From 58277fe32bbe2739f7c1d4f7550b556e23b52bb1 Mon Sep 17 00:00:00 2001 From: Hamza El-Saawy Date: Sun, 22 May 2022 19:23:39 -0400 Subject: [PATCH 1/2] Switch to go-winio/tools/mkwinsyscall Added `.\tools.go" file to add mkwinsyscall to `go.mod` and track as a dependency, as recommended by the [go wiki](https://github.com/golang/go/wiki/Modules#how-can-i-track-tool-dependencies-for-a-module). Using `-sort=false` flag to make changes easier to see. (Will be undone in next commit.) Signed-off-by: Hamza El-Saawy --- computestorage/storage.go | 2 +- computestorage/zsyscall_windows.go | 37 +- go.mod | 10 +- go.sum | 18 +- hcn/hcn.go | 2 +- hcn/zsyscall_windows.go | 115 +- hcsshim.go | 2 +- internal/hns/hns.go | 2 +- internal/hns/zsyscall_windows.go | 10 +- internal/interop/interop.go | 2 +- internal/interop/zsyscall_windows.go | 7 +- internal/regstate/regstate.go | 2 +- internal/regstate/zsyscall_windows.go | 7 +- internal/security/syscall_windows.go | 2 +- internal/security/zsyscall_windows.go | 4 +- internal/vmcompute/vmcompute.go | 2 +- internal/vmcompute/zsyscall_windows.go | 85 +- internal/wclayer/wclayer.go | 2 +- internal/wclayer/zsyscall_windows.go | 99 +- internal/winapi/winapi.go | 2 +- internal/winapi/zsyscall_windows.go | 68 +- test/go.mod | 10 +- test/go.sum | 17 +- tools.go | 5 + .../Microsoft/go-winio/.gitattributes | 1 + .../github.com/Microsoft/go-winio/.gitignore | 9 + .../Microsoft/go-winio/.golangci.yml | 144 ++ .../github.com/Microsoft/go-winio/README.md | 72 +- .../github.com/Microsoft/go-winio/SECURITY.md | 41 + .../github.com/Microsoft/go-winio/backup.go | 48 +- .../go-winio/backuptar/{noop.go => doc.go} | 1 - .../Microsoft/go-winio/backuptar/strconv.go | 2 + .../Microsoft/go-winio/backuptar/tar.go | 146 +- vendor/github.com/Microsoft/go-winio/doc.go | 22 + vendor/github.com/Microsoft/go-winio/ea.go | 8 +- vendor/github.com/Microsoft/go-winio/file.go | 66 +- .../github.com/Microsoft/go-winio/fileinfo.go | 29 +- .../github.com/Microsoft/go-winio/hvsock.go | 345 +++- .../go-winio/internal/socket/rawaddr.go | 20 + .../go-winio/internal/socket/socket.go | 179 ++ .../internal/socket/zsyscall_windows.go | 72 + vendor/github.com/Microsoft/go-winio/pipe.go | 124 +- .../Microsoft/go-winio/pkg/etw/doc.go | 8 + .../Microsoft/go-winio/pkg/etw/eventdata.go | 27 +- .../go-winio/pkg/etw/eventdatadescriptor.go | 12 +- .../go-winio/pkg/etw/eventdescriptor.go | 8 + .../go-winio/pkg/etw/eventmetadata.go | 22 +- .../Microsoft/go-winio/pkg/etw/eventopt.go | 1 + .../Microsoft/go-winio/pkg/etw/fieldopt.go | 10 +- .../Microsoft/go-winio/pkg/etw/newprovider.go | 15 +- .../pkg/etw/newprovider_unsupported.go | 4 +- .../Microsoft/go-winio/pkg/etw/provider.go | 76 +- .../go-winio/pkg/etw/providerglobal.go | 4 +- .../Microsoft/go-winio/pkg/etw/ptr64_32.go | 2 + .../Microsoft/go-winio/pkg/etw/ptr64_64.go | 2 + .../go-winio/pkg/etw/{etw.go => syscall.go} | 11 +- .../Microsoft/go-winio/pkg/etw/wrapper_32.go | 1 + .../Microsoft/go-winio/pkg/etw/wrapper_64.go | 21 +- .../go-winio/pkg/etw/zsyscall_windows.go | 4 +- .../Microsoft/go-winio/pkg/etwlogrus/hook.go | 85 +- .../Microsoft/go-winio/pkg/etwlogrus/opts.go | 53 + .../Microsoft/go-winio/pkg/guid/guid.go | 16 +- .../go-winio/pkg/guid/guid_nonwindows.go | 1 + .../go-winio/pkg/guid/guid_windows.go | 3 + .../go-winio/pkg/guid/variant_string.go | 27 + .../Microsoft/go-winio/pkg/process/process.go | 6 +- .../Microsoft/go-winio/pkg/process/syscall.go | 3 +- .../go-winio/pkg/process/zsyscall_windows.go | 4 +- .../Microsoft/go-winio/privilege.go | 32 +- .../github.com/Microsoft/go-winio/reparse.go | 11 +- vendor/github.com/Microsoft/go-winio/sd.go | 64 +- .../github.com/Microsoft/go-winio/syscall.go | 4 +- vendor/github.com/Microsoft/go-winio/tools.go | 5 + .../go-winio/tools/mkwinsyscall/doc.go | 57 + .../tools/mkwinsyscall/mkwinsyscall.go | 305 ++-- .../github.com/Microsoft/go-winio/vhd/vhd.go | 59 +- .../Microsoft/go-winio/vhd/zvhd_windows.go | 4 +- .../Microsoft/go-winio/zsyscall_windows.go | 45 +- vendor/golang.org/x/mod/LICENSE | 27 + vendor/golang.org/x/mod/PATENTS | 22 + vendor/golang.org/x/mod/semver/semver.go | 401 +++++ vendor/golang.org/x/net/AUTHORS | 3 - vendor/golang.org/x/net/CONTRIBUTORS | 3 - vendor/golang.org/x/sync/AUTHORS | 3 - vendor/golang.org/x/sync/CONTRIBUTORS | 3 - vendor/golang.org/x/sys/AUTHORS | 3 - vendor/golang.org/x/sys/CONTRIBUTORS | 3 - vendor/golang.org/x/sys/unix/mkerrors.sh | 4 + vendor/golang.org/x/sys/unix/zerrors_linux.go | 1 + vendor/golang.org/x/tools/LICENSE | 27 + vendor/golang.org/x/tools/PATENTS | 22 + .../x/tools/cmd/stringer/stringer.go | 658 +++++++ .../x/tools/go/gcexportdata/gcexportdata.go | 177 ++ .../x/tools/go/gcexportdata/importer.go | 75 + .../x/tools/go/internal/gcimporter/bexport.go | 853 +++++++++ .../x/tools/go/internal/gcimporter/bimport.go | 1053 ++++++++++++ .../go/internal/gcimporter/exportdata.go | 99 ++ .../go/internal/gcimporter/gcimporter.go | 1125 ++++++++++++ .../x/tools/go/internal/gcimporter/iexport.go | 1010 +++++++++++ .../x/tools/go/internal/gcimporter/iimport.go | 878 ++++++++++ .../go/internal/gcimporter/newInterface10.go | 22 + .../go/internal/gcimporter/newInterface11.go | 14 + .../go/internal/gcimporter/support_go117.go | 16 + .../go/internal/gcimporter/support_go118.go | 23 + .../go/internal/gcimporter/unified_no.go | 10 + .../go/internal/gcimporter/unified_yes.go | 10 + .../go/internal/gcimporter/ureader_no.go | 19 + .../go/internal/gcimporter/ureader_yes.go | 612 +++++++ .../tools/go/internal/packagesdriver/sizes.go | 49 + .../x/tools/go/internal/pkgbits/codes.go | 77 + .../x/tools/go/internal/pkgbits/decoder.go | 433 +++++ .../x/tools/go/internal/pkgbits/doc.go | 32 + .../x/tools/go/internal/pkgbits/encoder.go | 379 ++++ .../x/tools/go/internal/pkgbits/flags.go | 9 + .../x/tools/go/internal/pkgbits/frames_go1.go | 21 + .../tools/go/internal/pkgbits/frames_go17.go | 28 + .../x/tools/go/internal/pkgbits/reloc.go | 42 + .../x/tools/go/internal/pkgbits/support.go | 17 + .../x/tools/go/internal/pkgbits/sync.go | 113 ++ .../go/internal/pkgbits/syncmarker_string.go | 89 + vendor/golang.org/x/tools/go/packages/doc.go | 220 +++ .../x/tools/go/packages/external.go | 101 ++ .../golang.org/x/tools/go/packages/golist.go | 1173 +++++++++++++ .../x/tools/go/packages/golist_overlay.go | 575 +++++++ .../x/tools/go/packages/loadmode_string.go | 57 + .../x/tools/go/packages/packages.go | 1273 ++++++++++++++ .../golang.org/x/tools/go/packages/visit.go | 59 + .../x/tools/internal/event/core/event.go | 85 + .../x/tools/internal/event/core/export.go | 70 + .../x/tools/internal/event/core/fast.go | 77 + .../golang.org/x/tools/internal/event/doc.go | 7 + .../x/tools/internal/event/event.go | 127 ++ .../x/tools/internal/event/keys/keys.go | 564 ++++++ .../x/tools/internal/event/keys/standard.go | 22 + .../x/tools/internal/event/label/label.go | 215 +++ .../x/tools/internal/gocommand/invoke.go | 283 +++ .../x/tools/internal/gocommand/vendor.go | 109 ++ .../x/tools/internal/gocommand/version.go | 51 + .../internal/packagesinternal/packages.go | 30 + .../x/tools/internal/typeparams/common.go | 179 ++ .../x/tools/internal/typeparams/coretype.go | 122 ++ .../internal/typeparams/enabled_go117.go | 12 + .../internal/typeparams/enabled_go118.go | 15 + .../x/tools/internal/typeparams/normalize.go | 218 +++ .../x/tools/internal/typeparams/termlist.go | 163 ++ .../internal/typeparams/typeparams_go117.go | 197 +++ .../internal/typeparams/typeparams_go118.go | 151 ++ .../x/tools/internal/typeparams/typeterm.go | 170 ++ .../tools/internal/typesinternal/errorcode.go | 1526 +++++++++++++++++ .../typesinternal/errorcode_string.go | 167 ++ .../x/tools/internal/typesinternal/types.go | 52 + .../tools/internal/typesinternal/types_118.go | 19 + vendor/modules.txt | 31 +- zsyscall_windows.go | 7 +- 154 files changed, 18672 insertions(+), 773 deletions(-) create mode 100644 tools.go create mode 100644 vendor/github.com/Microsoft/go-winio/.gitattributes create mode 100644 vendor/github.com/Microsoft/go-winio/.golangci.yml create mode 100644 vendor/github.com/Microsoft/go-winio/SECURITY.md rename vendor/github.com/Microsoft/go-winio/backuptar/{noop.go => doc.go} (81%) create mode 100644 vendor/github.com/Microsoft/go-winio/doc.go create mode 100644 vendor/github.com/Microsoft/go-winio/internal/socket/rawaddr.go create mode 100644 vendor/github.com/Microsoft/go-winio/internal/socket/socket.go create mode 100644 vendor/github.com/Microsoft/go-winio/internal/socket/zsyscall_windows.go create mode 100644 vendor/github.com/Microsoft/go-winio/pkg/etw/doc.go rename vendor/github.com/Microsoft/go-winio/pkg/etw/{etw.go => syscall.go} (70%) create mode 100644 vendor/github.com/Microsoft/go-winio/pkg/etwlogrus/opts.go create mode 100644 vendor/github.com/Microsoft/go-winio/pkg/guid/variant_string.go create mode 100644 vendor/github.com/Microsoft/go-winio/tools.go create mode 100644 vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/doc.go rename mksyscall_windows.go => vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/mkwinsyscall.go (78%) create mode 100644 vendor/golang.org/x/mod/LICENSE create mode 100644 vendor/golang.org/x/mod/PATENTS create mode 100644 vendor/golang.org/x/mod/semver/semver.go delete mode 100644 vendor/golang.org/x/net/AUTHORS delete mode 100644 vendor/golang.org/x/net/CONTRIBUTORS delete mode 100644 vendor/golang.org/x/sync/AUTHORS delete mode 100644 vendor/golang.org/x/sync/CONTRIBUTORS delete mode 100644 vendor/golang.org/x/sys/AUTHORS delete mode 100644 vendor/golang.org/x/sys/CONTRIBUTORS create mode 100644 vendor/golang.org/x/tools/LICENSE create mode 100644 vendor/golang.org/x/tools/PATENTS create mode 100644 vendor/golang.org/x/tools/cmd/stringer/stringer.go create mode 100644 vendor/golang.org/x/tools/go/gcexportdata/gcexportdata.go create mode 100644 vendor/golang.org/x/tools/go/gcexportdata/importer.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/bexport.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/bimport.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/exportdata.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/gcimporter.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/iexport.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/iimport.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/newInterface10.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/newInterface11.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/support_go117.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/support_go118.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/unified_no.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/unified_yes.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/ureader_no.go create mode 100644 vendor/golang.org/x/tools/go/internal/gcimporter/ureader_yes.go create mode 100644 vendor/golang.org/x/tools/go/internal/packagesdriver/sizes.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/codes.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/decoder.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/doc.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/encoder.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/flags.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/frames_go1.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/frames_go17.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/reloc.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/support.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/sync.go create mode 100644 vendor/golang.org/x/tools/go/internal/pkgbits/syncmarker_string.go create mode 100644 vendor/golang.org/x/tools/go/packages/doc.go create mode 100644 vendor/golang.org/x/tools/go/packages/external.go create mode 100644 vendor/golang.org/x/tools/go/packages/golist.go create mode 100644 vendor/golang.org/x/tools/go/packages/golist_overlay.go create mode 100644 vendor/golang.org/x/tools/go/packages/loadmode_string.go create mode 100644 vendor/golang.org/x/tools/go/packages/packages.go create mode 100644 vendor/golang.org/x/tools/go/packages/visit.go create mode 100644 vendor/golang.org/x/tools/internal/event/core/event.go create mode 100644 vendor/golang.org/x/tools/internal/event/core/export.go create mode 100644 vendor/golang.org/x/tools/internal/event/core/fast.go create mode 100644 vendor/golang.org/x/tools/internal/event/doc.go create mode 100644 vendor/golang.org/x/tools/internal/event/event.go create mode 100644 vendor/golang.org/x/tools/internal/event/keys/keys.go create mode 100644 vendor/golang.org/x/tools/internal/event/keys/standard.go create mode 100644 vendor/golang.org/x/tools/internal/event/label/label.go create mode 100644 vendor/golang.org/x/tools/internal/gocommand/invoke.go create mode 100644 vendor/golang.org/x/tools/internal/gocommand/vendor.go create mode 100644 vendor/golang.org/x/tools/internal/gocommand/version.go create mode 100644 vendor/golang.org/x/tools/internal/packagesinternal/packages.go create mode 100644 vendor/golang.org/x/tools/internal/typeparams/common.go create mode 100644 vendor/golang.org/x/tools/internal/typeparams/coretype.go create mode 100644 vendor/golang.org/x/tools/internal/typeparams/enabled_go117.go create mode 100644 vendor/golang.org/x/tools/internal/typeparams/enabled_go118.go create mode 100644 vendor/golang.org/x/tools/internal/typeparams/normalize.go create mode 100644 vendor/golang.org/x/tools/internal/typeparams/termlist.go create mode 100644 vendor/golang.org/x/tools/internal/typeparams/typeparams_go117.go create mode 100644 vendor/golang.org/x/tools/internal/typeparams/typeparams_go118.go create mode 100644 vendor/golang.org/x/tools/internal/typeparams/typeterm.go create mode 100644 vendor/golang.org/x/tools/internal/typesinternal/errorcode.go create mode 100644 vendor/golang.org/x/tools/internal/typesinternal/errorcode_string.go create mode 100644 vendor/golang.org/x/tools/internal/typesinternal/types.go create mode 100644 vendor/golang.org/x/tools/internal/typesinternal/types_118.go diff --git a/computestorage/storage.go b/computestorage/storage.go index d8b3d6a319..f2c391c483 100644 --- a/computestorage/storage.go +++ b/computestorage/storage.go @@ -7,7 +7,7 @@ import ( hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" ) -//go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go storage.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go storage.go //sys hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) = computestorage.HcsImportLayer? //sys hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) = computestorage.HcsExportLayer? diff --git a/computestorage/zsyscall_windows.go b/computestorage/zsyscall_windows.go index 4f95180674..39fec99ca6 100644 --- a/computestorage/zsyscall_windows.go +++ b/computestorage/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package computestorage @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -71,7 +74,8 @@ func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) } func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { - if hr = procHcsImportLayer.Find(); hr != nil { + hr = procHcsImportLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) @@ -109,7 +113,8 @@ func hcsExportLayer(layerPath string, exportFolderPath string, layerData string, } func _hcsExportLayer(layerPath *uint16, exportFolderPath *uint16, layerData *uint16, options *uint16) (hr error) { - if hr = procHcsExportLayer.Find(); hr != nil { + hr = procHcsExportLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsExportLayer.Addr(), 4, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(exportFolderPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options)), 0, 0) @@ -132,7 +137,8 @@ func hcsDestroyLayer(layerPath string) (hr error) { } func _hcsDestroyLayer(layerPath *uint16) (hr error) { - if hr = procHcsDestoryLayer.Find(); hr != nil { + hr = procHcsDestoryLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) @@ -160,7 +166,8 @@ func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string } func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { - if hr = procHcsSetupBaseOSLayer.Find(); hr != nil { + hr = procHcsSetupBaseOSLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) @@ -193,7 +200,8 @@ func hcsInitializeWritableLayer(writableLayerPath string, layerData string, opti } func _hcsInitializeWritableLayer(writableLayerPath *uint16, layerData *uint16, options *uint16) (hr error) { - if hr = procHcsInitializeWritableLayer.Find(); hr != nil { + hr = procHcsInitializeWritableLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsInitializeWritableLayer.Addr(), 3, uintptr(unsafe.Pointer(writableLayerPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options))) @@ -221,7 +229,8 @@ func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) } func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { - if hr = procHcsAttachLayerStorageFilter.Find(); hr != nil { + hr = procHcsAttachLayerStorageFilter.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) @@ -244,7 +253,8 @@ func hcsDetachLayerStorageFilter(layerPath string) (hr error) { } func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { - if hr = procHcsDetachLayerStorageFilter.Find(); hr != nil { + hr = procHcsDetachLayerStorageFilter.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) @@ -258,7 +268,8 @@ func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { } func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { - if hr = procHcsFormatWritableLayerVhd.Find(); hr != nil { + hr = procHcsFormatWritableLayerVhd.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) @@ -272,7 +283,8 @@ func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { } func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { - if hr = procHcsGetLayerVhdMountPath.Find(); hr != nil { + hr = procHcsGetLayerVhdMountPath.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) @@ -305,7 +317,8 @@ func hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) ( } func _hcsSetupBaseOSVolume(layerPath *uint16, volumePath *uint16, options *uint16) (hr error) { - if hr = procHcsSetupBaseOSVolume.Find(); hr != nil { + hr = procHcsSetupBaseOSVolume.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSetupBaseOSVolume.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(volumePath)), uintptr(unsafe.Pointer(options))) diff --git a/go.mod b/go.mod index 5aa0cd5594..296ade1066 100644 --- a/go.mod +++ b/go.mod @@ -4,7 +4,7 @@ go 1.18 require ( github.com/BurntSushi/toml v0.4.1 - github.com/Microsoft/go-winio v0.5.2 + github.com/Microsoft/go-winio v0.6.0 github.com/cenkalti/backoff/v4 v4.1.3 github.com/containerd/cgroups v1.0.3 github.com/containerd/console v1.0.3 @@ -28,8 +28,8 @@ require ( github.com/vishvananda/netns v0.0.0-20210104183010-2eb08e3e575f go.etcd.io/bbolt v1.3.6 go.opencensus.io v0.23.0 - golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f - golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8 + golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4 + golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f google.golang.org/grpc v1.47.0 ) @@ -64,8 +64,10 @@ require ( github.com/xeipuuv/gojsonpointer v0.0.0-20190905194746-02993c407bfb // indirect github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect github.com/yashtewari/glob-intersection v0.1.0 // indirect - golang.org/x/net v0.0.0-20220708220712-1185a9018129 // indirect + golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4 // indirect + golang.org/x/net v0.0.0-20220722155237-a158d28d115b // indirect golang.org/x/text v0.3.7 // indirect + golang.org/x/tools v0.1.12 // indirect google.golang.org/genproto v0.0.0-20220107163113-42d7afdf6368 // indirect google.golang.org/protobuf v1.28.0 // indirect gopkg.in/yaml.v2 v2.4.0 // indirect diff --git a/go.sum b/go.sum index 178a87dcfc..41a26a8f14 100644 --- a/go.sum +++ b/go.sum @@ -94,8 +94,8 @@ github.com/Microsoft/go-winio v0.4.17-0.20210211115548-6eac466e5fa3/go.mod h1:JP github.com/Microsoft/go-winio v0.4.17-0.20210324224401-5516f17a5958/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= github.com/Microsoft/go-winio v0.4.17/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= github.com/Microsoft/go-winio v0.5.1/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= -github.com/Microsoft/go-winio v0.5.2 h1:a9IhgEQBCUEk6QCdml9CiJGhAws+YwffDHEMp1VMrpA= -github.com/Microsoft/go-winio v0.5.2/go.mod h1:WpS1mjBmmwHBEWmogvA2mj8546UReBk4v8QkMxJ6pZY= +github.com/Microsoft/go-winio v0.6.0 h1:slsWYD/zyx7lCXoZVlvQrj0hPTM1HI4+v1sIda2yDvg= +github.com/Microsoft/go-winio v0.6.0/go.mod h1:cTAf44im0RAYeL23bpB+fzCyDH2MJiz2BO69KH/soAE= github.com/Microsoft/hcsshim v0.8.6/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= github.com/Microsoft/hcsshim v0.8.7-0.20190325164909-8abdbb8205e4/go.mod h1:Op3hHsoHPAvb6lceZHDtd9OkTew38wNoXnJs8iY7rUg= github.com/Microsoft/hcsshim v0.8.7/go.mod h1:OHd7sQqRFrYd3RmSgbgji+ctCwkbq2wbEYNSzOYtcBQ= @@ -1359,6 +1359,8 @@ golang.org/x/mod v0.4.1/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.4.2/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.5.0/go.mod h1:5OXOZSfqPIIbmVBIIKWRFfZjPR0E5r58TLhUjH0a2Ro= golang.org/x/mod v0.5.1/go.mod h1:5OXOZSfqPIIbmVBIIKWRFfZjPR0E5r58TLhUjH0a2Ro= +golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4 h1:6zppjxzCulZykYSLyVDYbneBfbaBIQPYMevg0bEwv2s= +golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4/go.mod h1:jJ57K6gSWd91VN4djpZkiMVwK6gcyfeH4XE8wZrZaV4= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180906233101-161cd47e91fd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20181011144130-49bb7cea24b1/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= @@ -1423,8 +1425,8 @@ golang.org/x/net v0.0.0-20211112202133-69e39bad7dc2/go.mod h1:9nx3DQGgdP8bBQD5qx golang.org/x/net v0.0.0-20211209124913-491a49abca63/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= golang.org/x/net v0.0.0-20211216030914-fe4d6282115f/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y= golang.org/x/net v0.0.0-20220127200216-cd36cc0744dd/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= -golang.org/x/net v0.0.0-20220708220712-1185a9018129 h1:vucSRfWwTsoXro7P+3Cjlr6flUMtzCwzlvkxEQtHHB0= -golang.org/x/net v0.0.0-20220708220712-1185a9018129/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= +golang.org/x/net v0.0.0-20220722155237-a158d28d115b h1:PxfKdU9lEEDYjdIzOtC4qFWgkU2rGHdKlKowJSMN9h0= +golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= @@ -1454,8 +1456,9 @@ golang.org/x/sync v0.0.0-20200625203802-6e8e738ad208/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f h1:Ax0t5p6N38Ga0dThY21weqDEyz2oklo4IvDkpigvkD8= golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4 h1:uVc8UZUe6tr40fFVnUP5Oj+veunVezqYl9z7DYw9xzw= +golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20180823144017-11551d06cbcc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180909124046-d0be0721c37e/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= @@ -1572,8 +1575,9 @@ golang.org/x/sys v0.0.0-20211116061358-0a5406a5449c/go.mod h1:oPkhp1MJrh7nUepCBc golang.org/x/sys v0.0.0-20211216021012-1d35b9e2eb4e/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220114195835-da31bd327af9/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220412211240-33da011f77ad/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8 h1:0A+M6Uqn+Eje4kHMK80dtF3JCXC4ykBgQG4Fe06QRhQ= golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f h1:v4INt8xihDGvnrfjMDVXGxw9wrfxYyCjk0KbXjhR55s= +golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/term v0.0.0-20201117132131-f5c789dd3221/go.mod h1:Nr5EML6q2oocZ2LXRh80K7BxOlk5/8JxuGnuhpl+muw= golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= golang.org/x/term v0.0.0-20210220032956-6a3ed077a48d/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= @@ -1704,6 +1708,8 @@ golang.org/x/tools v0.1.5/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk= golang.org/x/tools v0.1.6/go.mod h1:LGqMHiF4EqQNHR1JncWGqT5BVaXmza+X+BDGol+dOxo= golang.org/x/tools v0.1.7/go.mod h1:LGqMHiF4EqQNHR1JncWGqT5BVaXmza+X+BDGol+dOxo= golang.org/x/tools v0.1.9/go.mod h1:nABZi5QlRsZVlzPpHl034qft6wpY4eDcsTt5AaioBiU= +golang.org/x/tools v0.1.12 h1:VveCTK38A2rkS8ZqFY25HIDFscX5X9OoEhJd3quQmXU= +golang.org/x/tools v0.1.12/go.mod h1:hNGJHUnrk76NpqgfD5Aqm5Crs+Hm0VOH/i9J2+nxYbc= golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= diff --git a/hcn/hcn.go b/hcn/hcn.go index a1974e1f4b..b0983dd539 100644 --- a/hcn/hcn.go +++ b/hcn/hcn.go @@ -10,7 +10,7 @@ import ( "github.com/Microsoft/go-winio/pkg/guid" ) -//go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go hcn.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go hcn.go /// HNS V1 API diff --git a/hcn/zsyscall_windows.go b/hcn/zsyscall_windows.go index 7ec5b58b66..b44b3099e5 100644 --- a/hcn/zsyscall_windows.go +++ b/hcn/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package hcn @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -111,7 +114,8 @@ func _hnsCall(method string, path string, object string, response **uint16) (hr } func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { - if hr = procHNSCall.Find(); hr != nil { + hr = procHNSCall.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) @@ -134,7 +138,8 @@ func hcnEnumerateNetworks(query string, networks **uint16, result **uint16) (hr } func _hcnEnumerateNetworks(query *uint16, networks **uint16, result **uint16) (hr error) { - if hr = procHcnEnumerateNetworks.Find(); hr != nil { + hr = procHcnEnumerateNetworks.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnEnumerateNetworks.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(networks)), uintptr(unsafe.Pointer(result))) @@ -157,7 +162,8 @@ func hcnCreateNetwork(id *_guid, settings string, network *hcnNetwork, result ** } func _hcnCreateNetwork(id *_guid, settings *uint16, network *hcnNetwork, result **uint16) (hr error) { - if hr = procHcnCreateNetwork.Find(); hr != nil { + hr = procHcnCreateNetwork.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnCreateNetwork.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -171,7 +177,8 @@ func _hcnCreateNetwork(id *_guid, settings *uint16, network *hcnNetwork, result } func hcnOpenNetwork(id *_guid, network *hcnNetwork, result **uint16) (hr error) { - if hr = procHcnOpenNetwork.Find(); hr != nil { + hr = procHcnOpenNetwork.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnOpenNetwork.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result))) @@ -194,7 +201,8 @@ func hcnModifyNetwork(network hcnNetwork, settings string, result **uint16) (hr } func _hcnModifyNetwork(network hcnNetwork, settings *uint16, result **uint16) (hr error) { - if hr = procHcnModifyNetwork.Find(); hr != nil { + hr = procHcnModifyNetwork.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnModifyNetwork.Addr(), 3, uintptr(network), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) @@ -217,7 +225,8 @@ func hcnQueryNetworkProperties(network hcnNetwork, query string, properties **ui } func _hcnQueryNetworkProperties(network hcnNetwork, query *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcnQueryNetworkProperties.Find(); hr != nil { + hr = procHcnQueryNetworkProperties.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnQueryNetworkProperties.Addr(), 4, uintptr(network), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -231,7 +240,8 @@ func _hcnQueryNetworkProperties(network hcnNetwork, query *uint16, properties ** } func hcnDeleteNetwork(id *_guid, result **uint16) (hr error) { - if hr = procHcnDeleteNetwork.Find(); hr != nil { + hr = procHcnDeleteNetwork.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnDeleteNetwork.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) @@ -245,7 +255,8 @@ func hcnDeleteNetwork(id *_guid, result **uint16) (hr error) { } func hcnCloseNetwork(network hcnNetwork) (hr error) { - if hr = procHcnCloseNetwork.Find(); hr != nil { + hr = procHcnCloseNetwork.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnCloseNetwork.Addr(), 1, uintptr(network), 0, 0) @@ -268,7 +279,8 @@ func hcnEnumerateEndpoints(query string, endpoints **uint16, result **uint16) (h } func _hcnEnumerateEndpoints(query *uint16, endpoints **uint16, result **uint16) (hr error) { - if hr = procHcnEnumerateEndpoints.Find(); hr != nil { + hr = procHcnEnumerateEndpoints.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnEnumerateEndpoints.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(endpoints)), uintptr(unsafe.Pointer(result))) @@ -291,7 +303,8 @@ func hcnCreateEndpoint(network hcnNetwork, id *_guid, settings string, endpoint } func _hcnCreateEndpoint(network hcnNetwork, id *_guid, settings *uint16, endpoint *hcnEndpoint, result **uint16) (hr error) { - if hr = procHcnCreateEndpoint.Find(); hr != nil { + hr = procHcnCreateEndpoint.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnCreateEndpoint.Addr(), 5, uintptr(network), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result)), 0) @@ -305,7 +318,8 @@ func _hcnCreateEndpoint(network hcnNetwork, id *_guid, settings *uint16, endpoin } func hcnOpenEndpoint(id *_guid, endpoint *hcnEndpoint, result **uint16) (hr error) { - if hr = procHcnOpenEndpoint.Find(); hr != nil { + hr = procHcnOpenEndpoint.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnOpenEndpoint.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result))) @@ -328,7 +342,8 @@ func hcnModifyEndpoint(endpoint hcnEndpoint, settings string, result **uint16) ( } func _hcnModifyEndpoint(endpoint hcnEndpoint, settings *uint16, result **uint16) (hr error) { - if hr = procHcnModifyEndpoint.Find(); hr != nil { + hr = procHcnModifyEndpoint.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnModifyEndpoint.Addr(), 3, uintptr(endpoint), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) @@ -351,7 +366,8 @@ func hcnQueryEndpointProperties(endpoint hcnEndpoint, query string, properties * } func _hcnQueryEndpointProperties(endpoint hcnEndpoint, query *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcnQueryEndpointProperties.Find(); hr != nil { + hr = procHcnQueryEndpointProperties.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnQueryEndpointProperties.Addr(), 4, uintptr(endpoint), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -365,7 +381,8 @@ func _hcnQueryEndpointProperties(endpoint hcnEndpoint, query *uint16, properties } func hcnDeleteEndpoint(id *_guid, result **uint16) (hr error) { - if hr = procHcnDeleteEndpoint.Find(); hr != nil { + hr = procHcnDeleteEndpoint.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnDeleteEndpoint.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) @@ -379,7 +396,8 @@ func hcnDeleteEndpoint(id *_guid, result **uint16) (hr error) { } func hcnCloseEndpoint(endpoint hcnEndpoint) (hr error) { - if hr = procHcnCloseEndpoint.Find(); hr != nil { + hr = procHcnCloseEndpoint.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnCloseEndpoint.Addr(), 1, uintptr(endpoint), 0, 0) @@ -402,7 +420,8 @@ func hcnEnumerateNamespaces(query string, namespaces **uint16, result **uint16) } func _hcnEnumerateNamespaces(query *uint16, namespaces **uint16, result **uint16) (hr error) { - if hr = procHcnEnumerateNamespaces.Find(); hr != nil { + hr = procHcnEnumerateNamespaces.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnEnumerateNamespaces.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(namespaces)), uintptr(unsafe.Pointer(result))) @@ -425,7 +444,8 @@ func hcnCreateNamespace(id *_guid, settings string, namespace *hcnNamespace, res } func _hcnCreateNamespace(id *_guid, settings *uint16, namespace *hcnNamespace, result **uint16) (hr error) { - if hr = procHcnCreateNamespace.Find(); hr != nil { + hr = procHcnCreateNamespace.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnCreateNamespace.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -439,7 +459,8 @@ func _hcnCreateNamespace(id *_guid, settings *uint16, namespace *hcnNamespace, r } func hcnOpenNamespace(id *_guid, namespace *hcnNamespace, result **uint16) (hr error) { - if hr = procHcnOpenNamespace.Find(); hr != nil { + hr = procHcnOpenNamespace.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnOpenNamespace.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result))) @@ -462,7 +483,8 @@ func hcnModifyNamespace(namespace hcnNamespace, settings string, result **uint16 } func _hcnModifyNamespace(namespace hcnNamespace, settings *uint16, result **uint16) (hr error) { - if hr = procHcnModifyNamespace.Find(); hr != nil { + hr = procHcnModifyNamespace.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnModifyNamespace.Addr(), 3, uintptr(namespace), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) @@ -485,7 +507,8 @@ func hcnQueryNamespaceProperties(namespace hcnNamespace, query string, propertie } func _hcnQueryNamespaceProperties(namespace hcnNamespace, query *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcnQueryNamespaceProperties.Find(); hr != nil { + hr = procHcnQueryNamespaceProperties.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnQueryNamespaceProperties.Addr(), 4, uintptr(namespace), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -499,7 +522,8 @@ func _hcnQueryNamespaceProperties(namespace hcnNamespace, query *uint16, propert } func hcnDeleteNamespace(id *_guid, result **uint16) (hr error) { - if hr = procHcnDeleteNamespace.Find(); hr != nil { + hr = procHcnDeleteNamespace.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnDeleteNamespace.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) @@ -513,7 +537,8 @@ func hcnDeleteNamespace(id *_guid, result **uint16) (hr error) { } func hcnCloseNamespace(namespace hcnNamespace) (hr error) { - if hr = procHcnCloseNamespace.Find(); hr != nil { + hr = procHcnCloseNamespace.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnCloseNamespace.Addr(), 1, uintptr(namespace), 0, 0) @@ -536,7 +561,8 @@ func hcnEnumerateLoadBalancers(query string, loadBalancers **uint16, result **ui } func _hcnEnumerateLoadBalancers(query *uint16, loadBalancers **uint16, result **uint16) (hr error) { - if hr = procHcnEnumerateLoadBalancers.Find(); hr != nil { + hr = procHcnEnumerateLoadBalancers.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnEnumerateLoadBalancers.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(loadBalancers)), uintptr(unsafe.Pointer(result))) @@ -559,7 +585,8 @@ func hcnCreateLoadBalancer(id *_guid, settings string, loadBalancer *hcnLoadBala } func _hcnCreateLoadBalancer(id *_guid, settings *uint16, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { - if hr = procHcnCreateLoadBalancer.Find(); hr != nil { + hr = procHcnCreateLoadBalancer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnCreateLoadBalancer.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -573,7 +600,8 @@ func _hcnCreateLoadBalancer(id *_guid, settings *uint16, loadBalancer *hcnLoadBa } func hcnOpenLoadBalancer(id *_guid, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { - if hr = procHcnOpenLoadBalancer.Find(); hr != nil { + hr = procHcnOpenLoadBalancer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnOpenLoadBalancer.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result))) @@ -596,7 +624,8 @@ func hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings string, result } func _hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings *uint16, result **uint16) (hr error) { - if hr = procHcnModifyLoadBalancer.Find(); hr != nil { + hr = procHcnModifyLoadBalancer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnModifyLoadBalancer.Addr(), 3, uintptr(loadBalancer), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) @@ -619,7 +648,8 @@ func hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query string, } func _hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcnQueryLoadBalancerProperties.Find(); hr != nil { + hr = procHcnQueryLoadBalancerProperties.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnQueryLoadBalancerProperties.Addr(), 4, uintptr(loadBalancer), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -633,7 +663,8 @@ func _hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query *uint16 } func hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) { - if hr = procHcnDeleteLoadBalancer.Find(); hr != nil { + hr = procHcnDeleteLoadBalancer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnDeleteLoadBalancer.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) @@ -647,7 +678,8 @@ func hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) { } func hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) { - if hr = procHcnCloseLoadBalancer.Find(); hr != nil { + hr = procHcnCloseLoadBalancer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnCloseLoadBalancer.Addr(), 1, uintptr(loadBalancer), 0, 0) @@ -670,7 +702,8 @@ func hcnEnumerateRoutes(query string, routes **uint16, result **uint16) (hr erro } func _hcnEnumerateRoutes(query *uint16, routes **uint16, result **uint16) (hr error) { - if hr = procHcnEnumerateSdnRoutes.Find(); hr != nil { + hr = procHcnEnumerateSdnRoutes.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnEnumerateSdnRoutes.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(routes)), uintptr(unsafe.Pointer(result))) @@ -693,7 +726,8 @@ func hcnCreateRoute(id *_guid, settings string, route *hcnRoute, result **uint16 } func _hcnCreateRoute(id *_guid, settings *uint16, route *hcnRoute, result **uint16) (hr error) { - if hr = procHcnCreateSdnRoute.Find(); hr != nil { + hr = procHcnCreateSdnRoute.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnCreateSdnRoute.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(route)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -707,7 +741,8 @@ func _hcnCreateRoute(id *_guid, settings *uint16, route *hcnRoute, result **uint } func hcnOpenRoute(id *_guid, route *hcnRoute, result **uint16) (hr error) { - if hr = procHcnOpenSdnRoute.Find(); hr != nil { + hr = procHcnOpenSdnRoute.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnOpenSdnRoute.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(route)), uintptr(unsafe.Pointer(result))) @@ -730,7 +765,8 @@ func hcnModifyRoute(route hcnRoute, settings string, result **uint16) (hr error) } func _hcnModifyRoute(route hcnRoute, settings *uint16, result **uint16) (hr error) { - if hr = procHcnModifySdnRoute.Find(); hr != nil { + hr = procHcnModifySdnRoute.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnModifySdnRoute.Addr(), 3, uintptr(route), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) @@ -753,7 +789,8 @@ func hcnQueryRouteProperties(route hcnRoute, query string, properties **uint16, } func _hcnQueryRouteProperties(route hcnRoute, query *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcnQuerySdnRouteProperties.Find(); hr != nil { + hr = procHcnQuerySdnRouteProperties.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcnQuerySdnRouteProperties.Addr(), 4, uintptr(route), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -767,7 +804,8 @@ func _hcnQueryRouteProperties(route hcnRoute, query *uint16, properties **uint16 } func hcnDeleteRoute(id *_guid, result **uint16) (hr error) { - if hr = procHcnDeleteSdnRoute.Find(); hr != nil { + hr = procHcnDeleteSdnRoute.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnDeleteSdnRoute.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) @@ -781,7 +819,8 @@ func hcnDeleteRoute(id *_guid, result **uint16) (hr error) { } func hcnCloseRoute(route hcnRoute) (hr error) { - if hr = procHcnCloseSdnRoute.Find(); hr != nil { + hr = procHcnCloseSdnRoute.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcnCloseSdnRoute.Addr(), 1, uintptr(route), 0, 0) diff --git a/hcsshim.go b/hcsshim.go index 7e20399138..f52bb3ab9d 100644 --- a/hcsshim.go +++ b/hcsshim.go @@ -11,7 +11,7 @@ import ( "github.com/Microsoft/hcsshim/internal/hcserror" ) -//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go hcsshim.go //sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId diff --git a/internal/hns/hns.go b/internal/hns/hns.go index b2e475f53c..fe557e3b97 100644 --- a/internal/hns/hns.go +++ b/internal/hns/hns.go @@ -2,7 +2,7 @@ package hns import "fmt" -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go hns.go //sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? diff --git a/internal/hns/zsyscall_windows.go b/internal/hns/zsyscall_windows.go index 204633a488..a35ee945db 100644 --- a/internal/hns/zsyscall_windows.go +++ b/internal/hns/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package hns @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -62,7 +65,8 @@ func _hnsCall(method string, path string, object string, response **uint16) (hr } func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { - if hr = procHNSCall.Find(); hr != nil { + hr = procHNSCall.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) diff --git a/internal/interop/interop.go b/internal/interop/interop.go index 137dc3990a..fda8b01d4b 100644 --- a/internal/interop/interop.go +++ b/internal/interop/interop.go @@ -7,7 +7,7 @@ import ( "unsafe" ) -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go interop.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go interop.go //sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree diff --git a/internal/interop/zsyscall_windows.go b/internal/interop/zsyscall_windows.go index 12b0c71c5a..a17a112508 100644 --- a/internal/interop/zsyscall_windows.go +++ b/internal/interop/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package interop @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } diff --git a/internal/regstate/regstate.go b/internal/regstate/regstate.go index 184975add8..a56be7b265 100644 --- a/internal/regstate/regstate.go +++ b/internal/regstate/regstate.go @@ -15,7 +15,7 @@ import ( "golang.org/x/sys/windows/registry" ) -//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go regstate.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go regstate.go //sys regCreateKeyEx(key syscall.Handle, subkey *uint16, reserved uint32, class *uint16, options uint32, desired uint32, sa *syscall.SecurityAttributes, result *syscall.Handle, disposition *uint32) (regerrno error) = advapi32.RegCreateKeyExW diff --git a/internal/regstate/zsyscall_windows.go b/internal/regstate/zsyscall_windows.go index 4e349ad498..4ff1b333a5 100644 --- a/internal/regstate/zsyscall_windows.go +++ b/internal/regstate/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated by 'go generate'; DO NOT EDIT. +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package regstate @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } diff --git a/internal/security/syscall_windows.go b/internal/security/syscall_windows.go index f0cdd7d20c..71326e4e46 100644 --- a/internal/security/syscall_windows.go +++ b/internal/security/syscall_windows.go @@ -1,6 +1,6 @@ package security -//go:generate go run $GOPATH/src/golang.org/x/sys/windows/mkwinsyscall/mkwinsyscall.go -output zsyscall_windows.go syscall_windows.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go syscall_windows.go //sys getSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, ppsidOwner **uintptr, ppsidGroup **uintptr, ppDacl *uintptr, ppSacl *uintptr, ppSecurityDescriptor *uintptr) (win32err error) = advapi32.GetSecurityInfo //sys setSecurityInfo(handle syscall.Handle, objectType uint32, si uint32, psidOwner uintptr, psidGroup uintptr, pDacl uintptr, pSacl uintptr) (win32err error) = advapi32.SetSecurityInfo diff --git a/internal/security/zsyscall_windows.go b/internal/security/zsyscall_windows.go index 4084680e0f..26c986b88f 100644 --- a/internal/security/zsyscall_windows.go +++ b/internal/security/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated by 'go generate'; DO NOT EDIT. +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package security diff --git a/internal/vmcompute/vmcompute.go b/internal/vmcompute/vmcompute.go index 3622f3bbee..08e6ec227a 100644 --- a/internal/vmcompute/vmcompute.go +++ b/internal/vmcompute/vmcompute.go @@ -16,7 +16,7 @@ import ( "github.com/Microsoft/hcsshim/internal/timeout" ) -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go vmcompute.go //sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? //sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? diff --git a/internal/vmcompute/zsyscall_windows.go b/internal/vmcompute/zsyscall_windows.go index cae55058de..ecd47f2e49 100644 --- a/internal/vmcompute/zsyscall_windows.go +++ b/internal/vmcompute/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package vmcompute @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -77,7 +80,8 @@ func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result ** } func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { - if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { + hr = procHcsEnumerateComputeSystems.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) @@ -105,7 +109,8 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha } func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { - if hr = procHcsCreateComputeSystem.Find(); hr != nil { + hr = procHcsCreateComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) @@ -128,7 +133,8 @@ func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) } func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { - if hr = procHcsOpenComputeSystem.Find(); hr != nil { + hr = procHcsOpenComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) @@ -142,7 +148,8 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16 } func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { - if hr = procHcsCloseComputeSystem.Find(); hr != nil { + hr = procHcsCloseComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) @@ -165,7 +172,8 @@ func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uin } func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsStartComputeSystem.Find(); hr != nil { + hr = procHcsStartComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) @@ -188,7 +196,8 @@ func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result ** } func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + hr = procHcsShutdownComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) @@ -211,7 +220,8 @@ func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result * } func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + hr = procHcsTerminateComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) @@ -234,7 +244,8 @@ func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uin } func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsPauseComputeSystem.Find(); hr != nil { + hr = procHcsPauseComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) @@ -257,7 +268,8 @@ func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **ui } func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsResumeComputeSystem.Find(); hr != nil { + hr = procHcsResumeComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) @@ -280,7 +292,8 @@ func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string } func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { + hr = procHcsGetComputeSystemProperties.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -303,7 +316,8 @@ func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, resul } func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { - if hr = procHcsModifyComputeSystem.Find(); hr != nil { + hr = procHcsModifyComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) @@ -326,7 +340,8 @@ func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { } func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyServiceSettings.Find(); hr != nil { + hr = procHcsModifyServiceSettings.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) @@ -340,7 +355,8 @@ func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { } func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { - if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { + hr = procHcsRegisterComputeSystemCallback.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) @@ -354,7 +370,8 @@ func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, } func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { - if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { + hr = procHcsUnregisterComputeSystemCallback.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) @@ -377,7 +394,8 @@ func hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint } func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsSaveComputeSystem.Find(); hr != nil { + hr = procHcsSaveComputeSystem.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSaveComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) @@ -400,7 +418,8 @@ func hcsCreateProcess(computeSystem HcsSystem, processParameters string, process } func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { - if hr = procHcsCreateProcess.Find(); hr != nil { + hr = procHcsCreateProcess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) @@ -414,7 +433,8 @@ func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, proce } func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { - if hr = procHcsOpenProcess.Find(); hr != nil { + hr = procHcsOpenProcess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) @@ -428,7 +448,8 @@ func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, re } func hcsCloseProcess(process HcsProcess) (hr error) { - if hr = procHcsCloseProcess.Find(); hr != nil { + hr = procHcsCloseProcess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) @@ -442,7 +463,8 @@ func hcsCloseProcess(process HcsProcess) (hr error) { } func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { + hr = procHcsTerminateProcess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) @@ -465,7 +487,8 @@ func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr e } func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsSignalProcess.Find(); hr != nil { + hr = procHcsSignalProcess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) @@ -479,7 +502,8 @@ func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr } func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { - if hr = procHcsGetProcessInfo.Find(); hr != nil { + hr = procHcsGetProcessInfo.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) @@ -493,7 +517,8 @@ func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInforma } func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { - if hr = procHcsGetProcessProperties.Find(); hr != nil { + hr = procHcsGetProcessProperties.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) @@ -516,7 +541,8 @@ func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr } func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyProcess.Find(); hr != nil { + hr = procHcsModifyProcess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) @@ -539,7 +565,8 @@ func hcsGetServiceProperties(propertyQuery string, properties **uint16, result * } func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetServiceProperties.Find(); hr != nil { + hr = procHcsGetServiceProperties.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) @@ -553,7 +580,8 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result } func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { - if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + hr = procHcsRegisterProcessCallback.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) @@ -567,7 +595,8 @@ func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context ui } func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { - if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + hr = procHcsUnregisterProcessCallback.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) diff --git a/internal/wclayer/wclayer.go b/internal/wclayer/wclayer.go index 8aeab8d24e..f7f7b89e44 100644 --- a/internal/wclayer/wclayer.go +++ b/internal/wclayer/wclayer.go @@ -4,7 +4,7 @@ package wclayer import "github.com/Microsoft/go-winio/pkg/guid" -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go wclayer.go //sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? //sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? diff --git a/internal/wclayer/zsyscall_windows.go b/internal/wclayer/zsyscall_windows.go index 67f917f07e..9acbffecfa 100644 --- a/internal/wclayer/zsyscall_windows.go +++ b/internal/wclayer/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package wclayer @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -74,7 +77,8 @@ func activateLayer(info *driverInfo, id string) (hr error) { } func _activateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procActivateLayer.Find(); hr != nil { + hr = procActivateLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) @@ -102,13 +106,14 @@ func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LA } func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procCopyLayer.Find() + if hr != nil { + return + } var _p2 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p2 = &descriptors[0] } - if hr = procCopyLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -134,7 +139,8 @@ func createLayer(info *driverInfo, id string, parent string) (hr error) { } func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { - if hr = procCreateLayer.Find(); hr != nil { + hr = procCreateLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) @@ -157,13 +163,14 @@ func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors } func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procCreateSandboxLayer.Find() + if hr != nil { + return + } var _p1 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p1 = &descriptors[0] } - if hr = procCreateSandboxLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -184,7 +191,8 @@ func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { } func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { - if hr = procExpandSandboxSize.Find(); hr != nil { + hr = procExpandSandboxSize.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) @@ -207,7 +215,8 @@ func deactivateLayer(info *driverInfo, id string) (hr error) { } func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDeactivateLayer.Find(); hr != nil { + hr = procDeactivateLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) @@ -230,7 +239,8 @@ func destroyLayer(info *driverInfo, id string) (hr error) { } func _destroyLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDestroyLayer.Find(); hr != nil { + hr = procDestroyLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) @@ -258,13 +268,14 @@ func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYE } func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procExportLayer.Find() + if hr != nil { + return + } var _p2 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p2 = &descriptors[0] } - if hr = procExportLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -285,7 +296,8 @@ func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uin } func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { - if hr = procGetLayerMountPath.Find(); hr != nil { + hr = procGetLayerMountPath.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) @@ -299,7 +311,8 @@ func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *u } func getBaseImages(buffer **uint16) (hr error) { - if hr = procGetBaseImages.Find(); hr != nil { + hr = procGetBaseImages.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) @@ -327,13 +340,14 @@ func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYE } func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procImportLayer.Find() + if hr != nil { + return + } var _p2 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p2 = &descriptors[0] } - if hr = procImportLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -354,7 +368,8 @@ func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { } func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { - if hr = procLayerExists.Find(); hr != nil { + hr = procLayerExists.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) @@ -377,7 +392,8 @@ func nameToGuid(name string, guid *_guid) (hr error) { } func _nameToGuid(name *uint16, guid *_guid) (hr error) { - if hr = procNameToGuid.Find(); hr != nil { + hr = procNameToGuid.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) @@ -400,13 +416,14 @@ func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR } func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + hr = procPrepareLayer.Find() + if hr != nil { + return + } var _p1 *WC_LAYER_DESCRIPTOR if len(descriptors) > 0 { _p1 = &descriptors[0] } - if hr = procPrepareLayer.Find(); hr != nil { - return - } r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { @@ -427,7 +444,8 @@ func unprepareLayer(info *driverInfo, id string) (hr error) { } func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procUnprepareLayer.Find(); hr != nil { + hr = procUnprepareLayer.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) @@ -450,7 +468,8 @@ func processBaseImage(path string) (hr error) { } func _processBaseImage(path *uint16) (hr error) { - if hr = procProcessBaseImage.Find(); hr != nil { + hr = procProcessBaseImage.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) @@ -473,7 +492,8 @@ func processUtilityImage(path string) (hr error) { } func _processUtilityImage(path *uint16) (hr error) { - if hr = procProcessUtilityImage.Find(); hr != nil { + hr = procProcessUtilityImage.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) @@ -501,7 +521,8 @@ func grantVmAccess(vmid string, filepath string) (hr error) { } func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { - if hr = procGrantVmAccess.Find(); hr != nil { + hr = procGrantVmAccess.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) @@ -526,11 +547,7 @@ func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtua func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) if r1 != 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -538,11 +555,7 @@ func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virt func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) if r1 != 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -559,11 +572,7 @@ func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } diff --git a/internal/winapi/winapi.go b/internal/winapi/winapi.go index b45fc7de43..d36a5a6ac6 100644 --- a/internal/winapi/winapi.go +++ b/internal/winapi/winapi.go @@ -1,3 +1,3 @@ package winapi -//go:generate go run ..\..\mksyscall_windows.go -output zsyscall_windows.go bindflt.go user.go console.go system.go net.go path.go thread.go jobobject.go logon.go memory.go process.go processor.go devices.go filesystem.go errors.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go bindflt.go user.go console.go system.go net.go path.go thread.go jobobject.go logon.go memory.go process.go processor.go devices.go filesystem.go errors.go diff --git a/internal/winapi/zsyscall_windows.go b/internal/winapi/zsyscall_windows.go index 80aeac51cd..3340f37fbe 100644 --- a/internal/winapi/zsyscall_windows.go +++ b/internal/winapi/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package winapi @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -82,7 +85,8 @@ var ( ) func BfSetupFilter(jobHandle windows.Handle, flags uint32, virtRootPath *uint16, virtTargetPath *uint16, virtExceptions **uint16, virtExceptionPathCount uint32) (hr error) { - if hr = procBfSetupFilter.Find(); hr != nil { + hr = procBfSetupFilter.Find() + if hr != nil { return } r0, _, _ := syscall.Syscall6(procBfSetupFilter.Addr(), 6, uintptr(jobHandle), uintptr(flags), uintptr(unsafe.Pointer(virtRootPath)), uintptr(unsafe.Pointer(virtTargetPath)), uintptr(unsafe.Pointer(virtExceptions)), uintptr(virtExceptionPathCount)) @@ -172,11 +176,7 @@ func SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBuffer r0, _, e1 := syscall.Syscall6(procSearchPathW.Addr(), 6, uintptr(unsafe.Pointer(lpPath)), uintptr(unsafe.Pointer(lpFileName)), uintptr(unsafe.Pointer(lpExtension)), uintptr(nBufferLength), uintptr(unsafe.Pointer(lpBuffer)), uintptr(unsafe.Pointer(lpFilePath))) size = uint32(r0) if size == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -185,11 +185,7 @@ func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, r0, _, e1 := syscall.Syscall9(procCreateRemoteThread.Addr(), 7, uintptr(process), uintptr(unsafe.Pointer(sa)), uintptr(stackSize), uintptr(startAddr), uintptr(parameter), uintptr(creationFlags), uintptr(unsafe.Pointer(threadID)), 0, 0) handle = windows.Handle(r0) if handle == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -197,11 +193,7 @@ func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *int32) (err error) { r1, _, e1 := syscall.Syscall(procIsProcessInJob.Addr(), 3, uintptr(procHandle), uintptr(jobHandle), uintptr(unsafe.Pointer(result))) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -209,11 +201,7 @@ func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result func QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo unsafe.Pointer, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) { r1, _, e1 := syscall.Syscall6(procQueryInformationJobObject.Addr(), 5, uintptr(jobHandle), uintptr(infoClass), uintptr(jobObjectInfo), uintptr(jobObjectInformationLength), uintptr(unsafe.Pointer(lpReturnLength)), 0) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -222,11 +210,7 @@ func OpenJobObject(desiredAccess uint32, inheritHandle int32, lpName *uint16) (h r0, _, e1 := syscall.Syscall(procOpenJobObjectW.Addr(), 3, uintptr(desiredAccess), uintptr(inheritHandle), uintptr(unsafe.Pointer(lpName))) handle = windows.Handle(r0) if handle == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -235,11 +219,7 @@ func SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateContro r0, _, e1 := syscall.Syscall(procSetIoRateControlInformationJobObject.Addr(), 2, uintptr(jobHandle), uintptr(unsafe.Pointer(ioRateControlInfo)), 0) ret = uint32(r0) if ret == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -248,11 +228,7 @@ func QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName r0, _, e1 := syscall.Syscall6(procQueryIoRateControlInformationJobObject.Addr(), 4, uintptr(jobHandle), uintptr(unsafe.Pointer(volumeName)), uintptr(unsafe.Pointer(ioRateControlInfo)), uintptr(unsafe.Pointer(infoBlockCount)), 0, 0) ret = uint32(r0) if ret == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -272,11 +248,7 @@ func NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttri func LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) { r1, _, e1 := syscall.Syscall6(procLogonUserW.Addr(), 6, uintptr(unsafe.Pointer(username)), uintptr(unsafe.Pointer(domain)), uintptr(unsafe.Pointer(password)), uintptr(logonType), uintptr(logonProvider), uintptr(unsafe.Pointer(token))) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -360,11 +332,7 @@ func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyTyp func CopyFileW(existingFileName *uint16, newFileName *uint16, failIfExists int32) (err error) { r1, _, e1 := syscall.Syscall(procCopyFileW.Addr(), 3, uintptr(unsafe.Pointer(existingFileName)), uintptr(unsafe.Pointer(newFileName)), uintptr(failIfExists)) if r1 == 0 { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = syscall.EINVAL - } + err = errnoErr(e1) } return } @@ -391,14 +359,10 @@ func NtQueryDirectoryObject(handle uintptr, buffer *byte, length uint32, singleE var _p0 uint32 if singleEntry { _p0 = 1 - } else { - _p0 = 0 } var _p1 uint32 if restartScan { _p1 = 1 - } else { - _p1 = 0 } r0, _, _ := syscall.Syscall9(procNtQueryDirectoryObject.Addr(), 7, uintptr(handle), uintptr(unsafe.Pointer(buffer)), uintptr(length), uintptr(_p0), uintptr(_p1), uintptr(unsafe.Pointer(context)), uintptr(unsafe.Pointer(returnLength)), 0, 0) status = uint32(r0) diff --git a/test/go.mod b/test/go.mod index 25e469d863..861295fd6c 100644 --- a/test/go.mod +++ b/test/go.mod @@ -3,7 +3,7 @@ module github.com/Microsoft/hcsshim/test go 1.17 require ( - github.com/Microsoft/go-winio v0.5.2 + github.com/Microsoft/go-winio v0.6.0 github.com/Microsoft/hcsshim v0.9.4 github.com/containerd/cgroups v1.0.3 github.com/containerd/containerd v1.6.6 @@ -19,8 +19,8 @@ require ( github.com/pkg/errors v0.9.1 github.com/sirupsen/logrus v1.9.0 github.com/stretchr/testify v1.8.0 - golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f - golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8 + golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4 + golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f google.golang.org/grpc v1.47.0 k8s.io/cri-api v0.24.1 ) @@ -74,8 +74,10 @@ require ( github.com/xeipuuv/gojsonschema v1.2.0 // indirect github.com/yashtewari/glob-intersection v0.1.0 // indirect go.opencensus.io v0.23.0 // indirect - golang.org/x/net v0.0.0-20220708220712-1185a9018129 // indirect + golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4 // indirect + golang.org/x/net v0.0.0-20220722155237-a158d28d115b // indirect golang.org/x/text v0.3.7 // indirect + golang.org/x/tools v0.1.12 // indirect google.golang.org/genproto v0.0.0-20220616135557-88e70c0c3a90 // indirect google.golang.org/protobuf v1.28.0 // indirect gopkg.in/yaml.v2 v2.4.0 // indirect diff --git a/test/go.sum b/test/go.sum index b7cd761562..ecc10a7f5f 100644 --- a/test/go.sum +++ b/test/go.sum @@ -105,8 +105,9 @@ github.com/Microsoft/go-winio v0.4.17-0.20210211115548-6eac466e5fa3/go.mod h1:JP github.com/Microsoft/go-winio v0.4.17-0.20210324224401-5516f17a5958/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= github.com/Microsoft/go-winio v0.4.17/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= github.com/Microsoft/go-winio v0.5.1/go.mod h1:JPGBdM1cNvN/6ISo+n8V5iA4v8pBzdOpzfwIujj1a84= -github.com/Microsoft/go-winio v0.5.2 h1:a9IhgEQBCUEk6QCdml9CiJGhAws+YwffDHEMp1VMrpA= github.com/Microsoft/go-winio v0.5.2/go.mod h1:WpS1mjBmmwHBEWmogvA2mj8546UReBk4v8QkMxJ6pZY= +github.com/Microsoft/go-winio v0.6.0 h1:slsWYD/zyx7lCXoZVlvQrj0hPTM1HI4+v1sIda2yDvg= +github.com/Microsoft/go-winio v0.6.0/go.mod h1:cTAf44im0RAYeL23bpB+fzCyDH2MJiz2BO69KH/soAE= github.com/Microsoft/hcsshim/test v0.0.0-20201218223536-d3e5debf77da/go.mod h1:5hlzMzRKMLyo42nCZ9oml8AdTlq/0cvIaBv6tK1RehU= github.com/Microsoft/hcsshim/test v0.0.0-20210227013316-43a75bb4edd3/go.mod h1:mw7qgWloBUl75W/gVH3cQszUg1+gUITj7D6NY7ywVnY= github.com/NYTimes/gziphandler v0.0.0-20170623195520-56545f4a5d46/go.mod h1:3wb06e3pkSAbeQ52E9H9iFoQsEEwGN64994WTCIhntQ= @@ -779,7 +780,6 @@ github.com/kr/pty v1.1.5/go.mod h1:9r2w37qlBe7rQ6e1fg1S/9xpWHSnaqNdHD3WcMdbPDA= github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY= github.com/kr/text v0.2.0/go.mod h1:eLer722TekiGuMkidMxC/pM04lWEeraHUUmBw8l2grE= -github.com/linuxkit/virtsock v0.0.0-20201010232012-f8cee7dfc7a3 h1:jUp75lepDg0phMUJBCmvaeFDldD2N3S1lBuPwUTszio= github.com/kulti/thelper v0.4.0/go.mod h1:vMu2Cizjy/grP+jmsvOFDx1kYP6+PD1lqg4Yu5exl2U= github.com/kunwardeep/paralleltest v1.0.3/go.mod h1:vLydzomDFpk7yu5UX02RmP0H8QfRPOV/oFhWN85Mjb4= github.com/kylelemons/godebug v1.1.0/go.mod h1:9/0rRGxNHcop5bhtWyNeEfOS8JIWk580+fNqagV/RAw= @@ -1219,6 +1219,7 @@ github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9dec github.com/yuin/goldmark v1.3.5/go.mod h1:mwnBkeHKe2W/ZEtQ+71ViKU8L12m81fl3OWwC1Zlc8k= github.com/yuin/goldmark v1.4.0/go.mod h1:mwnBkeHKe2W/ZEtQ+71ViKU8L12m81fl3OWwC1Zlc8k= github.com/yuin/goldmark v1.4.1/go.mod h1:mwnBkeHKe2W/ZEtQ+71ViKU8L12m81fl3OWwC1Zlc8k= +github.com/yuin/goldmark v1.4.13/go.mod h1:6yULJ656Px+3vBD8DxQVa3kxgyrAnzto9xy5taEt/CY= github.com/yvasiyarov/go-metrics v0.0.0-20140926110328-57bccd1ccd43/go.mod h1:aX5oPXxHm3bOH+xeAttToC8pqch2ScQN/JoXYupl6xs= github.com/yvasiyarov/gorelic v0.0.0-20141212073537-a9bba5b9ab50/go.mod h1:NUSPSUX/bi6SeDMUh6brw0nXpxHnc96TguQh0+r/ssA= github.com/yvasiyarov/newrelic_platform_go v0.0.0-20140908184405-b21fdbd4370f/go.mod h1:GlGEuHIJweS1mbCqG+7vt2nvWLzLLnRHbXz5JKd/Qbg= @@ -1353,6 +1354,7 @@ golang.org/x/mod v0.4.1/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.4.2/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.5.0/go.mod h1:5OXOZSfqPIIbmVBIIKWRFfZjPR0E5r58TLhUjH0a2Ro= golang.org/x/mod v0.5.1/go.mod h1:5OXOZSfqPIIbmVBIIKWRFfZjPR0E5r58TLhUjH0a2Ro= +golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4 h1:6zppjxzCulZykYSLyVDYbneBfbaBIQPYMevg0bEwv2s= golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4/go.mod h1:jJ57K6gSWd91VN4djpZkiMVwK6gcyfeH4XE8wZrZaV4= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= @@ -1424,8 +1426,9 @@ golang.org/x/net v0.0.0-20220412020605-290c469a71a5/go.mod h1:CfG3xpIq0wQ8r1q4Su golang.org/x/net v0.0.0-20220425223048-2871e0cb64e4/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk= golang.org/x/net v0.0.0-20220607020251-c690dde0001d/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= golang.org/x/net v0.0.0-20220624214902-1bab6f366d9e/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= -golang.org/x/net v0.0.0-20220708220712-1185a9018129 h1:vucSRfWwTsoXro7P+3Cjlr6flUMtzCwzlvkxEQtHHB0= golang.org/x/net v0.0.0-20220708220712-1185a9018129/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= +golang.org/x/net v0.0.0-20220722155237-a158d28d115b h1:PxfKdU9lEEDYjdIzOtC4qFWgkU2rGHdKlKowJSMN9h0= +golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= @@ -1460,8 +1463,9 @@ golang.org/x/sync v0.0.0-20200625203802-6e8e738ad208/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f h1:Ax0t5p6N38Ga0dThY21weqDEyz2oklo4IvDkpigvkD8= golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= +golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4 h1:uVc8UZUe6tr40fFVnUP5Oj+veunVezqYl9z7DYw9xzw= +golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20180823144017-11551d06cbcc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= @@ -1586,8 +1590,9 @@ golang.org/x/sys v0.0.0-20220502124256-b6088ccd6cba/go.mod h1:oPkhp1MJrh7nUepCBc golang.org/x/sys v0.0.0-20220503163025-988cb79eb6c6/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.0.0-20220610221304-9f5ed59c137d/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= -golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8 h1:0A+M6Uqn+Eje4kHMK80dtF3JCXC4ykBgQG4Fe06QRhQ= golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f h1:v4INt8xihDGvnrfjMDVXGxw9wrfxYyCjk0KbXjhR55s= +golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/term v0.0.0-20201117132131-f5c789dd3221/go.mod h1:Nr5EML6q2oocZ2LXRh80K7BxOlk5/8JxuGnuhpl+muw= golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= golang.org/x/term v0.0.0-20210220032956-6a3ed077a48d/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= @@ -1714,6 +1719,8 @@ golang.org/x/tools v0.1.6/go.mod h1:LGqMHiF4EqQNHR1JncWGqT5BVaXmza+X+BDGol+dOxo= golang.org/x/tools v0.1.7/go.mod h1:LGqMHiF4EqQNHR1JncWGqT5BVaXmza+X+BDGol+dOxo= golang.org/x/tools v0.1.9/go.mod h1:nABZi5QlRsZVlzPpHl034qft6wpY4eDcsTt5AaioBiU= golang.org/x/tools v0.1.11/go.mod h1:SgwaegtQh8clINPpECJMqnxLv9I09HLqnW3RMqW0CA4= +golang.org/x/tools v0.1.12 h1:VveCTK38A2rkS8ZqFY25HIDFscX5X9OoEhJd3quQmXU= +golang.org/x/tools v0.1.12/go.mod h1:hNGJHUnrk76NpqgfD5Aqm5Crs+Hm0VOH/i9J2+nxYbc= golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= diff --git a/tools.go b/tools.go new file mode 100644 index 0000000000..3964e2f023 --- /dev/null +++ b/tools.go @@ -0,0 +1,5 @@ +//go:build tools + +package hcsshim + +import _ "github.com/Microsoft/go-winio/tools/mkwinsyscall" diff --git a/vendor/github.com/Microsoft/go-winio/.gitattributes b/vendor/github.com/Microsoft/go-winio/.gitattributes new file mode 100644 index 0000000000..94f480de94 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/.gitattributes @@ -0,0 +1 @@ +* text=auto eol=lf \ No newline at end of file diff --git a/vendor/github.com/Microsoft/go-winio/.gitignore b/vendor/github.com/Microsoft/go-winio/.gitignore index b883f1fdc6..815e20660e 100644 --- a/vendor/github.com/Microsoft/go-winio/.gitignore +++ b/vendor/github.com/Microsoft/go-winio/.gitignore @@ -1 +1,10 @@ +.vscode/ + *.exe + +# testing +testdata + +# go workspaces +go.work +go.work.sum diff --git a/vendor/github.com/Microsoft/go-winio/.golangci.yml b/vendor/github.com/Microsoft/go-winio/.golangci.yml new file mode 100644 index 0000000000..af403bb13a --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/.golangci.yml @@ -0,0 +1,144 @@ +run: + skip-dirs: + - pkg/etw/sample + +linters: + enable: + # style + - containedctx # struct contains a context + - dupl # duplicate code + - errname # erorrs are named correctly + - goconst # strings that should be constants + - godot # comments end in a period + - misspell + - nolintlint # "//nolint" directives are properly explained + - revive # golint replacement + - stylecheck # golint replacement, less configurable than revive + - unconvert # unnecessary conversions + - wastedassign + + # bugs, performance, unused, etc ... + - contextcheck # function uses a non-inherited context + - errorlint # errors not wrapped for 1.13 + - exhaustive # check exhaustiveness of enum switch statements + - gofmt # files are gofmt'ed + - gosec # security + - nestif # deeply nested ifs + - nilerr # returns nil even with non-nil error + - prealloc # slices that can be pre-allocated + - structcheck # unused struct fields + - unparam # unused function params + +issues: + exclude-rules: + # err is very often shadowed in nested scopes + - linters: + - govet + text: '^shadow: declaration of "err" shadows declaration' + + # ignore long lines for skip autogen directives + - linters: + - revive + text: "^line-length-limit: " + source: "^//(go:generate|sys) " + + # allow unjustified ignores of error checks in defer statements + - linters: + - nolintlint + text: "^directive `//nolint:errcheck` should provide explanation" + source: '^\s*defer ' + + # allow unjustified ignores of error lints for io.EOF + - linters: + - nolintlint + text: "^directive `//nolint:errorlint` should provide explanation" + source: '[=|!]= io.EOF' + + +linters-settings: + govet: + enable-all: true + disable: + # struct order is often for Win32 compat + # also, ignore pointer bytes/GC issues for now until performance becomes an issue + - fieldalignment + check-shadowing: true + nolintlint: + allow-leading-space: false + require-explanation: true + require-specific: true + revive: + # revive is more configurable than static check, so likely the preferred alternative to static-check + # (once the perf issue is solved: https://github.com/golangci/golangci-lint/issues/2997) + enable-all-rules: + true + # https://github.com/mgechev/revive/blob/master/RULES_DESCRIPTIONS.md + rules: + # rules with required arguments + - name: argument-limit + disabled: true + - name: banned-characters + disabled: true + - name: cognitive-complexity + disabled: true + - name: cyclomatic + disabled: true + - name: file-header + disabled: true + - name: function-length + disabled: true + - name: function-result-limit + disabled: true + - name: max-public-structs + disabled: true + # geneally annoying rules + - name: add-constant # complains about any and all strings and integers + disabled: true + - name: confusing-naming # we frequently use "Foo()" and "foo()" together + disabled: true + - name: flag-parameter # excessive, and a common idiom we use + disabled: true + # general config + - name: line-length-limit + arguments: + - 140 + - name: var-naming + arguments: + - [] + - - CID + - CRI + - CTRD + - DACL + - DLL + - DOS + - ETW + - FSCTL + - GCS + - GMSA + - HCS + - HV + - IO + - LCOW + - LDAP + - LPAC + - LTSC + - MMIO + - NT + - OCI + - PMEM + - PWSH + - RX + - SACl + - SID + - SMB + - TX + - VHD + - VHDX + - VMID + - VPCI + - WCOW + - WIM + stylecheck: + checks: + - "all" + - "-ST1003" # use revive's var naming diff --git a/vendor/github.com/Microsoft/go-winio/README.md b/vendor/github.com/Microsoft/go-winio/README.md index 683be1dcf9..7474b4f0b6 100644 --- a/vendor/github.com/Microsoft/go-winio/README.md +++ b/vendor/github.com/Microsoft/go-winio/README.md @@ -13,16 +13,60 @@ Please see the LICENSE file for licensing information. ## Contributing -This project welcomes contributions and suggestions. Most contributions require you to agree to a Contributor License Agreement (CLA) -declaring that you have the right to, and actually do, grant us the rights to use your contribution. For details, visit https://cla.microsoft.com. +This project welcomes contributions and suggestions. +Most contributions require you to agree to a Contributor License Agreement (CLA) declaring that +you have the right to, and actually do, grant us the rights to use your contribution. +For details, visit [Microsoft CLA](https://cla.microsoft.com). -When you submit a pull request, a CLA-bot will automatically determine whether you need to provide a CLA and decorate the PR -appropriately (e.g., label, comment). Simply follow the instructions provided by the bot. You will only need to do this once across all repos using our CLA. +When you submit a pull request, a CLA-bot will automatically determine whether you need to +provide a CLA and decorate the PR appropriately (e.g., label, comment). +Simply follow the instructions provided by the bot. +You will only need to do this once across all repos using our CLA. -We also require that contributors sign their commits using git commit -s or git commit --signoff to certify they either authored the work themselves -or otherwise have permission to use it in this project. Please see https://developercertificate.org/ for more info, as well as to make sure that you can -attest to the rules listed. Our CI uses the DCO Github app to ensure that all commits in a given PR are signed-off. +Additionally, the pull request pipeline requires the following steps to be performed before +mergining. +### Code Sign-Off + +We require that contributors sign their commits using [`git commit --signoff`][git-commit-s] +to certify they either authored the work themselves or otherwise have permission to use it in this project. + +A range of commits can be signed off using [`git rebase --signoff`][git-rebase-s]. + +Please see [the developer certificate](https://developercertificate.org) for more info, +as well as to make sure that you can attest to the rules listed. +Our CI uses the DCO Github app to ensure that all commits in a given PR are signed-off. + +### Linting + +Code must pass a linting stage, which uses [`golangci-lint`][lint]. +The linting settings are stored in [`.golangci.yaml`](./.golangci.yaml), and can be run +automatically with VSCode by adding the following to your workspace or folder settings: + +```json + "go.lintTool": "golangci-lint", + "go.lintOnSave": "package", +``` + +Additional editor [integrations options are also available][lint-ide]. + +Alternatively, `golangci-lint` can be [installed locally][lint-install] and run from the repo root: + +```shell +# use . or specify a path to only lint a package +# to show all lint errors, use flags "--max-issues-per-linter=0 --max-same-issues=0" +> golangci-lint run ./... +``` + +### Go Generate + +The pipeline checks that auto-generated code, via `go generate`, are up to date. + +This can be done for the entire repo: + +```shell +> go generate ./... +``` ## Code of Conduct @@ -30,8 +74,16 @@ This project has adopted the [Microsoft Open Source Code of Conduct](https://ope For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments. +## Special Thanks +Thanks to [natefinch][natefinch] for the inspiration for this library. +See [npipe](https://github.com/natefinch/npipe) for another named pipe implementation. -## Special Thanks -Thanks to natefinch for the inspiration for this library. See https://github.com/natefinch/npipe -for another named pipe implementation. +[lint]: https://golangci-lint.run/ +[lint-ide]: https://golangci-lint.run/usage/integrations/#editor-integration +[lint-install]: https://golangci-lint.run/usage/install/#local-installation + +[git-commit-s]: https://git-scm.com/docs/git-commit#Documentation/git-commit.txt--s +[git-rebase-s]: https://git-scm.com/docs/git-rebase#Documentation/git-rebase.txt---signoff + +[natefinch]: https://github.com/natefinch diff --git a/vendor/github.com/Microsoft/go-winio/SECURITY.md b/vendor/github.com/Microsoft/go-winio/SECURITY.md new file mode 100644 index 0000000000..869fdfe2b2 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/SECURITY.md @@ -0,0 +1,41 @@ + + +## Security + +Microsoft takes the security of our software products and services seriously, which includes all source code repositories managed through our GitHub organizations, which include [Microsoft](https://github.com/Microsoft), [Azure](https://github.com/Azure), [DotNet](https://github.com/dotnet), [AspNet](https://github.com/aspnet), [Xamarin](https://github.com/xamarin), and [our GitHub organizations](https://opensource.microsoft.com/). + +If you believe you have found a security vulnerability in any Microsoft-owned repository that meets [Microsoft's definition of a security vulnerability](https://aka.ms/opensource/security/definition), please report it to us as described below. + +## Reporting Security Issues + +**Please do not report security vulnerabilities through public GitHub issues.** + +Instead, please report them to the Microsoft Security Response Center (MSRC) at [https://msrc.microsoft.com/create-report](https://aka.ms/opensource/security/create-report). + +If you prefer to submit without logging in, send email to [secure@microsoft.com](mailto:secure@microsoft.com). If possible, encrypt your message with our PGP key; please download it from the [Microsoft Security Response Center PGP Key page](https://aka.ms/opensource/security/pgpkey). + +You should receive a response within 24 hours. If for some reason you do not, please follow up via email to ensure we received your original message. Additional information can be found at [microsoft.com/msrc](https://aka.ms/opensource/security/msrc). + +Please include the requested information listed below (as much as you can provide) to help us better understand the nature and scope of the possible issue: + + * Type of issue (e.g. buffer overflow, SQL injection, cross-site scripting, etc.) + * Full paths of source file(s) related to the manifestation of the issue + * The location of the affected source code (tag/branch/commit or direct URL) + * Any special configuration required to reproduce the issue + * Step-by-step instructions to reproduce the issue + * Proof-of-concept or exploit code (if possible) + * Impact of the issue, including how an attacker might exploit the issue + +This information will help us triage your report more quickly. + +If you are reporting for a bug bounty, more complete reports can contribute to a higher bounty award. Please visit our [Microsoft Bug Bounty Program](https://aka.ms/opensource/security/bounty) page for more details about our active programs. + +## Preferred Languages + +We prefer all communications to be in English. + +## Policy + +Microsoft follows the principle of [Coordinated Vulnerability Disclosure](https://aka.ms/opensource/security/cvd). + + diff --git a/vendor/github.com/Microsoft/go-winio/backup.go b/vendor/github.com/Microsoft/go-winio/backup.go index 2be34af431..09621c8846 100644 --- a/vendor/github.com/Microsoft/go-winio/backup.go +++ b/vendor/github.com/Microsoft/go-winio/backup.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package winio @@ -7,11 +8,12 @@ import ( "errors" "fmt" "io" - "io/ioutil" "os" "runtime" "syscall" "unicode/utf16" + + "golang.org/x/sys/windows" ) //sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead @@ -24,7 +26,7 @@ const ( BackupAlternateData BackupLink BackupPropertyData - BackupObjectId + BackupObjectId //revive:disable-line:var-naming ID, not Id BackupReparseData BackupSparseBlock BackupTxfsData @@ -34,14 +36,16 @@ const ( StreamSparseAttributes = uint32(8) ) +//nolint:revive // var-naming: ALL_CAPS const ( - WRITE_DAC = 0x40000 - WRITE_OWNER = 0x80000 - ACCESS_SYSTEM_SECURITY = 0x1000000 + WRITE_DAC = windows.WRITE_DAC + WRITE_OWNER = windows.WRITE_OWNER + ACCESS_SYSTEM_SECURITY = windows.ACCESS_SYSTEM_SECURITY ) // BackupHeader represents a backup stream of a file. type BackupHeader struct { + //revive:disable-next-line:var-naming ID, not Id Id uint32 // The backup stream ID Attributes uint32 // Stream attributes Size int64 // The size of the stream in bytes @@ -49,8 +53,8 @@ type BackupHeader struct { Offset int64 // The offset of the stream in the file (for BackupSparseBlock only). } -type win32StreamId struct { - StreamId uint32 +type win32StreamID struct { + StreamID uint32 Attributes uint32 Size uint64 NameSize uint32 @@ -71,7 +75,7 @@ func NewBackupStreamReader(r io.Reader) *BackupStreamReader { // Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if // it was not completely read. func (r *BackupStreamReader) Next() (*BackupHeader, error) { - if r.bytesLeft > 0 { + if r.bytesLeft > 0 { //nolint:nestif // todo: flatten this if s, ok := r.r.(io.Seeker); ok { // Make sure Seek on io.SeekCurrent sometimes succeeds // before trying the actual seek. @@ -82,16 +86,16 @@ func (r *BackupStreamReader) Next() (*BackupHeader, error) { r.bytesLeft = 0 } } - if _, err := io.Copy(ioutil.Discard, r); err != nil { + if _, err := io.Copy(io.Discard, r); err != nil { return nil, err } } - var wsi win32StreamId + var wsi win32StreamID if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil { return nil, err } hdr := &BackupHeader{ - Id: wsi.StreamId, + Id: wsi.StreamID, Attributes: wsi.Attributes, Size: int64(wsi.Size), } @@ -102,7 +106,7 @@ func (r *BackupStreamReader) Next() (*BackupHeader, error) { } hdr.Name = syscall.UTF16ToString(name) } - if wsi.StreamId == BackupSparseBlock { + if wsi.StreamID == BackupSparseBlock { if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil { return nil, err } @@ -147,8 +151,8 @@ func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error { return fmt.Errorf("missing %d bytes", w.bytesLeft) } name := utf16.Encode([]rune(hdr.Name)) - wsi := win32StreamId{ - StreamId: hdr.Id, + wsi := win32StreamID{ + StreamID: hdr.Id, Attributes: hdr.Attributes, Size: uint64(hdr.Size), NameSize: uint32(len(name) * 2), @@ -203,7 +207,7 @@ func (r *BackupFileReader) Read(b []byte) (int, error) { var bytesRead uint32 err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx) if err != nil { - return 0, &os.PathError{"BackupRead", r.f.Name(), err} + return 0, &os.PathError{Op: "BackupRead", Path: r.f.Name(), Err: err} } runtime.KeepAlive(r.f) if bytesRead == 0 { @@ -216,7 +220,7 @@ func (r *BackupFileReader) Read(b []byte) (int, error) { // the underlying file. func (r *BackupFileReader) Close() error { if r.ctx != 0 { - backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx) + _ = backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx) runtime.KeepAlive(r.f) r.ctx = 0 } @@ -242,7 +246,7 @@ func (w *BackupFileWriter) Write(b []byte) (int, error) { var bytesWritten uint32 err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx) if err != nil { - return 0, &os.PathError{"BackupWrite", w.f.Name(), err} + return 0, &os.PathError{Op: "BackupWrite", Path: w.f.Name(), Err: err} } runtime.KeepAlive(w.f) if int(bytesWritten) != len(b) { @@ -255,7 +259,7 @@ func (w *BackupFileWriter) Write(b []byte) (int, error) { // close the underlying file. func (w *BackupFileWriter) Close() error { if w.ctx != 0 { - backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx) + _ = backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx) runtime.KeepAlive(w.f) w.ctx = 0 } @@ -271,7 +275,13 @@ func OpenForBackup(path string, access uint32, share uint32, createmode uint32) if err != nil { return nil, err } - h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0) + h, err := syscall.CreateFile(&winPath[0], + access, + share, + nil, + createmode, + syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, + 0) if err != nil { err = &os.PathError{Op: "open", Path: path, Err: err} return nil, err diff --git a/vendor/github.com/Microsoft/go-winio/backuptar/noop.go b/vendor/github.com/Microsoft/go-winio/backuptar/doc.go similarity index 81% rename from vendor/github.com/Microsoft/go-winio/backuptar/noop.go rename to vendor/github.com/Microsoft/go-winio/backuptar/doc.go index d39eccf023..965d52ab04 100644 --- a/vendor/github.com/Microsoft/go-winio/backuptar/noop.go +++ b/vendor/github.com/Microsoft/go-winio/backuptar/doc.go @@ -1,4 +1,3 @@ -// +build !windows // This file only exists to allow go get on non-Windows platforms. package backuptar diff --git a/vendor/github.com/Microsoft/go-winio/backuptar/strconv.go b/vendor/github.com/Microsoft/go-winio/backuptar/strconv.go index 3416096639..455fd798eb 100644 --- a/vendor/github.com/Microsoft/go-winio/backuptar/strconv.go +++ b/vendor/github.com/Microsoft/go-winio/backuptar/strconv.go @@ -1,3 +1,5 @@ +//go:build windows + package backuptar import ( diff --git a/vendor/github.com/Microsoft/go-winio/backuptar/tar.go b/vendor/github.com/Microsoft/go-winio/backuptar/tar.go index 2342a7fcd6..6b3b0cd519 100644 --- a/vendor/github.com/Microsoft/go-winio/backuptar/tar.go +++ b/vendor/github.com/Microsoft/go-winio/backuptar/tar.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package backuptar @@ -7,7 +8,6 @@ import ( "encoding/base64" "fmt" "io" - "io/ioutil" "path/filepath" "strconv" "strings" @@ -18,17 +18,18 @@ import ( "golang.org/x/sys/windows" ) +//nolint:deadcode,varcheck // keep unused constants for potential future use const ( - c_ISUID = 04000 // Set uid - c_ISGID = 02000 // Set gid - c_ISVTX = 01000 // Save text (sticky bit) - c_ISDIR = 040000 // Directory - c_ISFIFO = 010000 // FIFO - c_ISREG = 0100000 // Regular file - c_ISLNK = 0120000 // Symbolic link - c_ISBLK = 060000 // Block special file - c_ISCHR = 020000 // Character special file - c_ISSOCK = 0140000 // Socket + cISUID = 0004000 // Set uid + cISGID = 0002000 // Set gid + cISVTX = 0001000 // Save text (sticky bit) + cISDIR = 0040000 // Directory + cISFIFO = 0010000 // FIFO + cISREG = 0100000 // Regular file + cISLNK = 0120000 // Symbolic link + cISBLK = 0060000 // Block special file + cISCHR = 0020000 // Character special file + cISSOCK = 0140000 // Socket ) const ( @@ -44,7 +45,7 @@ const ( // zeroReader is an io.Reader that always returns 0s. type zeroReader struct{} -func (zr zeroReader) Read(b []byte) (int, error) { +func (zeroReader) Read(b []byte) (int, error) { for i := range b { b[i] = 0 } @@ -55,7 +56,7 @@ func copySparse(t *tar.Writer, br *winio.BackupStreamReader) error { curOffset := int64(0) for { bhdr, err := br.Next() - if err == io.EOF { + if err == io.EOF { //nolint:errorlint err = io.ErrUnexpectedEOF } if err != nil { @@ -71,8 +72,8 @@ func copySparse(t *tar.Writer, br *winio.BackupStreamReader) error { } // archive/tar does not support writing sparse files // so just write zeroes to catch up to the current offset. - if _, err := io.CopyN(t, zeroReader{}, bhdr.Offset-curOffset); err != nil { - return fmt.Errorf("seek to offset %d: %s", bhdr.Offset, err) + if _, err = io.CopyN(t, zeroReader{}, bhdr.Offset-curOffset); err != nil { + return fmt.Errorf("seek to offset %d: %w", bhdr.Offset, err) } if bhdr.Size == 0 { // A sparse block with size = 0 is used to mark the end of the sparse blocks. @@ -106,7 +107,7 @@ func BasicInfoHeader(name string, size int64, fileInfo *winio.FileBasicInfo) *ta hdr.PAXRecords[hdrCreationTime] = formatPAXTime(time.Unix(0, fileInfo.CreationTime.Nanoseconds())) if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { - hdr.Mode |= c_ISDIR + hdr.Mode |= cISDIR hdr.Size = 0 hdr.Typeflag = tar.TypeDir } @@ -116,32 +117,29 @@ func BasicInfoHeader(name string, size int64, fileInfo *winio.FileBasicInfo) *ta // SecurityDescriptorFromTarHeader reads the SDDL associated with the header of the current file // from the tar header and returns the security descriptor into a byte slice. func SecurityDescriptorFromTarHeader(hdr *tar.Header) ([]byte, error) { - // Maintaining old SDDL-based behavior for backward - // compatibility. All new tar headers written by this library - // will have raw binary for the security descriptor. - var sd []byte - var err error - if sddl, ok := hdr.PAXRecords[hdrSecurityDescriptor]; ok { - sd, err = winio.SddlToSecurityDescriptor(sddl) - if err != nil { - return nil, err - } - } if sdraw, ok := hdr.PAXRecords[hdrRawSecurityDescriptor]; ok { - sd, err = base64.StdEncoding.DecodeString(sdraw) + sd, err := base64.StdEncoding.DecodeString(sdraw) if err != nil { + // Not returning sd as-is in the error-case, as base64.DecodeString + // may return partially decoded data (not nil or empty slice) in case + // of a failure: https://github.com/golang/go/blob/go1.17.7/src/encoding/base64/base64.go#L382-L387 return nil, err } + return sd, nil } - return sd, nil + // Maintaining old SDDL-based behavior for backward compatibility. All new + // tar headers written by this library will have raw binary for the security + // descriptor. + if sddl, ok := hdr.PAXRecords[hdrSecurityDescriptor]; ok { + return winio.SddlToSecurityDescriptor(sddl) + } + return nil, nil } // ExtendedAttributesFromTarHeader reads the EAs associated with the header of the // current file from the tar header and returns it as a byte slice. func ExtendedAttributesFromTarHeader(hdr *tar.Header) ([]byte, error) { - var eas []winio.ExtendedAttribute - var eadata []byte - var err error + var eas []winio.ExtendedAttribute //nolint:prealloc // len(eas) <= len(hdr.PAXRecords); prealloc is wasteful for k, v := range hdr.PAXRecords { if !strings.HasPrefix(k, hdrEaPrefix) { continue @@ -155,13 +153,15 @@ func ExtendedAttributesFromTarHeader(hdr *tar.Header) ([]byte, error) { Value: data, }) } + var eaData []byte + var err error if len(eas) != 0 { - eadata, err = winio.EncodeExtendedAttributes(eas) + eaData, err = winio.EncodeExtendedAttributes(eas) if err != nil { return nil, err } } - return eadata, nil + return eaData, nil } // EncodeReparsePointFromTarHeader reads the ReparsePoint structure from the tar header @@ -182,11 +182,9 @@ func EncodeReparsePointFromTarHeader(hdr *tar.Header) []byte { // // The additional Win32 metadata is: // -// MSWINDOWS.fileattr: The Win32 file attributes, as a decimal value -// -// MSWINDOWS.rawsd: The Win32 security descriptor, in raw binary format -// -// MSWINDOWS.mountpoint: If present, this is a mount point and not a symlink, even though the type is '2' (symlink) +// - MSWINDOWS.fileattr: The Win32 file attributes, as a decimal value +// - MSWINDOWS.rawsd: The Win32 security descriptor, in raw binary format +// - MSWINDOWS.mountpoint: If present, this is a mount point and not a symlink, even though the type is '2' (symlink) func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size int64, fileInfo *winio.FileBasicInfo) error { name = filepath.ToSlash(name) hdr := BasicInfoHeader(name, size, fileInfo) @@ -209,7 +207,7 @@ func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size var dataHdr *winio.BackupHeader for dataHdr == nil { bhdr, err := br.Next() - if err == io.EOF { + if err == io.EOF { //nolint:errorlint break } if err != nil { @@ -217,21 +215,21 @@ func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size } switch bhdr.Id { case winio.BackupData: - hdr.Mode |= c_ISREG + hdr.Mode |= cISREG if !readTwice { dataHdr = bhdr } case winio.BackupSecurity: - sd, err := ioutil.ReadAll(br) + sd, err := io.ReadAll(br) if err != nil { return err } hdr.PAXRecords[hdrRawSecurityDescriptor] = base64.StdEncoding.EncodeToString(sd) case winio.BackupReparseData: - hdr.Mode |= c_ISLNK + hdr.Mode |= cISLNK hdr.Typeflag = tar.TypeSymlink - reparseBuffer, err := ioutil.ReadAll(br) + reparseBuffer, _ := io.ReadAll(br) rp, err := winio.DecodeReparsePoint(reparseBuffer) if err != nil { return err @@ -242,7 +240,7 @@ func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size hdr.Linkname = rp.Target case winio.BackupEaData: - eab, err := ioutil.ReadAll(br) + eab, err := io.ReadAll(br) if err != nil { return err } @@ -276,7 +274,7 @@ func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size } for dataHdr == nil { bhdr, err := br.Next() - if err == io.EOF { + if err == io.EOF { //nolint:errorlint break } if err != nil { @@ -311,7 +309,7 @@ func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size // range of the file containing the range contents. Finally there is a sparse block stream with // size = 0 and offset = . - if dataHdr != nil { + if dataHdr != nil { //nolint:nestif // todo: reduce nesting complexity // A data stream was found. Copy the data. // We assume that we will either have a data stream size > 0 XOR have sparse block streams. if dataHdr.Size > 0 || (dataHdr.Attributes&winio.StreamSparseAttributes) == 0 { @@ -319,13 +317,13 @@ func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size return fmt.Errorf("%s: mismatch between file size %d and header size %d", name, size, dataHdr.Size) } if _, err = io.Copy(t, br); err != nil { - return fmt.Errorf("%s: copying contents from data stream: %s", name, err) + return fmt.Errorf("%s: copying contents from data stream: %w", name, err) } } else if size > 0 { // As of a recent OS change, BackupRead now returns a data stream for empty sparse files. // These files have no sparse block streams, so skip the copySparse call if file size = 0. if err = copySparse(t, br); err != nil { - return fmt.Errorf("%s: copying contents from sparse block stream: %s", name, err) + return fmt.Errorf("%s: copying contents from sparse block stream: %w", name, err) } } } @@ -335,7 +333,7 @@ func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size // been written. In practice, this means that we don't get EA or TXF metadata. for { bhdr, err := br.Next() - if err == io.EOF { + if err == io.EOF { //nolint:errorlint break } if err != nil { @@ -343,35 +341,30 @@ func WriteTarFileFromBackupStream(t *tar.Writer, r io.Reader, name string, size } switch bhdr.Id { case winio.BackupAlternateData: - altName := bhdr.Name - if strings.HasSuffix(altName, ":$DATA") { - altName = altName[:len(altName)-len(":$DATA")] - } - if (bhdr.Attributes & winio.StreamSparseAttributes) == 0 { - hdr = &tar.Header{ - Format: hdr.Format, - Name: name + altName, - Mode: hdr.Mode, - Typeflag: tar.TypeReg, - Size: bhdr.Size, - ModTime: hdr.ModTime, - AccessTime: hdr.AccessTime, - ChangeTime: hdr.ChangeTime, - } - err = t.WriteHeader(hdr) - if err != nil { - return err - } - _, err = io.Copy(t, br) - if err != nil { - return err - } - - } else { + if (bhdr.Attributes & winio.StreamSparseAttributes) != 0 { // Unsupported for now, since the size of the alternate stream is not present // in the backup stream until after the data has been read. return fmt.Errorf("%s: tar of sparse alternate data streams is unsupported", name) } + altName := strings.TrimSuffix(bhdr.Name, ":$DATA") + hdr = &tar.Header{ + Format: hdr.Format, + Name: name + altName, + Mode: hdr.Mode, + Typeflag: tar.TypeReg, + Size: bhdr.Size, + ModTime: hdr.ModTime, + AccessTime: hdr.AccessTime, + ChangeTime: hdr.ChangeTime, + } + err = t.WriteHeader(hdr) + if err != nil { + return err + } + _, err = io.Copy(t, br) + if err != nil { + return err + } case winio.BackupEaData, winio.BackupLink, winio.BackupPropertyData, winio.BackupObjectId, winio.BackupTxfsData: // ignore these streams default: @@ -413,7 +406,7 @@ func FileInfoFromHeader(hdr *tar.Header) (name string, size int64, fileInfo *win } fileInfo.CreationTime = windows.NsecToFiletime(creationTime.UnixNano()) } - return + return name, size, fileInfo, err } // WriteBackupStreamFromTarFile writes a Win32 backup stream from the current tar file. Since this function may process multiple @@ -474,7 +467,6 @@ func WriteBackupStreamFromTarFile(w io.Writer, t *tar.Reader, hdr *tar.Header) ( if err != nil { return nil, err } - } if hdr.Typeflag == tar.TypeReg || hdr.Typeflag == tar.TypeRegA { diff --git a/vendor/github.com/Microsoft/go-winio/doc.go b/vendor/github.com/Microsoft/go-winio/doc.go new file mode 100644 index 0000000000..1f5bfe2d54 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/doc.go @@ -0,0 +1,22 @@ +// This package provides utilities for efficiently performing Win32 IO operations in Go. +// Currently, this package is provides support for genreal IO and management of +// - named pipes +// - files +// - [Hyper-V sockets] +// +// This code is similar to Go's [net] package, and uses IO completion ports to avoid +// blocking IO on system threads, allowing Go to reuse the thread to schedule other goroutines. +// +// This limits support to Windows Vista and newer operating systems. +// +// Additionally, this package provides support for: +// - creating and managing GUIDs +// - writing to [ETW] +// - opening and manageing VHDs +// - parsing [Windows Image files] +// - auto-generating Win32 API code +// +// [Hyper-V sockets]: https://docs.microsoft.com/en-us/virtualization/hyper-v-on-windows/user-guide/make-integration-service +// [ETW]: https://docs.microsoft.com/en-us/windows-hardware/drivers/devtest/event-tracing-for-windows--etw- +// [Windows Image files]: https://docs.microsoft.com/en-us/windows-hardware/manufacture/desktop/work-with-windows-images +package winio diff --git a/vendor/github.com/Microsoft/go-winio/ea.go b/vendor/github.com/Microsoft/go-winio/ea.go index 4051c1b33b..e104dbdfdf 100644 --- a/vendor/github.com/Microsoft/go-winio/ea.go +++ b/vendor/github.com/Microsoft/go-winio/ea.go @@ -33,7 +33,7 @@ func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info) if err != nil { err = errInvalidEaBuffer - return + return ea, nb, err } nameOffset := fileFullEaInformationSize @@ -43,7 +43,7 @@ func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { nextOffset := int(info.NextEntryOffset) if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) { err = errInvalidEaBuffer - return + return ea, nb, err } ea.Name = string(b[nameOffset : nameOffset+nameLen]) @@ -52,7 +52,7 @@ func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { if info.NextEntryOffset != 0 { nb = b[info.NextEntryOffset:] } - return + return ea, nb, err } // DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION @@ -67,7 +67,7 @@ func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) { eas = append(eas, ea) b = nb } - return + return eas, err } func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error { diff --git a/vendor/github.com/Microsoft/go-winio/file.go b/vendor/github.com/Microsoft/go-winio/file.go index 293ab54c80..175a99d3f4 100644 --- a/vendor/github.com/Microsoft/go-winio/file.go +++ b/vendor/github.com/Microsoft/go-winio/file.go @@ -11,6 +11,8 @@ import ( "sync/atomic" "syscall" "time" + + "golang.org/x/sys/windows" ) //sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx @@ -24,6 +26,8 @@ type atomicBool int32 func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 } func (b *atomicBool) setFalse() { atomic.StoreInt32((*int32)(b), 0) } func (b *atomicBool) setTrue() { atomic.StoreInt32((*int32)(b), 1) } + +//revive:disable-next-line:predeclared Keep "new" to maintain consistency with "atomic" pkg func (b *atomicBool) swap(new bool) bool { var newInt int32 if new { @@ -32,11 +36,6 @@ func (b *atomicBool) swap(new bool) bool { return atomic.SwapInt32((*int32)(b), newInt) == 1 } -const ( - cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1 - cFILE_SKIP_SET_EVENT_ON_HANDLE = 2 -) - var ( ErrFileClosed = errors.New("file has already been closed") ErrTimeout = &timeoutError{} @@ -44,28 +43,28 @@ var ( type timeoutError struct{} -func (e *timeoutError) Error() string { return "i/o timeout" } -func (e *timeoutError) Timeout() bool { return true } -func (e *timeoutError) Temporary() bool { return true } +func (*timeoutError) Error() string { return "i/o timeout" } +func (*timeoutError) Timeout() bool { return true } +func (*timeoutError) Temporary() bool { return true } type timeoutChan chan struct{} var ioInitOnce sync.Once var ioCompletionPort syscall.Handle -// ioResult contains the result of an asynchronous IO operation +// ioResult contains the result of an asynchronous IO operation. type ioResult struct { bytes uint32 err error } -// ioOperation represents an outstanding asynchronous Win32 IO +// ioOperation represents an outstanding asynchronous Win32 IO. type ioOperation struct { o syscall.Overlapped ch chan ioResult } -func initIo() { +func initIO() { h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff) if err != nil { panic(err) @@ -94,15 +93,15 @@ type deadlineHandler struct { timedout atomicBool } -// makeWin32File makes a new win32File from an existing file handle +// makeWin32File makes a new win32File from an existing file handle. func makeWin32File(h syscall.Handle) (*win32File, error) { f := &win32File{handle: h} - ioInitOnce.Do(initIo) + ioInitOnce.Do(initIO) _, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff) if err != nil { return nil, err } - err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE) + err = setFileCompletionNotificationModes(h, windows.FILE_SKIP_COMPLETION_PORT_ON_SUCCESS|windows.FILE_SKIP_SET_EVENT_ON_HANDLE) if err != nil { return nil, err } @@ -121,14 +120,14 @@ func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) { return f, nil } -// closeHandle closes the resources associated with a Win32 handle +// closeHandle closes the resources associated with a Win32 handle. func (f *win32File) closeHandle() { f.wgLock.Lock() // Atomically set that we are closing, releasing the resources only once. if !f.closing.swap(true) { f.wgLock.Unlock() // cancel all IO and wait for it to complete - cancelIoEx(f.handle, nil) + _ = cancelIoEx(f.handle, nil) f.wg.Wait() // at this point, no new IO can start syscall.Close(f.handle) @@ -144,14 +143,14 @@ func (f *win32File) Close() error { return nil } -// IsClosed checks if the file has been closed +// IsClosed checks if the file has been closed. func (f *win32File) IsClosed() bool { return f.closing.isSet() } -// prepareIo prepares for a new IO operation. +// prepareIO prepares for a new IO operation. // The caller must call f.wg.Done() when the IO is finished, prior to Close() returning. -func (f *win32File) prepareIo() (*ioOperation, error) { +func (f *win32File) prepareIO() (*ioOperation, error) { f.wgLock.RLock() if f.closing.isSet() { f.wgLock.RUnlock() @@ -164,7 +163,7 @@ func (f *win32File) prepareIo() (*ioOperation, error) { return c, nil } -// ioCompletionProcessor processes completed async IOs forever +// ioCompletionProcessor processes completed async IOs forever. func ioCompletionProcessor(h syscall.Handle) { for { var bytes uint32 @@ -178,15 +177,17 @@ func ioCompletionProcessor(h syscall.Handle) { } } -// asyncIo processes the return value from ReadFile or WriteFile, blocking until +// todo: helsaawy - create an asyncIO version that takes a context + +// asyncIO processes the return value from ReadFile or WriteFile, blocking until // the operation has actually completed. -func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) { - if err != syscall.ERROR_IO_PENDING { +func (f *win32File) asyncIO(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) { + if err != syscall.ERROR_IO_PENDING { //nolint:errorlint // err is Errno return int(bytes), err } if f.closing.isSet() { - cancelIoEx(f.handle, &c.o) + _ = cancelIoEx(f.handle, &c.o) } var timeout timeoutChan @@ -200,7 +201,7 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er select { case r = <-c.ch: err = r.err - if err == syscall.ERROR_OPERATION_ABORTED { + if err == syscall.ERROR_OPERATION_ABORTED { //nolint:errorlint // err is Errno if f.closing.isSet() { err = ErrFileClosed } @@ -210,10 +211,10 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er err = wsaGetOverlappedResult(f.handle, &c.o, &bytes, false, &flags) } case <-timeout: - cancelIoEx(f.handle, &c.o) + _ = cancelIoEx(f.handle, &c.o) r = <-c.ch err = r.err - if err == syscall.ERROR_OPERATION_ABORTED { + if err == syscall.ERROR_OPERATION_ABORTED { //nolint:errorlint // err is Errno err = ErrTimeout } } @@ -221,13 +222,14 @@ func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, er // runtime.KeepAlive is needed, as c is passed via native // code to ioCompletionProcessor, c must remain alive // until the channel read is complete. + // todo: (de)allocate *ioOperation via win32 heap functions, instead of needing to KeepAlive? runtime.KeepAlive(c) return int(r.bytes), err } // Read reads from a file handle. func (f *win32File) Read(b []byte) (int, error) { - c, err := f.prepareIo() + c, err := f.prepareIO() if err != nil { return 0, err } @@ -239,13 +241,13 @@ func (f *win32File) Read(b []byte) (int, error) { var bytes uint32 err = syscall.ReadFile(f.handle, b, &bytes, &c.o) - n, err := f.asyncIo(c, &f.readDeadline, bytes, err) + n, err := f.asyncIO(c, &f.readDeadline, bytes, err) runtime.KeepAlive(b) // Handle EOF conditions. if err == nil && n == 0 && len(b) != 0 { return 0, io.EOF - } else if err == syscall.ERROR_BROKEN_PIPE { + } else if err == syscall.ERROR_BROKEN_PIPE { //nolint:errorlint // err is Errno return 0, io.EOF } else { return n, err @@ -254,7 +256,7 @@ func (f *win32File) Read(b []byte) (int, error) { // Write writes to a file handle. func (f *win32File) Write(b []byte) (int, error) { - c, err := f.prepareIo() + c, err := f.prepareIO() if err != nil { return 0, err } @@ -266,7 +268,7 @@ func (f *win32File) Write(b []byte) (int, error) { var bytes uint32 err = syscall.WriteFile(f.handle, b, &bytes, &c.o) - n, err := f.asyncIo(c, &f.writeDeadline, bytes, err) + n, err := f.asyncIO(c, &f.writeDeadline, bytes, err) runtime.KeepAlive(b) return n, err } diff --git a/vendor/github.com/Microsoft/go-winio/fileinfo.go b/vendor/github.com/Microsoft/go-winio/fileinfo.go index 3ab6bff69c..702950e72a 100644 --- a/vendor/github.com/Microsoft/go-winio/fileinfo.go +++ b/vendor/github.com/Microsoft/go-winio/fileinfo.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package winio @@ -14,13 +15,18 @@ import ( type FileBasicInfo struct { CreationTime, LastAccessTime, LastWriteTime, ChangeTime windows.Filetime FileAttributes uint32 - pad uint32 // padding + _ uint32 // padding } // GetFileBasicInfo retrieves times and attributes for a file. func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) { bi := &FileBasicInfo{} - if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), windows.FileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + if err := windows.GetFileInformationByHandleEx( + windows.Handle(f.Fd()), + windows.FileBasicInfo, + (*byte)(unsafe.Pointer(bi)), + uint32(unsafe.Sizeof(*bi)), + ); err != nil { return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} } runtime.KeepAlive(f) @@ -29,7 +35,12 @@ func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) { // SetFileBasicInfo sets times and attributes for a file. func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error { - if err := windows.SetFileInformationByHandle(windows.Handle(f.Fd()), windows.FileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil { + if err := windows.SetFileInformationByHandle( + windows.Handle(f.Fd()), + windows.FileBasicInfo, + (*byte)(unsafe.Pointer(bi)), + uint32(unsafe.Sizeof(*bi)), + ); err != nil { return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err} } runtime.KeepAlive(f) @@ -48,7 +59,10 @@ type FileStandardInfo struct { // GetFileStandardInfo retrieves ended information for the file. func GetFileStandardInfo(f *os.File) (*FileStandardInfo, error) { si := &FileStandardInfo{} - if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), windows.FileStandardInfo, (*byte)(unsafe.Pointer(si)), uint32(unsafe.Sizeof(*si))); err != nil { + if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), + windows.FileStandardInfo, + (*byte)(unsafe.Pointer(si)), + uint32(unsafe.Sizeof(*si))); err != nil { return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} } runtime.KeepAlive(f) @@ -65,7 +79,12 @@ type FileIDInfo struct { // GetFileID retrieves the unique (volume, file ID) pair for a file. func GetFileID(f *os.File) (*FileIDInfo, error) { fileID := &FileIDInfo{} - if err := windows.GetFileInformationByHandleEx(windows.Handle(f.Fd()), windows.FileIdInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil { + if err := windows.GetFileInformationByHandleEx( + windows.Handle(f.Fd()), + windows.FileIdInfo, + (*byte)(unsafe.Pointer(fileID)), + uint32(unsafe.Sizeof(*fileID)), + ); err != nil { return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err} } runtime.KeepAlive(f) diff --git a/vendor/github.com/Microsoft/go-winio/hvsock.go b/vendor/github.com/Microsoft/go-winio/hvsock.go index b2b644d002..52f1c280f6 100644 --- a/vendor/github.com/Microsoft/go-winio/hvsock.go +++ b/vendor/github.com/Microsoft/go-winio/hvsock.go @@ -4,6 +4,8 @@ package winio import ( + "context" + "errors" "fmt" "io" "net" @@ -12,16 +14,87 @@ import ( "time" "unsafe" + "golang.org/x/sys/windows" + + "github.com/Microsoft/go-winio/internal/socket" "github.com/Microsoft/go-winio/pkg/guid" ) -//sys bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) [failretval==socketError] = ws2_32.bind +const afHVSock = 34 // AF_HYPERV -const ( - afHvSock = 34 // AF_HYPERV +// Well known Service and VM IDs +//https://docs.microsoft.com/en-us/virtualization/hyper-v-on-windows/user-guide/make-integration-service#vmid-wildcards - socketError = ^uintptr(0) -) +// HvsockGUIDWildcard is the wildcard VmId for accepting connections from all partitions. +func HvsockGUIDWildcard() guid.GUID { // 00000000-0000-0000-0000-000000000000 + return guid.GUID{} +} + +// HvsockGUIDBroadcast is the wildcard VmId for broadcasting sends to all partitions. +func HvsockGUIDBroadcast() guid.GUID { //ffffffff-ffff-ffff-ffff-ffffffffffff + return guid.GUID{ + Data1: 0xffffffff, + Data2: 0xffff, + Data3: 0xffff, + Data4: [8]uint8{0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}, + } +} + +// HvsockGUIDLoopback is the Loopback VmId for accepting connections to the same partition as the connector. +func HvsockGUIDLoopback() guid.GUID { // e0e16197-dd56-4a10-9195-5ee7a155a838 + return guid.GUID{ + Data1: 0xe0e16197, + Data2: 0xdd56, + Data3: 0x4a10, + Data4: [8]uint8{0x91, 0x95, 0x5e, 0xe7, 0xa1, 0x55, 0xa8, 0x38}, + } +} + +// HvsockGUIDSiloHost is the address of a silo's host partition: +// - The silo host of a hosted silo is the utility VM. +// - The silo host of a silo on a physical host is the physical host. +func HvsockGUIDSiloHost() guid.GUID { // 36bd0c5c-7276-4223-88ba-7d03b654c568 + return guid.GUID{ + Data1: 0x36bd0c5c, + Data2: 0x7276, + Data3: 0x4223, + Data4: [8]byte{0x88, 0xba, 0x7d, 0x03, 0xb6, 0x54, 0xc5, 0x68}, + } +} + +// HvsockGUIDChildren is the wildcard VmId for accepting connections from the connector's child partitions. +func HvsockGUIDChildren() guid.GUID { // 90db8b89-0d35-4f79-8ce9-49ea0ac8b7cd + return guid.GUID{ + Data1: 0x90db8b89, + Data2: 0xd35, + Data3: 0x4f79, + Data4: [8]uint8{0x8c, 0xe9, 0x49, 0xea, 0xa, 0xc8, 0xb7, 0xcd}, + } +} + +// HvsockGUIDParent is the wildcard VmId for accepting connections from the connector's parent partition. +// Listening on this VmId accepts connection from: +// - Inside silos: silo host partition. +// - Inside hosted silo: host of the VM. +// - Inside VM: VM host. +// - Physical host: Not supported. +func HvsockGUIDParent() guid.GUID { // a42e7cda-d03f-480c-9cc2-a4de20abb878 + return guid.GUID{ + Data1: 0xa42e7cda, + Data2: 0xd03f, + Data3: 0x480c, + Data4: [8]uint8{0x9c, 0xc2, 0xa4, 0xde, 0x20, 0xab, 0xb8, 0x78}, + } +} + +// hvsockVsockServiceTemplate is the Service GUID used for the VSOCK protocol. +func hvsockVsockServiceTemplate() guid.GUID { // 00000000-facb-11e6-bd58-64006a7986d3 + return guid.GUID{ + Data2: 0xfacb, + Data3: 0x11e6, + Data4: [8]uint8{0xbd, 0x58, 0x64, 0x00, 0x6a, 0x79, 0x86, 0xd3}, + } +} // An HvsockAddr is an address for a AF_HYPERV socket. type HvsockAddr struct { @@ -36,8 +109,10 @@ type rawHvsockAddr struct { ServiceID guid.GUID } +var _ socket.RawSockaddr = &rawHvsockAddr{} + // Network returns the address's network name, "hvsock". -func (addr *HvsockAddr) Network() string { +func (*HvsockAddr) Network() string { return "hvsock" } @@ -47,14 +122,14 @@ func (addr *HvsockAddr) String() string { // VsockServiceID returns an hvsock service ID corresponding to the specified AF_VSOCK port. func VsockServiceID(port uint32) guid.GUID { - g, _ := guid.FromString("00000000-facb-11e6-bd58-64006a7986d3") + g := hvsockVsockServiceTemplate() // make a copy g.Data1 = port return g } func (addr *HvsockAddr) raw() rawHvsockAddr { return rawHvsockAddr{ - Family: afHvSock, + Family: afHVSock, VMID: addr.VMID, ServiceID: addr.ServiceID, } @@ -65,20 +140,48 @@ func (addr *HvsockAddr) fromRaw(raw *rawHvsockAddr) { addr.ServiceID = raw.ServiceID } +// Sockaddr returns a pointer to and the size of this struct. +// +// Implements the [socket.RawSockaddr] interface, and allows use in +// [socket.Bind] and [socket.ConnectEx]. +func (r *rawHvsockAddr) Sockaddr() (unsafe.Pointer, int32, error) { + return unsafe.Pointer(r), int32(unsafe.Sizeof(rawHvsockAddr{})), nil +} + +// Sockaddr interface allows use with `sockets.Bind()` and `.ConnectEx()`. +func (r *rawHvsockAddr) FromBytes(b []byte) error { + n := int(unsafe.Sizeof(rawHvsockAddr{})) + + if len(b) < n { + return fmt.Errorf("got %d, want %d: %w", len(b), n, socket.ErrBufferSize) + } + + copy(unsafe.Slice((*byte)(unsafe.Pointer(r)), n), b[:n]) + if r.Family != afHVSock { + return fmt.Errorf("got %d, want %d: %w", r.Family, afHVSock, socket.ErrAddrFamily) + } + + return nil +} + // HvsockListener is a socket listener for the AF_HYPERV address family. type HvsockListener struct { sock *win32File addr HvsockAddr } +var _ net.Listener = &HvsockListener{} + // HvsockConn is a connected socket of the AF_HYPERV address family. type HvsockConn struct { sock *win32File local, remote HvsockAddr } -func newHvSocket() (*win32File, error) { - fd, err := syscall.Socket(afHvSock, syscall.SOCK_STREAM, 1) +var _ net.Conn = &HvsockConn{} + +func newHVSocket() (*win32File, error) { + fd, err := syscall.Socket(afHVSock, syscall.SOCK_STREAM, 1) if err != nil { return nil, os.NewSyscallError("socket", err) } @@ -94,12 +197,12 @@ func newHvSocket() (*win32File, error) { // ListenHvsock listens for connections on the specified hvsock address. func ListenHvsock(addr *HvsockAddr) (_ *HvsockListener, err error) { l := &HvsockListener{addr: *addr} - sock, err := newHvSocket() + sock, err := newHVSocket() if err != nil { return nil, l.opErr("listen", err) } sa := addr.raw() - err = bind(sock.handle, unsafe.Pointer(&sa), int32(unsafe.Sizeof(sa))) + err = socket.Bind(windows.Handle(sock.handle), &sa) if err != nil { return nil, l.opErr("listen", os.NewSyscallError("socket", err)) } @@ -121,7 +224,7 @@ func (l *HvsockListener) Addr() net.Addr { // Accept waits for the next connection and returns it. func (l *HvsockListener) Accept() (_ net.Conn, err error) { - sock, err := newHvSocket() + sock, err := newHVSocket() if err != nil { return nil, l.opErr("accept", err) } @@ -130,27 +233,42 @@ func (l *HvsockListener) Accept() (_ net.Conn, err error) { sock.Close() } }() - c, err := l.sock.prepareIo() + c, err := l.sock.prepareIO() if err != nil { return nil, l.opErr("accept", err) } defer l.sock.wg.Done() // AcceptEx, per documentation, requires an extra 16 bytes per address. + // + // https://docs.microsoft.com/en-us/windows/win32/api/mswsock/nf-mswsock-acceptex const addrlen = uint32(16 + unsafe.Sizeof(rawHvsockAddr{})) var addrbuf [addrlen * 2]byte var bytes uint32 - err = syscall.AcceptEx(l.sock.handle, sock.handle, &addrbuf[0], 0, addrlen, addrlen, &bytes, &c.o) - _, err = l.sock.asyncIo(c, nil, bytes, err) - if err != nil { + err = syscall.AcceptEx(l.sock.handle, sock.handle, &addrbuf[0], 0 /*rxdatalen*/, addrlen, addrlen, &bytes, &c.o) + if _, err = l.sock.asyncIO(c, nil, bytes, err); err != nil { return nil, l.opErr("accept", os.NewSyscallError("acceptex", err)) } + conn := &HvsockConn{ sock: sock, } + // The local address returned in the AcceptEx buffer is the same as the Listener socket's + // address. However, the service GUID reported by GetSockName is different from the Listeners + // socket, and is sometimes the same as the local address of the socket that dialed the + // address, with the service GUID.Data1 incremented, but othertimes is different. + // todo: does the local address matter? is the listener's address or the actual address appropriate? conn.local.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[0]))) conn.remote.fromRaw((*rawHvsockAddr)(unsafe.Pointer(&addrbuf[addrlen]))) + + // initialize the accepted socket and update its properties with those of the listening socket + if err = windows.Setsockopt(windows.Handle(sock.handle), + windows.SOL_SOCKET, windows.SO_UPDATE_ACCEPT_CONTEXT, + (*byte)(unsafe.Pointer(&l.sock.handle)), int32(unsafe.Sizeof(l.sock.handle))); err != nil { + return nil, conn.opErr("accept", os.NewSyscallError("setsockopt", err)) + } + sock = nil return conn, nil } @@ -160,43 +278,171 @@ func (l *HvsockListener) Close() error { return l.sock.Close() } -/* Need to finish ConnectEx handling -func DialHvsock(ctx context.Context, addr *HvsockAddr) (*HvsockConn, error) { - sock, err := newHvSocket() +// HvsockDialer configures and dials a Hyper-V Socket (ie, [HvsockConn]). +type HvsockDialer struct { + // Deadline is the time the Dial operation must connect before erroring. + Deadline time.Time + + // Retries is the number of additional connects to try if the connection times out, is refused, + // or the host is unreachable + Retries uint + + // RetryWait is the time to wait after a connection error to retry + RetryWait time.Duration + + rt *time.Timer // redial wait timer +} + +// Dial the Hyper-V socket at addr. +// +// See [HvsockDialer.Dial] for more information. +func Dial(ctx context.Context, addr *HvsockAddr) (conn *HvsockConn, err error) { + return (&HvsockDialer{}).Dial(ctx, addr) +} + +// Dial attempts to connect to the Hyper-V socket at addr, and returns a connection if successful. +// Will attempt (HvsockDialer).Retries if dialing fails, waiting (HvsockDialer).RetryWait between +// retries. +// +// Dialing can be cancelled either by providing (HvsockDialer).Deadline, or cancelling ctx. +func (d *HvsockDialer) Dial(ctx context.Context, addr *HvsockAddr) (conn *HvsockConn, err error) { + op := "dial" + // create the conn early to use opErr() + conn = &HvsockConn{ + remote: *addr, + } + + if !d.Deadline.IsZero() { + var cancel context.CancelFunc + ctx, cancel = context.WithDeadline(ctx, d.Deadline) + defer cancel() + } + + // preemptive timeout/cancellation check + if err = ctx.Err(); err != nil { + return nil, conn.opErr(op, err) + } + + sock, err := newHVSocket() if err != nil { - return nil, err + return nil, conn.opErr(op, err) } defer func() { if sock != nil { sock.Close() } }() - c, err := sock.prepareIo() + + sa := addr.raw() + err = socket.Bind(windows.Handle(sock.handle), &sa) if err != nil { - return nil, err + return nil, conn.opErr(op, os.NewSyscallError("bind", err)) + } + + c, err := sock.prepareIO() + if err != nil { + return nil, conn.opErr(op, err) } defer sock.wg.Done() var bytes uint32 - err = windows.ConnectEx(windows.Handle(sock.handle), sa, nil, 0, &bytes, &c.o) - _, err = sock.asyncIo(ctx, c, nil, bytes, err) + for i := uint(0); i <= d.Retries; i++ { + err = socket.ConnectEx( + windows.Handle(sock.handle), + &sa, + nil, // sendBuf + 0, // sendDataLen + &bytes, + (*windows.Overlapped)(unsafe.Pointer(&c.o))) + _, err = sock.asyncIO(c, nil, bytes, err) + if i < d.Retries && canRedial(err) { + if err = d.redialWait(ctx); err == nil { + continue + } + } + break + } if err != nil { - return nil, err + return nil, conn.opErr(op, os.NewSyscallError("connectex", err)) } - conn := &HvsockConn{ - sock: sock, - remote: *addr, + + // update the connection properties, so shutdown can be used + if err = windows.Setsockopt( + windows.Handle(sock.handle), + windows.SOL_SOCKET, + windows.SO_UPDATE_CONNECT_CONTEXT, + nil, // optvalue + 0, // optlen + ); err != nil { + return nil, conn.opErr(op, os.NewSyscallError("setsockopt", err)) + } + + // get the local name + var sal rawHvsockAddr + err = socket.GetSockName(windows.Handle(sock.handle), &sal) + if err != nil { + return nil, conn.opErr(op, os.NewSyscallError("getsockname", err)) + } + conn.local.fromRaw(&sal) + + // one last check for timeout, since asyncIO doesn't check the context + if err = ctx.Err(); err != nil { + return nil, conn.opErr(op, err) } + + conn.sock = sock sock = nil + return conn, nil } -*/ + +// redialWait waits before attempting to redial, resetting the timer as appropriate. +func (d *HvsockDialer) redialWait(ctx context.Context) (err error) { + if d.RetryWait == 0 { + return nil + } + + if d.rt == nil { + d.rt = time.NewTimer(d.RetryWait) + } else { + // should already be stopped and drained + d.rt.Reset(d.RetryWait) + } + + select { + case <-ctx.Done(): + case <-d.rt.C: + return nil + } + + // stop and drain the timer + if !d.rt.Stop() { + <-d.rt.C + } + return ctx.Err() +} + +// assumes error is a plain, unwrapped syscall.Errno provided by direct syscall. +func canRedial(err error) bool { + //nolint:errorlint // guaranteed to be an Errno + switch err { + case windows.WSAECONNREFUSED, windows.WSAENETUNREACH, windows.WSAETIMEDOUT, + windows.ERROR_CONNECTION_REFUSED, windows.ERROR_CONNECTION_UNAVAIL: + return true + default: + return false + } +} func (conn *HvsockConn) opErr(op string, err error) error { + // translate from "file closed" to "socket closed" + if errors.Is(err, ErrFileClosed) { + err = socket.ErrSocketClosed + } return &net.OpError{Op: op, Net: "hvsock", Source: &conn.local, Addr: &conn.remote, Err: err} } func (conn *HvsockConn) Read(b []byte) (int, error) { - c, err := conn.sock.prepareIo() + c, err := conn.sock.prepareIO() if err != nil { return 0, conn.opErr("read", err) } @@ -204,10 +450,11 @@ func (conn *HvsockConn) Read(b []byte) (int, error) { buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))} var flags, bytes uint32 err = syscall.WSARecv(conn.sock.handle, &buf, 1, &bytes, &flags, &c.o, nil) - n, err := conn.sock.asyncIo(c, &conn.sock.readDeadline, bytes, err) + n, err := conn.sock.asyncIO(c, &conn.sock.readDeadline, bytes, err) if err != nil { - if _, ok := err.(syscall.Errno); ok { - err = os.NewSyscallError("wsarecv", err) + var eno windows.Errno + if errors.As(err, &eno) { + err = os.NewSyscallError("wsarecv", eno) } return 0, conn.opErr("read", err) } else if n == 0 { @@ -230,7 +477,7 @@ func (conn *HvsockConn) Write(b []byte) (int, error) { } func (conn *HvsockConn) write(b []byte) (int, error) { - c, err := conn.sock.prepareIo() + c, err := conn.sock.prepareIO() if err != nil { return 0, conn.opErr("write", err) } @@ -238,10 +485,11 @@ func (conn *HvsockConn) write(b []byte) (int, error) { buf := syscall.WSABuf{Buf: &b[0], Len: uint32(len(b))} var bytes uint32 err = syscall.WSASend(conn.sock.handle, &buf, 1, &bytes, 0, &c.o, nil) - n, err := conn.sock.asyncIo(c, &conn.sock.writeDeadline, bytes, err) + n, err := conn.sock.asyncIO(c, &conn.sock.writeDeadline, bytes, err) if err != nil { - if _, ok := err.(syscall.Errno); ok { - err = os.NewSyscallError("wsasend", err) + var eno windows.Errno + if errors.As(err, &eno) { + err = os.NewSyscallError("wsasend", eno) } return 0, conn.opErr("write", err) } @@ -257,13 +505,19 @@ func (conn *HvsockConn) IsClosed() bool { return conn.sock.IsClosed() } +// shutdown disables sending or receiving on a socket. func (conn *HvsockConn) shutdown(how int) error { if conn.IsClosed() { - return ErrFileClosed + return socket.ErrSocketClosed } err := syscall.Shutdown(conn.sock.handle, how) if err != nil { + // If the connection was closed, shutdowns fail with "not connected" + if errors.Is(err, windows.WSAENOTCONN) || + errors.Is(err, windows.WSAESHUTDOWN) { + err = socket.ErrSocketClosed + } return os.NewSyscallError("shutdown", err) } return nil @@ -273,7 +527,7 @@ func (conn *HvsockConn) shutdown(how int) error { func (conn *HvsockConn) CloseRead() error { err := conn.shutdown(syscall.SHUT_RD) if err != nil { - return conn.opErr("close", err) + return conn.opErr("closeread", err) } return nil } @@ -283,7 +537,7 @@ func (conn *HvsockConn) CloseRead() error { func (conn *HvsockConn) CloseWrite() error { err := conn.shutdown(syscall.SHUT_WR) if err != nil { - return conn.opErr("close", err) + return conn.opErr("closewrite", err) } return nil } @@ -300,8 +554,13 @@ func (conn *HvsockConn) RemoteAddr() net.Addr { // SetDeadline implements the net.Conn SetDeadline method. func (conn *HvsockConn) SetDeadline(t time.Time) error { - conn.SetReadDeadline(t) - conn.SetWriteDeadline(t) + // todo: implement `SetDeadline` for `win32File` + if err := conn.SetReadDeadline(t); err != nil { + return fmt.Errorf("set read deadline: %w", err) + } + if err := conn.SetWriteDeadline(t); err != nil { + return fmt.Errorf("set write deadline: %w", err) + } return nil } diff --git a/vendor/github.com/Microsoft/go-winio/internal/socket/rawaddr.go b/vendor/github.com/Microsoft/go-winio/internal/socket/rawaddr.go new file mode 100644 index 0000000000..7e82f9afa9 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/socket/rawaddr.go @@ -0,0 +1,20 @@ +package socket + +import ( + "unsafe" +) + +// RawSockaddr allows structs to be used with [Bind] and [ConnectEx]. The +// struct must meet the Win32 sockaddr requirements specified here: +// https://docs.microsoft.com/en-us/windows/win32/winsock/sockaddr-2 +// +// Specifically, the struct size must be least larger than an int16 (unsigned short) +// for the address family. +type RawSockaddr interface { + // Sockaddr returns a pointer to the RawSockaddr and its struct size, allowing + // for the RawSockaddr's data to be overwritten by syscalls (if necessary). + // + // It is the callers responsibility to validate that the values are valid; invalid + // pointers or size can cause a panic. + Sockaddr() (unsafe.Pointer, int32, error) +} diff --git a/vendor/github.com/Microsoft/go-winio/internal/socket/socket.go b/vendor/github.com/Microsoft/go-winio/internal/socket/socket.go new file mode 100644 index 0000000000..39e8c05f8f --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/socket/socket.go @@ -0,0 +1,179 @@ +//go:build windows + +package socket + +import ( + "errors" + "fmt" + "net" + "sync" + "syscall" + "unsafe" + + "github.com/Microsoft/go-winio/pkg/guid" + "golang.org/x/sys/windows" +) + +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go socket.go + +//sys getsockname(s windows.Handle, name unsafe.Pointer, namelen *int32) (err error) [failretval==socketError] = ws2_32.getsockname +//sys getpeername(s windows.Handle, name unsafe.Pointer, namelen *int32) (err error) [failretval==socketError] = ws2_32.getpeername +//sys bind(s windows.Handle, name unsafe.Pointer, namelen int32) (err error) [failretval==socketError] = ws2_32.bind + +const socketError = uintptr(^uint32(0)) + +var ( + // todo(helsaawy): create custom error types to store the desired vs actual size and addr family? + + ErrBufferSize = errors.New("buffer size") + ErrAddrFamily = errors.New("address family") + ErrInvalidPointer = errors.New("invalid pointer") + ErrSocketClosed = fmt.Errorf("socket closed: %w", net.ErrClosed) +) + +// todo(helsaawy): replace these with generics, ie: GetSockName[S RawSockaddr](s windows.Handle) (S, error) + +// GetSockName writes the local address of socket s to the [RawSockaddr] rsa. +// If rsa is not large enough, the [windows.WSAEFAULT] is returned. +func GetSockName(s windows.Handle, rsa RawSockaddr) error { + ptr, l, err := rsa.Sockaddr() + if err != nil { + return fmt.Errorf("could not retrieve socket pointer and size: %w", err) + } + + // although getsockname returns WSAEFAULT if the buffer is too small, it does not set + // &l to the correct size, so--apart from doubling the buffer repeatedly--there is no remedy + return getsockname(s, ptr, &l) +} + +// GetPeerName returns the remote address the socket is connected to. +// +// See [GetSockName] for more information. +func GetPeerName(s windows.Handle, rsa RawSockaddr) error { + ptr, l, err := rsa.Sockaddr() + if err != nil { + return fmt.Errorf("could not retrieve socket pointer and size: %w", err) + } + + return getpeername(s, ptr, &l) +} + +func Bind(s windows.Handle, rsa RawSockaddr) (err error) { + ptr, l, err := rsa.Sockaddr() + if err != nil { + return fmt.Errorf("could not retrieve socket pointer and size: %w", err) + } + + return bind(s, ptr, l) +} + +// "golang.org/x/sys/windows".ConnectEx and .Bind only accept internal implementations of the +// their sockaddr interface, so they cannot be used with HvsockAddr +// Replicate functionality here from +// https://cs.opensource.google/go/x/sys/+/master:windows/syscall_windows.go + +// The function pointers to `AcceptEx`, `ConnectEx` and `GetAcceptExSockaddrs` must be loaded at +// runtime via a WSAIoctl call: +// https://docs.microsoft.com/en-us/windows/win32/api/Mswsock/nc-mswsock-lpfn_connectex#remarks + +type runtimeFunc struct { + id guid.GUID + once sync.Once + addr uintptr + err error +} + +func (f *runtimeFunc) Load() error { + f.once.Do(func() { + var s windows.Handle + s, f.err = windows.Socket(windows.AF_INET, windows.SOCK_STREAM, windows.IPPROTO_TCP) + if f.err != nil { + return + } + defer windows.CloseHandle(s) //nolint:errcheck + + var n uint32 + f.err = windows.WSAIoctl(s, + windows.SIO_GET_EXTENSION_FUNCTION_POINTER, + (*byte)(unsafe.Pointer(&f.id)), + uint32(unsafe.Sizeof(f.id)), + (*byte)(unsafe.Pointer(&f.addr)), + uint32(unsafe.Sizeof(f.addr)), + &n, + nil, //overlapped + 0, //completionRoutine + ) + }) + return f.err +} + +var ( + // todo: add `AcceptEx` and `GetAcceptExSockaddrs` + WSAID_CONNECTEX = guid.GUID{ //revive:disable-line:var-naming ALL_CAPS + Data1: 0x25a207b9, + Data2: 0xddf3, + Data3: 0x4660, + Data4: [8]byte{0x8e, 0xe9, 0x76, 0xe5, 0x8c, 0x74, 0x06, 0x3e}, + } + + connectExFunc = runtimeFunc{id: WSAID_CONNECTEX} +) + +func ConnectEx( + fd windows.Handle, + rsa RawSockaddr, + sendBuf *byte, + sendDataLen uint32, + bytesSent *uint32, + overlapped *windows.Overlapped, +) error { + if err := connectExFunc.Load(); err != nil { + return fmt.Errorf("failed to load ConnectEx function pointer: %w", err) + } + ptr, n, err := rsa.Sockaddr() + if err != nil { + return err + } + return connectEx(fd, ptr, n, sendBuf, sendDataLen, bytesSent, overlapped) +} + +// BOOL LpfnConnectex( +// [in] SOCKET s, +// [in] const sockaddr *name, +// [in] int namelen, +// [in, optional] PVOID lpSendBuffer, +// [in] DWORD dwSendDataLength, +// [out] LPDWORD lpdwBytesSent, +// [in] LPOVERLAPPED lpOverlapped +// ) + +func connectEx( + s windows.Handle, + name unsafe.Pointer, + namelen int32, + sendBuf *byte, + sendDataLen uint32, + bytesSent *uint32, + overlapped *windows.Overlapped, +) (err error) { + // todo: after upgrading to 1.18, switch from syscall.Syscall9 to syscall.SyscallN + r1, _, e1 := syscall.Syscall9(connectExFunc.addr, + 7, + uintptr(s), + uintptr(name), + uintptr(namelen), + uintptr(unsafe.Pointer(sendBuf)), + uintptr(sendDataLen), + uintptr(unsafe.Pointer(bytesSent)), + uintptr(unsafe.Pointer(overlapped)), + 0, + 0) + if r1 == 0 { + if e1 != 0 { + err = error(e1) + } else { + err = syscall.EINVAL + } + } + return err +} diff --git a/vendor/github.com/Microsoft/go-winio/internal/socket/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/internal/socket/zsyscall_windows.go new file mode 100644 index 0000000000..6d2e1a9e44 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/internal/socket/zsyscall_windows.go @@ -0,0 +1,72 @@ +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. + +package socket + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return errERROR_EINVAL + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modws2_32 = windows.NewLazySystemDLL("ws2_32.dll") + + procbind = modws2_32.NewProc("bind") + procgetpeername = modws2_32.NewProc("getpeername") + procgetsockname = modws2_32.NewProc("getsockname") +) + +func bind(s windows.Handle, name unsafe.Pointer, namelen int32) (err error) { + r1, _, e1 := syscall.Syscall(procbind.Addr(), 3, uintptr(s), uintptr(name), uintptr(namelen)) + if r1 == socketError { + err = errnoErr(e1) + } + return +} + +func getpeername(s windows.Handle, name unsafe.Pointer, namelen *int32) (err error) { + r1, _, e1 := syscall.Syscall(procgetpeername.Addr(), 3, uintptr(s), uintptr(name), uintptr(unsafe.Pointer(namelen))) + if r1 == socketError { + err = errnoErr(e1) + } + return +} + +func getsockname(s windows.Handle, name unsafe.Pointer, namelen *int32) (err error) { + r1, _, e1 := syscall.Syscall(procgetsockname.Addr(), 3, uintptr(s), uintptr(name), uintptr(unsafe.Pointer(namelen))) + if r1 == socketError { + err = errnoErr(e1) + } + return +} diff --git a/vendor/github.com/Microsoft/go-winio/pipe.go b/vendor/github.com/Microsoft/go-winio/pipe.go index 96700a73de..ca6e38fc00 100644 --- a/vendor/github.com/Microsoft/go-winio/pipe.go +++ b/vendor/github.com/Microsoft/go-winio/pipe.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package winio @@ -13,6 +14,8 @@ import ( "syscall" "time" "unsafe" + + "golang.org/x/sys/windows" ) //sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe @@ -21,10 +24,10 @@ import ( //sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo //sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW //sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc -//sys ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) = ntdll.NtCreateNamedPipeFile -//sys rtlNtStatusToDosError(status ntstatus) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb -//sys rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) = ntdll.RtlDosPathNameToNtPathName_U -//sys rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) = ntdll.RtlDefaultNpAcl +//sys ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntStatus) = ntdll.NtCreateNamedPipeFile +//sys rtlNtStatusToDosError(status ntStatus) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb +//sys rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntStatus) = ntdll.RtlDosPathNameToNtPathName_U +//sys rtlDefaultNpAcl(dacl *uintptr) (status ntStatus) = ntdll.RtlDefaultNpAcl type ioStatusBlock struct { Status, Information uintptr @@ -51,45 +54,22 @@ type securityDescriptor struct { Control uint16 Owner uintptr Group uintptr - Sacl uintptr - Dacl uintptr + Sacl uintptr //revive:disable-line:var-naming SACL, not Sacl + Dacl uintptr //revive:disable-line:var-naming DACL, not Dacl } -type ntstatus int32 +type ntStatus int32 -func (status ntstatus) Err() error { +func (status ntStatus) Err() error { if status >= 0 { return nil } return rtlNtStatusToDosError(status) } -const ( - cERROR_PIPE_BUSY = syscall.Errno(231) - cERROR_NO_DATA = syscall.Errno(232) - cERROR_PIPE_CONNECTED = syscall.Errno(535) - cERROR_SEM_TIMEOUT = syscall.Errno(121) - - cSECURITY_SQOS_PRESENT = 0x100000 - cSECURITY_ANONYMOUS = 0 - - cPIPE_TYPE_MESSAGE = 4 - - cPIPE_READMODE_MESSAGE = 2 - - cFILE_OPEN = 1 - cFILE_CREATE = 2 - - cFILE_PIPE_MESSAGE_TYPE = 1 - cFILE_PIPE_REJECT_REMOTE_CLIENTS = 2 - - cSE_DACL_PRESENT = 4 -) - var ( // ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed. - // This error should match net.errClosing since docker takes a dependency on its text. - ErrPipeListenerClosed = errors.New("use of closed network connection") + ErrPipeListenerClosed = net.ErrClosed errPipeWriteClosed = errors.New("pipe has been closed for write") ) @@ -116,9 +96,10 @@ func (f *win32Pipe) RemoteAddr() net.Addr { } func (f *win32Pipe) SetDeadline(t time.Time) error { - f.SetReadDeadline(t) - f.SetWriteDeadline(t) - return nil + if err := f.SetReadDeadline(t); err != nil { + return err + } + return f.SetWriteDeadline(t) } // CloseWrite closes the write side of a message pipe in byte mode. @@ -157,14 +138,14 @@ func (f *win32MessageBytePipe) Read(b []byte) (int, error) { return 0, io.EOF } n, err := f.win32File.Read(b) - if err == io.EOF { + if err == io.EOF { //nolint:errorlint // If this was the result of a zero-byte read, then // it is possible that the read was due to a zero-size // message. Since we are simulating CloseWrite with a // zero-byte message, ensure that all future Read() calls // also return EOF. f.readEOF = true - } else if err == syscall.ERROR_MORE_DATA { + } else if err == syscall.ERROR_MORE_DATA { //nolint:errorlint // err is Errno // ERROR_MORE_DATA indicates that the pipe's read mode is message mode // and the message still has more bytes. Treat this as a success, since // this package presents all named pipes as byte streams. @@ -173,7 +154,7 @@ func (f *win32MessageBytePipe) Read(b []byte) (int, error) { return n, err } -func (s pipeAddress) Network() string { +func (pipeAddress) Network() string { return "pipe" } @@ -184,16 +165,21 @@ func (s pipeAddress) String() string { // tryDialPipe attempts to dial the pipe at `path` until `ctx` cancellation or timeout. func tryDialPipe(ctx context.Context, path *string, access uint32) (syscall.Handle, error) { for { - select { case <-ctx.Done(): return syscall.Handle(0), ctx.Err() default: - h, err := createFile(*path, access, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) + h, err := createFile(*path, + access, + 0, + nil, + syscall.OPEN_EXISTING, + windows.FILE_FLAG_OVERLAPPED|windows.SECURITY_SQOS_PRESENT|windows.SECURITY_ANONYMOUS, + 0) if err == nil { return h, nil } - if err != cERROR_PIPE_BUSY { + if err != windows.ERROR_PIPE_BUSY { //nolint:errorlint // err is Errno return h, &os.PathError{Err: err, Op: "open", Path: *path} } // Wait 10 msec and try again. This is a rather simplistic @@ -213,9 +199,10 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) { } else { absTimeout = time.Now().Add(2 * time.Second) } - ctx, _ := context.WithDeadline(context.Background(), absTimeout) + ctx, cancel := context.WithDeadline(context.Background(), absTimeout) + defer cancel() conn, err := DialPipeContext(ctx, path) - if err == context.DeadlineExceeded { + if errors.Is(err, context.DeadlineExceeded) { return nil, ErrTimeout } return conn, err @@ -251,7 +238,7 @@ func DialPipeAccess(ctx context.Context, path string, access uint32) (net.Conn, // If the pipe is in message mode, return a message byte pipe, which // supports CloseWrite(). - if flags&cPIPE_TYPE_MESSAGE != 0 { + if flags&windows.PIPE_TYPE_MESSAGE != 0 { return &win32MessageBytePipe{ win32Pipe: win32Pipe{win32File: f, path: path}, }, nil @@ -283,7 +270,11 @@ func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (sy oa.Length = unsafe.Sizeof(oa) var ntPath unicodeString - if err := rtlDosPathNameToNtPathName(&path16[0], &ntPath, 0, 0).Err(); err != nil { + if err := rtlDosPathNameToNtPathName(&path16[0], + &ntPath, + 0, + 0, + ).Err(); err != nil { return 0, &os.PathError{Op: "open", Path: path, Err: err} } defer localFree(ntPath.Buffer) @@ -292,8 +283,8 @@ func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (sy // The security descriptor is only needed for the first pipe. if first { if sd != nil { - len := uint32(len(sd)) - sdb := localAlloc(0, len) + l := uint32(len(sd)) + sdb := localAlloc(0, l) defer localFree(sdb) copy((*[0xffff]byte)(unsafe.Pointer(sdb))[:], sd) oa.SecurityDescriptor = (*securityDescriptor)(unsafe.Pointer(sdb)) @@ -301,28 +292,28 @@ func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (sy // Construct the default named pipe security descriptor. var dacl uintptr if err := rtlDefaultNpAcl(&dacl).Err(); err != nil { - return 0, fmt.Errorf("getting default named pipe ACL: %s", err) + return 0, fmt.Errorf("getting default named pipe ACL: %w", err) } defer localFree(dacl) sdb := &securityDescriptor{ Revision: 1, - Control: cSE_DACL_PRESENT, + Control: windows.SE_DACL_PRESENT, Dacl: dacl, } oa.SecurityDescriptor = sdb } } - typ := uint32(cFILE_PIPE_REJECT_REMOTE_CLIENTS) + typ := uint32(windows.FILE_PIPE_REJECT_REMOTE_CLIENTS) if c.MessageMode { - typ |= cFILE_PIPE_MESSAGE_TYPE + typ |= windows.FILE_PIPE_MESSAGE_TYPE } - disposition := uint32(cFILE_OPEN) + disposition := uint32(windows.FILE_OPEN) access := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | syscall.SYNCHRONIZE) if first { - disposition = cFILE_CREATE + disposition = windows.FILE_CREATE // By not asking for read or write access, the named pipe file system // will put this pipe into an initially disconnected state, blocking // client connections until the next call with first == false. @@ -335,7 +326,20 @@ func makeServerPipeHandle(path string, sd []byte, c *PipeConfig, first bool) (sy h syscall.Handle iosb ioStatusBlock ) - err = ntCreateNamedPipeFile(&h, access, &oa, &iosb, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE, disposition, 0, typ, 0, 0, 0xffffffff, uint32(c.InputBufferSize), uint32(c.OutputBufferSize), &timeout).Err() + err = ntCreateNamedPipeFile(&h, + access, + &oa, + &iosb, + syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE, + disposition, + 0, + typ, + 0, + 0, + 0xffffffff, + uint32(c.InputBufferSize), + uint32(c.OutputBufferSize), + &timeout).Err() if err != nil { return 0, &os.PathError{Op: "open", Path: path, Err: err} } @@ -380,7 +384,7 @@ func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) { p.Close() p = nil err = <-ch - if err == nil || err == ErrFileClosed { + if err == nil || err == ErrFileClosed { //nolint:errorlint // err is Errno err = ErrPipeListenerClosed } } @@ -402,12 +406,12 @@ func (l *win32PipeListener) listenerRoutine() { p, err = l.makeConnectedServerPipe() // If the connection was immediately closed by the client, try // again. - if err != cERROR_NO_DATA { + if err != windows.ERROR_NO_DATA { //nolint:errorlint // err is Errno break } } responseCh <- acceptResponse{p, err} - closed = err == ErrPipeListenerClosed + closed = err == ErrPipeListenerClosed //nolint:errorlint // err is Errno } } syscall.Close(l.firstHandle) @@ -469,15 +473,15 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) { } func connectPipe(p *win32File) error { - c, err := p.prepareIo() + c, err := p.prepareIO() if err != nil { return err } defer p.wg.Done() err = connectNamedPipe(p.handle, &c.o) - _, err = p.asyncIo(c, nil, 0, err) - if err != nil && err != cERROR_PIPE_CONNECTED { + _, err = p.asyncIO(c, nil, 0, err) + if err != nil && err != windows.ERROR_PIPE_CONNECTED { //nolint:errorlint // err is Errno return err } return nil diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/doc.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/doc.go new file mode 100644 index 0000000000..888def7766 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/doc.go @@ -0,0 +1,8 @@ +// Package etw provides support for TraceLogging-based ETW (Event Tracing +// for Windows). TraceLogging is a format of ETW events that are self-describing +// (the event contains information on its own schema). This allows them to be +// decoded without needing a separate manifest with event information. The +// implementation here is based on the information found in +// TraceLoggingProvider.h in the Windows SDK, which implements TraceLogging as a +// set of C macros. +package etw diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdata.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdata.go index abf16803ee..a635475494 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdata.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdata.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package etw @@ -14,60 +15,60 @@ type eventData struct { buffer bytes.Buffer } -// bytes returns the raw binary data containing the event data. The returned +// toBytes returns the raw binary data containing the event data. The returned // value is not copied from the internal buffer, so it can be mutated by the // eventData object after it is returned. -func (ed *eventData) bytes() []byte { +func (ed *eventData) toBytes() []byte { return ed.buffer.Bytes() } // writeString appends a string, including the null terminator, to the buffer. func (ed *eventData) writeString(data string) { - ed.buffer.WriteString(data) - ed.buffer.WriteByte(0) + _, _ = ed.buffer.WriteString(data) + _ = ed.buffer.WriteByte(0) } // writeInt8 appends a int8 to the buffer. func (ed *eventData) writeInt8(value int8) { - ed.buffer.WriteByte(uint8(value)) + _ = ed.buffer.WriteByte(uint8(value)) } // writeInt16 appends a int16 to the buffer. func (ed *eventData) writeInt16(value int16) { - binary.Write(&ed.buffer, binary.LittleEndian, value) + _ = binary.Write(&ed.buffer, binary.LittleEndian, value) } // writeInt32 appends a int32 to the buffer. func (ed *eventData) writeInt32(value int32) { - binary.Write(&ed.buffer, binary.LittleEndian, value) + _ = binary.Write(&ed.buffer, binary.LittleEndian, value) } // writeInt64 appends a int64 to the buffer. func (ed *eventData) writeInt64(value int64) { - binary.Write(&ed.buffer, binary.LittleEndian, value) + _ = binary.Write(&ed.buffer, binary.LittleEndian, value) } // writeUint8 appends a uint8 to the buffer. func (ed *eventData) writeUint8(value uint8) { - ed.buffer.WriteByte(value) + _ = ed.buffer.WriteByte(value) } // writeUint16 appends a uint16 to the buffer. func (ed *eventData) writeUint16(value uint16) { - binary.Write(&ed.buffer, binary.LittleEndian, value) + _ = binary.Write(&ed.buffer, binary.LittleEndian, value) } // writeUint32 appends a uint32 to the buffer. func (ed *eventData) writeUint32(value uint32) { - binary.Write(&ed.buffer, binary.LittleEndian, value) + _ = binary.Write(&ed.buffer, binary.LittleEndian, value) } // writeUint64 appends a uint64 to the buffer. func (ed *eventData) writeUint64(value uint64) { - binary.Write(&ed.buffer, binary.LittleEndian, value) + _ = binary.Write(&ed.buffer, binary.LittleEndian, value) } // writeFiletime appends a FILETIME to the buffer. func (ed *eventData) writeFiletime(value syscall.Filetime) { - binary.Write(&ed.buffer, binary.LittleEndian, value) + _ = binary.Write(&ed.buffer, binary.LittleEndian, value) } diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdatadescriptor.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdatadescriptor.go index 8b0ad48162..9cbef49006 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdatadescriptor.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdatadescriptor.go @@ -1,3 +1,5 @@ +//go:build windows + package etw import ( @@ -13,11 +15,11 @@ const ( ) type eventDataDescriptor struct { - ptr ptr64 - size uint32 - dataType eventDataDescriptorType - reserved1 uint8 - reserved2 uint16 + ptr ptr64 + size uint32 + dataType eventDataDescriptorType + _ uint8 + _ uint16 } func newEventDataDescriptor(dataType eventDataDescriptorType, buffer []byte) eventDataDescriptor { diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdescriptor.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdescriptor.go index cc41f15999..0dd11b458d 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdescriptor.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventdescriptor.go @@ -1,3 +1,5 @@ +//go:build windows + package etw // Channel represents the ETW logging channel that is used. It can be used by @@ -45,6 +47,8 @@ const ( ) // EventDescriptor represents various metadata for an ETW event. +// +//nolint:structcheck // task is currently unused type eventDescriptor struct { id uint16 version uint8 @@ -70,6 +74,8 @@ func newEventDescriptor() *eventDescriptor { // should uniquely identify the other event metadata (contained in // EventDescriptor, and field metadata). Only the lower 24 bits of this value // are relevant. +// +//nolint:unused // keep for future use func (ed *eventDescriptor) identity() uint32 { return (uint32(ed.version) << 16) | uint32(ed.id) } @@ -78,6 +84,8 @@ func (ed *eventDescriptor) identity() uint32 { // should uniquely identify the other event metadata (contained in // EventDescriptor, and field metadata). Only the lower 24 bits of this value // are relevant. +// +//nolint:unused // keep for future use func (ed *eventDescriptor) setIdentity(identity uint32) { ed.id = uint16(identity) ed.version = uint8(identity >> 16) diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventmetadata.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventmetadata.go index 6fdc126cc9..a2e151a502 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventmetadata.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventmetadata.go @@ -1,3 +1,5 @@ +//go:build windows + package etw import ( @@ -10,6 +12,8 @@ type inType byte // Various inType definitions for TraceLogging. These must match the definitions // found in TraceLoggingProvider.h in the Windows SDK. +// +//nolint:deadcode,varcheck // keep unused constants for potential future use const ( inTypeNull inType = iota inTypeUnicodeString @@ -47,6 +51,8 @@ type outType byte // Various outType definitions for TraceLogging. These must match the // definitions found in TraceLoggingProvider.h in the Windows SDK. +// +//nolint:deadcode,varcheck // keep unused constants for potential future use const ( // outTypeDefault indicates that the default formatting for the inType will // be used by the event decoder. @@ -81,11 +87,11 @@ type eventMetadata struct { buffer bytes.Buffer } -// bytes returns the raw binary data containing the event metadata. Before being +// toBytes returns the raw binary data containing the event metadata. Before being // returned, the current size of the buffer is written to the start of the // buffer. The returned value is not copied from the internal buffer, so it can // be mutated by the eventMetadata object after it is returned. -func (em *eventMetadata) bytes() []byte { +func (em *eventMetadata) toBytes() []byte { // Finalize the event metadata buffer by filling in the buffer length at the // beginning. binary.LittleEndian.PutUint16(em.buffer.Bytes(), uint16(em.buffer.Len())) @@ -95,7 +101,7 @@ func (em *eventMetadata) bytes() []byte { // writeEventHeader writes the metadata for the start of an event to the buffer. // This specifies the event name and tags. func (em *eventMetadata) writeEventHeader(name string, tags uint32) { - binary.Write(&em.buffer, binary.LittleEndian, uint16(0)) // Length placeholder + _ = binary.Write(&em.buffer, binary.LittleEndian, uint16(0)) // Length placeholder em.writeTags(tags) em.buffer.WriteString(name) em.buffer.WriteByte(0) // Null terminator for name @@ -118,7 +124,7 @@ func (em *eventMetadata) writeFieldInner(name string, inType inType, outType out } if arrSize != 0 { - binary.Write(&em.buffer, binary.LittleEndian, arrSize) + _ = binary.Write(&em.buffer, binary.LittleEndian, arrSize) } } @@ -151,13 +157,17 @@ func (em *eventMetadata) writeTags(tags uint32) { } // writeField writes the metadata for a simple field to the buffer. +// +//nolint:unparam // tags is currently always 0, may change in the future func (em *eventMetadata) writeField(name string, inType inType, outType outType, tags uint32) { em.writeFieldInner(name, inType, outType, tags, 0) } // writeArray writes the metadata for an array field to the buffer. The number // of elements in the array must be written as a uint16 in the event data, -// immediately preceeding the event data. +// immediately preceding the event data. +// +//nolint:unparam // tags is currently always 0, may change in the future func (em *eventMetadata) writeArray(name string, inType inType, outType outType, tags uint32) { em.writeFieldInner(name, inType|inTypeArray, outType, tags, 0) } @@ -165,6 +175,8 @@ func (em *eventMetadata) writeArray(name string, inType inType, outType outType, // writeCountedArray writes the metadata for an array field to the buffer. The // size of a counted array is fixed, and the size is written into the metadata // directly. +// +//nolint:unused // keep for future use func (em *eventMetadata) writeCountedArray(name string, count uint16, inType inType, outType outType, tags uint32) { em.writeFieldInner(name, inType|inTypeCountedArray, outType, tags, count) } diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventopt.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventopt.go index eaace6886e..73403220c9 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/eventopt.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/eventopt.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package etw diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/fieldopt.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/fieldopt.go index b5ea80a460..b769c89629 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/fieldopt.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/fieldopt.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package etw @@ -481,7 +482,7 @@ func SmartField(name string, v interface{}) FieldOpt { case reflect.Int32: return SmartField(name, int32(rv.Int())) case reflect.Int64: - return SmartField(name, int64(rv.Int())) + return SmartField(name, int64(rv.Int())) //nolint:unconvert // make look consistent case reflect.Uint: return SmartField(name, uint(rv.Uint())) case reflect.Uint8: @@ -491,13 +492,13 @@ func SmartField(name string, v interface{}) FieldOpt { case reflect.Uint32: return SmartField(name, uint32(rv.Uint())) case reflect.Uint64: - return SmartField(name, uint64(rv.Uint())) + return SmartField(name, uint64(rv.Uint())) //nolint:unconvert // make look consistent case reflect.Uintptr: return SmartField(name, uintptr(rv.Uint())) case reflect.Float32: return SmartField(name, float32(rv.Float())) case reflect.Float64: - return SmartField(name, float64(rv.Float())) + return SmartField(name, float64(rv.Float())) //nolint:unconvert // make look consistent case reflect.String: return SmartField(name, rv.String()) case reflect.Struct: @@ -509,6 +510,9 @@ func SmartField(name string, v interface{}) FieldOpt { } } return Struct(name, fields...) + case reflect.Array, reflect.Chan, reflect.Complex128, reflect.Complex64, + reflect.Func, reflect.Interface, reflect.Invalid, reflect.Map, reflect.Ptr, + reflect.Slice, reflect.UnsafePointer: } } diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/newprovider.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/newprovider.go index 581ef595a5..3669b4f783 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/newprovider.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/newprovider.go @@ -1,3 +1,4 @@ +//go:build windows && (amd64 || arm64 || 386) // +build windows // +build amd64 arm64 386 @@ -45,18 +46,18 @@ func NewProviderWithOptions(name string, options ...ProviderOpt) (provider *Prov trait := &bytes.Buffer{} if opts.group != (guid.GUID{}) { - binary.Write(trait, binary.LittleEndian, uint16(0)) // Write empty size for buffer (update later) - binary.Write(trait, binary.LittleEndian, uint8(1)) // EtwProviderTraitTypeGroup - traitArray := opts.group.ToWindowsArray() // Append group guid + _ = binary.Write(trait, binary.LittleEndian, uint16(0)) // Write empty size for buffer (update later) + _ = binary.Write(trait, binary.LittleEndian, uint8(1)) // EtwProviderTraitTypeGroup + traitArray := opts.group.ToWindowsArray() // Append group guid trait.Write(traitArray[:]) binary.LittleEndian.PutUint16(trait.Bytes(), uint16(trait.Len())) // Update size } metadata := &bytes.Buffer{} - binary.Write(metadata, binary.LittleEndian, uint16(0)) // Write empty size for buffer (to update later) + _ = binary.Write(metadata, binary.LittleEndian, uint16(0)) // Write empty size for buffer (to update later) metadata.WriteString(name) metadata.WriteByte(0) // Null terminator for name - trait.WriteTo(metadata) // Add traits if applicable + _, _ = trait.WriteTo(metadata) // Add traits if applicable binary.LittleEndian.PutUint16(metadata.Bytes(), uint16(metadata.Len())) // Update the size at the beginning of the buffer provider.metadata = metadata.Bytes() @@ -64,8 +65,8 @@ func NewProviderWithOptions(name string, options ...ProviderOpt) (provider *Prov provider.handle, eventInfoClassProviderSetTraits, uintptr(unsafe.Pointer(&provider.metadata[0])), - uint32(len(provider.metadata))); err != nil { - + uint32(len(provider.metadata)), + ); err != nil { return nil, err } diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/newprovider_unsupported.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/newprovider_unsupported.go index 5a05c13425..e0057cfe0d 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/newprovider_unsupported.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/newprovider_unsupported.go @@ -1,5 +1,5 @@ -// +build windows -// +build arm +//go:build windows && arm +// +build windows,arm package etw diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/provider.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/provider.go index a5b90d037d..8174bff1b0 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/provider.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/provider.go @@ -1,9 +1,10 @@ +//go:build windows // +build windows package etw import ( - "crypto/sha1" + "crypto/sha1" //nolint:gosec // not used for secure application "encoding/binary" "strings" "unicode/utf16" @@ -27,7 +28,7 @@ type Provider struct { keywordAll uint64 } -// String returns the `provider`.ID as a string +// String returns the `provider`.ID as a string. func (provider *Provider) String() string { if provider == nil { return "" @@ -54,6 +55,7 @@ const ( type eventInfoClass uint32 +//nolint:deadcode,varcheck // keep unused constants for potential future use const ( eventInfoClassProviderBinaryTrackInfo eventInfoClass = iota eventInfoClassProviderSetReserved1 @@ -65,10 +67,19 @@ const ( // enable/disable notifications from ETW. type EnableCallback func(guid.GUID, ProviderState, Level, uint64, uint64, uintptr) -func providerCallback(sourceID guid.GUID, state ProviderState, level Level, matchAnyKeyword uint64, matchAllKeyword uint64, filterData uintptr, i uintptr) { +func providerCallback( + sourceID guid.GUID, + state ProviderState, + level Level, + matchAnyKeyword uint64, + matchAllKeyword uint64, + filterData uintptr, + i uintptr, +) { provider := providers.getProvider(uint(i)) switch state { + case ProviderStateCaptureState: case ProviderStateDisable: provider.enabled = false case ProviderStateEnable: @@ -90,17 +101,22 @@ func providerCallback(sourceID guid.GUID, state ProviderState, level Level, matc // // The algorithm is roughly the RFC 4122 algorithm for a V5 UUID, but differs in // the following ways: -// - The input name is first upper-cased, UTF16-encoded, and converted to -// big-endian. -// - No variant is set on the result UUID. -// - The result UUID is treated as being in little-endian format, rather than -// big-endian. +// - The input name is first upper-cased, UTF16-encoded, and converted to +// big-endian. +// - No variant is set on the result UUID. +// - The result UUID is treated as being in little-endian format, rather than +// big-endian. func providerIDFromName(name string) guid.GUID { - buffer := sha1.New() - namespace := guid.GUID{0x482C2DB2, 0xC390, 0x47C8, [8]byte{0x87, 0xF8, 0x1A, 0x15, 0xBF, 0xC1, 0x30, 0xFB}} + buffer := sha1.New() //nolint:gosec // not used for secure application + namespace := guid.GUID{ + Data1: 0x482C2DB2, + Data2: 0xC390, + Data3: 0x47C8, + Data4: [8]byte{0x87, 0xF8, 0x1A, 0x15, 0xBF, 0xC1, 0x30, 0xFB}, + } namespaceBytes := namespace.ToArray() buffer.Write(namespaceBytes[:]) - binary.Write(buffer, binary.BigEndian, utf16.Encode([]rune(strings.ToUpper(name)))) + _ = binary.Write(buffer, binary.BigEndian, utf16.Encode([]rune(strings.ToUpper(name)))) sum := buffer.Sum(nil) sum[7] = (sum[7] & 0xf) | 0x50 @@ -117,25 +133,24 @@ type providerOpts struct { } // ProviderOpt allows the caller to specify provider options to -// NewProviderWithOptions +// NewProviderWithOptions. type ProviderOpt func(*providerOpts) -// WithCallback is used to provide a callback option to NewProviderWithOptions +// WithCallback is used to provide a callback option to NewProviderWithOptions. func WithCallback(callback EnableCallback) ProviderOpt { return func(opts *providerOpts) { opts.callback = callback } } -// WithID is used to provide a provider ID option to NewProviderWithOptions +// WithID is used to provide a provider ID option to NewProviderWithOptions. func WithID(id guid.GUID) ProviderOpt { return func(opts *providerOpts) { opts.id = id } } -// WithGroup is used to provide a provider group option to -// NewProviderWithOptions +// WithGroup is used to provide a provider group option to NewProviderWithOptions. func WithGroup(group guid.GUID) ProviderOpt { return func(opts *providerOpts) { opts.group = group @@ -237,11 +252,17 @@ func (provider *Provider) WriteEvent(name string, eventOpts []EventOpt, fieldOpt // event metadata (e.g. for the name) so we don't need to do this check for // the metadata. dataBlobs := [][]byte{} - if len(ed.bytes()) > 0 { - dataBlobs = [][]byte{ed.bytes()} + if len(ed.toBytes()) > 0 { + dataBlobs = [][]byte{ed.toBytes()} } - return provider.writeEventRaw(options.descriptor, options.activityID, options.relatedActivityID, [][]byte{em.bytes()}, dataBlobs) + return provider.writeEventRaw( + options.descriptor, + options.activityID, + options.relatedActivityID, + [][]byte{em.toBytes()}, + dataBlobs, + ) } // writeEventRaw writes a single ETW event from the provider. This function is @@ -257,17 +278,24 @@ func (provider *Provider) writeEventRaw( relatedActivityID guid.GUID, metadataBlobs [][]byte, dataBlobs [][]byte) error { - dataDescriptorCount := uint32(1 + len(metadataBlobs) + len(dataBlobs)) dataDescriptors := make([]eventDataDescriptor, 0, dataDescriptorCount) - dataDescriptors = append(dataDescriptors, newEventDataDescriptor(eventDataDescriptorTypeProviderMetadata, provider.metadata)) + dataDescriptors = append(dataDescriptors, + newEventDataDescriptor(eventDataDescriptorTypeProviderMetadata, provider.metadata)) for _, blob := range metadataBlobs { - dataDescriptors = append(dataDescriptors, newEventDataDescriptor(eventDataDescriptorTypeEventMetadata, blob)) + dataDescriptors = append(dataDescriptors, + newEventDataDescriptor(eventDataDescriptorTypeEventMetadata, blob)) } for _, blob := range dataBlobs { - dataDescriptors = append(dataDescriptors, newEventDataDescriptor(eventDataDescriptorTypeUserData, blob)) + dataDescriptors = append(dataDescriptors, + newEventDataDescriptor(eventDataDescriptorTypeUserData, blob)) } - return eventWriteTransfer(provider.handle, descriptor, (*windows.GUID)(&activityID), (*windows.GUID)(&relatedActivityID), dataDescriptorCount, &dataDescriptors[0]) + return eventWriteTransfer(provider.handle, + descriptor, + (*windows.GUID)(&activityID), + (*windows.GUID)(&relatedActivityID), + dataDescriptorCount, + &dataDescriptors[0]) } diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/providerglobal.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/providerglobal.go index ce3d305762..0a1d90dda0 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/providerglobal.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/providerglobal.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package etw @@ -14,7 +15,6 @@ type providerMap struct { m map[uint]*Provider i uint lock sync.Mutex - once sync.Once } var providers = providerMap{ @@ -50,5 +50,7 @@ func (p *providerMap) getProvider(index uint) *Provider { return p.m[index] } +//todo: combine these into struct, so that "globalProviderCallback" is guaranteed to be initialized through method access + var providerCallbackOnce sync.Once var globalProviderCallback uintptr diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/ptr64_32.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/ptr64_32.go index d1a76125d7..26c9f1948a 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/ptr64_32.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/ptr64_32.go @@ -1,3 +1,5 @@ +//go:build windows && (386 || arm) +// +build windows // +build 386 arm package etw diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/ptr64_64.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/ptr64_64.go index b86c8f2bd8..1524c643fd 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/ptr64_64.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/ptr64_64.go @@ -1,3 +1,5 @@ +//go:build windows && (amd64 || arm64) +// +build windows // +build amd64 arm64 package etw diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/etw.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/syscall.go similarity index 70% rename from vendor/github.com/Microsoft/go-winio/pkg/etw/etw.go rename to vendor/github.com/Microsoft/go-winio/pkg/etw/syscall.go index 10cd08d84c..16f3bb13e5 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/etw.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/syscall.go @@ -1,13 +1,8 @@ -// Package etw provides support for TraceLogging-based ETW (Event Tracing -// for Windows). TraceLogging is a format of ETW events that are self-describing -// (the event contains information on its own schema). This allows them to be -// decoded without needing a separate manifest with event information. The -// implementation here is based on the information found in -// TraceLoggingProvider.h in the Windows SDK, which implements TraceLogging as a -// set of C macros. +//go:build windows + package etw -//go:generate go run mksyscall_windows.go -output zsyscall_windows.go etw.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go syscall.go //sys eventRegister(providerId *windows.GUID, callback uintptr, callbackContext uintptr, providerHandle *providerHandle) (win32err error) = advapi32.EventRegister diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/wrapper_32.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/wrapper_32.go index 6867a1f878..14c4998420 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/wrapper_32.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/wrapper_32.go @@ -1,3 +1,4 @@ +//go:build windows && (386 || arm) // +build windows // +build 386 arm diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/wrapper_64.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/wrapper_64.go index fe83df2bf0..8cfe2e8cab 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/wrapper_64.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/wrapper_64.go @@ -1,3 +1,4 @@ +//go:build windows && (amd64 || arm64) // +build windows // +build amd64 arm64 @@ -19,7 +20,6 @@ func eventWriteTransfer( relatedActivityID *windows.GUID, dataDescriptorCount uint32, dataDescriptors *eventDataDescriptor) (win32err error) { - return eventWriteTransfer_64( providerHandle, descriptor, @@ -34,7 +34,6 @@ func eventSetInformation( class eventInfoClass, information uintptr, length uint32) (win32err error) { - return eventSetInformation_64( providerHandle, class, @@ -46,7 +45,21 @@ func eventSetInformation( // for provider notifications. Because Go has trouble with callback arguments of // different size, it has only pointer-sized arguments, which are then cast to // the appropriate types when calling providerCallback. -func providerCallbackAdapter(sourceID *guid.GUID, state uintptr, level uintptr, matchAnyKeyword uintptr, matchAllKeyword uintptr, filterData uintptr, i uintptr) uintptr { - providerCallback(*sourceID, ProviderState(state), Level(level), uint64(matchAnyKeyword), uint64(matchAllKeyword), filterData, i) +func providerCallbackAdapter( + sourceID *guid.GUID, + state uintptr, + level uintptr, + matchAnyKeyword uintptr, + matchAllKeyword uintptr, + filterData uintptr, + i uintptr, +) uintptr { + providerCallback(*sourceID, + ProviderState(state), + Level(level), + uint64(matchAnyKeyword), + uint64(matchAllKeyword), + filterData, + i) return 0 } diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etw/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/pkg/etw/zsyscall_windows.go index 719b13d284..c78a6ed543 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etw/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etw/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated by 'go generate'; DO NOT EDIT. +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package etw diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etwlogrus/hook.go b/vendor/github.com/Microsoft/go-winio/pkg/etwlogrus/hook.go index 4332af5649..76f6239a54 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/etwlogrus/hook.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/etwlogrus/hook.go @@ -1,40 +1,79 @@ +//go:build windows // +build windows package etwlogrus import ( + "errors" "sort" - "github.com/Microsoft/go-winio/pkg/etw" "github.com/sirupsen/logrus" + + "github.com/Microsoft/go-winio/pkg/etw" ) +const defaultEventName = "LogrusEntry" + +// ErrNoProvider is returned when a hook is created without a provider being configured. +var ErrNoProvider = errors.New("no ETW registered provider") + +// HookOpt is an option to change the behavior of the Logrus ETW hook. +type HookOpt func(*Hook) error + // Hook is a Logrus hook which logs received events to ETW. type Hook struct { provider *etw.Provider closeProvider bool + // allows setting the entry name + getName func(*logrus.Entry) string + // returns additional options to add to the event + getEventsOpts func(*logrus.Entry) []etw.EventOpt +} + +// NewHook registers a new ETW provider and returns a hook to log from it. +// The provider will be closed when the hook is closed. +func NewHook(providerName string, opts ...HookOpt) (*Hook, error) { + opts = append(opts, WithNewETWProvider(providerName)) + + return NewHookFromOpts(opts...) +} + +// NewHookFromProvider creates a new hook based on an existing ETW provider. +// The provider will not be closed when the hook is closed. +func NewHookFromProvider(provider *etw.Provider, opts ...HookOpt) (*Hook, error) { + opts = append(opts, WithExistingETWProvider(provider)) + + return NewHookFromOpts(opts...) } -// NewHook registers a new ETW provider and returns a hook to log from it. The -// provider will be closed when the hook is closed. -func NewHook(providerName string) (*Hook, error) { - provider, err := etw.NewProvider(providerName, nil) - if err != nil { - return nil, err +// NewHookFromOpts creates a new hook with the provided options. +// An error is returned if the hook does not have a valid provider. +func NewHookFromOpts(opts ...HookOpt) (*Hook, error) { + h := defaultHook() + + for _, o := range opts { + if err := o(h); err != nil { + return nil, err + } } + return h, h.validate() +} - return &Hook{provider, true}, nil +func defaultHook() *Hook { + h := &Hook{} + return h } -// NewHookFromProvider creates a new hook based on an existing ETW provider. The -// provider will not be closed when the hook is closed. -func NewHookFromProvider(provider *etw.Provider) (*Hook, error) { - return &Hook{provider, false}, nil +func (h *Hook) validate() error { + if h.provider == nil { + return ErrNoProvider + } + return nil } // Levels returns the set of levels that this hook wants to receive log entries // for. -func (h *Hook) Levels() []logrus.Level { +func (*Hook) Levels() []logrus.Level { return logrus.AllLevels } @@ -58,6 +97,21 @@ func (h *Hook) Fire(e *logrus.Entry) error { return nil } + name := defaultEventName + if h.getName != nil { + if n := h.getName(e); n != "" { + name = n + } + } + + // extra room for two more options in addition to log level to avoid repeated reallocations + // if the user also provides options + opts := make([]etw.EventOpt, 0, 3) + opts = append(opts, etw.WithLevel(level)) + if h.getEventsOpts != nil { + opts = append(opts, h.getEventsOpts(e)...) + } + // Sort the fields by name so they are consistent in each instance // of an event. Otherwise, the fields don't line up in WPA. names := make([]string, 0, len(e.Data)) @@ -88,10 +142,7 @@ func (h *Hook) Fire(e *logrus.Entry) error { // as a session listening for the event having no available space in its // buffers). Therefore, we don't return the error from WriteEvent, as it is // just noise in many cases. - h.provider.WriteEvent( - "LogrusEntry", - etw.WithEventOpts(etw.WithLevel(level)), - fields) + _ = h.provider.WriteEvent(name, opts, fields) return nil } diff --git a/vendor/github.com/Microsoft/go-winio/pkg/etwlogrus/opts.go b/vendor/github.com/Microsoft/go-winio/pkg/etwlogrus/opts.go new file mode 100644 index 0000000000..499fca87c4 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/etwlogrus/opts.go @@ -0,0 +1,53 @@ +//go:build windows + +package etwlogrus + +import ( + "github.com/sirupsen/logrus" + + "github.com/Microsoft/go-winio/pkg/etw" +) + +// etw provider + +// WithNewETWProvider registers a new ETW provider and sets the hook to log using it. +// The provider will be closed when the hook is closed. +func WithNewETWProvider(n string) HookOpt { + return func(h *Hook) error { + provider, err := etw.NewProvider(n, nil) + if err != nil { + return err + } + + h.provider = provider + h.closeProvider = true + return nil + } +} + +// WithExistingETWProvider configures the hook to use an existing ETW provider. +// The provider will not be closed when the hook is closed. +func WithExistingETWProvider(p *etw.Provider) HookOpt { + return func(h *Hook) error { + h.provider = p + h.closeProvider = false + return nil + } +} + +// WithGetName sets the ETW EventName of an event to the value returned by f +// If the name is empty, the default event name will be used. +func WithGetName(f func(*logrus.Entry) string) HookOpt { + return func(h *Hook) error { + h.getName = f + return nil + } +} + +// WithEventOpts allows additional ETW event properties (keywords, tags, etc.) to be specified. +func WithEventOpts(f func(*logrus.Entry) []etw.EventOpt) HookOpt { + return func(h *Hook) error { + h.getEventsOpts = f + return nil + } +} diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go index 2d9161e2de..48ce4e9243 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid.go @@ -1,5 +1,3 @@ -// +build windows - // Package guid provides a GUID type. The backing structure for a GUID is // identical to that used by the golang.org/x/sys/windows GUID type. // There are two main binary encodings used for a GUID, the big-endian encoding, @@ -9,24 +7,26 @@ package guid import ( "crypto/rand" - "crypto/sha1" + "crypto/sha1" //nolint:gosec // not used for secure application "encoding" "encoding/binary" "fmt" "strconv" ) +//go:generate go run golang.org/x/tools/cmd/stringer -type=Variant -trimprefix=Variant -linecomment + // Variant specifies which GUID variant (or "type") of the GUID. It determines // how the entirety of the rest of the GUID is interpreted. type Variant uint8 -// The variants specified by RFC 4122. +// The variants specified by RFC 4122 section 4.1.1. const ( // VariantUnknown specifies a GUID variant which does not conform to one of // the variant encodings specified in RFC 4122. VariantUnknown Variant = iota VariantNCS - VariantRFC4122 + VariantRFC4122 // RFC 4122 VariantMicrosoft VariantFuture ) @@ -36,6 +36,10 @@ const ( // hash of an input string. type Version uint8 +func (v Version) String() string { + return strconv.FormatUint(uint64(v), 10) +} + var _ = (encoding.TextMarshaler)(GUID{}) var _ = (encoding.TextUnmarshaler)(&GUID{}) @@ -61,7 +65,7 @@ func NewV4() (GUID, error) { // big-endian UTF16 stream of bytes. If that is desired, the string can be // encoded as such before being passed to this function. func NewV5(namespace GUID, name []byte) (GUID, error) { - b := sha1.New() + b := sha1.New() //nolint:gosec // not used for secure application namespaceBytes := namespace.ToArray() b.Write(namespaceBytes[:]) b.Write(name) diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_nonwindows.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_nonwindows.go index f64d828c0b..805bd35484 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_nonwindows.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_nonwindows.go @@ -1,3 +1,4 @@ +//go:build !windows // +build !windows package guid diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_windows.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_windows.go index 83617f4eee..27e45ee5cc 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_windows.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/guid_windows.go @@ -1,3 +1,6 @@ +//go:build windows +// +build windows + package guid import "golang.org/x/sys/windows" diff --git a/vendor/github.com/Microsoft/go-winio/pkg/guid/variant_string.go b/vendor/github.com/Microsoft/go-winio/pkg/guid/variant_string.go new file mode 100644 index 0000000000..4076d3132f --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/pkg/guid/variant_string.go @@ -0,0 +1,27 @@ +// Code generated by "stringer -type=Variant -trimprefix=Variant -linecomment"; DO NOT EDIT. + +package guid + +import "strconv" + +func _() { + // An "invalid array index" compiler error signifies that the constant values have changed. + // Re-run the stringer command to generate them again. + var x [1]struct{} + _ = x[VariantUnknown-0] + _ = x[VariantNCS-1] + _ = x[VariantRFC4122-2] + _ = x[VariantMicrosoft-3] + _ = x[VariantFuture-4] +} + +const _Variant_name = "UnknownNCSRFC 4122MicrosoftFuture" + +var _Variant_index = [...]uint8{0, 7, 10, 18, 27, 33} + +func (i Variant) String() string { + if i >= Variant(len(_Variant_index)-1) { + return "Variant(" + strconv.FormatInt(int64(i), 10) + ")" + } + return _Variant_name[_Variant_index[i]:_Variant_index[i+1]] +} diff --git a/vendor/github.com/Microsoft/go-winio/pkg/process/process.go b/vendor/github.com/Microsoft/go-winio/pkg/process/process.go index 85c70fe661..873d24e97a 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/process/process.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/process/process.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package process @@ -32,6 +33,8 @@ func EnumProcesses() ([]uint32, error) { // ProcessMemoryCountersEx is the PROCESS_MEMORY_COUNTERS_EX struct from // Windows: // https://docs.microsoft.com/en-us/windows/win32/api/psapi/ns-psapi-process_memory_counters_ex +// +//nolint:revive // process.ProcessMemoryCountersEx stutters, too late to change it type ProcessMemoryCountersEx struct { Cb uint32 PageFaultCount uint32 @@ -75,7 +78,7 @@ func QueryFullProcessImageName(process windows.Handle, flags uint32) (string, er for { b := make([]uint16, bufferSize) err := queryFullProcessImageName(process, flags, &b[0], &bufferSize) - if err == windows.ERROR_INSUFFICIENT_BUFFER { + if err == windows.ERROR_INSUFFICIENT_BUFFER { //nolint:errorlint // err is Errno bufferSize = bufferSize * 2 continue } @@ -84,5 +87,4 @@ func QueryFullProcessImageName(process windows.Handle, flags uint32) (string, er } return windows.UTF16ToString(b[:bufferSize]), nil } - } diff --git a/vendor/github.com/Microsoft/go-winio/pkg/process/syscall.go b/vendor/github.com/Microsoft/go-winio/pkg/process/syscall.go index 980105fd46..3d47dd7a1e 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/process/syscall.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/process/syscall.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package process @@ -6,7 +7,7 @@ import ( "golang.org/x/sys/windows" ) -//go:generate go run golang.org/x/sys/windows/mkwinsyscall -output zsyscall_windows.go syscall.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go syscall.go //sys enumProcesses(pids *uint32, bufferSize uint32, retBufferSize *uint32) (err error) = kernel32.K32EnumProcesses //sys getProcessMemoryInfo(process handle, memCounters *ProcessMemoryCountersEx, size uint32) (err error) = kernel32.K32GetProcessMemoryInfo diff --git a/vendor/github.com/Microsoft/go-winio/pkg/process/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/pkg/process/zsyscall_windows.go index 405206b65e..aa39e76080 100644 --- a/vendor/github.com/Microsoft/go-winio/pkg/process/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/go-winio/pkg/process/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated by 'go generate'; DO NOT EDIT. +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package process diff --git a/vendor/github.com/Microsoft/go-winio/privilege.go b/vendor/github.com/Microsoft/go-winio/privilege.go index c3dd7c2176..0ff9dac906 100644 --- a/vendor/github.com/Microsoft/go-winio/privilege.go +++ b/vendor/github.com/Microsoft/go-winio/privilege.go @@ -1,3 +1,4 @@ +//go:build windows // +build windows package winio @@ -24,22 +25,17 @@ import ( //sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW const ( - SE_PRIVILEGE_ENABLED = 2 + //revive:disable-next-line:var-naming ALL_CAPS + SE_PRIVILEGE_ENABLED = windows.SE_PRIVILEGE_ENABLED - ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300 + //revive:disable-next-line:var-naming ALL_CAPS + ERROR_NOT_ALL_ASSIGNED syscall.Errno = windows.ERROR_NOT_ALL_ASSIGNED SeBackupPrivilege = "SeBackupPrivilege" SeRestorePrivilege = "SeRestorePrivilege" SeSecurityPrivilege = "SeSecurityPrivilege" ) -const ( - securityAnonymous = iota - securityIdentification - securityImpersonation - securityDelegation -) - var ( privNames = make(map[string]uint64) privNameMutex sync.Mutex @@ -51,11 +47,9 @@ type PrivilegeError struct { } func (e *PrivilegeError) Error() string { - s := "" + s := "Could not enable privilege " if len(e.privileges) > 1 { s = "Could not enable privileges " - } else { - s = "Could not enable privilege " } for i, p := range e.privileges { if i != 0 { @@ -94,7 +88,7 @@ func RunWithPrivileges(names []string, fn func() error) error { } func mapPrivileges(names []string) ([]uint64, error) { - var privileges []uint64 + privileges := make([]uint64, 0, len(names)) privNameMutex.Lock() defer privNameMutex.Unlock() for _, name := range names { @@ -127,7 +121,7 @@ func enableDisableProcessPrivilege(names []string, action uint32) error { return err } - p, _ := windows.GetCurrentProcess() + p := windows.CurrentProcess() var token windows.Token err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token) if err != nil { @@ -140,10 +134,10 @@ func enableDisableProcessPrivilege(names []string, action uint32) error { func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error { var b bytes.Buffer - binary.Write(&b, binary.LittleEndian, uint32(len(privileges))) + _ = binary.Write(&b, binary.LittleEndian, uint32(len(privileges))) for _, p := range privileges { - binary.Write(&b, binary.LittleEndian, p) - binary.Write(&b, binary.LittleEndian, action) + _ = binary.Write(&b, binary.LittleEndian, p) + _ = binary.Write(&b, binary.LittleEndian, action) } prevState := make([]byte, b.Len()) reqSize := uint32(0) @@ -151,7 +145,7 @@ func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) e if !success { return err } - if err == ERROR_NOT_ALL_ASSIGNED { + if err == ERROR_NOT_ALL_ASSIGNED { //nolint:errorlint // err is Errno return &PrivilegeError{privileges} } return nil @@ -177,7 +171,7 @@ func getPrivilegeName(luid uint64) string { } func newThreadToken() (windows.Token, error) { - err := impersonateSelf(securityImpersonation) + err := impersonateSelf(windows.SecurityImpersonation) if err != nil { return 0, err } diff --git a/vendor/github.com/Microsoft/go-winio/reparse.go b/vendor/github.com/Microsoft/go-winio/reparse.go index fc1ee4d3a3..67d1a104a6 100644 --- a/vendor/github.com/Microsoft/go-winio/reparse.go +++ b/vendor/github.com/Microsoft/go-winio/reparse.go @@ -1,3 +1,6 @@ +//go:build windows +// +build windows + package winio import ( @@ -113,16 +116,16 @@ func EncodeReparsePoint(rp *ReparsePoint) []byte { } var b bytes.Buffer - binary.Write(&b, binary.LittleEndian, &data) + _ = binary.Write(&b, binary.LittleEndian, &data) if !rp.IsMountPoint { flags := uint32(0) if relative { flags |= 1 } - binary.Write(&b, binary.LittleEndian, flags) + _ = binary.Write(&b, binary.LittleEndian, flags) } - binary.Write(&b, binary.LittleEndian, ntTarget16) - binary.Write(&b, binary.LittleEndian, target16) + _ = binary.Write(&b, binary.LittleEndian, ntTarget16) + _ = binary.Write(&b, binary.LittleEndian, target16) return b.Bytes() } diff --git a/vendor/github.com/Microsoft/go-winio/sd.go b/vendor/github.com/Microsoft/go-winio/sd.go index db1b370a1b..5550ef6b61 100644 --- a/vendor/github.com/Microsoft/go-winio/sd.go +++ b/vendor/github.com/Microsoft/go-winio/sd.go @@ -1,23 +1,25 @@ +//go:build windows // +build windows package winio import ( + "errors" "syscall" "unsafe" + + "golang.org/x/sys/windows" ) //sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW +//sys lookupAccountSid(systemName *uint16, sid *byte, name *uint16, nameSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountSidW //sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW +//sys convertStringSidToSid(str *uint16, sid **byte) (err error) = advapi32.ConvertStringSidToSidW //sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW //sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW //sys localFree(mem uintptr) = LocalFree //sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength -const ( - cERROR_NONE_MAPPED = syscall.Errno(1332) -) - type AccountLookupError struct { Name string Err error @@ -28,8 +30,10 @@ func (e *AccountLookupError) Error() string { return "lookup account: empty account name specified" } var s string - switch e.Err { - case cERROR_NONE_MAPPED: + switch { + case errors.Is(e.Err, windows.ERROR_INVALID_SID): + s = "the security ID structure is invalid" + case errors.Is(e.Err, windows.ERROR_NONE_MAPPED): s = "not found" default: s = e.Err.Error() @@ -37,6 +41,8 @@ func (e *AccountLookupError) Error() string { return "lookup account " + e.Name + ": " + s } +func (e *AccountLookupError) Unwrap() error { return e.Err } + type SddlConversionError struct { Sddl string Err error @@ -46,15 +52,19 @@ func (e *SddlConversionError) Error() string { return "convert " + e.Sddl + ": " + e.Err.Error() } +func (e *SddlConversionError) Unwrap() error { return e.Err } + // LookupSidByName looks up the SID of an account by name +// +//revive:disable-next-line:var-naming SID, not Sid func LookupSidByName(name string) (sid string, err error) { if name == "" { - return "", &AccountLookupError{name, cERROR_NONE_MAPPED} + return "", &AccountLookupError{name, windows.ERROR_NONE_MAPPED} } var sidSize, sidNameUse, refDomainSize uint32 err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse) - if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER { + if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER { //nolint:errorlint // err is Errno return "", &AccountLookupError{name, err} } sidBuffer := make([]byte, sidSize) @@ -73,6 +83,42 @@ func LookupSidByName(name string) (sid string, err error) { return sid, nil } +// LookupNameBySid looks up the name of an account by SID +// +//revive:disable-next-line:var-naming SID, not Sid +func LookupNameBySid(sid string) (name string, err error) { + if sid == "" { + return "", &AccountLookupError{sid, windows.ERROR_NONE_MAPPED} + } + + sidBuffer, err := windows.UTF16PtrFromString(sid) + if err != nil { + return "", &AccountLookupError{sid, err} + } + + var sidPtr *byte + if err = convertStringSidToSid(sidBuffer, &sidPtr); err != nil { + return "", &AccountLookupError{sid, err} + } + defer localFree(uintptr(unsafe.Pointer(sidPtr))) + + var nameSize, refDomainSize, sidNameUse uint32 + err = lookupAccountSid(nil, sidPtr, nil, &nameSize, nil, &refDomainSize, &sidNameUse) + if err != nil && err != windows.ERROR_INSUFFICIENT_BUFFER { //nolint:errorlint // err is Errno + return "", &AccountLookupError{sid, err} + } + + nameBuffer := make([]uint16, nameSize) + refDomainBuffer := make([]uint16, refDomainSize) + err = lookupAccountSid(nil, sidPtr, &nameBuffer[0], &nameSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse) + if err != nil { + return "", &AccountLookupError{sid, err} + } + + name = windows.UTF16ToString(nameBuffer) + return name, nil +} + func SddlToSecurityDescriptor(sddl string) ([]byte, error) { var sdBuffer uintptr err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil) @@ -87,7 +133,7 @@ func SddlToSecurityDescriptor(sddl string) ([]byte, error) { func SecurityDescriptorToSddl(sd []byte) (string, error) { var sddl *uint16 - // The returned string length seems to including an aribtrary number of terminating NULs. + // The returned string length seems to include an arbitrary number of terminating NULs. // Don't use it. err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil) if err != nil { diff --git a/vendor/github.com/Microsoft/go-winio/syscall.go b/vendor/github.com/Microsoft/go-winio/syscall.go index 5955c99fde..a6ca111b39 100644 --- a/vendor/github.com/Microsoft/go-winio/syscall.go +++ b/vendor/github.com/Microsoft/go-winio/syscall.go @@ -1,3 +1,5 @@ +//go:build windows + package winio -//go:generate go run golang.org/x/sys/windows/mkwinsyscall -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go hvsock.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go ./*.go diff --git a/vendor/github.com/Microsoft/go-winio/tools.go b/vendor/github.com/Microsoft/go-winio/tools.go new file mode 100644 index 0000000000..2aa045843e --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/tools.go @@ -0,0 +1,5 @@ +//go:build tools + +package winio + +import _ "golang.org/x/tools/cmd/stringer" diff --git a/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/doc.go b/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/doc.go new file mode 100644 index 0000000000..20b172ccf6 --- /dev/null +++ b/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/doc.go @@ -0,0 +1,57 @@ +/* +mkwinsyscall generates windows system call bodies + +It parses all files specified on command line containing function +prototypes (like syscall_windows.go) and prints system call bodies +to standard output. + +The prototypes are marked by lines beginning with "//sys" and read +like func declarations if //sys is replaced by func, but: + + - The parameter lists must give a name for each argument. This + includes return parameters. + + - The parameter lists must give a type for each argument: + the (x, y, z int) shorthand is not allowed. + + - If the return parameter is an error number, it must be named err. + + - If go func name needs to be different from its winapi dll name, + the winapi name could be specified at the end, after "=" sign, like + + //sys LoadLibrary(libname string) (handle uint32, err error) = LoadLibraryA + + - Each function that returns err needs to supply a condition, that + return value of winapi will be tested against to detect failure. + This would set err to windows "last-error", otherwise it will be nil. + The value can be provided at end of //sys declaration, like + + //sys LoadLibrary(libname string) (handle uint32, err error) [failretval==-1] = LoadLibraryA + + and is [failretval==0] by default. + + - If the function name ends in a "?", then the function not existing is non- + fatal, and an error will be returned instead of panicking. + +Usage: + + mkwinsyscall [flags] [path ...] + +Flags + + -output string + Output file name (standard output if omitted). + -sort + Sort DLL and function declarations (default true). + Intended to help transition from older versions of mkwinsyscall by making diffs + easier to read and understand. + -systemdll + Whether all DLLs should be loaded from the Windows system directory (default true). + -trace + Generate print statement after every syscall. + -utf16 + Encode string arguments as UTF-16 for syscalls not ending in 'A' or 'W' (default true). + -winio + Import this package ("github.com/Microsoft/go-winio"). +*/ +package main diff --git a/mksyscall_windows.go b/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/mkwinsyscall.go similarity index 78% rename from mksyscall_windows.go rename to vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/mkwinsyscall.go index 9d008cbab3..e72be31384 100644 --- a/mksyscall_windows.go +++ b/vendor/github.com/Microsoft/go-winio/tools/mkwinsyscall/mkwinsyscall.go @@ -1,50 +1,9 @@ +//go:build windows + // Copyright 2013 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -//go:build ignore -// +build ignore - -/* -mksyscall_windows generates windows system call bodies - -It parses all files specified on command line containing function -prototypes (like syscall_windows.go) and prints system call bodies -to standard output. - -The prototypes are marked by lines beginning with "//sys" and read -like func declarations if //sys is replaced by func, but: - - - The parameter lists must give a name for each argument. This - includes return parameters. - - - The parameter lists must give a type for each argument: - the (x, y, z int) shorthand is not allowed. - -* If the return parameter is an error number, it must be named err. - - - If go func name needs to be different from it's winapi dll name, - the winapi name could be specified at the end, after "=" sign, like - //sys LoadLibrary(libname string) (handle uint32, err error) = LoadLibraryA - - - Each function that returns err needs to supply a condition, that - return value of winapi will be tested against to detect failure. - This would set err to windows "last-error", otherwise it will be nil. - The value can be provided at end of //sys declaration, like - //sys LoadLibrary(libname string) (handle uint32, err error) [failretval==-1] = LoadLibraryA - and is [failretval==0] by default. - -Usage: - - mksyscall_windows [flags] [path ...] - -The flags are: - - -output - Specify output file name (outputs to console if blank). - -trace - Generate print statement after every syscall. -*/ package main import ( @@ -65,33 +24,66 @@ import ( "strconv" "strings" "text/template" + + "golang.org/x/sys/windows" +) + +const ( + pkgSyscall = "syscall" + pkgWindows = "windows" + + // common types. + + tBool = "bool" + tBoolPtr = "*bool" + tError = "error" + tString = "string" + + // error variable names. + + varErr = "err" + varErrNTStatus = "ntStatus" + varErrHR = "hr" ) var ( filename = flag.String("output", "", "output file name (standard output if omitted)") printTraceFlag = flag.Bool("trace", false, "generate print statement after every syscall") systemDLL = flag.Bool("systemdll", true, "whether all DLLs should be loaded from the Windows system directory") - winio = flag.Bool("winio", false, "import go-winio") + winio = flag.Bool("winio", false, `import this package ("github.com/Microsoft/go-winio")`) + utf16 = flag.Bool("utf16", true, "encode string arguments as UTF-16 for syscalls not ending in 'A' or 'W'") + sortdecls = flag.Bool("sort", true, "sort DLL and function declarations") ) func trim(s string) string { return strings.Trim(s, " \t") } +func endsIn(s string, c byte) bool { + return len(s) >= 1 && s[len(s)-1] == c +} + var packageName string func packagename() string { return packageName } +func windowsdot() string { + if packageName == pkgWindows { + return "" + } + return pkgWindows + "." +} + func syscalldot() string { - if packageName == "syscall" { + if packageName == pkgSyscall { return "" } - return "syscall." + return pkgSyscall + "." } -// Param is function parameter +// Param is function parameter. type Param struct { Name string Type string @@ -110,14 +102,20 @@ func (p *Param) tmpVar() string { // BoolTmpVarCode returns source code for bool temp variable. func (p *Param) BoolTmpVarCode() string { - const code = `var %s uint32 - if %s { - %s = 1 - } else { - %s = 0 + const code = `var %[1]s uint32 + if %[2]s { + %[1]s = 1 }` - tmp := p.tmpVar() - return fmt.Sprintf(code, tmp, p.Name, tmp, tmp) + return fmt.Sprintf(code, p.tmpVar(), p.Name) +} + +// BoolPointerTmpVarCode returns source code for bool temp variable. +func (p *Param) BoolPointerTmpVarCode() string { + const code = `var %[1]s uint32 + if *%[2]s { + %[1]s = 1 + }` + return fmt.Sprintf(code, p.tmpVar(), p.Name) } // SliceTmpVarCode returns source code for slice temp variable. @@ -153,8 +151,10 @@ func (p *Param) StringTmpVarCode() string { // TmpVarCode returns source code for temp variable. func (p *Param) TmpVarCode() string { switch { - case p.Type == "bool": + case p.Type == tBool: return p.BoolTmpVarCode() + case p.Type == tBoolPtr: + return p.BoolPointerTmpVarCode() case strings.HasPrefix(p.Type, "[]"): return p.SliceTmpVarCode() default: @@ -162,6 +162,16 @@ func (p *Param) TmpVarCode() string { } } +// TmpVarReadbackCode returns source code for reading back the temp variable into the original variable. +func (p *Param) TmpVarReadbackCode() string { + switch { + case p.Type == tBoolPtr: + return fmt.Sprintf("*%s = %s != 0", p.Name, p.tmpVar()) + default: + return "" + } +} + // TmpVarHelperCode returns source code for helper's temp variable. func (p *Param) TmpVarHelperCode() string { if p.Type != "string" { @@ -177,9 +187,11 @@ func (p *Param) SyscallArgList() []string { t := p.HelperType() var s string switch { + case t == tBoolPtr: + s = fmt.Sprintf("unsafe.Pointer(&%s)", p.tmpVar()) case t[0] == '*': s = fmt.Sprintf("unsafe.Pointer(%s)", p.Name) - case t == "bool": + case t == tBool: s = p.tmpVar() case strings.HasPrefix(t, "[]"): return []string{ @@ -194,12 +206,12 @@ func (p *Param) SyscallArgList() []string { // IsError determines if p parameter is used to return error. func (p *Param) IsError() bool { - return p.Name == "err" && p.Type == "error" + return p.Name == varErr && p.Type == tError } // HelperType returns type of parameter p used in helper function. func (p *Param) HelperType() string { - if p.Type == "string" { + if p.Type == tString { return p.fn.StrconvType() } return p.Type @@ -221,18 +233,19 @@ func join(ps []*Param, fn func(*Param) string, sep string) string { // Rets describes function return parameters. type Rets struct { - Name string - Type string - ReturnsError bool - FailCond string + Name string + Type string + ReturnsError bool + FailCond string + fnMaybeAbsent bool } // ErrorVarName returns error variable name for r. func (r *Rets) ErrorVarName() string { if r.ReturnsError { - return "err" + return varErr } - if r.Type == "error" { + if r.Type == tError { return r.Name } return "" @@ -245,7 +258,7 @@ func (r *Rets) ToParams() []*Param { ps = append(ps, &Param{Name: r.Name, Type: r.Type}) } if r.ReturnsError { - ps = append(ps, &Param{Name: "err", Type: "error"}) + ps = append(ps, &Param{Name: varErr, Type: tError}) } return ps } @@ -255,6 +268,8 @@ func (r *Rets) List() string { s := join(r.ToParams(), func(p *Param) string { return p.Name + " " + p.Type }, ", ") if len(s) > 0 { s = "(" + s + ")" + } else if r.fnMaybeAbsent { + s = "(err error)" } return s } @@ -283,17 +298,13 @@ func (r *Rets) SetReturnValuesCode() string { func (r *Rets) useLongHandleErrorCode(retvar string) string { const code = `if %s { - if e1 != 0 { - err = errnoErr(e1) - } else { - err = %sEINVAL - } + err = errnoErr(e1) }` cond := retvar + " == 0" if r.FailCond != "" { cond = strings.Replace(r.FailCond, "failretval", retvar, 1) } - return fmt.Sprintf(code, cond, syscalldot()) + return fmt.Sprintf(code, cond) } // SetErrorCode returns source code that sets return parameters. @@ -301,30 +312,38 @@ func (r *Rets) SetErrorCode() string { const code = `if r0 != 0 { %s = %sErrno(r0) }` + const ntStatus = `if r0 != 0 { + %s = %sNTStatus(r0) + }` const hrCode = `if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } %s = %sErrno(r0) }` + if r.Name == "" && !r.ReturnsError { return "" } if r.Name == "" { return r.useLongHandleErrorCode("r1") } - if r.Type == "error" { - if r.Name == "hr" { + if r.Type == tError { + switch r.Name { + case varErrNTStatus, strings.ToLower(varErrNTStatus): // allow ntstatus to work + return fmt.Sprintf(ntStatus, r.Name, windowsdot()) + case varErrHR: return fmt.Sprintf(hrCode, r.Name, syscalldot()) - } else { + default: return fmt.Sprintf(code, r.Name, syscalldot()) } } - s := "" + + var s string switch { case r.Type[0] == '*': s = fmt.Sprintf("%s = (%s)(unsafe.Pointer(r0))", r.Name, r.Type) - case r.Type == "bool": + case r.Type == tBool: s = fmt.Sprintf("%s = r0 != 0", r.Name) default: s = fmt.Sprintf("%s = %s(r0)", r.Name, r.Type) @@ -341,7 +360,6 @@ type Fn struct { Params []*Param Rets *Rets PrintTrace bool - confirmproc bool dllname string dllfuncname string src string @@ -469,9 +487,9 @@ func newFn(s string) (*Fn, error) { default: return nil, errors.New("Could not extract dll name from \"" + f.src + "\"") } - if f.dllfuncname[len(f.dllfuncname)-1] == '?' { - f.confirmproc = true - f.dllfuncname = f.dllfuncname[0 : len(f.dllfuncname)-1] + if n := f.dllfuncname; endsIn(n, '?') { + f.dllfuncname = n[:len(n)-1] + f.Rets.fnMaybeAbsent = true } return f, nil } @@ -492,10 +510,6 @@ func (f *Fn) DLLFuncName() string { return f.dllfuncname } -func (f *Fn) ConfirmProc() bool { - return f.confirmproc -} - // ParamList returns source code for function f parameters. func (f *Fn) ParamList() string { return join(f.Params, func(p *Param) string { return p.Name + " " + p.Type }, ", ") @@ -567,7 +581,7 @@ func (f *Fn) HelperCallParamList() string { a := make([]string, 0, len(f.Params)) for _, p := range f.Params { s := p.Name - if p.Type == "string" { + if p.Type == tString { s = p.tmpVar() } a = append(a, s) @@ -575,10 +589,28 @@ func (f *Fn) HelperCallParamList() string { return strings.Join(a, ", ") } -// IsUTF16 is true, if f is W (utf16) function. It is false -// for all A (ascii) functions. -func (_ *Fn) IsUTF16() bool { - return true +// MaybeAbsent returns source code for handling functions that are possibly unavailable. +func (f *Fn) MaybeAbsent() string { + if !f.Rets.fnMaybeAbsent { + return "" + } + const code = `%[1]s = proc%[2]s.Find() + if %[1]s != nil { + return + }` + errorVar := f.Rets.ErrorVarName() + if errorVar == "" { + errorVar = varErr + } + return fmt.Sprintf(code, errorVar, f.DLLFuncName()) +} + +// IsUTF16 is true, if f is W (UTF-16) function and false for all A (ASCII) functions. +// Functions ending in neither will default to UTF-16, unless the `-utf16` flag is set +// to `false`. +func (f *Fn) IsUTF16() bool { + s := f.DLLFuncName() + return endsIn(s, 'W') || (*utf16 && !endsIn(s, 'A')) } // StrconvFunc returns name of Go string to OS string function for f. @@ -601,25 +633,13 @@ func (f *Fn) StrconvType() string { // Otherwise it is false. func (f *Fn) HasStringParam() bool { for _, p := range f.Params { - if p.Type == "string" { + if p.Type == tString { return true } } return false } -var uniqDllFuncName = make(map[string]bool) - -// IsNotDuplicate is true if f is not a duplicated function -func (f *Fn) IsNotDuplicate() bool { - funcName := f.DLLFuncName() - if uniqDllFuncName[funcName] == false { - uniqDllFuncName[funcName] = true - return true - } - return false -} - // HelperName returns name of function f helper. func (f *Fn) HelperName() string { if !f.HasStringParam() { @@ -631,6 +651,7 @@ func (f *Fn) HelperName() string { // Source files and functions. type Source struct { Funcs []*Fn + DLLFuncNames []*Fn Files []string StdLibImports []string ExternalImports []string @@ -647,7 +668,7 @@ func (src *Source) ExternalImport(pkg string) { } // ParseFiles parses files listed in fs and extracts all syscall -// functions listed in sys comments. It returns source files +// functions listed in sys comments. It returns source files // and functions collection *Source if successful. func ParseFiles(fs []string) (*Source, error) { src := &Source{ @@ -663,6 +684,15 @@ func ParseFiles(fs []string) (*Source, error) { return nil, err } } + src.DLLFuncNames = make([]*Fn, 0, len(src.Funcs)) + uniq := make(map[string]bool, len(src.Funcs)) + for _, fn := range src.Funcs { + name := fn.DLLFuncName() + if !uniq[name] { + src.DLLFuncNames = append(src.DLLFuncNames, fn) + uniq[name] = true + } + } return src, nil } @@ -677,17 +707,43 @@ func (src *Source) DLLs() []string { r = append(r, name) } } + if *sortdecls { + sort.Strings(r) + } return r } -// ParseFile adds additional file path to a source set src. +// ParseFile adds additional file (or files, if path is a glob pattern) path to a source set src. func (src *Source) ParseFile(path string) error { file, err := os.Open(path) + if err == nil { + defer file.Close() + return src.parseFile(file) + } else if !(errors.Is(err, os.ErrNotExist) || errors.Is(err, windows.ERROR_INVALID_NAME)) { + return err + } + + paths, err := filepath.Glob(path) if err != nil { return err } - defer file.Close() + for _, path := range paths { + file, err := os.Open(path) + if err != nil { + return err + } + err = src.parseFile(file) + file.Close() + if err != nil { + return err + } + } + + return nil +} + +func (src *Source) parseFile(file *os.File) error { s := bufio.NewScanner(file) for s.Scan() { t := trim(s.Text()) @@ -710,11 +766,20 @@ func (src *Source) ParseFile(path string) error { if err := s.Err(); err != nil { return err } - src.Files = append(src.Files, path) + src.Files = append(src.Files, file.Name()) + if *sortdecls { + sort.Slice(src.Funcs, func(i, j int) bool { + fi, fj := src.Funcs[i], src.Funcs[j] + if fi.DLLName() == fj.DLLName() { + return fi.DLLFuncName() < fj.DLLFuncName() + } + return fi.DLLName() < fj.DLLName() + }) + } // get package name fset := token.NewFileSet() - _, err = file.Seek(0, 0) + _, err := file.Seek(0, 0) if err != nil { return err } @@ -727,7 +792,7 @@ func (src *Source) ParseFile(path string) error { return nil } -// IsStdRepo returns true if src is part of standard library. +// IsStdRepo reports whether src is part of standard library. func (src *Source) IsStdRepo() (bool, error) { if len(src.Files) == 0 { return false, errors.New("no input files provided") @@ -814,7 +879,7 @@ func (src *Source) Generate(w io.Writer) error { } func usage() { - fmt.Fprintf(os.Stderr, "usage: mksyscall_windows [flags] [path ...]\n") + fmt.Fprintf(os.Stderr, "usage: mkwinsyscall [flags] [path ...]\n") flag.PrintDefaults() os.Exit(1) } @@ -844,6 +909,7 @@ func main() { if *filename == "" { _, err = os.Stdout.Write(data) } else { + //nolint:gosec // G306: code file, no need for wants 0600 err = os.WriteFile(*filename, data, 0644) } if err != nil { @@ -852,9 +918,11 @@ func main() { } // TODO: use println instead to print in the following template + const srcTemplate = ` +{{define "main"}} //go:build windows -{{define "main"}}// Code generated mksyscall_windows.exe DO NOT EDIT +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package {{packagename}} @@ -876,6 +944,7 @@ const ( var ( errERROR_IO_PENDING error = {{syscalldot}}Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = {{syscalldot}}EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -883,7 +952,7 @@ var ( func errnoErr(e {{syscalldot}}Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } @@ -904,7 +973,7 @@ var ( {{define "dlls"}}{{range .DLLs}} mod{{.}} = {{newlazydll .}} {{end}}{{end}} -{{define "funcnames"}}{{range .Funcs}}{{if .IsNotDuplicate}} proc{{.DLLFuncName}} = mod{{.DLLName}}.NewProc("{{.DLLFuncName}}"){{end}} +{{define "funcnames"}}{{range .DLLFuncNames}} proc{{.DLLFuncName}} = mod{{.DLLName}}.NewProc("{{.DLLFuncName}}") {{end}}{{end}} {{define "helperbody"}} @@ -915,7 +984,7 @@ func {{.Name}}({{.ParamList}}) {{template "results" .}}{ {{define "funcbody"}} func {{.HelperName}}({{.HelperParamList}}) {{template "results" .}}{ -{{template "tmpvars" .}} {{template "syscallcheck" .}}{{template "syscall" .}} +{{template "maybeabsent" .}} {{template "tmpvars" .}} {{template "syscall" .}} {{template "tmpvarsreadback" .}} {{template "seterror" .}}{{template "printtrace" .}} return } {{end}} @@ -923,6 +992,9 @@ func {{.HelperName}}({{.HelperParamList}}) {{template "results" .}}{ {{define "helpertmpvars"}}{{range .Params}}{{if .TmpVarHelperCode}} {{.TmpVarHelperCode}} {{end}}{{end}}{{end}} +{{define "maybeabsent"}}{{if .MaybeAbsent}}{{.MaybeAbsent}} +{{end}}{{end}} + {{define "tmpvars"}}{{range .Params}}{{if .TmpVarCode}} {{.TmpVarCode}} {{end}}{{end}}{{end}} @@ -930,11 +1002,8 @@ func {{.HelperName}}({{.HelperParamList}}) {{template "results" .}}{ {{define "syscall"}}{{.Rets.SetReturnValuesCode}}{{.Syscall}}(proc{{.DLLFuncName}}.Addr(), {{.ParamCount}}, {{.SyscallParamList}}){{end}} -{{define "syscallcheck"}}{{if .ConfirmProc}}if {{.Rets.ErrorVarName}} = proc{{.DLLFuncName}}.Find(); {{.Rets.ErrorVarName}} != nil { - return -} -{{end}}{{end}} - +{{define "tmpvarsreadback"}}{{range .Params}}{{if .TmpVarReadbackCode}} +{{.TmpVarReadbackCode}}{{end}}{{end}}{{end}} {{define "seterror"}}{{if .Rets.SetErrorCode}} {{.Rets.SetErrorCode}} {{end}}{{end}} diff --git a/vendor/github.com/Microsoft/go-winio/vhd/vhd.go b/vendor/github.com/Microsoft/go-winio/vhd/vhd.go index f7f78fc230..b54cad1127 100644 --- a/vendor/github.com/Microsoft/go-winio/vhd/vhd.go +++ b/vendor/github.com/Microsoft/go-winio/vhd/vhd.go @@ -11,7 +11,7 @@ import ( "golang.org/x/sys/windows" ) -//go:generate go run mksyscall_windows.go -output zvhd_windows.go vhd.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zvhd_windows.go vhd.go //sys createVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, securityDescriptor *uintptr, createVirtualDiskFlags uint32, providerSpecificFlags uint32, parameters *CreateVirtualDiskParameters, overlapped *syscall.Overlapped, handle *syscall.Handle) (win32err error) = virtdisk.CreateVirtualDisk //sys openVirtualDisk(virtualStorageType *VirtualStorageType, path string, virtualDiskAccessMask uint32, openVirtualDiskFlags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (win32err error) = virtdisk.OpenVirtualDisk @@ -62,8 +62,8 @@ type OpenVirtualDiskParameters struct { Version2 OpenVersion2 } -// The higher level `OpenVersion2` struct uses bools to refer to `GetInfoOnly` and `ReadOnly` for ease of use. However, -// the internal windows structure uses `BOOLS` aka int32s for these types. `openVersion2` is used for translating +// The higher level `OpenVersion2` struct uses `bool`s to refer to `GetInfoOnly` and `ReadOnly` for ease of use. However, +// the internal windows structure uses `BOOL`s aka int32s for these types. `openVersion2` is used for translating // `OpenVersion2` fields to the correct windows internal field types on the `Open____` methods. type openVersion2 struct { getInfoOnly int32 @@ -87,9 +87,10 @@ type AttachVirtualDiskParameters struct { } const ( + //revive:disable-next-line:var-naming ALL_CAPS VIRTUAL_STORAGE_TYPE_DEVICE_VHDX = 0x3 - // Access Mask for opening a VHD + // Access Mask for opening a VHD. VirtualDiskAccessNone VirtualDiskAccessMask = 0x00000000 VirtualDiskAccessAttachRO VirtualDiskAccessMask = 0x00010000 VirtualDiskAccessAttachRW VirtualDiskAccessMask = 0x00020000 @@ -101,7 +102,7 @@ const ( VirtualDiskAccessAll VirtualDiskAccessMask = 0x003f0000 VirtualDiskAccessWritable VirtualDiskAccessMask = 0x00320000 - // Flags for creating a VHD + // Flags for creating a VHD. CreateVirtualDiskFlagNone CreateVirtualDiskFlag = 0x0 CreateVirtualDiskFlagFullPhysicalAllocation CreateVirtualDiskFlag = 0x1 CreateVirtualDiskFlagPreventWritesToSourceDisk CreateVirtualDiskFlag = 0x2 @@ -109,12 +110,12 @@ const ( CreateVirtualDiskFlagCreateBackingStorage CreateVirtualDiskFlag = 0x8 CreateVirtualDiskFlagUseChangeTrackingSourceLimit CreateVirtualDiskFlag = 0x10 CreateVirtualDiskFlagPreserveParentChangeTrackingState CreateVirtualDiskFlag = 0x20 - CreateVirtualDiskFlagVhdSetUseOriginalBackingStorage CreateVirtualDiskFlag = 0x40 + CreateVirtualDiskFlagVhdSetUseOriginalBackingStorage CreateVirtualDiskFlag = 0x40 //revive:disable-line:var-naming VHD, not Vhd CreateVirtualDiskFlagSparseFile CreateVirtualDiskFlag = 0x80 - CreateVirtualDiskFlagPmemCompatible CreateVirtualDiskFlag = 0x100 + CreateVirtualDiskFlagPmemCompatible CreateVirtualDiskFlag = 0x100 //revive:disable-line:var-naming PMEM, not Pmem CreateVirtualDiskFlagSupportCompressedVolumes CreateVirtualDiskFlag = 0x200 - // Flags for opening a VHD + // Flags for opening a VHD. OpenVirtualDiskFlagNone VirtualDiskFlag = 0x00000000 OpenVirtualDiskFlagNoParents VirtualDiskFlag = 0x00000001 OpenVirtualDiskFlagBlankFile VirtualDiskFlag = 0x00000002 @@ -127,7 +128,7 @@ const ( OpenVirtualDiskFlagNoWriteHardening VirtualDiskFlag = 0x00000100 OpenVirtualDiskFlagSupportCompressedVolumes VirtualDiskFlag = 0x00000200 - // Flags for attaching a VHD + // Flags for attaching a VHD. AttachVirtualDiskFlagNone AttachVirtualDiskFlag = 0x00000000 AttachVirtualDiskFlagReadOnly AttachVirtualDiskFlag = 0x00000001 AttachVirtualDiskFlagNoDriveLetter AttachVirtualDiskFlag = 0x00000002 @@ -140,12 +141,14 @@ const ( AttachVirtualDiskFlagSinglePartition AttachVirtualDiskFlag = 0x00000100 AttachVirtualDiskFlagRegisterVolume AttachVirtualDiskFlag = 0x00000200 - // Flags for detaching a VHD + // Flags for detaching a VHD. DetachVirtualDiskFlagNone DetachVirtualDiskFlag = 0x0 ) // CreateVhdx is a helper function to create a simple vhdx file at the given path using // default values. +// +//revive:disable-next-line:var-naming VHDX, not Vhdx func CreateVhdx(path string, maxSizeInGb, blockSizeInMb uint32) error { params := CreateVirtualDiskParameters{ Version: 2, @@ -172,6 +175,8 @@ func DetachVirtualDisk(handle syscall.Handle) (err error) { } // DetachVhd detaches a vhd found at `path`. +// +//revive:disable-next-line:var-naming VHD, not Vhd func DetachVhd(path string) error { handle, err := OpenVirtualDisk( path, @@ -181,12 +186,16 @@ func DetachVhd(path string) error { if err != nil { return err } - defer syscall.CloseHandle(handle) + defer syscall.CloseHandle(handle) //nolint:errcheck return DetachVirtualDisk(handle) } // AttachVirtualDisk attaches a virtual hard disk for use. -func AttachVirtualDisk(handle syscall.Handle, attachVirtualDiskFlag AttachVirtualDiskFlag, parameters *AttachVirtualDiskParameters) (err error) { +func AttachVirtualDisk( + handle syscall.Handle, + attachVirtualDiskFlag AttachVirtualDiskFlag, + parameters *AttachVirtualDiskParameters, +) (err error) { // Supports both version 1 and 2 of the attach parameters as version 2 wasn't present in RS5. if err := attachVirtualDisk( handle, @@ -203,6 +212,8 @@ func AttachVirtualDisk(handle syscall.Handle, attachVirtualDiskFlag AttachVirtua // AttachVhd attaches a virtual hard disk at `path` for use. Attaches using version 2 // of the ATTACH_VIRTUAL_DISK_PARAMETERS. +// +//revive:disable-next-line:var-naming VHD, not Vhd func AttachVhd(path string) (err error) { handle, err := OpenVirtualDisk( path, @@ -213,7 +224,7 @@ func AttachVhd(path string) (err error) { return err } - defer syscall.CloseHandle(handle) + defer syscall.CloseHandle(handle) //nolint:errcheck params := AttachVirtualDiskParameters{Version: 2} if err := AttachVirtualDisk( handle, @@ -226,7 +237,11 @@ func AttachVhd(path string) (err error) { } // OpenVirtualDisk obtains a handle to a VHD opened with supplied access mask and flags. -func OpenVirtualDisk(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask, openVirtualDiskFlags VirtualDiskFlag) (syscall.Handle, error) { +func OpenVirtualDisk( + vhdPath string, + virtualDiskAccessMask VirtualDiskAccessMask, + openVirtualDiskFlags VirtualDiskFlag, +) (syscall.Handle, error) { parameters := OpenVirtualDiskParameters{Version: 2} handle, err := OpenVirtualDiskWithParameters( vhdPath, @@ -241,7 +256,12 @@ func OpenVirtualDisk(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask } // OpenVirtualDiskWithParameters obtains a handle to a VHD opened with supplied access mask, flags and parameters. -func OpenVirtualDiskWithParameters(vhdPath string, virtualDiskAccessMask VirtualDiskAccessMask, openVirtualDiskFlags VirtualDiskFlag, parameters *OpenVirtualDiskParameters) (syscall.Handle, error) { +func OpenVirtualDiskWithParameters( + vhdPath string, + virtualDiskAccessMask VirtualDiskAccessMask, + openVirtualDiskFlags VirtualDiskFlag, + parameters *OpenVirtualDiskParameters, +) (syscall.Handle, error) { var ( handle syscall.Handle defaultType VirtualStorageType @@ -279,7 +299,12 @@ func OpenVirtualDiskWithParameters(vhdPath string, virtualDiskAccessMask Virtual } // CreateVirtualDisk creates a virtual harddisk and returns a handle to the disk. -func CreateVirtualDisk(path string, virtualDiskAccessMask VirtualDiskAccessMask, createVirtualDiskFlags CreateVirtualDiskFlag, parameters *CreateVirtualDiskParameters) (syscall.Handle, error) { +func CreateVirtualDisk( + path string, + virtualDiskAccessMask VirtualDiskAccessMask, + createVirtualDiskFlags CreateVirtualDiskFlag, + parameters *CreateVirtualDiskParameters, +) (syscall.Handle, error) { var ( handle syscall.Handle defaultType VirtualStorageType @@ -323,6 +348,8 @@ func GetVirtualDiskPhysicalPath(handle syscall.Handle) (_ string, err error) { } // CreateDiffVhd is a helper function to create a differencing virtual disk. +// +//revive:disable-next-line:var-naming VHD, not Vhd func CreateDiffVhd(diffVhdPath, baseVhdPath string, blockSizeInMB uint32) error { // Setting `ParentPath` is how to signal to create a differencing disk. createParams := &CreateVirtualDiskParameters{ diff --git a/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go b/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go index 1d7498db3b..d0e917d2be 100644 --- a/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go +++ b/vendor/github.com/Microsoft/go-winio/vhd/zvhd_windows.go @@ -1,4 +1,6 @@ -// Code generated by 'go generate'; DO NOT EDIT. +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package vhd diff --git a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go index 176ff75e32..83f45a1351 100644 --- a/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/go-winio/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated by 'go generate'; DO NOT EDIT. +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package winio @@ -47,9 +49,11 @@ var ( procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW") procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW") procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW") + procConvertStringSidToSidW = modadvapi32.NewProc("ConvertStringSidToSidW") procGetSecurityDescriptorLength = modadvapi32.NewProc("GetSecurityDescriptorLength") procImpersonateSelf = modadvapi32.NewProc("ImpersonateSelf") procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW") + procLookupAccountSidW = modadvapi32.NewProc("LookupAccountSidW") procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW") procLookupPrivilegeNameW = modadvapi32.NewProc("LookupPrivilegeNameW") procLookupPrivilegeValueW = modadvapi32.NewProc("LookupPrivilegeValueW") @@ -74,7 +78,6 @@ var ( procRtlDosPathNameToNtPathName_U = modntdll.NewProc("RtlDosPathNameToNtPathName_U") procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb") procWSAGetOverlappedResult = modws2_32.NewProc("WSAGetOverlappedResult") - procbind = modws2_32.NewProc("bind") ) func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) { @@ -123,6 +126,14 @@ func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision return } +func convertStringSidToSid(str *uint16, sid **byte) (err error) { + r1, _, e1 := syscall.Syscall(procConvertStringSidToSidW.Addr(), 2, uintptr(unsafe.Pointer(str)), uintptr(unsafe.Pointer(sid)), 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + func getSecurityDescriptorLength(sd uintptr) (len uint32) { r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0) len = uint32(r0) @@ -154,6 +165,14 @@ func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidS return } +func lookupAccountSid(systemName *uint16, sid *byte, name *uint16, nameSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) { + r1, _, e1 := syscall.Syscall9(procLookupAccountSidW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(nameSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) { var _p0 *uint16 _p0, err = syscall.UTF16PtrFromString(systemName) @@ -380,25 +399,25 @@ func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err erro return } -func ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntstatus) { +func ntCreateNamedPipeFile(pipe *syscall.Handle, access uint32, oa *objectAttributes, iosb *ioStatusBlock, share uint32, disposition uint32, options uint32, typ uint32, readMode uint32, completionMode uint32, maxInstances uint32, inboundQuota uint32, outputQuota uint32, timeout *int64) (status ntStatus) { r0, _, _ := syscall.Syscall15(procNtCreateNamedPipeFile.Addr(), 14, uintptr(unsafe.Pointer(pipe)), uintptr(access), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(share), uintptr(disposition), uintptr(options), uintptr(typ), uintptr(readMode), uintptr(completionMode), uintptr(maxInstances), uintptr(inboundQuota), uintptr(outputQuota), uintptr(unsafe.Pointer(timeout)), 0) - status = ntstatus(r0) + status = ntStatus(r0) return } -func rtlDefaultNpAcl(dacl *uintptr) (status ntstatus) { +func rtlDefaultNpAcl(dacl *uintptr) (status ntStatus) { r0, _, _ := syscall.Syscall(procRtlDefaultNpAcl.Addr(), 1, uintptr(unsafe.Pointer(dacl)), 0, 0) - status = ntstatus(r0) + status = ntStatus(r0) return } -func rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntstatus) { +func rtlDosPathNameToNtPathName(name *uint16, ntName *unicodeString, filePart uintptr, reserved uintptr) (status ntStatus) { r0, _, _ := syscall.Syscall6(procRtlDosPathNameToNtPathName_U.Addr(), 4, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(ntName)), uintptr(filePart), uintptr(reserved), 0, 0) - status = ntstatus(r0) + status = ntStatus(r0) return } -func rtlNtStatusToDosError(status ntstatus) (winerr error) { +func rtlNtStatusToDosError(status ntStatus) (winerr error) { r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0) if r0 != 0 { winerr = syscall.Errno(r0) @@ -417,11 +436,3 @@ func wsaGetOverlappedResult(h syscall.Handle, o *syscall.Overlapped, bytes *uint } return } - -func bind(s syscall.Handle, name unsafe.Pointer, namelen int32) (err error) { - r1, _, e1 := syscall.Syscall(procbind.Addr(), 3, uintptr(s), uintptr(name), uintptr(namelen)) - if r1 == socketError { - err = errnoErr(e1) - } - return -} diff --git a/vendor/golang.org/x/mod/LICENSE b/vendor/golang.org/x/mod/LICENSE new file mode 100644 index 0000000000..6a66aea5ea --- /dev/null +++ b/vendor/golang.org/x/mod/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/mod/PATENTS b/vendor/golang.org/x/mod/PATENTS new file mode 100644 index 0000000000..733099041f --- /dev/null +++ b/vendor/golang.org/x/mod/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/mod/semver/semver.go b/vendor/golang.org/x/mod/semver/semver.go new file mode 100644 index 0000000000..a30a22bf20 --- /dev/null +++ b/vendor/golang.org/x/mod/semver/semver.go @@ -0,0 +1,401 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package semver implements comparison of semantic version strings. +// In this package, semantic version strings must begin with a leading "v", +// as in "v1.0.0". +// +// The general form of a semantic version string accepted by this package is +// +// vMAJOR[.MINOR[.PATCH[-PRERELEASE][+BUILD]]] +// +// where square brackets indicate optional parts of the syntax; +// MAJOR, MINOR, and PATCH are decimal integers without extra leading zeros; +// PRERELEASE and BUILD are each a series of non-empty dot-separated identifiers +// using only alphanumeric characters and hyphens; and +// all-numeric PRERELEASE identifiers must not have leading zeros. +// +// This package follows Semantic Versioning 2.0.0 (see semver.org) +// with two exceptions. First, it requires the "v" prefix. Second, it recognizes +// vMAJOR and vMAJOR.MINOR (with no prerelease or build suffixes) +// as shorthands for vMAJOR.0.0 and vMAJOR.MINOR.0. +package semver + +import "sort" + +// parsed returns the parsed form of a semantic version string. +type parsed struct { + major string + minor string + patch string + short string + prerelease string + build string +} + +// IsValid reports whether v is a valid semantic version string. +func IsValid(v string) bool { + _, ok := parse(v) + return ok +} + +// Canonical returns the canonical formatting of the semantic version v. +// It fills in any missing .MINOR or .PATCH and discards build metadata. +// Two semantic versions compare equal only if their canonical formattings +// are identical strings. +// The canonical invalid semantic version is the empty string. +func Canonical(v string) string { + p, ok := parse(v) + if !ok { + return "" + } + if p.build != "" { + return v[:len(v)-len(p.build)] + } + if p.short != "" { + return v + p.short + } + return v +} + +// Major returns the major version prefix of the semantic version v. +// For example, Major("v2.1.0") == "v2". +// If v is an invalid semantic version string, Major returns the empty string. +func Major(v string) string { + pv, ok := parse(v) + if !ok { + return "" + } + return v[:1+len(pv.major)] +} + +// MajorMinor returns the major.minor version prefix of the semantic version v. +// For example, MajorMinor("v2.1.0") == "v2.1". +// If v is an invalid semantic version string, MajorMinor returns the empty string. +func MajorMinor(v string) string { + pv, ok := parse(v) + if !ok { + return "" + } + i := 1 + len(pv.major) + if j := i + 1 + len(pv.minor); j <= len(v) && v[i] == '.' && v[i+1:j] == pv.minor { + return v[:j] + } + return v[:i] + "." + pv.minor +} + +// Prerelease returns the prerelease suffix of the semantic version v. +// For example, Prerelease("v2.1.0-pre+meta") == "-pre". +// If v is an invalid semantic version string, Prerelease returns the empty string. +func Prerelease(v string) string { + pv, ok := parse(v) + if !ok { + return "" + } + return pv.prerelease +} + +// Build returns the build suffix of the semantic version v. +// For example, Build("v2.1.0+meta") == "+meta". +// If v is an invalid semantic version string, Build returns the empty string. +func Build(v string) string { + pv, ok := parse(v) + if !ok { + return "" + } + return pv.build +} + +// Compare returns an integer comparing two versions according to +// semantic version precedence. +// The result will be 0 if v == w, -1 if v < w, or +1 if v > w. +// +// An invalid semantic version string is considered less than a valid one. +// All invalid semantic version strings compare equal to each other. +func Compare(v, w string) int { + pv, ok1 := parse(v) + pw, ok2 := parse(w) + if !ok1 && !ok2 { + return 0 + } + if !ok1 { + return -1 + } + if !ok2 { + return +1 + } + if c := compareInt(pv.major, pw.major); c != 0 { + return c + } + if c := compareInt(pv.minor, pw.minor); c != 0 { + return c + } + if c := compareInt(pv.patch, pw.patch); c != 0 { + return c + } + return comparePrerelease(pv.prerelease, pw.prerelease) +} + +// Max canonicalizes its arguments and then returns the version string +// that compares greater. +// +// Deprecated: use Compare instead. In most cases, returning a canonicalized +// version is not expected or desired. +func Max(v, w string) string { + v = Canonical(v) + w = Canonical(w) + if Compare(v, w) > 0 { + return v + } + return w +} + +// ByVersion implements sort.Interface for sorting semantic version strings. +type ByVersion []string + +func (vs ByVersion) Len() int { return len(vs) } +func (vs ByVersion) Swap(i, j int) { vs[i], vs[j] = vs[j], vs[i] } +func (vs ByVersion) Less(i, j int) bool { + cmp := Compare(vs[i], vs[j]) + if cmp != 0 { + return cmp < 0 + } + return vs[i] < vs[j] +} + +// Sort sorts a list of semantic version strings using ByVersion. +func Sort(list []string) { + sort.Sort(ByVersion(list)) +} + +func parse(v string) (p parsed, ok bool) { + if v == "" || v[0] != 'v' { + return + } + p.major, v, ok = parseInt(v[1:]) + if !ok { + return + } + if v == "" { + p.minor = "0" + p.patch = "0" + p.short = ".0.0" + return + } + if v[0] != '.' { + ok = false + return + } + p.minor, v, ok = parseInt(v[1:]) + if !ok { + return + } + if v == "" { + p.patch = "0" + p.short = ".0" + return + } + if v[0] != '.' { + ok = false + return + } + p.patch, v, ok = parseInt(v[1:]) + if !ok { + return + } + if len(v) > 0 && v[0] == '-' { + p.prerelease, v, ok = parsePrerelease(v) + if !ok { + return + } + } + if len(v) > 0 && v[0] == '+' { + p.build, v, ok = parseBuild(v) + if !ok { + return + } + } + if v != "" { + ok = false + return + } + ok = true + return +} + +func parseInt(v string) (t, rest string, ok bool) { + if v == "" { + return + } + if v[0] < '0' || '9' < v[0] { + return + } + i := 1 + for i < len(v) && '0' <= v[i] && v[i] <= '9' { + i++ + } + if v[0] == '0' && i != 1 { + return + } + return v[:i], v[i:], true +} + +func parsePrerelease(v string) (t, rest string, ok bool) { + // "A pre-release version MAY be denoted by appending a hyphen and + // a series of dot separated identifiers immediately following the patch version. + // Identifiers MUST comprise only ASCII alphanumerics and hyphen [0-9A-Za-z-]. + // Identifiers MUST NOT be empty. Numeric identifiers MUST NOT include leading zeroes." + if v == "" || v[0] != '-' { + return + } + i := 1 + start := 1 + for i < len(v) && v[i] != '+' { + if !isIdentChar(v[i]) && v[i] != '.' { + return + } + if v[i] == '.' { + if start == i || isBadNum(v[start:i]) { + return + } + start = i + 1 + } + i++ + } + if start == i || isBadNum(v[start:i]) { + return + } + return v[:i], v[i:], true +} + +func parseBuild(v string) (t, rest string, ok bool) { + if v == "" || v[0] != '+' { + return + } + i := 1 + start := 1 + for i < len(v) { + if !isIdentChar(v[i]) && v[i] != '.' { + return + } + if v[i] == '.' { + if start == i { + return + } + start = i + 1 + } + i++ + } + if start == i { + return + } + return v[:i], v[i:], true +} + +func isIdentChar(c byte) bool { + return 'A' <= c && c <= 'Z' || 'a' <= c && c <= 'z' || '0' <= c && c <= '9' || c == '-' +} + +func isBadNum(v string) bool { + i := 0 + for i < len(v) && '0' <= v[i] && v[i] <= '9' { + i++ + } + return i == len(v) && i > 1 && v[0] == '0' +} + +func isNum(v string) bool { + i := 0 + for i < len(v) && '0' <= v[i] && v[i] <= '9' { + i++ + } + return i == len(v) +} + +func compareInt(x, y string) int { + if x == y { + return 0 + } + if len(x) < len(y) { + return -1 + } + if len(x) > len(y) { + return +1 + } + if x < y { + return -1 + } else { + return +1 + } +} + +func comparePrerelease(x, y string) int { + // "When major, minor, and patch are equal, a pre-release version has + // lower precedence than a normal version. + // Example: 1.0.0-alpha < 1.0.0. + // Precedence for two pre-release versions with the same major, minor, + // and patch version MUST be determined by comparing each dot separated + // identifier from left to right until a difference is found as follows: + // identifiers consisting of only digits are compared numerically and + // identifiers with letters or hyphens are compared lexically in ASCII + // sort order. Numeric identifiers always have lower precedence than + // non-numeric identifiers. A larger set of pre-release fields has a + // higher precedence than a smaller set, if all of the preceding + // identifiers are equal. + // Example: 1.0.0-alpha < 1.0.0-alpha.1 < 1.0.0-alpha.beta < + // 1.0.0-beta < 1.0.0-beta.2 < 1.0.0-beta.11 < 1.0.0-rc.1 < 1.0.0." + if x == y { + return 0 + } + if x == "" { + return +1 + } + if y == "" { + return -1 + } + for x != "" && y != "" { + x = x[1:] // skip - or . + y = y[1:] // skip - or . + var dx, dy string + dx, x = nextIdent(x) + dy, y = nextIdent(y) + if dx != dy { + ix := isNum(dx) + iy := isNum(dy) + if ix != iy { + if ix { + return -1 + } else { + return +1 + } + } + if ix { + if len(dx) < len(dy) { + return -1 + } + if len(dx) > len(dy) { + return +1 + } + } + if dx < dy { + return -1 + } else { + return +1 + } + } + } + if x == "" { + return -1 + } else { + return +1 + } +} + +func nextIdent(x string) (dx, rest string) { + i := 0 + for i < len(x) && x[i] != '.' { + i++ + } + return x[:i], x[i:] +} diff --git a/vendor/golang.org/x/net/AUTHORS b/vendor/golang.org/x/net/AUTHORS deleted file mode 100644 index 15167cd746..0000000000 --- a/vendor/golang.org/x/net/AUTHORS +++ /dev/null @@ -1,3 +0,0 @@ -# This source code refers to The Go Authors for copyright purposes. -# The master list of authors is in the main Go distribution, -# visible at http://tip.golang.org/AUTHORS. diff --git a/vendor/golang.org/x/net/CONTRIBUTORS b/vendor/golang.org/x/net/CONTRIBUTORS deleted file mode 100644 index 1c4577e968..0000000000 --- a/vendor/golang.org/x/net/CONTRIBUTORS +++ /dev/null @@ -1,3 +0,0 @@ -# This source code was written by the Go contributors. -# The master list of contributors is in the main Go distribution, -# visible at http://tip.golang.org/CONTRIBUTORS. diff --git a/vendor/golang.org/x/sync/AUTHORS b/vendor/golang.org/x/sync/AUTHORS deleted file mode 100644 index 15167cd746..0000000000 --- a/vendor/golang.org/x/sync/AUTHORS +++ /dev/null @@ -1,3 +0,0 @@ -# This source code refers to The Go Authors for copyright purposes. -# The master list of authors is in the main Go distribution, -# visible at http://tip.golang.org/AUTHORS. diff --git a/vendor/golang.org/x/sync/CONTRIBUTORS b/vendor/golang.org/x/sync/CONTRIBUTORS deleted file mode 100644 index 1c4577e968..0000000000 --- a/vendor/golang.org/x/sync/CONTRIBUTORS +++ /dev/null @@ -1,3 +0,0 @@ -# This source code was written by the Go contributors. -# The master list of contributors is in the main Go distribution, -# visible at http://tip.golang.org/CONTRIBUTORS. diff --git a/vendor/golang.org/x/sys/AUTHORS b/vendor/golang.org/x/sys/AUTHORS deleted file mode 100644 index 15167cd746..0000000000 --- a/vendor/golang.org/x/sys/AUTHORS +++ /dev/null @@ -1,3 +0,0 @@ -# This source code refers to The Go Authors for copyright purposes. -# The master list of authors is in the main Go distribution, -# visible at http://tip.golang.org/AUTHORS. diff --git a/vendor/golang.org/x/sys/CONTRIBUTORS b/vendor/golang.org/x/sys/CONTRIBUTORS deleted file mode 100644 index 1c4577e968..0000000000 --- a/vendor/golang.org/x/sys/CONTRIBUTORS +++ /dev/null @@ -1,3 +0,0 @@ -# This source code was written by the Go contributors. -# The master list of contributors is in the main Go distribution, -# visible at http://tip.golang.org/CONTRIBUTORS. diff --git a/vendor/golang.org/x/sys/unix/mkerrors.sh b/vendor/golang.org/x/sys/unix/mkerrors.sh index ca50e4e14d..2ab44aa659 100644 --- a/vendor/golang.org/x/sys/unix/mkerrors.sh +++ b/vendor/golang.org/x/sys/unix/mkerrors.sh @@ -297,6 +297,10 @@ struct ltchars { #define SOL_NETLINK 270 #endif +#ifndef SOL_SMC +#define SOL_SMC 286 +#endif + #ifdef SOL_BLUETOOTH // SPARC includes this in /usr/include/sparc64-linux-gnu/bits/socket.h // but it is already in bluetooth_linux.go diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux.go b/vendor/golang.org/x/sys/unix/zerrors_linux.go index b0d6c27386..785d693eb3 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux.go @@ -2940,6 +2940,7 @@ const ( SOL_RAW = 0xff SOL_RDS = 0x114 SOL_RXRPC = 0x110 + SOL_SMC = 0x11e SOL_TCP = 0x6 SOL_TIPC = 0x10f SOL_TLS = 0x11a diff --git a/vendor/golang.org/x/tools/LICENSE b/vendor/golang.org/x/tools/LICENSE new file mode 100644 index 0000000000..6a66aea5ea --- /dev/null +++ b/vendor/golang.org/x/tools/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/tools/PATENTS b/vendor/golang.org/x/tools/PATENTS new file mode 100644 index 0000000000..733099041f --- /dev/null +++ b/vendor/golang.org/x/tools/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/tools/cmd/stringer/stringer.go b/vendor/golang.org/x/tools/cmd/stringer/stringer.go new file mode 100644 index 0000000000..b079985b36 --- /dev/null +++ b/vendor/golang.org/x/tools/cmd/stringer/stringer.go @@ -0,0 +1,658 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Stringer is a tool to automate the creation of methods that satisfy the fmt.Stringer +// interface. Given the name of a (signed or unsigned) integer type T that has constants +// defined, stringer will create a new self-contained Go source file implementing +// +// func (t T) String() string +// +// The file is created in the same package and directory as the package that defines T. +// It has helpful defaults designed for use with go generate. +// +// Stringer works best with constants that are consecutive values such as created using iota, +// but creates good code regardless. In the future it might also provide custom support for +// constant sets that are bit patterns. +// +// For example, given this snippet, +// +// package painkiller +// +// type Pill int +// +// const ( +// Placebo Pill = iota +// Aspirin +// Ibuprofen +// Paracetamol +// Acetaminophen = Paracetamol +// ) +// +// running this command +// +// stringer -type=Pill +// +// in the same directory will create the file pill_string.go, in package painkiller, +// containing a definition of +// +// func (Pill) String() string +// +// That method will translate the value of a Pill constant to the string representation +// of the respective constant name, so that the call fmt.Print(painkiller.Aspirin) will +// print the string "Aspirin". +// +// Typically this process would be run using go generate, like this: +// +// //go:generate stringer -type=Pill +// +// If multiple constants have the same value, the lexically first matching name will +// be used (in the example, Acetaminophen will print as "Paracetamol"). +// +// With no arguments, it processes the package in the current directory. +// Otherwise, the arguments must name a single directory holding a Go package +// or a set of Go source files that represent a single Go package. +// +// The -type flag accepts a comma-separated list of types so a single run can +// generate methods for multiple types. The default output file is t_string.go, +// where t is the lower-cased name of the first type listed. It can be overridden +// with the -output flag. +// +// The -linecomment flag tells stringer to generate the text of any line comment, trimmed +// of leading spaces, instead of the constant name. For instance, if the constants above had a +// Pill prefix, one could write +// +// PillAspirin // Aspirin +// +// to suppress it in the output. +package main // import "golang.org/x/tools/cmd/stringer" + +import ( + "bytes" + "flag" + "fmt" + "go/ast" + "go/constant" + "go/format" + "go/token" + "go/types" + "io/ioutil" + "log" + "os" + "path/filepath" + "sort" + "strings" + + "golang.org/x/tools/go/packages" +) + +var ( + typeNames = flag.String("type", "", "comma-separated list of type names; must be set") + output = flag.String("output", "", "output file name; default srcdir/_string.go") + trimprefix = flag.String("trimprefix", "", "trim the `prefix` from the generated constant names") + linecomment = flag.Bool("linecomment", false, "use line comment text as printed text when present") + buildTags = flag.String("tags", "", "comma-separated list of build tags to apply") +) + +// Usage is a replacement usage function for the flags package. +func Usage() { + fmt.Fprintf(os.Stderr, "Usage of stringer:\n") + fmt.Fprintf(os.Stderr, "\tstringer [flags] -type T [directory]\n") + fmt.Fprintf(os.Stderr, "\tstringer [flags] -type T files... # Must be a single package\n") + fmt.Fprintf(os.Stderr, "For more information, see:\n") + fmt.Fprintf(os.Stderr, "\thttps://pkg.go.dev/golang.org/x/tools/cmd/stringer\n") + fmt.Fprintf(os.Stderr, "Flags:\n") + flag.PrintDefaults() +} + +func main() { + log.SetFlags(0) + log.SetPrefix("stringer: ") + flag.Usage = Usage + flag.Parse() + if len(*typeNames) == 0 { + flag.Usage() + os.Exit(2) + } + types := strings.Split(*typeNames, ",") + var tags []string + if len(*buildTags) > 0 { + tags = strings.Split(*buildTags, ",") + } + + // We accept either one directory or a list of files. Which do we have? + args := flag.Args() + if len(args) == 0 { + // Default: process whole package in current directory. + args = []string{"."} + } + + // Parse the package once. + var dir string + g := Generator{ + trimPrefix: *trimprefix, + lineComment: *linecomment, + } + // TODO(suzmue): accept other patterns for packages (directories, list of files, import paths, etc). + if len(args) == 1 && isDirectory(args[0]) { + dir = args[0] + } else { + if len(tags) != 0 { + log.Fatal("-tags option applies only to directories, not when files are specified") + } + dir = filepath.Dir(args[0]) + } + + g.parsePackage(args, tags) + + // Print the header and package clause. + g.Printf("// Code generated by \"stringer %s\"; DO NOT EDIT.\n", strings.Join(os.Args[1:], " ")) + g.Printf("\n") + g.Printf("package %s", g.pkg.name) + g.Printf("\n") + g.Printf("import \"strconv\"\n") // Used by all methods. + + // Run generate for each type. + for _, typeName := range types { + g.generate(typeName) + } + + // Format the output. + src := g.format() + + // Write to file. + outputName := *output + if outputName == "" { + baseName := fmt.Sprintf("%s_string.go", types[0]) + outputName = filepath.Join(dir, strings.ToLower(baseName)) + } + err := ioutil.WriteFile(outputName, src, 0644) + if err != nil { + log.Fatalf("writing output: %s", err) + } +} + +// isDirectory reports whether the named file is a directory. +func isDirectory(name string) bool { + info, err := os.Stat(name) + if err != nil { + log.Fatal(err) + } + return info.IsDir() +} + +// Generator holds the state of the analysis. Primarily used to buffer +// the output for format.Source. +type Generator struct { + buf bytes.Buffer // Accumulated output. + pkg *Package // Package we are scanning. + + trimPrefix string + lineComment bool +} + +func (g *Generator) Printf(format string, args ...interface{}) { + fmt.Fprintf(&g.buf, format, args...) +} + +// File holds a single parsed file and associated data. +type File struct { + pkg *Package // Package to which this file belongs. + file *ast.File // Parsed AST. + // These fields are reset for each type being generated. + typeName string // Name of the constant type. + values []Value // Accumulator for constant values of that type. + + trimPrefix string + lineComment bool +} + +type Package struct { + name string + defs map[*ast.Ident]types.Object + files []*File +} + +// parsePackage analyzes the single package constructed from the patterns and tags. +// parsePackage exits if there is an error. +func (g *Generator) parsePackage(patterns []string, tags []string) { + cfg := &packages.Config{ + Mode: packages.NeedName | packages.NeedTypes | packages.NeedTypesInfo | packages.NeedSyntax, + // TODO: Need to think about constants in test files. Maybe write type_string_test.go + // in a separate pass? For later. + Tests: false, + BuildFlags: []string{fmt.Sprintf("-tags=%s", strings.Join(tags, " "))}, + } + pkgs, err := packages.Load(cfg, patterns...) + if err != nil { + log.Fatal(err) + } + if len(pkgs) != 1 { + log.Fatalf("error: %d packages found", len(pkgs)) + } + g.addPackage(pkgs[0]) +} + +// addPackage adds a type checked Package and its syntax files to the generator. +func (g *Generator) addPackage(pkg *packages.Package) { + g.pkg = &Package{ + name: pkg.Name, + defs: pkg.TypesInfo.Defs, + files: make([]*File, len(pkg.Syntax)), + } + + for i, file := range pkg.Syntax { + g.pkg.files[i] = &File{ + file: file, + pkg: g.pkg, + trimPrefix: g.trimPrefix, + lineComment: g.lineComment, + } + } +} + +// generate produces the String method for the named type. +func (g *Generator) generate(typeName string) { + values := make([]Value, 0, 100) + for _, file := range g.pkg.files { + // Set the state for this run of the walker. + file.typeName = typeName + file.values = nil + if file.file != nil { + ast.Inspect(file.file, file.genDecl) + values = append(values, file.values...) + } + } + + if len(values) == 0 { + log.Fatalf("no values defined for type %s", typeName) + } + // Generate code that will fail if the constants change value. + g.Printf("func _() {\n") + g.Printf("\t// An \"invalid array index\" compiler error signifies that the constant values have changed.\n") + g.Printf("\t// Re-run the stringer command to generate them again.\n") + g.Printf("\tvar x [1]struct{}\n") + for _, v := range values { + g.Printf("\t_ = x[%s - %s]\n", v.originalName, v.str) + } + g.Printf("}\n") + runs := splitIntoRuns(values) + // The decision of which pattern to use depends on the number of + // runs in the numbers. If there's only one, it's easy. For more than + // one, there's a tradeoff between complexity and size of the data + // and code vs. the simplicity of a map. A map takes more space, + // but so does the code. The decision here (crossover at 10) is + // arbitrary, but considers that for large numbers of runs the cost + // of the linear scan in the switch might become important, and + // rather than use yet another algorithm such as binary search, + // we punt and use a map. In any case, the likelihood of a map + // being necessary for any realistic example other than bitmasks + // is very low. And bitmasks probably deserve their own analysis, + // to be done some other day. + switch { + case len(runs) == 1: + g.buildOneRun(runs, typeName) + case len(runs) <= 10: + g.buildMultipleRuns(runs, typeName) + default: + g.buildMap(runs, typeName) + } +} + +// splitIntoRuns breaks the values into runs of contiguous sequences. +// For example, given 1,2,3,5,6,7 it returns {1,2,3},{5,6,7}. +// The input slice is known to be non-empty. +func splitIntoRuns(values []Value) [][]Value { + // We use stable sort so the lexically first name is chosen for equal elements. + sort.Stable(byValue(values)) + // Remove duplicates. Stable sort has put the one we want to print first, + // so use that one. The String method won't care about which named constant + // was the argument, so the first name for the given value is the only one to keep. + // We need to do this because identical values would cause the switch or map + // to fail to compile. + j := 1 + for i := 1; i < len(values); i++ { + if values[i].value != values[i-1].value { + values[j] = values[i] + j++ + } + } + values = values[:j] + runs := make([][]Value, 0, 10) + for len(values) > 0 { + // One contiguous sequence per outer loop. + i := 1 + for i < len(values) && values[i].value == values[i-1].value+1 { + i++ + } + runs = append(runs, values[:i]) + values = values[i:] + } + return runs +} + +// format returns the gofmt-ed contents of the Generator's buffer. +func (g *Generator) format() []byte { + src, err := format.Source(g.buf.Bytes()) + if err != nil { + // Should never happen, but can arise when developing this code. + // The user can compile the output to see the error. + log.Printf("warning: internal error: invalid Go generated: %s", err) + log.Printf("warning: compile the package to analyze the error") + return g.buf.Bytes() + } + return src +} + +// Value represents a declared constant. +type Value struct { + originalName string // The name of the constant. + name string // The name with trimmed prefix. + // The value is stored as a bit pattern alone. The boolean tells us + // whether to interpret it as an int64 or a uint64; the only place + // this matters is when sorting. + // Much of the time the str field is all we need; it is printed + // by Value.String. + value uint64 // Will be converted to int64 when needed. + signed bool // Whether the constant is a signed type. + str string // The string representation given by the "go/constant" package. +} + +func (v *Value) String() string { + return v.str +} + +// byValue lets us sort the constants into increasing order. +// We take care in the Less method to sort in signed or unsigned order, +// as appropriate. +type byValue []Value + +func (b byValue) Len() int { return len(b) } +func (b byValue) Swap(i, j int) { b[i], b[j] = b[j], b[i] } +func (b byValue) Less(i, j int) bool { + if b[i].signed { + return int64(b[i].value) < int64(b[j].value) + } + return b[i].value < b[j].value +} + +// genDecl processes one declaration clause. +func (f *File) genDecl(node ast.Node) bool { + decl, ok := node.(*ast.GenDecl) + if !ok || decl.Tok != token.CONST { + // We only care about const declarations. + return true + } + // The name of the type of the constants we are declaring. + // Can change if this is a multi-element declaration. + typ := "" + // Loop over the elements of the declaration. Each element is a ValueSpec: + // a list of names possibly followed by a type, possibly followed by values. + // If the type and value are both missing, we carry down the type (and value, + // but the "go/types" package takes care of that). + for _, spec := range decl.Specs { + vspec := spec.(*ast.ValueSpec) // Guaranteed to succeed as this is CONST. + if vspec.Type == nil && len(vspec.Values) > 0 { + // "X = 1". With no type but a value. If the constant is untyped, + // skip this vspec and reset the remembered type. + typ = "" + + // If this is a simple type conversion, remember the type. + // We don't mind if this is actually a call; a qualified call won't + // be matched (that will be SelectorExpr, not Ident), and only unusual + // situations will result in a function call that appears to be + // a type conversion. + ce, ok := vspec.Values[0].(*ast.CallExpr) + if !ok { + continue + } + id, ok := ce.Fun.(*ast.Ident) + if !ok { + continue + } + typ = id.Name + } + if vspec.Type != nil { + // "X T". We have a type. Remember it. + ident, ok := vspec.Type.(*ast.Ident) + if !ok { + continue + } + typ = ident.Name + } + if typ != f.typeName { + // This is not the type we're looking for. + continue + } + // We now have a list of names (from one line of source code) all being + // declared with the desired type. + // Grab their names and actual values and store them in f.values. + for _, name := range vspec.Names { + if name.Name == "_" { + continue + } + // This dance lets the type checker find the values for us. It's a + // bit tricky: look up the object declared by the name, find its + // types.Const, and extract its value. + obj, ok := f.pkg.defs[name] + if !ok { + log.Fatalf("no value for constant %s", name) + } + info := obj.Type().Underlying().(*types.Basic).Info() + if info&types.IsInteger == 0 { + log.Fatalf("can't handle non-integer constant type %s", typ) + } + value := obj.(*types.Const).Val() // Guaranteed to succeed as this is CONST. + if value.Kind() != constant.Int { + log.Fatalf("can't happen: constant is not an integer %s", name) + } + i64, isInt := constant.Int64Val(value) + u64, isUint := constant.Uint64Val(value) + if !isInt && !isUint { + log.Fatalf("internal error: value of %s is not an integer: %s", name, value.String()) + } + if !isInt { + u64 = uint64(i64) + } + v := Value{ + originalName: name.Name, + value: u64, + signed: info&types.IsUnsigned == 0, + str: value.String(), + } + if c := vspec.Comment; f.lineComment && c != nil && len(c.List) == 1 { + v.name = strings.TrimSpace(c.Text()) + } else { + v.name = strings.TrimPrefix(v.originalName, f.trimPrefix) + } + f.values = append(f.values, v) + } + } + return false +} + +// Helpers + +// usize returns the number of bits of the smallest unsigned integer +// type that will hold n. Used to create the smallest possible slice of +// integers to use as indexes into the concatenated strings. +func usize(n int) int { + switch { + case n < 1<<8: + return 8 + case n < 1<<16: + return 16 + default: + // 2^32 is enough constants for anyone. + return 32 + } +} + +// declareIndexAndNameVars declares the index slices and concatenated names +// strings representing the runs of values. +func (g *Generator) declareIndexAndNameVars(runs [][]Value, typeName string) { + var indexes, names []string + for i, run := range runs { + index, name := g.createIndexAndNameDecl(run, typeName, fmt.Sprintf("_%d", i)) + if len(run) != 1 { + indexes = append(indexes, index) + } + names = append(names, name) + } + g.Printf("const (\n") + for _, name := range names { + g.Printf("\t%s\n", name) + } + g.Printf(")\n\n") + + if len(indexes) > 0 { + g.Printf("var (") + for _, index := range indexes { + g.Printf("\t%s\n", index) + } + g.Printf(")\n\n") + } +} + +// declareIndexAndNameVar is the single-run version of declareIndexAndNameVars +func (g *Generator) declareIndexAndNameVar(run []Value, typeName string) { + index, name := g.createIndexAndNameDecl(run, typeName, "") + g.Printf("const %s\n", name) + g.Printf("var %s\n", index) +} + +// createIndexAndNameDecl returns the pair of declarations for the run. The caller will add "const" and "var". +func (g *Generator) createIndexAndNameDecl(run []Value, typeName string, suffix string) (string, string) { + b := new(bytes.Buffer) + indexes := make([]int, len(run)) + for i := range run { + b.WriteString(run[i].name) + indexes[i] = b.Len() + } + nameConst := fmt.Sprintf("_%s_name%s = %q", typeName, suffix, b.String()) + nameLen := b.Len() + b.Reset() + fmt.Fprintf(b, "_%s_index%s = [...]uint%d{0, ", typeName, suffix, usize(nameLen)) + for i, v := range indexes { + if i > 0 { + fmt.Fprintf(b, ", ") + } + fmt.Fprintf(b, "%d", v) + } + fmt.Fprintf(b, "}") + return b.String(), nameConst +} + +// declareNameVars declares the concatenated names string representing all the values in the runs. +func (g *Generator) declareNameVars(runs [][]Value, typeName string, suffix string) { + g.Printf("const _%s_name%s = \"", typeName, suffix) + for _, run := range runs { + for i := range run { + g.Printf("%s", run[i].name) + } + } + g.Printf("\"\n") +} + +// buildOneRun generates the variables and String method for a single run of contiguous values. +func (g *Generator) buildOneRun(runs [][]Value, typeName string) { + values := runs[0] + g.Printf("\n") + g.declareIndexAndNameVar(values, typeName) + // The generated code is simple enough to write as a Printf format. + lessThanZero := "" + if values[0].signed { + lessThanZero = "i < 0 || " + } + if values[0].value == 0 { // Signed or unsigned, 0 is still 0. + g.Printf(stringOneRun, typeName, usize(len(values)), lessThanZero) + } else { + g.Printf(stringOneRunWithOffset, typeName, values[0].String(), usize(len(values)), lessThanZero) + } +} + +// Arguments to format are: +// +// [1]: type name +// [2]: size of index element (8 for uint8 etc.) +// [3]: less than zero check (for signed types) +const stringOneRun = `func (i %[1]s) String() string { + if %[3]si >= %[1]s(len(_%[1]s_index)-1) { + return "%[1]s(" + strconv.FormatInt(int64(i), 10) + ")" + } + return _%[1]s_name[_%[1]s_index[i]:_%[1]s_index[i+1]] +} +` + +// Arguments to format are: +// [1]: type name +// [2]: lowest defined value for type, as a string +// [3]: size of index element (8 for uint8 etc.) +// [4]: less than zero check (for signed types) +/* + */ +const stringOneRunWithOffset = `func (i %[1]s) String() string { + i -= %[2]s + if %[4]si >= %[1]s(len(_%[1]s_index)-1) { + return "%[1]s(" + strconv.FormatInt(int64(i + %[2]s), 10) + ")" + } + return _%[1]s_name[_%[1]s_index[i] : _%[1]s_index[i+1]] +} +` + +// buildMultipleRuns generates the variables and String method for multiple runs of contiguous values. +// For this pattern, a single Printf format won't do. +func (g *Generator) buildMultipleRuns(runs [][]Value, typeName string) { + g.Printf("\n") + g.declareIndexAndNameVars(runs, typeName) + g.Printf("func (i %s) String() string {\n", typeName) + g.Printf("\tswitch {\n") + for i, values := range runs { + if len(values) == 1 { + g.Printf("\tcase i == %s:\n", &values[0]) + g.Printf("\t\treturn _%s_name_%d\n", typeName, i) + continue + } + if values[0].value == 0 && !values[0].signed { + // For an unsigned lower bound of 0, "0 <= i" would be redundant. + g.Printf("\tcase i <= %s:\n", &values[len(values)-1]) + } else { + g.Printf("\tcase %s <= i && i <= %s:\n", &values[0], &values[len(values)-1]) + } + if values[0].value != 0 { + g.Printf("\t\ti -= %s\n", &values[0]) + } + g.Printf("\t\treturn _%s_name_%d[_%s_index_%d[i]:_%s_index_%d[i+1]]\n", + typeName, i, typeName, i, typeName, i) + } + g.Printf("\tdefault:\n") + g.Printf("\t\treturn \"%s(\" + strconv.FormatInt(int64(i), 10) + \")\"\n", typeName) + g.Printf("\t}\n") + g.Printf("}\n") +} + +// buildMap handles the case where the space is so sparse a map is a reasonable fallback. +// It's a rare situation but has simple code. +func (g *Generator) buildMap(runs [][]Value, typeName string) { + g.Printf("\n") + g.declareNameVars(runs, typeName, "") + g.Printf("\nvar _%s_map = map[%s]string{\n", typeName, typeName) + n := 0 + for _, values := range runs { + for _, value := range values { + g.Printf("\t%s: _%s_name[%d:%d],\n", &value, typeName, n, n+len(value.name)) + n += len(value.name) + } + } + g.Printf("}\n\n") + g.Printf(stringMap, typeName) +} + +// Argument to format is the type name. +const stringMap = `func (i %[1]s) String() string { + if str, ok := _%[1]s_map[i]; ok { + return str + } + return "%[1]s(" + strconv.FormatInt(int64(i), 10) + ")" +} +` diff --git a/vendor/golang.org/x/tools/go/gcexportdata/gcexportdata.go b/vendor/golang.org/x/tools/go/gcexportdata/gcexportdata.go new file mode 100644 index 0000000000..2ed25a7502 --- /dev/null +++ b/vendor/golang.org/x/tools/go/gcexportdata/gcexportdata.go @@ -0,0 +1,177 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package gcexportdata provides functions for locating, reading, and +// writing export data files containing type information produced by the +// gc compiler. This package supports go1.7 export data format and all +// later versions. +// +// Although it might seem convenient for this package to live alongside +// go/types in the standard library, this would cause version skew +// problems for developer tools that use it, since they must be able to +// consume the outputs of the gc compiler both before and after a Go +// update such as from Go 1.7 to Go 1.8. Because this package lives in +// golang.org/x/tools, sites can update their version of this repo some +// time before the Go 1.8 release and rebuild and redeploy their +// developer tools, which will then be able to consume both Go 1.7 and +// Go 1.8 export data files, so they will work before and after the +// Go update. (See discussion at https://golang.org/issue/15651.) +package gcexportdata // import "golang.org/x/tools/go/gcexportdata" + +import ( + "bufio" + "bytes" + "encoding/json" + "fmt" + "go/token" + "go/types" + "io" + "io/ioutil" + "os/exec" + + "golang.org/x/tools/go/internal/gcimporter" +) + +// Find returns the name of an object (.o) or archive (.a) file +// containing type information for the specified import path, +// using the go command. +// If no file was found, an empty filename is returned. +// +// A relative srcDir is interpreted relative to the current working directory. +// +// Find also returns the package's resolved (canonical) import path, +// reflecting the effects of srcDir and vendoring on importPath. +// +// Deprecated: Use the higher-level API in golang.org/x/tools/go/packages, +// which is more efficient. +func Find(importPath, srcDir string) (filename, path string) { + cmd := exec.Command("go", "list", "-json", "-export", "--", importPath) + cmd.Dir = srcDir + out, err := cmd.CombinedOutput() + if err != nil { + return "", "" + } + var data struct { + ImportPath string + Export string + } + json.Unmarshal(out, &data) + return data.Export, data.ImportPath +} + +// NewReader returns a reader for the export data section of an object +// (.o) or archive (.a) file read from r. The new reader may provide +// additional trailing data beyond the end of the export data. +func NewReader(r io.Reader) (io.Reader, error) { + buf := bufio.NewReader(r) + _, size, err := gcimporter.FindExportData(buf) + if err != nil { + return nil, err + } + + if size >= 0 { + // We were given an archive and found the __.PKGDEF in it. + // This tells us the size of the export data, and we don't + // need to return the entire file. + return &io.LimitedReader{ + R: buf, + N: size, + }, nil + } else { + // We were given an object file. As such, we don't know how large + // the export data is and must return the entire file. + return buf, nil + } +} + +// Read reads export data from in, decodes it, and returns type +// information for the package. +// The package name is specified by path. +// File position information is added to fset. +// +// Read may inspect and add to the imports map to ensure that references +// within the export data to other packages are consistent. The caller +// must ensure that imports[path] does not exist, or exists but is +// incomplete (see types.Package.Complete), and Read inserts the +// resulting package into this map entry. +// +// On return, the state of the reader is undefined. +func Read(in io.Reader, fset *token.FileSet, imports map[string]*types.Package, path string) (*types.Package, error) { + data, err := ioutil.ReadAll(in) + if err != nil { + return nil, fmt.Errorf("reading export data for %q: %v", path, err) + } + + if bytes.HasPrefix(data, []byte("!")) { + return nil, fmt.Errorf("can't read export data for %q directly from an archive file (call gcexportdata.NewReader first to extract export data)", path) + } + + // The App Engine Go runtime v1.6 uses the old export data format. + // TODO(adonovan): delete once v1.7 has been around for a while. + if bytes.HasPrefix(data, []byte("package ")) { + return gcimporter.ImportData(imports, path, path, bytes.NewReader(data)) + } + + // The indexed export format starts with an 'i'; the older + // binary export format starts with a 'c', 'd', or 'v' + // (from "version"). Select appropriate importer. + if len(data) > 0 { + switch data[0] { + case 'i': + _, pkg, err := gcimporter.IImportData(fset, imports, data[1:], path) + return pkg, err + + case 'v', 'c', 'd': + _, pkg, err := gcimporter.BImportData(fset, imports, data, path) + return pkg, err + + case 'u': + _, pkg, err := gcimporter.UImportData(fset, imports, data[1:], path) + return pkg, err + + default: + l := len(data) + if l > 10 { + l = 10 + } + return nil, fmt.Errorf("unexpected export data with prefix %q for path %s", string(data[:l]), path) + } + } + return nil, fmt.Errorf("empty export data for %s", path) +} + +// Write writes encoded type information for the specified package to out. +// The FileSet provides file position information for named objects. +func Write(out io.Writer, fset *token.FileSet, pkg *types.Package) error { + if _, err := io.WriteString(out, "i"); err != nil { + return err + } + return gcimporter.IExportData(out, fset, pkg) +} + +// ReadBundle reads an export bundle from in, decodes it, and returns type +// information for the packages. +// File position information is added to fset. +// +// ReadBundle may inspect and add to the imports map to ensure that references +// within the export bundle to other packages are consistent. +// +// On return, the state of the reader is undefined. +// +// Experimental: This API is experimental and may change in the future. +func ReadBundle(in io.Reader, fset *token.FileSet, imports map[string]*types.Package) ([]*types.Package, error) { + data, err := ioutil.ReadAll(in) + if err != nil { + return nil, fmt.Errorf("reading export bundle: %v", err) + } + return gcimporter.IImportBundle(fset, imports, data) +} + +// WriteBundle writes encoded type information for the specified packages to out. +// The FileSet provides file position information for named objects. +// +// Experimental: This API is experimental and may change in the future. +func WriteBundle(out io.Writer, fset *token.FileSet, pkgs []*types.Package) error { + return gcimporter.IExportBundle(out, fset, pkgs) +} diff --git a/vendor/golang.org/x/tools/go/gcexportdata/importer.go b/vendor/golang.org/x/tools/go/gcexportdata/importer.go new file mode 100644 index 0000000000..37a7247e26 --- /dev/null +++ b/vendor/golang.org/x/tools/go/gcexportdata/importer.go @@ -0,0 +1,75 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package gcexportdata + +import ( + "fmt" + "go/token" + "go/types" + "os" +) + +// NewImporter returns a new instance of the types.Importer interface +// that reads type information from export data files written by gc. +// The Importer also satisfies types.ImporterFrom. +// +// Export data files are located using "go build" workspace conventions +// and the build.Default context. +// +// Use this importer instead of go/importer.For("gc", ...) to avoid the +// version-skew problems described in the documentation of this package, +// or to control the FileSet or access the imports map populated during +// package loading. +// +// Deprecated: Use the higher-level API in golang.org/x/tools/go/packages, +// which is more efficient. +func NewImporter(fset *token.FileSet, imports map[string]*types.Package) types.ImporterFrom { + return importer{fset, imports} +} + +type importer struct { + fset *token.FileSet + imports map[string]*types.Package +} + +func (imp importer) Import(importPath string) (*types.Package, error) { + return imp.ImportFrom(importPath, "", 0) +} + +func (imp importer) ImportFrom(importPath, srcDir string, mode types.ImportMode) (_ *types.Package, err error) { + filename, path := Find(importPath, srcDir) + if filename == "" { + if importPath == "unsafe" { + // Even for unsafe, call Find first in case + // the package was vendored. + return types.Unsafe, nil + } + return nil, fmt.Errorf("can't find import: %s", importPath) + } + + if pkg, ok := imp.imports[path]; ok && pkg.Complete() { + return pkg, nil // cache hit + } + + // open file + f, err := os.Open(filename) + if err != nil { + return nil, err + } + defer func() { + f.Close() + if err != nil { + // add file name to error + err = fmt.Errorf("reading export data: %s: %v", filename, err) + } + }() + + r, err := NewReader(f) + if err != nil { + return nil, err + } + + return Read(r, imp.fset, imp.imports, path) +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/bexport.go b/vendor/golang.org/x/tools/go/internal/gcimporter/bexport.go new file mode 100644 index 0000000000..196cb3f9b4 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/bexport.go @@ -0,0 +1,853 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Binary package export. +// This file was derived from $GOROOT/src/cmd/compile/internal/gc/bexport.go; +// see that file for specification of the format. + +package gcimporter + +import ( + "bytes" + "encoding/binary" + "fmt" + "go/ast" + "go/constant" + "go/token" + "go/types" + "math" + "math/big" + "sort" + "strings" +) + +// If debugFormat is set, each integer and string value is preceded by a marker +// and position information in the encoding. This mechanism permits an importer +// to recognize immediately when it is out of sync. The importer recognizes this +// mode automatically (i.e., it can import export data produced with debugging +// support even if debugFormat is not set at the time of import). This mode will +// lead to massively larger export data (by a factor of 2 to 3) and should only +// be enabled during development and debugging. +// +// NOTE: This flag is the first flag to enable if importing dies because of +// (suspected) format errors, and whenever a change is made to the format. +const debugFormat = false // default: false + +// Current export format version. Increase with each format change. +// +// Note: The latest binary (non-indexed) export format is at version 6. +// This exporter is still at level 4, but it doesn't matter since +// the binary importer can handle older versions just fine. +// +// 6: package height (CL 105038) -- NOT IMPLEMENTED HERE +// 5: improved position encoding efficiency (issue 20080, CL 41619) -- NOT IMPLEMENTED HERE +// 4: type name objects support type aliases, uses aliasTag +// 3: Go1.8 encoding (same as version 2, aliasTag defined but never used) +// 2: removed unused bool in ODCL export (compiler only) +// 1: header format change (more regular), export package for _ struct fields +// 0: Go1.7 encoding +const exportVersion = 4 + +// trackAllTypes enables cycle tracking for all types, not just named +// types. The existing compiler invariants assume that unnamed types +// that are not completely set up are not used, or else there are spurious +// errors. +// If disabled, only named types are tracked, possibly leading to slightly +// less efficient encoding in rare cases. It also prevents the export of +// some corner-case type declarations (but those are not handled correctly +// with with the textual export format either). +// TODO(gri) enable and remove once issues caused by it are fixed +const trackAllTypes = false + +type exporter struct { + fset *token.FileSet + out bytes.Buffer + + // object -> index maps, indexed in order of serialization + strIndex map[string]int + pkgIndex map[*types.Package]int + typIndex map[types.Type]int + + // position encoding + posInfoFormat bool + prevFile string + prevLine int + + // debugging support + written int // bytes written + indent int // for trace +} + +// internalError represents an error generated inside this package. +type internalError string + +func (e internalError) Error() string { return "gcimporter: " + string(e) } + +func internalErrorf(format string, args ...interface{}) error { + return internalError(fmt.Sprintf(format, args...)) +} + +// BExportData returns binary export data for pkg. +// If no file set is provided, position info will be missing. +func BExportData(fset *token.FileSet, pkg *types.Package) (b []byte, err error) { + if !debug { + defer func() { + if e := recover(); e != nil { + if ierr, ok := e.(internalError); ok { + err = ierr + return + } + // Not an internal error; panic again. + panic(e) + } + }() + } + + p := exporter{ + fset: fset, + strIndex: map[string]int{"": 0}, // empty string is mapped to 0 + pkgIndex: make(map[*types.Package]int), + typIndex: make(map[types.Type]int), + posInfoFormat: true, // TODO(gri) might become a flag, eventually + } + + // write version info + // The version string must start with "version %d" where %d is the version + // number. Additional debugging information may follow after a blank; that + // text is ignored by the importer. + p.rawStringln(fmt.Sprintf("version %d", exportVersion)) + var debug string + if debugFormat { + debug = "debug" + } + p.rawStringln(debug) // cannot use p.bool since it's affected by debugFormat; also want to see this clearly + p.bool(trackAllTypes) + p.bool(p.posInfoFormat) + + // --- generic export data --- + + // populate type map with predeclared "known" types + for index, typ := range predeclared() { + p.typIndex[typ] = index + } + if len(p.typIndex) != len(predeclared()) { + return nil, internalError("duplicate entries in type map?") + } + + // write package data + p.pkg(pkg, true) + if trace { + p.tracef("\n") + } + + // write objects + objcount := 0 + scope := pkg.Scope() + for _, name := range scope.Names() { + if !ast.IsExported(name) { + continue + } + if trace { + p.tracef("\n") + } + p.obj(scope.Lookup(name)) + objcount++ + } + + // indicate end of list + if trace { + p.tracef("\n") + } + p.tag(endTag) + + // for self-verification only (redundant) + p.int(objcount) + + if trace { + p.tracef("\n") + } + + // --- end of export data --- + + return p.out.Bytes(), nil +} + +func (p *exporter) pkg(pkg *types.Package, emptypath bool) { + if pkg == nil { + panic(internalError("unexpected nil pkg")) + } + + // if we saw the package before, write its index (>= 0) + if i, ok := p.pkgIndex[pkg]; ok { + p.index('P', i) + return + } + + // otherwise, remember the package, write the package tag (< 0) and package data + if trace { + p.tracef("P%d = { ", len(p.pkgIndex)) + defer p.tracef("} ") + } + p.pkgIndex[pkg] = len(p.pkgIndex) + + p.tag(packageTag) + p.string(pkg.Name()) + if emptypath { + p.string("") + } else { + p.string(pkg.Path()) + } +} + +func (p *exporter) obj(obj types.Object) { + switch obj := obj.(type) { + case *types.Const: + p.tag(constTag) + p.pos(obj) + p.qualifiedName(obj) + p.typ(obj.Type()) + p.value(obj.Val()) + + case *types.TypeName: + if obj.IsAlias() { + p.tag(aliasTag) + p.pos(obj) + p.qualifiedName(obj) + } else { + p.tag(typeTag) + } + p.typ(obj.Type()) + + case *types.Var: + p.tag(varTag) + p.pos(obj) + p.qualifiedName(obj) + p.typ(obj.Type()) + + case *types.Func: + p.tag(funcTag) + p.pos(obj) + p.qualifiedName(obj) + sig := obj.Type().(*types.Signature) + p.paramList(sig.Params(), sig.Variadic()) + p.paramList(sig.Results(), false) + + default: + panic(internalErrorf("unexpected object %v (%T)", obj, obj)) + } +} + +func (p *exporter) pos(obj types.Object) { + if !p.posInfoFormat { + return + } + + file, line := p.fileLine(obj) + if file == p.prevFile { + // common case: write line delta + // delta == 0 means different file or no line change + delta := line - p.prevLine + p.int(delta) + if delta == 0 { + p.int(-1) // -1 means no file change + } + } else { + // different file + p.int(0) + // Encode filename as length of common prefix with previous + // filename, followed by (possibly empty) suffix. Filenames + // frequently share path prefixes, so this can save a lot + // of space and make export data size less dependent on file + // path length. The suffix is unlikely to be empty because + // file names tend to end in ".go". + n := commonPrefixLen(p.prevFile, file) + p.int(n) // n >= 0 + p.string(file[n:]) // write suffix only + p.prevFile = file + p.int(line) + } + p.prevLine = line +} + +func (p *exporter) fileLine(obj types.Object) (file string, line int) { + if p.fset != nil { + pos := p.fset.Position(obj.Pos()) + file = pos.Filename + line = pos.Line + } + return +} + +func commonPrefixLen(a, b string) int { + if len(a) > len(b) { + a, b = b, a + } + // len(a) <= len(b) + i := 0 + for i < len(a) && a[i] == b[i] { + i++ + } + return i +} + +func (p *exporter) qualifiedName(obj types.Object) { + p.string(obj.Name()) + p.pkg(obj.Pkg(), false) +} + +func (p *exporter) typ(t types.Type) { + if t == nil { + panic(internalError("nil type")) + } + + // Possible optimization: Anonymous pointer types *T where + // T is a named type are common. We could canonicalize all + // such types *T to a single type PT = *T. This would lead + // to at most one *T entry in typIndex, and all future *T's + // would be encoded as the respective index directly. Would + // save 1 byte (pointerTag) per *T and reduce the typIndex + // size (at the cost of a canonicalization map). We can do + // this later, without encoding format change. + + // if we saw the type before, write its index (>= 0) + if i, ok := p.typIndex[t]; ok { + p.index('T', i) + return + } + + // otherwise, remember the type, write the type tag (< 0) and type data + if trackAllTypes { + if trace { + p.tracef("T%d = {>\n", len(p.typIndex)) + defer p.tracef("<\n} ") + } + p.typIndex[t] = len(p.typIndex) + } + + switch t := t.(type) { + case *types.Named: + if !trackAllTypes { + // if we don't track all types, track named types now + p.typIndex[t] = len(p.typIndex) + } + + p.tag(namedTag) + p.pos(t.Obj()) + p.qualifiedName(t.Obj()) + p.typ(t.Underlying()) + if !types.IsInterface(t) { + p.assocMethods(t) + } + + case *types.Array: + p.tag(arrayTag) + p.int64(t.Len()) + p.typ(t.Elem()) + + case *types.Slice: + p.tag(sliceTag) + p.typ(t.Elem()) + + case *dddSlice: + p.tag(dddTag) + p.typ(t.elem) + + case *types.Struct: + p.tag(structTag) + p.fieldList(t) + + case *types.Pointer: + p.tag(pointerTag) + p.typ(t.Elem()) + + case *types.Signature: + p.tag(signatureTag) + p.paramList(t.Params(), t.Variadic()) + p.paramList(t.Results(), false) + + case *types.Interface: + p.tag(interfaceTag) + p.iface(t) + + case *types.Map: + p.tag(mapTag) + p.typ(t.Key()) + p.typ(t.Elem()) + + case *types.Chan: + p.tag(chanTag) + p.int(int(3 - t.Dir())) // hack + p.typ(t.Elem()) + + default: + panic(internalErrorf("unexpected type %T: %s", t, t)) + } +} + +func (p *exporter) assocMethods(named *types.Named) { + // Sort methods (for determinism). + var methods []*types.Func + for i := 0; i < named.NumMethods(); i++ { + methods = append(methods, named.Method(i)) + } + sort.Sort(methodsByName(methods)) + + p.int(len(methods)) + + if trace && methods != nil { + p.tracef("associated methods {>\n") + } + + for i, m := range methods { + if trace && i > 0 { + p.tracef("\n") + } + + p.pos(m) + name := m.Name() + p.string(name) + if !exported(name) { + p.pkg(m.Pkg(), false) + } + + sig := m.Type().(*types.Signature) + p.paramList(types.NewTuple(sig.Recv()), false) + p.paramList(sig.Params(), sig.Variadic()) + p.paramList(sig.Results(), false) + p.int(0) // dummy value for go:nointerface pragma - ignored by importer + } + + if trace && methods != nil { + p.tracef("<\n} ") + } +} + +type methodsByName []*types.Func + +func (x methodsByName) Len() int { return len(x) } +func (x methodsByName) Swap(i, j int) { x[i], x[j] = x[j], x[i] } +func (x methodsByName) Less(i, j int) bool { return x[i].Name() < x[j].Name() } + +func (p *exporter) fieldList(t *types.Struct) { + if trace && t.NumFields() > 0 { + p.tracef("fields {>\n") + defer p.tracef("<\n} ") + } + + p.int(t.NumFields()) + for i := 0; i < t.NumFields(); i++ { + if trace && i > 0 { + p.tracef("\n") + } + p.field(t.Field(i)) + p.string(t.Tag(i)) + } +} + +func (p *exporter) field(f *types.Var) { + if !f.IsField() { + panic(internalError("field expected")) + } + + p.pos(f) + p.fieldName(f) + p.typ(f.Type()) +} + +func (p *exporter) iface(t *types.Interface) { + // TODO(gri): enable importer to load embedded interfaces, + // then emit Embeddeds and ExplicitMethods separately here. + p.int(0) + + n := t.NumMethods() + if trace && n > 0 { + p.tracef("methods {>\n") + defer p.tracef("<\n} ") + } + p.int(n) + for i := 0; i < n; i++ { + if trace && i > 0 { + p.tracef("\n") + } + p.method(t.Method(i)) + } +} + +func (p *exporter) method(m *types.Func) { + sig := m.Type().(*types.Signature) + if sig.Recv() == nil { + panic(internalError("method expected")) + } + + p.pos(m) + p.string(m.Name()) + if m.Name() != "_" && !ast.IsExported(m.Name()) { + p.pkg(m.Pkg(), false) + } + + // interface method; no need to encode receiver. + p.paramList(sig.Params(), sig.Variadic()) + p.paramList(sig.Results(), false) +} + +func (p *exporter) fieldName(f *types.Var) { + name := f.Name() + + if f.Anonymous() { + // anonymous field - we distinguish between 3 cases: + // 1) field name matches base type name and is exported + // 2) field name matches base type name and is not exported + // 3) field name doesn't match base type name (alias name) + bname := basetypeName(f.Type()) + if name == bname { + if ast.IsExported(name) { + name = "" // 1) we don't need to know the field name or package + } else { + name = "?" // 2) use unexported name "?" to force package export + } + } else { + // 3) indicate alias and export name as is + // (this requires an extra "@" but this is a rare case) + p.string("@") + } + } + + p.string(name) + if name != "" && !ast.IsExported(name) { + p.pkg(f.Pkg(), false) + } +} + +func basetypeName(typ types.Type) string { + switch typ := deref(typ).(type) { + case *types.Basic: + return typ.Name() + case *types.Named: + return typ.Obj().Name() + default: + return "" // unnamed type + } +} + +func (p *exporter) paramList(params *types.Tuple, variadic bool) { + // use negative length to indicate unnamed parameters + // (look at the first parameter only since either all + // names are present or all are absent) + n := params.Len() + if n > 0 && params.At(0).Name() == "" { + n = -n + } + p.int(n) + for i := 0; i < params.Len(); i++ { + q := params.At(i) + t := q.Type() + if variadic && i == params.Len()-1 { + t = &dddSlice{t.(*types.Slice).Elem()} + } + p.typ(t) + if n > 0 { + name := q.Name() + p.string(name) + if name != "_" { + p.pkg(q.Pkg(), false) + } + } + p.string("") // no compiler-specific info + } +} + +func (p *exporter) value(x constant.Value) { + if trace { + p.tracef("= ") + } + + switch x.Kind() { + case constant.Bool: + tag := falseTag + if constant.BoolVal(x) { + tag = trueTag + } + p.tag(tag) + + case constant.Int: + if v, exact := constant.Int64Val(x); exact { + // common case: x fits into an int64 - use compact encoding + p.tag(int64Tag) + p.int64(v) + return + } + // uncommon case: large x - use float encoding + // (powers of 2 will be encoded efficiently with exponent) + p.tag(floatTag) + p.float(constant.ToFloat(x)) + + case constant.Float: + p.tag(floatTag) + p.float(x) + + case constant.Complex: + p.tag(complexTag) + p.float(constant.Real(x)) + p.float(constant.Imag(x)) + + case constant.String: + p.tag(stringTag) + p.string(constant.StringVal(x)) + + case constant.Unknown: + // package contains type errors + p.tag(unknownTag) + + default: + panic(internalErrorf("unexpected value %v (%T)", x, x)) + } +} + +func (p *exporter) float(x constant.Value) { + if x.Kind() != constant.Float { + panic(internalErrorf("unexpected constant %v, want float", x)) + } + // extract sign (there is no -0) + sign := constant.Sign(x) + if sign == 0 { + // x == 0 + p.int(0) + return + } + // x != 0 + + var f big.Float + if v, exact := constant.Float64Val(x); exact { + // float64 + f.SetFloat64(v) + } else if num, denom := constant.Num(x), constant.Denom(x); num.Kind() == constant.Int { + // TODO(gri): add big.Rat accessor to constant.Value. + r := valueToRat(num) + f.SetRat(r.Quo(r, valueToRat(denom))) + } else { + // Value too large to represent as a fraction => inaccessible. + // TODO(gri): add big.Float accessor to constant.Value. + f.SetFloat64(math.MaxFloat64) // FIXME + } + + // extract exponent such that 0.5 <= m < 1.0 + var m big.Float + exp := f.MantExp(&m) + + // extract mantissa as *big.Int + // - set exponent large enough so mant satisfies mant.IsInt() + // - get *big.Int from mant + m.SetMantExp(&m, int(m.MinPrec())) + mant, acc := m.Int(nil) + if acc != big.Exact { + panic(internalError("internal error")) + } + + p.int(sign) + p.int(exp) + p.string(string(mant.Bytes())) +} + +func valueToRat(x constant.Value) *big.Rat { + // Convert little-endian to big-endian. + // I can't believe this is necessary. + bytes := constant.Bytes(x) + for i := 0; i < len(bytes)/2; i++ { + bytes[i], bytes[len(bytes)-1-i] = bytes[len(bytes)-1-i], bytes[i] + } + return new(big.Rat).SetInt(new(big.Int).SetBytes(bytes)) +} + +func (p *exporter) bool(b bool) bool { + if trace { + p.tracef("[") + defer p.tracef("= %v] ", b) + } + + x := 0 + if b { + x = 1 + } + p.int(x) + return b +} + +// ---------------------------------------------------------------------------- +// Low-level encoders + +func (p *exporter) index(marker byte, index int) { + if index < 0 { + panic(internalError("invalid index < 0")) + } + if debugFormat { + p.marker('t') + } + if trace { + p.tracef("%c%d ", marker, index) + } + p.rawInt64(int64(index)) +} + +func (p *exporter) tag(tag int) { + if tag >= 0 { + panic(internalError("invalid tag >= 0")) + } + if debugFormat { + p.marker('t') + } + if trace { + p.tracef("%s ", tagString[-tag]) + } + p.rawInt64(int64(tag)) +} + +func (p *exporter) int(x int) { + p.int64(int64(x)) +} + +func (p *exporter) int64(x int64) { + if debugFormat { + p.marker('i') + } + if trace { + p.tracef("%d ", x) + } + p.rawInt64(x) +} + +func (p *exporter) string(s string) { + if debugFormat { + p.marker('s') + } + if trace { + p.tracef("%q ", s) + } + // if we saw the string before, write its index (>= 0) + // (the empty string is mapped to 0) + if i, ok := p.strIndex[s]; ok { + p.rawInt64(int64(i)) + return + } + // otherwise, remember string and write its negative length and bytes + p.strIndex[s] = len(p.strIndex) + p.rawInt64(-int64(len(s))) + for i := 0; i < len(s); i++ { + p.rawByte(s[i]) + } +} + +// marker emits a marker byte and position information which makes +// it easy for a reader to detect if it is "out of sync". Used for +// debugFormat format only. +func (p *exporter) marker(m byte) { + p.rawByte(m) + // Enable this for help tracking down the location + // of an incorrect marker when running in debugFormat. + if false && trace { + p.tracef("#%d ", p.written) + } + p.rawInt64(int64(p.written)) +} + +// rawInt64 should only be used by low-level encoders. +func (p *exporter) rawInt64(x int64) { + var tmp [binary.MaxVarintLen64]byte + n := binary.PutVarint(tmp[:], x) + for i := 0; i < n; i++ { + p.rawByte(tmp[i]) + } +} + +// rawStringln should only be used to emit the initial version string. +func (p *exporter) rawStringln(s string) { + for i := 0; i < len(s); i++ { + p.rawByte(s[i]) + } + p.rawByte('\n') +} + +// rawByte is the bottleneck interface to write to p.out. +// rawByte escapes b as follows (any encoding does that +// hides '$'): +// +// '$' => '|' 'S' +// '|' => '|' '|' +// +// Necessary so other tools can find the end of the +// export data by searching for "$$". +// rawByte should only be used by low-level encoders. +func (p *exporter) rawByte(b byte) { + switch b { + case '$': + // write '$' as '|' 'S' + b = 'S' + fallthrough + case '|': + // write '|' as '|' '|' + p.out.WriteByte('|') + p.written++ + } + p.out.WriteByte(b) + p.written++ +} + +// tracef is like fmt.Printf but it rewrites the format string +// to take care of indentation. +func (p *exporter) tracef(format string, args ...interface{}) { + if strings.ContainsAny(format, "<>\n") { + var buf bytes.Buffer + for i := 0; i < len(format); i++ { + // no need to deal with runes + ch := format[i] + switch ch { + case '>': + p.indent++ + continue + case '<': + p.indent-- + continue + } + buf.WriteByte(ch) + if ch == '\n' { + for j := p.indent; j > 0; j-- { + buf.WriteString(". ") + } + } + } + format = buf.String() + } + fmt.Printf(format, args...) +} + +// Debugging support. +// (tagString is only used when tracing is enabled) +var tagString = [...]string{ + // Packages + -packageTag: "package", + + // Types + -namedTag: "named type", + -arrayTag: "array", + -sliceTag: "slice", + -dddTag: "ddd", + -structTag: "struct", + -pointerTag: "pointer", + -signatureTag: "signature", + -interfaceTag: "interface", + -mapTag: "map", + -chanTag: "chan", + + // Values + -falseTag: "false", + -trueTag: "true", + -int64Tag: "int64", + -floatTag: "float", + -fractionTag: "fraction", + -complexTag: "complex", + -stringTag: "string", + -unknownTag: "unknown", + + // Type aliases + -aliasTag: "alias", +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/bimport.go b/vendor/golang.org/x/tools/go/internal/gcimporter/bimport.go new file mode 100644 index 0000000000..b85de01470 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/bimport.go @@ -0,0 +1,1053 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This file is a copy of $GOROOT/src/go/internal/gcimporter/bimport.go. + +package gcimporter + +import ( + "encoding/binary" + "fmt" + "go/constant" + "go/token" + "go/types" + "sort" + "strconv" + "strings" + "sync" + "unicode" + "unicode/utf8" +) + +type importer struct { + imports map[string]*types.Package + data []byte + importpath string + buf []byte // for reading strings + version int // export format version + + // object lists + strList []string // in order of appearance + pathList []string // in order of appearance + pkgList []*types.Package // in order of appearance + typList []types.Type // in order of appearance + interfaceList []*types.Interface // for delayed completion only + trackAllTypes bool + + // position encoding + posInfoFormat bool + prevFile string + prevLine int + fake fakeFileSet + + // debugging support + debugFormat bool + read int // bytes read +} + +// BImportData imports a package from the serialized package data +// and returns the number of bytes consumed and a reference to the package. +// If the export data version is not recognized or the format is otherwise +// compromised, an error is returned. +func BImportData(fset *token.FileSet, imports map[string]*types.Package, data []byte, path string) (_ int, pkg *types.Package, err error) { + // catch panics and return them as errors + const currentVersion = 6 + version := -1 // unknown version + defer func() { + if e := recover(); e != nil { + // Return a (possibly nil or incomplete) package unchanged (see #16088). + if version > currentVersion { + err = fmt.Errorf("cannot import %q (%v), export data is newer version - update tool", path, e) + } else { + err = fmt.Errorf("cannot import %q (%v), possibly version skew - reinstall package", path, e) + } + } + }() + + p := importer{ + imports: imports, + data: data, + importpath: path, + version: version, + strList: []string{""}, // empty string is mapped to 0 + pathList: []string{""}, // empty string is mapped to 0 + fake: fakeFileSet{ + fset: fset, + files: make(map[string]*fileInfo), + }, + } + defer p.fake.setLines() // set lines for files in fset + + // read version info + var versionstr string + if b := p.rawByte(); b == 'c' || b == 'd' { + // Go1.7 encoding; first byte encodes low-level + // encoding format (compact vs debug). + // For backward-compatibility only (avoid problems with + // old installed packages). Newly compiled packages use + // the extensible format string. + // TODO(gri) Remove this support eventually; after Go1.8. + if b == 'd' { + p.debugFormat = true + } + p.trackAllTypes = p.rawByte() == 'a' + p.posInfoFormat = p.int() != 0 + versionstr = p.string() + if versionstr == "v1" { + version = 0 + } + } else { + // Go1.8 extensible encoding + // read version string and extract version number (ignore anything after the version number) + versionstr = p.rawStringln(b) + if s := strings.SplitN(versionstr, " ", 3); len(s) >= 2 && s[0] == "version" { + if v, err := strconv.Atoi(s[1]); err == nil && v > 0 { + version = v + } + } + } + p.version = version + + // read version specific flags - extend as necessary + switch p.version { + // case currentVersion: + // ... + // fallthrough + case currentVersion, 5, 4, 3, 2, 1: + p.debugFormat = p.rawStringln(p.rawByte()) == "debug" + p.trackAllTypes = p.int() != 0 + p.posInfoFormat = p.int() != 0 + case 0: + // Go1.7 encoding format - nothing to do here + default: + errorf("unknown bexport format version %d (%q)", p.version, versionstr) + } + + // --- generic export data --- + + // populate typList with predeclared "known" types + p.typList = append(p.typList, predeclared()...) + + // read package data + pkg = p.pkg() + + // read objects of phase 1 only (see cmd/compile/internal/gc/bexport.go) + objcount := 0 + for { + tag := p.tagOrIndex() + if tag == endTag { + break + } + p.obj(tag) + objcount++ + } + + // self-verification + if count := p.int(); count != objcount { + errorf("got %d objects; want %d", objcount, count) + } + + // ignore compiler-specific import data + + // complete interfaces + // TODO(gri) re-investigate if we still need to do this in a delayed fashion + for _, typ := range p.interfaceList { + typ.Complete() + } + + // record all referenced packages as imports + list := append(([]*types.Package)(nil), p.pkgList[1:]...) + sort.Sort(byPath(list)) + pkg.SetImports(list) + + // package was imported completely and without errors + pkg.MarkComplete() + + return p.read, pkg, nil +} + +func errorf(format string, args ...interface{}) { + panic(fmt.Sprintf(format, args...)) +} + +func (p *importer) pkg() *types.Package { + // if the package was seen before, i is its index (>= 0) + i := p.tagOrIndex() + if i >= 0 { + return p.pkgList[i] + } + + // otherwise, i is the package tag (< 0) + if i != packageTag { + errorf("unexpected package tag %d version %d", i, p.version) + } + + // read package data + name := p.string() + var path string + if p.version >= 5 { + path = p.path() + } else { + path = p.string() + } + if p.version >= 6 { + p.int() // package height; unused by go/types + } + + // we should never see an empty package name + if name == "" { + errorf("empty package name in import") + } + + // an empty path denotes the package we are currently importing; + // it must be the first package we see + if (path == "") != (len(p.pkgList) == 0) { + errorf("package path %q for pkg index %d", path, len(p.pkgList)) + } + + // if the package was imported before, use that one; otherwise create a new one + if path == "" { + path = p.importpath + } + pkg := p.imports[path] + if pkg == nil { + pkg = types.NewPackage(path, name) + p.imports[path] = pkg + } else if pkg.Name() != name { + errorf("conflicting names %s and %s for package %q", pkg.Name(), name, path) + } + p.pkgList = append(p.pkgList, pkg) + + return pkg +} + +// objTag returns the tag value for each object kind. +func objTag(obj types.Object) int { + switch obj.(type) { + case *types.Const: + return constTag + case *types.TypeName: + return typeTag + case *types.Var: + return varTag + case *types.Func: + return funcTag + default: + errorf("unexpected object: %v (%T)", obj, obj) // panics + panic("unreachable") + } +} + +func sameObj(a, b types.Object) bool { + // Because unnamed types are not canonicalized, we cannot simply compare types for + // (pointer) identity. + // Ideally we'd check equality of constant values as well, but this is good enough. + return objTag(a) == objTag(b) && types.Identical(a.Type(), b.Type()) +} + +func (p *importer) declare(obj types.Object) { + pkg := obj.Pkg() + if alt := pkg.Scope().Insert(obj); alt != nil { + // This can only trigger if we import a (non-type) object a second time. + // Excluding type aliases, this cannot happen because 1) we only import a package + // once; and b) we ignore compiler-specific export data which may contain + // functions whose inlined function bodies refer to other functions that + // were already imported. + // However, type aliases require reexporting the original type, so we need + // to allow it (see also the comment in cmd/compile/internal/gc/bimport.go, + // method importer.obj, switch case importing functions). + // TODO(gri) review/update this comment once the gc compiler handles type aliases. + if !sameObj(obj, alt) { + errorf("inconsistent import:\n\t%v\npreviously imported as:\n\t%v\n", obj, alt) + } + } +} + +func (p *importer) obj(tag int) { + switch tag { + case constTag: + pos := p.pos() + pkg, name := p.qualifiedName() + typ := p.typ(nil, nil) + val := p.value() + p.declare(types.NewConst(pos, pkg, name, typ, val)) + + case aliasTag: + // TODO(gri) verify type alias hookup is correct + pos := p.pos() + pkg, name := p.qualifiedName() + typ := p.typ(nil, nil) + p.declare(types.NewTypeName(pos, pkg, name, typ)) + + case typeTag: + p.typ(nil, nil) + + case varTag: + pos := p.pos() + pkg, name := p.qualifiedName() + typ := p.typ(nil, nil) + p.declare(types.NewVar(pos, pkg, name, typ)) + + case funcTag: + pos := p.pos() + pkg, name := p.qualifiedName() + params, isddd := p.paramList() + result, _ := p.paramList() + sig := types.NewSignature(nil, params, result, isddd) + p.declare(types.NewFunc(pos, pkg, name, sig)) + + default: + errorf("unexpected object tag %d", tag) + } +} + +const deltaNewFile = -64 // see cmd/compile/internal/gc/bexport.go + +func (p *importer) pos() token.Pos { + if !p.posInfoFormat { + return token.NoPos + } + + file := p.prevFile + line := p.prevLine + delta := p.int() + line += delta + if p.version >= 5 { + if delta == deltaNewFile { + if n := p.int(); n >= 0 { + // file changed + file = p.path() + line = n + } + } + } else { + if delta == 0 { + if n := p.int(); n >= 0 { + // file changed + file = p.prevFile[:n] + p.string() + line = p.int() + } + } + } + p.prevFile = file + p.prevLine = line + + return p.fake.pos(file, line, 0) +} + +// Synthesize a token.Pos +type fakeFileSet struct { + fset *token.FileSet + files map[string]*fileInfo +} + +type fileInfo struct { + file *token.File + lastline int +} + +const maxlines = 64 * 1024 + +func (s *fakeFileSet) pos(file string, line, column int) token.Pos { + // TODO(mdempsky): Make use of column. + + // Since we don't know the set of needed file positions, we reserve maxlines + // positions per file. We delay calling token.File.SetLines until all + // positions have been calculated (by way of fakeFileSet.setLines), so that + // we can avoid setting unnecessary lines. See also golang/go#46586. + f := s.files[file] + if f == nil { + f = &fileInfo{file: s.fset.AddFile(file, -1, maxlines)} + s.files[file] = f + } + if line > maxlines { + line = 1 + } + if line > f.lastline { + f.lastline = line + } + + // Return a fake position assuming that f.file consists only of newlines. + return token.Pos(f.file.Base() + line - 1) +} + +func (s *fakeFileSet) setLines() { + fakeLinesOnce.Do(func() { + fakeLines = make([]int, maxlines) + for i := range fakeLines { + fakeLines[i] = i + } + }) + for _, f := range s.files { + f.file.SetLines(fakeLines[:f.lastline]) + } +} + +var ( + fakeLines []int + fakeLinesOnce sync.Once +) + +func (p *importer) qualifiedName() (pkg *types.Package, name string) { + name = p.string() + pkg = p.pkg() + return +} + +func (p *importer) record(t types.Type) { + p.typList = append(p.typList, t) +} + +// A dddSlice is a types.Type representing ...T parameters. +// It only appears for parameter types and does not escape +// the importer. +type dddSlice struct { + elem types.Type +} + +func (t *dddSlice) Underlying() types.Type { return t } +func (t *dddSlice) String() string { return "..." + t.elem.String() } + +// parent is the package which declared the type; parent == nil means +// the package currently imported. The parent package is needed for +// exported struct fields and interface methods which don't contain +// explicit package information in the export data. +// +// A non-nil tname is used as the "owner" of the result type; i.e., +// the result type is the underlying type of tname. tname is used +// to give interface methods a named receiver type where possible. +func (p *importer) typ(parent *types.Package, tname *types.Named) types.Type { + // if the type was seen before, i is its index (>= 0) + i := p.tagOrIndex() + if i >= 0 { + return p.typList[i] + } + + // otherwise, i is the type tag (< 0) + switch i { + case namedTag: + // read type object + pos := p.pos() + parent, name := p.qualifiedName() + scope := parent.Scope() + obj := scope.Lookup(name) + + // if the object doesn't exist yet, create and insert it + if obj == nil { + obj = types.NewTypeName(pos, parent, name, nil) + scope.Insert(obj) + } + + if _, ok := obj.(*types.TypeName); !ok { + errorf("pkg = %s, name = %s => %s", parent, name, obj) + } + + // associate new named type with obj if it doesn't exist yet + t0 := types.NewNamed(obj.(*types.TypeName), nil, nil) + + // but record the existing type, if any + tname := obj.Type().(*types.Named) // tname is either t0 or the existing type + p.record(tname) + + // read underlying type + t0.SetUnderlying(p.typ(parent, t0)) + + // interfaces don't have associated methods + if types.IsInterface(t0) { + return tname + } + + // read associated methods + for i := p.int(); i > 0; i-- { + // TODO(gri) replace this with something closer to fieldName + pos := p.pos() + name := p.string() + if !exported(name) { + p.pkg() + } + + recv, _ := p.paramList() // TODO(gri) do we need a full param list for the receiver? + params, isddd := p.paramList() + result, _ := p.paramList() + p.int() // go:nointerface pragma - discarded + + sig := types.NewSignature(recv.At(0), params, result, isddd) + t0.AddMethod(types.NewFunc(pos, parent, name, sig)) + } + + return tname + + case arrayTag: + t := new(types.Array) + if p.trackAllTypes { + p.record(t) + } + + n := p.int64() + *t = *types.NewArray(p.typ(parent, nil), n) + return t + + case sliceTag: + t := new(types.Slice) + if p.trackAllTypes { + p.record(t) + } + + *t = *types.NewSlice(p.typ(parent, nil)) + return t + + case dddTag: + t := new(dddSlice) + if p.trackAllTypes { + p.record(t) + } + + t.elem = p.typ(parent, nil) + return t + + case structTag: + t := new(types.Struct) + if p.trackAllTypes { + p.record(t) + } + + *t = *types.NewStruct(p.fieldList(parent)) + return t + + case pointerTag: + t := new(types.Pointer) + if p.trackAllTypes { + p.record(t) + } + + *t = *types.NewPointer(p.typ(parent, nil)) + return t + + case signatureTag: + t := new(types.Signature) + if p.trackAllTypes { + p.record(t) + } + + params, isddd := p.paramList() + result, _ := p.paramList() + *t = *types.NewSignature(nil, params, result, isddd) + return t + + case interfaceTag: + // Create a dummy entry in the type list. This is safe because we + // cannot expect the interface type to appear in a cycle, as any + // such cycle must contain a named type which would have been + // first defined earlier. + // TODO(gri) Is this still true now that we have type aliases? + // See issue #23225. + n := len(p.typList) + if p.trackAllTypes { + p.record(nil) + } + + var embeddeds []types.Type + for n := p.int(); n > 0; n-- { + p.pos() + embeddeds = append(embeddeds, p.typ(parent, nil)) + } + + t := newInterface(p.methodList(parent, tname), embeddeds) + p.interfaceList = append(p.interfaceList, t) + if p.trackAllTypes { + p.typList[n] = t + } + return t + + case mapTag: + t := new(types.Map) + if p.trackAllTypes { + p.record(t) + } + + key := p.typ(parent, nil) + val := p.typ(parent, nil) + *t = *types.NewMap(key, val) + return t + + case chanTag: + t := new(types.Chan) + if p.trackAllTypes { + p.record(t) + } + + dir := chanDir(p.int()) + val := p.typ(parent, nil) + *t = *types.NewChan(dir, val) + return t + + default: + errorf("unexpected type tag %d", i) // panics + panic("unreachable") + } +} + +func chanDir(d int) types.ChanDir { + // tag values must match the constants in cmd/compile/internal/gc/go.go + switch d { + case 1 /* Crecv */ : + return types.RecvOnly + case 2 /* Csend */ : + return types.SendOnly + case 3 /* Cboth */ : + return types.SendRecv + default: + errorf("unexpected channel dir %d", d) + return 0 + } +} + +func (p *importer) fieldList(parent *types.Package) (fields []*types.Var, tags []string) { + if n := p.int(); n > 0 { + fields = make([]*types.Var, n) + tags = make([]string, n) + for i := range fields { + fields[i], tags[i] = p.field(parent) + } + } + return +} + +func (p *importer) field(parent *types.Package) (*types.Var, string) { + pos := p.pos() + pkg, name, alias := p.fieldName(parent) + typ := p.typ(parent, nil) + tag := p.string() + + anonymous := false + if name == "" { + // anonymous field - typ must be T or *T and T must be a type name + switch typ := deref(typ).(type) { + case *types.Basic: // basic types are named types + pkg = nil // // objects defined in Universe scope have no package + name = typ.Name() + case *types.Named: + name = typ.Obj().Name() + default: + errorf("named base type expected") + } + anonymous = true + } else if alias { + // anonymous field: we have an explicit name because it's an alias + anonymous = true + } + + return types.NewField(pos, pkg, name, typ, anonymous), tag +} + +func (p *importer) methodList(parent *types.Package, baseType *types.Named) (methods []*types.Func) { + if n := p.int(); n > 0 { + methods = make([]*types.Func, n) + for i := range methods { + methods[i] = p.method(parent, baseType) + } + } + return +} + +func (p *importer) method(parent *types.Package, baseType *types.Named) *types.Func { + pos := p.pos() + pkg, name, _ := p.fieldName(parent) + // If we don't have a baseType, use a nil receiver. + // A receiver using the actual interface type (which + // we don't know yet) will be filled in when we call + // types.Interface.Complete. + var recv *types.Var + if baseType != nil { + recv = types.NewVar(token.NoPos, parent, "", baseType) + } + params, isddd := p.paramList() + result, _ := p.paramList() + sig := types.NewSignature(recv, params, result, isddd) + return types.NewFunc(pos, pkg, name, sig) +} + +func (p *importer) fieldName(parent *types.Package) (pkg *types.Package, name string, alias bool) { + name = p.string() + pkg = parent + if pkg == nil { + // use the imported package instead + pkg = p.pkgList[0] + } + if p.version == 0 && name == "_" { + // version 0 didn't export a package for _ fields + return + } + switch name { + case "": + // 1) field name matches base type name and is exported: nothing to do + case "?": + // 2) field name matches base type name and is not exported: need package + name = "" + pkg = p.pkg() + case "@": + // 3) field name doesn't match type name (alias) + name = p.string() + alias = true + fallthrough + default: + if !exported(name) { + pkg = p.pkg() + } + } + return +} + +func (p *importer) paramList() (*types.Tuple, bool) { + n := p.int() + if n == 0 { + return nil, false + } + // negative length indicates unnamed parameters + named := true + if n < 0 { + n = -n + named = false + } + // n > 0 + params := make([]*types.Var, n) + isddd := false + for i := range params { + params[i], isddd = p.param(named) + } + return types.NewTuple(params...), isddd +} + +func (p *importer) param(named bool) (*types.Var, bool) { + t := p.typ(nil, nil) + td, isddd := t.(*dddSlice) + if isddd { + t = types.NewSlice(td.elem) + } + + var pkg *types.Package + var name string + if named { + name = p.string() + if name == "" { + errorf("expected named parameter") + } + if name != "_" { + pkg = p.pkg() + } + if i := strings.Index(name, "·"); i > 0 { + name = name[:i] // cut off gc-specific parameter numbering + } + } + + // read and discard compiler-specific info + p.string() + + return types.NewVar(token.NoPos, pkg, name, t), isddd +} + +func exported(name string) bool { + ch, _ := utf8.DecodeRuneInString(name) + return unicode.IsUpper(ch) +} + +func (p *importer) value() constant.Value { + switch tag := p.tagOrIndex(); tag { + case falseTag: + return constant.MakeBool(false) + case trueTag: + return constant.MakeBool(true) + case int64Tag: + return constant.MakeInt64(p.int64()) + case floatTag: + return p.float() + case complexTag: + re := p.float() + im := p.float() + return constant.BinaryOp(re, token.ADD, constant.MakeImag(im)) + case stringTag: + return constant.MakeString(p.string()) + case unknownTag: + return constant.MakeUnknown() + default: + errorf("unexpected value tag %d", tag) // panics + panic("unreachable") + } +} + +func (p *importer) float() constant.Value { + sign := p.int() + if sign == 0 { + return constant.MakeInt64(0) + } + + exp := p.int() + mant := []byte(p.string()) // big endian + + // remove leading 0's if any + for len(mant) > 0 && mant[0] == 0 { + mant = mant[1:] + } + + // convert to little endian + // TODO(gri) go/constant should have a more direct conversion function + // (e.g., once it supports a big.Float based implementation) + for i, j := 0, len(mant)-1; i < j; i, j = i+1, j-1 { + mant[i], mant[j] = mant[j], mant[i] + } + + // adjust exponent (constant.MakeFromBytes creates an integer value, + // but mant represents the mantissa bits such that 0.5 <= mant < 1.0) + exp -= len(mant) << 3 + if len(mant) > 0 { + for msd := mant[len(mant)-1]; msd&0x80 == 0; msd <<= 1 { + exp++ + } + } + + x := constant.MakeFromBytes(mant) + switch { + case exp < 0: + d := constant.Shift(constant.MakeInt64(1), token.SHL, uint(-exp)) + x = constant.BinaryOp(x, token.QUO, d) + case exp > 0: + x = constant.Shift(x, token.SHL, uint(exp)) + } + + if sign < 0 { + x = constant.UnaryOp(token.SUB, x, 0) + } + return x +} + +// ---------------------------------------------------------------------------- +// Low-level decoders + +func (p *importer) tagOrIndex() int { + if p.debugFormat { + p.marker('t') + } + + return int(p.rawInt64()) +} + +func (p *importer) int() int { + x := p.int64() + if int64(int(x)) != x { + errorf("exported integer too large") + } + return int(x) +} + +func (p *importer) int64() int64 { + if p.debugFormat { + p.marker('i') + } + + return p.rawInt64() +} + +func (p *importer) path() string { + if p.debugFormat { + p.marker('p') + } + // if the path was seen before, i is its index (>= 0) + // (the empty string is at index 0) + i := p.rawInt64() + if i >= 0 { + return p.pathList[i] + } + // otherwise, i is the negative path length (< 0) + a := make([]string, -i) + for n := range a { + a[n] = p.string() + } + s := strings.Join(a, "/") + p.pathList = append(p.pathList, s) + return s +} + +func (p *importer) string() string { + if p.debugFormat { + p.marker('s') + } + // if the string was seen before, i is its index (>= 0) + // (the empty string is at index 0) + i := p.rawInt64() + if i >= 0 { + return p.strList[i] + } + // otherwise, i is the negative string length (< 0) + if n := int(-i); n <= cap(p.buf) { + p.buf = p.buf[:n] + } else { + p.buf = make([]byte, n) + } + for i := range p.buf { + p.buf[i] = p.rawByte() + } + s := string(p.buf) + p.strList = append(p.strList, s) + return s +} + +func (p *importer) marker(want byte) { + if got := p.rawByte(); got != want { + errorf("incorrect marker: got %c; want %c (pos = %d)", got, want, p.read) + } + + pos := p.read + if n := int(p.rawInt64()); n != pos { + errorf("incorrect position: got %d; want %d", n, pos) + } +} + +// rawInt64 should only be used by low-level decoders. +func (p *importer) rawInt64() int64 { + i, err := binary.ReadVarint(p) + if err != nil { + errorf("read error: %v", err) + } + return i +} + +// rawStringln should only be used to read the initial version string. +func (p *importer) rawStringln(b byte) string { + p.buf = p.buf[:0] + for b != '\n' { + p.buf = append(p.buf, b) + b = p.rawByte() + } + return string(p.buf) +} + +// needed for binary.ReadVarint in rawInt64 +func (p *importer) ReadByte() (byte, error) { + return p.rawByte(), nil +} + +// byte is the bottleneck interface for reading p.data. +// It unescapes '|' 'S' to '$' and '|' '|' to '|'. +// rawByte should only be used by low-level decoders. +func (p *importer) rawByte() byte { + b := p.data[0] + r := 1 + if b == '|' { + b = p.data[1] + r = 2 + switch b { + case 'S': + b = '$' + case '|': + // nothing to do + default: + errorf("unexpected escape sequence in export data") + } + } + p.data = p.data[r:] + p.read += r + return b + +} + +// ---------------------------------------------------------------------------- +// Export format + +// Tags. Must be < 0. +const ( + // Objects + packageTag = -(iota + 1) + constTag + typeTag + varTag + funcTag + endTag + + // Types + namedTag + arrayTag + sliceTag + dddTag + structTag + pointerTag + signatureTag + interfaceTag + mapTag + chanTag + + // Values + falseTag + trueTag + int64Tag + floatTag + fractionTag // not used by gc + complexTag + stringTag + nilTag // only used by gc (appears in exported inlined function bodies) + unknownTag // not used by gc (only appears in packages with errors) + + // Type aliases + aliasTag +) + +var predeclOnce sync.Once +var predecl []types.Type // initialized lazily + +func predeclared() []types.Type { + predeclOnce.Do(func() { + // initialize lazily to be sure that all + // elements have been initialized before + predecl = []types.Type{ // basic types + types.Typ[types.Bool], + types.Typ[types.Int], + types.Typ[types.Int8], + types.Typ[types.Int16], + types.Typ[types.Int32], + types.Typ[types.Int64], + types.Typ[types.Uint], + types.Typ[types.Uint8], + types.Typ[types.Uint16], + types.Typ[types.Uint32], + types.Typ[types.Uint64], + types.Typ[types.Uintptr], + types.Typ[types.Float32], + types.Typ[types.Float64], + types.Typ[types.Complex64], + types.Typ[types.Complex128], + types.Typ[types.String], + + // basic type aliases + types.Universe.Lookup("byte").Type(), + types.Universe.Lookup("rune").Type(), + + // error + types.Universe.Lookup("error").Type(), + + // untyped types + types.Typ[types.UntypedBool], + types.Typ[types.UntypedInt], + types.Typ[types.UntypedRune], + types.Typ[types.UntypedFloat], + types.Typ[types.UntypedComplex], + types.Typ[types.UntypedString], + types.Typ[types.UntypedNil], + + // package unsafe + types.Typ[types.UnsafePointer], + + // invalid type + types.Typ[types.Invalid], // only appears in packages with errors + + // used internally by gc; never used by this package or in .a files + anyType{}, + } + predecl = append(predecl, additionalPredeclared()...) + }) + return predecl +} + +type anyType struct{} + +func (t anyType) Underlying() types.Type { return t } +func (t anyType) String() string { return "any" } diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/exportdata.go b/vendor/golang.org/x/tools/go/internal/gcimporter/exportdata.go new file mode 100644 index 0000000000..f6437feb1c --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/exportdata.go @@ -0,0 +1,99 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This file is a copy of $GOROOT/src/go/internal/gcimporter/exportdata.go. + +// This file implements FindExportData. + +package gcimporter + +import ( + "bufio" + "fmt" + "io" + "strconv" + "strings" +) + +func readGopackHeader(r *bufio.Reader) (name string, size int64, err error) { + // See $GOROOT/include/ar.h. + hdr := make([]byte, 16+12+6+6+8+10+2) + _, err = io.ReadFull(r, hdr) + if err != nil { + return + } + // leave for debugging + if false { + fmt.Printf("header: %s", hdr) + } + s := strings.TrimSpace(string(hdr[16+12+6+6+8:][:10])) + length, err := strconv.Atoi(s) + size = int64(length) + if err != nil || hdr[len(hdr)-2] != '`' || hdr[len(hdr)-1] != '\n' { + err = fmt.Errorf("invalid archive header") + return + } + name = strings.TrimSpace(string(hdr[:16])) + return +} + +// FindExportData positions the reader r at the beginning of the +// export data section of an underlying GC-created object/archive +// file by reading from it. The reader must be positioned at the +// start of the file before calling this function. The hdr result +// is the string before the export data, either "$$" or "$$B". +// The size result is the length of the export data in bytes, or -1 if not known. +func FindExportData(r *bufio.Reader) (hdr string, size int64, err error) { + // Read first line to make sure this is an object file. + line, err := r.ReadSlice('\n') + if err != nil { + err = fmt.Errorf("can't find export data (%v)", err) + return + } + + if string(line) == "!\n" { + // Archive file. Scan to __.PKGDEF. + var name string + if name, size, err = readGopackHeader(r); err != nil { + return + } + + // First entry should be __.PKGDEF. + if name != "__.PKGDEF" { + err = fmt.Errorf("go archive is missing __.PKGDEF") + return + } + + // Read first line of __.PKGDEF data, so that line + // is once again the first line of the input. + if line, err = r.ReadSlice('\n'); err != nil { + err = fmt.Errorf("can't find export data (%v)", err) + return + } + size -= int64(len(line)) + } + + // Now at __.PKGDEF in archive or still at beginning of file. + // Either way, line should begin with "go object ". + if !strings.HasPrefix(string(line), "go object ") { + err = fmt.Errorf("not a Go object file") + return + } + + // Skip over object header to export data. + // Begins after first line starting with $$. + for line[0] != '$' { + if line, err = r.ReadSlice('\n'); err != nil { + err = fmt.Errorf("can't find export data (%v)", err) + return + } + size -= int64(len(line)) + } + hdr = string(line) + if size < 0 { + size = -1 + } + + return +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/gcimporter.go b/vendor/golang.org/x/tools/go/internal/gcimporter/gcimporter.go new file mode 100644 index 0000000000..e96c39600d --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/gcimporter.go @@ -0,0 +1,1125 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This file is a modified copy of $GOROOT/src/go/internal/gcimporter/gcimporter.go, +// but it also contains the original source-based importer code for Go1.6. +// Once we stop supporting 1.6, we can remove that code. + +// Package gcimporter provides various functions for reading +// gc-generated object files that can be used to implement the +// Importer interface defined by the Go 1.5 standard library package. +package gcimporter // import "golang.org/x/tools/go/internal/gcimporter" + +import ( + "bufio" + "errors" + "fmt" + "go/build" + "go/constant" + "go/token" + "go/types" + "io" + "io/ioutil" + "os" + "path/filepath" + "sort" + "strconv" + "strings" + "text/scanner" +) + +const ( + // Enable debug during development: it adds some additional checks, and + // prevents errors from being recovered. + debug = false + + // If trace is set, debugging output is printed to std out. + trace = false +) + +var pkgExts = [...]string{".a", ".o"} + +// FindPkg returns the filename and unique package id for an import +// path based on package information provided by build.Import (using +// the build.Default build.Context). A relative srcDir is interpreted +// relative to the current working directory. +// If no file was found, an empty filename is returned. +func FindPkg(path, srcDir string) (filename, id string) { + if path == "" { + return + } + + var noext string + switch { + default: + // "x" -> "$GOPATH/pkg/$GOOS_$GOARCH/x.ext", "x" + // Don't require the source files to be present. + if abs, err := filepath.Abs(srcDir); err == nil { // see issue 14282 + srcDir = abs + } + bp, _ := build.Import(path, srcDir, build.FindOnly|build.AllowBinary) + if bp.PkgObj == "" { + id = path // make sure we have an id to print in error message + return + } + noext = strings.TrimSuffix(bp.PkgObj, ".a") + id = bp.ImportPath + + case build.IsLocalImport(path): + // "./x" -> "/this/directory/x.ext", "/this/directory/x" + noext = filepath.Join(srcDir, path) + id = noext + + case filepath.IsAbs(path): + // for completeness only - go/build.Import + // does not support absolute imports + // "/x" -> "/x.ext", "/x" + noext = path + id = path + } + + if false { // for debugging + if path != id { + fmt.Printf("%s -> %s\n", path, id) + } + } + + // try extensions + for _, ext := range pkgExts { + filename = noext + ext + if f, err := os.Stat(filename); err == nil && !f.IsDir() { + return + } + } + + filename = "" // not found + return +} + +// ImportData imports a package by reading the gc-generated export data, +// adds the corresponding package object to the packages map indexed by id, +// and returns the object. +// +// The packages map must contains all packages already imported. The data +// reader position must be the beginning of the export data section. The +// filename is only used in error messages. +// +// If packages[id] contains the completely imported package, that package +// can be used directly, and there is no need to call this function (but +// there is also no harm but for extra time used). +func ImportData(packages map[string]*types.Package, filename, id string, data io.Reader) (pkg *types.Package, err error) { + // support for parser error handling + defer func() { + switch r := recover().(type) { + case nil: + // nothing to do + case importError: + err = r + default: + panic(r) // internal error + } + }() + + var p parser + p.init(filename, id, data, packages) + pkg = p.parseExport() + + return +} + +// Import imports a gc-generated package given its import path and srcDir, adds +// the corresponding package object to the packages map, and returns the object. +// The packages map must contain all packages already imported. +func Import(packages map[string]*types.Package, path, srcDir string, lookup func(path string) (io.ReadCloser, error)) (pkg *types.Package, err error) { + var rc io.ReadCloser + var filename, id string + if lookup != nil { + // With custom lookup specified, assume that caller has + // converted path to a canonical import path for use in the map. + if path == "unsafe" { + return types.Unsafe, nil + } + id = path + + // No need to re-import if the package was imported completely before. + if pkg = packages[id]; pkg != nil && pkg.Complete() { + return + } + f, err := lookup(path) + if err != nil { + return nil, err + } + rc = f + } else { + filename, id = FindPkg(path, srcDir) + if filename == "" { + if path == "unsafe" { + return types.Unsafe, nil + } + return nil, fmt.Errorf("can't find import: %q", id) + } + + // no need to re-import if the package was imported completely before + if pkg = packages[id]; pkg != nil && pkg.Complete() { + return + } + + // open file + f, err := os.Open(filename) + if err != nil { + return nil, err + } + defer func() { + if err != nil { + // add file name to error + err = fmt.Errorf("%s: %v", filename, err) + } + }() + rc = f + } + defer rc.Close() + + var hdr string + var size int64 + buf := bufio.NewReader(rc) + if hdr, size, err = FindExportData(buf); err != nil { + return + } + + switch hdr { + case "$$\n": + // Work-around if we don't have a filename; happens only if lookup != nil. + // Either way, the filename is only needed for importer error messages, so + // this is fine. + if filename == "" { + filename = path + } + return ImportData(packages, filename, id, buf) + + case "$$B\n": + var data []byte + data, err = ioutil.ReadAll(buf) + if err != nil { + break + } + + // TODO(gri): allow clients of go/importer to provide a FileSet. + // Or, define a new standard go/types/gcexportdata package. + fset := token.NewFileSet() + + // The indexed export format starts with an 'i'; the older + // binary export format starts with a 'c', 'd', or 'v' + // (from "version"). Select appropriate importer. + if len(data) > 0 { + switch data[0] { + case 'i': + _, pkg, err := IImportData(fset, packages, data[1:], id) + return pkg, err + + case 'v', 'c', 'd': + _, pkg, err := BImportData(fset, packages, data, id) + return pkg, err + + case 'u': + _, pkg, err := UImportData(fset, packages, data[1:size], id) + return pkg, err + + default: + l := len(data) + if l > 10 { + l = 10 + } + return nil, fmt.Errorf("unexpected export data with prefix %q for path %s", string(data[:l]), id) + } + } + + default: + err = fmt.Errorf("unknown export data header: %q", hdr) + } + + return +} + +// ---------------------------------------------------------------------------- +// Parser + +// TODO(gri) Imported objects don't have position information. +// Ideally use the debug table line info; alternatively +// create some fake position (or the position of the +// import). That way error messages referring to imported +// objects can print meaningful information. + +// parser parses the exports inside a gc compiler-produced +// object/archive file and populates its scope with the results. +type parser struct { + scanner scanner.Scanner + tok rune // current token + lit string // literal string; only valid for Ident, Int, String tokens + id string // package id of imported package + sharedPkgs map[string]*types.Package // package id -> package object (across importer) + localPkgs map[string]*types.Package // package id -> package object (just this package) +} + +func (p *parser) init(filename, id string, src io.Reader, packages map[string]*types.Package) { + p.scanner.Init(src) + p.scanner.Error = func(_ *scanner.Scanner, msg string) { p.error(msg) } + p.scanner.Mode = scanner.ScanIdents | scanner.ScanInts | scanner.ScanChars | scanner.ScanStrings | scanner.ScanComments | scanner.SkipComments + p.scanner.Whitespace = 1<<'\t' | 1<<' ' + p.scanner.Filename = filename // for good error messages + p.next() + p.id = id + p.sharedPkgs = packages + if debug { + // check consistency of packages map + for _, pkg := range packages { + if pkg.Name() == "" { + fmt.Printf("no package name for %s\n", pkg.Path()) + } + } + } +} + +func (p *parser) next() { + p.tok = p.scanner.Scan() + switch p.tok { + case scanner.Ident, scanner.Int, scanner.Char, scanner.String, '·': + p.lit = p.scanner.TokenText() + default: + p.lit = "" + } + if debug { + fmt.Printf("%s: %q -> %q\n", scanner.TokenString(p.tok), p.scanner.TokenText(), p.lit) + } +} + +func declTypeName(pkg *types.Package, name string) *types.TypeName { + scope := pkg.Scope() + if obj := scope.Lookup(name); obj != nil { + return obj.(*types.TypeName) + } + obj := types.NewTypeName(token.NoPos, pkg, name, nil) + // a named type may be referred to before the underlying type + // is known - set it up + types.NewNamed(obj, nil, nil) + scope.Insert(obj) + return obj +} + +// ---------------------------------------------------------------------------- +// Error handling + +// Internal errors are boxed as importErrors. +type importError struct { + pos scanner.Position + err error +} + +func (e importError) Error() string { + return fmt.Sprintf("import error %s (byte offset = %d): %s", e.pos, e.pos.Offset, e.err) +} + +func (p *parser) error(err interface{}) { + if s, ok := err.(string); ok { + err = errors.New(s) + } + // panic with a runtime.Error if err is not an error + panic(importError{p.scanner.Pos(), err.(error)}) +} + +func (p *parser) errorf(format string, args ...interface{}) { + p.error(fmt.Sprintf(format, args...)) +} + +func (p *parser) expect(tok rune) string { + lit := p.lit + if p.tok != tok { + p.errorf("expected %s, got %s (%s)", scanner.TokenString(tok), scanner.TokenString(p.tok), lit) + } + p.next() + return lit +} + +func (p *parser) expectSpecial(tok string) { + sep := 'x' // not white space + i := 0 + for i < len(tok) && p.tok == rune(tok[i]) && sep > ' ' { + sep = p.scanner.Peek() // if sep <= ' ', there is white space before the next token + p.next() + i++ + } + if i < len(tok) { + p.errorf("expected %q, got %q", tok, tok[0:i]) + } +} + +func (p *parser) expectKeyword(keyword string) { + lit := p.expect(scanner.Ident) + if lit != keyword { + p.errorf("expected keyword %s, got %q", keyword, lit) + } +} + +// ---------------------------------------------------------------------------- +// Qualified and unqualified names + +// parsePackageID parses a PackageId: +// +// PackageId = string_lit . +func (p *parser) parsePackageID() string { + id, err := strconv.Unquote(p.expect(scanner.String)) + if err != nil { + p.error(err) + } + // id == "" stands for the imported package id + // (only known at time of package installation) + if id == "" { + id = p.id + } + return id +} + +// parsePackageName parse a PackageName: +// +// PackageName = ident . +func (p *parser) parsePackageName() string { + return p.expect(scanner.Ident) +} + +// parseDotIdent parses a dotIdentifier: +// +// dotIdentifier = ( ident | '·' ) { ident | int | '·' } . +func (p *parser) parseDotIdent() string { + ident := "" + if p.tok != scanner.Int { + sep := 'x' // not white space + for (p.tok == scanner.Ident || p.tok == scanner.Int || p.tok == '·') && sep > ' ' { + ident += p.lit + sep = p.scanner.Peek() // if sep <= ' ', there is white space before the next token + p.next() + } + } + if ident == "" { + p.expect(scanner.Ident) // use expect() for error handling + } + return ident +} + +// parseQualifiedName parses a QualifiedName: +// +// QualifiedName = "@" PackageId "." ( "?" | dotIdentifier ) . +func (p *parser) parseQualifiedName() (id, name string) { + p.expect('@') + id = p.parsePackageID() + p.expect('.') + // Per rev f280b8a485fd (10/2/2013), qualified names may be used for anonymous fields. + if p.tok == '?' { + p.next() + } else { + name = p.parseDotIdent() + } + return +} + +// getPkg returns the package for a given id. If the package is +// not found, create the package and add it to the p.localPkgs +// and p.sharedPkgs maps. name is the (expected) name of the +// package. If name == "", the package name is expected to be +// set later via an import clause in the export data. +// +// id identifies a package, usually by a canonical package path like +// "encoding/json" but possibly by a non-canonical import path like +// "./json". +func (p *parser) getPkg(id, name string) *types.Package { + // package unsafe is not in the packages maps - handle explicitly + if id == "unsafe" { + return types.Unsafe + } + + pkg := p.localPkgs[id] + if pkg == nil { + // first import of id from this package + pkg = p.sharedPkgs[id] + if pkg == nil { + // first import of id by this importer; + // add (possibly unnamed) pkg to shared packages + pkg = types.NewPackage(id, name) + p.sharedPkgs[id] = pkg + } + // add (possibly unnamed) pkg to local packages + if p.localPkgs == nil { + p.localPkgs = make(map[string]*types.Package) + } + p.localPkgs[id] = pkg + } else if name != "" { + // package exists already and we have an expected package name; + // make sure names match or set package name if necessary + if pname := pkg.Name(); pname == "" { + pkg.SetName(name) + } else if pname != name { + p.errorf("%s package name mismatch: %s (given) vs %s (expected)", id, pname, name) + } + } + return pkg +} + +// parseExportedName is like parseQualifiedName, but +// the package id is resolved to an imported *types.Package. +func (p *parser) parseExportedName() (pkg *types.Package, name string) { + id, name := p.parseQualifiedName() + pkg = p.getPkg(id, "") + return +} + +// ---------------------------------------------------------------------------- +// Types + +// parseBasicType parses a BasicType: +// +// BasicType = identifier . +func (p *parser) parseBasicType() types.Type { + id := p.expect(scanner.Ident) + obj := types.Universe.Lookup(id) + if obj, ok := obj.(*types.TypeName); ok { + return obj.Type() + } + p.errorf("not a basic type: %s", id) + return nil +} + +// parseArrayType parses an ArrayType: +// +// ArrayType = "[" int_lit "]" Type . +func (p *parser) parseArrayType(parent *types.Package) types.Type { + // "[" already consumed and lookahead known not to be "]" + lit := p.expect(scanner.Int) + p.expect(']') + elem := p.parseType(parent) + n, err := strconv.ParseInt(lit, 10, 64) + if err != nil { + p.error(err) + } + return types.NewArray(elem, n) +} + +// parseMapType parses a MapType: +// +// MapType = "map" "[" Type "]" Type . +func (p *parser) parseMapType(parent *types.Package) types.Type { + p.expectKeyword("map") + p.expect('[') + key := p.parseType(parent) + p.expect(']') + elem := p.parseType(parent) + return types.NewMap(key, elem) +} + +// parseName parses a Name: +// +// Name = identifier | "?" | QualifiedName . +// +// For unqualified and anonymous names, the returned package is the parent +// package unless parent == nil, in which case the returned package is the +// package being imported. (The parent package is not nil if the name +// is an unqualified struct field or interface method name belonging to a +// type declared in another package.) +// +// For qualified names, the returned package is nil (and not created if +// it doesn't exist yet) unless materializePkg is set (which creates an +// unnamed package with valid package path). In the latter case, a +// subsequent import clause is expected to provide a name for the package. +func (p *parser) parseName(parent *types.Package, materializePkg bool) (pkg *types.Package, name string) { + pkg = parent + if pkg == nil { + pkg = p.sharedPkgs[p.id] + } + switch p.tok { + case scanner.Ident: + name = p.lit + p.next() + case '?': + // anonymous + p.next() + case '@': + // exported name prefixed with package path + pkg = nil + var id string + id, name = p.parseQualifiedName() + if materializePkg { + pkg = p.getPkg(id, "") + } + default: + p.error("name expected") + } + return +} + +func deref(typ types.Type) types.Type { + if p, _ := typ.(*types.Pointer); p != nil { + return p.Elem() + } + return typ +} + +// parseField parses a Field: +// +// Field = Name Type [ string_lit ] . +func (p *parser) parseField(parent *types.Package) (*types.Var, string) { + pkg, name := p.parseName(parent, true) + + if name == "_" { + // Blank fields should be package-qualified because they + // are unexported identifiers, but gc does not qualify them. + // Assuming that the ident belongs to the current package + // causes types to change during re-exporting, leading + // to spurious "can't assign A to B" errors from go/types. + // As a workaround, pretend all blank fields belong + // to the same unique dummy package. + const blankpkg = "<_>" + pkg = p.getPkg(blankpkg, blankpkg) + } + + typ := p.parseType(parent) + anonymous := false + if name == "" { + // anonymous field - typ must be T or *T and T must be a type name + switch typ := deref(typ).(type) { + case *types.Basic: // basic types are named types + pkg = nil // objects defined in Universe scope have no package + name = typ.Name() + case *types.Named: + name = typ.Obj().Name() + default: + p.errorf("anonymous field expected") + } + anonymous = true + } + tag := "" + if p.tok == scanner.String { + s := p.expect(scanner.String) + var err error + tag, err = strconv.Unquote(s) + if err != nil { + p.errorf("invalid struct tag %s: %s", s, err) + } + } + return types.NewField(token.NoPos, pkg, name, typ, anonymous), tag +} + +// parseStructType parses a StructType: +// +// StructType = "struct" "{" [ FieldList ] "}" . +// FieldList = Field { ";" Field } . +func (p *parser) parseStructType(parent *types.Package) types.Type { + var fields []*types.Var + var tags []string + + p.expectKeyword("struct") + p.expect('{') + for i := 0; p.tok != '}' && p.tok != scanner.EOF; i++ { + if i > 0 { + p.expect(';') + } + fld, tag := p.parseField(parent) + if tag != "" && tags == nil { + tags = make([]string, i) + } + if tags != nil { + tags = append(tags, tag) + } + fields = append(fields, fld) + } + p.expect('}') + + return types.NewStruct(fields, tags) +} + +// parseParameter parses a Parameter: +// +// Parameter = ( identifier | "?" ) [ "..." ] Type [ string_lit ] . +func (p *parser) parseParameter() (par *types.Var, isVariadic bool) { + _, name := p.parseName(nil, false) + // remove gc-specific parameter numbering + if i := strings.Index(name, "·"); i >= 0 { + name = name[:i] + } + if p.tok == '.' { + p.expectSpecial("...") + isVariadic = true + } + typ := p.parseType(nil) + if isVariadic { + typ = types.NewSlice(typ) + } + // ignore argument tag (e.g. "noescape") + if p.tok == scanner.String { + p.next() + } + // TODO(gri) should we provide a package? + par = types.NewVar(token.NoPos, nil, name, typ) + return +} + +// parseParameters parses a Parameters: +// +// Parameters = "(" [ ParameterList ] ")" . +// ParameterList = { Parameter "," } Parameter . +func (p *parser) parseParameters() (list []*types.Var, isVariadic bool) { + p.expect('(') + for p.tok != ')' && p.tok != scanner.EOF { + if len(list) > 0 { + p.expect(',') + } + par, variadic := p.parseParameter() + list = append(list, par) + if variadic { + if isVariadic { + p.error("... not on final argument") + } + isVariadic = true + } + } + p.expect(')') + + return +} + +// parseSignature parses a Signature: +// +// Signature = Parameters [ Result ] . +// Result = Type | Parameters . +func (p *parser) parseSignature(recv *types.Var) *types.Signature { + params, isVariadic := p.parseParameters() + + // optional result type + var results []*types.Var + if p.tok == '(' { + var variadic bool + results, variadic = p.parseParameters() + if variadic { + p.error("... not permitted on result type") + } + } + + return types.NewSignature(recv, types.NewTuple(params...), types.NewTuple(results...), isVariadic) +} + +// parseInterfaceType parses an InterfaceType: +// +// InterfaceType = "interface" "{" [ MethodList ] "}" . +// MethodList = Method { ";" Method } . +// Method = Name Signature . +// +// The methods of embedded interfaces are always "inlined" +// by the compiler and thus embedded interfaces are never +// visible in the export data. +func (p *parser) parseInterfaceType(parent *types.Package) types.Type { + var methods []*types.Func + + p.expectKeyword("interface") + p.expect('{') + for i := 0; p.tok != '}' && p.tok != scanner.EOF; i++ { + if i > 0 { + p.expect(';') + } + pkg, name := p.parseName(parent, true) + sig := p.parseSignature(nil) + methods = append(methods, types.NewFunc(token.NoPos, pkg, name, sig)) + } + p.expect('}') + + // Complete requires the type's embedded interfaces to be fully defined, + // but we do not define any + return newInterface(methods, nil).Complete() +} + +// parseChanType parses a ChanType: +// +// ChanType = ( "chan" [ "<-" ] | "<-" "chan" ) Type . +func (p *parser) parseChanType(parent *types.Package) types.Type { + dir := types.SendRecv + if p.tok == scanner.Ident { + p.expectKeyword("chan") + if p.tok == '<' { + p.expectSpecial("<-") + dir = types.SendOnly + } + } else { + p.expectSpecial("<-") + p.expectKeyword("chan") + dir = types.RecvOnly + } + elem := p.parseType(parent) + return types.NewChan(dir, elem) +} + +// parseType parses a Type: +// +// Type = +// BasicType | TypeName | ArrayType | SliceType | StructType | +// PointerType | FuncType | InterfaceType | MapType | ChanType | +// "(" Type ")" . +// +// BasicType = ident . +// TypeName = ExportedName . +// SliceType = "[" "]" Type . +// PointerType = "*" Type . +// FuncType = "func" Signature . +func (p *parser) parseType(parent *types.Package) types.Type { + switch p.tok { + case scanner.Ident: + switch p.lit { + default: + return p.parseBasicType() + case "struct": + return p.parseStructType(parent) + case "func": + // FuncType + p.next() + return p.parseSignature(nil) + case "interface": + return p.parseInterfaceType(parent) + case "map": + return p.parseMapType(parent) + case "chan": + return p.parseChanType(parent) + } + case '@': + // TypeName + pkg, name := p.parseExportedName() + return declTypeName(pkg, name).Type() + case '[': + p.next() // look ahead + if p.tok == ']' { + // SliceType + p.next() + return types.NewSlice(p.parseType(parent)) + } + return p.parseArrayType(parent) + case '*': + // PointerType + p.next() + return types.NewPointer(p.parseType(parent)) + case '<': + return p.parseChanType(parent) + case '(': + // "(" Type ")" + p.next() + typ := p.parseType(parent) + p.expect(')') + return typ + } + p.errorf("expected type, got %s (%q)", scanner.TokenString(p.tok), p.lit) + return nil +} + +// ---------------------------------------------------------------------------- +// Declarations + +// parseImportDecl parses an ImportDecl: +// +// ImportDecl = "import" PackageName PackageId . +func (p *parser) parseImportDecl() { + p.expectKeyword("import") + name := p.parsePackageName() + p.getPkg(p.parsePackageID(), name) +} + +// parseInt parses an int_lit: +// +// int_lit = [ "+" | "-" ] { "0" ... "9" } . +func (p *parser) parseInt() string { + s := "" + switch p.tok { + case '-': + s = "-" + p.next() + case '+': + p.next() + } + return s + p.expect(scanner.Int) +} + +// parseNumber parses a number: +// +// number = int_lit [ "p" int_lit ] . +func (p *parser) parseNumber() (typ *types.Basic, val constant.Value) { + // mantissa + mant := constant.MakeFromLiteral(p.parseInt(), token.INT, 0) + if mant == nil { + panic("invalid mantissa") + } + + if p.lit == "p" { + // exponent (base 2) + p.next() + exp, err := strconv.ParseInt(p.parseInt(), 10, 0) + if err != nil { + p.error(err) + } + if exp < 0 { + denom := constant.MakeInt64(1) + denom = constant.Shift(denom, token.SHL, uint(-exp)) + typ = types.Typ[types.UntypedFloat] + val = constant.BinaryOp(mant, token.QUO, denom) + return + } + if exp > 0 { + mant = constant.Shift(mant, token.SHL, uint(exp)) + } + typ = types.Typ[types.UntypedFloat] + val = mant + return + } + + typ = types.Typ[types.UntypedInt] + val = mant + return +} + +// parseConstDecl parses a ConstDecl: +// +// ConstDecl = "const" ExportedName [ Type ] "=" Literal . +// Literal = bool_lit | int_lit | float_lit | complex_lit | rune_lit | string_lit . +// bool_lit = "true" | "false" . +// complex_lit = "(" float_lit "+" float_lit "i" ")" . +// rune_lit = "(" int_lit "+" int_lit ")" . +// string_lit = `"` { unicode_char } `"` . +func (p *parser) parseConstDecl() { + p.expectKeyword("const") + pkg, name := p.parseExportedName() + + var typ0 types.Type + if p.tok != '=' { + // constant types are never structured - no need for parent type + typ0 = p.parseType(nil) + } + + p.expect('=') + var typ types.Type + var val constant.Value + switch p.tok { + case scanner.Ident: + // bool_lit + if p.lit != "true" && p.lit != "false" { + p.error("expected true or false") + } + typ = types.Typ[types.UntypedBool] + val = constant.MakeBool(p.lit == "true") + p.next() + + case '-', scanner.Int: + // int_lit + typ, val = p.parseNumber() + + case '(': + // complex_lit or rune_lit + p.next() + if p.tok == scanner.Char { + p.next() + p.expect('+') + typ = types.Typ[types.UntypedRune] + _, val = p.parseNumber() + p.expect(')') + break + } + _, re := p.parseNumber() + p.expect('+') + _, im := p.parseNumber() + p.expectKeyword("i") + p.expect(')') + typ = types.Typ[types.UntypedComplex] + val = constant.BinaryOp(re, token.ADD, constant.MakeImag(im)) + + case scanner.Char: + // rune_lit + typ = types.Typ[types.UntypedRune] + val = constant.MakeFromLiteral(p.lit, token.CHAR, 0) + p.next() + + case scanner.String: + // string_lit + typ = types.Typ[types.UntypedString] + val = constant.MakeFromLiteral(p.lit, token.STRING, 0) + p.next() + + default: + p.errorf("expected literal got %s", scanner.TokenString(p.tok)) + } + + if typ0 == nil { + typ0 = typ + } + + pkg.Scope().Insert(types.NewConst(token.NoPos, pkg, name, typ0, val)) +} + +// parseTypeDecl parses a TypeDecl: +// +// TypeDecl = "type" ExportedName Type . +func (p *parser) parseTypeDecl() { + p.expectKeyword("type") + pkg, name := p.parseExportedName() + obj := declTypeName(pkg, name) + + // The type object may have been imported before and thus already + // have a type associated with it. We still need to parse the type + // structure, but throw it away if the object already has a type. + // This ensures that all imports refer to the same type object for + // a given type declaration. + typ := p.parseType(pkg) + + if name := obj.Type().(*types.Named); name.Underlying() == nil { + name.SetUnderlying(typ) + } +} + +// parseVarDecl parses a VarDecl: +// +// VarDecl = "var" ExportedName Type . +func (p *parser) parseVarDecl() { + p.expectKeyword("var") + pkg, name := p.parseExportedName() + typ := p.parseType(pkg) + pkg.Scope().Insert(types.NewVar(token.NoPos, pkg, name, typ)) +} + +// parseFunc parses a Func: +// +// Func = Signature [ Body ] . +// Body = "{" ... "}" . +func (p *parser) parseFunc(recv *types.Var) *types.Signature { + sig := p.parseSignature(recv) + if p.tok == '{' { + p.next() + for i := 1; i > 0; p.next() { + switch p.tok { + case '{': + i++ + case '}': + i-- + } + } + } + return sig +} + +// parseMethodDecl parses a MethodDecl: +// +// MethodDecl = "func" Receiver Name Func . +// Receiver = "(" ( identifier | "?" ) [ "*" ] ExportedName ")" . +func (p *parser) parseMethodDecl() { + // "func" already consumed + p.expect('(') + recv, _ := p.parseParameter() // receiver + p.expect(')') + + // determine receiver base type object + base := deref(recv.Type()).(*types.Named) + + // parse method name, signature, and possibly inlined body + _, name := p.parseName(nil, false) + sig := p.parseFunc(recv) + + // methods always belong to the same package as the base type object + pkg := base.Obj().Pkg() + + // add method to type unless type was imported before + // and method exists already + // TODO(gri) This leads to a quadratic algorithm - ok for now because method counts are small. + base.AddMethod(types.NewFunc(token.NoPos, pkg, name, sig)) +} + +// parseFuncDecl parses a FuncDecl: +// +// FuncDecl = "func" ExportedName Func . +func (p *parser) parseFuncDecl() { + // "func" already consumed + pkg, name := p.parseExportedName() + typ := p.parseFunc(nil) + pkg.Scope().Insert(types.NewFunc(token.NoPos, pkg, name, typ)) +} + +// parseDecl parses a Decl: +// +// Decl = [ ImportDecl | ConstDecl | TypeDecl | VarDecl | FuncDecl | MethodDecl ] "\n" . +func (p *parser) parseDecl() { + if p.tok == scanner.Ident { + switch p.lit { + case "import": + p.parseImportDecl() + case "const": + p.parseConstDecl() + case "type": + p.parseTypeDecl() + case "var": + p.parseVarDecl() + case "func": + p.next() // look ahead + if p.tok == '(' { + p.parseMethodDecl() + } else { + p.parseFuncDecl() + } + } + } + p.expect('\n') +} + +// ---------------------------------------------------------------------------- +// Export + +// parseExport parses an Export: +// +// Export = "PackageClause { Decl } "$$" . +// PackageClause = "package" PackageName [ "safe" ] "\n" . +func (p *parser) parseExport() *types.Package { + p.expectKeyword("package") + name := p.parsePackageName() + if p.tok == scanner.Ident && p.lit == "safe" { + // package was compiled with -u option - ignore + p.next() + } + p.expect('\n') + + pkg := p.getPkg(p.id, name) + + for p.tok != '$' && p.tok != scanner.EOF { + p.parseDecl() + } + + if ch := p.scanner.Peek(); p.tok != '$' || ch != '$' { + // don't call next()/expect() since reading past the + // export data may cause scanner errors (e.g. NUL chars) + p.errorf("expected '$$', got %s %c", scanner.TokenString(p.tok), ch) + } + + if n := p.scanner.ErrorCount; n != 0 { + p.errorf("expected no scanner errors, got %d", n) + } + + // Record all locally referenced packages as imports. + var imports []*types.Package + for id, pkg2 := range p.localPkgs { + if pkg2.Name() == "" { + p.errorf("%s package has no name", id) + } + if id == p.id { + continue // avoid self-edge + } + imports = append(imports, pkg2) + } + sort.Sort(byPath(imports)) + pkg.SetImports(imports) + + // package was imported completely and without errors + pkg.MarkComplete() + + return pkg +} + +type byPath []*types.Package + +func (a byPath) Len() int { return len(a) } +func (a byPath) Swap(i, j int) { a[i], a[j] = a[j], a[i] } +func (a byPath) Less(i, j int) bool { return a[i].Path() < a[j].Path() } diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/iexport.go b/vendor/golang.org/x/tools/go/internal/gcimporter/iexport.go new file mode 100644 index 0000000000..9a4ff329e1 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/iexport.go @@ -0,0 +1,1010 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Indexed binary package export. +// This file was derived from $GOROOT/src/cmd/compile/internal/gc/iexport.go; +// see that file for specification of the format. + +package gcimporter + +import ( + "bytes" + "encoding/binary" + "fmt" + "go/ast" + "go/constant" + "go/token" + "go/types" + "io" + "math/big" + "reflect" + "sort" + "strconv" + "strings" + + "golang.org/x/tools/internal/typeparams" +) + +// Current bundled export format version. Increase with each format change. +// 0: initial implementation +const bundleVersion = 0 + +// IExportData writes indexed export data for pkg to out. +// +// If no file set is provided, position info will be missing. +// The package path of the top-level package will not be recorded, +// so that calls to IImportData can override with a provided package path. +func IExportData(out io.Writer, fset *token.FileSet, pkg *types.Package) error { + return iexportCommon(out, fset, false, iexportVersion, []*types.Package{pkg}) +} + +// IExportBundle writes an indexed export bundle for pkgs to out. +func IExportBundle(out io.Writer, fset *token.FileSet, pkgs []*types.Package) error { + return iexportCommon(out, fset, true, iexportVersion, pkgs) +} + +func iexportCommon(out io.Writer, fset *token.FileSet, bundle bool, version int, pkgs []*types.Package) (err error) { + if !debug { + defer func() { + if e := recover(); e != nil { + if ierr, ok := e.(internalError); ok { + err = ierr + return + } + // Not an internal error; panic again. + panic(e) + } + }() + } + + p := iexporter{ + fset: fset, + version: version, + allPkgs: map[*types.Package]bool{}, + stringIndex: map[string]uint64{}, + declIndex: map[types.Object]uint64{}, + tparamNames: map[types.Object]string{}, + typIndex: map[types.Type]uint64{}, + } + if !bundle { + p.localpkg = pkgs[0] + } + + for i, pt := range predeclared() { + p.typIndex[pt] = uint64(i) + } + if len(p.typIndex) > predeclReserved { + panic(internalErrorf("too many predeclared types: %d > %d", len(p.typIndex), predeclReserved)) + } + + // Initialize work queue with exported declarations. + for _, pkg := range pkgs { + scope := pkg.Scope() + for _, name := range scope.Names() { + if ast.IsExported(name) { + p.pushDecl(scope.Lookup(name)) + } + } + + if bundle { + // Ensure pkg and its imports are included in the index. + p.allPkgs[pkg] = true + for _, imp := range pkg.Imports() { + p.allPkgs[imp] = true + } + } + } + + // Loop until no more work. + for !p.declTodo.empty() { + p.doDecl(p.declTodo.popHead()) + } + + // Append indices to data0 section. + dataLen := uint64(p.data0.Len()) + w := p.newWriter() + w.writeIndex(p.declIndex) + + if bundle { + w.uint64(uint64(len(pkgs))) + for _, pkg := range pkgs { + w.pkg(pkg) + imps := pkg.Imports() + w.uint64(uint64(len(imps))) + for _, imp := range imps { + w.pkg(imp) + } + } + } + w.flush() + + // Assemble header. + var hdr intWriter + if bundle { + hdr.uint64(bundleVersion) + } + hdr.uint64(uint64(p.version)) + hdr.uint64(uint64(p.strings.Len())) + hdr.uint64(dataLen) + + // Flush output. + io.Copy(out, &hdr) + io.Copy(out, &p.strings) + io.Copy(out, &p.data0) + + return nil +} + +// writeIndex writes out an object index. mainIndex indicates whether +// we're writing out the main index, which is also read by +// non-compiler tools and includes a complete package description +// (i.e., name and height). +func (w *exportWriter) writeIndex(index map[types.Object]uint64) { + type pkgObj struct { + obj types.Object + name string // qualified name; differs from obj.Name for type params + } + // Build a map from packages to objects from that package. + pkgObjs := map[*types.Package][]pkgObj{} + + // For the main index, make sure to include every package that + // we reference, even if we're not exporting (or reexporting) + // any symbols from it. + if w.p.localpkg != nil { + pkgObjs[w.p.localpkg] = nil + } + for pkg := range w.p.allPkgs { + pkgObjs[pkg] = nil + } + + for obj := range index { + name := w.p.exportName(obj) + pkgObjs[obj.Pkg()] = append(pkgObjs[obj.Pkg()], pkgObj{obj, name}) + } + + var pkgs []*types.Package + for pkg, objs := range pkgObjs { + pkgs = append(pkgs, pkg) + + sort.Slice(objs, func(i, j int) bool { + return objs[i].name < objs[j].name + }) + } + + sort.Slice(pkgs, func(i, j int) bool { + return w.exportPath(pkgs[i]) < w.exportPath(pkgs[j]) + }) + + w.uint64(uint64(len(pkgs))) + for _, pkg := range pkgs { + w.string(w.exportPath(pkg)) + w.string(pkg.Name()) + w.uint64(uint64(0)) // package height is not needed for go/types + + objs := pkgObjs[pkg] + w.uint64(uint64(len(objs))) + for _, obj := range objs { + w.string(obj.name) + w.uint64(index[obj.obj]) + } + } +} + +// exportName returns the 'exported' name of an object. It differs from +// obj.Name() only for type parameters (see tparamExportName for details). +func (p *iexporter) exportName(obj types.Object) (res string) { + if name := p.tparamNames[obj]; name != "" { + return name + } + return obj.Name() +} + +type iexporter struct { + fset *token.FileSet + out *bytes.Buffer + version int + + localpkg *types.Package + + // allPkgs tracks all packages that have been referenced by + // the export data, so we can ensure to include them in the + // main index. + allPkgs map[*types.Package]bool + + declTodo objQueue + + strings intWriter + stringIndex map[string]uint64 + + data0 intWriter + declIndex map[types.Object]uint64 + tparamNames map[types.Object]string // typeparam->exported name + typIndex map[types.Type]uint64 + + indent int // for tracing support +} + +func (p *iexporter) trace(format string, args ...interface{}) { + if !trace { + // Call sites should also be guarded, but having this check here allows + // easily enabling/disabling debug trace statements. + return + } + fmt.Printf(strings.Repeat("..", p.indent)+format+"\n", args...) +} + +// stringOff returns the offset of s within the string section. +// If not already present, it's added to the end. +func (p *iexporter) stringOff(s string) uint64 { + off, ok := p.stringIndex[s] + if !ok { + off = uint64(p.strings.Len()) + p.stringIndex[s] = off + + p.strings.uint64(uint64(len(s))) + p.strings.WriteString(s) + } + return off +} + +// pushDecl adds n to the declaration work queue, if not already present. +func (p *iexporter) pushDecl(obj types.Object) { + // Package unsafe is known to the compiler and predeclared. + // Caller should not ask us to do export it. + if obj.Pkg() == types.Unsafe { + panic("cannot export package unsafe") + } + + if _, ok := p.declIndex[obj]; ok { + return + } + + p.declIndex[obj] = ^uint64(0) // mark obj present in work queue + p.declTodo.pushTail(obj) +} + +// exportWriter handles writing out individual data section chunks. +type exportWriter struct { + p *iexporter + + data intWriter + currPkg *types.Package + prevFile string + prevLine int64 + prevColumn int64 +} + +func (w *exportWriter) exportPath(pkg *types.Package) string { + if pkg == w.p.localpkg { + return "" + } + return pkg.Path() +} + +func (p *iexporter) doDecl(obj types.Object) { + if trace { + p.trace("exporting decl %v (%T)", obj, obj) + p.indent++ + defer func() { + p.indent-- + p.trace("=> %s", obj) + }() + } + w := p.newWriter() + w.setPkg(obj.Pkg(), false) + + switch obj := obj.(type) { + case *types.Var: + w.tag('V') + w.pos(obj.Pos()) + w.typ(obj.Type(), obj.Pkg()) + + case *types.Func: + sig, _ := obj.Type().(*types.Signature) + if sig.Recv() != nil { + panic(internalErrorf("unexpected method: %v", sig)) + } + + // Function. + if typeparams.ForSignature(sig).Len() == 0 { + w.tag('F') + } else { + w.tag('G') + } + w.pos(obj.Pos()) + // The tparam list of the function type is the declaration of the type + // params. So, write out the type params right now. Then those type params + // will be referenced via their type offset (via typOff) in all other + // places in the signature and function where they are used. + // + // While importing the type parameters, tparamList computes and records + // their export name, so that it can be later used when writing the index. + if tparams := typeparams.ForSignature(sig); tparams.Len() > 0 { + w.tparamList(obj.Name(), tparams, obj.Pkg()) + } + w.signature(sig) + + case *types.Const: + w.tag('C') + w.pos(obj.Pos()) + w.value(obj.Type(), obj.Val()) + + case *types.TypeName: + t := obj.Type() + + if tparam, ok := t.(*typeparams.TypeParam); ok { + w.tag('P') + w.pos(obj.Pos()) + constraint := tparam.Constraint() + if p.version >= iexportVersionGo1_18 { + implicit := false + if iface, _ := constraint.(*types.Interface); iface != nil { + implicit = typeparams.IsImplicit(iface) + } + w.bool(implicit) + } + w.typ(constraint, obj.Pkg()) + break + } + + if obj.IsAlias() { + w.tag('A') + w.pos(obj.Pos()) + w.typ(t, obj.Pkg()) + break + } + + // Defined type. + named, ok := t.(*types.Named) + if !ok { + panic(internalErrorf("%s is not a defined type", t)) + } + + if typeparams.ForNamed(named).Len() == 0 { + w.tag('T') + } else { + w.tag('U') + } + w.pos(obj.Pos()) + + if typeparams.ForNamed(named).Len() > 0 { + // While importing the type parameters, tparamList computes and records + // their export name, so that it can be later used when writing the index. + w.tparamList(obj.Name(), typeparams.ForNamed(named), obj.Pkg()) + } + + underlying := obj.Type().Underlying() + w.typ(underlying, obj.Pkg()) + + if types.IsInterface(t) { + break + } + + n := named.NumMethods() + w.uint64(uint64(n)) + for i := 0; i < n; i++ { + m := named.Method(i) + w.pos(m.Pos()) + w.string(m.Name()) + sig, _ := m.Type().(*types.Signature) + + // Receiver type parameters are type arguments of the receiver type, so + // their name must be qualified before exporting recv. + if rparams := typeparams.RecvTypeParams(sig); rparams.Len() > 0 { + prefix := obj.Name() + "." + m.Name() + for i := 0; i < rparams.Len(); i++ { + rparam := rparams.At(i) + name := tparamExportName(prefix, rparam) + w.p.tparamNames[rparam.Obj()] = name + } + } + w.param(sig.Recv()) + w.signature(sig) + } + + default: + panic(internalErrorf("unexpected object: %v", obj)) + } + + p.declIndex[obj] = w.flush() +} + +func (w *exportWriter) tag(tag byte) { + w.data.WriteByte(tag) +} + +func (w *exportWriter) pos(pos token.Pos) { + if w.p.version >= iexportVersionPosCol { + w.posV1(pos) + } else { + w.posV0(pos) + } +} + +func (w *exportWriter) posV1(pos token.Pos) { + if w.p.fset == nil { + w.int64(0) + return + } + + p := w.p.fset.Position(pos) + file := p.Filename + line := int64(p.Line) + column := int64(p.Column) + + deltaColumn := (column - w.prevColumn) << 1 + deltaLine := (line - w.prevLine) << 1 + + if file != w.prevFile { + deltaLine |= 1 + } + if deltaLine != 0 { + deltaColumn |= 1 + } + + w.int64(deltaColumn) + if deltaColumn&1 != 0 { + w.int64(deltaLine) + if deltaLine&1 != 0 { + w.string(file) + } + } + + w.prevFile = file + w.prevLine = line + w.prevColumn = column +} + +func (w *exportWriter) posV0(pos token.Pos) { + if w.p.fset == nil { + w.int64(0) + return + } + + p := w.p.fset.Position(pos) + file := p.Filename + line := int64(p.Line) + + // When file is the same as the last position (common case), + // we can save a few bytes by delta encoding just the line + // number. + // + // Note: Because data objects may be read out of order (or not + // at all), we can only apply delta encoding within a single + // object. This is handled implicitly by tracking prevFile and + // prevLine as fields of exportWriter. + + if file == w.prevFile { + delta := line - w.prevLine + w.int64(delta) + if delta == deltaNewFile { + w.int64(-1) + } + } else { + w.int64(deltaNewFile) + w.int64(line) // line >= 0 + w.string(file) + w.prevFile = file + } + w.prevLine = line +} + +func (w *exportWriter) pkg(pkg *types.Package) { + // Ensure any referenced packages are declared in the main index. + w.p.allPkgs[pkg] = true + + w.string(w.exportPath(pkg)) +} + +func (w *exportWriter) qualifiedIdent(obj types.Object) { + name := w.p.exportName(obj) + + // Ensure any referenced declarations are written out too. + w.p.pushDecl(obj) + w.string(name) + w.pkg(obj.Pkg()) +} + +func (w *exportWriter) typ(t types.Type, pkg *types.Package) { + w.data.uint64(w.p.typOff(t, pkg)) +} + +func (p *iexporter) newWriter() *exportWriter { + return &exportWriter{p: p} +} + +func (w *exportWriter) flush() uint64 { + off := uint64(w.p.data0.Len()) + io.Copy(&w.p.data0, &w.data) + return off +} + +func (p *iexporter) typOff(t types.Type, pkg *types.Package) uint64 { + off, ok := p.typIndex[t] + if !ok { + w := p.newWriter() + w.doTyp(t, pkg) + off = predeclReserved + w.flush() + p.typIndex[t] = off + } + return off +} + +func (w *exportWriter) startType(k itag) { + w.data.uint64(uint64(k)) +} + +func (w *exportWriter) doTyp(t types.Type, pkg *types.Package) { + if trace { + w.p.trace("exporting type %s (%T)", t, t) + w.p.indent++ + defer func() { + w.p.indent-- + w.p.trace("=> %s", t) + }() + } + switch t := t.(type) { + case *types.Named: + if targs := typeparams.NamedTypeArgs(t); targs.Len() > 0 { + w.startType(instanceType) + // TODO(rfindley): investigate if this position is correct, and if it + // matters. + w.pos(t.Obj().Pos()) + w.typeList(targs, pkg) + w.typ(typeparams.NamedTypeOrigin(t), pkg) + return + } + w.startType(definedType) + w.qualifiedIdent(t.Obj()) + + case *typeparams.TypeParam: + w.startType(typeParamType) + w.qualifiedIdent(t.Obj()) + + case *types.Pointer: + w.startType(pointerType) + w.typ(t.Elem(), pkg) + + case *types.Slice: + w.startType(sliceType) + w.typ(t.Elem(), pkg) + + case *types.Array: + w.startType(arrayType) + w.uint64(uint64(t.Len())) + w.typ(t.Elem(), pkg) + + case *types.Chan: + w.startType(chanType) + // 1 RecvOnly; 2 SendOnly; 3 SendRecv + var dir uint64 + switch t.Dir() { + case types.RecvOnly: + dir = 1 + case types.SendOnly: + dir = 2 + case types.SendRecv: + dir = 3 + } + w.uint64(dir) + w.typ(t.Elem(), pkg) + + case *types.Map: + w.startType(mapType) + w.typ(t.Key(), pkg) + w.typ(t.Elem(), pkg) + + case *types.Signature: + w.startType(signatureType) + w.setPkg(pkg, true) + w.signature(t) + + case *types.Struct: + w.startType(structType) + w.setPkg(pkg, true) + + n := t.NumFields() + w.uint64(uint64(n)) + for i := 0; i < n; i++ { + f := t.Field(i) + w.pos(f.Pos()) + w.string(f.Name()) + w.typ(f.Type(), pkg) + w.bool(f.Anonymous()) + w.string(t.Tag(i)) // note (or tag) + } + + case *types.Interface: + w.startType(interfaceType) + w.setPkg(pkg, true) + + n := t.NumEmbeddeds() + w.uint64(uint64(n)) + for i := 0; i < n; i++ { + ft := t.EmbeddedType(i) + tPkg := pkg + if named, _ := ft.(*types.Named); named != nil { + w.pos(named.Obj().Pos()) + } else { + w.pos(token.NoPos) + } + w.typ(ft, tPkg) + } + + n = t.NumExplicitMethods() + w.uint64(uint64(n)) + for i := 0; i < n; i++ { + m := t.ExplicitMethod(i) + w.pos(m.Pos()) + w.string(m.Name()) + sig, _ := m.Type().(*types.Signature) + w.signature(sig) + } + + case *typeparams.Union: + w.startType(unionType) + nt := t.Len() + w.uint64(uint64(nt)) + for i := 0; i < nt; i++ { + term := t.Term(i) + w.bool(term.Tilde()) + w.typ(term.Type(), pkg) + } + + default: + panic(internalErrorf("unexpected type: %v, %v", t, reflect.TypeOf(t))) + } +} + +func (w *exportWriter) setPkg(pkg *types.Package, write bool) { + if write { + w.pkg(pkg) + } + + w.currPkg = pkg +} + +func (w *exportWriter) signature(sig *types.Signature) { + w.paramList(sig.Params()) + w.paramList(sig.Results()) + if sig.Params().Len() > 0 { + w.bool(sig.Variadic()) + } +} + +func (w *exportWriter) typeList(ts *typeparams.TypeList, pkg *types.Package) { + w.uint64(uint64(ts.Len())) + for i := 0; i < ts.Len(); i++ { + w.typ(ts.At(i), pkg) + } +} + +func (w *exportWriter) tparamList(prefix string, list *typeparams.TypeParamList, pkg *types.Package) { + ll := uint64(list.Len()) + w.uint64(ll) + for i := 0; i < list.Len(); i++ { + tparam := list.At(i) + // Set the type parameter exportName before exporting its type. + exportName := tparamExportName(prefix, tparam) + w.p.tparamNames[tparam.Obj()] = exportName + w.typ(list.At(i), pkg) + } +} + +const blankMarker = "$" + +// tparamExportName returns the 'exported' name of a type parameter, which +// differs from its actual object name: it is prefixed with a qualifier, and +// blank type parameter names are disambiguated by their index in the type +// parameter list. +func tparamExportName(prefix string, tparam *typeparams.TypeParam) string { + assert(prefix != "") + name := tparam.Obj().Name() + if name == "_" { + name = blankMarker + strconv.Itoa(tparam.Index()) + } + return prefix + "." + name +} + +// tparamName returns the real name of a type parameter, after stripping its +// qualifying prefix and reverting blank-name encoding. See tparamExportName +// for details. +func tparamName(exportName string) string { + // Remove the "path" from the type param name that makes it unique. + ix := strings.LastIndex(exportName, ".") + if ix < 0 { + errorf("malformed type parameter export name %s: missing prefix", exportName) + } + name := exportName[ix+1:] + if strings.HasPrefix(name, blankMarker) { + return "_" + } + return name +} + +func (w *exportWriter) paramList(tup *types.Tuple) { + n := tup.Len() + w.uint64(uint64(n)) + for i := 0; i < n; i++ { + w.param(tup.At(i)) + } +} + +func (w *exportWriter) param(obj types.Object) { + w.pos(obj.Pos()) + w.localIdent(obj) + w.typ(obj.Type(), obj.Pkg()) +} + +func (w *exportWriter) value(typ types.Type, v constant.Value) { + w.typ(typ, nil) + if w.p.version >= iexportVersionGo1_18 { + w.int64(int64(v.Kind())) + } + + switch b := typ.Underlying().(*types.Basic); b.Info() & types.IsConstType { + case types.IsBoolean: + w.bool(constant.BoolVal(v)) + case types.IsInteger: + var i big.Int + if i64, exact := constant.Int64Val(v); exact { + i.SetInt64(i64) + } else if ui64, exact := constant.Uint64Val(v); exact { + i.SetUint64(ui64) + } else { + i.SetString(v.ExactString(), 10) + } + w.mpint(&i, typ) + case types.IsFloat: + f := constantToFloat(v) + w.mpfloat(f, typ) + case types.IsComplex: + w.mpfloat(constantToFloat(constant.Real(v)), typ) + w.mpfloat(constantToFloat(constant.Imag(v)), typ) + case types.IsString: + w.string(constant.StringVal(v)) + default: + if b.Kind() == types.Invalid { + // package contains type errors + break + } + panic(internalErrorf("unexpected type %v (%v)", typ, typ.Underlying())) + } +} + +// constantToFloat converts a constant.Value with kind constant.Float to a +// big.Float. +func constantToFloat(x constant.Value) *big.Float { + x = constant.ToFloat(x) + // Use the same floating-point precision (512) as cmd/compile + // (see Mpprec in cmd/compile/internal/gc/mpfloat.go). + const mpprec = 512 + var f big.Float + f.SetPrec(mpprec) + if v, exact := constant.Float64Val(x); exact { + // float64 + f.SetFloat64(v) + } else if num, denom := constant.Num(x), constant.Denom(x); num.Kind() == constant.Int { + // TODO(gri): add big.Rat accessor to constant.Value. + n := valueToRat(num) + d := valueToRat(denom) + f.SetRat(n.Quo(n, d)) + } else { + // Value too large to represent as a fraction => inaccessible. + // TODO(gri): add big.Float accessor to constant.Value. + _, ok := f.SetString(x.ExactString()) + assert(ok) + } + return &f +} + +// mpint exports a multi-precision integer. +// +// For unsigned types, small values are written out as a single +// byte. Larger values are written out as a length-prefixed big-endian +// byte string, where the length prefix is encoded as its complement. +// For example, bytes 0, 1, and 2 directly represent the integer +// values 0, 1, and 2; while bytes 255, 254, and 253 indicate a 1-, +// 2-, and 3-byte big-endian string follow. +// +// Encoding for signed types use the same general approach as for +// unsigned types, except small values use zig-zag encoding and the +// bottom bit of length prefix byte for large values is reserved as a +// sign bit. +// +// The exact boundary between small and large encodings varies +// according to the maximum number of bytes needed to encode a value +// of type typ. As a special case, 8-bit types are always encoded as a +// single byte. +// +// TODO(mdempsky): Is this level of complexity really worthwhile? +func (w *exportWriter) mpint(x *big.Int, typ types.Type) { + basic, ok := typ.Underlying().(*types.Basic) + if !ok { + panic(internalErrorf("unexpected type %v (%T)", typ.Underlying(), typ.Underlying())) + } + + signed, maxBytes := intSize(basic) + + negative := x.Sign() < 0 + if !signed && negative { + panic(internalErrorf("negative unsigned integer; type %v, value %v", typ, x)) + } + + b := x.Bytes() + if len(b) > 0 && b[0] == 0 { + panic(internalErrorf("leading zeros")) + } + if uint(len(b)) > maxBytes { + panic(internalErrorf("bad mpint length: %d > %d (type %v, value %v)", len(b), maxBytes, typ, x)) + } + + maxSmall := 256 - maxBytes + if signed { + maxSmall = 256 - 2*maxBytes + } + if maxBytes == 1 { + maxSmall = 256 + } + + // Check if x can use small value encoding. + if len(b) <= 1 { + var ux uint + if len(b) == 1 { + ux = uint(b[0]) + } + if signed { + ux <<= 1 + if negative { + ux-- + } + } + if ux < maxSmall { + w.data.WriteByte(byte(ux)) + return + } + } + + n := 256 - uint(len(b)) + if signed { + n = 256 - 2*uint(len(b)) + if negative { + n |= 1 + } + } + if n < maxSmall || n >= 256 { + panic(internalErrorf("encoding mistake: %d, %v, %v => %d", len(b), signed, negative, n)) + } + + w.data.WriteByte(byte(n)) + w.data.Write(b) +} + +// mpfloat exports a multi-precision floating point number. +// +// The number's value is decomposed into mantissa × 2**exponent, where +// mantissa is an integer. The value is written out as mantissa (as a +// multi-precision integer) and then the exponent, except exponent is +// omitted if mantissa is zero. +func (w *exportWriter) mpfloat(f *big.Float, typ types.Type) { + if f.IsInf() { + panic("infinite constant") + } + + // Break into f = mant × 2**exp, with 0.5 <= mant < 1. + var mant big.Float + exp := int64(f.MantExp(&mant)) + + // Scale so that mant is an integer. + prec := mant.MinPrec() + mant.SetMantExp(&mant, int(prec)) + exp -= int64(prec) + + manti, acc := mant.Int(nil) + if acc != big.Exact { + panic(internalErrorf("mantissa scaling failed for %f (%s)", f, acc)) + } + w.mpint(manti, typ) + if manti.Sign() != 0 { + w.int64(exp) + } +} + +func (w *exportWriter) bool(b bool) bool { + var x uint64 + if b { + x = 1 + } + w.uint64(x) + return b +} + +func (w *exportWriter) int64(x int64) { w.data.int64(x) } +func (w *exportWriter) uint64(x uint64) { w.data.uint64(x) } +func (w *exportWriter) string(s string) { w.uint64(w.p.stringOff(s)) } + +func (w *exportWriter) localIdent(obj types.Object) { + // Anonymous parameters. + if obj == nil { + w.string("") + return + } + + name := obj.Name() + if name == "_" { + w.string("_") + return + } + + w.string(name) +} + +type intWriter struct { + bytes.Buffer +} + +func (w *intWriter) int64(x int64) { + var buf [binary.MaxVarintLen64]byte + n := binary.PutVarint(buf[:], x) + w.Write(buf[:n]) +} + +func (w *intWriter) uint64(x uint64) { + var buf [binary.MaxVarintLen64]byte + n := binary.PutUvarint(buf[:], x) + w.Write(buf[:n]) +} + +func assert(cond bool) { + if !cond { + panic("internal error: assertion failed") + } +} + +// The below is copied from go/src/cmd/compile/internal/gc/syntax.go. + +// objQueue is a FIFO queue of types.Object. The zero value of objQueue is +// a ready-to-use empty queue. +type objQueue struct { + ring []types.Object + head, tail int +} + +// empty returns true if q contains no Nodes. +func (q *objQueue) empty() bool { + return q.head == q.tail +} + +// pushTail appends n to the tail of the queue. +func (q *objQueue) pushTail(obj types.Object) { + if len(q.ring) == 0 { + q.ring = make([]types.Object, 16) + } else if q.head+len(q.ring) == q.tail { + // Grow the ring. + nring := make([]types.Object, len(q.ring)*2) + // Copy the old elements. + part := q.ring[q.head%len(q.ring):] + if q.tail-q.head <= len(part) { + part = part[:q.tail-q.head] + copy(nring, part) + } else { + pos := copy(nring, part) + copy(nring[pos:], q.ring[:q.tail%len(q.ring)]) + } + q.ring, q.head, q.tail = nring, 0, q.tail-q.head + } + + q.ring[q.tail%len(q.ring)] = obj + q.tail++ +} + +// popHead pops a node from the head of the queue. It panics if q is empty. +func (q *objQueue) popHead() types.Object { + if q.empty() { + panic("dequeue empty") + } + obj := q.ring[q.head%len(q.ring)] + q.head++ + return obj +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/iimport.go b/vendor/golang.org/x/tools/go/internal/gcimporter/iimport.go new file mode 100644 index 0000000000..4caa0f55d9 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/iimport.go @@ -0,0 +1,878 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Indexed package import. +// See cmd/compile/internal/gc/iexport.go for the export data format. + +// This file is a copy of $GOROOT/src/go/internal/gcimporter/iimport.go. + +package gcimporter + +import ( + "bytes" + "encoding/binary" + "fmt" + "go/constant" + "go/token" + "go/types" + "io" + "math/big" + "sort" + "strings" + + "golang.org/x/tools/internal/typeparams" +) + +type intReader struct { + *bytes.Reader + path string +} + +func (r *intReader) int64() int64 { + i, err := binary.ReadVarint(r.Reader) + if err != nil { + errorf("import %q: read varint error: %v", r.path, err) + } + return i +} + +func (r *intReader) uint64() uint64 { + i, err := binary.ReadUvarint(r.Reader) + if err != nil { + errorf("import %q: read varint error: %v", r.path, err) + } + return i +} + +// Keep this in sync with constants in iexport.go. +const ( + iexportVersionGo1_11 = 0 + iexportVersionPosCol = 1 + iexportVersionGo1_18 = 2 + iexportVersionGenerics = 2 +) + +type ident struct { + pkg *types.Package + name string +} + +const predeclReserved = 32 + +type itag uint64 + +const ( + // Types + definedType itag = iota + pointerType + sliceType + arrayType + chanType + mapType + signatureType + structType + interfaceType + typeParamType + instanceType + unionType +) + +// IImportData imports a package from the serialized package data +// and returns 0 and a reference to the package. +// If the export data version is not recognized or the format is otherwise +// compromised, an error is returned. +func IImportData(fset *token.FileSet, imports map[string]*types.Package, data []byte, path string) (int, *types.Package, error) { + pkgs, err := iimportCommon(fset, imports, data, false, path) + if err != nil { + return 0, nil, err + } + return 0, pkgs[0], nil +} + +// IImportBundle imports a set of packages from the serialized package bundle. +func IImportBundle(fset *token.FileSet, imports map[string]*types.Package, data []byte) ([]*types.Package, error) { + return iimportCommon(fset, imports, data, true, "") +} + +func iimportCommon(fset *token.FileSet, imports map[string]*types.Package, data []byte, bundle bool, path string) (pkgs []*types.Package, err error) { + const currentVersion = 1 + version := int64(-1) + if !debug { + defer func() { + if e := recover(); e != nil { + if bundle { + err = fmt.Errorf("%v", e) + } else if version > currentVersion { + err = fmt.Errorf("cannot import %q (%v), export data is newer version - update tool", path, e) + } else { + err = fmt.Errorf("cannot import %q (%v), possibly version skew - reinstall package", path, e) + } + } + }() + } + + r := &intReader{bytes.NewReader(data), path} + + if bundle { + bundleVersion := r.uint64() + switch bundleVersion { + case bundleVersion: + default: + errorf("unknown bundle format version %d", bundleVersion) + } + } + + version = int64(r.uint64()) + switch version { + case iexportVersionGo1_18, iexportVersionPosCol, iexportVersionGo1_11: + default: + if version > iexportVersionGo1_18 { + errorf("unstable iexport format version %d, just rebuild compiler and std library", version) + } else { + errorf("unknown iexport format version %d", version) + } + } + + sLen := int64(r.uint64()) + dLen := int64(r.uint64()) + + whence, _ := r.Seek(0, io.SeekCurrent) + stringData := data[whence : whence+sLen] + declData := data[whence+sLen : whence+sLen+dLen] + r.Seek(sLen+dLen, io.SeekCurrent) + + p := iimporter{ + version: int(version), + ipath: path, + + stringData: stringData, + stringCache: make(map[uint64]string), + pkgCache: make(map[uint64]*types.Package), + + declData: declData, + pkgIndex: make(map[*types.Package]map[string]uint64), + typCache: make(map[uint64]types.Type), + // Separate map for typeparams, keyed by their package and unique + // name. + tparamIndex: make(map[ident]types.Type), + + fake: fakeFileSet{ + fset: fset, + files: make(map[string]*fileInfo), + }, + } + defer p.fake.setLines() // set lines for files in fset + + for i, pt := range predeclared() { + p.typCache[uint64(i)] = pt + } + + pkgList := make([]*types.Package, r.uint64()) + for i := range pkgList { + pkgPathOff := r.uint64() + pkgPath := p.stringAt(pkgPathOff) + pkgName := p.stringAt(r.uint64()) + _ = r.uint64() // package height; unused by go/types + + if pkgPath == "" { + pkgPath = path + } + pkg := imports[pkgPath] + if pkg == nil { + pkg = types.NewPackage(pkgPath, pkgName) + imports[pkgPath] = pkg + } else if pkg.Name() != pkgName { + errorf("conflicting names %s and %s for package %q", pkg.Name(), pkgName, path) + } + + p.pkgCache[pkgPathOff] = pkg + + nameIndex := make(map[string]uint64) + for nSyms := r.uint64(); nSyms > 0; nSyms-- { + name := p.stringAt(r.uint64()) + nameIndex[name] = r.uint64() + } + + p.pkgIndex[pkg] = nameIndex + pkgList[i] = pkg + } + + if bundle { + pkgs = make([]*types.Package, r.uint64()) + for i := range pkgs { + pkg := p.pkgAt(r.uint64()) + imps := make([]*types.Package, r.uint64()) + for j := range imps { + imps[j] = p.pkgAt(r.uint64()) + } + pkg.SetImports(imps) + pkgs[i] = pkg + } + } else { + if len(pkgList) == 0 { + errorf("no packages found for %s", path) + panic("unreachable") + } + pkgs = pkgList[:1] + + // record all referenced packages as imports + list := append(([]*types.Package)(nil), pkgList[1:]...) + sort.Sort(byPath(list)) + pkgs[0].SetImports(list) + } + + for _, pkg := range pkgs { + if pkg.Complete() { + continue + } + + names := make([]string, 0, len(p.pkgIndex[pkg])) + for name := range p.pkgIndex[pkg] { + names = append(names, name) + } + sort.Strings(names) + for _, name := range names { + p.doDecl(pkg, name) + } + + // package was imported completely and without errors + pkg.MarkComplete() + } + + // SetConstraint can't be called if the constraint type is not yet complete. + // When type params are created in the 'P' case of (*importReader).obj(), + // the associated constraint type may not be complete due to recursion. + // Therefore, we defer calling SetConstraint there, and call it here instead + // after all types are complete. + for _, d := range p.later { + typeparams.SetTypeParamConstraint(d.t, d.constraint) + } + + for _, typ := range p.interfaceList { + typ.Complete() + } + + return pkgs, nil +} + +type setConstraintArgs struct { + t *typeparams.TypeParam + constraint types.Type +} + +type iimporter struct { + version int + ipath string + + stringData []byte + stringCache map[uint64]string + pkgCache map[uint64]*types.Package + + declData []byte + pkgIndex map[*types.Package]map[string]uint64 + typCache map[uint64]types.Type + tparamIndex map[ident]types.Type + + fake fakeFileSet + interfaceList []*types.Interface + + // Arguments for calls to SetConstraint that are deferred due to recursive types + later []setConstraintArgs + + indent int // for tracing support +} + +func (p *iimporter) trace(format string, args ...interface{}) { + if !trace { + // Call sites should also be guarded, but having this check here allows + // easily enabling/disabling debug trace statements. + return + } + fmt.Printf(strings.Repeat("..", p.indent)+format+"\n", args...) +} + +func (p *iimporter) doDecl(pkg *types.Package, name string) { + if debug { + p.trace("import decl %s", name) + p.indent++ + defer func() { + p.indent-- + p.trace("=> %s", name) + }() + } + // See if we've already imported this declaration. + if obj := pkg.Scope().Lookup(name); obj != nil { + return + } + + off, ok := p.pkgIndex[pkg][name] + if !ok { + errorf("%v.%v not in index", pkg, name) + } + + r := &importReader{p: p, currPkg: pkg} + r.declReader.Reset(p.declData[off:]) + + r.obj(name) +} + +func (p *iimporter) stringAt(off uint64) string { + if s, ok := p.stringCache[off]; ok { + return s + } + + slen, n := binary.Uvarint(p.stringData[off:]) + if n <= 0 { + errorf("varint failed") + } + spos := off + uint64(n) + s := string(p.stringData[spos : spos+slen]) + p.stringCache[off] = s + return s +} + +func (p *iimporter) pkgAt(off uint64) *types.Package { + if pkg, ok := p.pkgCache[off]; ok { + return pkg + } + path := p.stringAt(off) + errorf("missing package %q in %q", path, p.ipath) + return nil +} + +func (p *iimporter) typAt(off uint64, base *types.Named) types.Type { + if t, ok := p.typCache[off]; ok && canReuse(base, t) { + return t + } + + if off < predeclReserved { + errorf("predeclared type missing from cache: %v", off) + } + + r := &importReader{p: p} + r.declReader.Reset(p.declData[off-predeclReserved:]) + t := r.doType(base) + + if canReuse(base, t) { + p.typCache[off] = t + } + return t +} + +// canReuse reports whether the type rhs on the RHS of the declaration for def +// may be re-used. +// +// Specifically, if def is non-nil and rhs is an interface type with methods, it +// may not be re-used because we have a convention of setting the receiver type +// for interface methods to def. +func canReuse(def *types.Named, rhs types.Type) bool { + if def == nil { + return true + } + iface, _ := rhs.(*types.Interface) + if iface == nil { + return true + } + // Don't use iface.Empty() here as iface may not be complete. + return iface.NumEmbeddeds() == 0 && iface.NumExplicitMethods() == 0 +} + +type importReader struct { + p *iimporter + declReader bytes.Reader + currPkg *types.Package + prevFile string + prevLine int64 + prevColumn int64 +} + +func (r *importReader) obj(name string) { + tag := r.byte() + pos := r.pos() + + switch tag { + case 'A': + typ := r.typ() + + r.declare(types.NewTypeName(pos, r.currPkg, name, typ)) + + case 'C': + typ, val := r.value() + + r.declare(types.NewConst(pos, r.currPkg, name, typ, val)) + + case 'F', 'G': + var tparams []*typeparams.TypeParam + if tag == 'G' { + tparams = r.tparamList() + } + sig := r.signature(nil, nil, tparams) + r.declare(types.NewFunc(pos, r.currPkg, name, sig)) + + case 'T', 'U': + // Types can be recursive. We need to setup a stub + // declaration before recursing. + obj := types.NewTypeName(pos, r.currPkg, name, nil) + named := types.NewNamed(obj, nil, nil) + // Declare obj before calling r.tparamList, so the new type name is recognized + // if used in the constraint of one of its own typeparams (see #48280). + r.declare(obj) + if tag == 'U' { + tparams := r.tparamList() + typeparams.SetForNamed(named, tparams) + } + + underlying := r.p.typAt(r.uint64(), named).Underlying() + named.SetUnderlying(underlying) + + if !isInterface(underlying) { + for n := r.uint64(); n > 0; n-- { + mpos := r.pos() + mname := r.ident() + recv := r.param() + + // If the receiver has any targs, set those as the + // rparams of the method (since those are the + // typeparams being used in the method sig/body). + base := baseType(recv.Type()) + assert(base != nil) + targs := typeparams.NamedTypeArgs(base) + var rparams []*typeparams.TypeParam + if targs.Len() > 0 { + rparams = make([]*typeparams.TypeParam, targs.Len()) + for i := range rparams { + rparams[i] = targs.At(i).(*typeparams.TypeParam) + } + } + msig := r.signature(recv, rparams, nil) + + named.AddMethod(types.NewFunc(mpos, r.currPkg, mname, msig)) + } + } + + case 'P': + // We need to "declare" a typeparam in order to have a name that + // can be referenced recursively (if needed) in the type param's + // bound. + if r.p.version < iexportVersionGenerics { + errorf("unexpected type param type") + } + name0 := tparamName(name) + tn := types.NewTypeName(pos, r.currPkg, name0, nil) + t := typeparams.NewTypeParam(tn, nil) + + // To handle recursive references to the typeparam within its + // bound, save the partial type in tparamIndex before reading the bounds. + id := ident{r.currPkg, name} + r.p.tparamIndex[id] = t + var implicit bool + if r.p.version >= iexportVersionGo1_18 { + implicit = r.bool() + } + constraint := r.typ() + if implicit { + iface, _ := constraint.(*types.Interface) + if iface == nil { + errorf("non-interface constraint marked implicit") + } + typeparams.MarkImplicit(iface) + } + // The constraint type may not be complete, if we + // are in the middle of a type recursion involving type + // constraints. So, we defer SetConstraint until we have + // completely set up all types in ImportData. + r.p.later = append(r.p.later, setConstraintArgs{t: t, constraint: constraint}) + + case 'V': + typ := r.typ() + + r.declare(types.NewVar(pos, r.currPkg, name, typ)) + + default: + errorf("unexpected tag: %v", tag) + } +} + +func (r *importReader) declare(obj types.Object) { + obj.Pkg().Scope().Insert(obj) +} + +func (r *importReader) value() (typ types.Type, val constant.Value) { + typ = r.typ() + if r.p.version >= iexportVersionGo1_18 { + // TODO: add support for using the kind. + _ = constant.Kind(r.int64()) + } + + switch b := typ.Underlying().(*types.Basic); b.Info() & types.IsConstType { + case types.IsBoolean: + val = constant.MakeBool(r.bool()) + + case types.IsString: + val = constant.MakeString(r.string()) + + case types.IsInteger: + var x big.Int + r.mpint(&x, b) + val = constant.Make(&x) + + case types.IsFloat: + val = r.mpfloat(b) + + case types.IsComplex: + re := r.mpfloat(b) + im := r.mpfloat(b) + val = constant.BinaryOp(re, token.ADD, constant.MakeImag(im)) + + default: + if b.Kind() == types.Invalid { + val = constant.MakeUnknown() + return + } + errorf("unexpected type %v", typ) // panics + panic("unreachable") + } + + return +} + +func intSize(b *types.Basic) (signed bool, maxBytes uint) { + if (b.Info() & types.IsUntyped) != 0 { + return true, 64 + } + + switch b.Kind() { + case types.Float32, types.Complex64: + return true, 3 + case types.Float64, types.Complex128: + return true, 7 + } + + signed = (b.Info() & types.IsUnsigned) == 0 + switch b.Kind() { + case types.Int8, types.Uint8: + maxBytes = 1 + case types.Int16, types.Uint16: + maxBytes = 2 + case types.Int32, types.Uint32: + maxBytes = 4 + default: + maxBytes = 8 + } + + return +} + +func (r *importReader) mpint(x *big.Int, typ *types.Basic) { + signed, maxBytes := intSize(typ) + + maxSmall := 256 - maxBytes + if signed { + maxSmall = 256 - 2*maxBytes + } + if maxBytes == 1 { + maxSmall = 256 + } + + n, _ := r.declReader.ReadByte() + if uint(n) < maxSmall { + v := int64(n) + if signed { + v >>= 1 + if n&1 != 0 { + v = ^v + } + } + x.SetInt64(v) + return + } + + v := -n + if signed { + v = -(n &^ 1) >> 1 + } + if v < 1 || uint(v) > maxBytes { + errorf("weird decoding: %v, %v => %v", n, signed, v) + } + b := make([]byte, v) + io.ReadFull(&r.declReader, b) + x.SetBytes(b) + if signed && n&1 != 0 { + x.Neg(x) + } +} + +func (r *importReader) mpfloat(typ *types.Basic) constant.Value { + var mant big.Int + r.mpint(&mant, typ) + var f big.Float + f.SetInt(&mant) + if f.Sign() != 0 { + f.SetMantExp(&f, int(r.int64())) + } + return constant.Make(&f) +} + +func (r *importReader) ident() string { + return r.string() +} + +func (r *importReader) qualifiedIdent() (*types.Package, string) { + name := r.string() + pkg := r.pkg() + return pkg, name +} + +func (r *importReader) pos() token.Pos { + if r.p.version >= iexportVersionPosCol { + r.posv1() + } else { + r.posv0() + } + + if r.prevFile == "" && r.prevLine == 0 && r.prevColumn == 0 { + return token.NoPos + } + return r.p.fake.pos(r.prevFile, int(r.prevLine), int(r.prevColumn)) +} + +func (r *importReader) posv0() { + delta := r.int64() + if delta != deltaNewFile { + r.prevLine += delta + } else if l := r.int64(); l == -1 { + r.prevLine += deltaNewFile + } else { + r.prevFile = r.string() + r.prevLine = l + } +} + +func (r *importReader) posv1() { + delta := r.int64() + r.prevColumn += delta >> 1 + if delta&1 != 0 { + delta = r.int64() + r.prevLine += delta >> 1 + if delta&1 != 0 { + r.prevFile = r.string() + } + } +} + +func (r *importReader) typ() types.Type { + return r.p.typAt(r.uint64(), nil) +} + +func isInterface(t types.Type) bool { + _, ok := t.(*types.Interface) + return ok +} + +func (r *importReader) pkg() *types.Package { return r.p.pkgAt(r.uint64()) } +func (r *importReader) string() string { return r.p.stringAt(r.uint64()) } + +func (r *importReader) doType(base *types.Named) (res types.Type) { + k := r.kind() + if debug { + r.p.trace("importing type %d (base: %s)", k, base) + r.p.indent++ + defer func() { + r.p.indent-- + r.p.trace("=> %s", res) + }() + } + switch k { + default: + errorf("unexpected kind tag in %q: %v", r.p.ipath, k) + return nil + + case definedType: + pkg, name := r.qualifiedIdent() + r.p.doDecl(pkg, name) + return pkg.Scope().Lookup(name).(*types.TypeName).Type() + case pointerType: + return types.NewPointer(r.typ()) + case sliceType: + return types.NewSlice(r.typ()) + case arrayType: + n := r.uint64() + return types.NewArray(r.typ(), int64(n)) + case chanType: + dir := chanDir(int(r.uint64())) + return types.NewChan(dir, r.typ()) + case mapType: + return types.NewMap(r.typ(), r.typ()) + case signatureType: + r.currPkg = r.pkg() + return r.signature(nil, nil, nil) + + case structType: + r.currPkg = r.pkg() + + fields := make([]*types.Var, r.uint64()) + tags := make([]string, len(fields)) + for i := range fields { + fpos := r.pos() + fname := r.ident() + ftyp := r.typ() + emb := r.bool() + tag := r.string() + + fields[i] = types.NewField(fpos, r.currPkg, fname, ftyp, emb) + tags[i] = tag + } + return types.NewStruct(fields, tags) + + case interfaceType: + r.currPkg = r.pkg() + + embeddeds := make([]types.Type, r.uint64()) + for i := range embeddeds { + _ = r.pos() + embeddeds[i] = r.typ() + } + + methods := make([]*types.Func, r.uint64()) + for i := range methods { + mpos := r.pos() + mname := r.ident() + + // TODO(mdempsky): Matches bimport.go, but I + // don't agree with this. + var recv *types.Var + if base != nil { + recv = types.NewVar(token.NoPos, r.currPkg, "", base) + } + + msig := r.signature(recv, nil, nil) + methods[i] = types.NewFunc(mpos, r.currPkg, mname, msig) + } + + typ := newInterface(methods, embeddeds) + r.p.interfaceList = append(r.p.interfaceList, typ) + return typ + + case typeParamType: + if r.p.version < iexportVersionGenerics { + errorf("unexpected type param type") + } + pkg, name := r.qualifiedIdent() + id := ident{pkg, name} + if t, ok := r.p.tparamIndex[id]; ok { + // We're already in the process of importing this typeparam. + return t + } + // Otherwise, import the definition of the typeparam now. + r.p.doDecl(pkg, name) + return r.p.tparamIndex[id] + + case instanceType: + if r.p.version < iexportVersionGenerics { + errorf("unexpected instantiation type") + } + // pos does not matter for instances: they are positioned on the original + // type. + _ = r.pos() + len := r.uint64() + targs := make([]types.Type, len) + for i := range targs { + targs[i] = r.typ() + } + baseType := r.typ() + // The imported instantiated type doesn't include any methods, so + // we must always use the methods of the base (orig) type. + // TODO provide a non-nil *Environment + t, _ := typeparams.Instantiate(nil, baseType, targs, false) + return t + + case unionType: + if r.p.version < iexportVersionGenerics { + errorf("unexpected instantiation type") + } + terms := make([]*typeparams.Term, r.uint64()) + for i := range terms { + terms[i] = typeparams.NewTerm(r.bool(), r.typ()) + } + return typeparams.NewUnion(terms) + } +} + +func (r *importReader) kind() itag { + return itag(r.uint64()) +} + +func (r *importReader) signature(recv *types.Var, rparams []*typeparams.TypeParam, tparams []*typeparams.TypeParam) *types.Signature { + params := r.paramList() + results := r.paramList() + variadic := params.Len() > 0 && r.bool() + return typeparams.NewSignatureType(recv, rparams, tparams, params, results, variadic) +} + +func (r *importReader) tparamList() []*typeparams.TypeParam { + n := r.uint64() + if n == 0 { + return nil + } + xs := make([]*typeparams.TypeParam, n) + for i := range xs { + // Note: the standard library importer is tolerant of nil types here, + // though would panic in SetTypeParams. + xs[i] = r.typ().(*typeparams.TypeParam) + } + return xs +} + +func (r *importReader) paramList() *types.Tuple { + xs := make([]*types.Var, r.uint64()) + for i := range xs { + xs[i] = r.param() + } + return types.NewTuple(xs...) +} + +func (r *importReader) param() *types.Var { + pos := r.pos() + name := r.ident() + typ := r.typ() + return types.NewParam(pos, r.currPkg, name, typ) +} + +func (r *importReader) bool() bool { + return r.uint64() != 0 +} + +func (r *importReader) int64() int64 { + n, err := binary.ReadVarint(&r.declReader) + if err != nil { + errorf("readVarint: %v", err) + } + return n +} + +func (r *importReader) uint64() uint64 { + n, err := binary.ReadUvarint(&r.declReader) + if err != nil { + errorf("readUvarint: %v", err) + } + return n +} + +func (r *importReader) byte() byte { + x, err := r.declReader.ReadByte() + if err != nil { + errorf("declReader.ReadByte: %v", err) + } + return x +} + +func baseType(typ types.Type) *types.Named { + // pointer receivers are never types.Named types + if p, _ := typ.(*types.Pointer); p != nil { + typ = p.Elem() + } + // receiver base types are always (possibly generic) types.Named types + n, _ := typ.(*types.Named) + return n +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/newInterface10.go b/vendor/golang.org/x/tools/go/internal/gcimporter/newInterface10.go new file mode 100644 index 0000000000..8b163e3d05 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/newInterface10.go @@ -0,0 +1,22 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.11 +// +build !go1.11 + +package gcimporter + +import "go/types" + +func newInterface(methods []*types.Func, embeddeds []types.Type) *types.Interface { + named := make([]*types.Named, len(embeddeds)) + for i, e := range embeddeds { + var ok bool + named[i], ok = e.(*types.Named) + if !ok { + panic("embedding of non-defined interfaces in interfaces is not supported before Go 1.11") + } + } + return types.NewInterface(methods, named) +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/newInterface11.go b/vendor/golang.org/x/tools/go/internal/gcimporter/newInterface11.go new file mode 100644 index 0000000000..49984f40fd --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/newInterface11.go @@ -0,0 +1,14 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.11 +// +build go1.11 + +package gcimporter + +import "go/types" + +func newInterface(methods []*types.Func, embeddeds []types.Type) *types.Interface { + return types.NewInterfaceType(methods, embeddeds) +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/support_go117.go b/vendor/golang.org/x/tools/go/internal/gcimporter/support_go117.go new file mode 100644 index 0000000000..d892273efb --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/support_go117.go @@ -0,0 +1,16 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.18 +// +build !go1.18 + +package gcimporter + +import "go/types" + +const iexportVersion = iexportVersionGo1_11 + +func additionalPredeclared() []types.Type { + return nil +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/support_go118.go b/vendor/golang.org/x/tools/go/internal/gcimporter/support_go118.go new file mode 100644 index 0000000000..a993843230 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/support_go118.go @@ -0,0 +1,23 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 +// +build go1.18 + +package gcimporter + +import "go/types" + +const iexportVersion = iexportVersionGenerics + +// additionalPredeclared returns additional predeclared types in go.1.18. +func additionalPredeclared() []types.Type { + return []types.Type{ + // comparable + types.Universe.Lookup("comparable").Type(), + + // any + types.Universe.Lookup("any").Type(), + } +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/unified_no.go b/vendor/golang.org/x/tools/go/internal/gcimporter/unified_no.go new file mode 100644 index 0000000000..286bf44548 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/unified_no.go @@ -0,0 +1,10 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !(go1.18 && goexperiment.unified) +// +build !go1.18 !goexperiment.unified + +package gcimporter + +const unifiedIR = false diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/unified_yes.go b/vendor/golang.org/x/tools/go/internal/gcimporter/unified_yes.go new file mode 100644 index 0000000000..b5d69ffbe6 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/unified_yes.go @@ -0,0 +1,10 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 && goexperiment.unified +// +build go1.18,goexperiment.unified + +package gcimporter + +const unifiedIR = true diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/ureader_no.go b/vendor/golang.org/x/tools/go/internal/gcimporter/ureader_no.go new file mode 100644 index 0000000000..8eb20729c2 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/ureader_no.go @@ -0,0 +1,19 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.18 +// +build !go1.18 + +package gcimporter + +import ( + "fmt" + "go/token" + "go/types" +) + +func UImportData(fset *token.FileSet, imports map[string]*types.Package, data []byte, path string) (_ int, pkg *types.Package, err error) { + err = fmt.Errorf("go/tools compiled with a Go version earlier than 1.18 cannot read unified IR export data") + return +} diff --git a/vendor/golang.org/x/tools/go/internal/gcimporter/ureader_yes.go b/vendor/golang.org/x/tools/go/internal/gcimporter/ureader_yes.go new file mode 100644 index 0000000000..3c1a437543 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/gcimporter/ureader_yes.go @@ -0,0 +1,612 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Derived from go/internal/gcimporter/ureader.go + +//go:build go1.18 +// +build go1.18 + +package gcimporter + +import ( + "go/token" + "go/types" + "strings" + + "golang.org/x/tools/go/internal/pkgbits" +) + +// A pkgReader holds the shared state for reading a unified IR package +// description. +type pkgReader struct { + pkgbits.PkgDecoder + + fake fakeFileSet + + ctxt *types.Context + imports map[string]*types.Package // previously imported packages, indexed by path + + // lazily initialized arrays corresponding to the unified IR + // PosBase, Pkg, and Type sections, respectively. + posBases []string // position bases (i.e., file names) + pkgs []*types.Package + typs []types.Type + + // laterFns holds functions that need to be invoked at the end of + // import reading. + laterFns []func() +} + +// later adds a function to be invoked at the end of import reading. +func (pr *pkgReader) later(fn func()) { + pr.laterFns = append(pr.laterFns, fn) +} + +// See cmd/compile/internal/noder.derivedInfo. +type derivedInfo struct { + idx pkgbits.Index + needed bool +} + +// See cmd/compile/internal/noder.typeInfo. +type typeInfo struct { + idx pkgbits.Index + derived bool +} + +func UImportData(fset *token.FileSet, imports map[string]*types.Package, data []byte, path string) (_ int, pkg *types.Package, err error) { + s := string(data) + s = s[:strings.LastIndex(s, "\n$$\n")] + input := pkgbits.NewPkgDecoder(path, s) + pkg = readUnifiedPackage(fset, nil, imports, input) + return +} + +// readUnifiedPackage reads a package description from the given +// unified IR export data decoder. +func readUnifiedPackage(fset *token.FileSet, ctxt *types.Context, imports map[string]*types.Package, input pkgbits.PkgDecoder) *types.Package { + pr := pkgReader{ + PkgDecoder: input, + + fake: fakeFileSet{ + fset: fset, + files: make(map[string]*fileInfo), + }, + + ctxt: ctxt, + imports: imports, + + posBases: make([]string, input.NumElems(pkgbits.RelocPosBase)), + pkgs: make([]*types.Package, input.NumElems(pkgbits.RelocPkg)), + typs: make([]types.Type, input.NumElems(pkgbits.RelocType)), + } + defer pr.fake.setLines() + + r := pr.newReader(pkgbits.RelocMeta, pkgbits.PublicRootIdx, pkgbits.SyncPublic) + pkg := r.pkg() + r.Bool() // has init + + for i, n := 0, r.Len(); i < n; i++ { + // As if r.obj(), but avoiding the Scope.Lookup call, + // to avoid eager loading of imports. + r.Sync(pkgbits.SyncObject) + assert(!r.Bool()) + r.p.objIdx(r.Reloc(pkgbits.RelocObj)) + assert(r.Len() == 0) + } + + r.Sync(pkgbits.SyncEOF) + + for _, fn := range pr.laterFns { + fn() + } + + pkg.MarkComplete() + return pkg +} + +// A reader holds the state for reading a single unified IR element +// within a package. +type reader struct { + pkgbits.Decoder + + p *pkgReader + + dict *readerDict +} + +// A readerDict holds the state for type parameters that parameterize +// the current unified IR element. +type readerDict struct { + // bounds is a slice of typeInfos corresponding to the underlying + // bounds of the element's type parameters. + bounds []typeInfo + + // tparams is a slice of the constructed TypeParams for the element. + tparams []*types.TypeParam + + // devived is a slice of types derived from tparams, which may be + // instantiated while reading the current element. + derived []derivedInfo + derivedTypes []types.Type // lazily instantiated from derived +} + +func (pr *pkgReader) newReader(k pkgbits.RelocKind, idx pkgbits.Index, marker pkgbits.SyncMarker) *reader { + return &reader{ + Decoder: pr.NewDecoder(k, idx, marker), + p: pr, + } +} + +// @@@ Positions + +func (r *reader) pos() token.Pos { + r.Sync(pkgbits.SyncPos) + if !r.Bool() { + return token.NoPos + } + + // TODO(mdempsky): Delta encoding. + posBase := r.posBase() + line := r.Uint() + col := r.Uint() + return r.p.fake.pos(posBase, int(line), int(col)) +} + +func (r *reader) posBase() string { + return r.p.posBaseIdx(r.Reloc(pkgbits.RelocPosBase)) +} + +func (pr *pkgReader) posBaseIdx(idx pkgbits.Index) string { + if b := pr.posBases[idx]; b != "" { + return b + } + + r := pr.newReader(pkgbits.RelocPosBase, idx, pkgbits.SyncPosBase) + + // Within types2, position bases have a lot more details (e.g., + // keeping track of where //line directives appeared exactly). + // + // For go/types, we just track the file name. + + filename := r.String() + + if r.Bool() { // file base + // Was: "b = token.NewTrimmedFileBase(filename, true)" + } else { // line base + pos := r.pos() + line := r.Uint() + col := r.Uint() + + // Was: "b = token.NewLineBase(pos, filename, true, line, col)" + _, _, _ = pos, line, col + } + + b := filename + pr.posBases[idx] = b + return b +} + +// @@@ Packages + +func (r *reader) pkg() *types.Package { + r.Sync(pkgbits.SyncPkg) + return r.p.pkgIdx(r.Reloc(pkgbits.RelocPkg)) +} + +func (pr *pkgReader) pkgIdx(idx pkgbits.Index) *types.Package { + // TODO(mdempsky): Consider using some non-nil pointer to indicate + // the universe scope, so we don't need to keep re-reading it. + if pkg := pr.pkgs[idx]; pkg != nil { + return pkg + } + + pkg := pr.newReader(pkgbits.RelocPkg, idx, pkgbits.SyncPkgDef).doPkg() + pr.pkgs[idx] = pkg + return pkg +} + +func (r *reader) doPkg() *types.Package { + path := r.String() + switch path { + case "": + path = r.p.PkgPath() + case "builtin": + return nil // universe + case "unsafe": + return types.Unsafe + } + + if pkg := r.p.imports[path]; pkg != nil { + return pkg + } + + name := r.String() + + pkg := types.NewPackage(path, name) + r.p.imports[path] = pkg + + imports := make([]*types.Package, r.Len()) + for i := range imports { + imports[i] = r.pkg() + } + pkg.SetImports(imports) + + return pkg +} + +// @@@ Types + +func (r *reader) typ() types.Type { + return r.p.typIdx(r.typInfo(), r.dict) +} + +func (r *reader) typInfo() typeInfo { + r.Sync(pkgbits.SyncType) + if r.Bool() { + return typeInfo{idx: pkgbits.Index(r.Len()), derived: true} + } + return typeInfo{idx: r.Reloc(pkgbits.RelocType), derived: false} +} + +func (pr *pkgReader) typIdx(info typeInfo, dict *readerDict) types.Type { + idx := info.idx + var where *types.Type + if info.derived { + where = &dict.derivedTypes[idx] + idx = dict.derived[idx].idx + } else { + where = &pr.typs[idx] + } + + if typ := *where; typ != nil { + return typ + } + + r := pr.newReader(pkgbits.RelocType, idx, pkgbits.SyncTypeIdx) + r.dict = dict + + typ := r.doTyp() + assert(typ != nil) + + // See comment in pkgReader.typIdx explaining how this happens. + if prev := *where; prev != nil { + return prev + } + + *where = typ + return typ +} + +func (r *reader) doTyp() (res types.Type) { + switch tag := pkgbits.CodeType(r.Code(pkgbits.SyncType)); tag { + default: + errorf("unhandled type tag: %v", tag) + panic("unreachable") + + case pkgbits.TypeBasic: + return types.Typ[r.Len()] + + case pkgbits.TypeNamed: + obj, targs := r.obj() + name := obj.(*types.TypeName) + if len(targs) != 0 { + t, _ := types.Instantiate(r.p.ctxt, name.Type(), targs, false) + return t + } + return name.Type() + + case pkgbits.TypeTypeParam: + return r.dict.tparams[r.Len()] + + case pkgbits.TypeArray: + len := int64(r.Uint64()) + return types.NewArray(r.typ(), len) + case pkgbits.TypeChan: + dir := types.ChanDir(r.Len()) + return types.NewChan(dir, r.typ()) + case pkgbits.TypeMap: + return types.NewMap(r.typ(), r.typ()) + case pkgbits.TypePointer: + return types.NewPointer(r.typ()) + case pkgbits.TypeSignature: + return r.signature(nil, nil, nil) + case pkgbits.TypeSlice: + return types.NewSlice(r.typ()) + case pkgbits.TypeStruct: + return r.structType() + case pkgbits.TypeInterface: + return r.interfaceType() + case pkgbits.TypeUnion: + return r.unionType() + } +} + +func (r *reader) structType() *types.Struct { + fields := make([]*types.Var, r.Len()) + var tags []string + for i := range fields { + pos := r.pos() + pkg, name := r.selector() + ftyp := r.typ() + tag := r.String() + embedded := r.Bool() + + fields[i] = types.NewField(pos, pkg, name, ftyp, embedded) + if tag != "" { + for len(tags) < i { + tags = append(tags, "") + } + tags = append(tags, tag) + } + } + return types.NewStruct(fields, tags) +} + +func (r *reader) unionType() *types.Union { + terms := make([]*types.Term, r.Len()) + for i := range terms { + terms[i] = types.NewTerm(r.Bool(), r.typ()) + } + return types.NewUnion(terms) +} + +func (r *reader) interfaceType() *types.Interface { + methods := make([]*types.Func, r.Len()) + embeddeds := make([]types.Type, r.Len()) + implicit := len(methods) == 0 && len(embeddeds) == 1 && r.Bool() + + for i := range methods { + pos := r.pos() + pkg, name := r.selector() + mtyp := r.signature(nil, nil, nil) + methods[i] = types.NewFunc(pos, pkg, name, mtyp) + } + + for i := range embeddeds { + embeddeds[i] = r.typ() + } + + iface := types.NewInterfaceType(methods, embeddeds) + if implicit { + iface.MarkImplicit() + } + return iface +} + +func (r *reader) signature(recv *types.Var, rtparams, tparams []*types.TypeParam) *types.Signature { + r.Sync(pkgbits.SyncSignature) + + params := r.params() + results := r.params() + variadic := r.Bool() + + return types.NewSignatureType(recv, rtparams, tparams, params, results, variadic) +} + +func (r *reader) params() *types.Tuple { + r.Sync(pkgbits.SyncParams) + + params := make([]*types.Var, r.Len()) + for i := range params { + params[i] = r.param() + } + + return types.NewTuple(params...) +} + +func (r *reader) param() *types.Var { + r.Sync(pkgbits.SyncParam) + + pos := r.pos() + pkg, name := r.localIdent() + typ := r.typ() + + return types.NewParam(pos, pkg, name, typ) +} + +// @@@ Objects + +func (r *reader) obj() (types.Object, []types.Type) { + r.Sync(pkgbits.SyncObject) + + assert(!r.Bool()) + + pkg, name := r.p.objIdx(r.Reloc(pkgbits.RelocObj)) + obj := pkgScope(pkg).Lookup(name) + + targs := make([]types.Type, r.Len()) + for i := range targs { + targs[i] = r.typ() + } + + return obj, targs +} + +func (pr *pkgReader) objIdx(idx pkgbits.Index) (*types.Package, string) { + rname := pr.newReader(pkgbits.RelocName, idx, pkgbits.SyncObject1) + + objPkg, objName := rname.qualifiedIdent() + assert(objName != "") + + tag := pkgbits.CodeObj(rname.Code(pkgbits.SyncCodeObj)) + + if tag == pkgbits.ObjStub { + assert(objPkg == nil || objPkg == types.Unsafe) + return objPkg, objName + } + + if objPkg.Scope().Lookup(objName) == nil { + dict := pr.objDictIdx(idx) + + r := pr.newReader(pkgbits.RelocObj, idx, pkgbits.SyncObject1) + r.dict = dict + + declare := func(obj types.Object) { + objPkg.Scope().Insert(obj) + } + + switch tag { + default: + panic("weird") + + case pkgbits.ObjAlias: + pos := r.pos() + typ := r.typ() + declare(types.NewTypeName(pos, objPkg, objName, typ)) + + case pkgbits.ObjConst: + pos := r.pos() + typ := r.typ() + val := r.Value() + declare(types.NewConst(pos, objPkg, objName, typ, val)) + + case pkgbits.ObjFunc: + pos := r.pos() + tparams := r.typeParamNames() + sig := r.signature(nil, nil, tparams) + declare(types.NewFunc(pos, objPkg, objName, sig)) + + case pkgbits.ObjType: + pos := r.pos() + + obj := types.NewTypeName(pos, objPkg, objName, nil) + named := types.NewNamed(obj, nil, nil) + declare(obj) + + named.SetTypeParams(r.typeParamNames()) + + // TODO(mdempsky): Rewrite receiver types to underlying is an + // Interface? The go/types importer does this (I think because + // unit tests expected that), but cmd/compile doesn't care + // about it, so maybe we can avoid worrying about that here. + rhs := r.typ() + r.p.later(func() { + underlying := rhs.Underlying() + named.SetUnderlying(underlying) + }) + + for i, n := 0, r.Len(); i < n; i++ { + named.AddMethod(r.method()) + } + + case pkgbits.ObjVar: + pos := r.pos() + typ := r.typ() + declare(types.NewVar(pos, objPkg, objName, typ)) + } + } + + return objPkg, objName +} + +func (pr *pkgReader) objDictIdx(idx pkgbits.Index) *readerDict { + r := pr.newReader(pkgbits.RelocObjDict, idx, pkgbits.SyncObject1) + + var dict readerDict + + if implicits := r.Len(); implicits != 0 { + errorf("unexpected object with %v implicit type parameter(s)", implicits) + } + + dict.bounds = make([]typeInfo, r.Len()) + for i := range dict.bounds { + dict.bounds[i] = r.typInfo() + } + + dict.derived = make([]derivedInfo, r.Len()) + dict.derivedTypes = make([]types.Type, len(dict.derived)) + for i := range dict.derived { + dict.derived[i] = derivedInfo{r.Reloc(pkgbits.RelocType), r.Bool()} + } + + // function references follow, but reader doesn't need those + + return &dict +} + +func (r *reader) typeParamNames() []*types.TypeParam { + r.Sync(pkgbits.SyncTypeParamNames) + + // Note: This code assumes it only processes objects without + // implement type parameters. This is currently fine, because + // reader is only used to read in exported declarations, which are + // always package scoped. + + if len(r.dict.bounds) == 0 { + return nil + } + + // Careful: Type parameter lists may have cycles. To allow for this, + // we construct the type parameter list in two passes: first we + // create all the TypeNames and TypeParams, then we construct and + // set the bound type. + + r.dict.tparams = make([]*types.TypeParam, len(r.dict.bounds)) + for i := range r.dict.bounds { + pos := r.pos() + pkg, name := r.localIdent() + + tname := types.NewTypeName(pos, pkg, name, nil) + r.dict.tparams[i] = types.NewTypeParam(tname, nil) + } + + typs := make([]types.Type, len(r.dict.bounds)) + for i, bound := range r.dict.bounds { + typs[i] = r.p.typIdx(bound, r.dict) + } + + // TODO(mdempsky): This is subtle, elaborate further. + // + // We have to save tparams outside of the closure, because + // typeParamNames() can be called multiple times with the same + // dictionary instance. + // + // Also, this needs to happen later to make sure SetUnderlying has + // been called. + // + // TODO(mdempsky): Is it safe to have a single "later" slice or do + // we need to have multiple passes? See comments on CL 386002 and + // go.dev/issue/52104. + tparams := r.dict.tparams + r.p.later(func() { + for i, typ := range typs { + tparams[i].SetConstraint(typ) + } + }) + + return r.dict.tparams +} + +func (r *reader) method() *types.Func { + r.Sync(pkgbits.SyncMethod) + pos := r.pos() + pkg, name := r.selector() + + rparams := r.typeParamNames() + sig := r.signature(r.param(), rparams, nil) + + _ = r.pos() // TODO(mdempsky): Remove; this is a hacker for linker.go. + return types.NewFunc(pos, pkg, name, sig) +} + +func (r *reader) qualifiedIdent() (*types.Package, string) { return r.ident(pkgbits.SyncSym) } +func (r *reader) localIdent() (*types.Package, string) { return r.ident(pkgbits.SyncLocalIdent) } +func (r *reader) selector() (*types.Package, string) { return r.ident(pkgbits.SyncSelector) } + +func (r *reader) ident(marker pkgbits.SyncMarker) (*types.Package, string) { + r.Sync(marker) + return r.pkg(), r.String() +} + +// pkgScope returns pkg.Scope(). +// If pkg is nil, it returns types.Universe instead. +// +// TODO(mdempsky): Remove after x/tools can depend on Go 1.19. +func pkgScope(pkg *types.Package) *types.Scope { + if pkg != nil { + return pkg.Scope() + } + return types.Universe +} diff --git a/vendor/golang.org/x/tools/go/internal/packagesdriver/sizes.go b/vendor/golang.org/x/tools/go/internal/packagesdriver/sizes.go new file mode 100644 index 0000000000..18a002f82a --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/packagesdriver/sizes.go @@ -0,0 +1,49 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package packagesdriver fetches type sizes for go/packages and go/analysis. +package packagesdriver + +import ( + "context" + "fmt" + "go/types" + "strings" + + "golang.org/x/tools/internal/gocommand" +) + +var debug = false + +func GetSizesGolist(ctx context.Context, inv gocommand.Invocation, gocmdRunner *gocommand.Runner) (types.Sizes, error) { + inv.Verb = "list" + inv.Args = []string{"-f", "{{context.GOARCH}} {{context.Compiler}}", "--", "unsafe"} + stdout, stderr, friendlyErr, rawErr := gocmdRunner.RunRaw(ctx, inv) + var goarch, compiler string + if rawErr != nil { + if rawErrMsg := rawErr.Error(); strings.Contains(rawErrMsg, "cannot find main module") || strings.Contains(rawErrMsg, "go.mod file not found") { + // User's running outside of a module. All bets are off. Get GOARCH and guess compiler is gc. + // TODO(matloob): Is this a problem in practice? + inv.Verb = "env" + inv.Args = []string{"GOARCH"} + envout, enverr := gocmdRunner.Run(ctx, inv) + if enverr != nil { + return nil, enverr + } + goarch = strings.TrimSpace(envout.String()) + compiler = "gc" + } else { + return nil, friendlyErr + } + } else { + fields := strings.Fields(stdout.String()) + if len(fields) < 2 { + return nil, fmt.Errorf("could not parse GOARCH and Go compiler in format \" \":\nstdout: <<%s>>\nstderr: <<%s>>", + stdout.String(), stderr.String()) + } + goarch = fields[0] + compiler = fields[1] + } + return types.SizesFor(compiler, goarch), nil +} diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/codes.go b/vendor/golang.org/x/tools/go/internal/pkgbits/codes.go new file mode 100644 index 0000000000..f0cabde96e --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/codes.go @@ -0,0 +1,77 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +// A Code is an enum value that can be encoded into bitstreams. +// +// Code types are preferable for enum types, because they allow +// Decoder to detect desyncs. +type Code interface { + // Marker returns the SyncMarker for the Code's dynamic type. + Marker() SyncMarker + + // Value returns the Code's ordinal value. + Value() int +} + +// A CodeVal distinguishes among go/constant.Value encodings. +type CodeVal int + +func (c CodeVal) Marker() SyncMarker { return SyncVal } +func (c CodeVal) Value() int { return int(c) } + +// Note: These values are public and cannot be changed without +// updating the go/types importers. + +const ( + ValBool CodeVal = iota + ValString + ValInt64 + ValBigInt + ValBigRat + ValBigFloat +) + +// A CodeType distinguishes among go/types.Type encodings. +type CodeType int + +func (c CodeType) Marker() SyncMarker { return SyncType } +func (c CodeType) Value() int { return int(c) } + +// Note: These values are public and cannot be changed without +// updating the go/types importers. + +const ( + TypeBasic CodeType = iota + TypeNamed + TypePointer + TypeSlice + TypeArray + TypeChan + TypeMap + TypeSignature + TypeStruct + TypeInterface + TypeUnion + TypeTypeParam +) + +// A CodeObj distinguishes among go/types.Object encodings. +type CodeObj int + +func (c CodeObj) Marker() SyncMarker { return SyncCodeObj } +func (c CodeObj) Value() int { return int(c) } + +// Note: These values are public and cannot be changed without +// updating the go/types importers. + +const ( + ObjAlias CodeObj = iota + ObjConst + ObjType + ObjFunc + ObjVar + ObjStub +) diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/decoder.go b/vendor/golang.org/x/tools/go/internal/pkgbits/decoder.go new file mode 100644 index 0000000000..2bc793668e --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/decoder.go @@ -0,0 +1,433 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +import ( + "encoding/binary" + "fmt" + "go/constant" + "go/token" + "math/big" + "os" + "runtime" + "strings" +) + +// A PkgDecoder provides methods for decoding a package's Unified IR +// export data. +type PkgDecoder struct { + // version is the file format version. + version uint32 + + // sync indicates whether the file uses sync markers. + sync bool + + // pkgPath is the package path for the package to be decoded. + // + // TODO(mdempsky): Remove; unneeded since CL 391014. + pkgPath string + + // elemData is the full data payload of the encoded package. + // Elements are densely and contiguously packed together. + // + // The last 8 bytes of elemData are the package fingerprint. + elemData string + + // elemEnds stores the byte-offset end positions of element + // bitstreams within elemData. + // + // For example, element I's bitstream data starts at elemEnds[I-1] + // (or 0, if I==0) and ends at elemEnds[I]. + // + // Note: elemEnds is indexed by absolute indices, not + // section-relative indices. + elemEnds []uint32 + + // elemEndsEnds stores the index-offset end positions of relocation + // sections within elemEnds. + // + // For example, section K's end positions start at elemEndsEnds[K-1] + // (or 0, if K==0) and end at elemEndsEnds[K]. + elemEndsEnds [numRelocs]uint32 +} + +// PkgPath returns the package path for the package +// +// TODO(mdempsky): Remove; unneeded since CL 391014. +func (pr *PkgDecoder) PkgPath() string { return pr.pkgPath } + +// SyncMarkers reports whether pr uses sync markers. +func (pr *PkgDecoder) SyncMarkers() bool { return pr.sync } + +// NewPkgDecoder returns a PkgDecoder initialized to read the Unified +// IR export data from input. pkgPath is the package path for the +// compilation unit that produced the export data. +// +// TODO(mdempsky): Remove pkgPath parameter; unneeded since CL 391014. +func NewPkgDecoder(pkgPath, input string) PkgDecoder { + pr := PkgDecoder{ + pkgPath: pkgPath, + } + + // TODO(mdempsky): Implement direct indexing of input string to + // avoid copying the position information. + + r := strings.NewReader(input) + + assert(binary.Read(r, binary.LittleEndian, &pr.version) == nil) + + switch pr.version { + default: + panic(fmt.Errorf("unsupported version: %v", pr.version)) + case 0: + // no flags + case 1: + var flags uint32 + assert(binary.Read(r, binary.LittleEndian, &flags) == nil) + pr.sync = flags&flagSyncMarkers != 0 + } + + assert(binary.Read(r, binary.LittleEndian, pr.elemEndsEnds[:]) == nil) + + pr.elemEnds = make([]uint32, pr.elemEndsEnds[len(pr.elemEndsEnds)-1]) + assert(binary.Read(r, binary.LittleEndian, pr.elemEnds[:]) == nil) + + pos, err := r.Seek(0, os.SEEK_CUR) + assert(err == nil) + + pr.elemData = input[pos:] + assert(len(pr.elemData)-8 == int(pr.elemEnds[len(pr.elemEnds)-1])) + + return pr +} + +// NumElems returns the number of elements in section k. +func (pr *PkgDecoder) NumElems(k RelocKind) int { + count := int(pr.elemEndsEnds[k]) + if k > 0 { + count -= int(pr.elemEndsEnds[k-1]) + } + return count +} + +// TotalElems returns the total number of elements across all sections. +func (pr *PkgDecoder) TotalElems() int { + return len(pr.elemEnds) +} + +// Fingerprint returns the package fingerprint. +func (pr *PkgDecoder) Fingerprint() [8]byte { + var fp [8]byte + copy(fp[:], pr.elemData[len(pr.elemData)-8:]) + return fp +} + +// AbsIdx returns the absolute index for the given (section, index) +// pair. +func (pr *PkgDecoder) AbsIdx(k RelocKind, idx Index) int { + absIdx := int(idx) + if k > 0 { + absIdx += int(pr.elemEndsEnds[k-1]) + } + if absIdx >= int(pr.elemEndsEnds[k]) { + errorf("%v:%v is out of bounds; %v", k, idx, pr.elemEndsEnds) + } + return absIdx +} + +// DataIdx returns the raw element bitstream for the given (section, +// index) pair. +func (pr *PkgDecoder) DataIdx(k RelocKind, idx Index) string { + absIdx := pr.AbsIdx(k, idx) + + var start uint32 + if absIdx > 0 { + start = pr.elemEnds[absIdx-1] + } + end := pr.elemEnds[absIdx] + + return pr.elemData[start:end] +} + +// StringIdx returns the string value for the given string index. +func (pr *PkgDecoder) StringIdx(idx Index) string { + return pr.DataIdx(RelocString, idx) +} + +// NewDecoder returns a Decoder for the given (section, index) pair, +// and decodes the given SyncMarker from the element bitstream. +func (pr *PkgDecoder) NewDecoder(k RelocKind, idx Index, marker SyncMarker) Decoder { + r := pr.NewDecoderRaw(k, idx) + r.Sync(marker) + return r +} + +// NewDecoderRaw returns a Decoder for the given (section, index) pair. +// +// Most callers should use NewDecoder instead. +func (pr *PkgDecoder) NewDecoderRaw(k RelocKind, idx Index) Decoder { + r := Decoder{ + common: pr, + k: k, + Idx: idx, + } + + // TODO(mdempsky) r.data.Reset(...) after #44505 is resolved. + r.Data = *strings.NewReader(pr.DataIdx(k, idx)) + + r.Sync(SyncRelocs) + r.Relocs = make([]RelocEnt, r.Len()) + for i := range r.Relocs { + r.Sync(SyncReloc) + r.Relocs[i] = RelocEnt{RelocKind(r.Len()), Index(r.Len())} + } + + return r +} + +// A Decoder provides methods for decoding an individual element's +// bitstream data. +type Decoder struct { + common *PkgDecoder + + Relocs []RelocEnt + Data strings.Reader + + k RelocKind + Idx Index +} + +func (r *Decoder) checkErr(err error) { + if err != nil { + errorf("unexpected decoding error: %w", err) + } +} + +func (r *Decoder) rawUvarint() uint64 { + x, err := binary.ReadUvarint(&r.Data) + r.checkErr(err) + return x +} + +func (r *Decoder) rawVarint() int64 { + ux := r.rawUvarint() + + // Zig-zag decode. + x := int64(ux >> 1) + if ux&1 != 0 { + x = ^x + } + return x +} + +func (r *Decoder) rawReloc(k RelocKind, idx int) Index { + e := r.Relocs[idx] + assert(e.Kind == k) + return e.Idx +} + +// Sync decodes a sync marker from the element bitstream and asserts +// that it matches the expected marker. +// +// If r.common.sync is false, then Sync is a no-op. +func (r *Decoder) Sync(mWant SyncMarker) { + if !r.common.sync { + return + } + + pos, _ := r.Data.Seek(0, os.SEEK_CUR) // TODO(mdempsky): io.SeekCurrent after #44505 is resolved + mHave := SyncMarker(r.rawUvarint()) + writerPCs := make([]int, r.rawUvarint()) + for i := range writerPCs { + writerPCs[i] = int(r.rawUvarint()) + } + + if mHave == mWant { + return + } + + // There's some tension here between printing: + // + // (1) full file paths that tools can recognize (e.g., so emacs + // hyperlinks the "file:line" text for easy navigation), or + // + // (2) short file paths that are easier for humans to read (e.g., by + // omitting redundant or irrelevant details, so it's easier to + // focus on the useful bits that remain). + // + // The current formatting favors the former, as it seems more + // helpful in practice. But perhaps the formatting could be improved + // to better address both concerns. For example, use relative file + // paths if they would be shorter, or rewrite file paths to contain + // "$GOROOT" (like objabi.AbsFile does) if tools can be taught how + // to reliably expand that again. + + fmt.Printf("export data desync: package %q, section %v, index %v, offset %v\n", r.common.pkgPath, r.k, r.Idx, pos) + + fmt.Printf("\nfound %v, written at:\n", mHave) + if len(writerPCs) == 0 { + fmt.Printf("\t[stack trace unavailable; recompile package %q with -d=syncframes]\n", r.common.pkgPath) + } + for _, pc := range writerPCs { + fmt.Printf("\t%s\n", r.common.StringIdx(r.rawReloc(RelocString, pc))) + } + + fmt.Printf("\nexpected %v, reading at:\n", mWant) + var readerPCs [32]uintptr // TODO(mdempsky): Dynamically size? + n := runtime.Callers(2, readerPCs[:]) + for _, pc := range fmtFrames(readerPCs[:n]...) { + fmt.Printf("\t%s\n", pc) + } + + // We already printed a stack trace for the reader, so now we can + // simply exit. Printing a second one with panic or base.Fatalf + // would just be noise. + os.Exit(1) +} + +// Bool decodes and returns a bool value from the element bitstream. +func (r *Decoder) Bool() bool { + r.Sync(SyncBool) + x, err := r.Data.ReadByte() + r.checkErr(err) + assert(x < 2) + return x != 0 +} + +// Int64 decodes and returns an int64 value from the element bitstream. +func (r *Decoder) Int64() int64 { + r.Sync(SyncInt64) + return r.rawVarint() +} + +// Int64 decodes and returns a uint64 value from the element bitstream. +func (r *Decoder) Uint64() uint64 { + r.Sync(SyncUint64) + return r.rawUvarint() +} + +// Len decodes and returns a non-negative int value from the element bitstream. +func (r *Decoder) Len() int { x := r.Uint64(); v := int(x); assert(uint64(v) == x); return v } + +// Int decodes and returns an int value from the element bitstream. +func (r *Decoder) Int() int { x := r.Int64(); v := int(x); assert(int64(v) == x); return v } + +// Uint decodes and returns a uint value from the element bitstream. +func (r *Decoder) Uint() uint { x := r.Uint64(); v := uint(x); assert(uint64(v) == x); return v } + +// Code decodes a Code value from the element bitstream and returns +// its ordinal value. It's the caller's responsibility to convert the +// result to an appropriate Code type. +// +// TODO(mdempsky): Ideally this method would have signature "Code[T +// Code] T" instead, but we don't allow generic methods and the +// compiler can't depend on generics yet anyway. +func (r *Decoder) Code(mark SyncMarker) int { + r.Sync(mark) + return r.Len() +} + +// Reloc decodes a relocation of expected section k from the element +// bitstream and returns an index to the referenced element. +func (r *Decoder) Reloc(k RelocKind) Index { + r.Sync(SyncUseReloc) + return r.rawReloc(k, r.Len()) +} + +// String decodes and returns a string value from the element +// bitstream. +func (r *Decoder) String() string { + r.Sync(SyncString) + return r.common.StringIdx(r.Reloc(RelocString)) +} + +// Strings decodes and returns a variable-length slice of strings from +// the element bitstream. +func (r *Decoder) Strings() []string { + res := make([]string, r.Len()) + for i := range res { + res[i] = r.String() + } + return res +} + +// Value decodes and returns a constant.Value from the element +// bitstream. +func (r *Decoder) Value() constant.Value { + r.Sync(SyncValue) + isComplex := r.Bool() + val := r.scalar() + if isComplex { + val = constant.BinaryOp(val, token.ADD, constant.MakeImag(r.scalar())) + } + return val +} + +func (r *Decoder) scalar() constant.Value { + switch tag := CodeVal(r.Code(SyncVal)); tag { + default: + panic(fmt.Errorf("unexpected scalar tag: %v", tag)) + + case ValBool: + return constant.MakeBool(r.Bool()) + case ValString: + return constant.MakeString(r.String()) + case ValInt64: + return constant.MakeInt64(r.Int64()) + case ValBigInt: + return constant.Make(r.bigInt()) + case ValBigRat: + num := r.bigInt() + denom := r.bigInt() + return constant.Make(new(big.Rat).SetFrac(num, denom)) + case ValBigFloat: + return constant.Make(r.bigFloat()) + } +} + +func (r *Decoder) bigInt() *big.Int { + v := new(big.Int).SetBytes([]byte(r.String())) + if r.Bool() { + v.Neg(v) + } + return v +} + +func (r *Decoder) bigFloat() *big.Float { + v := new(big.Float).SetPrec(512) + assert(v.UnmarshalText([]byte(r.String())) == nil) + return v +} + +// @@@ Helpers + +// TODO(mdempsky): These should probably be removed. I think they're a +// smell that the export data format is not yet quite right. + +// PeekPkgPath returns the package path for the specified package +// index. +func (pr *PkgDecoder) PeekPkgPath(idx Index) string { + r := pr.NewDecoder(RelocPkg, idx, SyncPkgDef) + path := r.String() + if path == "" { + path = pr.pkgPath + } + return path +} + +// PeekObj returns the package path, object name, and CodeObj for the +// specified object index. +func (pr *PkgDecoder) PeekObj(idx Index) (string, string, CodeObj) { + r := pr.NewDecoder(RelocName, idx, SyncObject1) + r.Sync(SyncSym) + r.Sync(SyncPkg) + path := pr.PeekPkgPath(r.Reloc(RelocPkg)) + name := r.String() + assert(name != "") + + tag := CodeObj(r.Code(SyncCodeObj)) + + return path, name, tag +} diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/doc.go b/vendor/golang.org/x/tools/go/internal/pkgbits/doc.go new file mode 100644 index 0000000000..c8a2796b5e --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/doc.go @@ -0,0 +1,32 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package pkgbits implements low-level coding abstractions for +// Unified IR's export data format. +// +// At a low-level, a package is a collection of bitstream elements. +// Each element has a "kind" and a dense, non-negative index. +// Elements can be randomly accessed given their kind and index. +// +// Individual elements are sequences of variable-length values (e.g., +// integers, booleans, strings, go/constant values, cross-references +// to other elements). Package pkgbits provides APIs for encoding and +// decoding these low-level values, but the details of mapping +// higher-level Go constructs into elements is left to higher-level +// abstractions. +// +// Elements may cross-reference each other with "relocations." For +// example, an element representing a pointer type has a relocation +// referring to the element type. +// +// Go constructs may be composed as a constellation of multiple +// elements. For example, a declared function may have one element to +// describe the object (e.g., its name, type, position), and a +// separate element to describe its function body. This allows readers +// some flexibility in efficiently seeking or re-reading data (e.g., +// inlining requires re-reading the function body for each inlined +// call, without needing to re-read the object-level details). +// +// This is a copy of internal/pkgbits in the Go implementation. +package pkgbits diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/encoder.go b/vendor/golang.org/x/tools/go/internal/pkgbits/encoder.go new file mode 100644 index 0000000000..c50c838caa --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/encoder.go @@ -0,0 +1,379 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +import ( + "bytes" + "crypto/md5" + "encoding/binary" + "go/constant" + "io" + "math/big" + "runtime" +) + +// currentVersion is the current version number. +// +// - v0: initial prototype +// +// - v1: adds the flags uint32 word +const currentVersion uint32 = 1 + +// A PkgEncoder provides methods for encoding a package's Unified IR +// export data. +type PkgEncoder struct { + // elems holds the bitstream for previously encoded elements. + elems [numRelocs][]string + + // stringsIdx maps previously encoded strings to their index within + // the RelocString section, to allow deduplication. That is, + // elems[RelocString][stringsIdx[s]] == s (if present). + stringsIdx map[string]Index + + // syncFrames is the number of frames to write at each sync + // marker. A negative value means sync markers are omitted. + syncFrames int +} + +// SyncMarkers reports whether pw uses sync markers. +func (pw *PkgEncoder) SyncMarkers() bool { return pw.syncFrames >= 0 } + +// NewPkgEncoder returns an initialized PkgEncoder. +// +// syncFrames is the number of caller frames that should be serialized +// at Sync points. Serializing additional frames results in larger +// export data files, but can help diagnosing desync errors in +// higher-level Unified IR reader/writer code. If syncFrames is +// negative, then sync markers are omitted entirely. +func NewPkgEncoder(syncFrames int) PkgEncoder { + return PkgEncoder{ + stringsIdx: make(map[string]Index), + syncFrames: syncFrames, + } +} + +// DumpTo writes the package's encoded data to out0 and returns the +// package fingerprint. +func (pw *PkgEncoder) DumpTo(out0 io.Writer) (fingerprint [8]byte) { + h := md5.New() + out := io.MultiWriter(out0, h) + + writeUint32 := func(x uint32) { + assert(binary.Write(out, binary.LittleEndian, x) == nil) + } + + writeUint32(currentVersion) + + var flags uint32 + if pw.SyncMarkers() { + flags |= flagSyncMarkers + } + writeUint32(flags) + + // Write elemEndsEnds. + var sum uint32 + for _, elems := range &pw.elems { + sum += uint32(len(elems)) + writeUint32(sum) + } + + // Write elemEnds. + sum = 0 + for _, elems := range &pw.elems { + for _, elem := range elems { + sum += uint32(len(elem)) + writeUint32(sum) + } + } + + // Write elemData. + for _, elems := range &pw.elems { + for _, elem := range elems { + _, err := io.WriteString(out, elem) + assert(err == nil) + } + } + + // Write fingerprint. + copy(fingerprint[:], h.Sum(nil)) + _, err := out0.Write(fingerprint[:]) + assert(err == nil) + + return +} + +// StringIdx adds a string value to the strings section, if not +// already present, and returns its index. +func (pw *PkgEncoder) StringIdx(s string) Index { + if idx, ok := pw.stringsIdx[s]; ok { + assert(pw.elems[RelocString][idx] == s) + return idx + } + + idx := Index(len(pw.elems[RelocString])) + pw.elems[RelocString] = append(pw.elems[RelocString], s) + pw.stringsIdx[s] = idx + return idx +} + +// NewEncoder returns an Encoder for a new element within the given +// section, and encodes the given SyncMarker as the start of the +// element bitstream. +func (pw *PkgEncoder) NewEncoder(k RelocKind, marker SyncMarker) Encoder { + e := pw.NewEncoderRaw(k) + e.Sync(marker) + return e +} + +// NewEncoderRaw returns an Encoder for a new element within the given +// section. +// +// Most callers should use NewEncoder instead. +func (pw *PkgEncoder) NewEncoderRaw(k RelocKind) Encoder { + idx := Index(len(pw.elems[k])) + pw.elems[k] = append(pw.elems[k], "") // placeholder + + return Encoder{ + p: pw, + k: k, + Idx: idx, + } +} + +// An Encoder provides methods for encoding an individual element's +// bitstream data. +type Encoder struct { + p *PkgEncoder + + Relocs []RelocEnt + Data bytes.Buffer // accumulated element bitstream data + + encodingRelocHeader bool + + k RelocKind + Idx Index // index within relocation section +} + +// Flush finalizes the element's bitstream and returns its Index. +func (w *Encoder) Flush() Index { + var sb bytes.Buffer // TODO(mdempsky): strings.Builder after #44505 is resolved + + // Backup the data so we write the relocations at the front. + var tmp bytes.Buffer + io.Copy(&tmp, &w.Data) + + // TODO(mdempsky): Consider writing these out separately so they're + // easier to strip, along with function bodies, so that we can prune + // down to just the data that's relevant to go/types. + if w.encodingRelocHeader { + panic("encodingRelocHeader already true; recursive flush?") + } + w.encodingRelocHeader = true + w.Sync(SyncRelocs) + w.Len(len(w.Relocs)) + for _, rEnt := range w.Relocs { + w.Sync(SyncReloc) + w.Len(int(rEnt.Kind)) + w.Len(int(rEnt.Idx)) + } + + io.Copy(&sb, &w.Data) + io.Copy(&sb, &tmp) + w.p.elems[w.k][w.Idx] = sb.String() + + return w.Idx +} + +func (w *Encoder) checkErr(err error) { + if err != nil { + errorf("unexpected encoding error: %v", err) + } +} + +func (w *Encoder) rawUvarint(x uint64) { + var buf [binary.MaxVarintLen64]byte + n := binary.PutUvarint(buf[:], x) + _, err := w.Data.Write(buf[:n]) + w.checkErr(err) +} + +func (w *Encoder) rawVarint(x int64) { + // Zig-zag encode. + ux := uint64(x) << 1 + if x < 0 { + ux = ^ux + } + + w.rawUvarint(ux) +} + +func (w *Encoder) rawReloc(r RelocKind, idx Index) int { + // TODO(mdempsky): Use map for lookup; this takes quadratic time. + for i, rEnt := range w.Relocs { + if rEnt.Kind == r && rEnt.Idx == idx { + return i + } + } + + i := len(w.Relocs) + w.Relocs = append(w.Relocs, RelocEnt{r, idx}) + return i +} + +func (w *Encoder) Sync(m SyncMarker) { + if !w.p.SyncMarkers() { + return + } + + // Writing out stack frame string references requires working + // relocations, but writing out the relocations themselves involves + // sync markers. To prevent infinite recursion, we simply trim the + // stack frame for sync markers within the relocation header. + var frames []string + if !w.encodingRelocHeader && w.p.syncFrames > 0 { + pcs := make([]uintptr, w.p.syncFrames) + n := runtime.Callers(2, pcs) + frames = fmtFrames(pcs[:n]...) + } + + // TODO(mdempsky): Save space by writing out stack frames as a + // linked list so we can share common stack frames. + w.rawUvarint(uint64(m)) + w.rawUvarint(uint64(len(frames))) + for _, frame := range frames { + w.rawUvarint(uint64(w.rawReloc(RelocString, w.p.StringIdx(frame)))) + } +} + +// Bool encodes and writes a bool value into the element bitstream, +// and then returns the bool value. +// +// For simple, 2-alternative encodings, the idiomatic way to call Bool +// is something like: +// +// if w.Bool(x != 0) { +// // alternative #1 +// } else { +// // alternative #2 +// } +// +// For multi-alternative encodings, use Code instead. +func (w *Encoder) Bool(b bool) bool { + w.Sync(SyncBool) + var x byte + if b { + x = 1 + } + err := w.Data.WriteByte(x) + w.checkErr(err) + return b +} + +// Int64 encodes and writes an int64 value into the element bitstream. +func (w *Encoder) Int64(x int64) { + w.Sync(SyncInt64) + w.rawVarint(x) +} + +// Uint64 encodes and writes a uint64 value into the element bitstream. +func (w *Encoder) Uint64(x uint64) { + w.Sync(SyncUint64) + w.rawUvarint(x) +} + +// Len encodes and writes a non-negative int value into the element bitstream. +func (w *Encoder) Len(x int) { assert(x >= 0); w.Uint64(uint64(x)) } + +// Int encodes and writes an int value into the element bitstream. +func (w *Encoder) Int(x int) { w.Int64(int64(x)) } + +// Len encodes and writes a uint value into the element bitstream. +func (w *Encoder) Uint(x uint) { w.Uint64(uint64(x)) } + +// Reloc encodes and writes a relocation for the given (section, +// index) pair into the element bitstream. +// +// Note: Only the index is formally written into the element +// bitstream, so bitstream decoders must know from context which +// section an encoded relocation refers to. +func (w *Encoder) Reloc(r RelocKind, idx Index) { + w.Sync(SyncUseReloc) + w.Len(w.rawReloc(r, idx)) +} + +// Code encodes and writes a Code value into the element bitstream. +func (w *Encoder) Code(c Code) { + w.Sync(c.Marker()) + w.Len(c.Value()) +} + +// String encodes and writes a string value into the element +// bitstream. +// +// Internally, strings are deduplicated by adding them to the strings +// section (if not already present), and then writing a relocation +// into the element bitstream. +func (w *Encoder) String(s string) { + w.Sync(SyncString) + w.Reloc(RelocString, w.p.StringIdx(s)) +} + +// Strings encodes and writes a variable-length slice of strings into +// the element bitstream. +func (w *Encoder) Strings(ss []string) { + w.Len(len(ss)) + for _, s := range ss { + w.String(s) + } +} + +// Value encodes and writes a constant.Value into the element +// bitstream. +func (w *Encoder) Value(val constant.Value) { + w.Sync(SyncValue) + if w.Bool(val.Kind() == constant.Complex) { + w.scalar(constant.Real(val)) + w.scalar(constant.Imag(val)) + } else { + w.scalar(val) + } +} + +func (w *Encoder) scalar(val constant.Value) { + switch v := constant.Val(val).(type) { + default: + errorf("unhandled %v (%v)", val, val.Kind()) + case bool: + w.Code(ValBool) + w.Bool(v) + case string: + w.Code(ValString) + w.String(v) + case int64: + w.Code(ValInt64) + w.Int64(v) + case *big.Int: + w.Code(ValBigInt) + w.bigInt(v) + case *big.Rat: + w.Code(ValBigRat) + w.bigInt(v.Num()) + w.bigInt(v.Denom()) + case *big.Float: + w.Code(ValBigFloat) + w.bigFloat(v) + } +} + +func (w *Encoder) bigInt(v *big.Int) { + b := v.Bytes() + w.String(string(b)) // TODO: More efficient encoding. + w.Bool(v.Sign() < 0) +} + +func (w *Encoder) bigFloat(v *big.Float) { + b := v.Append(nil, 'p', -1) + w.String(string(b)) // TODO: More efficient encoding. +} diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/flags.go b/vendor/golang.org/x/tools/go/internal/pkgbits/flags.go new file mode 100644 index 0000000000..654222745f --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/flags.go @@ -0,0 +1,9 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +const ( + flagSyncMarkers = 1 << iota // file format contains sync markers +) diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/frames_go1.go b/vendor/golang.org/x/tools/go/internal/pkgbits/frames_go1.go new file mode 100644 index 0000000000..5294f6a63e --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/frames_go1.go @@ -0,0 +1,21 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.7 +// +build !go1.7 + +// TODO(mdempsky): Remove after #44505 is resolved + +package pkgbits + +import "runtime" + +func walkFrames(pcs []uintptr, visit frameVisitor) { + for _, pc := range pcs { + fn := runtime.FuncForPC(pc) + file, line := fn.FileLine(pc) + + visit(file, line, fn.Name(), pc-fn.Entry()) + } +} diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/frames_go17.go b/vendor/golang.org/x/tools/go/internal/pkgbits/frames_go17.go new file mode 100644 index 0000000000..2324ae7adf --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/frames_go17.go @@ -0,0 +1,28 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.7 +// +build go1.7 + +package pkgbits + +import "runtime" + +// walkFrames calls visit for each call frame represented by pcs. +// +// pcs should be a slice of PCs, as returned by runtime.Callers. +func walkFrames(pcs []uintptr, visit frameVisitor) { + if len(pcs) == 0 { + return + } + + frames := runtime.CallersFrames(pcs) + for { + frame, more := frames.Next() + visit(frame.File, frame.Line, frame.Function, frame.PC-frame.Entry) + if !more { + return + } + } +} diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/reloc.go b/vendor/golang.org/x/tools/go/internal/pkgbits/reloc.go new file mode 100644 index 0000000000..7a8f04ab3f --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/reloc.go @@ -0,0 +1,42 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +// A RelocKind indicates a particular section within a unified IR export. +type RelocKind int + +// An Index represents a bitstream element index within a particular +// section. +type Index int + +// A relocEnt (relocation entry) is an entry in an element's local +// reference table. +// +// TODO(mdempsky): Rename this too. +type RelocEnt struct { + Kind RelocKind + Idx Index +} + +// Reserved indices within the meta relocation section. +const ( + PublicRootIdx Index = 0 + PrivateRootIdx Index = 1 +) + +const ( + RelocString RelocKind = iota + RelocMeta + RelocPosBase + RelocPkg + RelocName + RelocType + RelocObj + RelocObjExt + RelocObjDict + RelocBody + + numRelocs = iota +) diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/support.go b/vendor/golang.org/x/tools/go/internal/pkgbits/support.go new file mode 100644 index 0000000000..ad26d3b28c --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/support.go @@ -0,0 +1,17 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +import "fmt" + +func assert(b bool) { + if !b { + panic("assertion failed") + } +} + +func errorf(format string, args ...interface{}) { + panic(fmt.Errorf(format, args...)) +} diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/sync.go b/vendor/golang.org/x/tools/go/internal/pkgbits/sync.go new file mode 100644 index 0000000000..5bd51ef717 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/sync.go @@ -0,0 +1,113 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package pkgbits + +import ( + "fmt" + "strings" +) + +// fmtFrames formats a backtrace for reporting reader/writer desyncs. +func fmtFrames(pcs ...uintptr) []string { + res := make([]string, 0, len(pcs)) + walkFrames(pcs, func(file string, line int, name string, offset uintptr) { + // Trim package from function name. It's just redundant noise. + name = strings.TrimPrefix(name, "cmd/compile/internal/noder.") + + res = append(res, fmt.Sprintf("%s:%v: %s +0x%v", file, line, name, offset)) + }) + return res +} + +type frameVisitor func(file string, line int, name string, offset uintptr) + +// SyncMarker is an enum type that represents markers that may be +// written to export data to ensure the reader and writer stay +// synchronized. +type SyncMarker int + +//go:generate stringer -type=SyncMarker -trimprefix=Sync + +const ( + _ SyncMarker = iota + + // Public markers (known to go/types importers). + + // Low-level coding markers. + SyncEOF + SyncBool + SyncInt64 + SyncUint64 + SyncString + SyncValue + SyncVal + SyncRelocs + SyncReloc + SyncUseReloc + + // Higher-level object and type markers. + SyncPublic + SyncPos + SyncPosBase + SyncObject + SyncObject1 + SyncPkg + SyncPkgDef + SyncMethod + SyncType + SyncTypeIdx + SyncTypeParamNames + SyncSignature + SyncParams + SyncParam + SyncCodeObj + SyncSym + SyncLocalIdent + SyncSelector + + // Private markers (only known to cmd/compile). + SyncPrivate + + SyncFuncExt + SyncVarExt + SyncTypeExt + SyncPragma + + SyncExprList + SyncExprs + SyncExpr + SyncExprType + SyncAssign + SyncOp + SyncFuncLit + SyncCompLit + + SyncDecl + SyncFuncBody + SyncOpenScope + SyncCloseScope + SyncCloseAnotherScope + SyncDeclNames + SyncDeclName + + SyncStmts + SyncBlockStmt + SyncIfStmt + SyncForStmt + SyncSwitchStmt + SyncRangeStmt + SyncCaseClause + SyncCommClause + SyncSelectStmt + SyncDecls + SyncLabeledStmt + SyncUseObjLocal + SyncAddLocal + SyncLinkname + SyncStmt1 + SyncStmtsEnd + SyncLabel + SyncOptLabel +) diff --git a/vendor/golang.org/x/tools/go/internal/pkgbits/syncmarker_string.go b/vendor/golang.org/x/tools/go/internal/pkgbits/syncmarker_string.go new file mode 100644 index 0000000000..4a5b0ca5f2 --- /dev/null +++ b/vendor/golang.org/x/tools/go/internal/pkgbits/syncmarker_string.go @@ -0,0 +1,89 @@ +// Code generated by "stringer -type=SyncMarker -trimprefix=Sync"; DO NOT EDIT. + +package pkgbits + +import "strconv" + +func _() { + // An "invalid array index" compiler error signifies that the constant values have changed. + // Re-run the stringer command to generate them again. + var x [1]struct{} + _ = x[SyncEOF-1] + _ = x[SyncBool-2] + _ = x[SyncInt64-3] + _ = x[SyncUint64-4] + _ = x[SyncString-5] + _ = x[SyncValue-6] + _ = x[SyncVal-7] + _ = x[SyncRelocs-8] + _ = x[SyncReloc-9] + _ = x[SyncUseReloc-10] + _ = x[SyncPublic-11] + _ = x[SyncPos-12] + _ = x[SyncPosBase-13] + _ = x[SyncObject-14] + _ = x[SyncObject1-15] + _ = x[SyncPkg-16] + _ = x[SyncPkgDef-17] + _ = x[SyncMethod-18] + _ = x[SyncType-19] + _ = x[SyncTypeIdx-20] + _ = x[SyncTypeParamNames-21] + _ = x[SyncSignature-22] + _ = x[SyncParams-23] + _ = x[SyncParam-24] + _ = x[SyncCodeObj-25] + _ = x[SyncSym-26] + _ = x[SyncLocalIdent-27] + _ = x[SyncSelector-28] + _ = x[SyncPrivate-29] + _ = x[SyncFuncExt-30] + _ = x[SyncVarExt-31] + _ = x[SyncTypeExt-32] + _ = x[SyncPragma-33] + _ = x[SyncExprList-34] + _ = x[SyncExprs-35] + _ = x[SyncExpr-36] + _ = x[SyncExprType-37] + _ = x[SyncAssign-38] + _ = x[SyncOp-39] + _ = x[SyncFuncLit-40] + _ = x[SyncCompLit-41] + _ = x[SyncDecl-42] + _ = x[SyncFuncBody-43] + _ = x[SyncOpenScope-44] + _ = x[SyncCloseScope-45] + _ = x[SyncCloseAnotherScope-46] + _ = x[SyncDeclNames-47] + _ = x[SyncDeclName-48] + _ = x[SyncStmts-49] + _ = x[SyncBlockStmt-50] + _ = x[SyncIfStmt-51] + _ = x[SyncForStmt-52] + _ = x[SyncSwitchStmt-53] + _ = x[SyncRangeStmt-54] + _ = x[SyncCaseClause-55] + _ = x[SyncCommClause-56] + _ = x[SyncSelectStmt-57] + _ = x[SyncDecls-58] + _ = x[SyncLabeledStmt-59] + _ = x[SyncUseObjLocal-60] + _ = x[SyncAddLocal-61] + _ = x[SyncLinkname-62] + _ = x[SyncStmt1-63] + _ = x[SyncStmtsEnd-64] + _ = x[SyncLabel-65] + _ = x[SyncOptLabel-66] +} + +const _SyncMarker_name = "EOFBoolInt64Uint64StringValueValRelocsRelocUseRelocPublicPosPosBaseObjectObject1PkgPkgDefMethodTypeTypeIdxTypeParamNamesSignatureParamsParamCodeObjSymLocalIdentSelectorPrivateFuncExtVarExtTypeExtPragmaExprListExprsExprExprTypeAssignOpFuncLitCompLitDeclFuncBodyOpenScopeCloseScopeCloseAnotherScopeDeclNamesDeclNameStmtsBlockStmtIfStmtForStmtSwitchStmtRangeStmtCaseClauseCommClauseSelectStmtDeclsLabeledStmtUseObjLocalAddLocalLinknameStmt1StmtsEndLabelOptLabel" + +var _SyncMarker_index = [...]uint16{0, 3, 7, 12, 18, 24, 29, 32, 38, 43, 51, 57, 60, 67, 73, 80, 83, 89, 95, 99, 106, 120, 129, 135, 140, 147, 150, 160, 168, 175, 182, 188, 195, 201, 209, 214, 218, 226, 232, 234, 241, 248, 252, 260, 269, 279, 296, 305, 313, 318, 327, 333, 340, 350, 359, 369, 379, 389, 394, 405, 416, 424, 432, 437, 445, 450, 458} + +func (i SyncMarker) String() string { + i -= 1 + if i < 0 || i >= SyncMarker(len(_SyncMarker_index)-1) { + return "SyncMarker(" + strconv.FormatInt(int64(i+1), 10) + ")" + } + return _SyncMarker_name[_SyncMarker_index[i]:_SyncMarker_index[i+1]] +} diff --git a/vendor/golang.org/x/tools/go/packages/doc.go b/vendor/golang.org/x/tools/go/packages/doc.go new file mode 100644 index 0000000000..da4ab89fe6 --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/doc.go @@ -0,0 +1,220 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +/* +Package packages loads Go packages for inspection and analysis. + +The Load function takes as input a list of patterns and return a list of Package +structs describing individual packages matched by those patterns. +The LoadMode controls the amount of detail in the loaded packages. + +Load passes most patterns directly to the underlying build tool, +but all patterns with the prefix "query=", where query is a +non-empty string of letters from [a-z], are reserved and may be +interpreted as query operators. + +Two query operators are currently supported: "file" and "pattern". + +The query "file=path/to/file.go" matches the package or packages enclosing +the Go source file path/to/file.go. For example "file=~/go/src/fmt/print.go" +might return the packages "fmt" and "fmt [fmt.test]". + +The query "pattern=string" causes "string" to be passed directly to +the underlying build tool. In most cases this is unnecessary, +but an application can use Load("pattern=" + x) as an escaping mechanism +to ensure that x is not interpreted as a query operator if it contains '='. + +All other query operators are reserved for future use and currently +cause Load to report an error. + +The Package struct provides basic information about the package, including + + - ID, a unique identifier for the package in the returned set; + - GoFiles, the names of the package's Go source files; + - Imports, a map from source import strings to the Packages they name; + - Types, the type information for the package's exported symbols; + - Syntax, the parsed syntax trees for the package's source code; and + - TypeInfo, the result of a complete type-check of the package syntax trees. + +(See the documentation for type Package for the complete list of fields +and more detailed descriptions.) + +For example, + + Load(nil, "bytes", "unicode...") + +returns four Package structs describing the standard library packages +bytes, unicode, unicode/utf16, and unicode/utf8. Note that one pattern +can match multiple packages and that a package might be matched by +multiple patterns: in general it is not possible to determine which +packages correspond to which patterns. + +Note that the list returned by Load contains only the packages matched +by the patterns. Their dependencies can be found by walking the import +graph using the Imports fields. + +The Load function can be configured by passing a pointer to a Config as +the first argument. A nil Config is equivalent to the zero Config, which +causes Load to run in LoadFiles mode, collecting minimal information. +See the documentation for type Config for details. + +As noted earlier, the Config.Mode controls the amount of detail +reported about the loaded packages. See the documentation for type LoadMode +for details. + +Most tools should pass their command-line arguments (after any flags) +uninterpreted to the loader, so that the loader can interpret them +according to the conventions of the underlying build system. +See the Example function for typical usage. +*/ +package packages // import "golang.org/x/tools/go/packages" + +/* + +Motivation and design considerations + +The new package's design solves problems addressed by two existing +packages: go/build, which locates and describes packages, and +golang.org/x/tools/go/loader, which loads, parses and type-checks them. +The go/build.Package structure encodes too much of the 'go build' way +of organizing projects, leaving us in need of a data type that describes a +package of Go source code independent of the underlying build system. +We wanted something that works equally well with go build and vgo, and +also other build systems such as Bazel and Blaze, making it possible to +construct analysis tools that work in all these environments. +Tools such as errcheck and staticcheck were essentially unavailable to +the Go community at Google, and some of Google's internal tools for Go +are unavailable externally. +This new package provides a uniform way to obtain package metadata by +querying each of these build systems, optionally supporting their +preferred command-line notations for packages, so that tools integrate +neatly with users' build environments. The Metadata query function +executes an external query tool appropriate to the current workspace. + +Loading packages always returns the complete import graph "all the way down", +even if all you want is information about a single package, because the query +mechanisms of all the build systems we currently support ({go,vgo} list, and +blaze/bazel aspect-based query) cannot provide detailed information +about one package without visiting all its dependencies too, so there is +no additional asymptotic cost to providing transitive information. +(This property might not be true of a hypothetical 5th build system.) + +In calls to TypeCheck, all initial packages, and any package that +transitively depends on one of them, must be loaded from source. +Consider A->B->C->D->E: if A,C are initial, A,B,C must be loaded from +source; D may be loaded from export data, and E may not be loaded at all +(though it's possible that D's export data mentions it, so a +types.Package may be created for it and exposed.) + +The old loader had a feature to suppress type-checking of function +bodies on a per-package basis, primarily intended to reduce the work of +obtaining type information for imported packages. Now that imports are +satisfied by export data, the optimization no longer seems necessary. + +Despite some early attempts, the old loader did not exploit export data, +instead always using the equivalent of WholeProgram mode. This was due +to the complexity of mixing source and export data packages (now +resolved by the upward traversal mentioned above), and because export data +files were nearly always missing or stale. Now that 'go build' supports +caching, all the underlying build systems can guarantee to produce +export data in a reasonable (amortized) time. + +Test "main" packages synthesized by the build system are now reported as +first-class packages, avoiding the need for clients (such as go/ssa) to +reinvent this generation logic. + +One way in which go/packages is simpler than the old loader is in its +treatment of in-package tests. In-package tests are packages that +consist of all the files of the library under test, plus the test files. +The old loader constructed in-package tests by a two-phase process of +mutation called "augmentation": first it would construct and type check +all the ordinary library packages and type-check the packages that +depend on them; then it would add more (test) files to the package and +type-check again. This two-phase approach had four major problems: +1) in processing the tests, the loader modified the library package, + leaving no way for a client application to see both the test + package and the library package; one would mutate into the other. +2) because test files can declare additional methods on types defined in + the library portion of the package, the dispatch of method calls in + the library portion was affected by the presence of the test files. + This should have been a clue that the packages were logically + different. +3) this model of "augmentation" assumed at most one in-package test + per library package, which is true of projects using 'go build', + but not other build systems. +4) because of the two-phase nature of test processing, all packages that + import the library package had to be processed before augmentation, + forcing a "one-shot" API and preventing the client from calling Load + in several times in sequence as is now possible in WholeProgram mode. + (TypeCheck mode has a similar one-shot restriction for a different reason.) + +Early drafts of this package supported "multi-shot" operation. +Although it allowed clients to make a sequence of calls (or concurrent +calls) to Load, building up the graph of Packages incrementally, +it was of marginal value: it complicated the API +(since it allowed some options to vary across calls but not others), +it complicated the implementation, +it cannot be made to work in Types mode, as explained above, +and it was less efficient than making one combined call (when this is possible). +Among the clients we have inspected, none made multiple calls to load +but could not be easily and satisfactorily modified to make only a single call. +However, applications changes may be required. +For example, the ssadump command loads the user-specified packages +and in addition the runtime package. It is tempting to simply append +"runtime" to the user-provided list, but that does not work if the user +specified an ad-hoc package such as [a.go b.go]. +Instead, ssadump no longer requests the runtime package, +but seeks it among the dependencies of the user-specified packages, +and emits an error if it is not found. + +Overlays: The Overlay field in the Config allows providing alternate contents +for Go source files, by providing a mapping from file path to contents. +go/packages will pull in new imports added in overlay files when go/packages +is run in LoadImports mode or greater. +Overlay support for the go list driver isn't complete yet: if the file doesn't +exist on disk, it will only be recognized in an overlay if it is a non-test file +and the package would be reported even without the overlay. + +Questions & Tasks + +- Add GOARCH/GOOS? + They are not portable concepts, but could be made portable. + Our goal has been to allow users to express themselves using the conventions + of the underlying build system: if the build system honors GOARCH + during a build and during a metadata query, then so should + applications built atop that query mechanism. + Conversely, if the target architecture of the build is determined by + command-line flags, the application can pass the relevant + flags through to the build system using a command such as: + myapp -query_flag="--cpu=amd64" -query_flag="--os=darwin" + However, this approach is low-level, unwieldy, and non-portable. + GOOS and GOARCH seem important enough to warrant a dedicated option. + +- How should we handle partial failures such as a mixture of good and + malformed patterns, existing and non-existent packages, successful and + failed builds, import failures, import cycles, and so on, in a call to + Load? + +- Support bazel, blaze, and go1.10 list, not just go1.11 list. + +- Handle (and test) various partial success cases, e.g. + a mixture of good packages and: + invalid patterns + nonexistent packages + empty packages + packages with malformed package or import declarations + unreadable files + import cycles + other parse errors + type errors + Make sure we record errors at the correct place in the graph. + +- Missing packages among initial arguments are not reported. + Return bogus packages for them, like golist does. + +- "undeclared name" errors (for example) are reported out of source file + order. I suspect this is due to the breadth-first resolution now used + by go/types. Is that a bug? Discuss with gri. + +*/ diff --git a/vendor/golang.org/x/tools/go/packages/external.go b/vendor/golang.org/x/tools/go/packages/external.go new file mode 100644 index 0000000000..7242a0a7d2 --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/external.go @@ -0,0 +1,101 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This file enables an external tool to intercept package requests. +// If the tool is present then its results are used in preference to +// the go list command. + +package packages + +import ( + "bytes" + "encoding/json" + "fmt" + exec "golang.org/x/sys/execabs" + "os" + "strings" +) + +// The Driver Protocol +// +// The driver, given the inputs to a call to Load, returns metadata about the packages specified. +// This allows for different build systems to support go/packages by telling go/packages how the +// packages' source is organized. +// The driver is a binary, either specified by the GOPACKAGESDRIVER environment variable or in +// the path as gopackagesdriver. It's given the inputs to load in its argv. See the package +// documentation in doc.go for the full description of the patterns that need to be supported. +// A driver receives as a JSON-serialized driverRequest struct in standard input and will +// produce a JSON-serialized driverResponse (see definition in packages.go) in its standard output. + +// driverRequest is used to provide the portion of Load's Config that is needed by a driver. +type driverRequest struct { + Mode LoadMode `json:"mode"` + // Env specifies the environment the underlying build system should be run in. + Env []string `json:"env"` + // BuildFlags are flags that should be passed to the underlying build system. + BuildFlags []string `json:"build_flags"` + // Tests specifies whether the patterns should also return test packages. + Tests bool `json:"tests"` + // Overlay maps file paths (relative to the driver's working directory) to the byte contents + // of overlay files. + Overlay map[string][]byte `json:"overlay"` +} + +// findExternalDriver returns the file path of a tool that supplies +// the build system package structure, or "" if not found." +// If GOPACKAGESDRIVER is set in the environment findExternalTool returns its +// value, otherwise it searches for a binary named gopackagesdriver on the PATH. +func findExternalDriver(cfg *Config) driver { + const toolPrefix = "GOPACKAGESDRIVER=" + tool := "" + for _, env := range cfg.Env { + if val := strings.TrimPrefix(env, toolPrefix); val != env { + tool = val + } + } + if tool != "" && tool == "off" { + return nil + } + if tool == "" { + var err error + tool, err = exec.LookPath("gopackagesdriver") + if err != nil { + return nil + } + } + return func(cfg *Config, words ...string) (*driverResponse, error) { + req, err := json.Marshal(driverRequest{ + Mode: cfg.Mode, + Env: cfg.Env, + BuildFlags: cfg.BuildFlags, + Tests: cfg.Tests, + Overlay: cfg.Overlay, + }) + if err != nil { + return nil, fmt.Errorf("failed to encode message to driver tool: %v", err) + } + + buf := new(bytes.Buffer) + stderr := new(bytes.Buffer) + cmd := exec.CommandContext(cfg.Context, tool, words...) + cmd.Dir = cfg.Dir + cmd.Env = cfg.Env + cmd.Stdin = bytes.NewReader(req) + cmd.Stdout = buf + cmd.Stderr = stderr + + if err := cmd.Run(); err != nil { + return nil, fmt.Errorf("%v: %v: %s", tool, err, cmd.Stderr) + } + if len(stderr.Bytes()) != 0 && os.Getenv("GOPACKAGESPRINTDRIVERERRORS") != "" { + fmt.Fprintf(os.Stderr, "%s stderr: <<%s>>\n", cmdDebugStr(cmd), stderr) + } + + var response driverResponse + if err := json.Unmarshal(buf.Bytes(), &response); err != nil { + return nil, err + } + return &response, nil + } +} diff --git a/vendor/golang.org/x/tools/go/packages/golist.go b/vendor/golang.org/x/tools/go/packages/golist.go new file mode 100644 index 0000000000..de881562de --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/golist.go @@ -0,0 +1,1173 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +import ( + "bytes" + "context" + "encoding/json" + "fmt" + "go/types" + "io/ioutil" + "log" + "os" + "path" + "path/filepath" + "reflect" + "sort" + "strconv" + "strings" + "sync" + "unicode" + + exec "golang.org/x/sys/execabs" + "golang.org/x/tools/go/internal/packagesdriver" + "golang.org/x/tools/internal/gocommand" + "golang.org/x/tools/internal/packagesinternal" +) + +// debug controls verbose logging. +var debug, _ = strconv.ParseBool(os.Getenv("GOPACKAGESDEBUG")) + +// A goTooOldError reports that the go command +// found by exec.LookPath is too old to use the new go list behavior. +type goTooOldError struct { + error +} + +// responseDeduper wraps a driverResponse, deduplicating its contents. +type responseDeduper struct { + seenRoots map[string]bool + seenPackages map[string]*Package + dr *driverResponse +} + +func newDeduper() *responseDeduper { + return &responseDeduper{ + dr: &driverResponse{}, + seenRoots: map[string]bool{}, + seenPackages: map[string]*Package{}, + } +} + +// addAll fills in r with a driverResponse. +func (r *responseDeduper) addAll(dr *driverResponse) { + for _, pkg := range dr.Packages { + r.addPackage(pkg) + } + for _, root := range dr.Roots { + r.addRoot(root) + } +} + +func (r *responseDeduper) addPackage(p *Package) { + if r.seenPackages[p.ID] != nil { + return + } + r.seenPackages[p.ID] = p + r.dr.Packages = append(r.dr.Packages, p) +} + +func (r *responseDeduper) addRoot(id string) { + if r.seenRoots[id] { + return + } + r.seenRoots[id] = true + r.dr.Roots = append(r.dr.Roots, id) +} + +type golistState struct { + cfg *Config + ctx context.Context + + envOnce sync.Once + goEnvError error + goEnv map[string]string + + rootsOnce sync.Once + rootDirsError error + rootDirs map[string]string + + goVersionOnce sync.Once + goVersionError error + goVersion int // The X in Go 1.X. + + // vendorDirs caches the (non)existence of vendor directories. + vendorDirs map[string]bool +} + +// getEnv returns Go environment variables. Only specific variables are +// populated -- computing all of them is slow. +func (state *golistState) getEnv() (map[string]string, error) { + state.envOnce.Do(func() { + var b *bytes.Buffer + b, state.goEnvError = state.invokeGo("env", "-json", "GOMOD", "GOPATH") + if state.goEnvError != nil { + return + } + + state.goEnv = make(map[string]string) + decoder := json.NewDecoder(b) + if state.goEnvError = decoder.Decode(&state.goEnv); state.goEnvError != nil { + return + } + }) + return state.goEnv, state.goEnvError +} + +// mustGetEnv is a convenience function that can be used if getEnv has already succeeded. +func (state *golistState) mustGetEnv() map[string]string { + env, err := state.getEnv() + if err != nil { + panic(fmt.Sprintf("mustGetEnv: %v", err)) + } + return env +} + +// goListDriver uses the go list command to interpret the patterns and produce +// the build system package structure. +// See driver for more details. +func goListDriver(cfg *Config, patterns ...string) (*driverResponse, error) { + // Make sure that any asynchronous go commands are killed when we return. + parentCtx := cfg.Context + if parentCtx == nil { + parentCtx = context.Background() + } + ctx, cancel := context.WithCancel(parentCtx) + defer cancel() + + response := newDeduper() + + state := &golistState{ + cfg: cfg, + ctx: ctx, + vendorDirs: map[string]bool{}, + } + + // Fill in response.Sizes asynchronously if necessary. + var sizeserr error + var sizeswg sync.WaitGroup + if cfg.Mode&NeedTypesSizes != 0 || cfg.Mode&NeedTypes != 0 { + sizeswg.Add(1) + go func() { + var sizes types.Sizes + sizes, sizeserr = packagesdriver.GetSizesGolist(ctx, state.cfgInvocation(), cfg.gocmdRunner) + // types.SizesFor always returns nil or a *types.StdSizes. + response.dr.Sizes, _ = sizes.(*types.StdSizes) + sizeswg.Done() + }() + } + + // Determine files requested in contains patterns + var containFiles []string + restPatterns := make([]string, 0, len(patterns)) + // Extract file= and other [querytype]= patterns. Report an error if querytype + // doesn't exist. +extractQueries: + for _, pattern := range patterns { + eqidx := strings.Index(pattern, "=") + if eqidx < 0 { + restPatterns = append(restPatterns, pattern) + } else { + query, value := pattern[:eqidx], pattern[eqidx+len("="):] + switch query { + case "file": + containFiles = append(containFiles, value) + case "pattern": + restPatterns = append(restPatterns, value) + case "": // not a reserved query + restPatterns = append(restPatterns, pattern) + default: + for _, rune := range query { + if rune < 'a' || rune > 'z' { // not a reserved query + restPatterns = append(restPatterns, pattern) + continue extractQueries + } + } + // Reject all other patterns containing "=" + return nil, fmt.Errorf("invalid query type %q in query pattern %q", query, pattern) + } + } + } + + // See if we have any patterns to pass through to go list. Zero initial + // patterns also requires a go list call, since it's the equivalent of + // ".". + if len(restPatterns) > 0 || len(patterns) == 0 { + dr, err := state.createDriverResponse(restPatterns...) + if err != nil { + return nil, err + } + response.addAll(dr) + } + + if len(containFiles) != 0 { + if err := state.runContainsQueries(response, containFiles); err != nil { + return nil, err + } + } + + // Only use go/packages' overlay processing if we're using a Go version + // below 1.16. Otherwise, go list handles it. + if goVersion, err := state.getGoVersion(); err == nil && goVersion < 16 { + modifiedPkgs, needPkgs, err := state.processGolistOverlay(response) + if err != nil { + return nil, err + } + + var containsCandidates []string + if len(containFiles) > 0 { + containsCandidates = append(containsCandidates, modifiedPkgs...) + containsCandidates = append(containsCandidates, needPkgs...) + } + if err := state.addNeededOverlayPackages(response, needPkgs); err != nil { + return nil, err + } + // Check candidate packages for containFiles. + if len(containFiles) > 0 { + for _, id := range containsCandidates { + pkg, ok := response.seenPackages[id] + if !ok { + response.addPackage(&Package{ + ID: id, + Errors: []Error{{ + Kind: ListError, + Msg: fmt.Sprintf("package %s expected but not seen", id), + }}, + }) + continue + } + for _, f := range containFiles { + for _, g := range pkg.GoFiles { + if sameFile(f, g) { + response.addRoot(id) + } + } + } + } + } + // Add root for any package that matches a pattern. This applies only to + // packages that are modified by overlays, since they are not added as + // roots automatically. + for _, pattern := range restPatterns { + match := matchPattern(pattern) + for _, pkgID := range modifiedPkgs { + pkg, ok := response.seenPackages[pkgID] + if !ok { + continue + } + if match(pkg.PkgPath) { + response.addRoot(pkg.ID) + } + } + } + } + + sizeswg.Wait() + if sizeserr != nil { + return nil, sizeserr + } + return response.dr, nil +} + +func (state *golistState) addNeededOverlayPackages(response *responseDeduper, pkgs []string) error { + if len(pkgs) == 0 { + return nil + } + dr, err := state.createDriverResponse(pkgs...) + if err != nil { + return err + } + for _, pkg := range dr.Packages { + response.addPackage(pkg) + } + _, needPkgs, err := state.processGolistOverlay(response) + if err != nil { + return err + } + return state.addNeededOverlayPackages(response, needPkgs) +} + +func (state *golistState) runContainsQueries(response *responseDeduper, queries []string) error { + for _, query := range queries { + // TODO(matloob): Do only one query per directory. + fdir := filepath.Dir(query) + // Pass absolute path of directory to go list so that it knows to treat it as a directory, + // not a package path. + pattern, err := filepath.Abs(fdir) + if err != nil { + return fmt.Errorf("could not determine absolute path of file= query path %q: %v", query, err) + } + dirResponse, err := state.createDriverResponse(pattern) + + // If there was an error loading the package, or no packages are returned, + // or the package is returned with errors, try to load the file as an + // ad-hoc package. + // Usually the error will appear in a returned package, but may not if we're + // in module mode and the ad-hoc is located outside a module. + if err != nil || len(dirResponse.Packages) == 0 || len(dirResponse.Packages) == 1 && len(dirResponse.Packages[0].GoFiles) == 0 && + len(dirResponse.Packages[0].Errors) == 1 { + var queryErr error + if dirResponse, queryErr = state.adhocPackage(pattern, query); queryErr != nil { + return err // return the original error + } + } + isRoot := make(map[string]bool, len(dirResponse.Roots)) + for _, root := range dirResponse.Roots { + isRoot[root] = true + } + for _, pkg := range dirResponse.Packages { + // Add any new packages to the main set + // We don't bother to filter packages that will be dropped by the changes of roots, + // that will happen anyway during graph construction outside this function. + // Over-reporting packages is not a problem. + response.addPackage(pkg) + // if the package was not a root one, it cannot have the file + if !isRoot[pkg.ID] { + continue + } + for _, pkgFile := range pkg.GoFiles { + if filepath.Base(query) == filepath.Base(pkgFile) { + response.addRoot(pkg.ID) + break + } + } + } + } + return nil +} + +// adhocPackage attempts to load or construct an ad-hoc package for a given +// query, if the original call to the driver produced inadequate results. +func (state *golistState) adhocPackage(pattern, query string) (*driverResponse, error) { + response, err := state.createDriverResponse(query) + if err != nil { + return nil, err + } + // If we get nothing back from `go list`, + // try to make this file into its own ad-hoc package. + // TODO(rstambler): Should this check against the original response? + if len(response.Packages) == 0 { + response.Packages = append(response.Packages, &Package{ + ID: "command-line-arguments", + PkgPath: query, + GoFiles: []string{query}, + CompiledGoFiles: []string{query}, + Imports: make(map[string]*Package), + }) + response.Roots = append(response.Roots, "command-line-arguments") + } + // Handle special cases. + if len(response.Packages) == 1 { + // golang/go#33482: If this is a file= query for ad-hoc packages where + // the file only exists on an overlay, and exists outside of a module, + // add the file to the package and remove the errors. + if response.Packages[0].ID == "command-line-arguments" || + filepath.ToSlash(response.Packages[0].PkgPath) == filepath.ToSlash(query) { + if len(response.Packages[0].GoFiles) == 0 { + filename := filepath.Join(pattern, filepath.Base(query)) // avoid recomputing abspath + // TODO(matloob): check if the file is outside of a root dir? + for path := range state.cfg.Overlay { + if path == filename { + response.Packages[0].Errors = nil + response.Packages[0].GoFiles = []string{path} + response.Packages[0].CompiledGoFiles = []string{path} + } + } + } + } + } + return response, nil +} + +// Fields must match go list; +// see $GOROOT/src/cmd/go/internal/load/pkg.go. +type jsonPackage struct { + ImportPath string + Dir string + Name string + Export string + GoFiles []string + CompiledGoFiles []string + IgnoredGoFiles []string + IgnoredOtherFiles []string + EmbedPatterns []string + EmbedFiles []string + CFiles []string + CgoFiles []string + CXXFiles []string + MFiles []string + HFiles []string + FFiles []string + SFiles []string + SwigFiles []string + SwigCXXFiles []string + SysoFiles []string + Imports []string + ImportMap map[string]string + Deps []string + Module *Module + TestGoFiles []string + TestImports []string + XTestGoFiles []string + XTestImports []string + ForTest string // q in a "p [q.test]" package, else "" + DepOnly bool + + Error *packagesinternal.PackageError + DepsErrors []*packagesinternal.PackageError +} + +type jsonPackageError struct { + ImportStack []string + Pos string + Err string +} + +func otherFiles(p *jsonPackage) [][]string { + return [][]string{p.CFiles, p.CXXFiles, p.MFiles, p.HFiles, p.FFiles, p.SFiles, p.SwigFiles, p.SwigCXXFiles, p.SysoFiles} +} + +// createDriverResponse uses the "go list" command to expand the pattern +// words and return a response for the specified packages. +func (state *golistState) createDriverResponse(words ...string) (*driverResponse, error) { + // go list uses the following identifiers in ImportPath and Imports: + // + // "p" -- importable package or main (command) + // "q.test" -- q's test executable + // "p [q.test]" -- variant of p as built for q's test executable + // "q_test [q.test]" -- q's external test package + // + // The packages p that are built differently for a test q.test + // are q itself, plus any helpers used by the external test q_test, + // typically including "testing" and all its dependencies. + + // Run "go list" for complete + // information on the specified packages. + goVersion, err := state.getGoVersion() + if err != nil { + return nil, err + } + buf, err := state.invokeGo("list", golistargs(state.cfg, words, goVersion)...) + if err != nil { + return nil, err + } + seen := make(map[string]*jsonPackage) + pkgs := make(map[string]*Package) + additionalErrors := make(map[string][]Error) + // Decode the JSON and convert it to Package form. + var response driverResponse + for dec := json.NewDecoder(buf); dec.More(); { + p := new(jsonPackage) + if err := dec.Decode(p); err != nil { + return nil, fmt.Errorf("JSON decoding failed: %v", err) + } + + if p.ImportPath == "" { + // The documentation for go list says that “[e]rroneous packages will have + // a non-empty ImportPath”. If for some reason it comes back empty, we + // prefer to error out rather than silently discarding data or handing + // back a package without any way to refer to it. + if p.Error != nil { + return nil, Error{ + Pos: p.Error.Pos, + Msg: p.Error.Err, + } + } + return nil, fmt.Errorf("package missing import path: %+v", p) + } + + // Work around https://golang.org/issue/33157: + // go list -e, when given an absolute path, will find the package contained at + // that directory. But when no package exists there, it will return a fake package + // with an error and the ImportPath set to the absolute path provided to go list. + // Try to convert that absolute path to what its package path would be if it's + // contained in a known module or GOPATH entry. This will allow the package to be + // properly "reclaimed" when overlays are processed. + if filepath.IsAbs(p.ImportPath) && p.Error != nil { + pkgPath, ok, err := state.getPkgPath(p.ImportPath) + if err != nil { + return nil, err + } + if ok { + p.ImportPath = pkgPath + } + } + + if old, found := seen[p.ImportPath]; found { + // If one version of the package has an error, and the other doesn't, assume + // that this is a case where go list is reporting a fake dependency variant + // of the imported package: When a package tries to invalidly import another + // package, go list emits a variant of the imported package (with the same + // import path, but with an error on it, and the package will have a + // DepError set on it). An example of when this can happen is for imports of + // main packages: main packages can not be imported, but they may be + // separately matched and listed by another pattern. + // See golang.org/issue/36188 for more details. + + // The plan is that eventually, hopefully in Go 1.15, the error will be + // reported on the importing package rather than the duplicate "fake" + // version of the imported package. Once all supported versions of Go + // have the new behavior this logic can be deleted. + // TODO(matloob): delete the workaround logic once all supported versions of + // Go return the errors on the proper package. + + // There should be exactly one version of a package that doesn't have an + // error. + if old.Error == nil && p.Error == nil { + if !reflect.DeepEqual(p, old) { + return nil, fmt.Errorf("internal error: go list gives conflicting information for package %v", p.ImportPath) + } + continue + } + + // Determine if this package's error needs to be bubbled up. + // This is a hack, and we expect for go list to eventually set the error + // on the package. + if old.Error != nil { + var errkind string + if strings.Contains(old.Error.Err, "not an importable package") { + errkind = "not an importable package" + } else if strings.Contains(old.Error.Err, "use of internal package") && strings.Contains(old.Error.Err, "not allowed") { + errkind = "use of internal package not allowed" + } + if errkind != "" { + if len(old.Error.ImportStack) < 1 { + return nil, fmt.Errorf(`internal error: go list gave a %q error with empty import stack`, errkind) + } + importingPkg := old.Error.ImportStack[len(old.Error.ImportStack)-1] + if importingPkg == old.ImportPath { + // Using an older version of Go which put this package itself on top of import + // stack, instead of the importer. Look for importer in second from top + // position. + if len(old.Error.ImportStack) < 2 { + return nil, fmt.Errorf(`internal error: go list gave a %q error with an import stack without importing package`, errkind) + } + importingPkg = old.Error.ImportStack[len(old.Error.ImportStack)-2] + } + additionalErrors[importingPkg] = append(additionalErrors[importingPkg], Error{ + Pos: old.Error.Pos, + Msg: old.Error.Err, + Kind: ListError, + }) + } + } + + // Make sure that if there's a version of the package without an error, + // that's the one reported to the user. + if old.Error == nil { + continue + } + + // This package will replace the old one at the end of the loop. + } + seen[p.ImportPath] = p + + pkg := &Package{ + Name: p.Name, + ID: p.ImportPath, + GoFiles: absJoin(p.Dir, p.GoFiles, p.CgoFiles), + CompiledGoFiles: absJoin(p.Dir, p.CompiledGoFiles), + OtherFiles: absJoin(p.Dir, otherFiles(p)...), + EmbedFiles: absJoin(p.Dir, p.EmbedFiles), + EmbedPatterns: absJoin(p.Dir, p.EmbedPatterns), + IgnoredFiles: absJoin(p.Dir, p.IgnoredGoFiles, p.IgnoredOtherFiles), + forTest: p.ForTest, + depsErrors: p.DepsErrors, + Module: p.Module, + } + + if (state.cfg.Mode&typecheckCgo) != 0 && len(p.CgoFiles) != 0 { + if len(p.CompiledGoFiles) > len(p.GoFiles) { + // We need the cgo definitions, which are in the first + // CompiledGoFile after the non-cgo ones. This is a hack but there + // isn't currently a better way to find it. We also need the pure + // Go files and unprocessed cgo files, all of which are already + // in pkg.GoFiles. + cgoTypes := p.CompiledGoFiles[len(p.GoFiles)] + pkg.CompiledGoFiles = append([]string{cgoTypes}, pkg.GoFiles...) + } else { + // golang/go#38990: go list silently fails to do cgo processing + pkg.CompiledGoFiles = nil + pkg.Errors = append(pkg.Errors, Error{ + Msg: "go list failed to return CompiledGoFiles. This may indicate failure to perform cgo processing; try building at the command line. See https://golang.org/issue/38990.", + Kind: ListError, + }) + } + } + + // Work around https://golang.org/issue/28749: + // cmd/go puts assembly, C, and C++ files in CompiledGoFiles. + // Filter out any elements of CompiledGoFiles that are also in OtherFiles. + // We have to keep this workaround in place until go1.12 is a distant memory. + if len(pkg.OtherFiles) > 0 { + other := make(map[string]bool, len(pkg.OtherFiles)) + for _, f := range pkg.OtherFiles { + other[f] = true + } + + out := pkg.CompiledGoFiles[:0] + for _, f := range pkg.CompiledGoFiles { + if other[f] { + continue + } + out = append(out, f) + } + pkg.CompiledGoFiles = out + } + + // Extract the PkgPath from the package's ID. + if i := strings.IndexByte(pkg.ID, ' '); i >= 0 { + pkg.PkgPath = pkg.ID[:i] + } else { + pkg.PkgPath = pkg.ID + } + + if pkg.PkgPath == "unsafe" { + pkg.GoFiles = nil // ignore fake unsafe.go file + } + + // Assume go list emits only absolute paths for Dir. + if p.Dir != "" && !filepath.IsAbs(p.Dir) { + log.Fatalf("internal error: go list returned non-absolute Package.Dir: %s", p.Dir) + } + + if p.Export != "" && !filepath.IsAbs(p.Export) { + pkg.ExportFile = filepath.Join(p.Dir, p.Export) + } else { + pkg.ExportFile = p.Export + } + + // imports + // + // Imports contains the IDs of all imported packages. + // ImportsMap records (path, ID) only where they differ. + ids := make(map[string]bool) + for _, id := range p.Imports { + ids[id] = true + } + pkg.Imports = make(map[string]*Package) + for path, id := range p.ImportMap { + pkg.Imports[path] = &Package{ID: id} // non-identity import + delete(ids, id) + } + for id := range ids { + if id == "C" { + continue + } + + pkg.Imports[id] = &Package{ID: id} // identity import + } + if !p.DepOnly { + response.Roots = append(response.Roots, pkg.ID) + } + + // Work around for pre-go.1.11 versions of go list. + // TODO(matloob): they should be handled by the fallback. + // Can we delete this? + if len(pkg.CompiledGoFiles) == 0 { + pkg.CompiledGoFiles = pkg.GoFiles + } + + // Temporary work-around for golang/go#39986. Parse filenames out of + // error messages. This happens if there are unrecoverable syntax + // errors in the source, so we can't match on a specific error message. + if err := p.Error; err != nil && state.shouldAddFilenameFromError(p) { + addFilenameFromPos := func(pos string) bool { + split := strings.Split(pos, ":") + if len(split) < 1 { + return false + } + filename := strings.TrimSpace(split[0]) + if filename == "" { + return false + } + if !filepath.IsAbs(filename) { + filename = filepath.Join(state.cfg.Dir, filename) + } + info, _ := os.Stat(filename) + if info == nil { + return false + } + pkg.CompiledGoFiles = append(pkg.CompiledGoFiles, filename) + pkg.GoFiles = append(pkg.GoFiles, filename) + return true + } + found := addFilenameFromPos(err.Pos) + // In some cases, go list only reports the error position in the + // error text, not the error position. One such case is when the + // file's package name is a keyword (see golang.org/issue/39763). + if !found { + addFilenameFromPos(err.Err) + } + } + + if p.Error != nil { + msg := strings.TrimSpace(p.Error.Err) // Trim to work around golang.org/issue/32363. + // Address golang.org/issue/35964 by appending import stack to error message. + if msg == "import cycle not allowed" && len(p.Error.ImportStack) != 0 { + msg += fmt.Sprintf(": import stack: %v", p.Error.ImportStack) + } + pkg.Errors = append(pkg.Errors, Error{ + Pos: p.Error.Pos, + Msg: msg, + Kind: ListError, + }) + } + + pkgs[pkg.ID] = pkg + } + + for id, errs := range additionalErrors { + if p, ok := pkgs[id]; ok { + p.Errors = append(p.Errors, errs...) + } + } + for _, pkg := range pkgs { + response.Packages = append(response.Packages, pkg) + } + sort.Slice(response.Packages, func(i, j int) bool { return response.Packages[i].ID < response.Packages[j].ID }) + + return &response, nil +} + +func (state *golistState) shouldAddFilenameFromError(p *jsonPackage) bool { + if len(p.GoFiles) > 0 || len(p.CompiledGoFiles) > 0 { + return false + } + + goV, err := state.getGoVersion() + if err != nil { + return false + } + + // On Go 1.14 and earlier, only add filenames from errors if the import stack is empty. + // The import stack behaves differently for these versions than newer Go versions. + if goV < 15 { + return len(p.Error.ImportStack) == 0 + } + + // On Go 1.15 and later, only parse filenames out of error if there's no import stack, + // or the current package is at the top of the import stack. This is not guaranteed + // to work perfectly, but should avoid some cases where files in errors don't belong to this + // package. + return len(p.Error.ImportStack) == 0 || p.Error.ImportStack[len(p.Error.ImportStack)-1] == p.ImportPath +} + +func (state *golistState) getGoVersion() (int, error) { + state.goVersionOnce.Do(func() { + state.goVersion, state.goVersionError = gocommand.GoVersion(state.ctx, state.cfgInvocation(), state.cfg.gocmdRunner) + }) + return state.goVersion, state.goVersionError +} + +// getPkgPath finds the package path of a directory if it's relative to a root +// directory. +func (state *golistState) getPkgPath(dir string) (string, bool, error) { + absDir, err := filepath.Abs(dir) + if err != nil { + return "", false, err + } + roots, err := state.determineRootDirs() + if err != nil { + return "", false, err + } + + for rdir, rpath := range roots { + // Make sure that the directory is in the module, + // to avoid creating a path relative to another module. + if !strings.HasPrefix(absDir, rdir) { + continue + } + // TODO(matloob): This doesn't properly handle symlinks. + r, err := filepath.Rel(rdir, dir) + if err != nil { + continue + } + if rpath != "" { + // We choose only one root even though the directory even it can belong in multiple modules + // or GOPATH entries. This is okay because we only need to work with absolute dirs when a + // file is missing from disk, for instance when gopls calls go/packages in an overlay. + // Once the file is saved, gopls, or the next invocation of the tool will get the correct + // result straight from golist. + // TODO(matloob): Implement module tiebreaking? + return path.Join(rpath, filepath.ToSlash(r)), true, nil + } + return filepath.ToSlash(r), true, nil + } + return "", false, nil +} + +// absJoin absolutizes and flattens the lists of files. +func absJoin(dir string, fileses ...[]string) (res []string) { + for _, files := range fileses { + for _, file := range files { + if !filepath.IsAbs(file) { + file = filepath.Join(dir, file) + } + res = append(res, file) + } + } + return res +} + +func jsonFlag(cfg *Config, goVersion int) string { + if goVersion < 19 { + return "-json" + } + var fields []string + added := make(map[string]bool) + addFields := func(fs ...string) { + for _, f := range fs { + if !added[f] { + added[f] = true + fields = append(fields, f) + } + } + } + addFields("Name", "ImportPath", "Error") // These fields are always needed + if cfg.Mode&NeedFiles != 0 || cfg.Mode&NeedTypes != 0 { + addFields("Dir", "GoFiles", "IgnoredGoFiles", "IgnoredOtherFiles", "CFiles", + "CgoFiles", "CXXFiles", "MFiles", "HFiles", "FFiles", "SFiles", + "SwigFiles", "SwigCXXFiles", "SysoFiles") + if cfg.Tests { + addFields("TestGoFiles", "XTestGoFiles") + } + } + if cfg.Mode&NeedTypes != 0 { + // CompiledGoFiles seems to be required for the test case TestCgoNoSyntax, + // even when -compiled isn't passed in. + // TODO(#52435): Should we make the test ask for -compiled, or automatically + // request CompiledGoFiles in certain circumstances? + addFields("Dir", "CompiledGoFiles") + } + if cfg.Mode&NeedCompiledGoFiles != 0 { + addFields("Dir", "CompiledGoFiles", "Export") + } + if cfg.Mode&NeedImports != 0 { + // When imports are requested, DepOnly is used to distinguish between packages + // explicitly requested and transitive imports of those packages. + addFields("DepOnly", "Imports", "ImportMap") + if cfg.Tests { + addFields("TestImports", "XTestImports") + } + } + if cfg.Mode&NeedDeps != 0 { + addFields("DepOnly") + } + if usesExportData(cfg) { + // Request Dir in the unlikely case Export is not absolute. + addFields("Dir", "Export") + } + if cfg.Mode&needInternalForTest != 0 { + addFields("ForTest") + } + if cfg.Mode&needInternalDepsErrors != 0 { + addFields("DepsErrors") + } + if cfg.Mode&NeedModule != 0 { + addFields("Module") + } + if cfg.Mode&NeedEmbedFiles != 0 { + addFields("EmbedFiles") + } + if cfg.Mode&NeedEmbedPatterns != 0 { + addFields("EmbedPatterns") + } + return "-json=" + strings.Join(fields, ",") +} + +func golistargs(cfg *Config, words []string, goVersion int) []string { + const findFlags = NeedImports | NeedTypes | NeedSyntax | NeedTypesInfo + fullargs := []string{ + "-e", jsonFlag(cfg, goVersion), + fmt.Sprintf("-compiled=%t", cfg.Mode&(NeedCompiledGoFiles|NeedSyntax|NeedTypes|NeedTypesInfo|NeedTypesSizes) != 0), + fmt.Sprintf("-test=%t", cfg.Tests), + fmt.Sprintf("-export=%t", usesExportData(cfg)), + fmt.Sprintf("-deps=%t", cfg.Mode&NeedImports != 0), + // go list doesn't let you pass -test and -find together, + // probably because you'd just get the TestMain. + fmt.Sprintf("-find=%t", !cfg.Tests && cfg.Mode&findFlags == 0 && !usesExportData(cfg)), + } + fullargs = append(fullargs, cfg.BuildFlags...) + fullargs = append(fullargs, "--") + fullargs = append(fullargs, words...) + return fullargs +} + +// cfgInvocation returns an Invocation that reflects cfg's settings. +func (state *golistState) cfgInvocation() gocommand.Invocation { + cfg := state.cfg + return gocommand.Invocation{ + BuildFlags: cfg.BuildFlags, + ModFile: cfg.modFile, + ModFlag: cfg.modFlag, + CleanEnv: cfg.Env != nil, + Env: cfg.Env, + Logf: cfg.Logf, + WorkingDir: cfg.Dir, + } +} + +// invokeGo returns the stdout of a go command invocation. +func (state *golistState) invokeGo(verb string, args ...string) (*bytes.Buffer, error) { + cfg := state.cfg + + inv := state.cfgInvocation() + + // For Go versions 1.16 and above, `go list` accepts overlays directly via + // the -overlay flag. Set it, if it's available. + // + // The check for "list" is not necessarily required, but we should avoid + // getting the go version if possible. + if verb == "list" { + goVersion, err := state.getGoVersion() + if err != nil { + return nil, err + } + if goVersion >= 16 { + filename, cleanup, err := state.writeOverlays() + if err != nil { + return nil, err + } + defer cleanup() + inv.Overlay = filename + } + } + inv.Verb = verb + inv.Args = args + gocmdRunner := cfg.gocmdRunner + if gocmdRunner == nil { + gocmdRunner = &gocommand.Runner{} + } + stdout, stderr, friendlyErr, err := gocmdRunner.RunRaw(cfg.Context, inv) + if err != nil { + // Check for 'go' executable not being found. + if ee, ok := err.(*exec.Error); ok && ee.Err == exec.ErrNotFound { + return nil, fmt.Errorf("'go list' driver requires 'go', but %s", exec.ErrNotFound) + } + + exitErr, ok := err.(*exec.ExitError) + if !ok { + // Catastrophic error: + // - context cancellation + return nil, fmt.Errorf("couldn't run 'go': %w", err) + } + + // Old go version? + if strings.Contains(stderr.String(), "flag provided but not defined") { + return nil, goTooOldError{fmt.Errorf("unsupported version of go: %s: %s", exitErr, stderr)} + } + + // Related to #24854 + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "unexpected directory layout") { + return nil, friendlyErr + } + + // Is there an error running the C compiler in cgo? This will be reported in the "Error" field + // and should be suppressed by go list -e. + // + // This condition is not perfect yet because the error message can include other error messages than runtime/cgo. + isPkgPathRune := func(r rune) bool { + // From https://golang.org/ref/spec#Import_declarations: + // Implementation restriction: A compiler may restrict ImportPaths to non-empty strings + // using only characters belonging to Unicode's L, M, N, P, and S general categories + // (the Graphic characters without spaces) and may also exclude the + // characters !"#$%&'()*,:;<=>?[\]^`{|} and the Unicode replacement character U+FFFD. + return unicode.IsOneOf([]*unicode.RangeTable{unicode.L, unicode.M, unicode.N, unicode.P, unicode.S}, r) && + !strings.ContainsRune("!\"#$%&'()*,:;<=>?[\\]^`{|}\uFFFD", r) + } + // golang/go#36770: Handle case where cmd/go prints module download messages before the error. + msg := stderr.String() + for strings.HasPrefix(msg, "go: downloading") { + msg = msg[strings.IndexRune(msg, '\n')+1:] + } + if len(stderr.String()) > 0 && strings.HasPrefix(stderr.String(), "# ") { + msg := msg[len("# "):] + if strings.HasPrefix(strings.TrimLeftFunc(msg, isPkgPathRune), "\n") { + return stdout, nil + } + // Treat pkg-config errors as a special case (golang.org/issue/36770). + if strings.HasPrefix(msg, "pkg-config") { + return stdout, nil + } + } + + // This error only appears in stderr. See golang.org/cl/166398 for a fix in go list to show + // the error in the Err section of stdout in case -e option is provided. + // This fix is provided for backwards compatibility. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "named files must be .go files") { + output := fmt.Sprintf(`{"ImportPath": "command-line-arguments","Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Similar to the previous error, but currently lacks a fix in Go. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "named files must all be in one directory") { + output := fmt.Sprintf(`{"ImportPath": "command-line-arguments","Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Backwards compatibility for Go 1.11 because 1.12 and 1.13 put the directory in the ImportPath. + // If the package doesn't exist, put the absolute path of the directory into the error message, + // as Go 1.13 list does. + const noSuchDirectory = "no such directory" + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), noSuchDirectory) { + errstr := stderr.String() + abspath := strings.TrimSpace(errstr[strings.Index(errstr, noSuchDirectory)+len(noSuchDirectory):]) + output := fmt.Sprintf(`{"ImportPath": %q,"Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + abspath, strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Workaround for #29280: go list -e has incorrect behavior when an ad-hoc package doesn't exist. + // Note that the error message we look for in this case is different that the one looked for above. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "no such file or directory") { + output := fmt.Sprintf(`{"ImportPath": "command-line-arguments","Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Workaround for #34273. go list -e with GO111MODULE=on has incorrect behavior when listing a + // directory outside any module. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "outside available modules") { + output := fmt.Sprintf(`{"ImportPath": %q,"Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + // TODO(matloob): command-line-arguments isn't correct here. + "command-line-arguments", strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Another variation of the previous error + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "outside module root") { + output := fmt.Sprintf(`{"ImportPath": %q,"Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + // TODO(matloob): command-line-arguments isn't correct here. + "command-line-arguments", strings.Trim(stderr.String(), "\n")) + return bytes.NewBufferString(output), nil + } + + // Workaround for an instance of golang.org/issue/26755: go list -e will return a non-zero exit + // status if there's a dependency on a package that doesn't exist. But it should return + // a zero exit status and set an error on that package. + if len(stderr.String()) > 0 && strings.Contains(stderr.String(), "no Go files in") { + // Don't clobber stdout if `go list` actually returned something. + if len(stdout.String()) > 0 { + return stdout, nil + } + // try to extract package name from string + stderrStr := stderr.String() + var importPath string + colon := strings.Index(stderrStr, ":") + if colon > 0 && strings.HasPrefix(stderrStr, "go build ") { + importPath = stderrStr[len("go build "):colon] + } + output := fmt.Sprintf(`{"ImportPath": %q,"Incomplete": true,"Error": {"Pos": "","Err": %q}}`, + importPath, strings.Trim(stderrStr, "\n")) + return bytes.NewBufferString(output), nil + } + + // Export mode entails a build. + // If that build fails, errors appear on stderr + // (despite the -e flag) and the Export field is blank. + // Do not fail in that case. + // The same is true if an ad-hoc package given to go list doesn't exist. + // TODO(matloob): Remove these once we can depend on go list to exit with a zero status with -e even when + // packages don't exist or a build fails. + if !usesExportData(cfg) && !containsGoFile(args) { + return nil, friendlyErr + } + } + return stdout, nil +} + +// OverlayJSON is the format overlay files are expected to be in. +// The Replace map maps from overlaid paths to replacement paths: +// the Go command will forward all reads trying to open +// each overlaid path to its replacement path, or consider the overlaid +// path not to exist if the replacement path is empty. +// +// From golang/go#39958. +type OverlayJSON struct { + Replace map[string]string `json:"replace,omitempty"` +} + +// writeOverlays writes out files for go list's -overlay flag, as described +// above. +func (state *golistState) writeOverlays() (filename string, cleanup func(), err error) { + // Do nothing if there are no overlays in the config. + if len(state.cfg.Overlay) == 0 { + return "", func() {}, nil + } + dir, err := ioutil.TempDir("", "gopackages-*") + if err != nil { + return "", nil, err + } + // The caller must clean up this directory, unless this function returns an + // error. + cleanup = func() { + os.RemoveAll(dir) + } + defer func() { + if err != nil { + cleanup() + } + }() + overlays := map[string]string{} + for k, v := range state.cfg.Overlay { + // Create a unique filename for the overlaid files, to avoid + // creating nested directories. + noSeparator := strings.Join(strings.Split(filepath.ToSlash(k), "/"), "") + f, err := ioutil.TempFile(dir, fmt.Sprintf("*-%s", noSeparator)) + if err != nil { + return "", func() {}, err + } + if _, err := f.Write(v); err != nil { + return "", func() {}, err + } + if err := f.Close(); err != nil { + return "", func() {}, err + } + overlays[k] = f.Name() + } + b, err := json.Marshal(OverlayJSON{Replace: overlays}) + if err != nil { + return "", func() {}, err + } + // Write out the overlay file that contains the filepath mappings. + filename = filepath.Join(dir, "overlay.json") + if err := ioutil.WriteFile(filename, b, 0665); err != nil { + return "", func() {}, err + } + return filename, cleanup, nil +} + +func containsGoFile(s []string) bool { + for _, f := range s { + if strings.HasSuffix(f, ".go") { + return true + } + } + return false +} + +func cmdDebugStr(cmd *exec.Cmd) string { + env := make(map[string]string) + for _, kv := range cmd.Env { + split := strings.SplitN(kv, "=", 2) + k, v := split[0], split[1] + env[k] = v + } + + var args []string + for _, arg := range cmd.Args { + quoted := strconv.Quote(arg) + if quoted[1:len(quoted)-1] != arg || strings.Contains(arg, " ") { + args = append(args, quoted) + } else { + args = append(args, arg) + } + } + return fmt.Sprintf("GOROOT=%v GOPATH=%v GO111MODULE=%v GOPROXY=%v PWD=%v %v", env["GOROOT"], env["GOPATH"], env["GO111MODULE"], env["GOPROXY"], env["PWD"], strings.Join(args, " ")) +} diff --git a/vendor/golang.org/x/tools/go/packages/golist_overlay.go b/vendor/golang.org/x/tools/go/packages/golist_overlay.go new file mode 100644 index 0000000000..9576b472f9 --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/golist_overlay.go @@ -0,0 +1,575 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +import ( + "encoding/json" + "fmt" + "go/parser" + "go/token" + "os" + "path/filepath" + "regexp" + "sort" + "strconv" + "strings" + + "golang.org/x/tools/internal/gocommand" +) + +// processGolistOverlay provides rudimentary support for adding +// files that don't exist on disk to an overlay. The results can be +// sometimes incorrect. +// TODO(matloob): Handle unsupported cases, including the following: +// - determining the correct package to add given a new import path +func (state *golistState) processGolistOverlay(response *responseDeduper) (modifiedPkgs, needPkgs []string, err error) { + havePkgs := make(map[string]string) // importPath -> non-test package ID + needPkgsSet := make(map[string]bool) + modifiedPkgsSet := make(map[string]bool) + + pkgOfDir := make(map[string][]*Package) + for _, pkg := range response.dr.Packages { + // This is an approximation of import path to id. This can be + // wrong for tests, vendored packages, and a number of other cases. + havePkgs[pkg.PkgPath] = pkg.ID + dir, err := commonDir(pkg.GoFiles) + if err != nil { + return nil, nil, err + } + if dir != "" { + pkgOfDir[dir] = append(pkgOfDir[dir], pkg) + } + } + + // If no new imports are added, it is safe to avoid loading any needPkgs. + // Otherwise, it's hard to tell which package is actually being loaded + // (due to vendoring) and whether any modified package will show up + // in the transitive set of dependencies (because new imports are added, + // potentially modifying the transitive set of dependencies). + var overlayAddsImports bool + + // If both a package and its test package are created by the overlay, we + // need the real package first. Process all non-test files before test + // files, and make the whole process deterministic while we're at it. + var overlayFiles []string + for opath := range state.cfg.Overlay { + overlayFiles = append(overlayFiles, opath) + } + sort.Slice(overlayFiles, func(i, j int) bool { + iTest := strings.HasSuffix(overlayFiles[i], "_test.go") + jTest := strings.HasSuffix(overlayFiles[j], "_test.go") + if iTest != jTest { + return !iTest // non-tests are before tests. + } + return overlayFiles[i] < overlayFiles[j] + }) + for _, opath := range overlayFiles { + contents := state.cfg.Overlay[opath] + base := filepath.Base(opath) + dir := filepath.Dir(opath) + var pkg *Package // if opath belongs to both a package and its test variant, this will be the test variant + var testVariantOf *Package // if opath is a test file, this is the package it is testing + var fileExists bool + isTestFile := strings.HasSuffix(opath, "_test.go") + pkgName, ok := extractPackageName(opath, contents) + if !ok { + // Don't bother adding a file that doesn't even have a parsable package statement + // to the overlay. + continue + } + // If all the overlay files belong to a different package, change the + // package name to that package. + maybeFixPackageName(pkgName, isTestFile, pkgOfDir[dir]) + nextPackage: + for _, p := range response.dr.Packages { + if pkgName != p.Name && p.ID != "command-line-arguments" { + continue + } + for _, f := range p.GoFiles { + if !sameFile(filepath.Dir(f), dir) { + continue + } + // Make sure to capture information on the package's test variant, if needed. + if isTestFile && !hasTestFiles(p) { + // TODO(matloob): Are there packages other than the 'production' variant + // of a package that this can match? This shouldn't match the test main package + // because the file is generated in another directory. + testVariantOf = p + continue nextPackage + } else if !isTestFile && hasTestFiles(p) { + // We're examining a test variant, but the overlaid file is + // a non-test file. Because the overlay implementation + // (currently) only adds a file to one package, skip this + // package, so that we can add the file to the production + // variant of the package. (https://golang.org/issue/36857 + // tracks handling overlays on both the production and test + // variant of a package). + continue nextPackage + } + if pkg != nil && p != pkg && pkg.PkgPath == p.PkgPath { + // We have already seen the production version of the + // for which p is a test variant. + if hasTestFiles(p) { + testVariantOf = pkg + } + } + pkg = p + if filepath.Base(f) == base { + fileExists = true + } + } + } + // The overlay could have included an entirely new package or an + // ad-hoc package. An ad-hoc package is one that we have manually + // constructed from inadequate `go list` results for a file= query. + // It will have the ID command-line-arguments. + if pkg == nil || pkg.ID == "command-line-arguments" { + // Try to find the module or gopath dir the file is contained in. + // Then for modules, add the module opath to the beginning. + pkgPath, ok, err := state.getPkgPath(dir) + if err != nil { + return nil, nil, err + } + if !ok { + break + } + var forTest string // only set for x tests + isXTest := strings.HasSuffix(pkgName, "_test") + if isXTest { + forTest = pkgPath + pkgPath += "_test" + } + id := pkgPath + if isTestFile { + if isXTest { + id = fmt.Sprintf("%s [%s.test]", pkgPath, forTest) + } else { + id = fmt.Sprintf("%s [%s.test]", pkgPath, pkgPath) + } + } + if pkg != nil { + // TODO(rstambler): We should change the package's path and ID + // here. The only issue is that this messes with the roots. + } else { + // Try to reclaim a package with the same ID, if it exists in the response. + for _, p := range response.dr.Packages { + if reclaimPackage(p, id, opath, contents) { + pkg = p + break + } + } + // Otherwise, create a new package. + if pkg == nil { + pkg = &Package{ + PkgPath: pkgPath, + ID: id, + Name: pkgName, + Imports: make(map[string]*Package), + } + response.addPackage(pkg) + havePkgs[pkg.PkgPath] = id + // Add the production package's sources for a test variant. + if isTestFile && !isXTest && testVariantOf != nil { + pkg.GoFiles = append(pkg.GoFiles, testVariantOf.GoFiles...) + pkg.CompiledGoFiles = append(pkg.CompiledGoFiles, testVariantOf.CompiledGoFiles...) + // Add the package under test and its imports to the test variant. + pkg.forTest = testVariantOf.PkgPath + for k, v := range testVariantOf.Imports { + pkg.Imports[k] = &Package{ID: v.ID} + } + } + if isXTest { + pkg.forTest = forTest + } + } + } + } + if !fileExists { + pkg.GoFiles = append(pkg.GoFiles, opath) + // TODO(matloob): Adding the file to CompiledGoFiles can exhibit the wrong behavior + // if the file will be ignored due to its build tags. + pkg.CompiledGoFiles = append(pkg.CompiledGoFiles, opath) + modifiedPkgsSet[pkg.ID] = true + } + imports, err := extractImports(opath, contents) + if err != nil { + // Let the parser or type checker report errors later. + continue + } + for _, imp := range imports { + // TODO(rstambler): If the package is an x test and the import has + // a test variant, make sure to replace it. + if _, found := pkg.Imports[imp]; found { + continue + } + overlayAddsImports = true + id, ok := havePkgs[imp] + if !ok { + var err error + id, err = state.resolveImport(dir, imp) + if err != nil { + return nil, nil, err + } + } + pkg.Imports[imp] = &Package{ID: id} + // Add dependencies to the non-test variant version of this package as well. + if testVariantOf != nil { + testVariantOf.Imports[imp] = &Package{ID: id} + } + } + } + + // toPkgPath guesses the package path given the id. + toPkgPath := func(sourceDir, id string) (string, error) { + if i := strings.IndexByte(id, ' '); i >= 0 { + return state.resolveImport(sourceDir, id[:i]) + } + return state.resolveImport(sourceDir, id) + } + + // Now that new packages have been created, do another pass to determine + // the new set of missing packages. + for _, pkg := range response.dr.Packages { + for _, imp := range pkg.Imports { + if len(pkg.GoFiles) == 0 { + return nil, nil, fmt.Errorf("cannot resolve imports for package %q with no Go files", pkg.PkgPath) + } + pkgPath, err := toPkgPath(filepath.Dir(pkg.GoFiles[0]), imp.ID) + if err != nil { + return nil, nil, err + } + if _, ok := havePkgs[pkgPath]; !ok { + needPkgsSet[pkgPath] = true + } + } + } + + if overlayAddsImports { + needPkgs = make([]string, 0, len(needPkgsSet)) + for pkg := range needPkgsSet { + needPkgs = append(needPkgs, pkg) + } + } + modifiedPkgs = make([]string, 0, len(modifiedPkgsSet)) + for pkg := range modifiedPkgsSet { + modifiedPkgs = append(modifiedPkgs, pkg) + } + return modifiedPkgs, needPkgs, err +} + +// resolveImport finds the ID of a package given its import path. +// In particular, it will find the right vendored copy when in GOPATH mode. +func (state *golistState) resolveImport(sourceDir, importPath string) (string, error) { + env, err := state.getEnv() + if err != nil { + return "", err + } + if env["GOMOD"] != "" { + return importPath, nil + } + + searchDir := sourceDir + for { + vendorDir := filepath.Join(searchDir, "vendor") + exists, ok := state.vendorDirs[vendorDir] + if !ok { + info, err := os.Stat(vendorDir) + exists = err == nil && info.IsDir() + state.vendorDirs[vendorDir] = exists + } + + if exists { + vendoredPath := filepath.Join(vendorDir, importPath) + if info, err := os.Stat(vendoredPath); err == nil && info.IsDir() { + // We should probably check for .go files here, but shame on anyone who fools us. + path, ok, err := state.getPkgPath(vendoredPath) + if err != nil { + return "", err + } + if ok { + return path, nil + } + } + } + + // We know we've hit the top of the filesystem when we Dir / and get /, + // or C:\ and get C:\, etc. + next := filepath.Dir(searchDir) + if next == searchDir { + break + } + searchDir = next + } + return importPath, nil +} + +func hasTestFiles(p *Package) bool { + for _, f := range p.GoFiles { + if strings.HasSuffix(f, "_test.go") { + return true + } + } + return false +} + +// determineRootDirs returns a mapping from absolute directories that could +// contain code to their corresponding import path prefixes. +func (state *golistState) determineRootDirs() (map[string]string, error) { + env, err := state.getEnv() + if err != nil { + return nil, err + } + if env["GOMOD"] != "" { + state.rootsOnce.Do(func() { + state.rootDirs, state.rootDirsError = state.determineRootDirsModules() + }) + } else { + state.rootsOnce.Do(func() { + state.rootDirs, state.rootDirsError = state.determineRootDirsGOPATH() + }) + } + return state.rootDirs, state.rootDirsError +} + +func (state *golistState) determineRootDirsModules() (map[string]string, error) { + // List all of the modules--the first will be the directory for the main + // module. Any replaced modules will also need to be treated as roots. + // Editing files in the module cache isn't a great idea, so we don't + // plan to ever support that. + out, err := state.invokeGo("list", "-m", "-json", "all") + if err != nil { + // 'go list all' will fail if we're outside of a module and + // GO111MODULE=on. Try falling back without 'all'. + var innerErr error + out, innerErr = state.invokeGo("list", "-m", "-json") + if innerErr != nil { + return nil, err + } + } + roots := map[string]string{} + modules := map[string]string{} + var i int + for dec := json.NewDecoder(out); dec.More(); { + mod := new(gocommand.ModuleJSON) + if err := dec.Decode(mod); err != nil { + return nil, err + } + if mod.Dir != "" && mod.Path != "" { + // This is a valid module; add it to the map. + absDir, err := filepath.Abs(mod.Dir) + if err != nil { + return nil, err + } + modules[absDir] = mod.Path + // The first result is the main module. + if i == 0 || mod.Replace != nil && mod.Replace.Path != "" { + roots[absDir] = mod.Path + } + } + i++ + } + return roots, nil +} + +func (state *golistState) determineRootDirsGOPATH() (map[string]string, error) { + m := map[string]string{} + for _, dir := range filepath.SplitList(state.mustGetEnv()["GOPATH"]) { + absDir, err := filepath.Abs(dir) + if err != nil { + return nil, err + } + m[filepath.Join(absDir, "src")] = "" + } + return m, nil +} + +func extractImports(filename string, contents []byte) ([]string, error) { + f, err := parser.ParseFile(token.NewFileSet(), filename, contents, parser.ImportsOnly) // TODO(matloob): reuse fileset? + if err != nil { + return nil, err + } + var res []string + for _, imp := range f.Imports { + quotedPath := imp.Path.Value + path, err := strconv.Unquote(quotedPath) + if err != nil { + return nil, err + } + res = append(res, path) + } + return res, nil +} + +// reclaimPackage attempts to reuse a package that failed to load in an overlay. +// +// If the package has errors and has no Name, GoFiles, or Imports, +// then it's possible that it doesn't yet exist on disk. +func reclaimPackage(pkg *Package, id string, filename string, contents []byte) bool { + // TODO(rstambler): Check the message of the actual error? + // It differs between $GOPATH and module mode. + if pkg.ID != id { + return false + } + if len(pkg.Errors) != 1 { + return false + } + if pkg.Name != "" || pkg.ExportFile != "" { + return false + } + if len(pkg.GoFiles) > 0 || len(pkg.CompiledGoFiles) > 0 || len(pkg.OtherFiles) > 0 { + return false + } + if len(pkg.Imports) > 0 { + return false + } + pkgName, ok := extractPackageName(filename, contents) + if !ok { + return false + } + pkg.Name = pkgName + pkg.Errors = nil + return true +} + +func extractPackageName(filename string, contents []byte) (string, bool) { + // TODO(rstambler): Check the message of the actual error? + // It differs between $GOPATH and module mode. + f, err := parser.ParseFile(token.NewFileSet(), filename, contents, parser.PackageClauseOnly) // TODO(matloob): reuse fileset? + if err != nil { + return "", false + } + return f.Name.Name, true +} + +// commonDir returns the directory that all files are in, "" if files is empty, +// or an error if they aren't in the same directory. +func commonDir(files []string) (string, error) { + seen := make(map[string]bool) + for _, f := range files { + seen[filepath.Dir(f)] = true + } + if len(seen) > 1 { + return "", fmt.Errorf("files (%v) are in more than one directory: %v", files, seen) + } + for k := range seen { + // seen has only one element; return it. + return k, nil + } + return "", nil // no files +} + +// It is possible that the files in the disk directory dir have a different package +// name from newName, which is deduced from the overlays. If they all have a different +// package name, and they all have the same package name, then that name becomes +// the package name. +// It returns true if it changes the package name, false otherwise. +func maybeFixPackageName(newName string, isTestFile bool, pkgsOfDir []*Package) { + names := make(map[string]int) + for _, p := range pkgsOfDir { + names[p.Name]++ + } + if len(names) != 1 { + // some files are in different packages + return + } + var oldName string + for k := range names { + oldName = k + } + if newName == oldName { + return + } + // We might have a case where all of the package names in the directory are + // the same, but the overlay file is for an x test, which belongs to its + // own package. If the x test does not yet exist on disk, we may not yet + // have its package name on disk, but we should not rename the packages. + // + // We use a heuristic to determine if this file belongs to an x test: + // The test file should have a package name whose package name has a _test + // suffix or looks like "newName_test". + maybeXTest := strings.HasPrefix(oldName+"_test", newName) || strings.HasSuffix(newName, "_test") + if isTestFile && maybeXTest { + return + } + for _, p := range pkgsOfDir { + p.Name = newName + } +} + +// This function is copy-pasted from +// https://github.com/golang/go/blob/9706f510a5e2754595d716bd64be8375997311fb/src/cmd/go/internal/search/search.go#L360. +// It should be deleted when we remove support for overlays from go/packages. +// +// NOTE: This does not handle any ./... or ./ style queries, as this function +// doesn't know the working directory. +// +// matchPattern(pattern)(name) reports whether +// name matches pattern. Pattern is a limited glob +// pattern in which '...' means 'any string' and there +// is no other special syntax. +// Unfortunately, there are two special cases. Quoting "go help packages": +// +// First, /... at the end of the pattern can match an empty string, +// so that net/... matches both net and packages in its subdirectories, like net/http. +// Second, any slash-separated pattern element containing a wildcard never +// participates in a match of the "vendor" element in the path of a vendored +// package, so that ./... does not match packages in subdirectories of +// ./vendor or ./mycode/vendor, but ./vendor/... and ./mycode/vendor/... do. +// Note, however, that a directory named vendor that itself contains code +// is not a vendored package: cmd/vendor would be a command named vendor, +// and the pattern cmd/... matches it. +func matchPattern(pattern string) func(name string) bool { + // Convert pattern to regular expression. + // The strategy for the trailing /... is to nest it in an explicit ? expression. + // The strategy for the vendor exclusion is to change the unmatchable + // vendor strings to a disallowed code point (vendorChar) and to use + // "(anything but that codepoint)*" as the implementation of the ... wildcard. + // This is a bit complicated but the obvious alternative, + // namely a hand-written search like in most shell glob matchers, + // is too easy to make accidentally exponential. + // Using package regexp guarantees linear-time matching. + + const vendorChar = "\x00" + + if strings.Contains(pattern, vendorChar) { + return func(name string) bool { return false } + } + + re := regexp.QuoteMeta(pattern) + re = replaceVendor(re, vendorChar) + switch { + case strings.HasSuffix(re, `/`+vendorChar+`/\.\.\.`): + re = strings.TrimSuffix(re, `/`+vendorChar+`/\.\.\.`) + `(/vendor|/` + vendorChar + `/\.\.\.)` + case re == vendorChar+`/\.\.\.`: + re = `(/vendor|/` + vendorChar + `/\.\.\.)` + case strings.HasSuffix(re, `/\.\.\.`): + re = strings.TrimSuffix(re, `/\.\.\.`) + `(/\.\.\.)?` + } + re = strings.ReplaceAll(re, `\.\.\.`, `[^`+vendorChar+`]*`) + + reg := regexp.MustCompile(`^` + re + `$`) + + return func(name string) bool { + if strings.Contains(name, vendorChar) { + return false + } + return reg.MatchString(replaceVendor(name, vendorChar)) + } +} + +// replaceVendor returns the result of replacing +// non-trailing vendor path elements in x with repl. +func replaceVendor(x, repl string) string { + if !strings.Contains(x, "vendor") { + return x + } + elem := strings.Split(x, "/") + for i := 0; i < len(elem)-1; i++ { + if elem[i] == "vendor" { + elem[i] = repl + } + } + return strings.Join(elem, "/") +} diff --git a/vendor/golang.org/x/tools/go/packages/loadmode_string.go b/vendor/golang.org/x/tools/go/packages/loadmode_string.go new file mode 100644 index 0000000000..5c080d21b5 --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/loadmode_string.go @@ -0,0 +1,57 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +import ( + "fmt" + "strings" +) + +var allModes = []LoadMode{ + NeedName, + NeedFiles, + NeedCompiledGoFiles, + NeedImports, + NeedDeps, + NeedExportFile, + NeedTypes, + NeedSyntax, + NeedTypesInfo, + NeedTypesSizes, +} + +var modeStrings = []string{ + "NeedName", + "NeedFiles", + "NeedCompiledGoFiles", + "NeedImports", + "NeedDeps", + "NeedExportFile", + "NeedTypes", + "NeedSyntax", + "NeedTypesInfo", + "NeedTypesSizes", +} + +func (mod LoadMode) String() string { + m := mod + if m == 0 { + return "LoadMode(0)" + } + var out []string + for i, x := range allModes { + if x > m { + break + } + if (m & x) != 0 { + out = append(out, modeStrings[i]) + m = m ^ x + } + } + if m != 0 { + out = append(out, "Unknown") + } + return fmt.Sprintf("LoadMode(%s)", strings.Join(out, "|")) +} diff --git a/vendor/golang.org/x/tools/go/packages/packages.go b/vendor/golang.org/x/tools/go/packages/packages.go new file mode 100644 index 0000000000..a93dc6add4 --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/packages.go @@ -0,0 +1,1273 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +// See doc.go for package documentation and implementation notes. + +import ( + "context" + "encoding/json" + "fmt" + "go/ast" + "go/parser" + "go/scanner" + "go/token" + "go/types" + "io/ioutil" + "log" + "os" + "path/filepath" + "strings" + "sync" + "time" + + "golang.org/x/tools/go/gcexportdata" + "golang.org/x/tools/internal/gocommand" + "golang.org/x/tools/internal/packagesinternal" + "golang.org/x/tools/internal/typeparams" + "golang.org/x/tools/internal/typesinternal" +) + +// A LoadMode controls the amount of detail to return when loading. +// The bits below can be combined to specify which fields should be +// filled in the result packages. +// The zero value is a special case, equivalent to combining +// the NeedName, NeedFiles, and NeedCompiledGoFiles bits. +// ID and Errors (if present) will always be filled. +// Load may return more information than requested. +type LoadMode int + +const ( + // NeedName adds Name and PkgPath. + NeedName LoadMode = 1 << iota + + // NeedFiles adds GoFiles and OtherFiles. + NeedFiles + + // NeedCompiledGoFiles adds CompiledGoFiles. + NeedCompiledGoFiles + + // NeedImports adds Imports. If NeedDeps is not set, the Imports field will contain + // "placeholder" Packages with only the ID set. + NeedImports + + // NeedDeps adds the fields requested by the LoadMode in the packages in Imports. + NeedDeps + + // NeedExportFile adds ExportFile. + NeedExportFile + + // NeedTypes adds Types, Fset, and IllTyped. + NeedTypes + + // NeedSyntax adds Syntax. + NeedSyntax + + // NeedTypesInfo adds TypesInfo. + NeedTypesInfo + + // NeedTypesSizes adds TypesSizes. + NeedTypesSizes + + // needInternalDepsErrors adds the internal deps errors field for use by gopls. + needInternalDepsErrors + + // needInternalForTest adds the internal forTest field. + // Tests must also be set on the context for this field to be populated. + needInternalForTest + + // typecheckCgo enables full support for type checking cgo. Requires Go 1.15+. + // Modifies CompiledGoFiles and Types, and has no effect on its own. + typecheckCgo + + // NeedModule adds Module. + NeedModule + + // NeedEmbedFiles adds EmbedFiles. + NeedEmbedFiles + + // NeedEmbedPatterns adds EmbedPatterns. + NeedEmbedPatterns +) + +const ( + // Deprecated: LoadFiles exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadFiles = NeedName | NeedFiles | NeedCompiledGoFiles + + // Deprecated: LoadImports exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadImports = LoadFiles | NeedImports + + // Deprecated: LoadTypes exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadTypes = LoadImports | NeedTypes | NeedTypesSizes + + // Deprecated: LoadSyntax exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadSyntax = LoadTypes | NeedSyntax | NeedTypesInfo + + // Deprecated: LoadAllSyntax exists for historical compatibility + // and should not be used. Please directly specify the needed fields using the Need values. + LoadAllSyntax = LoadSyntax | NeedDeps + + // Deprecated: NeedExportsFile is a historical misspelling of NeedExportFile. + NeedExportsFile = NeedExportFile +) + +// A Config specifies details about how packages should be loaded. +// The zero value is a valid configuration. +// Calls to Load do not modify this struct. +type Config struct { + // Mode controls the level of information returned for each package. + Mode LoadMode + + // Context specifies the context for the load operation. + // If the context is cancelled, the loader may stop early + // and return an ErrCancelled error. + // If Context is nil, the load cannot be cancelled. + Context context.Context + + // Logf is the logger for the config. + // If the user provides a logger, debug logging is enabled. + // If the GOPACKAGESDEBUG environment variable is set to true, + // but the logger is nil, default to log.Printf. + Logf func(format string, args ...interface{}) + + // Dir is the directory in which to run the build system's query tool + // that provides information about the packages. + // If Dir is empty, the tool is run in the current directory. + Dir string + + // Env is the environment to use when invoking the build system's query tool. + // If Env is nil, the current environment is used. + // As in os/exec's Cmd, only the last value in the slice for + // each environment key is used. To specify the setting of only + // a few variables, append to the current environment, as in: + // + // opt.Env = append(os.Environ(), "GOOS=plan9", "GOARCH=386") + // + Env []string + + // gocmdRunner guards go command calls from concurrency errors. + gocmdRunner *gocommand.Runner + + // BuildFlags is a list of command-line flags to be passed through to + // the build system's query tool. + BuildFlags []string + + // modFile will be used for -modfile in go command invocations. + modFile string + + // modFlag will be used for -modfile in go command invocations. + modFlag string + + // Fset provides source position information for syntax trees and types. + // If Fset is nil, Load will use a new fileset, but preserve Fset's value. + Fset *token.FileSet + + // ParseFile is called to read and parse each file + // when preparing a package's type-checked syntax tree. + // It must be safe to call ParseFile simultaneously from multiple goroutines. + // If ParseFile is nil, the loader will uses parser.ParseFile. + // + // ParseFile should parse the source from src and use filename only for + // recording position information. + // + // An application may supply a custom implementation of ParseFile + // to change the effective file contents or the behavior of the parser, + // or to modify the syntax tree. For example, selectively eliminating + // unwanted function bodies can significantly accelerate type checking. + ParseFile func(fset *token.FileSet, filename string, src []byte) (*ast.File, error) + + // If Tests is set, the loader includes not just the packages + // matching a particular pattern but also any related test packages, + // including test-only variants of the package and the test executable. + // + // For example, when using the go command, loading "fmt" with Tests=true + // returns four packages, with IDs "fmt" (the standard package), + // "fmt [fmt.test]" (the package as compiled for the test), + // "fmt_test" (the test functions from source files in package fmt_test), + // and "fmt.test" (the test binary). + // + // In build systems with explicit names for tests, + // setting Tests may have no effect. + Tests bool + + // Overlay provides a mapping of absolute file paths to file contents. + // If the file with the given path already exists, the parser will use the + // alternative file contents provided by the map. + // + // Overlays provide incomplete support for when a given file doesn't + // already exist on disk. See the package doc above for more details. + Overlay map[string][]byte +} + +// driver is the type for functions that query the build system for the +// packages named by the patterns. +type driver func(cfg *Config, patterns ...string) (*driverResponse, error) + +// driverResponse contains the results for a driver query. +type driverResponse struct { + // NotHandled is returned if the request can't be handled by the current + // driver. If an external driver returns a response with NotHandled, the + // rest of the driverResponse is ignored, and go/packages will fallback + // to the next driver. If go/packages is extended in the future to support + // lists of multiple drivers, go/packages will fall back to the next driver. + NotHandled bool + + // Sizes, if not nil, is the types.Sizes to use when type checking. + Sizes *types.StdSizes + + // Roots is the set of package IDs that make up the root packages. + // We have to encode this separately because when we encode a single package + // we cannot know if it is one of the roots as that requires knowledge of the + // graph it is part of. + Roots []string `json:",omitempty"` + + // Packages is the full set of packages in the graph. + // The packages are not connected into a graph. + // The Imports if populated will be stubs that only have their ID set. + // Imports will be connected and then type and syntax information added in a + // later pass (see refine). + Packages []*Package +} + +// Load loads and returns the Go packages named by the given patterns. +// +// Config specifies loading options; +// nil behaves the same as an empty Config. +// +// Load returns an error if any of the patterns was invalid +// as defined by the underlying build system. +// It may return an empty list of packages without an error, +// for instance for an empty expansion of a valid wildcard. +// Errors associated with a particular package are recorded in the +// corresponding Package's Errors list, and do not cause Load to +// return an error. Clients may need to handle such errors before +// proceeding with further analysis. The PrintErrors function is +// provided for convenient display of all errors. +func Load(cfg *Config, patterns ...string) ([]*Package, error) { + l := newLoader(cfg) + response, err := defaultDriver(&l.Config, patterns...) + if err != nil { + return nil, err + } + l.sizes = response.Sizes + return l.refine(response.Roots, response.Packages...) +} + +// defaultDriver is a driver that implements go/packages' fallback behavior. +// It will try to request to an external driver, if one exists. If there's +// no external driver, or the driver returns a response with NotHandled set, +// defaultDriver will fall back to the go list driver. +func defaultDriver(cfg *Config, patterns ...string) (*driverResponse, error) { + driver := findExternalDriver(cfg) + if driver == nil { + driver = goListDriver + } + response, err := driver(cfg, patterns...) + if err != nil { + return response, err + } else if response.NotHandled { + return goListDriver(cfg, patterns...) + } + return response, nil +} + +// A Package describes a loaded Go package. +type Package struct { + // ID is a unique identifier for a package, + // in a syntax provided by the underlying build system. + // + // Because the syntax varies based on the build system, + // clients should treat IDs as opaque and not attempt to + // interpret them. + ID string + + // Name is the package name as it appears in the package source code. + Name string + + // PkgPath is the package path as used by the go/types package. + PkgPath string + + // Errors contains any errors encountered querying the metadata + // of the package, or while parsing or type-checking its files. + Errors []Error + + // GoFiles lists the absolute file paths of the package's Go source files. + GoFiles []string + + // CompiledGoFiles lists the absolute file paths of the package's source + // files that are suitable for type checking. + // This may differ from GoFiles if files are processed before compilation. + CompiledGoFiles []string + + // OtherFiles lists the absolute file paths of the package's non-Go source files, + // including assembly, C, C++, Fortran, Objective-C, SWIG, and so on. + OtherFiles []string + + // EmbedFiles lists the absolute file paths of the package's files + // embedded with go:embed. + EmbedFiles []string + + // EmbedPatterns lists the absolute file patterns of the package's + // files embedded with go:embed. + EmbedPatterns []string + + // IgnoredFiles lists source files that are not part of the package + // using the current build configuration but that might be part of + // the package using other build configurations. + IgnoredFiles []string + + // ExportFile is the absolute path to a file containing type + // information for the package as provided by the build system. + ExportFile string + + // Imports maps import paths appearing in the package's Go source files + // to corresponding loaded Packages. + Imports map[string]*Package + + // Types provides type information for the package. + // The NeedTypes LoadMode bit sets this field for packages matching the + // patterns; type information for dependencies may be missing or incomplete, + // unless NeedDeps and NeedImports are also set. + Types *types.Package + + // Fset provides position information for Types, TypesInfo, and Syntax. + // It is set only when Types is set. + Fset *token.FileSet + + // IllTyped indicates whether the package or any dependency contains errors. + // It is set only when Types is set. + IllTyped bool + + // Syntax is the package's syntax trees, for the files listed in CompiledGoFiles. + // + // The NeedSyntax LoadMode bit populates this field for packages matching the patterns. + // If NeedDeps and NeedImports are also set, this field will also be populated + // for dependencies. + // + // Syntax is kept in the same order as CompiledGoFiles, with the caveat that nils are + // removed. If parsing returned nil, Syntax may be shorter than CompiledGoFiles. + Syntax []*ast.File + + // TypesInfo provides type information about the package's syntax trees. + // It is set only when Syntax is set. + TypesInfo *types.Info + + // TypesSizes provides the effective size function for types in TypesInfo. + TypesSizes types.Sizes + + // forTest is the package under test, if any. + forTest string + + // depsErrors is the DepsErrors field from the go list response, if any. + depsErrors []*packagesinternal.PackageError + + // module is the module information for the package if it exists. + Module *Module +} + +// Module provides module information for a package. +type Module struct { + Path string // module path + Version string // module version + Replace *Module // replaced by this module + Time *time.Time // time version was created + Main bool // is this the main module? + Indirect bool // is this module only an indirect dependency of main module? + Dir string // directory holding files for this module, if any + GoMod string // path to go.mod file used when loading this module, if any + GoVersion string // go version used in module + Error *ModuleError // error loading module +} + +// ModuleError holds errors loading a module. +type ModuleError struct { + Err string // the error itself +} + +func init() { + packagesinternal.GetForTest = func(p interface{}) string { + return p.(*Package).forTest + } + packagesinternal.GetDepsErrors = func(p interface{}) []*packagesinternal.PackageError { + return p.(*Package).depsErrors + } + packagesinternal.GetGoCmdRunner = func(config interface{}) *gocommand.Runner { + return config.(*Config).gocmdRunner + } + packagesinternal.SetGoCmdRunner = func(config interface{}, runner *gocommand.Runner) { + config.(*Config).gocmdRunner = runner + } + packagesinternal.SetModFile = func(config interface{}, value string) { + config.(*Config).modFile = value + } + packagesinternal.SetModFlag = func(config interface{}, value string) { + config.(*Config).modFlag = value + } + packagesinternal.TypecheckCgo = int(typecheckCgo) + packagesinternal.DepsErrors = int(needInternalDepsErrors) + packagesinternal.ForTest = int(needInternalForTest) +} + +// An Error describes a problem with a package's metadata, syntax, or types. +type Error struct { + Pos string // "file:line:col" or "file:line" or "" or "-" + Msg string + Kind ErrorKind +} + +// ErrorKind describes the source of the error, allowing the user to +// differentiate between errors generated by the driver, the parser, or the +// type-checker. +type ErrorKind int + +const ( + UnknownError ErrorKind = iota + ListError + ParseError + TypeError +) + +func (err Error) Error() string { + pos := err.Pos + if pos == "" { + pos = "-" // like token.Position{}.String() + } + return pos + ": " + err.Msg +} + +// flatPackage is the JSON form of Package +// It drops all the type and syntax fields, and transforms the Imports +// +// TODO(adonovan): identify this struct with Package, effectively +// publishing the JSON protocol. +type flatPackage struct { + ID string + Name string `json:",omitempty"` + PkgPath string `json:",omitempty"` + Errors []Error `json:",omitempty"` + GoFiles []string `json:",omitempty"` + CompiledGoFiles []string `json:",omitempty"` + OtherFiles []string `json:",omitempty"` + EmbedFiles []string `json:",omitempty"` + EmbedPatterns []string `json:",omitempty"` + IgnoredFiles []string `json:",omitempty"` + ExportFile string `json:",omitempty"` + Imports map[string]string `json:",omitempty"` +} + +// MarshalJSON returns the Package in its JSON form. +// For the most part, the structure fields are written out unmodified, and +// the type and syntax fields are skipped. +// The imports are written out as just a map of path to package id. +// The errors are written using a custom type that tries to preserve the +// structure of error types we know about. +// +// This method exists to enable support for additional build systems. It is +// not intended for use by clients of the API and we may change the format. +func (p *Package) MarshalJSON() ([]byte, error) { + flat := &flatPackage{ + ID: p.ID, + Name: p.Name, + PkgPath: p.PkgPath, + Errors: p.Errors, + GoFiles: p.GoFiles, + CompiledGoFiles: p.CompiledGoFiles, + OtherFiles: p.OtherFiles, + EmbedFiles: p.EmbedFiles, + EmbedPatterns: p.EmbedPatterns, + IgnoredFiles: p.IgnoredFiles, + ExportFile: p.ExportFile, + } + if len(p.Imports) > 0 { + flat.Imports = make(map[string]string, len(p.Imports)) + for path, ipkg := range p.Imports { + flat.Imports[path] = ipkg.ID + } + } + return json.Marshal(flat) +} + +// UnmarshalJSON reads in a Package from its JSON format. +// See MarshalJSON for details about the format accepted. +func (p *Package) UnmarshalJSON(b []byte) error { + flat := &flatPackage{} + if err := json.Unmarshal(b, &flat); err != nil { + return err + } + *p = Package{ + ID: flat.ID, + Name: flat.Name, + PkgPath: flat.PkgPath, + Errors: flat.Errors, + GoFiles: flat.GoFiles, + CompiledGoFiles: flat.CompiledGoFiles, + OtherFiles: flat.OtherFiles, + EmbedFiles: flat.EmbedFiles, + EmbedPatterns: flat.EmbedPatterns, + ExportFile: flat.ExportFile, + } + if len(flat.Imports) > 0 { + p.Imports = make(map[string]*Package, len(flat.Imports)) + for path, id := range flat.Imports { + p.Imports[path] = &Package{ID: id} + } + } + return nil +} + +func (p *Package) String() string { return p.ID } + +// loaderPackage augments Package with state used during the loading phase +type loaderPackage struct { + *Package + importErrors map[string]error // maps each bad import to its error + loadOnce sync.Once + color uint8 // for cycle detection + needsrc bool // load from source (Mode >= LoadTypes) + needtypes bool // type information is either requested or depended on + initial bool // package was matched by a pattern +} + +// loader holds the working state of a single call to load. +type loader struct { + pkgs map[string]*loaderPackage + Config + sizes types.Sizes + parseCache map[string]*parseValue + parseCacheMu sync.Mutex + exportMu sync.Mutex // enforces mutual exclusion of exportdata operations + + // Config.Mode contains the implied mode (see impliedLoadMode). + // Implied mode contains all the fields we need the data for. + // In requestedMode there are the actually requested fields. + // We'll zero them out before returning packages to the user. + // This makes it easier for us to get the conditions where + // we need certain modes right. + requestedMode LoadMode +} + +type parseValue struct { + f *ast.File + err error + ready chan struct{} +} + +func newLoader(cfg *Config) *loader { + ld := &loader{ + parseCache: map[string]*parseValue{}, + } + if cfg != nil { + ld.Config = *cfg + // If the user has provided a logger, use it. + ld.Config.Logf = cfg.Logf + } + if ld.Config.Logf == nil { + // If the GOPACKAGESDEBUG environment variable is set to true, + // but the user has not provided a logger, default to log.Printf. + if debug { + ld.Config.Logf = log.Printf + } else { + ld.Config.Logf = func(format string, args ...interface{}) {} + } + } + if ld.Config.Mode == 0 { + ld.Config.Mode = NeedName | NeedFiles | NeedCompiledGoFiles // Preserve zero behavior of Mode for backwards compatibility. + } + if ld.Config.Env == nil { + ld.Config.Env = os.Environ() + } + if ld.Config.gocmdRunner == nil { + ld.Config.gocmdRunner = &gocommand.Runner{} + } + if ld.Context == nil { + ld.Context = context.Background() + } + if ld.Dir == "" { + if dir, err := os.Getwd(); err == nil { + ld.Dir = dir + } + } + + // Save the actually requested fields. We'll zero them out before returning packages to the user. + ld.requestedMode = ld.Mode + ld.Mode = impliedLoadMode(ld.Mode) + + if ld.Mode&NeedTypes != 0 || ld.Mode&NeedSyntax != 0 { + if ld.Fset == nil { + ld.Fset = token.NewFileSet() + } + + // ParseFile is required even in LoadTypes mode + // because we load source if export data is missing. + if ld.ParseFile == nil { + ld.ParseFile = func(fset *token.FileSet, filename string, src []byte) (*ast.File, error) { + const mode = parser.AllErrors | parser.ParseComments + return parser.ParseFile(fset, filename, src, mode) + } + } + } + + return ld +} + +// refine connects the supplied packages into a graph and then adds type and +// and syntax information as requested by the LoadMode. +func (ld *loader) refine(roots []string, list ...*Package) ([]*Package, error) { + rootMap := make(map[string]int, len(roots)) + for i, root := range roots { + rootMap[root] = i + } + ld.pkgs = make(map[string]*loaderPackage) + // first pass, fixup and build the map and roots + var initial = make([]*loaderPackage, len(roots)) + for _, pkg := range list { + rootIndex := -1 + if i, found := rootMap[pkg.ID]; found { + rootIndex = i + } + + // Overlays can invalidate export data. + // TODO(matloob): make this check fine-grained based on dependencies on overlaid files + exportDataInvalid := len(ld.Overlay) > 0 || pkg.ExportFile == "" && pkg.PkgPath != "unsafe" + // This package needs type information if the caller requested types and the package is + // either a root, or it's a non-root and the user requested dependencies ... + needtypes := (ld.Mode&NeedTypes|NeedTypesInfo != 0 && (rootIndex >= 0 || ld.Mode&NeedDeps != 0)) + // This package needs source if the call requested source (or types info, which implies source) + // and the package is either a root, or itas a non- root and the user requested dependencies... + needsrc := ((ld.Mode&(NeedSyntax|NeedTypesInfo) != 0 && (rootIndex >= 0 || ld.Mode&NeedDeps != 0)) || + // ... or if we need types and the exportData is invalid. We fall back to (incompletely) + // typechecking packages from source if they fail to compile. + (ld.Mode&(NeedTypes|NeedTypesInfo) != 0 && exportDataInvalid)) && pkg.PkgPath != "unsafe" + lpkg := &loaderPackage{ + Package: pkg, + needtypes: needtypes, + needsrc: needsrc, + } + ld.pkgs[lpkg.ID] = lpkg + if rootIndex >= 0 { + initial[rootIndex] = lpkg + lpkg.initial = true + } + } + for i, root := range roots { + if initial[i] == nil { + return nil, fmt.Errorf("root package %v is missing", root) + } + } + + // Materialize the import graph. + + const ( + white = 0 // new + grey = 1 // in progress + black = 2 // complete + ) + + // visit traverses the import graph, depth-first, + // and materializes the graph as Packages.Imports. + // + // Valid imports are saved in the Packages.Import map. + // Invalid imports (cycles and missing nodes) are saved in the importErrors map. + // Thus, even in the presence of both kinds of errors, the Import graph remains a DAG. + // + // visit returns whether the package needs src or has a transitive + // dependency on a package that does. These are the only packages + // for which we load source code. + var stack []*loaderPackage + var visit func(lpkg *loaderPackage) bool + var srcPkgs []*loaderPackage + visit = func(lpkg *loaderPackage) bool { + switch lpkg.color { + case black: + return lpkg.needsrc + case grey: + panic("internal error: grey node") + } + lpkg.color = grey + stack = append(stack, lpkg) // push + stubs := lpkg.Imports // the structure form has only stubs with the ID in the Imports + // If NeedImports isn't set, the imports fields will all be zeroed out. + if ld.Mode&NeedImports != 0 { + lpkg.Imports = make(map[string]*Package, len(stubs)) + for importPath, ipkg := range stubs { + var importErr error + imp := ld.pkgs[ipkg.ID] + if imp == nil { + // (includes package "C" when DisableCgo) + importErr = fmt.Errorf("missing package: %q", ipkg.ID) + } else if imp.color == grey { + importErr = fmt.Errorf("import cycle: %s", stack) + } + if importErr != nil { + if lpkg.importErrors == nil { + lpkg.importErrors = make(map[string]error) + } + lpkg.importErrors[importPath] = importErr + continue + } + + if visit(imp) { + lpkg.needsrc = true + } + lpkg.Imports[importPath] = imp.Package + } + } + if lpkg.needsrc { + srcPkgs = append(srcPkgs, lpkg) + } + if ld.Mode&NeedTypesSizes != 0 { + lpkg.TypesSizes = ld.sizes + } + stack = stack[:len(stack)-1] // pop + lpkg.color = black + + return lpkg.needsrc + } + + if ld.Mode&NeedImports == 0 { + // We do this to drop the stub import packages that we are not even going to try to resolve. + for _, lpkg := range initial { + lpkg.Imports = nil + } + } else { + // For each initial package, create its import DAG. + for _, lpkg := range initial { + visit(lpkg) + } + } + if ld.Mode&NeedImports != 0 && ld.Mode&NeedTypes != 0 { + for _, lpkg := range srcPkgs { + // Complete type information is required for the + // immediate dependencies of each source package. + for _, ipkg := range lpkg.Imports { + imp := ld.pkgs[ipkg.ID] + imp.needtypes = true + } + } + } + // Load type data and syntax if needed, starting at + // the initial packages (roots of the import DAG). + if ld.Mode&NeedTypes != 0 || ld.Mode&NeedSyntax != 0 { + var wg sync.WaitGroup + for _, lpkg := range initial { + wg.Add(1) + go func(lpkg *loaderPackage) { + ld.loadRecursive(lpkg) + wg.Done() + }(lpkg) + } + wg.Wait() + } + + result := make([]*Package, len(initial)) + for i, lpkg := range initial { + result[i] = lpkg.Package + } + for i := range ld.pkgs { + // Clear all unrequested fields, + // to catch programs that use more than they request. + if ld.requestedMode&NeedName == 0 { + ld.pkgs[i].Name = "" + ld.pkgs[i].PkgPath = "" + } + if ld.requestedMode&NeedFiles == 0 { + ld.pkgs[i].GoFiles = nil + ld.pkgs[i].OtherFiles = nil + ld.pkgs[i].IgnoredFiles = nil + } + if ld.requestedMode&NeedEmbedFiles == 0 { + ld.pkgs[i].EmbedFiles = nil + } + if ld.requestedMode&NeedEmbedPatterns == 0 { + ld.pkgs[i].EmbedPatterns = nil + } + if ld.requestedMode&NeedCompiledGoFiles == 0 { + ld.pkgs[i].CompiledGoFiles = nil + } + if ld.requestedMode&NeedImports == 0 { + ld.pkgs[i].Imports = nil + } + if ld.requestedMode&NeedExportFile == 0 { + ld.pkgs[i].ExportFile = "" + } + if ld.requestedMode&NeedTypes == 0 { + ld.pkgs[i].Types = nil + ld.pkgs[i].Fset = nil + ld.pkgs[i].IllTyped = false + } + if ld.requestedMode&NeedSyntax == 0 { + ld.pkgs[i].Syntax = nil + } + if ld.requestedMode&NeedTypesInfo == 0 { + ld.pkgs[i].TypesInfo = nil + } + if ld.requestedMode&NeedTypesSizes == 0 { + ld.pkgs[i].TypesSizes = nil + } + if ld.requestedMode&NeedModule == 0 { + ld.pkgs[i].Module = nil + } + } + + return result, nil +} + +// loadRecursive loads the specified package and its dependencies, +// recursively, in parallel, in topological order. +// It is atomic and idempotent. +// Precondition: ld.Mode&NeedTypes. +func (ld *loader) loadRecursive(lpkg *loaderPackage) { + lpkg.loadOnce.Do(func() { + // Load the direct dependencies, in parallel. + var wg sync.WaitGroup + for _, ipkg := range lpkg.Imports { + imp := ld.pkgs[ipkg.ID] + wg.Add(1) + go func(imp *loaderPackage) { + ld.loadRecursive(imp) + wg.Done() + }(imp) + } + wg.Wait() + ld.loadPackage(lpkg) + }) +} + +// loadPackage loads the specified package. +// It must be called only once per Package, +// after immediate dependencies are loaded. +// Precondition: ld.Mode & NeedTypes. +func (ld *loader) loadPackage(lpkg *loaderPackage) { + if lpkg.PkgPath == "unsafe" { + // Fill in the blanks to avoid surprises. + lpkg.Types = types.Unsafe + lpkg.Fset = ld.Fset + lpkg.Syntax = []*ast.File{} + lpkg.TypesInfo = new(types.Info) + lpkg.TypesSizes = ld.sizes + return + } + + // Call NewPackage directly with explicit name. + // This avoids skew between golist and go/types when the files' + // package declarations are inconsistent. + lpkg.Types = types.NewPackage(lpkg.PkgPath, lpkg.Name) + lpkg.Fset = ld.Fset + + // Subtle: we populate all Types fields with an empty Package + // before loading export data so that export data processing + // never has to create a types.Package for an indirect dependency, + // which would then require that such created packages be explicitly + // inserted back into the Import graph as a final step after export data loading. + // The Diamond test exercises this case. + if !lpkg.needtypes && !lpkg.needsrc { + return + } + if !lpkg.needsrc { + ld.loadFromExportData(lpkg) + return // not a source package, don't get syntax trees + } + + appendError := func(err error) { + // Convert various error types into the one true Error. + var errs []Error + switch err := err.(type) { + case Error: + // from driver + errs = append(errs, err) + + case *os.PathError: + // from parser + errs = append(errs, Error{ + Pos: err.Path + ":1", + Msg: err.Err.Error(), + Kind: ParseError, + }) + + case scanner.ErrorList: + // from parser + for _, err := range err { + errs = append(errs, Error{ + Pos: err.Pos.String(), + Msg: err.Msg, + Kind: ParseError, + }) + } + + case types.Error: + // from type checker + errs = append(errs, Error{ + Pos: err.Fset.Position(err.Pos).String(), + Msg: err.Msg, + Kind: TypeError, + }) + + default: + // unexpected impoverished error from parser? + errs = append(errs, Error{ + Pos: "-", + Msg: err.Error(), + Kind: UnknownError, + }) + + // If you see this error message, please file a bug. + log.Printf("internal error: error %q (%T) without position", err, err) + } + + lpkg.Errors = append(lpkg.Errors, errs...) + } + + if ld.Config.Mode&NeedTypes != 0 && len(lpkg.CompiledGoFiles) == 0 && lpkg.ExportFile != "" { + // The config requested loading sources and types, but sources are missing. + // Add an error to the package and fall back to loading from export data. + appendError(Error{"-", fmt.Sprintf("sources missing for package %s", lpkg.ID), ParseError}) + ld.loadFromExportData(lpkg) + return // can't get syntax trees for this package + } + + files, errs := ld.parseFiles(lpkg.CompiledGoFiles) + for _, err := range errs { + appendError(err) + } + + lpkg.Syntax = files + if ld.Config.Mode&NeedTypes == 0 { + return + } + + lpkg.TypesInfo = &types.Info{ + Types: make(map[ast.Expr]types.TypeAndValue), + Defs: make(map[*ast.Ident]types.Object), + Uses: make(map[*ast.Ident]types.Object), + Implicits: make(map[ast.Node]types.Object), + Scopes: make(map[ast.Node]*types.Scope), + Selections: make(map[*ast.SelectorExpr]*types.Selection), + } + typeparams.InitInstanceInfo(lpkg.TypesInfo) + lpkg.TypesSizes = ld.sizes + + importer := importerFunc(func(path string) (*types.Package, error) { + if path == "unsafe" { + return types.Unsafe, nil + } + + // The imports map is keyed by import path. + ipkg := lpkg.Imports[path] + if ipkg == nil { + if err := lpkg.importErrors[path]; err != nil { + return nil, err + } + // There was skew between the metadata and the + // import declarations, likely due to an edit + // race, or because the ParseFile feature was + // used to supply alternative file contents. + return nil, fmt.Errorf("no metadata for %s", path) + } + + if ipkg.Types != nil && ipkg.Types.Complete() { + return ipkg.Types, nil + } + log.Fatalf("internal error: package %q without types was imported from %q", path, lpkg) + panic("unreachable") + }) + + // type-check + tc := &types.Config{ + Importer: importer, + + // Type-check bodies of functions only in non-initial packages. + // Example: for import graph A->B->C and initial packages {A,C}, + // we can ignore function bodies in B. + IgnoreFuncBodies: ld.Mode&NeedDeps == 0 && !lpkg.initial, + + Error: appendError, + Sizes: ld.sizes, + } + if (ld.Mode & typecheckCgo) != 0 { + if !typesinternal.SetUsesCgo(tc) { + appendError(Error{ + Msg: "typecheckCgo requires Go 1.15+", + Kind: ListError, + }) + return + } + } + types.NewChecker(tc, ld.Fset, lpkg.Types, lpkg.TypesInfo).Files(lpkg.Syntax) + + lpkg.importErrors = nil // no longer needed + + // If !Cgo, the type-checker uses FakeImportC mode, so + // it doesn't invoke the importer for import "C", + // nor report an error for the import, + // or for any undefined C.f reference. + // We must detect this explicitly and correctly + // mark the package as IllTyped (by reporting an error). + // TODO(adonovan): if these errors are annoying, + // we could just set IllTyped quietly. + if tc.FakeImportC { + outer: + for _, f := range lpkg.Syntax { + for _, imp := range f.Imports { + if imp.Path.Value == `"C"` { + err := types.Error{Fset: ld.Fset, Pos: imp.Pos(), Msg: `import "C" ignored`} + appendError(err) + break outer + } + } + } + } + + // Record accumulated errors. + illTyped := len(lpkg.Errors) > 0 + if !illTyped { + for _, imp := range lpkg.Imports { + if imp.IllTyped { + illTyped = true + break + } + } + } + lpkg.IllTyped = illTyped +} + +// An importFunc is an implementation of the single-method +// types.Importer interface based on a function value. +type importerFunc func(path string) (*types.Package, error) + +func (f importerFunc) Import(path string) (*types.Package, error) { return f(path) } + +// We use a counting semaphore to limit +// the number of parallel I/O calls per process. +var ioLimit = make(chan bool, 20) + +func (ld *loader) parseFile(filename string) (*ast.File, error) { + ld.parseCacheMu.Lock() + v, ok := ld.parseCache[filename] + if ok { + // cache hit + ld.parseCacheMu.Unlock() + <-v.ready + } else { + // cache miss + v = &parseValue{ready: make(chan struct{})} + ld.parseCache[filename] = v + ld.parseCacheMu.Unlock() + + var src []byte + for f, contents := range ld.Config.Overlay { + if sameFile(f, filename) { + src = contents + } + } + var err error + if src == nil { + ioLimit <- true // wait + src, err = ioutil.ReadFile(filename) + <-ioLimit // signal + } + if err != nil { + v.err = err + } else { + v.f, v.err = ld.ParseFile(ld.Fset, filename, src) + } + + close(v.ready) + } + return v.f, v.err +} + +// parseFiles reads and parses the Go source files and returns the ASTs +// of the ones that could be at least partially parsed, along with a +// list of I/O and parse errors encountered. +// +// Because files are scanned in parallel, the token.Pos +// positions of the resulting ast.Files are not ordered. +func (ld *loader) parseFiles(filenames []string) ([]*ast.File, []error) { + var wg sync.WaitGroup + n := len(filenames) + parsed := make([]*ast.File, n) + errors := make([]error, n) + for i, file := range filenames { + if ld.Config.Context.Err() != nil { + parsed[i] = nil + errors[i] = ld.Config.Context.Err() + continue + } + wg.Add(1) + go func(i int, filename string) { + parsed[i], errors[i] = ld.parseFile(filename) + wg.Done() + }(i, file) + } + wg.Wait() + + // Eliminate nils, preserving order. + var o int + for _, f := range parsed { + if f != nil { + parsed[o] = f + o++ + } + } + parsed = parsed[:o] + + o = 0 + for _, err := range errors { + if err != nil { + errors[o] = err + o++ + } + } + errors = errors[:o] + + return parsed, errors +} + +// sameFile returns true if x and y have the same basename and denote +// the same file. +func sameFile(x, y string) bool { + if x == y { + // It could be the case that y doesn't exist. + // For instance, it may be an overlay file that + // hasn't been written to disk. To handle that case + // let x == y through. (We added the exact absolute path + // string to the CompiledGoFiles list, so the unwritten + // overlay case implies x==y.) + return true + } + if strings.EqualFold(filepath.Base(x), filepath.Base(y)) { // (optimisation) + if xi, err := os.Stat(x); err == nil { + if yi, err := os.Stat(y); err == nil { + return os.SameFile(xi, yi) + } + } + } + return false +} + +// loadFromExportData returns type information for the specified +// package, loading it from an export data file on the first request. +func (ld *loader) loadFromExportData(lpkg *loaderPackage) (*types.Package, error) { + if lpkg.PkgPath == "" { + log.Fatalf("internal error: Package %s has no PkgPath", lpkg) + } + + // Because gcexportdata.Read has the potential to create or + // modify the types.Package for each node in the transitive + // closure of dependencies of lpkg, all exportdata operations + // must be sequential. (Finer-grained locking would require + // changes to the gcexportdata API.) + // + // The exportMu lock guards the Package.Pkg field and the + // types.Package it points to, for each Package in the graph. + // + // Not all accesses to Package.Pkg need to be protected by exportMu: + // graph ordering ensures that direct dependencies of source + // packages are fully loaded before the importer reads their Pkg field. + ld.exportMu.Lock() + defer ld.exportMu.Unlock() + + if tpkg := lpkg.Types; tpkg != nil && tpkg.Complete() { + return tpkg, nil // cache hit + } + + lpkg.IllTyped = true // fail safe + + if lpkg.ExportFile == "" { + // Errors while building export data will have been printed to stderr. + return nil, fmt.Errorf("no export data file") + } + f, err := os.Open(lpkg.ExportFile) + if err != nil { + return nil, err + } + defer f.Close() + + // Read gc export data. + // + // We don't currently support gccgo export data because all + // underlying workspaces use the gc toolchain. (Even build + // systems that support gccgo don't use it for workspace + // queries.) + r, err := gcexportdata.NewReader(f) + if err != nil { + return nil, fmt.Errorf("reading %s: %v", lpkg.ExportFile, err) + } + + // Build the view. + // + // The gcexportdata machinery has no concept of package ID. + // It identifies packages by their PkgPath, which although not + // globally unique is unique within the scope of one invocation + // of the linker, type-checker, or gcexportdata. + // + // So, we must build a PkgPath-keyed view of the global + // (conceptually ID-keyed) cache of packages and pass it to + // gcexportdata. The view must contain every existing + // package that might possibly be mentioned by the + // current package---its transitive closure. + // + // In loadPackage, we unconditionally create a types.Package for + // each dependency so that export data loading does not + // create new ones. + // + // TODO(adonovan): it would be simpler and more efficient + // if the export data machinery invoked a callback to + // get-or-create a package instead of a map. + // + view := make(map[string]*types.Package) // view seen by gcexportdata + seen := make(map[*loaderPackage]bool) // all visited packages + var visit func(pkgs map[string]*Package) + visit = func(pkgs map[string]*Package) { + for _, p := range pkgs { + lpkg := ld.pkgs[p.ID] + if !seen[lpkg] { + seen[lpkg] = true + view[lpkg.PkgPath] = lpkg.Types + visit(lpkg.Imports) + } + } + } + visit(lpkg.Imports) + + viewLen := len(view) + 1 // adding the self package + // Parse the export data. + // (May modify incomplete packages in view but not create new ones.) + tpkg, err := gcexportdata.Read(r, ld.Fset, view, lpkg.PkgPath) + if err != nil { + return nil, fmt.Errorf("reading %s: %v", lpkg.ExportFile, err) + } + if _, ok := view["go.shape"]; ok { + // Account for the pseudopackage "go.shape" that gets + // created by generic code. + viewLen++ + } + if viewLen != len(view) { + log.Panicf("golang.org/x/tools/go/packages: unexpected new packages during load of %s", lpkg.PkgPath) + } + + lpkg.Types = tpkg + lpkg.IllTyped = false + + return tpkg, nil +} + +// impliedLoadMode returns loadMode with its dependencies. +func impliedLoadMode(loadMode LoadMode) LoadMode { + if loadMode&(NeedDeps|NeedTypes|NeedTypesInfo) != 0 { + // All these things require knowing the import graph. + loadMode |= NeedImports + } + + return loadMode +} + +func usesExportData(cfg *Config) bool { + return cfg.Mode&NeedExportFile != 0 || cfg.Mode&NeedTypes != 0 && cfg.Mode&NeedDeps == 0 +} diff --git a/vendor/golang.org/x/tools/go/packages/visit.go b/vendor/golang.org/x/tools/go/packages/visit.go new file mode 100644 index 0000000000..a1dcc40b72 --- /dev/null +++ b/vendor/golang.org/x/tools/go/packages/visit.go @@ -0,0 +1,59 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package packages + +import ( + "fmt" + "os" + "sort" +) + +// Visit visits all the packages in the import graph whose roots are +// pkgs, calling the optional pre function the first time each package +// is encountered (preorder), and the optional post function after a +// package's dependencies have been visited (postorder). +// The boolean result of pre(pkg) determines whether +// the imports of package pkg are visited. +func Visit(pkgs []*Package, pre func(*Package) bool, post func(*Package)) { + seen := make(map[*Package]bool) + var visit func(*Package) + visit = func(pkg *Package) { + if !seen[pkg] { + seen[pkg] = true + + if pre == nil || pre(pkg) { + paths := make([]string, 0, len(pkg.Imports)) + for path := range pkg.Imports { + paths = append(paths, path) + } + sort.Strings(paths) // Imports is a map, this makes visit stable + for _, path := range paths { + visit(pkg.Imports[path]) + } + } + + if post != nil { + post(pkg) + } + } + } + for _, pkg := range pkgs { + visit(pkg) + } +} + +// PrintErrors prints to os.Stderr the accumulated errors of all +// packages in the import graph rooted at pkgs, dependencies first. +// PrintErrors returns the number of errors printed. +func PrintErrors(pkgs []*Package) int { + var n int + Visit(pkgs, nil, func(pkg *Package) { + for _, err := range pkg.Errors { + fmt.Fprintln(os.Stderr, err) + n++ + } + }) + return n +} diff --git a/vendor/golang.org/x/tools/internal/event/core/event.go b/vendor/golang.org/x/tools/internal/event/core/event.go new file mode 100644 index 0000000000..a6cf0e64a4 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/core/event.go @@ -0,0 +1,85 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package core provides support for event based telemetry. +package core + +import ( + "fmt" + "time" + + "golang.org/x/tools/internal/event/label" +) + +// Event holds the information about an event of note that occurred. +type Event struct { + at time.Time + + // As events are often on the stack, storing the first few labels directly + // in the event can avoid an allocation at all for the very common cases of + // simple events. + // The length needs to be large enough to cope with the majority of events + // but no so large as to cause undue stack pressure. + // A log message with two values will use 3 labels (one for each value and + // one for the message itself). + + static [3]label.Label // inline storage for the first few labels + dynamic []label.Label // dynamically sized storage for remaining labels +} + +// eventLabelMap implements label.Map for a the labels of an Event. +type eventLabelMap struct { + event Event +} + +func (ev Event) At() time.Time { return ev.at } + +func (ev Event) Format(f fmt.State, r rune) { + if !ev.at.IsZero() { + fmt.Fprint(f, ev.at.Format("2006/01/02 15:04:05 ")) + } + for index := 0; ev.Valid(index); index++ { + if l := ev.Label(index); l.Valid() { + fmt.Fprintf(f, "\n\t%v", l) + } + } +} + +func (ev Event) Valid(index int) bool { + return index >= 0 && index < len(ev.static)+len(ev.dynamic) +} + +func (ev Event) Label(index int) label.Label { + if index < len(ev.static) { + return ev.static[index] + } + return ev.dynamic[index-len(ev.static)] +} + +func (ev Event) Find(key label.Key) label.Label { + for _, l := range ev.static { + if l.Key() == key { + return l + } + } + for _, l := range ev.dynamic { + if l.Key() == key { + return l + } + } + return label.Label{} +} + +func MakeEvent(static [3]label.Label, labels []label.Label) Event { + return Event{ + static: static, + dynamic: labels, + } +} + +// CloneEvent event returns a copy of the event with the time adjusted to at. +func CloneEvent(ev Event, at time.Time) Event { + ev.at = at + return ev +} diff --git a/vendor/golang.org/x/tools/internal/event/core/export.go b/vendor/golang.org/x/tools/internal/event/core/export.go new file mode 100644 index 0000000000..05f3a9a579 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/core/export.go @@ -0,0 +1,70 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package core + +import ( + "context" + "sync/atomic" + "time" + "unsafe" + + "golang.org/x/tools/internal/event/label" +) + +// Exporter is a function that handles events. +// It may return a modified context and event. +type Exporter func(context.Context, Event, label.Map) context.Context + +var ( + exporter unsafe.Pointer +) + +// SetExporter sets the global exporter function that handles all events. +// The exporter is called synchronously from the event call site, so it should +// return quickly so as not to hold up user code. +func SetExporter(e Exporter) { + p := unsafe.Pointer(&e) + if e == nil { + // &e is always valid, and so p is always valid, but for the early abort + // of ProcessEvent to be efficient it needs to make the nil check on the + // pointer without having to dereference it, so we make the nil function + // also a nil pointer + p = nil + } + atomic.StorePointer(&exporter, p) +} + +// deliver is called to deliver an event to the supplied exporter. +// it will fill in the time. +func deliver(ctx context.Context, exporter Exporter, ev Event) context.Context { + // add the current time to the event + ev.at = time.Now() + // hand the event off to the current exporter + return exporter(ctx, ev, ev) +} + +// Export is called to deliver an event to the global exporter if set. +func Export(ctx context.Context, ev Event) context.Context { + // get the global exporter and abort early if there is not one + exporterPtr := (*Exporter)(atomic.LoadPointer(&exporter)) + if exporterPtr == nil { + return ctx + } + return deliver(ctx, *exporterPtr, ev) +} + +// ExportPair is called to deliver a start event to the supplied exporter. +// It also returns a function that will deliver the end event to the same +// exporter. +// It will fill in the time. +func ExportPair(ctx context.Context, begin, end Event) (context.Context, func()) { + // get the global exporter and abort early if there is not one + exporterPtr := (*Exporter)(atomic.LoadPointer(&exporter)) + if exporterPtr == nil { + return ctx, func() {} + } + ctx = deliver(ctx, *exporterPtr, begin) + return ctx, func() { deliver(ctx, *exporterPtr, end) } +} diff --git a/vendor/golang.org/x/tools/internal/event/core/fast.go b/vendor/golang.org/x/tools/internal/event/core/fast.go new file mode 100644 index 0000000000..06c1d4615e --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/core/fast.go @@ -0,0 +1,77 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package core + +import ( + "context" + + "golang.org/x/tools/internal/event/keys" + "golang.org/x/tools/internal/event/label" +) + +// Log1 takes a message and one label delivers a log event to the exporter. +// It is a customized version of Print that is faster and does no allocation. +func Log1(ctx context.Context, message string, t1 label.Label) { + Export(ctx, MakeEvent([3]label.Label{ + keys.Msg.Of(message), + t1, + }, nil)) +} + +// Log2 takes a message and two labels and delivers a log event to the exporter. +// It is a customized version of Print that is faster and does no allocation. +func Log2(ctx context.Context, message string, t1 label.Label, t2 label.Label) { + Export(ctx, MakeEvent([3]label.Label{ + keys.Msg.Of(message), + t1, + t2, + }, nil)) +} + +// Metric1 sends a label event to the exporter with the supplied labels. +func Metric1(ctx context.Context, t1 label.Label) context.Context { + return Export(ctx, MakeEvent([3]label.Label{ + keys.Metric.New(), + t1, + }, nil)) +} + +// Metric2 sends a label event to the exporter with the supplied labels. +func Metric2(ctx context.Context, t1, t2 label.Label) context.Context { + return Export(ctx, MakeEvent([3]label.Label{ + keys.Metric.New(), + t1, + t2, + }, nil)) +} + +// Start1 sends a span start event with the supplied label list to the exporter. +// It also returns a function that will end the span, which should normally be +// deferred. +func Start1(ctx context.Context, name string, t1 label.Label) (context.Context, func()) { + return ExportPair(ctx, + MakeEvent([3]label.Label{ + keys.Start.Of(name), + t1, + }, nil), + MakeEvent([3]label.Label{ + keys.End.New(), + }, nil)) +} + +// Start2 sends a span start event with the supplied label list to the exporter. +// It also returns a function that will end the span, which should normally be +// deferred. +func Start2(ctx context.Context, name string, t1, t2 label.Label) (context.Context, func()) { + return ExportPair(ctx, + MakeEvent([3]label.Label{ + keys.Start.Of(name), + t1, + t2, + }, nil), + MakeEvent([3]label.Label{ + keys.End.New(), + }, nil)) +} diff --git a/vendor/golang.org/x/tools/internal/event/doc.go b/vendor/golang.org/x/tools/internal/event/doc.go new file mode 100644 index 0000000000..5dc6e6babe --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/doc.go @@ -0,0 +1,7 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package event provides a set of packages that cover the main +// concepts of telemetry in an implementation agnostic way. +package event diff --git a/vendor/golang.org/x/tools/internal/event/event.go b/vendor/golang.org/x/tools/internal/event/event.go new file mode 100644 index 0000000000..4d55e577d1 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/event.go @@ -0,0 +1,127 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package event + +import ( + "context" + + "golang.org/x/tools/internal/event/core" + "golang.org/x/tools/internal/event/keys" + "golang.org/x/tools/internal/event/label" +) + +// Exporter is a function that handles events. +// It may return a modified context and event. +type Exporter func(context.Context, core.Event, label.Map) context.Context + +// SetExporter sets the global exporter function that handles all events. +// The exporter is called synchronously from the event call site, so it should +// return quickly so as not to hold up user code. +func SetExporter(e Exporter) { + core.SetExporter(core.Exporter(e)) +} + +// Log takes a message and a label list and combines them into a single event +// before delivering them to the exporter. +func Log(ctx context.Context, message string, labels ...label.Label) { + core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Msg.Of(message), + }, labels)) +} + +// IsLog returns true if the event was built by the Log function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsLog(ev core.Event) bool { + return ev.Label(0).Key() == keys.Msg +} + +// Error takes a message and a label list and combines them into a single event +// before delivering them to the exporter. It captures the error in the +// delivered event. +func Error(ctx context.Context, message string, err error, labels ...label.Label) { + core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Msg.Of(message), + keys.Err.Of(err), + }, labels)) +} + +// IsError returns true if the event was built by the Error function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsError(ev core.Event) bool { + return ev.Label(0).Key() == keys.Msg && + ev.Label(1).Key() == keys.Err +} + +// Metric sends a label event to the exporter with the supplied labels. +func Metric(ctx context.Context, labels ...label.Label) { + core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Metric.New(), + }, labels)) +} + +// IsMetric returns true if the event was built by the Metric function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsMetric(ev core.Event) bool { + return ev.Label(0).Key() == keys.Metric +} + +// Label sends a label event to the exporter with the supplied labels. +func Label(ctx context.Context, labels ...label.Label) context.Context { + return core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Label.New(), + }, labels)) +} + +// IsLabel returns true if the event was built by the Label function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsLabel(ev core.Event) bool { + return ev.Label(0).Key() == keys.Label +} + +// Start sends a span start event with the supplied label list to the exporter. +// It also returns a function that will end the span, which should normally be +// deferred. +func Start(ctx context.Context, name string, labels ...label.Label) (context.Context, func()) { + return core.ExportPair(ctx, + core.MakeEvent([3]label.Label{ + keys.Start.Of(name), + }, labels), + core.MakeEvent([3]label.Label{ + keys.End.New(), + }, nil)) +} + +// IsStart returns true if the event was built by the Start function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsStart(ev core.Event) bool { + return ev.Label(0).Key() == keys.Start +} + +// IsEnd returns true if the event was built by the End function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsEnd(ev core.Event) bool { + return ev.Label(0).Key() == keys.End +} + +// Detach returns a context without an associated span. +// This allows the creation of spans that are not children of the current span. +func Detach(ctx context.Context) context.Context { + return core.Export(ctx, core.MakeEvent([3]label.Label{ + keys.Detach.New(), + }, nil)) +} + +// IsDetach returns true if the event was built by the Detach function. +// It is intended to be used in exporters to identify the semantics of the +// event when deciding what to do with it. +func IsDetach(ev core.Event) bool { + return ev.Label(0).Key() == keys.Detach +} diff --git a/vendor/golang.org/x/tools/internal/event/keys/keys.go b/vendor/golang.org/x/tools/internal/event/keys/keys.go new file mode 100644 index 0000000000..a02206e301 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/keys/keys.go @@ -0,0 +1,564 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package keys + +import ( + "fmt" + "io" + "math" + "strconv" + + "golang.org/x/tools/internal/event/label" +) + +// Value represents a key for untyped values. +type Value struct { + name string + description string +} + +// New creates a new Key for untyped values. +func New(name, description string) *Value { + return &Value{name: name, description: description} +} + +func (k *Value) Name() string { return k.name } +func (k *Value) Description() string { return k.description } + +func (k *Value) Format(w io.Writer, buf []byte, l label.Label) { + fmt.Fprint(w, k.From(l)) +} + +// Get can be used to get a label for the key from a label.Map. +func (k *Value) Get(lm label.Map) interface{} { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return nil +} + +// From can be used to get a value from a Label. +func (k *Value) From(t label.Label) interface{} { return t.UnpackValue() } + +// Of creates a new Label with this key and the supplied value. +func (k *Value) Of(value interface{}) label.Label { return label.OfValue(k, value) } + +// Tag represents a key for tagging labels that have no value. +// These are used when the existence of the label is the entire information it +// carries, such as marking events to be of a specific kind, or from a specific +// package. +type Tag struct { + name string + description string +} + +// NewTag creates a new Key for tagging labels. +func NewTag(name, description string) *Tag { + return &Tag{name: name, description: description} +} + +func (k *Tag) Name() string { return k.name } +func (k *Tag) Description() string { return k.description } + +func (k *Tag) Format(w io.Writer, buf []byte, l label.Label) {} + +// New creates a new Label with this key. +func (k *Tag) New() label.Label { return label.OfValue(k, nil) } + +// Int represents a key +type Int struct { + name string + description string +} + +// NewInt creates a new Key for int values. +func NewInt(name, description string) *Int { + return &Int{name: name, description: description} +} + +func (k *Int) Name() string { return k.name } +func (k *Int) Description() string { return k.description } + +func (k *Int) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, int64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int) Of(v int) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int) Get(lm label.Map) int { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int) From(t label.Label) int { return int(t.Unpack64()) } + +// Int8 represents a key +type Int8 struct { + name string + description string +} + +// NewInt8 creates a new Key for int8 values. +func NewInt8(name, description string) *Int8 { + return &Int8{name: name, description: description} +} + +func (k *Int8) Name() string { return k.name } +func (k *Int8) Description() string { return k.description } + +func (k *Int8) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, int64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int8) Of(v int8) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int8) Get(lm label.Map) int8 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int8) From(t label.Label) int8 { return int8(t.Unpack64()) } + +// Int16 represents a key +type Int16 struct { + name string + description string +} + +// NewInt16 creates a new Key for int16 values. +func NewInt16(name, description string) *Int16 { + return &Int16{name: name, description: description} +} + +func (k *Int16) Name() string { return k.name } +func (k *Int16) Description() string { return k.description } + +func (k *Int16) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, int64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int16) Of(v int16) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int16) Get(lm label.Map) int16 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int16) From(t label.Label) int16 { return int16(t.Unpack64()) } + +// Int32 represents a key +type Int32 struct { + name string + description string +} + +// NewInt32 creates a new Key for int32 values. +func NewInt32(name, description string) *Int32 { + return &Int32{name: name, description: description} +} + +func (k *Int32) Name() string { return k.name } +func (k *Int32) Description() string { return k.description } + +func (k *Int32) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, int64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int32) Of(v int32) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int32) Get(lm label.Map) int32 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int32) From(t label.Label) int32 { return int32(t.Unpack64()) } + +// Int64 represents a key +type Int64 struct { + name string + description string +} + +// NewInt64 creates a new Key for int64 values. +func NewInt64(name, description string) *Int64 { + return &Int64{name: name, description: description} +} + +func (k *Int64) Name() string { return k.name } +func (k *Int64) Description() string { return k.description } + +func (k *Int64) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendInt(buf, k.From(l), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Int64) Of(v int64) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Int64) Get(lm label.Map) int64 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Int64) From(t label.Label) int64 { return int64(t.Unpack64()) } + +// UInt represents a key +type UInt struct { + name string + description string +} + +// NewUInt creates a new Key for uint values. +func NewUInt(name, description string) *UInt { + return &UInt{name: name, description: description} +} + +func (k *UInt) Name() string { return k.name } +func (k *UInt) Description() string { return k.description } + +func (k *UInt) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, uint64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt) Of(v uint) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt) Get(lm label.Map) uint { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt) From(t label.Label) uint { return uint(t.Unpack64()) } + +// UInt8 represents a key +type UInt8 struct { + name string + description string +} + +// NewUInt8 creates a new Key for uint8 values. +func NewUInt8(name, description string) *UInt8 { + return &UInt8{name: name, description: description} +} + +func (k *UInt8) Name() string { return k.name } +func (k *UInt8) Description() string { return k.description } + +func (k *UInt8) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, uint64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt8) Of(v uint8) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt8) Get(lm label.Map) uint8 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt8) From(t label.Label) uint8 { return uint8(t.Unpack64()) } + +// UInt16 represents a key +type UInt16 struct { + name string + description string +} + +// NewUInt16 creates a new Key for uint16 values. +func NewUInt16(name, description string) *UInt16 { + return &UInt16{name: name, description: description} +} + +func (k *UInt16) Name() string { return k.name } +func (k *UInt16) Description() string { return k.description } + +func (k *UInt16) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, uint64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt16) Of(v uint16) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt16) Get(lm label.Map) uint16 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt16) From(t label.Label) uint16 { return uint16(t.Unpack64()) } + +// UInt32 represents a key +type UInt32 struct { + name string + description string +} + +// NewUInt32 creates a new Key for uint32 values. +func NewUInt32(name, description string) *UInt32 { + return &UInt32{name: name, description: description} +} + +func (k *UInt32) Name() string { return k.name } +func (k *UInt32) Description() string { return k.description } + +func (k *UInt32) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, uint64(k.From(l)), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt32) Of(v uint32) label.Label { return label.Of64(k, uint64(v)) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt32) Get(lm label.Map) uint32 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt32) From(t label.Label) uint32 { return uint32(t.Unpack64()) } + +// UInt64 represents a key +type UInt64 struct { + name string + description string +} + +// NewUInt64 creates a new Key for uint64 values. +func NewUInt64(name, description string) *UInt64 { + return &UInt64{name: name, description: description} +} + +func (k *UInt64) Name() string { return k.name } +func (k *UInt64) Description() string { return k.description } + +func (k *UInt64) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendUint(buf, k.From(l), 10)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *UInt64) Of(v uint64) label.Label { return label.Of64(k, v) } + +// Get can be used to get a label for the key from a label.Map. +func (k *UInt64) Get(lm label.Map) uint64 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *UInt64) From(t label.Label) uint64 { return t.Unpack64() } + +// Float32 represents a key +type Float32 struct { + name string + description string +} + +// NewFloat32 creates a new Key for float32 values. +func NewFloat32(name, description string) *Float32 { + return &Float32{name: name, description: description} +} + +func (k *Float32) Name() string { return k.name } +func (k *Float32) Description() string { return k.description } + +func (k *Float32) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendFloat(buf, float64(k.From(l)), 'E', -1, 32)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Float32) Of(v float32) label.Label { + return label.Of64(k, uint64(math.Float32bits(v))) +} + +// Get can be used to get a label for the key from a label.Map. +func (k *Float32) Get(lm label.Map) float32 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Float32) From(t label.Label) float32 { + return math.Float32frombits(uint32(t.Unpack64())) +} + +// Float64 represents a key +type Float64 struct { + name string + description string +} + +// NewFloat64 creates a new Key for int64 values. +func NewFloat64(name, description string) *Float64 { + return &Float64{name: name, description: description} +} + +func (k *Float64) Name() string { return k.name } +func (k *Float64) Description() string { return k.description } + +func (k *Float64) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendFloat(buf, k.From(l), 'E', -1, 64)) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Float64) Of(v float64) label.Label { + return label.Of64(k, math.Float64bits(v)) +} + +// Get can be used to get a label for the key from a label.Map. +func (k *Float64) Get(lm label.Map) float64 { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return 0 +} + +// From can be used to get a value from a Label. +func (k *Float64) From(t label.Label) float64 { + return math.Float64frombits(t.Unpack64()) +} + +// String represents a key +type String struct { + name string + description string +} + +// NewString creates a new Key for int64 values. +func NewString(name, description string) *String { + return &String{name: name, description: description} +} + +func (k *String) Name() string { return k.name } +func (k *String) Description() string { return k.description } + +func (k *String) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendQuote(buf, k.From(l))) +} + +// Of creates a new Label with this key and the supplied value. +func (k *String) Of(v string) label.Label { return label.OfString(k, v) } + +// Get can be used to get a label for the key from a label.Map. +func (k *String) Get(lm label.Map) string { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return "" +} + +// From can be used to get a value from a Label. +func (k *String) From(t label.Label) string { return t.UnpackString() } + +// Boolean represents a key +type Boolean struct { + name string + description string +} + +// NewBoolean creates a new Key for bool values. +func NewBoolean(name, description string) *Boolean { + return &Boolean{name: name, description: description} +} + +func (k *Boolean) Name() string { return k.name } +func (k *Boolean) Description() string { return k.description } + +func (k *Boolean) Format(w io.Writer, buf []byte, l label.Label) { + w.Write(strconv.AppendBool(buf, k.From(l))) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Boolean) Of(v bool) label.Label { + if v { + return label.Of64(k, 1) + } + return label.Of64(k, 0) +} + +// Get can be used to get a label for the key from a label.Map. +func (k *Boolean) Get(lm label.Map) bool { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return false +} + +// From can be used to get a value from a Label. +func (k *Boolean) From(t label.Label) bool { return t.Unpack64() > 0 } + +// Error represents a key +type Error struct { + name string + description string +} + +// NewError creates a new Key for int64 values. +func NewError(name, description string) *Error { + return &Error{name: name, description: description} +} + +func (k *Error) Name() string { return k.name } +func (k *Error) Description() string { return k.description } + +func (k *Error) Format(w io.Writer, buf []byte, l label.Label) { + io.WriteString(w, k.From(l).Error()) +} + +// Of creates a new Label with this key and the supplied value. +func (k *Error) Of(v error) label.Label { return label.OfValue(k, v) } + +// Get can be used to get a label for the key from a label.Map. +func (k *Error) Get(lm label.Map) error { + if t := lm.Find(k); t.Valid() { + return k.From(t) + } + return nil +} + +// From can be used to get a value from a Label. +func (k *Error) From(t label.Label) error { + err, _ := t.UnpackValue().(error) + return err +} diff --git a/vendor/golang.org/x/tools/internal/event/keys/standard.go b/vendor/golang.org/x/tools/internal/event/keys/standard.go new file mode 100644 index 0000000000..7e95866592 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/keys/standard.go @@ -0,0 +1,22 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package keys + +var ( + // Msg is a key used to add message strings to label lists. + Msg = NewString("message", "a readable message") + // Label is a key used to indicate an event adds labels to the context. + Label = NewTag("label", "a label context marker") + // Start is used for things like traces that have a name. + Start = NewString("start", "span start") + // Metric is a key used to indicate an event records metrics. + End = NewTag("end", "a span end marker") + // Metric is a key used to indicate an event records metrics. + Detach = NewTag("detach", "a span detach marker") + // Err is a key used to add error values to label lists. + Err = NewError("error", "an error that occurred") + // Metric is a key used to indicate an event records metrics. + Metric = NewTag("metric", "a metric event marker") +) diff --git a/vendor/golang.org/x/tools/internal/event/label/label.go b/vendor/golang.org/x/tools/internal/event/label/label.go new file mode 100644 index 0000000000..0f526e1f9a --- /dev/null +++ b/vendor/golang.org/x/tools/internal/event/label/label.go @@ -0,0 +1,215 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package label + +import ( + "fmt" + "io" + "reflect" + "unsafe" +) + +// Key is used as the identity of a Label. +// Keys are intended to be compared by pointer only, the name should be unique +// for communicating with external systems, but it is not required or enforced. +type Key interface { + // Name returns the key name. + Name() string + // Description returns a string that can be used to describe the value. + Description() string + + // Format is used in formatting to append the value of the label to the + // supplied buffer. + // The formatter may use the supplied buf as a scratch area to avoid + // allocations. + Format(w io.Writer, buf []byte, l Label) +} + +// Label holds a key and value pair. +// It is normally used when passing around lists of labels. +type Label struct { + key Key + packed uint64 + untyped interface{} +} + +// Map is the interface to a collection of Labels indexed by key. +type Map interface { + // Find returns the label that matches the supplied key. + Find(key Key) Label +} + +// List is the interface to something that provides an iterable +// list of labels. +// Iteration should start from 0 and continue until Valid returns false. +type List interface { + // Valid returns true if the index is within range for the list. + // It does not imply the label at that index will itself be valid. + Valid(index int) bool + // Label returns the label at the given index. + Label(index int) Label +} + +// list implements LabelList for a list of Labels. +type list struct { + labels []Label +} + +// filter wraps a LabelList filtering out specific labels. +type filter struct { + keys []Key + underlying List +} + +// listMap implements LabelMap for a simple list of labels. +type listMap struct { + labels []Label +} + +// mapChain implements LabelMap for a list of underlying LabelMap. +type mapChain struct { + maps []Map +} + +// OfValue creates a new label from the key and value. +// This method is for implementing new key types, label creation should +// normally be done with the Of method of the key. +func OfValue(k Key, value interface{}) Label { return Label{key: k, untyped: value} } + +// UnpackValue assumes the label was built using LabelOfValue and returns the value +// that was passed to that constructor. +// This method is for implementing new key types, for type safety normal +// access should be done with the From method of the key. +func (t Label) UnpackValue() interface{} { return t.untyped } + +// Of64 creates a new label from a key and a uint64. This is often +// used for non uint64 values that can be packed into a uint64. +// This method is for implementing new key types, label creation should +// normally be done with the Of method of the key. +func Of64(k Key, v uint64) Label { return Label{key: k, packed: v} } + +// Unpack64 assumes the label was built using LabelOf64 and returns the value that +// was passed to that constructor. +// This method is for implementing new key types, for type safety normal +// access should be done with the From method of the key. +func (t Label) Unpack64() uint64 { return t.packed } + +type stringptr unsafe.Pointer + +// OfString creates a new label from a key and a string. +// This method is for implementing new key types, label creation should +// normally be done with the Of method of the key. +func OfString(k Key, v string) Label { + hdr := (*reflect.StringHeader)(unsafe.Pointer(&v)) + return Label{ + key: k, + packed: uint64(hdr.Len), + untyped: stringptr(hdr.Data), + } +} + +// UnpackString assumes the label was built using LabelOfString and returns the +// value that was passed to that constructor. +// This method is for implementing new key types, for type safety normal +// access should be done with the From method of the key. +func (t Label) UnpackString() string { + var v string + hdr := (*reflect.StringHeader)(unsafe.Pointer(&v)) + hdr.Data = uintptr(t.untyped.(stringptr)) + hdr.Len = int(t.packed) + return v +} + +// Valid returns true if the Label is a valid one (it has a key). +func (t Label) Valid() bool { return t.key != nil } + +// Key returns the key of this Label. +func (t Label) Key() Key { return t.key } + +// Format is used for debug printing of labels. +func (t Label) Format(f fmt.State, r rune) { + if !t.Valid() { + io.WriteString(f, `nil`) + return + } + io.WriteString(f, t.Key().Name()) + io.WriteString(f, "=") + var buf [128]byte + t.Key().Format(f, buf[:0], t) +} + +func (l *list) Valid(index int) bool { + return index >= 0 && index < len(l.labels) +} + +func (l *list) Label(index int) Label { + return l.labels[index] +} + +func (f *filter) Valid(index int) bool { + return f.underlying.Valid(index) +} + +func (f *filter) Label(index int) Label { + l := f.underlying.Label(index) + for _, f := range f.keys { + if l.Key() == f { + return Label{} + } + } + return l +} + +func (lm listMap) Find(key Key) Label { + for _, l := range lm.labels { + if l.Key() == key { + return l + } + } + return Label{} +} + +func (c mapChain) Find(key Key) Label { + for _, src := range c.maps { + l := src.Find(key) + if l.Valid() { + return l + } + } + return Label{} +} + +var emptyList = &list{} + +func NewList(labels ...Label) List { + if len(labels) == 0 { + return emptyList + } + return &list{labels: labels} +} + +func Filter(l List, keys ...Key) List { + if len(keys) == 0 { + return l + } + return &filter{keys: keys, underlying: l} +} + +func NewMap(labels ...Label) Map { + return listMap{labels: labels} +} + +func MergeMaps(srcs ...Map) Map { + var nonNil []Map + for _, src := range srcs { + if src != nil { + nonNil = append(nonNil, src) + } + } + if len(nonNil) == 1 { + return nonNil[0] + } + return mapChain{maps: nonNil} +} diff --git a/vendor/golang.org/x/tools/internal/gocommand/invoke.go b/vendor/golang.org/x/tools/internal/gocommand/invoke.go new file mode 100644 index 0000000000..67256dc397 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gocommand/invoke.go @@ -0,0 +1,283 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package gocommand is a helper for calling the go command. +package gocommand + +import ( + "bytes" + "context" + "fmt" + "io" + "os" + "regexp" + "strconv" + "strings" + "sync" + "time" + + exec "golang.org/x/sys/execabs" + + "golang.org/x/tools/internal/event" +) + +// An Runner will run go command invocations and serialize +// them if it sees a concurrency error. +type Runner struct { + // once guards the runner initialization. + once sync.Once + + // inFlight tracks available workers. + inFlight chan struct{} + + // serialized guards the ability to run a go command serially, + // to avoid deadlocks when claiming workers. + serialized chan struct{} +} + +const maxInFlight = 10 + +func (runner *Runner) initialize() { + runner.once.Do(func() { + runner.inFlight = make(chan struct{}, maxInFlight) + runner.serialized = make(chan struct{}, 1) + }) +} + +// 1.13: go: updates to go.mod needed, but contents have changed +// 1.14: go: updating go.mod: existing contents have changed since last read +var modConcurrencyError = regexp.MustCompile(`go:.*go.mod.*contents have changed`) + +// Run is a convenience wrapper around RunRaw. +// It returns only stdout and a "friendly" error. +func (runner *Runner) Run(ctx context.Context, inv Invocation) (*bytes.Buffer, error) { + stdout, _, friendly, _ := runner.RunRaw(ctx, inv) + return stdout, friendly +} + +// RunPiped runs the invocation serially, always waiting for any concurrent +// invocations to complete first. +func (runner *Runner) RunPiped(ctx context.Context, inv Invocation, stdout, stderr io.Writer) error { + _, err := runner.runPiped(ctx, inv, stdout, stderr) + return err +} + +// RunRaw runs the invocation, serializing requests only if they fight over +// go.mod changes. +func (runner *Runner) RunRaw(ctx context.Context, inv Invocation) (*bytes.Buffer, *bytes.Buffer, error, error) { + // Make sure the runner is always initialized. + runner.initialize() + + // First, try to run the go command concurrently. + stdout, stderr, friendlyErr, err := runner.runConcurrent(ctx, inv) + + // If we encounter a load concurrency error, we need to retry serially. + if friendlyErr == nil || !modConcurrencyError.MatchString(friendlyErr.Error()) { + return stdout, stderr, friendlyErr, err + } + event.Error(ctx, "Load concurrency error, will retry serially", err) + + // Run serially by calling runPiped. + stdout.Reset() + stderr.Reset() + friendlyErr, err = runner.runPiped(ctx, inv, stdout, stderr) + return stdout, stderr, friendlyErr, err +} + +func (runner *Runner) runConcurrent(ctx context.Context, inv Invocation) (*bytes.Buffer, *bytes.Buffer, error, error) { + // Wait for 1 worker to become available. + select { + case <-ctx.Done(): + return nil, nil, nil, ctx.Err() + case runner.inFlight <- struct{}{}: + defer func() { <-runner.inFlight }() + } + + stdout, stderr := &bytes.Buffer{}, &bytes.Buffer{} + friendlyErr, err := inv.runWithFriendlyError(ctx, stdout, stderr) + return stdout, stderr, friendlyErr, err +} + +func (runner *Runner) runPiped(ctx context.Context, inv Invocation, stdout, stderr io.Writer) (error, error) { + // Make sure the runner is always initialized. + runner.initialize() + + // Acquire the serialization lock. This avoids deadlocks between two + // runPiped commands. + select { + case <-ctx.Done(): + return nil, ctx.Err() + case runner.serialized <- struct{}{}: + defer func() { <-runner.serialized }() + } + + // Wait for all in-progress go commands to return before proceeding, + // to avoid load concurrency errors. + for i := 0; i < maxInFlight; i++ { + select { + case <-ctx.Done(): + return nil, ctx.Err() + case runner.inFlight <- struct{}{}: + // Make sure we always "return" any workers we took. + defer func() { <-runner.inFlight }() + } + } + + return inv.runWithFriendlyError(ctx, stdout, stderr) +} + +// An Invocation represents a call to the go command. +type Invocation struct { + Verb string + Args []string + BuildFlags []string + + // If ModFlag is set, the go command is invoked with -mod=ModFlag. + ModFlag string + + // If ModFile is set, the go command is invoked with -modfile=ModFile. + ModFile string + + // If Overlay is set, the go command is invoked with -overlay=Overlay. + Overlay string + + // If CleanEnv is set, the invocation will run only with the environment + // in Env, not starting with os.Environ. + CleanEnv bool + Env []string + WorkingDir string + Logf func(format string, args ...interface{}) +} + +func (i *Invocation) runWithFriendlyError(ctx context.Context, stdout, stderr io.Writer) (friendlyError error, rawError error) { + rawError = i.run(ctx, stdout, stderr) + if rawError != nil { + friendlyError = rawError + // Check for 'go' executable not being found. + if ee, ok := rawError.(*exec.Error); ok && ee.Err == exec.ErrNotFound { + friendlyError = fmt.Errorf("go command required, not found: %v", ee) + } + if ctx.Err() != nil { + friendlyError = ctx.Err() + } + friendlyError = fmt.Errorf("err: %v: stderr: %s", friendlyError, stderr) + } + return +} + +func (i *Invocation) run(ctx context.Context, stdout, stderr io.Writer) error { + log := i.Logf + if log == nil { + log = func(string, ...interface{}) {} + } + + goArgs := []string{i.Verb} + + appendModFile := func() { + if i.ModFile != "" { + goArgs = append(goArgs, "-modfile="+i.ModFile) + } + } + appendModFlag := func() { + if i.ModFlag != "" { + goArgs = append(goArgs, "-mod="+i.ModFlag) + } + } + appendOverlayFlag := func() { + if i.Overlay != "" { + goArgs = append(goArgs, "-overlay="+i.Overlay) + } + } + + switch i.Verb { + case "env", "version": + goArgs = append(goArgs, i.Args...) + case "mod": + // mod needs the sub-verb before flags. + goArgs = append(goArgs, i.Args[0]) + appendModFile() + goArgs = append(goArgs, i.Args[1:]...) + case "get": + goArgs = append(goArgs, i.BuildFlags...) + appendModFile() + goArgs = append(goArgs, i.Args...) + + default: // notably list and build. + goArgs = append(goArgs, i.BuildFlags...) + appendModFile() + appendModFlag() + appendOverlayFlag() + goArgs = append(goArgs, i.Args...) + } + cmd := exec.Command("go", goArgs...) + cmd.Stdout = stdout + cmd.Stderr = stderr + // On darwin the cwd gets resolved to the real path, which breaks anything that + // expects the working directory to keep the original path, including the + // go command when dealing with modules. + // The Go stdlib has a special feature where if the cwd and the PWD are the + // same node then it trusts the PWD, so by setting it in the env for the child + // process we fix up all the paths returned by the go command. + if !i.CleanEnv { + cmd.Env = os.Environ() + } + cmd.Env = append(cmd.Env, i.Env...) + if i.WorkingDir != "" { + cmd.Env = append(cmd.Env, "PWD="+i.WorkingDir) + cmd.Dir = i.WorkingDir + } + defer func(start time.Time) { log("%s for %v", time.Since(start), cmdDebugStr(cmd)) }(time.Now()) + + return runCmdContext(ctx, cmd) +} + +// runCmdContext is like exec.CommandContext except it sends os.Interrupt +// before os.Kill. +func runCmdContext(ctx context.Context, cmd *exec.Cmd) error { + if err := cmd.Start(); err != nil { + return err + } + resChan := make(chan error, 1) + go func() { + resChan <- cmd.Wait() + }() + + select { + case err := <-resChan: + return err + case <-ctx.Done(): + } + // Cancelled. Interrupt and see if it ends voluntarily. + cmd.Process.Signal(os.Interrupt) + select { + case err := <-resChan: + return err + case <-time.After(time.Second): + } + // Didn't shut down in response to interrupt. Kill it hard. + cmd.Process.Kill() + return <-resChan +} + +func cmdDebugStr(cmd *exec.Cmd) string { + env := make(map[string]string) + for _, kv := range cmd.Env { + split := strings.SplitN(kv, "=", 2) + if len(split) == 2 { + k, v := split[0], split[1] + env[k] = v + } + } + + var args []string + for _, arg := range cmd.Args { + quoted := strconv.Quote(arg) + if quoted[1:len(quoted)-1] != arg || strings.Contains(arg, " ") { + args = append(args, quoted) + } else { + args = append(args, arg) + } + } + return fmt.Sprintf("GOROOT=%v GOPATH=%v GO111MODULE=%v GOPROXY=%v PWD=%v %v", env["GOROOT"], env["GOPATH"], env["GO111MODULE"], env["GOPROXY"], env["PWD"], strings.Join(args, " ")) +} diff --git a/vendor/golang.org/x/tools/internal/gocommand/vendor.go b/vendor/golang.org/x/tools/internal/gocommand/vendor.go new file mode 100644 index 0000000000..2d3d408c0b --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gocommand/vendor.go @@ -0,0 +1,109 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package gocommand + +import ( + "bytes" + "context" + "fmt" + "os" + "path/filepath" + "regexp" + "strings" + "time" + + "golang.org/x/mod/semver" +) + +// ModuleJSON holds information about a module. +type ModuleJSON struct { + Path string // module path + Version string // module version + Versions []string // available module versions (with -versions) + Replace *ModuleJSON // replaced by this module + Time *time.Time // time version was created + Update *ModuleJSON // available update, if any (with -u) + Main bool // is this the main module? + Indirect bool // is this module only an indirect dependency of main module? + Dir string // directory holding files for this module, if any + GoMod string // path to go.mod file used when loading this module, if any + GoVersion string // go version used in module +} + +var modFlagRegexp = regexp.MustCompile(`-mod[ =](\w+)`) + +// VendorEnabled reports whether vendoring is enabled. It takes a *Runner to execute Go commands +// with the supplied context.Context and Invocation. The Invocation can contain pre-defined fields, +// of which only Verb and Args are modified to run the appropriate Go command. +// Inspired by setDefaultBuildMod in modload/init.go +func VendorEnabled(ctx context.Context, inv Invocation, r *Runner) (bool, *ModuleJSON, error) { + mainMod, go114, err := getMainModuleAnd114(ctx, inv, r) + if err != nil { + return false, nil, err + } + + // We check the GOFLAGS to see if there is anything overridden or not. + inv.Verb = "env" + inv.Args = []string{"GOFLAGS"} + stdout, err := r.Run(ctx, inv) + if err != nil { + return false, nil, err + } + goflags := string(bytes.TrimSpace(stdout.Bytes())) + matches := modFlagRegexp.FindStringSubmatch(goflags) + var modFlag string + if len(matches) != 0 { + modFlag = matches[1] + } + // Don't override an explicit '-mod=' argument. + if modFlag == "vendor" { + return true, mainMod, nil + } else if modFlag != "" { + return false, nil, nil + } + if mainMod == nil || !go114 { + return false, nil, nil + } + // Check 1.14's automatic vendor mode. + if fi, err := os.Stat(filepath.Join(mainMod.Dir, "vendor")); err == nil && fi.IsDir() { + if mainMod.GoVersion != "" && semver.Compare("v"+mainMod.GoVersion, "v1.14") >= 0 { + // The Go version is at least 1.14, and a vendor directory exists. + // Set -mod=vendor by default. + return true, mainMod, nil + } + } + return false, nil, nil +} + +// getMainModuleAnd114 gets one of the main modules' information and whether the +// go command in use is 1.14+. This is the information needed to figure out +// if vendoring should be enabled. +func getMainModuleAnd114(ctx context.Context, inv Invocation, r *Runner) (*ModuleJSON, bool, error) { + const format = `{{.Path}} +{{.Dir}} +{{.GoMod}} +{{.GoVersion}} +{{range context.ReleaseTags}}{{if eq . "go1.14"}}{{.}}{{end}}{{end}} +` + inv.Verb = "list" + inv.Args = []string{"-m", "-f", format} + stdout, err := r.Run(ctx, inv) + if err != nil { + return nil, false, err + } + + lines := strings.Split(stdout.String(), "\n") + if len(lines) < 5 { + return nil, false, fmt.Errorf("unexpected stdout: %q", stdout.String()) + } + mod := &ModuleJSON{ + Path: lines[0], + Dir: lines[1], + GoMod: lines[2], + GoVersion: lines[3], + Main: true, + } + return mod, lines[4] == "go1.14", nil +} diff --git a/vendor/golang.org/x/tools/internal/gocommand/version.go b/vendor/golang.org/x/tools/internal/gocommand/version.go new file mode 100644 index 0000000000..7130436802 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/gocommand/version.go @@ -0,0 +1,51 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package gocommand + +import ( + "context" + "fmt" + "strings" +) + +// GoVersion checks the go version by running "go list" with modules off. +// It returns the X in Go 1.X. +func GoVersion(ctx context.Context, inv Invocation, r *Runner) (int, error) { + inv.Verb = "list" + inv.Args = []string{"-e", "-f", `{{context.ReleaseTags}}`, `--`, `unsafe`} + inv.Env = append(append([]string{}, inv.Env...), "GO111MODULE=off") + // Unset any unneeded flags, and remove them from BuildFlags, if they're + // present. + inv.ModFile = "" + inv.ModFlag = "" + var buildFlags []string + for _, flag := range inv.BuildFlags { + // Flags can be prefixed by one or two dashes. + f := strings.TrimPrefix(strings.TrimPrefix(flag, "-"), "-") + if strings.HasPrefix(f, "mod=") || strings.HasPrefix(f, "modfile=") { + continue + } + buildFlags = append(buildFlags, flag) + } + inv.BuildFlags = buildFlags + stdoutBytes, err := r.Run(ctx, inv) + if err != nil { + return 0, err + } + stdout := stdoutBytes.String() + if len(stdout) < 3 { + return 0, fmt.Errorf("bad ReleaseTags output: %q", stdout) + } + // Split up "[go1.1 go1.15]" + tags := strings.Fields(stdout[1 : len(stdout)-2]) + for i := len(tags) - 1; i >= 0; i-- { + var version int + if _, err := fmt.Sscanf(tags[i], "go1.%d", &version); err != nil { + continue + } + return version, nil + } + return 0, fmt.Errorf("no parseable ReleaseTags in %v", tags) +} diff --git a/vendor/golang.org/x/tools/internal/packagesinternal/packages.go b/vendor/golang.org/x/tools/internal/packagesinternal/packages.go new file mode 100644 index 0000000000..d9950b1f0b --- /dev/null +++ b/vendor/golang.org/x/tools/internal/packagesinternal/packages.go @@ -0,0 +1,30 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package packagesinternal exposes internal-only fields from go/packages. +package packagesinternal + +import ( + "golang.org/x/tools/internal/gocommand" +) + +var GetForTest = func(p interface{}) string { return "" } +var GetDepsErrors = func(p interface{}) []*PackageError { return nil } + +type PackageError struct { + ImportStack []string // shortest path from package named on command line to this one + Pos string // position of error (if present, file:line:col) + Err string // the error itself +} + +var GetGoCmdRunner = func(config interface{}) *gocommand.Runner { return nil } + +var SetGoCmdRunner = func(config interface{}, runner *gocommand.Runner) {} + +var TypecheckCgo int +var DepsErrors int // must be set as a LoadMode to call GetDepsErrors +var ForTest int // must be set as a LoadMode to call GetForTest + +var SetModFlag = func(config interface{}, value string) {} +var SetModFile = func(config interface{}, value string) {} diff --git a/vendor/golang.org/x/tools/internal/typeparams/common.go b/vendor/golang.org/x/tools/internal/typeparams/common.go new file mode 100644 index 0000000000..25a1426d30 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/common.go @@ -0,0 +1,179 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package typeparams contains common utilities for writing tools that interact +// with generic Go code, as introduced with Go 1.18. +// +// Many of the types and functions in this package are proxies for the new APIs +// introduced in the standard library with Go 1.18. For example, the +// typeparams.Union type is an alias for go/types.Union, and the ForTypeSpec +// function returns the value of the go/ast.TypeSpec.TypeParams field. At Go +// versions older than 1.18 these helpers are implemented as stubs, allowing +// users of this package to write code that handles generic constructs inline, +// even if the Go version being used to compile does not support generics. +// +// Additionally, this package contains common utilities for working with the +// new generic constructs, to supplement the standard library APIs. Notably, +// the StructuralTerms API computes a minimal representation of the structural +// restrictions on a type parameter. +// +// An external version of these APIs is available in the +// golang.org/x/exp/typeparams module. +package typeparams + +import ( + "go/ast" + "go/token" + "go/types" +) + +// UnpackIndexExpr extracts data from AST nodes that represent index +// expressions. +// +// For an ast.IndexExpr, the resulting indices slice will contain exactly one +// index expression. For an ast.IndexListExpr (go1.18+), it may have a variable +// number of index expressions. +// +// For nodes that don't represent index expressions, the first return value of +// UnpackIndexExpr will be nil. +func UnpackIndexExpr(n ast.Node) (x ast.Expr, lbrack token.Pos, indices []ast.Expr, rbrack token.Pos) { + switch e := n.(type) { + case *ast.IndexExpr: + return e.X, e.Lbrack, []ast.Expr{e.Index}, e.Rbrack + case *IndexListExpr: + return e.X, e.Lbrack, e.Indices, e.Rbrack + } + return nil, token.NoPos, nil, token.NoPos +} + +// PackIndexExpr returns an *ast.IndexExpr or *ast.IndexListExpr, depending on +// the cardinality of indices. Calling PackIndexExpr with len(indices) == 0 +// will panic. +func PackIndexExpr(x ast.Expr, lbrack token.Pos, indices []ast.Expr, rbrack token.Pos) ast.Expr { + switch len(indices) { + case 0: + panic("empty indices") + case 1: + return &ast.IndexExpr{ + X: x, + Lbrack: lbrack, + Index: indices[0], + Rbrack: rbrack, + } + default: + return &IndexListExpr{ + X: x, + Lbrack: lbrack, + Indices: indices, + Rbrack: rbrack, + } + } +} + +// IsTypeParam reports whether t is a type parameter. +func IsTypeParam(t types.Type) bool { + _, ok := t.(*TypeParam) + return ok +} + +// OriginMethod returns the origin method associated with the method fn. +// For methods on a non-generic receiver base type, this is just +// fn. However, for methods with a generic receiver, OriginMethod returns the +// corresponding method in the method set of the origin type. +// +// As a special case, if fn is not a method (has no receiver), OriginMethod +// returns fn. +func OriginMethod(fn *types.Func) *types.Func { + recv := fn.Type().(*types.Signature).Recv() + if recv == nil { + + return fn + } + base := recv.Type() + p, isPtr := base.(*types.Pointer) + if isPtr { + base = p.Elem() + } + named, isNamed := base.(*types.Named) + if !isNamed { + // Receiver is a *types.Interface. + return fn + } + if ForNamed(named).Len() == 0 { + // Receiver base has no type parameters, so we can avoid the lookup below. + return fn + } + orig := NamedTypeOrigin(named) + gfn, _, _ := types.LookupFieldOrMethod(orig, true, fn.Pkg(), fn.Name()) + return gfn.(*types.Func) +} + +// GenericAssignableTo is a generalization of types.AssignableTo that +// implements the following rule for uninstantiated generic types: +// +// If V and T are generic named types, then V is considered assignable to T if, +// for every possible instantation of V[A_1, ..., A_N], the instantiation +// T[A_1, ..., A_N] is valid and V[A_1, ..., A_N] implements T[A_1, ..., A_N]. +// +// If T has structural constraints, they must be satisfied by V. +// +// For example, consider the following type declarations: +// +// type Interface[T any] interface { +// Accept(T) +// } +// +// type Container[T any] struct { +// Element T +// } +// +// func (c Container[T]) Accept(t T) { c.Element = t } +// +// In this case, GenericAssignableTo reports that instantiations of Container +// are assignable to the corresponding instantiation of Interface. +func GenericAssignableTo(ctxt *Context, V, T types.Type) bool { + // If V and T are not both named, or do not have matching non-empty type + // parameter lists, fall back on types.AssignableTo. + + VN, Vnamed := V.(*types.Named) + TN, Tnamed := T.(*types.Named) + if !Vnamed || !Tnamed { + return types.AssignableTo(V, T) + } + + vtparams := ForNamed(VN) + ttparams := ForNamed(TN) + if vtparams.Len() == 0 || vtparams.Len() != ttparams.Len() || NamedTypeArgs(VN).Len() != 0 || NamedTypeArgs(TN).Len() != 0 { + return types.AssignableTo(V, T) + } + + // V and T have the same (non-zero) number of type params. Instantiate both + // with the type parameters of V. This must always succeed for V, and will + // succeed for T if and only if the type set of each type parameter of V is a + // subset of the type set of the corresponding type parameter of T, meaning + // that every instantiation of V corresponds to a valid instantiation of T. + + // Minor optimization: ensure we share a context across the two + // instantiations below. + if ctxt == nil { + ctxt = NewContext() + } + + var targs []types.Type + for i := 0; i < vtparams.Len(); i++ { + targs = append(targs, vtparams.At(i)) + } + + vinst, err := Instantiate(ctxt, V, targs, true) + if err != nil { + panic("type parameters should satisfy their own constraints") + } + + tinst, err := Instantiate(ctxt, T, targs, true) + if err != nil { + return false + } + + return types.AssignableTo(vinst, tinst) +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/coretype.go b/vendor/golang.org/x/tools/internal/typeparams/coretype.go new file mode 100644 index 0000000000..993135ec90 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/coretype.go @@ -0,0 +1,122 @@ +// Copyright 2022 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package typeparams + +import ( + "go/types" +) + +// CoreType returns the core type of T or nil if T does not have a core type. +// +// See https://go.dev/ref/spec#Core_types for the definition of a core type. +func CoreType(T types.Type) types.Type { + U := T.Underlying() + if _, ok := U.(*types.Interface); !ok { + return U // for non-interface types, + } + + terms, err := _NormalTerms(U) + if len(terms) == 0 || err != nil { + // len(terms) -> empty type set of interface. + // err != nil => U is invalid, exceeds complexity bounds, or has an empty type set. + return nil // no core type. + } + + U = terms[0].Type().Underlying() + var identical int // i in [0,identical) => Identical(U, terms[i].Type().Underlying()) + for identical = 1; identical < len(terms); identical++ { + if !types.Identical(U, terms[identical].Type().Underlying()) { + break + } + } + + if identical == len(terms) { + // https://go.dev/ref/spec#Core_types + // "There is a single type U which is the underlying type of all types in the type set of T" + return U + } + ch, ok := U.(*types.Chan) + if !ok { + return nil // no core type as identical < len(terms) and U is not a channel. + } + // https://go.dev/ref/spec#Core_types + // "the type chan E if T contains only bidirectional channels, or the type chan<- E or + // <-chan E depending on the direction of the directional channels present." + for chans := identical; chans < len(terms); chans++ { + curr, ok := terms[chans].Type().Underlying().(*types.Chan) + if !ok { + return nil + } + if !types.Identical(ch.Elem(), curr.Elem()) { + return nil // channel elements are not identical. + } + if ch.Dir() == types.SendRecv { + // ch is bidirectional. We can safely always use curr's direction. + ch = curr + } else if curr.Dir() != types.SendRecv && ch.Dir() != curr.Dir() { + // ch and curr are not bidirectional and not the same direction. + return nil + } + } + return ch +} + +// _NormalTerms returns a slice of terms representing the normalized structural +// type restrictions of a type, if any. +// +// For all types other than *types.TypeParam, *types.Interface, and +// *types.Union, this is just a single term with Tilde() == false and +// Type() == typ. For *types.TypeParam, *types.Interface, and *types.Union, see +// below. +// +// Structural type restrictions of a type parameter are created via +// non-interface types embedded in its constraint interface (directly, or via a +// chain of interface embeddings). For example, in the declaration type +// T[P interface{~int; m()}] int the structural restriction of the type +// parameter P is ~int. +// +// With interface embedding and unions, the specification of structural type +// restrictions may be arbitrarily complex. For example, consider the +// following: +// +// type A interface{ ~string|~[]byte } +// +// type B interface{ int|string } +// +// type C interface { ~string|~int } +// +// type T[P interface{ A|B; C }] int +// +// In this example, the structural type restriction of P is ~string|int: A|B +// expands to ~string|~[]byte|int|string, which reduces to ~string|~[]byte|int, +// which when intersected with C (~string|~int) yields ~string|int. +// +// _NormalTerms computes these expansions and reductions, producing a +// "normalized" form of the embeddings. A structural restriction is normalized +// if it is a single union containing no interface terms, and is minimal in the +// sense that removing any term changes the set of types satisfying the +// constraint. It is left as a proof for the reader that, modulo sorting, there +// is exactly one such normalized form. +// +// Because the minimal representation always takes this form, _NormalTerms +// returns a slice of tilde terms corresponding to the terms of the union in +// the normalized structural restriction. An error is returned if the type is +// invalid, exceeds complexity bounds, or has an empty type set. In the latter +// case, _NormalTerms returns ErrEmptyTypeSet. +// +// _NormalTerms makes no guarantees about the order of terms, except that it +// is deterministic. +func _NormalTerms(typ types.Type) ([]*Term, error) { + switch typ := typ.(type) { + case *TypeParam: + return StructuralTerms(typ) + case *Union: + return UnionTermSet(typ) + case *types.Interface: + return InterfaceTermSet(typ) + default: + return []*Term{NewTerm(false, typ)}, nil + } +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/enabled_go117.go b/vendor/golang.org/x/tools/internal/typeparams/enabled_go117.go new file mode 100644 index 0000000000..18212390e1 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/enabled_go117.go @@ -0,0 +1,12 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.18 +// +build !go1.18 + +package typeparams + +// Enabled reports whether type parameters are enabled in the current build +// environment. +const Enabled = false diff --git a/vendor/golang.org/x/tools/internal/typeparams/enabled_go118.go b/vendor/golang.org/x/tools/internal/typeparams/enabled_go118.go new file mode 100644 index 0000000000..d67148823c --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/enabled_go118.go @@ -0,0 +1,15 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 +// +build go1.18 + +package typeparams + +// Note: this constant is in a separate file as this is the only acceptable +// diff between the <1.18 API of this package and the 1.18 API. + +// Enabled reports whether type parameters are enabled in the current build +// environment. +const Enabled = true diff --git a/vendor/golang.org/x/tools/internal/typeparams/normalize.go b/vendor/golang.org/x/tools/internal/typeparams/normalize.go new file mode 100644 index 0000000000..9c631b6512 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/normalize.go @@ -0,0 +1,218 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package typeparams + +import ( + "errors" + "fmt" + "go/types" + "os" + "strings" +) + +//go:generate go run copytermlist.go + +const debug = false + +var ErrEmptyTypeSet = errors.New("empty type set") + +// StructuralTerms returns a slice of terms representing the normalized +// structural type restrictions of a type parameter, if any. +// +// Structural type restrictions of a type parameter are created via +// non-interface types embedded in its constraint interface (directly, or via a +// chain of interface embeddings). For example, in the declaration +// +// type T[P interface{~int; m()}] int +// +// the structural restriction of the type parameter P is ~int. +// +// With interface embedding and unions, the specification of structural type +// restrictions may be arbitrarily complex. For example, consider the +// following: +// +// type A interface{ ~string|~[]byte } +// +// type B interface{ int|string } +// +// type C interface { ~string|~int } +// +// type T[P interface{ A|B; C }] int +// +// In this example, the structural type restriction of P is ~string|int: A|B +// expands to ~string|~[]byte|int|string, which reduces to ~string|~[]byte|int, +// which when intersected with C (~string|~int) yields ~string|int. +// +// StructuralTerms computes these expansions and reductions, producing a +// "normalized" form of the embeddings. A structural restriction is normalized +// if it is a single union containing no interface terms, and is minimal in the +// sense that removing any term changes the set of types satisfying the +// constraint. It is left as a proof for the reader that, modulo sorting, there +// is exactly one such normalized form. +// +// Because the minimal representation always takes this form, StructuralTerms +// returns a slice of tilde terms corresponding to the terms of the union in +// the normalized structural restriction. An error is returned if the +// constraint interface is invalid, exceeds complexity bounds, or has an empty +// type set. In the latter case, StructuralTerms returns ErrEmptyTypeSet. +// +// StructuralTerms makes no guarantees about the order of terms, except that it +// is deterministic. +func StructuralTerms(tparam *TypeParam) ([]*Term, error) { + constraint := tparam.Constraint() + if constraint == nil { + return nil, fmt.Errorf("%s has nil constraint", tparam) + } + iface, _ := constraint.Underlying().(*types.Interface) + if iface == nil { + return nil, fmt.Errorf("constraint is %T, not *types.Interface", constraint.Underlying()) + } + return InterfaceTermSet(iface) +} + +// InterfaceTermSet computes the normalized terms for a constraint interface, +// returning an error if the term set cannot be computed or is empty. In the +// latter case, the error will be ErrEmptyTypeSet. +// +// See the documentation of StructuralTerms for more information on +// normalization. +func InterfaceTermSet(iface *types.Interface) ([]*Term, error) { + return computeTermSet(iface) +} + +// UnionTermSet computes the normalized terms for a union, returning an error +// if the term set cannot be computed or is empty. In the latter case, the +// error will be ErrEmptyTypeSet. +// +// See the documentation of StructuralTerms for more information on +// normalization. +func UnionTermSet(union *Union) ([]*Term, error) { + return computeTermSet(union) +} + +func computeTermSet(typ types.Type) ([]*Term, error) { + tset, err := computeTermSetInternal(typ, make(map[types.Type]*termSet), 0) + if err != nil { + return nil, err + } + if tset.terms.isEmpty() { + return nil, ErrEmptyTypeSet + } + if tset.terms.isAll() { + return nil, nil + } + var terms []*Term + for _, term := range tset.terms { + terms = append(terms, NewTerm(term.tilde, term.typ)) + } + return terms, nil +} + +// A termSet holds the normalized set of terms for a given type. +// +// The name termSet is intentionally distinct from 'type set': a type set is +// all types that implement a type (and includes method restrictions), whereas +// a term set just represents the structural restrictions on a type. +type termSet struct { + complete bool + terms termlist +} + +func indentf(depth int, format string, args ...interface{}) { + fmt.Fprintf(os.Stderr, strings.Repeat(".", depth)+format+"\n", args...) +} + +func computeTermSetInternal(t types.Type, seen map[types.Type]*termSet, depth int) (res *termSet, err error) { + if t == nil { + panic("nil type") + } + + if debug { + indentf(depth, "%s", t.String()) + defer func() { + if err != nil { + indentf(depth, "=> %s", err) + } else { + indentf(depth, "=> %s", res.terms.String()) + } + }() + } + + const maxTermCount = 100 + if tset, ok := seen[t]; ok { + if !tset.complete { + return nil, fmt.Errorf("cycle detected in the declaration of %s", t) + } + return tset, nil + } + + // Mark the current type as seen to avoid infinite recursion. + tset := new(termSet) + defer func() { + tset.complete = true + }() + seen[t] = tset + + switch u := t.Underlying().(type) { + case *types.Interface: + // The term set of an interface is the intersection of the term sets of its + // embedded types. + tset.terms = allTermlist + for i := 0; i < u.NumEmbeddeds(); i++ { + embedded := u.EmbeddedType(i) + if _, ok := embedded.Underlying().(*TypeParam); ok { + return nil, fmt.Errorf("invalid embedded type %T", embedded) + } + tset2, err := computeTermSetInternal(embedded, seen, depth+1) + if err != nil { + return nil, err + } + tset.terms = tset.terms.intersect(tset2.terms) + } + case *Union: + // The term set of a union is the union of term sets of its terms. + tset.terms = nil + for i := 0; i < u.Len(); i++ { + t := u.Term(i) + var terms termlist + switch t.Type().Underlying().(type) { + case *types.Interface: + tset2, err := computeTermSetInternal(t.Type(), seen, depth+1) + if err != nil { + return nil, err + } + terms = tset2.terms + case *TypeParam, *Union: + // A stand-alone type parameter or union is not permitted as union + // term. + return nil, fmt.Errorf("invalid union term %T", t) + default: + if t.Type() == types.Typ[types.Invalid] { + continue + } + terms = termlist{{t.Tilde(), t.Type()}} + } + tset.terms = tset.terms.union(terms) + if len(tset.terms) > maxTermCount { + return nil, fmt.Errorf("exceeded max term count %d", maxTermCount) + } + } + case *TypeParam: + panic("unreachable") + default: + // For all other types, the term set is just a single non-tilde term + // holding the type itself. + if u != types.Typ[types.Invalid] { + tset.terms = termlist{{false, t}} + } + } + return tset, nil +} + +// under is a facade for the go/types internal function of the same name. It is +// used by typeterm.go. +func under(t types.Type) types.Type { + return t.Underlying() +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/termlist.go b/vendor/golang.org/x/tools/internal/typeparams/termlist.go new file mode 100644 index 0000000000..933106a23d --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/termlist.go @@ -0,0 +1,163 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Code generated by copytermlist.go DO NOT EDIT. + +package typeparams + +import ( + "bytes" + "go/types" +) + +// A termlist represents the type set represented by the union +// t1 ∪ y2 ∪ ... tn of the type sets of the terms t1 to tn. +// A termlist is in normal form if all terms are disjoint. +// termlist operations don't require the operands to be in +// normal form. +type termlist []*term + +// allTermlist represents the set of all types. +// It is in normal form. +var allTermlist = termlist{new(term)} + +// String prints the termlist exactly (without normalization). +func (xl termlist) String() string { + if len(xl) == 0 { + return "∅" + } + var buf bytes.Buffer + for i, x := range xl { + if i > 0 { + buf.WriteString(" ∪ ") + } + buf.WriteString(x.String()) + } + return buf.String() +} + +// isEmpty reports whether the termlist xl represents the empty set of types. +func (xl termlist) isEmpty() bool { + // If there's a non-nil term, the entire list is not empty. + // If the termlist is in normal form, this requires at most + // one iteration. + for _, x := range xl { + if x != nil { + return false + } + } + return true +} + +// isAll reports whether the termlist xl represents the set of all types. +func (xl termlist) isAll() bool { + // If there's a 𝓤 term, the entire list is 𝓤. + // If the termlist is in normal form, this requires at most + // one iteration. + for _, x := range xl { + if x != nil && x.typ == nil { + return true + } + } + return false +} + +// norm returns the normal form of xl. +func (xl termlist) norm() termlist { + // Quadratic algorithm, but good enough for now. + // TODO(gri) fix asymptotic performance + used := make([]bool, len(xl)) + var rl termlist + for i, xi := range xl { + if xi == nil || used[i] { + continue + } + for j := i + 1; j < len(xl); j++ { + xj := xl[j] + if xj == nil || used[j] { + continue + } + if u1, u2 := xi.union(xj); u2 == nil { + // If we encounter a 𝓤 term, the entire list is 𝓤. + // Exit early. + // (Note that this is not just an optimization; + // if we continue, we may end up with a 𝓤 term + // and other terms and the result would not be + // in normal form.) + if u1.typ == nil { + return allTermlist + } + xi = u1 + used[j] = true // xj is now unioned into xi - ignore it in future iterations + } + } + rl = append(rl, xi) + } + return rl +} + +// union returns the union xl ∪ yl. +func (xl termlist) union(yl termlist) termlist { + return append(xl, yl...).norm() +} + +// intersect returns the intersection xl ∩ yl. +func (xl termlist) intersect(yl termlist) termlist { + if xl.isEmpty() || yl.isEmpty() { + return nil + } + + // Quadratic algorithm, but good enough for now. + // TODO(gri) fix asymptotic performance + var rl termlist + for _, x := range xl { + for _, y := range yl { + if r := x.intersect(y); r != nil { + rl = append(rl, r) + } + } + } + return rl.norm() +} + +// equal reports whether xl and yl represent the same type set. +func (xl termlist) equal(yl termlist) bool { + // TODO(gri) this should be more efficient + return xl.subsetOf(yl) && yl.subsetOf(xl) +} + +// includes reports whether t ∈ xl. +func (xl termlist) includes(t types.Type) bool { + for _, x := range xl { + if x.includes(t) { + return true + } + } + return false +} + +// supersetOf reports whether y ⊆ xl. +func (xl termlist) supersetOf(y *term) bool { + for _, x := range xl { + if y.subsetOf(x) { + return true + } + } + return false +} + +// subsetOf reports whether xl ⊆ yl. +func (xl termlist) subsetOf(yl termlist) bool { + if yl.isEmpty() { + return xl.isEmpty() + } + + // each term x of xl must be a subset of yl + for _, x := range xl { + if !yl.supersetOf(x) { + return false // x is not a subset yl + } + } + return true +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/typeparams_go117.go b/vendor/golang.org/x/tools/internal/typeparams/typeparams_go117.go new file mode 100644 index 0000000000..b4788978ff --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/typeparams_go117.go @@ -0,0 +1,197 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build !go1.18 +// +build !go1.18 + +package typeparams + +import ( + "go/ast" + "go/token" + "go/types" +) + +func unsupported() { + panic("type parameters are unsupported at this go version") +} + +// IndexListExpr is a placeholder type, as type parameters are not supported at +// this Go version. Its methods panic on use. +type IndexListExpr struct { + ast.Expr + X ast.Expr // expression + Lbrack token.Pos // position of "[" + Indices []ast.Expr // index expressions + Rbrack token.Pos // position of "]" +} + +// ForTypeSpec returns an empty field list, as type parameters on not supported +// at this Go version. +func ForTypeSpec(*ast.TypeSpec) *ast.FieldList { + return nil +} + +// ForFuncType returns an empty field list, as type parameters are not +// supported at this Go version. +func ForFuncType(*ast.FuncType) *ast.FieldList { + return nil +} + +// TypeParam is a placeholder type, as type parameters are not supported at +// this Go version. Its methods panic on use. +type TypeParam struct{ types.Type } + +func (*TypeParam) Index() int { unsupported(); return 0 } +func (*TypeParam) Constraint() types.Type { unsupported(); return nil } +func (*TypeParam) Obj() *types.TypeName { unsupported(); return nil } + +// TypeParamList is a placeholder for an empty type parameter list. +type TypeParamList struct{} + +func (*TypeParamList) Len() int { return 0 } +func (*TypeParamList) At(int) *TypeParam { unsupported(); return nil } + +// TypeList is a placeholder for an empty type list. +type TypeList struct{} + +func (*TypeList) Len() int { return 0 } +func (*TypeList) At(int) types.Type { unsupported(); return nil } + +// NewTypeParam is unsupported at this Go version, and panics. +func NewTypeParam(name *types.TypeName, constraint types.Type) *TypeParam { + unsupported() + return nil +} + +// SetTypeParamConstraint is unsupported at this Go version, and panics. +func SetTypeParamConstraint(tparam *TypeParam, constraint types.Type) { + unsupported() +} + +// NewSignatureType calls types.NewSignature, panicking if recvTypeParams or +// typeParams is non-empty. +func NewSignatureType(recv *types.Var, recvTypeParams, typeParams []*TypeParam, params, results *types.Tuple, variadic bool) *types.Signature { + if len(recvTypeParams) != 0 || len(typeParams) != 0 { + panic("signatures cannot have type parameters at this Go version") + } + return types.NewSignature(recv, params, results, variadic) +} + +// ForSignature returns an empty slice. +func ForSignature(*types.Signature) *TypeParamList { + return nil +} + +// RecvTypeParams returns a nil slice. +func RecvTypeParams(sig *types.Signature) *TypeParamList { + return nil +} + +// IsComparable returns false, as no interfaces are type-restricted at this Go +// version. +func IsComparable(*types.Interface) bool { + return false +} + +// IsMethodSet returns true, as no interfaces are type-restricted at this Go +// version. +func IsMethodSet(*types.Interface) bool { + return true +} + +// IsImplicit returns false, as no interfaces are implicit at this Go version. +func IsImplicit(*types.Interface) bool { + return false +} + +// MarkImplicit does nothing, because this Go version does not have implicit +// interfaces. +func MarkImplicit(*types.Interface) {} + +// ForNamed returns an empty type parameter list, as type parameters are not +// supported at this Go version. +func ForNamed(*types.Named) *TypeParamList { + return nil +} + +// SetForNamed panics if tparams is non-empty. +func SetForNamed(_ *types.Named, tparams []*TypeParam) { + if len(tparams) > 0 { + unsupported() + } +} + +// NamedTypeArgs returns nil. +func NamedTypeArgs(*types.Named) *TypeList { + return nil +} + +// NamedTypeOrigin is the identity method at this Go version. +func NamedTypeOrigin(named *types.Named) types.Type { + return named +} + +// Term holds information about a structural type restriction. +type Term struct { + tilde bool + typ types.Type +} + +func (m *Term) Tilde() bool { return m.tilde } +func (m *Term) Type() types.Type { return m.typ } +func (m *Term) String() string { + pre := "" + if m.tilde { + pre = "~" + } + return pre + m.typ.String() +} + +// NewTerm is unsupported at this Go version, and panics. +func NewTerm(tilde bool, typ types.Type) *Term { + return &Term{tilde, typ} +} + +// Union is a placeholder type, as type parameters are not supported at this Go +// version. Its methods panic on use. +type Union struct{ types.Type } + +func (*Union) Len() int { return 0 } +func (*Union) Term(i int) *Term { unsupported(); return nil } + +// NewUnion is unsupported at this Go version, and panics. +func NewUnion(terms []*Term) *Union { + unsupported() + return nil +} + +// InitInstanceInfo is a noop at this Go version. +func InitInstanceInfo(*types.Info) {} + +// Instance is a placeholder type, as type parameters are not supported at this +// Go version. +type Instance struct { + TypeArgs *TypeList + Type types.Type +} + +// GetInstances returns a nil map, as type parameters are not supported at this +// Go version. +func GetInstances(info *types.Info) map[*ast.Ident]Instance { return nil } + +// Context is a placeholder type, as type parameters are not supported at +// this Go version. +type Context struct{} + +// NewContext returns a placeholder Context instance. +func NewContext() *Context { + return &Context{} +} + +// Instantiate is unsupported on this Go version, and panics. +func Instantiate(ctxt *Context, typ types.Type, targs []types.Type, validate bool) (types.Type, error) { + unsupported() + return nil, nil +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/typeparams_go118.go b/vendor/golang.org/x/tools/internal/typeparams/typeparams_go118.go new file mode 100644 index 0000000000..114a36b866 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/typeparams_go118.go @@ -0,0 +1,151 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 +// +build go1.18 + +package typeparams + +import ( + "go/ast" + "go/types" +) + +// IndexListExpr is an alias for ast.IndexListExpr. +type IndexListExpr = ast.IndexListExpr + +// ForTypeSpec returns n.TypeParams. +func ForTypeSpec(n *ast.TypeSpec) *ast.FieldList { + if n == nil { + return nil + } + return n.TypeParams +} + +// ForFuncType returns n.TypeParams. +func ForFuncType(n *ast.FuncType) *ast.FieldList { + if n == nil { + return nil + } + return n.TypeParams +} + +// TypeParam is an alias for types.TypeParam +type TypeParam = types.TypeParam + +// TypeParamList is an alias for types.TypeParamList +type TypeParamList = types.TypeParamList + +// TypeList is an alias for types.TypeList +type TypeList = types.TypeList + +// NewTypeParam calls types.NewTypeParam. +func NewTypeParam(name *types.TypeName, constraint types.Type) *TypeParam { + return types.NewTypeParam(name, constraint) +} + +// SetTypeParamConstraint calls tparam.SetConstraint(constraint). +func SetTypeParamConstraint(tparam *TypeParam, constraint types.Type) { + tparam.SetConstraint(constraint) +} + +// NewSignatureType calls types.NewSignatureType. +func NewSignatureType(recv *types.Var, recvTypeParams, typeParams []*TypeParam, params, results *types.Tuple, variadic bool) *types.Signature { + return types.NewSignatureType(recv, recvTypeParams, typeParams, params, results, variadic) +} + +// ForSignature returns sig.TypeParams() +func ForSignature(sig *types.Signature) *TypeParamList { + return sig.TypeParams() +} + +// RecvTypeParams returns sig.RecvTypeParams(). +func RecvTypeParams(sig *types.Signature) *TypeParamList { + return sig.RecvTypeParams() +} + +// IsComparable calls iface.IsComparable(). +func IsComparable(iface *types.Interface) bool { + return iface.IsComparable() +} + +// IsMethodSet calls iface.IsMethodSet(). +func IsMethodSet(iface *types.Interface) bool { + return iface.IsMethodSet() +} + +// IsImplicit calls iface.IsImplicit(). +func IsImplicit(iface *types.Interface) bool { + return iface.IsImplicit() +} + +// MarkImplicit calls iface.MarkImplicit(). +func MarkImplicit(iface *types.Interface) { + iface.MarkImplicit() +} + +// ForNamed extracts the (possibly empty) type parameter object list from +// named. +func ForNamed(named *types.Named) *TypeParamList { + return named.TypeParams() +} + +// SetForNamed sets the type params tparams on n. Each tparam must be of +// dynamic type *types.TypeParam. +func SetForNamed(n *types.Named, tparams []*TypeParam) { + n.SetTypeParams(tparams) +} + +// NamedTypeArgs returns named.TypeArgs(). +func NamedTypeArgs(named *types.Named) *TypeList { + return named.TypeArgs() +} + +// NamedTypeOrigin returns named.Orig(). +func NamedTypeOrigin(named *types.Named) types.Type { + return named.Origin() +} + +// Term is an alias for types.Term. +type Term = types.Term + +// NewTerm calls types.NewTerm. +func NewTerm(tilde bool, typ types.Type) *Term { + return types.NewTerm(tilde, typ) +} + +// Union is an alias for types.Union +type Union = types.Union + +// NewUnion calls types.NewUnion. +func NewUnion(terms []*Term) *Union { + return types.NewUnion(terms) +} + +// InitInstanceInfo initializes info to record information about type and +// function instances. +func InitInstanceInfo(info *types.Info) { + info.Instances = make(map[*ast.Ident]types.Instance) +} + +// Instance is an alias for types.Instance. +type Instance = types.Instance + +// GetInstances returns info.Instances. +func GetInstances(info *types.Info) map[*ast.Ident]Instance { + return info.Instances +} + +// Context is an alias for types.Context. +type Context = types.Context + +// NewContext calls types.NewContext. +func NewContext() *Context { + return types.NewContext() +} + +// Instantiate calls types.Instantiate. +func Instantiate(ctxt *Context, typ types.Type, targs []types.Type, validate bool) (types.Type, error) { + return types.Instantiate(ctxt, typ, targs, validate) +} diff --git a/vendor/golang.org/x/tools/internal/typeparams/typeterm.go b/vendor/golang.org/x/tools/internal/typeparams/typeterm.go new file mode 100644 index 0000000000..7ddee28d98 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typeparams/typeterm.go @@ -0,0 +1,170 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Code generated by copytermlist.go DO NOT EDIT. + +package typeparams + +import "go/types" + +// A term describes elementary type sets: +// +// ∅: (*term)(nil) == ∅ // set of no types (empty set) +// 𝓤: &term{} == 𝓤 // set of all types (𝓤niverse) +// T: &term{false, T} == {T} // set of type T +// ~t: &term{true, t} == {t' | under(t') == t} // set of types with underlying type t +// +type term struct { + tilde bool // valid if typ != nil + typ types.Type +} + +func (x *term) String() string { + switch { + case x == nil: + return "∅" + case x.typ == nil: + return "𝓤" + case x.tilde: + return "~" + x.typ.String() + default: + return x.typ.String() + } +} + +// equal reports whether x and y represent the same type set. +func (x *term) equal(y *term) bool { + // easy cases + switch { + case x == nil || y == nil: + return x == y + case x.typ == nil || y.typ == nil: + return x.typ == y.typ + } + // ∅ ⊂ x, y ⊂ 𝓤 + + return x.tilde == y.tilde && types.Identical(x.typ, y.typ) +} + +// union returns the union x ∪ y: zero, one, or two non-nil terms. +func (x *term) union(y *term) (_, _ *term) { + // easy cases + switch { + case x == nil && y == nil: + return nil, nil // ∅ ∪ ∅ == ∅ + case x == nil: + return y, nil // ∅ ∪ y == y + case y == nil: + return x, nil // x ∪ ∅ == x + case x.typ == nil: + return x, nil // 𝓤 ∪ y == 𝓤 + case y.typ == nil: + return y, nil // x ∪ 𝓤 == 𝓤 + } + // ∅ ⊂ x, y ⊂ 𝓤 + + if x.disjoint(y) { + return x, y // x ∪ y == (x, y) if x ∩ y == ∅ + } + // x.typ == y.typ + + // ~t ∪ ~t == ~t + // ~t ∪ T == ~t + // T ∪ ~t == ~t + // T ∪ T == T + if x.tilde || !y.tilde { + return x, nil + } + return y, nil +} + +// intersect returns the intersection x ∩ y. +func (x *term) intersect(y *term) *term { + // easy cases + switch { + case x == nil || y == nil: + return nil // ∅ ∩ y == ∅ and ∩ ∅ == ∅ + case x.typ == nil: + return y // 𝓤 ∩ y == y + case y.typ == nil: + return x // x ∩ 𝓤 == x + } + // ∅ ⊂ x, y ⊂ 𝓤 + + if x.disjoint(y) { + return nil // x ∩ y == ∅ if x ∩ y == ∅ + } + // x.typ == y.typ + + // ~t ∩ ~t == ~t + // ~t ∩ T == T + // T ∩ ~t == T + // T ∩ T == T + if !x.tilde || y.tilde { + return x + } + return y +} + +// includes reports whether t ∈ x. +func (x *term) includes(t types.Type) bool { + // easy cases + switch { + case x == nil: + return false // t ∈ ∅ == false + case x.typ == nil: + return true // t ∈ 𝓤 == true + } + // ∅ ⊂ x ⊂ 𝓤 + + u := t + if x.tilde { + u = under(u) + } + return types.Identical(x.typ, u) +} + +// subsetOf reports whether x ⊆ y. +func (x *term) subsetOf(y *term) bool { + // easy cases + switch { + case x == nil: + return true // ∅ ⊆ y == true + case y == nil: + return false // x ⊆ ∅ == false since x != ∅ + case y.typ == nil: + return true // x ⊆ 𝓤 == true + case x.typ == nil: + return false // 𝓤 ⊆ y == false since y != 𝓤 + } + // ∅ ⊂ x, y ⊂ 𝓤 + + if x.disjoint(y) { + return false // x ⊆ y == false if x ∩ y == ∅ + } + // x.typ == y.typ + + // ~t ⊆ ~t == true + // ~t ⊆ T == false + // T ⊆ ~t == true + // T ⊆ T == true + return !x.tilde || y.tilde +} + +// disjoint reports whether x ∩ y == ∅. +// x.typ and y.typ must not be nil. +func (x *term) disjoint(y *term) bool { + if debug && (x.typ == nil || y.typ == nil) { + panic("invalid argument(s)") + } + ux := x.typ + if y.tilde { + ux = under(ux) + } + uy := y.typ + if x.tilde { + uy = under(uy) + } + return !types.Identical(ux, uy) +} diff --git a/vendor/golang.org/x/tools/internal/typesinternal/errorcode.go b/vendor/golang.org/x/tools/internal/typesinternal/errorcode.go new file mode 100644 index 0000000000..d38ee3c27c --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typesinternal/errorcode.go @@ -0,0 +1,1526 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package typesinternal + +//go:generate stringer -type=ErrorCode + +type ErrorCode int + +// This file defines the error codes that can be produced during type-checking. +// Collectively, these codes provide an identifier that may be used to +// implement special handling for certain types of errors. +// +// Error codes should be fine-grained enough that the exact nature of the error +// can be easily determined, but coarse enough that they are not an +// implementation detail of the type checking algorithm. As a rule-of-thumb, +// errors should be considered equivalent if there is a theoretical refactoring +// of the type checker in which they are emitted in exactly one place. For +// example, the type checker emits different error messages for "too many +// arguments" and "too few arguments", but one can imagine an alternative type +// checker where this check instead just emits a single "wrong number of +// arguments", so these errors should have the same code. +// +// Error code names should be as brief as possible while retaining accuracy and +// distinctiveness. In most cases names should start with an adjective +// describing the nature of the error (e.g. "invalid", "unused", "misplaced"), +// and end with a noun identifying the relevant language object. For example, +// "DuplicateDecl" or "InvalidSliceExpr". For brevity, naming follows the +// convention that "bad" implies a problem with syntax, and "invalid" implies a +// problem with types. + +const ( + _ ErrorCode = iota + + // Test is reserved for errors that only apply while in self-test mode. + Test + + /* package names */ + + // BlankPkgName occurs when a package name is the blank identifier "_". + // + // Per the spec: + // "The PackageName must not be the blank identifier." + BlankPkgName + + // MismatchedPkgName occurs when a file's package name doesn't match the + // package name already established by other files. + MismatchedPkgName + + // InvalidPkgUse occurs when a package identifier is used outside of a + // selector expression. + // + // Example: + // import "fmt" + // + // var _ = fmt + InvalidPkgUse + + /* imports */ + + // BadImportPath occurs when an import path is not valid. + BadImportPath + + // BrokenImport occurs when importing a package fails. + // + // Example: + // import "amissingpackage" + BrokenImport + + // ImportCRenamed occurs when the special import "C" is renamed. "C" is a + // pseudo-package, and must not be renamed. + // + // Example: + // import _ "C" + ImportCRenamed + + // UnusedImport occurs when an import is unused. + // + // Example: + // import "fmt" + // + // func main() {} + UnusedImport + + /* initialization */ + + // InvalidInitCycle occurs when an invalid cycle is detected within the + // initialization graph. + // + // Example: + // var x int = f() + // + // func f() int { return x } + InvalidInitCycle + + /* decls */ + + // DuplicateDecl occurs when an identifier is declared multiple times. + // + // Example: + // var x = 1 + // var x = 2 + DuplicateDecl + + // InvalidDeclCycle occurs when a declaration cycle is not valid. + // + // Example: + // import "unsafe" + // + // type T struct { + // a [n]int + // } + // + // var n = unsafe.Sizeof(T{}) + InvalidDeclCycle + + // InvalidTypeCycle occurs when a cycle in type definitions results in a + // type that is not well-defined. + // + // Example: + // import "unsafe" + // + // type T [unsafe.Sizeof(T{})]int + InvalidTypeCycle + + /* decls > const */ + + // InvalidConstInit occurs when a const declaration has a non-constant + // initializer. + // + // Example: + // var x int + // const _ = x + InvalidConstInit + + // InvalidConstVal occurs when a const value cannot be converted to its + // target type. + // + // TODO(findleyr): this error code and example are not very clear. Consider + // removing it. + // + // Example: + // const _ = 1 << "hello" + InvalidConstVal + + // InvalidConstType occurs when the underlying type in a const declaration + // is not a valid constant type. + // + // Example: + // const c *int = 4 + InvalidConstType + + /* decls > var (+ other variable assignment codes) */ + + // UntypedNil occurs when the predeclared (untyped) value nil is used to + // initialize a variable declared without an explicit type. + // + // Example: + // var x = nil + UntypedNil + + // WrongAssignCount occurs when the number of values on the right-hand side + // of an assignment or or initialization expression does not match the number + // of variables on the left-hand side. + // + // Example: + // var x = 1, 2 + WrongAssignCount + + // UnassignableOperand occurs when the left-hand side of an assignment is + // not assignable. + // + // Example: + // func f() { + // const c = 1 + // c = 2 + // } + UnassignableOperand + + // NoNewVar occurs when a short variable declaration (':=') does not declare + // new variables. + // + // Example: + // func f() { + // x := 1 + // x := 2 + // } + NoNewVar + + // MultiValAssignOp occurs when an assignment operation (+=, *=, etc) does + // not have single-valued left-hand or right-hand side. + // + // Per the spec: + // "In assignment operations, both the left- and right-hand expression lists + // must contain exactly one single-valued expression" + // + // Example: + // func f() int { + // x, y := 1, 2 + // x, y += 1 + // return x + y + // } + MultiValAssignOp + + // InvalidIfaceAssign occurs when a value of type T is used as an + // interface, but T does not implement a method of the expected interface. + // + // Example: + // type I interface { + // f() + // } + // + // type T int + // + // var x I = T(1) + InvalidIfaceAssign + + // InvalidChanAssign occurs when a chan assignment is invalid. + // + // Per the spec, a value x is assignable to a channel type T if: + // "x is a bidirectional channel value, T is a channel type, x's type V and + // T have identical element types, and at least one of V or T is not a + // defined type." + // + // Example: + // type T1 chan int + // type T2 chan int + // + // var x T1 + // // Invalid assignment because both types are named + // var _ T2 = x + InvalidChanAssign + + // IncompatibleAssign occurs when the type of the right-hand side expression + // in an assignment cannot be assigned to the type of the variable being + // assigned. + // + // Example: + // var x []int + // var _ int = x + IncompatibleAssign + + // UnaddressableFieldAssign occurs when trying to assign to a struct field + // in a map value. + // + // Example: + // func f() { + // m := make(map[string]struct{i int}) + // m["foo"].i = 42 + // } + UnaddressableFieldAssign + + /* decls > type (+ other type expression codes) */ + + // NotAType occurs when the identifier used as the underlying type in a type + // declaration or the right-hand side of a type alias does not denote a type. + // + // Example: + // var S = 2 + // + // type T S + NotAType + + // InvalidArrayLen occurs when an array length is not a constant value. + // + // Example: + // var n = 3 + // var _ = [n]int{} + InvalidArrayLen + + // BlankIfaceMethod occurs when a method name is '_'. + // + // Per the spec: + // "The name of each explicitly specified method must be unique and not + // blank." + // + // Example: + // type T interface { + // _(int) + // } + BlankIfaceMethod + + // IncomparableMapKey occurs when a map key type does not support the == and + // != operators. + // + // Per the spec: + // "The comparison operators == and != must be fully defined for operands of + // the key type; thus the key type must not be a function, map, or slice." + // + // Example: + // var x map[T]int + // + // type T []int + IncomparableMapKey + + // InvalidIfaceEmbed occurs when a non-interface type is embedded in an + // interface. + // + // Example: + // type T struct {} + // + // func (T) m() + // + // type I interface { + // T + // } + InvalidIfaceEmbed + + // InvalidPtrEmbed occurs when an embedded field is of the pointer form *T, + // and T itself is itself a pointer, an unsafe.Pointer, or an interface. + // + // Per the spec: + // "An embedded field must be specified as a type name T or as a pointer to + // a non-interface type name *T, and T itself may not be a pointer type." + // + // Example: + // type T *int + // + // type S struct { + // *T + // } + InvalidPtrEmbed + + /* decls > func and method */ + + // BadRecv occurs when a method declaration does not have exactly one + // receiver parameter. + // + // Example: + // func () _() {} + BadRecv + + // InvalidRecv occurs when a receiver type expression is not of the form T + // or *T, or T is a pointer type. + // + // Example: + // type T struct {} + // + // func (**T) m() {} + InvalidRecv + + // DuplicateFieldAndMethod occurs when an identifier appears as both a field + // and method name. + // + // Example: + // type T struct { + // m int + // } + // + // func (T) m() {} + DuplicateFieldAndMethod + + // DuplicateMethod occurs when two methods on the same receiver type have + // the same name. + // + // Example: + // type T struct {} + // func (T) m() {} + // func (T) m(i int) int { return i } + DuplicateMethod + + /* decls > special */ + + // InvalidBlank occurs when a blank identifier is used as a value or type. + // + // Per the spec: + // "The blank identifier may appear as an operand only on the left-hand side + // of an assignment." + // + // Example: + // var x = _ + InvalidBlank + + // InvalidIota occurs when the predeclared identifier iota is used outside + // of a constant declaration. + // + // Example: + // var x = iota + InvalidIota + + // MissingInitBody occurs when an init function is missing its body. + // + // Example: + // func init() + MissingInitBody + + // InvalidInitSig occurs when an init function declares parameters or + // results. + // + // Example: + // func init() int { return 1 } + InvalidInitSig + + // InvalidInitDecl occurs when init is declared as anything other than a + // function. + // + // Example: + // var init = 1 + InvalidInitDecl + + // InvalidMainDecl occurs when main is declared as anything other than a + // function, in a main package. + InvalidMainDecl + + /* exprs */ + + // TooManyValues occurs when a function returns too many values for the + // expression context in which it is used. + // + // Example: + // func ReturnTwo() (int, int) { + // return 1, 2 + // } + // + // var x = ReturnTwo() + TooManyValues + + // NotAnExpr occurs when a type expression is used where a value expression + // is expected. + // + // Example: + // type T struct {} + // + // func f() { + // T + // } + NotAnExpr + + /* exprs > const */ + + // TruncatedFloat occurs when a float constant is truncated to an integer + // value. + // + // Example: + // var _ int = 98.6 + TruncatedFloat + + // NumericOverflow occurs when a numeric constant overflows its target type. + // + // Example: + // var x int8 = 1000 + NumericOverflow + + /* exprs > operation */ + + // UndefinedOp occurs when an operator is not defined for the type(s) used + // in an operation. + // + // Example: + // var c = "a" - "b" + UndefinedOp + + // MismatchedTypes occurs when operand types are incompatible in a binary + // operation. + // + // Example: + // var a = "hello" + // var b = 1 + // var c = a - b + MismatchedTypes + + // DivByZero occurs when a division operation is provable at compile + // time to be a division by zero. + // + // Example: + // const divisor = 0 + // var x int = 1/divisor + DivByZero + + // NonNumericIncDec occurs when an increment or decrement operator is + // applied to a non-numeric value. + // + // Example: + // func f() { + // var c = "c" + // c++ + // } + NonNumericIncDec + + /* exprs > ptr */ + + // UnaddressableOperand occurs when the & operator is applied to an + // unaddressable expression. + // + // Example: + // var x = &1 + UnaddressableOperand + + // InvalidIndirection occurs when a non-pointer value is indirected via the + // '*' operator. + // + // Example: + // var x int + // var y = *x + InvalidIndirection + + /* exprs > [] */ + + // NonIndexableOperand occurs when an index operation is applied to a value + // that cannot be indexed. + // + // Example: + // var x = 1 + // var y = x[1] + NonIndexableOperand + + // InvalidIndex occurs when an index argument is not of integer type, + // negative, or out-of-bounds. + // + // Example: + // var s = [...]int{1,2,3} + // var x = s[5] + // + // Example: + // var s = []int{1,2,3} + // var _ = s[-1] + // + // Example: + // var s = []int{1,2,3} + // var i string + // var _ = s[i] + InvalidIndex + + // SwappedSliceIndices occurs when constant indices in a slice expression + // are decreasing in value. + // + // Example: + // var _ = []int{1,2,3}[2:1] + SwappedSliceIndices + + /* operators > slice */ + + // NonSliceableOperand occurs when a slice operation is applied to a value + // whose type is not sliceable, or is unaddressable. + // + // Example: + // var x = [...]int{1, 2, 3}[:1] + // + // Example: + // var x = 1 + // var y = 1[:1] + NonSliceableOperand + + // InvalidSliceExpr occurs when a three-index slice expression (a[x:y:z]) is + // applied to a string. + // + // Example: + // var s = "hello" + // var x = s[1:2:3] + InvalidSliceExpr + + /* exprs > shift */ + + // InvalidShiftCount occurs when the right-hand side of a shift operation is + // either non-integer, negative, or too large. + // + // Example: + // var ( + // x string + // y int = 1 << x + // ) + InvalidShiftCount + + // InvalidShiftOperand occurs when the shifted operand is not an integer. + // + // Example: + // var s = "hello" + // var x = s << 2 + InvalidShiftOperand + + /* exprs > chan */ + + // InvalidReceive occurs when there is a channel receive from a value that + // is either not a channel, or is a send-only channel. + // + // Example: + // func f() { + // var x = 1 + // <-x + // } + InvalidReceive + + // InvalidSend occurs when there is a channel send to a value that is not a + // channel, or is a receive-only channel. + // + // Example: + // func f() { + // var x = 1 + // x <- "hello!" + // } + InvalidSend + + /* exprs > literal */ + + // DuplicateLitKey occurs when an index is duplicated in a slice, array, or + // map literal. + // + // Example: + // var _ = []int{0:1, 0:2} + // + // Example: + // var _ = map[string]int{"a": 1, "a": 2} + DuplicateLitKey + + // MissingLitKey occurs when a map literal is missing a key expression. + // + // Example: + // var _ = map[string]int{1} + MissingLitKey + + // InvalidLitIndex occurs when the key in a key-value element of a slice or + // array literal is not an integer constant. + // + // Example: + // var i = 0 + // var x = []string{i: "world"} + InvalidLitIndex + + // OversizeArrayLit occurs when an array literal exceeds its length. + // + // Example: + // var _ = [2]int{1,2,3} + OversizeArrayLit + + // MixedStructLit occurs when a struct literal contains a mix of positional + // and named elements. + // + // Example: + // var _ = struct{i, j int}{i: 1, 2} + MixedStructLit + + // InvalidStructLit occurs when a positional struct literal has an incorrect + // number of values. + // + // Example: + // var _ = struct{i, j int}{1,2,3} + InvalidStructLit + + // MissingLitField occurs when a struct literal refers to a field that does + // not exist on the struct type. + // + // Example: + // var _ = struct{i int}{j: 2} + MissingLitField + + // DuplicateLitField occurs when a struct literal contains duplicated + // fields. + // + // Example: + // var _ = struct{i int}{i: 1, i: 2} + DuplicateLitField + + // UnexportedLitField occurs when a positional struct literal implicitly + // assigns an unexported field of an imported type. + UnexportedLitField + + // InvalidLitField occurs when a field name is not a valid identifier. + // + // Example: + // var _ = struct{i int}{1: 1} + InvalidLitField + + // UntypedLit occurs when a composite literal omits a required type + // identifier. + // + // Example: + // type outer struct{ + // inner struct { i int } + // } + // + // var _ = outer{inner: {1}} + UntypedLit + + // InvalidLit occurs when a composite literal expression does not match its + // type. + // + // Example: + // type P *struct{ + // x int + // } + // var _ = P {} + InvalidLit + + /* exprs > selector */ + + // AmbiguousSelector occurs when a selector is ambiguous. + // + // Example: + // type E1 struct { i int } + // type E2 struct { i int } + // type T struct { E1; E2 } + // + // var x T + // var _ = x.i + AmbiguousSelector + + // UndeclaredImportedName occurs when a package-qualified identifier is + // undeclared by the imported package. + // + // Example: + // import "go/types" + // + // var _ = types.NotAnActualIdentifier + UndeclaredImportedName + + // UnexportedName occurs when a selector refers to an unexported identifier + // of an imported package. + // + // Example: + // import "reflect" + // + // type _ reflect.flag + UnexportedName + + // UndeclaredName occurs when an identifier is not declared in the current + // scope. + // + // Example: + // var x T + UndeclaredName + + // MissingFieldOrMethod occurs when a selector references a field or method + // that does not exist. + // + // Example: + // type T struct {} + // + // var x = T{}.f + MissingFieldOrMethod + + /* exprs > ... */ + + // BadDotDotDotSyntax occurs when a "..." occurs in a context where it is + // not valid. + // + // Example: + // var _ = map[int][...]int{0: {}} + BadDotDotDotSyntax + + // NonVariadicDotDotDot occurs when a "..." is used on the final argument to + // a non-variadic function. + // + // Example: + // func printArgs(s []string) { + // for _, a := range s { + // println(a) + // } + // } + // + // func f() { + // s := []string{"a", "b", "c"} + // printArgs(s...) + // } + NonVariadicDotDotDot + + // MisplacedDotDotDot occurs when a "..." is used somewhere other than the + // final argument to a function call. + // + // Example: + // func printArgs(args ...int) { + // for _, a := range args { + // println(a) + // } + // } + // + // func f() { + // a := []int{1,2,3} + // printArgs(0, a...) + // } + MisplacedDotDotDot + + // InvalidDotDotDotOperand occurs when a "..." operator is applied to a + // single-valued operand. + // + // Example: + // func printArgs(args ...int) { + // for _, a := range args { + // println(a) + // } + // } + // + // func f() { + // a := 1 + // printArgs(a...) + // } + // + // Example: + // func args() (int, int) { + // return 1, 2 + // } + // + // func printArgs(args ...int) { + // for _, a := range args { + // println(a) + // } + // } + // + // func g() { + // printArgs(args()...) + // } + InvalidDotDotDotOperand + + // InvalidDotDotDot occurs when a "..." is used in a non-variadic built-in + // function. + // + // Example: + // var s = []int{1, 2, 3} + // var l = len(s...) + InvalidDotDotDot + + /* exprs > built-in */ + + // UncalledBuiltin occurs when a built-in function is used as a + // function-valued expression, instead of being called. + // + // Per the spec: + // "The built-in functions do not have standard Go types, so they can only + // appear in call expressions; they cannot be used as function values." + // + // Example: + // var _ = copy + UncalledBuiltin + + // InvalidAppend occurs when append is called with a first argument that is + // not a slice. + // + // Example: + // var _ = append(1, 2) + InvalidAppend + + // InvalidCap occurs when an argument to the cap built-in function is not of + // supported type. + // + // See https://golang.org/ref/spec#Lengthand_capacity for information on + // which underlying types are supported as arguments to cap and len. + // + // Example: + // var s = 2 + // var x = cap(s) + InvalidCap + + // InvalidClose occurs when close(...) is called with an argument that is + // not of channel type, or that is a receive-only channel. + // + // Example: + // func f() { + // var x int + // close(x) + // } + InvalidClose + + // InvalidCopy occurs when the arguments are not of slice type or do not + // have compatible type. + // + // See https://golang.org/ref/spec#Appendingand_copying_slices for more + // information on the type requirements for the copy built-in. + // + // Example: + // func f() { + // var x []int + // y := []int64{1,2,3} + // copy(x, y) + // } + InvalidCopy + + // InvalidComplex occurs when the complex built-in function is called with + // arguments with incompatible types. + // + // Example: + // var _ = complex(float32(1), float64(2)) + InvalidComplex + + // InvalidDelete occurs when the delete built-in function is called with a + // first argument that is not a map. + // + // Example: + // func f() { + // m := "hello" + // delete(m, "e") + // } + InvalidDelete + + // InvalidImag occurs when the imag built-in function is called with an + // argument that does not have complex type. + // + // Example: + // var _ = imag(int(1)) + InvalidImag + + // InvalidLen occurs when an argument to the len built-in function is not of + // supported type. + // + // See https://golang.org/ref/spec#Lengthand_capacity for information on + // which underlying types are supported as arguments to cap and len. + // + // Example: + // var s = 2 + // var x = len(s) + InvalidLen + + // SwappedMakeArgs occurs when make is called with three arguments, and its + // length argument is larger than its capacity argument. + // + // Example: + // var x = make([]int, 3, 2) + SwappedMakeArgs + + // InvalidMake occurs when make is called with an unsupported type argument. + // + // See https://golang.org/ref/spec#Makingslices_maps_and_channels for + // information on the types that may be created using make. + // + // Example: + // var x = make(int) + InvalidMake + + // InvalidReal occurs when the real built-in function is called with an + // argument that does not have complex type. + // + // Example: + // var _ = real(int(1)) + InvalidReal + + /* exprs > assertion */ + + // InvalidAssert occurs when a type assertion is applied to a + // value that is not of interface type. + // + // Example: + // var x = 1 + // var _ = x.(float64) + InvalidAssert + + // ImpossibleAssert occurs for a type assertion x.(T) when the value x of + // interface cannot have dynamic type T, due to a missing or mismatching + // method on T. + // + // Example: + // type T int + // + // func (t *T) m() int { return int(*t) } + // + // type I interface { m() int } + // + // var x I + // var _ = x.(T) + ImpossibleAssert + + /* exprs > conversion */ + + // InvalidConversion occurs when the argument type cannot be converted to the + // target. + // + // See https://golang.org/ref/spec#Conversions for the rules of + // convertibility. + // + // Example: + // var x float64 + // var _ = string(x) + InvalidConversion + + // InvalidUntypedConversion occurs when an there is no valid implicit + // conversion from an untyped value satisfying the type constraints of the + // context in which it is used. + // + // Example: + // var _ = 1 + "" + InvalidUntypedConversion + + /* offsetof */ + + // BadOffsetofSyntax occurs when unsafe.Offsetof is called with an argument + // that is not a selector expression. + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Offsetof(x) + BadOffsetofSyntax + + // InvalidOffsetof occurs when unsafe.Offsetof is called with a method + // selector, rather than a field selector, or when the field is embedded via + // a pointer. + // + // Per the spec: + // + // "If f is an embedded field, it must be reachable without pointer + // indirections through fields of the struct. " + // + // Example: + // import "unsafe" + // + // type T struct { f int } + // type S struct { *T } + // var s S + // var _ = unsafe.Offsetof(s.f) + // + // Example: + // import "unsafe" + // + // type S struct{} + // + // func (S) m() {} + // + // var s S + // var _ = unsafe.Offsetof(s.m) + InvalidOffsetof + + /* control flow > scope */ + + // UnusedExpr occurs when a side-effect free expression is used as a + // statement. Such a statement has no effect. + // + // Example: + // func f(i int) { + // i*i + // } + UnusedExpr + + // UnusedVar occurs when a variable is declared but unused. + // + // Example: + // func f() { + // x := 1 + // } + UnusedVar + + // MissingReturn occurs when a function with results is missing a return + // statement. + // + // Example: + // func f() int {} + MissingReturn + + // WrongResultCount occurs when a return statement returns an incorrect + // number of values. + // + // Example: + // func ReturnOne() int { + // return 1, 2 + // } + WrongResultCount + + // OutOfScopeResult occurs when the name of a value implicitly returned by + // an empty return statement is shadowed in a nested scope. + // + // Example: + // func factor(n int) (i int) { + // for i := 2; i < n; i++ { + // if n%i == 0 { + // return + // } + // } + // return 0 + // } + OutOfScopeResult + + /* control flow > if */ + + // InvalidCond occurs when an if condition is not a boolean expression. + // + // Example: + // func checkReturn(i int) { + // if i { + // panic("non-zero return") + // } + // } + InvalidCond + + /* control flow > for */ + + // InvalidPostDecl occurs when there is a declaration in a for-loop post + // statement. + // + // Example: + // func f() { + // for i := 0; i < 10; j := 0 {} + // } + InvalidPostDecl + + // InvalidChanRange occurs when a send-only channel used in a range + // expression. + // + // Example: + // func sum(c chan<- int) { + // s := 0 + // for i := range c { + // s += i + // } + // } + InvalidChanRange + + // InvalidIterVar occurs when two iteration variables are used while ranging + // over a channel. + // + // Example: + // func f(c chan int) { + // for k, v := range c { + // println(k, v) + // } + // } + InvalidIterVar + + // InvalidRangeExpr occurs when the type of a range expression is not array, + // slice, string, map, or channel. + // + // Example: + // func f(i int) { + // for j := range i { + // println(j) + // } + // } + InvalidRangeExpr + + /* control flow > switch */ + + // MisplacedBreak occurs when a break statement is not within a for, switch, + // or select statement of the innermost function definition. + // + // Example: + // func f() { + // break + // } + MisplacedBreak + + // MisplacedContinue occurs when a continue statement is not within a for + // loop of the innermost function definition. + // + // Example: + // func sumeven(n int) int { + // proceed := func() { + // continue + // } + // sum := 0 + // for i := 1; i <= n; i++ { + // if i % 2 != 0 { + // proceed() + // } + // sum += i + // } + // return sum + // } + MisplacedContinue + + // MisplacedFallthrough occurs when a fallthrough statement is not within an + // expression switch. + // + // Example: + // func typename(i interface{}) string { + // switch i.(type) { + // case int64: + // fallthrough + // case int: + // return "int" + // } + // return "unsupported" + // } + MisplacedFallthrough + + // DuplicateCase occurs when a type or expression switch has duplicate + // cases. + // + // Example: + // func printInt(i int) { + // switch i { + // case 1: + // println("one") + // case 1: + // println("One") + // } + // } + DuplicateCase + + // DuplicateDefault occurs when a type or expression switch has multiple + // default clauses. + // + // Example: + // func printInt(i int) { + // switch i { + // case 1: + // println("one") + // default: + // println("One") + // default: + // println("1") + // } + // } + DuplicateDefault + + // BadTypeKeyword occurs when a .(type) expression is used anywhere other + // than a type switch. + // + // Example: + // type I interface { + // m() + // } + // var t I + // var _ = t.(type) + BadTypeKeyword + + // InvalidTypeSwitch occurs when .(type) is used on an expression that is + // not of interface type. + // + // Example: + // func f(i int) { + // switch x := i.(type) {} + // } + InvalidTypeSwitch + + // InvalidExprSwitch occurs when a switch expression is not comparable. + // + // Example: + // func _() { + // var a struct{ _ func() } + // switch a /* ERROR cannot switch on a */ { + // } + // } + InvalidExprSwitch + + /* control flow > select */ + + // InvalidSelectCase occurs when a select case is not a channel send or + // receive. + // + // Example: + // func checkChan(c <-chan int) bool { + // select { + // case c: + // return true + // default: + // return false + // } + // } + InvalidSelectCase + + /* control flow > labels and jumps */ + + // UndeclaredLabel occurs when an undeclared label is jumped to. + // + // Example: + // func f() { + // goto L + // } + UndeclaredLabel + + // DuplicateLabel occurs when a label is declared more than once. + // + // Example: + // func f() int { + // L: + // L: + // return 1 + // } + DuplicateLabel + + // MisplacedLabel occurs when a break or continue label is not on a for, + // switch, or select statement. + // + // Example: + // func f() { + // L: + // a := []int{1,2,3} + // for _, e := range a { + // if e > 10 { + // break L + // } + // println(a) + // } + // } + MisplacedLabel + + // UnusedLabel occurs when a label is declared but not used. + // + // Example: + // func f() { + // L: + // } + UnusedLabel + + // JumpOverDecl occurs when a label jumps over a variable declaration. + // + // Example: + // func f() int { + // goto L + // x := 2 + // L: + // x++ + // return x + // } + JumpOverDecl + + // JumpIntoBlock occurs when a forward jump goes to a label inside a nested + // block. + // + // Example: + // func f(x int) { + // goto L + // if x > 0 { + // L: + // print("inside block") + // } + // } + JumpIntoBlock + + /* control flow > calls */ + + // InvalidMethodExpr occurs when a pointer method is called but the argument + // is not addressable. + // + // Example: + // type T struct {} + // + // func (*T) m() int { return 1 } + // + // var _ = T.m(T{}) + InvalidMethodExpr + + // WrongArgCount occurs when too few or too many arguments are passed by a + // function call. + // + // Example: + // func f(i int) {} + // var x = f() + WrongArgCount + + // InvalidCall occurs when an expression is called that is not of function + // type. + // + // Example: + // var x = "x" + // var y = x() + InvalidCall + + /* control flow > suspended */ + + // UnusedResults occurs when a restricted expression-only built-in function + // is suspended via go or defer. Such a suspension discards the results of + // these side-effect free built-in functions, and therefore is ineffectual. + // + // Example: + // func f(a []int) int { + // defer len(a) + // return i + // } + UnusedResults + + // InvalidDefer occurs when a deferred expression is not a function call, + // for example if the expression is a type conversion. + // + // Example: + // func f(i int) int { + // defer int32(i) + // return i + // } + InvalidDefer + + // InvalidGo occurs when a go expression is not a function call, for example + // if the expression is a type conversion. + // + // Example: + // func f(i int) int { + // go int32(i) + // return i + // } + InvalidGo + + // All codes below were added in Go 1.17. + + /* decl */ + + // BadDecl occurs when a declaration has invalid syntax. + BadDecl + + // RepeatedDecl occurs when an identifier occurs more than once on the left + // hand side of a short variable declaration. + // + // Example: + // func _() { + // x, y, y := 1, 2, 3 + // } + RepeatedDecl + + /* unsafe */ + + // InvalidUnsafeAdd occurs when unsafe.Add is called with a + // length argument that is not of integer type. + // + // Example: + // import "unsafe" + // + // var p unsafe.Pointer + // var _ = unsafe.Add(p, float64(1)) + InvalidUnsafeAdd + + // InvalidUnsafeSlice occurs when unsafe.Slice is called with a + // pointer argument that is not of pointer type or a length argument + // that is not of integer type, negative, or out of bounds. + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Slice(x, 1) + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Slice(&x, float64(1)) + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Slice(&x, -1) + // + // Example: + // import "unsafe" + // + // var x int + // var _ = unsafe.Slice(&x, uint64(1) << 63) + InvalidUnsafeSlice + + // All codes below were added in Go 1.18. + + /* features */ + + // UnsupportedFeature occurs when a language feature is used that is not + // supported at this Go version. + UnsupportedFeature + + /* type params */ + + // NotAGenericType occurs when a non-generic type is used where a generic + // type is expected: in type or function instantiation. + // + // Example: + // type T int + // + // var _ T[int] + NotAGenericType + + // WrongTypeArgCount occurs when a type or function is instantiated with an + // incorrent number of type arguments, including when a generic type or + // function is used without instantiation. + // + // Errors inolving failed type inference are assigned other error codes. + // + // Example: + // type T[p any] int + // + // var _ T[int, string] + // + // Example: + // func f[T any]() {} + // + // var x = f + WrongTypeArgCount + + // CannotInferTypeArgs occurs when type or function type argument inference + // fails to infer all type arguments. + // + // Example: + // func f[T any]() {} + // + // func _() { + // f() + // } + // + // Example: + // type N[P, Q any] struct{} + // + // var _ N[int] + CannotInferTypeArgs + + // InvalidTypeArg occurs when a type argument does not satisfy its + // corresponding type parameter constraints. + // + // Example: + // type T[P ~int] struct{} + // + // var _ T[string] + InvalidTypeArg // arguments? InferenceFailed + + // InvalidInstanceCycle occurs when an invalid cycle is detected + // within the instantiation graph. + // + // Example: + // func f[T any]() { f[*T]() } + InvalidInstanceCycle + + // InvalidUnion occurs when an embedded union or approximation element is + // not valid. + // + // Example: + // type _ interface { + // ~int | interface{ m() } + // } + InvalidUnion + + // MisplacedConstraintIface occurs when a constraint-type interface is used + // outside of constraint position. + // + // Example: + // type I interface { ~int } + // + // var _ I + MisplacedConstraintIface + + // InvalidMethodTypeParams occurs when methods have type parameters. + // + // It cannot be encountered with an AST parsed using go/parser. + InvalidMethodTypeParams + + // MisplacedTypeParam occurs when a type parameter is used in a place where + // it is not permitted. + // + // Example: + // type T[P any] P + // + // Example: + // type T[P any] struct{ *P } + MisplacedTypeParam +) diff --git a/vendor/golang.org/x/tools/internal/typesinternal/errorcode_string.go b/vendor/golang.org/x/tools/internal/typesinternal/errorcode_string.go new file mode 100644 index 0000000000..de90e9515a --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typesinternal/errorcode_string.go @@ -0,0 +1,167 @@ +// Code generated by "stringer -type=ErrorCode"; DO NOT EDIT. + +package typesinternal + +import "strconv" + +func _() { + // An "invalid array index" compiler error signifies that the constant values have changed. + // Re-run the stringer command to generate them again. + var x [1]struct{} + _ = x[Test-1] + _ = x[BlankPkgName-2] + _ = x[MismatchedPkgName-3] + _ = x[InvalidPkgUse-4] + _ = x[BadImportPath-5] + _ = x[BrokenImport-6] + _ = x[ImportCRenamed-7] + _ = x[UnusedImport-8] + _ = x[InvalidInitCycle-9] + _ = x[DuplicateDecl-10] + _ = x[InvalidDeclCycle-11] + _ = x[InvalidTypeCycle-12] + _ = x[InvalidConstInit-13] + _ = x[InvalidConstVal-14] + _ = x[InvalidConstType-15] + _ = x[UntypedNil-16] + _ = x[WrongAssignCount-17] + _ = x[UnassignableOperand-18] + _ = x[NoNewVar-19] + _ = x[MultiValAssignOp-20] + _ = x[InvalidIfaceAssign-21] + _ = x[InvalidChanAssign-22] + _ = x[IncompatibleAssign-23] + _ = x[UnaddressableFieldAssign-24] + _ = x[NotAType-25] + _ = x[InvalidArrayLen-26] + _ = x[BlankIfaceMethod-27] + _ = x[IncomparableMapKey-28] + _ = x[InvalidIfaceEmbed-29] + _ = x[InvalidPtrEmbed-30] + _ = x[BadRecv-31] + _ = x[InvalidRecv-32] + _ = x[DuplicateFieldAndMethod-33] + _ = x[DuplicateMethod-34] + _ = x[InvalidBlank-35] + _ = x[InvalidIota-36] + _ = x[MissingInitBody-37] + _ = x[InvalidInitSig-38] + _ = x[InvalidInitDecl-39] + _ = x[InvalidMainDecl-40] + _ = x[TooManyValues-41] + _ = x[NotAnExpr-42] + _ = x[TruncatedFloat-43] + _ = x[NumericOverflow-44] + _ = x[UndefinedOp-45] + _ = x[MismatchedTypes-46] + _ = x[DivByZero-47] + _ = x[NonNumericIncDec-48] + _ = x[UnaddressableOperand-49] + _ = x[InvalidIndirection-50] + _ = x[NonIndexableOperand-51] + _ = x[InvalidIndex-52] + _ = x[SwappedSliceIndices-53] + _ = x[NonSliceableOperand-54] + _ = x[InvalidSliceExpr-55] + _ = x[InvalidShiftCount-56] + _ = x[InvalidShiftOperand-57] + _ = x[InvalidReceive-58] + _ = x[InvalidSend-59] + _ = x[DuplicateLitKey-60] + _ = x[MissingLitKey-61] + _ = x[InvalidLitIndex-62] + _ = x[OversizeArrayLit-63] + _ = x[MixedStructLit-64] + _ = x[InvalidStructLit-65] + _ = x[MissingLitField-66] + _ = x[DuplicateLitField-67] + _ = x[UnexportedLitField-68] + _ = x[InvalidLitField-69] + _ = x[UntypedLit-70] + _ = x[InvalidLit-71] + _ = x[AmbiguousSelector-72] + _ = x[UndeclaredImportedName-73] + _ = x[UnexportedName-74] + _ = x[UndeclaredName-75] + _ = x[MissingFieldOrMethod-76] + _ = x[BadDotDotDotSyntax-77] + _ = x[NonVariadicDotDotDot-78] + _ = x[MisplacedDotDotDot-79] + _ = x[InvalidDotDotDotOperand-80] + _ = x[InvalidDotDotDot-81] + _ = x[UncalledBuiltin-82] + _ = x[InvalidAppend-83] + _ = x[InvalidCap-84] + _ = x[InvalidClose-85] + _ = x[InvalidCopy-86] + _ = x[InvalidComplex-87] + _ = x[InvalidDelete-88] + _ = x[InvalidImag-89] + _ = x[InvalidLen-90] + _ = x[SwappedMakeArgs-91] + _ = x[InvalidMake-92] + _ = x[InvalidReal-93] + _ = x[InvalidAssert-94] + _ = x[ImpossibleAssert-95] + _ = x[InvalidConversion-96] + _ = x[InvalidUntypedConversion-97] + _ = x[BadOffsetofSyntax-98] + _ = x[InvalidOffsetof-99] + _ = x[UnusedExpr-100] + _ = x[UnusedVar-101] + _ = x[MissingReturn-102] + _ = x[WrongResultCount-103] + _ = x[OutOfScopeResult-104] + _ = x[InvalidCond-105] + _ = x[InvalidPostDecl-106] + _ = x[InvalidChanRange-107] + _ = x[InvalidIterVar-108] + _ = x[InvalidRangeExpr-109] + _ = x[MisplacedBreak-110] + _ = x[MisplacedContinue-111] + _ = x[MisplacedFallthrough-112] + _ = x[DuplicateCase-113] + _ = x[DuplicateDefault-114] + _ = x[BadTypeKeyword-115] + _ = x[InvalidTypeSwitch-116] + _ = x[InvalidExprSwitch-117] + _ = x[InvalidSelectCase-118] + _ = x[UndeclaredLabel-119] + _ = x[DuplicateLabel-120] + _ = x[MisplacedLabel-121] + _ = x[UnusedLabel-122] + _ = x[JumpOverDecl-123] + _ = x[JumpIntoBlock-124] + _ = x[InvalidMethodExpr-125] + _ = x[WrongArgCount-126] + _ = x[InvalidCall-127] + _ = x[UnusedResults-128] + _ = x[InvalidDefer-129] + _ = x[InvalidGo-130] + _ = x[BadDecl-131] + _ = x[RepeatedDecl-132] + _ = x[InvalidUnsafeAdd-133] + _ = x[InvalidUnsafeSlice-134] + _ = x[UnsupportedFeature-135] + _ = x[NotAGenericType-136] + _ = x[WrongTypeArgCount-137] + _ = x[CannotInferTypeArgs-138] + _ = x[InvalidTypeArg-139] + _ = x[InvalidInstanceCycle-140] + _ = x[InvalidUnion-141] + _ = x[MisplacedConstraintIface-142] + _ = x[InvalidMethodTypeParams-143] + _ = x[MisplacedTypeParam-144] +} + +const _ErrorCode_name = "TestBlankPkgNameMismatchedPkgNameInvalidPkgUseBadImportPathBrokenImportImportCRenamedUnusedImportInvalidInitCycleDuplicateDeclInvalidDeclCycleInvalidTypeCycleInvalidConstInitInvalidConstValInvalidConstTypeUntypedNilWrongAssignCountUnassignableOperandNoNewVarMultiValAssignOpInvalidIfaceAssignInvalidChanAssignIncompatibleAssignUnaddressableFieldAssignNotATypeInvalidArrayLenBlankIfaceMethodIncomparableMapKeyInvalidIfaceEmbedInvalidPtrEmbedBadRecvInvalidRecvDuplicateFieldAndMethodDuplicateMethodInvalidBlankInvalidIotaMissingInitBodyInvalidInitSigInvalidInitDeclInvalidMainDeclTooManyValuesNotAnExprTruncatedFloatNumericOverflowUndefinedOpMismatchedTypesDivByZeroNonNumericIncDecUnaddressableOperandInvalidIndirectionNonIndexableOperandInvalidIndexSwappedSliceIndicesNonSliceableOperandInvalidSliceExprInvalidShiftCountInvalidShiftOperandInvalidReceiveInvalidSendDuplicateLitKeyMissingLitKeyInvalidLitIndexOversizeArrayLitMixedStructLitInvalidStructLitMissingLitFieldDuplicateLitFieldUnexportedLitFieldInvalidLitFieldUntypedLitInvalidLitAmbiguousSelectorUndeclaredImportedNameUnexportedNameUndeclaredNameMissingFieldOrMethodBadDotDotDotSyntaxNonVariadicDotDotDotMisplacedDotDotDotInvalidDotDotDotOperandInvalidDotDotDotUncalledBuiltinInvalidAppendInvalidCapInvalidCloseInvalidCopyInvalidComplexInvalidDeleteInvalidImagInvalidLenSwappedMakeArgsInvalidMakeInvalidRealInvalidAssertImpossibleAssertInvalidConversionInvalidUntypedConversionBadOffsetofSyntaxInvalidOffsetofUnusedExprUnusedVarMissingReturnWrongResultCountOutOfScopeResultInvalidCondInvalidPostDeclInvalidChanRangeInvalidIterVarInvalidRangeExprMisplacedBreakMisplacedContinueMisplacedFallthroughDuplicateCaseDuplicateDefaultBadTypeKeywordInvalidTypeSwitchInvalidExprSwitchInvalidSelectCaseUndeclaredLabelDuplicateLabelMisplacedLabelUnusedLabelJumpOverDeclJumpIntoBlockInvalidMethodExprWrongArgCountInvalidCallUnusedResultsInvalidDeferInvalidGoBadDeclRepeatedDeclInvalidUnsafeAddInvalidUnsafeSliceUnsupportedFeatureNotAGenericTypeWrongTypeArgCountCannotInferTypeArgsInvalidTypeArgInvalidInstanceCycleInvalidUnionMisplacedConstraintIfaceInvalidMethodTypeParamsMisplacedTypeParam" + +var _ErrorCode_index = [...]uint16{0, 4, 16, 33, 46, 59, 71, 85, 97, 113, 126, 142, 158, 174, 189, 205, 215, 231, 250, 258, 274, 292, 309, 327, 351, 359, 374, 390, 408, 425, 440, 447, 458, 481, 496, 508, 519, 534, 548, 563, 578, 591, 600, 614, 629, 640, 655, 664, 680, 700, 718, 737, 749, 768, 787, 803, 820, 839, 853, 864, 879, 892, 907, 923, 937, 953, 968, 985, 1003, 1018, 1028, 1038, 1055, 1077, 1091, 1105, 1125, 1143, 1163, 1181, 1204, 1220, 1235, 1248, 1258, 1270, 1281, 1295, 1308, 1319, 1329, 1344, 1355, 1366, 1379, 1395, 1412, 1436, 1453, 1468, 1478, 1487, 1500, 1516, 1532, 1543, 1558, 1574, 1588, 1604, 1618, 1635, 1655, 1668, 1684, 1698, 1715, 1732, 1749, 1764, 1778, 1792, 1803, 1815, 1828, 1845, 1858, 1869, 1882, 1894, 1903, 1910, 1922, 1938, 1956, 1974, 1989, 2006, 2025, 2039, 2059, 2071, 2095, 2118, 2136} + +func (i ErrorCode) String() string { + i -= 1 + if i < 0 || i >= ErrorCode(len(_ErrorCode_index)-1) { + return "ErrorCode(" + strconv.FormatInt(int64(i+1), 10) + ")" + } + return _ErrorCode_name[_ErrorCode_index[i]:_ErrorCode_index[i+1]] +} diff --git a/vendor/golang.org/x/tools/internal/typesinternal/types.go b/vendor/golang.org/x/tools/internal/typesinternal/types.go new file mode 100644 index 0000000000..ce7d4351b2 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typesinternal/types.go @@ -0,0 +1,52 @@ +// Copyright 2020 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package typesinternal provides access to internal go/types APIs that are not +// yet exported. +package typesinternal + +import ( + "go/token" + "go/types" + "reflect" + "unsafe" +) + +func SetUsesCgo(conf *types.Config) bool { + v := reflect.ValueOf(conf).Elem() + + f := v.FieldByName("go115UsesCgo") + if !f.IsValid() { + f = v.FieldByName("UsesCgo") + if !f.IsValid() { + return false + } + } + + addr := unsafe.Pointer(f.UnsafeAddr()) + *(*bool)(addr) = true + + return true +} + +// ReadGo116ErrorData extracts additional information from types.Error values +// generated by Go version 1.16 and later: the error code, start position, and +// end position. If all positions are valid, start <= err.Pos <= end. +// +// If the data could not be read, the final result parameter will be false. +func ReadGo116ErrorData(err types.Error) (code ErrorCode, start, end token.Pos, ok bool) { + var data [3]int + // By coincidence all of these fields are ints, which simplifies things. + v := reflect.ValueOf(err) + for i, name := range []string{"go116code", "go116start", "go116end"} { + f := v.FieldByName(name) + if !f.IsValid() { + return 0, 0, 0, false + } + data[i] = int(f.Int()) + } + return ErrorCode(data[0]), token.Pos(data[1]), token.Pos(data[2]), true +} + +var SetGoVersion = func(conf *types.Config, version string) bool { return false } diff --git a/vendor/golang.org/x/tools/internal/typesinternal/types_118.go b/vendor/golang.org/x/tools/internal/typesinternal/types_118.go new file mode 100644 index 0000000000..a42b072a67 --- /dev/null +++ b/vendor/golang.org/x/tools/internal/typesinternal/types_118.go @@ -0,0 +1,19 @@ +// Copyright 2021 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:build go1.18 +// +build go1.18 + +package typesinternal + +import ( + "go/types" +) + +func init() { + SetGoVersion = func(conf *types.Config, version string) bool { + conf.GoVersion = version + return true + } +} diff --git a/vendor/modules.txt b/vendor/modules.txt index 59e4331ca2..205b3f4959 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -2,14 +2,16 @@ ## explicit; go 1.16 github.com/BurntSushi/toml github.com/BurntSushi/toml/internal -# github.com/Microsoft/go-winio v0.5.2 -## explicit; go 1.13 +# github.com/Microsoft/go-winio v0.6.0 +## explicit; go 1.17 github.com/Microsoft/go-winio github.com/Microsoft/go-winio/backuptar +github.com/Microsoft/go-winio/internal/socket github.com/Microsoft/go-winio/pkg/etw github.com/Microsoft/go-winio/pkg/etwlogrus github.com/Microsoft/go-winio/pkg/guid github.com/Microsoft/go-winio/pkg/process +github.com/Microsoft/go-winio/tools/mkwinsyscall github.com/Microsoft/go-winio/vhd # github.com/OneOfOne/xxhash v1.2.8 ## explicit; go 1.11 @@ -348,7 +350,10 @@ go.opencensus.io/trace go.opencensus.io/trace/internal go.opencensus.io/trace/propagation go.opencensus.io/trace/tracestate -# golang.org/x/net v0.0.0-20220708220712-1185a9018129 +# golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4 +## explicit; go 1.17 +golang.org/x/mod/semver +# golang.org/x/net v0.0.0-20220722155237-a158d28d115b ## explicit; go 1.17 golang.org/x/net/http/httpguts golang.org/x/net/http2 @@ -358,10 +363,10 @@ golang.org/x/net/internal/socks golang.org/x/net/internal/timeseries golang.org/x/net/proxy golang.org/x/net/trace -# golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f +# golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4 ## explicit golang.org/x/sync/errgroup -# golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8 +# golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f ## explicit; go 1.17 golang.org/x/sys/execabs golang.org/x/sys/internal/unsafeheader @@ -377,6 +382,22 @@ golang.org/x/text/secure/bidirule golang.org/x/text/transform golang.org/x/text/unicode/bidi golang.org/x/text/unicode/norm +# golang.org/x/tools v0.1.12 +## explicit; go 1.18 +golang.org/x/tools/cmd/stringer +golang.org/x/tools/go/gcexportdata +golang.org/x/tools/go/internal/gcimporter +golang.org/x/tools/go/internal/packagesdriver +golang.org/x/tools/go/internal/pkgbits +golang.org/x/tools/go/packages +golang.org/x/tools/internal/event +golang.org/x/tools/internal/event/core +golang.org/x/tools/internal/event/keys +golang.org/x/tools/internal/event/label +golang.org/x/tools/internal/gocommand +golang.org/x/tools/internal/packagesinternal +golang.org/x/tools/internal/typeparams +golang.org/x/tools/internal/typesinternal # google.golang.org/genproto v0.0.0-20220107163113-42d7afdf6368 => google.golang.org/genproto v0.0.0-20200224152610-e50cd9704f63 ## explicit; go 1.11 google.golang.org/genproto/googleapis/rpc/status diff --git a/zsyscall_windows.go b/zsyscall_windows.go index 8bed848573..9b619b6e62 100644 --- a/zsyscall_windows.go +++ b/zsyscall_windows.go @@ -1,4 +1,6 @@ -// Code generated mksyscall_windows.exe DO NOT EDIT +//go:build windows + +// Code generated by 'go generate' using "github.com/Microsoft/go-winio/tools/mkwinsyscall"; DO NOT EDIT. package hcsshim @@ -19,6 +21,7 @@ const ( var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) + errERROR_EINVAL error = syscall.EINVAL ) // errnoErr returns common boxed Errno values, to prevent @@ -26,7 +29,7 @@ var ( func errnoErr(e syscall.Errno) error { switch e { case 0: - return nil + return errERROR_EINVAL case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } From 486a9f18e3402773d52e864f10c376aaf55492a6 Mon Sep 17 00:00:00 2001 From: Hamza El-Saawy Date: Sun, 22 May 2022 19:26:01 -0400 Subject: [PATCH 2/2] undoing sort=false Signed-off-by: Hamza El-Saawy --- computestorage/storage.go | 2 +- computestorage/zsyscall_windows.go | 172 ++++----- hcn/hcn.go | 2 +- hcn/zsyscall_windows.go | 486 ++++++++++++------------- hcsshim.go | 2 +- internal/hns/hns.go | 2 +- internal/interop/interop.go | 2 +- internal/vmcompute/vmcompute.go | 2 +- internal/vmcompute/zsyscall_windows.go | 318 ++++++++-------- internal/wclayer/wclayer.go | 2 +- internal/wclayer/zsyscall_windows.go | 208 +++++------ internal/winapi/winapi.go | 2 +- internal/winapi/zsyscall_windows.go | 312 ++++++++-------- 13 files changed, 756 insertions(+), 756 deletions(-) diff --git a/computestorage/storage.go b/computestorage/storage.go index f2c391c483..82d68cb8b1 100644 --- a/computestorage/storage.go +++ b/computestorage/storage.go @@ -7,7 +7,7 @@ import ( hcsschema "github.com/Microsoft/hcsshim/internal/hcs/schema2" ) -//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go storage.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go storage.go //sys hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) = computestorage.HcsImportLayer? //sys hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) = computestorage.HcsExportLayer? diff --git a/computestorage/zsyscall_windows.go b/computestorage/zsyscall_windows.go index 39fec99ca6..9cf479181a 100644 --- a/computestorage/zsyscall_windows.go +++ b/computestorage/zsyscall_windows.go @@ -42,43 +42,86 @@ func errnoErr(e syscall.Errno) error { var ( modcomputestorage = windows.NewLazySystemDLL("computestorage.dll") - procHcsImportLayer = modcomputestorage.NewProc("HcsImportLayer") - procHcsExportLayer = modcomputestorage.NewProc("HcsExportLayer") - procHcsDestoryLayer = modcomputestorage.NewProc("HcsDestoryLayer") - procHcsSetupBaseOSLayer = modcomputestorage.NewProc("HcsSetupBaseOSLayer") - procHcsInitializeWritableLayer = modcomputestorage.NewProc("HcsInitializeWritableLayer") procHcsAttachLayerStorageFilter = modcomputestorage.NewProc("HcsAttachLayerStorageFilter") + procHcsDestoryLayer = modcomputestorage.NewProc("HcsDestoryLayer") procHcsDetachLayerStorageFilter = modcomputestorage.NewProc("HcsDetachLayerStorageFilter") + procHcsExportLayer = modcomputestorage.NewProc("HcsExportLayer") procHcsFormatWritableLayerVhd = modcomputestorage.NewProc("HcsFormatWritableLayerVhd") procHcsGetLayerVhdMountPath = modcomputestorage.NewProc("HcsGetLayerVhdMountPath") + procHcsImportLayer = modcomputestorage.NewProc("HcsImportLayer") + procHcsInitializeWritableLayer = modcomputestorage.NewProc("HcsInitializeWritableLayer") + procHcsSetupBaseOSLayer = modcomputestorage.NewProc("HcsSetupBaseOSLayer") procHcsSetupBaseOSVolume = modcomputestorage.NewProc("HcsSetupBaseOSVolume") ) -func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) { +func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(sourceFolderPath) + _p1, hr = syscall.UTF16PtrFromString(layerData) if hr != nil { return } - var _p2 *uint16 - _p2, hr = syscall.UTF16PtrFromString(layerData) + return _hcsAttachLayerStorageFilter(_p0, _p1) +} + +func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { + hr = procHcsAttachLayerStorageFilter.Find() if hr != nil { return } - return _hcsImportLayer(_p0, _p1, _p2) + r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { - hr = procHcsImportLayer.Find() +func hcsDestroyLayer(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) + return _hcsDestroyLayer(_p0) +} + +func _hcsDestroyLayer(layerPath *uint16) (hr error) { + hr = procHcsDestoryLayer.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsDetachLayerStorageFilter(layerPath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(layerPath) + if hr != nil { + return + } + return _hcsDetachLayerStorageFilter(_p0) +} + +func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { + hr = procHcsDetachLayerStorageFilter.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -127,21 +170,27 @@ func _hcsExportLayer(layerPath *uint16, exportFolderPath *uint16, layerData *uin return } -func hcsDestroyLayer(layerPath string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(layerPath) +func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { + hr = procHcsFormatWritableLayerVhd.Find() if hr != nil { return } - return _hcsDestroyLayer(_p0) + r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcsDestroyLayer(layerPath *uint16) (hr error) { - hr = procHcsDestoryLayer.Find() +func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { + hr = procHcsGetLayerVhdMountPath.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) + r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -151,26 +200,31 @@ func _hcsDestroyLayer(layerPath *uint16) (hr error) { return } -func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) { +func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(options) + _p1, hr = syscall.UTF16PtrFromString(sourceFolderPath) if hr != nil { return } - return _hcsSetupBaseOSLayer(_p0, handle, _p1) + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(layerData) + if hr != nil { + return + } + return _hcsImportLayer(_p0, _p1, _p2) } -func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { - hr = procHcsSetupBaseOSLayer.Find() +func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { + hr = procHcsImportLayer.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) + r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -214,80 +268,26 @@ func _hcsInitializeWritableLayer(writableLayerPath *uint16, layerData *uint16, o return } -func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) { +func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(layerData) - if hr != nil { - return - } - return _hcsAttachLayerStorageFilter(_p0, _p1) -} - -func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { - hr = procHcsAttachLayerStorageFilter.Find() - if hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsDetachLayerStorageFilter(layerPath string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(layerPath) - if hr != nil { - return - } - return _hcsDetachLayerStorageFilter(_p0) -} - -func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { - hr = procHcsDetachLayerStorageFilter.Find() - if hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - -func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { - hr = procHcsFormatWritableLayerVhd.Find() + _p1, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return + return _hcsSetupBaseOSLayer(_p0, handle, _p1) } -func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { - hr = procHcsGetLayerVhdMountPath.Find() +func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { + hr = procHcsSetupBaseOSLayer.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) + r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff diff --git a/hcn/hcn.go b/hcn/hcn.go index b0983dd539..61bd5b5718 100644 --- a/hcn/hcn.go +++ b/hcn/hcn.go @@ -10,7 +10,7 @@ import ( "github.com/Microsoft/go-winio/pkg/guid" ) -//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go hcn.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go hcn.go /// HNS V1 API diff --git a/hcn/zsyscall_windows.go b/hcn/zsyscall_windows.go index b44b3099e5..379023831e 100644 --- a/hcn/zsyscall_windows.go +++ b/hcn/zsyscall_windows.go @@ -40,51 +40,55 @@ func errnoErr(e syscall.Errno) error { } var ( + modcomputenetwork = windows.NewLazySystemDLL("computenetwork.dll") modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") - modcomputenetwork = windows.NewLazySystemDLL("computenetwork.dll") - procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") - procHNSCall = modvmcompute.NewProc("HNSCall") - procHcnEnumerateNetworks = modcomputenetwork.NewProc("HcnEnumerateNetworks") - procHcnCreateNetwork = modcomputenetwork.NewProc("HcnCreateNetwork") - procHcnOpenNetwork = modcomputenetwork.NewProc("HcnOpenNetwork") - procHcnModifyNetwork = modcomputenetwork.NewProc("HcnModifyNetwork") - procHcnQueryNetworkProperties = modcomputenetwork.NewProc("HcnQueryNetworkProperties") - procHcnDeleteNetwork = modcomputenetwork.NewProc("HcnDeleteNetwork") + procHcnCloseEndpoint = modcomputenetwork.NewProc("HcnCloseEndpoint") + procHcnCloseLoadBalancer = modcomputenetwork.NewProc("HcnCloseLoadBalancer") + procHcnCloseNamespace = modcomputenetwork.NewProc("HcnCloseNamespace") procHcnCloseNetwork = modcomputenetwork.NewProc("HcnCloseNetwork") - procHcnEnumerateEndpoints = modcomputenetwork.NewProc("HcnEnumerateEndpoints") + procHcnCloseSdnRoute = modcomputenetwork.NewProc("HcnCloseSdnRoute") procHcnCreateEndpoint = modcomputenetwork.NewProc("HcnCreateEndpoint") - procHcnOpenEndpoint = modcomputenetwork.NewProc("HcnOpenEndpoint") - procHcnModifyEndpoint = modcomputenetwork.NewProc("HcnModifyEndpoint") - procHcnQueryEndpointProperties = modcomputenetwork.NewProc("HcnQueryEndpointProperties") - procHcnDeleteEndpoint = modcomputenetwork.NewProc("HcnDeleteEndpoint") - procHcnCloseEndpoint = modcomputenetwork.NewProc("HcnCloseEndpoint") - procHcnEnumerateNamespaces = modcomputenetwork.NewProc("HcnEnumerateNamespaces") + procHcnCreateLoadBalancer = modcomputenetwork.NewProc("HcnCreateLoadBalancer") procHcnCreateNamespace = modcomputenetwork.NewProc("HcnCreateNamespace") - procHcnOpenNamespace = modcomputenetwork.NewProc("HcnOpenNamespace") - procHcnModifyNamespace = modcomputenetwork.NewProc("HcnModifyNamespace") - procHcnQueryNamespaceProperties = modcomputenetwork.NewProc("HcnQueryNamespaceProperties") + procHcnCreateNetwork = modcomputenetwork.NewProc("HcnCreateNetwork") + procHcnCreateSdnRoute = modcomputenetwork.NewProc("HcnCreateSdnRoute") + procHcnDeleteEndpoint = modcomputenetwork.NewProc("HcnDeleteEndpoint") + procHcnDeleteLoadBalancer = modcomputenetwork.NewProc("HcnDeleteLoadBalancer") procHcnDeleteNamespace = modcomputenetwork.NewProc("HcnDeleteNamespace") - procHcnCloseNamespace = modcomputenetwork.NewProc("HcnCloseNamespace") + procHcnDeleteNetwork = modcomputenetwork.NewProc("HcnDeleteNetwork") + procHcnDeleteSdnRoute = modcomputenetwork.NewProc("HcnDeleteSdnRoute") + procHcnEnumerateEndpoints = modcomputenetwork.NewProc("HcnEnumerateEndpoints") procHcnEnumerateLoadBalancers = modcomputenetwork.NewProc("HcnEnumerateLoadBalancers") - procHcnCreateLoadBalancer = modcomputenetwork.NewProc("HcnCreateLoadBalancer") - procHcnOpenLoadBalancer = modcomputenetwork.NewProc("HcnOpenLoadBalancer") - procHcnModifyLoadBalancer = modcomputenetwork.NewProc("HcnModifyLoadBalancer") - procHcnQueryLoadBalancerProperties = modcomputenetwork.NewProc("HcnQueryLoadBalancerProperties") - procHcnDeleteLoadBalancer = modcomputenetwork.NewProc("HcnDeleteLoadBalancer") - procHcnCloseLoadBalancer = modcomputenetwork.NewProc("HcnCloseLoadBalancer") + procHcnEnumerateNamespaces = modcomputenetwork.NewProc("HcnEnumerateNamespaces") + procHcnEnumerateNetworks = modcomputenetwork.NewProc("HcnEnumerateNetworks") procHcnEnumerateSdnRoutes = modcomputenetwork.NewProc("HcnEnumerateSdnRoutes") - procHcnCreateSdnRoute = modcomputenetwork.NewProc("HcnCreateSdnRoute") - procHcnOpenSdnRoute = modcomputenetwork.NewProc("HcnOpenSdnRoute") + procHcnModifyEndpoint = modcomputenetwork.NewProc("HcnModifyEndpoint") + procHcnModifyLoadBalancer = modcomputenetwork.NewProc("HcnModifyLoadBalancer") + procHcnModifyNamespace = modcomputenetwork.NewProc("HcnModifyNamespace") + procHcnModifyNetwork = modcomputenetwork.NewProc("HcnModifyNetwork") procHcnModifySdnRoute = modcomputenetwork.NewProc("HcnModifySdnRoute") + procHcnOpenEndpoint = modcomputenetwork.NewProc("HcnOpenEndpoint") + procHcnOpenLoadBalancer = modcomputenetwork.NewProc("HcnOpenLoadBalancer") + procHcnOpenNamespace = modcomputenetwork.NewProc("HcnOpenNamespace") + procHcnOpenNetwork = modcomputenetwork.NewProc("HcnOpenNetwork") + procHcnOpenSdnRoute = modcomputenetwork.NewProc("HcnOpenSdnRoute") + procHcnQueryEndpointProperties = modcomputenetwork.NewProc("HcnQueryEndpointProperties") + procHcnQueryLoadBalancerProperties = modcomputenetwork.NewProc("HcnQueryLoadBalancerProperties") + procHcnQueryNamespaceProperties = modcomputenetwork.NewProc("HcnQueryNamespaceProperties") + procHcnQueryNetworkProperties = modcomputenetwork.NewProc("HcnQueryNetworkProperties") procHcnQuerySdnRouteProperties = modcomputenetwork.NewProc("HcnQuerySdnRouteProperties") - procHcnDeleteSdnRoute = modcomputenetwork.NewProc("HcnDeleteSdnRoute") - procHcnCloseSdnRoute = modcomputenetwork.NewProc("HcnCloseSdnRoute") + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") + procHNSCall = modvmcompute.NewProc("HNSCall") ) -func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { - r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) +func hcnCloseEndpoint(endpoint hcnEndpoint) (hr error) { + hr = procHcnCloseEndpoint.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnCloseEndpoint.Addr(), 1, uintptr(endpoint), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -94,31 +98,27 @@ func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { return } -func _hnsCall(method string, path string, object string, response **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(method) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(path) +func hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) { + hr = procHcnCloseLoadBalancer.Find() if hr != nil { return } - var _p2 *uint16 - _p2, hr = syscall.UTF16PtrFromString(object) - if hr != nil { - return + r0, _, _ := syscall.Syscall(procHcnCloseLoadBalancer.Addr(), 1, uintptr(loadBalancer), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) } - return __hnsCall(_p0, _p1, _p2, response) + return } -func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { - hr = procHNSCall.Find() +func hcnCloseNamespace(namespace hcnNamespace) (hr error) { + hr = procHcnCloseNamespace.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + r0, _, _ := syscall.Syscall(procHcnCloseNamespace.Addr(), 1, uintptr(namespace), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -128,21 +128,27 @@ func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) return } -func hcnEnumerateNetworks(query string, networks **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) +func hcnCloseNetwork(network hcnNetwork) (hr error) { + hr = procHcnCloseNetwork.Find() if hr != nil { return } - return _hcnEnumerateNetworks(_p0, networks, result) + r0, _, _ := syscall.Syscall(procHcnCloseNetwork.Addr(), 1, uintptr(network), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcnEnumerateNetworks(query *uint16, networks **uint16, result **uint16) (hr error) { - hr = procHcnEnumerateNetworks.Find() +func hcnCloseRoute(route hcnRoute) (hr error) { + hr = procHcnCloseSdnRoute.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnEnumerateNetworks.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(networks)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcnCloseSdnRoute.Addr(), 1, uintptr(route), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -152,21 +158,21 @@ func _hcnEnumerateNetworks(query *uint16, networks **uint16, result **uint16) (h return } -func hcnCreateNetwork(id *_guid, settings string, network *hcnNetwork, result **uint16) (hr error) { +func hcnCreateEndpoint(network hcnNetwork, id *_guid, settings string, endpoint *hcnEndpoint, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcnCreateNetwork(id, _p0, network, result) + return _hcnCreateEndpoint(network, id, _p0, endpoint, result) } -func _hcnCreateNetwork(id *_guid, settings *uint16, network *hcnNetwork, result **uint16) (hr error) { - hr = procHcnCreateNetwork.Find() +func _hcnCreateEndpoint(network hcnNetwork, id *_guid, settings *uint16, endpoint *hcnEndpoint, result **uint16) (hr error) { + hr = procHcnCreateEndpoint.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnCreateNetwork.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall6(procHcnCreateEndpoint.Addr(), 5, uintptr(network), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -176,12 +182,21 @@ func _hcnCreateNetwork(id *_guid, settings *uint16, network *hcnNetwork, result return } -func hcnOpenNetwork(id *_guid, network *hcnNetwork, result **uint16) (hr error) { - hr = procHcnOpenNetwork.Find() +func hcnCreateLoadBalancer(id *_guid, settings string, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnOpenNetwork.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result))) + return _hcnCreateLoadBalancer(id, _p0, loadBalancer, result) +} + +func _hcnCreateLoadBalancer(id *_guid, settings *uint16, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { + hr = procHcnCreateLoadBalancer.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnCreateLoadBalancer.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -191,21 +206,21 @@ func hcnOpenNetwork(id *_guid, network *hcnNetwork, result **uint16) (hr error) return } -func hcnModifyNetwork(network hcnNetwork, settings string, result **uint16) (hr error) { +func hcnCreateNamespace(id *_guid, settings string, namespace *hcnNamespace, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcnModifyNetwork(network, _p0, result) + return _hcnCreateNamespace(id, _p0, namespace, result) } -func _hcnModifyNetwork(network hcnNetwork, settings *uint16, result **uint16) (hr error) { - hr = procHcnModifyNetwork.Find() +func _hcnCreateNamespace(id *_guid, settings *uint16, namespace *hcnNamespace, result **uint16) (hr error) { + hr = procHcnCreateNamespace.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnModifyNetwork.Addr(), 3, uintptr(network), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall6(procHcnCreateNamespace.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -215,21 +230,21 @@ func _hcnModifyNetwork(network hcnNetwork, settings *uint16, result **uint16) (h return } -func hcnQueryNetworkProperties(network hcnNetwork, query string, properties **uint16, result **uint16) (hr error) { +func hcnCreateNetwork(id *_guid, settings string, network *hcnNetwork, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) + _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcnQueryNetworkProperties(network, _p0, properties, result) + return _hcnCreateNetwork(id, _p0, network, result) } -func _hcnQueryNetworkProperties(network hcnNetwork, query *uint16, properties **uint16, result **uint16) (hr error) { - hr = procHcnQueryNetworkProperties.Find() +func _hcnCreateNetwork(id *_guid, settings *uint16, network *hcnNetwork, result **uint16) (hr error) { + hr = procHcnCreateNetwork.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnQueryNetworkProperties.Addr(), 4, uintptr(network), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall6(procHcnCreateNetwork.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -239,12 +254,21 @@ func _hcnQueryNetworkProperties(network hcnNetwork, query *uint16, properties ** return } -func hcnDeleteNetwork(id *_guid, result **uint16) (hr error) { - hr = procHcnDeleteNetwork.Find() +func hcnCreateRoute(id *_guid, settings string, route *hcnRoute, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnDeleteNetwork.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) + return _hcnCreateRoute(id, _p0, route, result) +} + +func _hcnCreateRoute(id *_guid, settings *uint16, route *hcnRoute, result **uint16) (hr error) { + hr = procHcnCreateSdnRoute.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnCreateSdnRoute.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(route)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -254,12 +278,12 @@ func hcnDeleteNetwork(id *_guid, result **uint16) (hr error) { return } -func hcnCloseNetwork(network hcnNetwork) (hr error) { - hr = procHcnCloseNetwork.Find() +func hcnDeleteEndpoint(id *_guid, result **uint16) (hr error) { + hr = procHcnDeleteEndpoint.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnCloseNetwork.Addr(), 1, uintptr(network), 0, 0) + r0, _, _ := syscall.Syscall(procHcnDeleteEndpoint.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -269,21 +293,12 @@ func hcnCloseNetwork(network hcnNetwork) (hr error) { return } -func hcnEnumerateEndpoints(query string, endpoints **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) - if hr != nil { - return - } - return _hcnEnumerateEndpoints(_p0, endpoints, result) -} - -func _hcnEnumerateEndpoints(query *uint16, endpoints **uint16, result **uint16) (hr error) { - hr = procHcnEnumerateEndpoints.Find() +func hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) { + hr = procHcnDeleteLoadBalancer.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnEnumerateEndpoints.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(endpoints)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcnDeleteLoadBalancer.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -293,21 +308,12 @@ func _hcnEnumerateEndpoints(query *uint16, endpoints **uint16, result **uint16) return } -func hcnCreateEndpoint(network hcnNetwork, id *_guid, settings string, endpoint *hcnEndpoint, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) - if hr != nil { - return - } - return _hcnCreateEndpoint(network, id, _p0, endpoint, result) -} - -func _hcnCreateEndpoint(network hcnNetwork, id *_guid, settings *uint16, endpoint *hcnEndpoint, result **uint16) (hr error) { - hr = procHcnCreateEndpoint.Find() +func hcnDeleteNamespace(id *_guid, result **uint16) (hr error) { + hr = procHcnDeleteNamespace.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnCreateEndpoint.Addr(), 5, uintptr(network), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result)), 0) + r0, _, _ := syscall.Syscall(procHcnDeleteNamespace.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -317,12 +323,12 @@ func _hcnCreateEndpoint(network hcnNetwork, id *_guid, settings *uint16, endpoin return } -func hcnOpenEndpoint(id *_guid, endpoint *hcnEndpoint, result **uint16) (hr error) { - hr = procHcnOpenEndpoint.Find() +func hcnDeleteNetwork(id *_guid, result **uint16) (hr error) { + hr = procHcnDeleteNetwork.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnOpenEndpoint.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcnDeleteNetwork.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -332,21 +338,12 @@ func hcnOpenEndpoint(id *_guid, endpoint *hcnEndpoint, result **uint16) (hr erro return } -func hcnModifyEndpoint(endpoint hcnEndpoint, settings string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) - if hr != nil { - return - } - return _hcnModifyEndpoint(endpoint, _p0, result) -} - -func _hcnModifyEndpoint(endpoint hcnEndpoint, settings *uint16, result **uint16) (hr error) { - hr = procHcnModifyEndpoint.Find() +func hcnDeleteRoute(id *_guid, result **uint16) (hr error) { + hr = procHcnDeleteSdnRoute.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnModifyEndpoint.Addr(), 3, uintptr(endpoint), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcnDeleteSdnRoute.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -356,21 +353,21 @@ func _hcnModifyEndpoint(endpoint hcnEndpoint, settings *uint16, result **uint16) return } -func hcnQueryEndpointProperties(endpoint hcnEndpoint, query string, properties **uint16, result **uint16) (hr error) { +func hcnEnumerateEndpoints(query string, endpoints **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - return _hcnQueryEndpointProperties(endpoint, _p0, properties, result) + return _hcnEnumerateEndpoints(_p0, endpoints, result) } -func _hcnQueryEndpointProperties(endpoint hcnEndpoint, query *uint16, properties **uint16, result **uint16) (hr error) { - hr = procHcnQueryEndpointProperties.Find() +func _hcnEnumerateEndpoints(query *uint16, endpoints **uint16, result **uint16) (hr error) { + hr = procHcnEnumerateEndpoints.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnQueryEndpointProperties.Addr(), 4, uintptr(endpoint), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall(procHcnEnumerateEndpoints.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(endpoints)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -380,27 +377,21 @@ func _hcnQueryEndpointProperties(endpoint hcnEndpoint, query *uint16, properties return } -func hcnDeleteEndpoint(id *_guid, result **uint16) (hr error) { - hr = procHcnDeleteEndpoint.Find() +func hcnEnumerateLoadBalancers(query string, loadBalancers **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnDeleteEndpoint.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return + return _hcnEnumerateLoadBalancers(_p0, loadBalancers, result) } -func hcnCloseEndpoint(endpoint hcnEndpoint) (hr error) { - hr = procHcnCloseEndpoint.Find() +func _hcnEnumerateLoadBalancers(query *uint16, loadBalancers **uint16, result **uint16) (hr error) { + hr = procHcnEnumerateLoadBalancers.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnCloseEndpoint.Addr(), 1, uintptr(endpoint), 0, 0) + r0, _, _ := syscall.Syscall(procHcnEnumerateLoadBalancers.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(loadBalancers)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -434,21 +425,21 @@ func _hcnEnumerateNamespaces(query *uint16, namespaces **uint16, result **uint16 return } -func hcnCreateNamespace(id *_guid, settings string, namespace *hcnNamespace, result **uint16) (hr error) { +func hcnEnumerateNetworks(query string, networks **uint16, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) + _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - return _hcnCreateNamespace(id, _p0, namespace, result) + return _hcnEnumerateNetworks(_p0, networks, result) } -func _hcnCreateNamespace(id *_guid, settings *uint16, namespace *hcnNamespace, result **uint16) (hr error) { - hr = procHcnCreateNamespace.Find() +func _hcnEnumerateNetworks(query *uint16, networks **uint16, result **uint16) (hr error) { + hr = procHcnEnumerateNetworks.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnCreateNamespace.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall(procHcnEnumerateNetworks.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(networks)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -458,12 +449,21 @@ func _hcnCreateNamespace(id *_guid, settings *uint16, namespace *hcnNamespace, r return } -func hcnOpenNamespace(id *_guid, namespace *hcnNamespace, result **uint16) (hr error) { - hr = procHcnOpenNamespace.Find() +func hcnEnumerateRoutes(query string, routes **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnOpenNamespace.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result))) + return _hcnEnumerateRoutes(_p0, routes, result) +} + +func _hcnEnumerateRoutes(query *uint16, routes **uint16, result **uint16) (hr error) { + hr = procHcnEnumerateSdnRoutes.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnEnumerateSdnRoutes.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(routes)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -473,21 +473,21 @@ func hcnOpenNamespace(id *_guid, namespace *hcnNamespace, result **uint16) (hr e return } -func hcnModifyNamespace(namespace hcnNamespace, settings string, result **uint16) (hr error) { +func hcnModifyEndpoint(endpoint hcnEndpoint, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcnModifyNamespace(namespace, _p0, result) + return _hcnModifyEndpoint(endpoint, _p0, result) } -func _hcnModifyNamespace(namespace hcnNamespace, settings *uint16, result **uint16) (hr error) { - hr = procHcnModifyNamespace.Find() +func _hcnModifyEndpoint(endpoint hcnEndpoint, settings *uint16, result **uint16) (hr error) { + hr = procHcnModifyEndpoint.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnModifyNamespace.Addr(), 3, uintptr(namespace), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcnModifyEndpoint.Addr(), 3, uintptr(endpoint), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -497,21 +497,21 @@ func _hcnModifyNamespace(namespace hcnNamespace, settings *uint16, result **uint return } -func hcnQueryNamespaceProperties(namespace hcnNamespace, query string, properties **uint16, result **uint16) (hr error) { +func hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) + _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcnQueryNamespaceProperties(namespace, _p0, properties, result) + return _hcnModifyLoadBalancer(loadBalancer, _p0, result) } -func _hcnQueryNamespaceProperties(namespace hcnNamespace, query *uint16, properties **uint16, result **uint16) (hr error) { - hr = procHcnQueryNamespaceProperties.Find() +func _hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings *uint16, result **uint16) (hr error) { + hr = procHcnModifyLoadBalancer.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnQueryNamespaceProperties.Addr(), 4, uintptr(namespace), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall(procHcnModifyLoadBalancer.Addr(), 3, uintptr(loadBalancer), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -521,27 +521,21 @@ func _hcnQueryNamespaceProperties(namespace hcnNamespace, query *uint16, propert return } -func hcnDeleteNamespace(id *_guid, result **uint16) (hr error) { - hr = procHcnDeleteNamespace.Find() +func hcnModifyNamespace(namespace hcnNamespace, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnDeleteNamespace.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return + return _hcnModifyNamespace(namespace, _p0, result) } -func hcnCloseNamespace(namespace hcnNamespace) (hr error) { - hr = procHcnCloseNamespace.Find() +func _hcnModifyNamespace(namespace hcnNamespace, settings *uint16, result **uint16) (hr error) { + hr = procHcnModifyNamespace.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnCloseNamespace.Addr(), 1, uintptr(namespace), 0, 0) + r0, _, _ := syscall.Syscall(procHcnModifyNamespace.Addr(), 3, uintptr(namespace), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -551,21 +545,21 @@ func hcnCloseNamespace(namespace hcnNamespace) (hr error) { return } -func hcnEnumerateLoadBalancers(query string, loadBalancers **uint16, result **uint16) (hr error) { +func hcnModifyNetwork(network hcnNetwork, settings string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) + _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcnEnumerateLoadBalancers(_p0, loadBalancers, result) + return _hcnModifyNetwork(network, _p0, result) } -func _hcnEnumerateLoadBalancers(query *uint16, loadBalancers **uint16, result **uint16) (hr error) { - hr = procHcnEnumerateLoadBalancers.Find() +func _hcnModifyNetwork(network hcnNetwork, settings *uint16, result **uint16) (hr error) { + hr = procHcnModifyNetwork.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnEnumerateLoadBalancers.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(loadBalancers)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcnModifyNetwork.Addr(), 3, uintptr(network), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -575,21 +569,21 @@ func _hcnEnumerateLoadBalancers(query *uint16, loadBalancers **uint16, result ** return } -func hcnCreateLoadBalancer(id *_guid, settings string, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { +func hcnModifyRoute(route hcnRoute, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcnCreateLoadBalancer(id, _p0, loadBalancer, result) + return _hcnModifyRoute(route, _p0, result) } -func _hcnCreateLoadBalancer(id *_guid, settings *uint16, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { - hr = procHcnCreateLoadBalancer.Find() +func _hcnModifyRoute(route hcnRoute, settings *uint16, result **uint16) (hr error) { + hr = procHcnModifySdnRoute.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnCreateLoadBalancer.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall(procHcnModifySdnRoute.Addr(), 3, uintptr(route), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -599,12 +593,12 @@ func _hcnCreateLoadBalancer(id *_guid, settings *uint16, loadBalancer *hcnLoadBa return } -func hcnOpenLoadBalancer(id *_guid, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { - hr = procHcnOpenLoadBalancer.Find() +func hcnOpenEndpoint(id *_guid, endpoint *hcnEndpoint, result **uint16) (hr error) { + hr = procHcnOpenEndpoint.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnOpenLoadBalancer.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcnOpenEndpoint.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -614,21 +608,12 @@ func hcnOpenLoadBalancer(id *_guid, loadBalancer *hcnLoadBalancer, result **uint return } -func hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) - if hr != nil { - return - } - return _hcnModifyLoadBalancer(loadBalancer, _p0, result) -} - -func _hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings *uint16, result **uint16) (hr error) { - hr = procHcnModifyLoadBalancer.Find() +func hcnOpenLoadBalancer(id *_guid, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { + hr = procHcnOpenLoadBalancer.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnModifyLoadBalancer.Addr(), 3, uintptr(loadBalancer), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcnOpenLoadBalancer.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -638,21 +623,12 @@ func _hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings *uint16, resu return } -func hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query string, properties **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) - if hr != nil { - return - } - return _hcnQueryLoadBalancerProperties(loadBalancer, _p0, properties, result) -} - -func _hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query *uint16, properties **uint16, result **uint16) (hr error) { - hr = procHcnQueryLoadBalancerProperties.Find() +func hcnOpenNamespace(id *_guid, namespace *hcnNamespace, result **uint16) (hr error) { + hr = procHcnOpenNamespace.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnQueryLoadBalancerProperties.Addr(), 4, uintptr(loadBalancer), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall(procHcnOpenNamespace.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -662,12 +638,12 @@ func _hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query *uint16 return } -func hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) { - hr = procHcnDeleteLoadBalancer.Find() +func hcnOpenNetwork(id *_guid, network *hcnNetwork, result **uint16) (hr error) { + hr = procHcnOpenNetwork.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnDeleteLoadBalancer.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) + r0, _, _ := syscall.Syscall(procHcnOpenNetwork.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -677,12 +653,12 @@ func hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) { return } -func hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) { - hr = procHcnCloseLoadBalancer.Find() +func hcnOpenRoute(id *_guid, route *hcnRoute, result **uint16) (hr error) { + hr = procHcnOpenSdnRoute.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnCloseLoadBalancer.Addr(), 1, uintptr(loadBalancer), 0, 0) + r0, _, _ := syscall.Syscall(procHcnOpenSdnRoute.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(route)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -692,21 +668,21 @@ func hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) { return } -func hcnEnumerateRoutes(query string, routes **uint16, result **uint16) (hr error) { +func hcnQueryEndpointProperties(endpoint hcnEndpoint, query string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - return _hcnEnumerateRoutes(_p0, routes, result) + return _hcnQueryEndpointProperties(endpoint, _p0, properties, result) } -func _hcnEnumerateRoutes(query *uint16, routes **uint16, result **uint16) (hr error) { - hr = procHcnEnumerateSdnRoutes.Find() +func _hcnQueryEndpointProperties(endpoint hcnEndpoint, query *uint16, properties **uint16, result **uint16) (hr error) { + hr = procHcnQueryEndpointProperties.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnEnumerateSdnRoutes.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(routes)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall6(procHcnQueryEndpointProperties.Addr(), 4, uintptr(endpoint), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -716,21 +692,21 @@ func _hcnEnumerateRoutes(query *uint16, routes **uint16, result **uint16) (hr er return } -func hcnCreateRoute(id *_guid, settings string, route *hcnRoute, result **uint16) (hr error) { +func hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) + _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - return _hcnCreateRoute(id, _p0, route, result) + return _hcnQueryLoadBalancerProperties(loadBalancer, _p0, properties, result) } -func _hcnCreateRoute(id *_guid, settings *uint16, route *hcnRoute, result **uint16) (hr error) { - hr = procHcnCreateSdnRoute.Find() +func _hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query *uint16, properties **uint16, result **uint16) (hr error) { + hr = procHcnQueryLoadBalancerProperties.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcnCreateSdnRoute.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(route)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall6(procHcnQueryLoadBalancerProperties.Addr(), 4, uintptr(loadBalancer), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -740,12 +716,21 @@ func _hcnCreateRoute(id *_guid, settings *uint16, route *hcnRoute, result **uint return } -func hcnOpenRoute(id *_guid, route *hcnRoute, result **uint16) (hr error) { - hr = procHcnOpenSdnRoute.Find() +func hcnQueryNamespaceProperties(namespace hcnNamespace, query string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnOpenSdnRoute.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(route)), uintptr(unsafe.Pointer(result))) + return _hcnQueryNamespaceProperties(namespace, _p0, properties, result) +} + +func _hcnQueryNamespaceProperties(namespace hcnNamespace, query *uint16, properties **uint16, result **uint16) (hr error) { + hr = procHcnQueryNamespaceProperties.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnQueryNamespaceProperties.Addr(), 4, uintptr(namespace), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -755,21 +740,21 @@ func hcnOpenRoute(id *_guid, route *hcnRoute, result **uint16) (hr error) { return } -func hcnModifyRoute(route hcnRoute, settings string, result **uint16) (hr error) { +func hcnQueryNetworkProperties(network hcnNetwork, query string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) + _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - return _hcnModifyRoute(route, _p0, result) + return _hcnQueryNetworkProperties(network, _p0, properties, result) } -func _hcnModifyRoute(route hcnRoute, settings *uint16, result **uint16) (hr error) { - hr = procHcnModifySdnRoute.Find() +func _hcnQueryNetworkProperties(network hcnNetwork, query *uint16, properties **uint16, result **uint16) (hr error) { + hr = procHcnQueryNetworkProperties.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnModifySdnRoute.Addr(), 3, uintptr(route), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall6(procHcnQueryNetworkProperties.Addr(), 4, uintptr(network), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -803,12 +788,8 @@ func _hcnQueryRouteProperties(route hcnRoute, query *uint16, properties **uint16 return } -func hcnDeleteRoute(id *_guid, result **uint16) (hr error) { - hr = procHcnDeleteSdnRoute.Find() - if hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcnDeleteSdnRoute.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -818,12 +799,31 @@ func hcnDeleteRoute(id *_guid, result **uint16) (hr error) { return } -func hcnCloseRoute(route hcnRoute) (hr error) { - hr = procHcnCloseSdnRoute.Find() +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcnCloseSdnRoute.Addr(), 1, uintptr(route), 0, 0) + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + hr = procHNSCall.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff diff --git a/hcsshim.go b/hcsshim.go index f52bb3ab9d..13f80e4a81 100644 --- a/hcsshim.go +++ b/hcsshim.go @@ -11,7 +11,7 @@ import ( "github.com/Microsoft/hcsshim/internal/hcserror" ) -//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go hcsshim.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go hcsshim.go //sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId diff --git a/internal/hns/hns.go b/internal/hns/hns.go index fe557e3b97..ec4c907d1f 100644 --- a/internal/hns/hns.go +++ b/internal/hns/hns.go @@ -2,7 +2,7 @@ package hns import "fmt" -//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go hns.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go hns.go //sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? diff --git a/internal/interop/interop.go b/internal/interop/interop.go index fda8b01d4b..a564696568 100644 --- a/internal/interop/interop.go +++ b/internal/interop/interop.go @@ -7,7 +7,7 @@ import ( "unsafe" ) -//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go interop.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go interop.go //sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree diff --git a/internal/vmcompute/vmcompute.go b/internal/vmcompute/vmcompute.go index 08e6ec227a..b328dfc238 100644 --- a/internal/vmcompute/vmcompute.go +++ b/internal/vmcompute/vmcompute.go @@ -16,7 +16,7 @@ import ( "github.com/Microsoft/hcsshim/internal/timeout" ) -//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go vmcompute.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go vmcompute.go //sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? //sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? diff --git a/internal/vmcompute/zsyscall_windows.go b/internal/vmcompute/zsyscall_windows.go index ecd47f2e49..42368872b7 100644 --- a/internal/vmcompute/zsyscall_windows.go +++ b/internal/vmcompute/zsyscall_windows.go @@ -42,49 +42,55 @@ func errnoErr(e syscall.Errno) error { var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") - procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") - procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") - procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") - procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") - procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") - procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") - procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") - procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") - procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") procHcsSaveComputeSystem = modvmcompute.NewProc("HcsSaveComputeSystem") - procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") - procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") - procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") - procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) -func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { + hr = procHcsCloseComputeSystem.Find() if hr != nil { return } - return _hcsEnumerateComputeSystems(_p0, computeSystems, result) + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { - hr = procHcsEnumerateComputeSystems.Find() +func hcsCloseProcess(process HcsProcess) (hr error) { + hr = procHcsCloseProcess.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -123,21 +129,21 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) + _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { return } - return _hcsOpenComputeSystem(_p0, computeSystem, result) + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { - hr = procHcsOpenComputeSystem.Find() +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { + hr = procHcsCreateProcess.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -147,12 +153,21 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { - hr = procHcsCloseComputeSystem.Find() +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) +} + +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + hr = procHcsEnumerateComputeSystems.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -162,21 +177,21 @@ func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { return } - return _hcsStartComputeSystem(computeSystem, _p0, result) + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - hr = procHcsStartComputeSystem.Find() +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + hr = procHcsGetComputeSystemProperties.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -186,21 +201,27 @@ func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { + hr = procHcsGetProcessInfo.Find() if hr != nil { return } - return _hcsShutdownComputeSystem(computeSystem, _p0, result) + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return } -func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - hr = procHcsShutdownComputeSystem.Find() +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { + hr = procHcsGetProcessProperties.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -210,21 +231,21 @@ func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { return } - return _hcsTerminateComputeSystem(computeSystem, _p0, result) + return _hcsGetServiceProperties(_p0, properties, result) } -func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - hr = procHcsTerminateComputeSystem.Find() +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + hr = procHcsGetServiceProperties.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -234,21 +255,21 @@ func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) + _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { return } - return _hcsPauseComputeSystem(computeSystem, _p0, result) + return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - hr = procHcsPauseComputeSystem.Find() +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { + hr = procHcsModifyComputeSystem.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -258,21 +279,21 @@ func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) + _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcsResumeComputeSystem(computeSystem, _p0, result) + return _hcsModifyProcess(process, _p0, result) } -func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - hr = procHcsResumeComputeSystem.Find() +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { + hr = procHcsModifyProcess.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -282,21 +303,21 @@ func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } - return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) + return _hcsModifyServiceSettings(_p0, result) } -func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - hr = procHcsGetComputeSystemProperties.Find() +func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { + hr = procHcsModifyServiceSettings.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -306,21 +327,21 @@ func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(configuration) + _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } - return _hcsModifyComputeSystem(computeSystem, _p0, result) + return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { - hr = procHcsModifyComputeSystem.Find() +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { + hr = procHcsOpenComputeSystem.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -330,21 +351,36 @@ func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, res return } -func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { + hr = procHcsOpenProcess.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) + _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - return _hcsModifyServiceSettings(_p0, result) + return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { - hr = procHcsModifyServiceSettings.Find() +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsPauseComputeSystem.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -369,12 +405,12 @@ func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { - hr = procHcsUnregisterComputeSystemCallback.Find() +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { + hr = procHcsRegisterProcessCallback.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -384,21 +420,21 @@ func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { return } -func hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - return _hcsSaveComputeSystem(computeSystem, _p0, result) + return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { - hr = procHcsSaveComputeSystem.Find() +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsResumeComputeSystem.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsSaveComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -408,36 +444,21 @@ func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **ui return } -func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { +func hcsSaveComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(processParameters) - if hr != nil { - return - } - return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) -} - -func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { - hr = procHcsCreateProcess.Find() + _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return + return _hcsSaveComputeSystem(computeSystem, _p0, result) } -func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { - hr = procHcsOpenProcess.Find() +func _hcsSaveComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsSaveComputeSystem.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + r0, _, _ := syscall.Syscall(procHcsSaveComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -447,27 +468,21 @@ func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, re return } -func hcsCloseProcess(process HcsProcess) (hr error) { - hr = procHcsCloseProcess.Find() +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return + return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { - hr = procHcsTerminateProcess.Find() +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsShutdownComputeSystem.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -501,27 +516,21 @@ func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { - hr = procHcsGetProcessInfo.Find() +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return + return _hcsStartComputeSystem(computeSystem, _p0, result) } -func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { - hr = procHcsGetProcessProperties.Find() +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsStartComputeSystem.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -531,21 +540,21 @@ func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) + _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } - return _hcsModifyProcess(process, _p0, result) + return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { - hr = procHcsModifyProcess.Find() +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { + hr = procHcsTerminateComputeSystem.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -555,21 +564,12 @@ func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (h return } -func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(propertyQuery) - if hr != nil { - return - } - return _hcsGetServiceProperties(_p0, properties, result) -} - -func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - hr = procHcsGetServiceProperties.Find() +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { + hr = procHcsTerminateProcess.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -579,12 +579,12 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { - hr = procHcsRegisterProcessCallback.Find() +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { + hr = procHcsUnregisterComputeSystemCallback.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff diff --git a/internal/wclayer/wclayer.go b/internal/wclayer/wclayer.go index f7f7b89e44..39682b8171 100644 --- a/internal/wclayer/wclayer.go +++ b/internal/wclayer/wclayer.go @@ -4,7 +4,7 @@ package wclayer import "github.com/Microsoft/go-winio/pkg/guid" -//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go wclayer.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go wclayer.go //sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? //sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? diff --git a/internal/wclayer/zsyscall_windows.go b/internal/wclayer/zsyscall_windows.go index 9acbffecfa..0cb509c46f 100644 --- a/internal/wclayer/zsyscall_windows.go +++ b/internal/wclayer/zsyscall_windows.go @@ -40,33 +40,75 @@ func errnoErr(e syscall.Errno) error { } var ( - modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") - modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modvirtdisk = windows.NewLazySystemDLL("virtdisk.dll") + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") + procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") + procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") procActivateLayer = modvmcompute.NewProc("ActivateLayer") procCopyLayer = modvmcompute.NewProc("CopyLayer") procCreateLayer = modvmcompute.NewProc("CreateLayer") procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") - procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") procExportLayer = modvmcompute.NewProc("ExportLayer") - procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") procImportLayer = modvmcompute.NewProc("ImportLayer") procLayerExists = modvmcompute.NewProc("LayerExists") procNameToGuid = modvmcompute.NewProc("NameToGuid") procPrepareLayer = modvmcompute.NewProc("PrepareLayer") - procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") - procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") - procOpenVirtualDisk = modvirtdisk.NewProc("OpenVirtualDisk") - procAttachVirtualDisk = modvirtdisk.NewProc("AttachVirtualDisk") - procGetDiskFreeSpaceExW = modkernel32.NewProc("GetDiskFreeSpaceExW") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") ) +func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(directoryName) + if err != nil { + return + } + return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) +} + +func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { + r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + +func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { + r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + +func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + var _p0 *uint16 + _p0, err = syscall.UTF16PtrFromString(path) + if err != nil { + return + } + return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) +} + +func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { + r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) + if r1 != 0 { + err = errnoErr(e1) + } + return +} + func activateLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) @@ -181,21 +223,21 @@ func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descripto return } -func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { +func deactivateLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } - return _expandSandboxSize(info, _p0, size) + return _deactivateLayer(info, _p0) } -func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { - hr = procExpandSandboxSize.Find() +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + hr = procDeactivateLayer.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -205,21 +247,21 @@ func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { return } -func deactivateLayer(info *driverInfo, id string) (hr error) { +func destroyLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } - return _deactivateLayer(info, _p0) + return _destroyLayer(info, _p0) } -func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { - hr = procDeactivateLayer.Find() +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + hr = procDestroyLayer.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -229,21 +271,21 @@ func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { return } -func destroyLayer(info *driverInfo, id string) (hr error) { +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } - return _destroyLayer(info, _p0) + return _expandSandboxSize(info, _p0, size) } -func _destroyLayer(info *driverInfo, id *uint16) (hr error) { - hr = procDestroyLayer.Find() +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + hr = procExpandSandboxSize.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -286,6 +328,21 @@ func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_L return } +func getBaseImages(buffer **uint16) (hr error) { + hr = procGetBaseImages.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) @@ -310,12 +367,26 @@ func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *u return } -func getBaseImages(buffer **uint16) (hr error) { - hr = procGetBaseImages.Find() +func grantVmAccess(vmid string, filepath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(vmid) if hr != nil { return } - r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(filepath) + if hr != nil { + return + } + return _grantVmAccess(_p0, _p1) +} + +func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { + hr = procGrantVmAccess.Find() + if hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -434,30 +505,6 @@ func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPT return } -func unprepareLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _unprepareLayer(info, _p0) -} - -func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { - hr = procUnprepareLayer.Find() - if hr != nil { - return - } - r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) - } - return -} - func processBaseImage(path string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(path) @@ -506,26 +553,21 @@ func _processUtilityImage(path *uint16) (hr error) { return } -func grantVmAccess(vmid string, filepath string) (hr error) { +func unprepareLayer(info *driverInfo, id string) (hr error) { var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(vmid) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(filepath) + _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } - return _grantVmAccess(_p0, _p1) + return _unprepareLayer(info, _p0) } -func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { - hr = procGrantVmAccess.Find() +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + hr = procUnprepareLayer.Find() if hr != nil { return } - r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -534,45 +576,3 @@ func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { } return } - -func openVirtualDisk(virtualStorageType *virtualStorageType, path string, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(path) - if err != nil { - return - } - return _openVirtualDisk(virtualStorageType, _p0, virtualDiskAccessMask, flags, parameters, handle) -} - -func _openVirtualDisk(virtualStorageType *virtualStorageType, path *uint16, virtualDiskAccessMask uint32, flags uint32, parameters *openVirtualDiskParameters, handle *syscall.Handle) (err error) { - r1, _, e1 := syscall.Syscall6(procOpenVirtualDisk.Addr(), 6, uintptr(unsafe.Pointer(virtualStorageType)), uintptr(unsafe.Pointer(path)), uintptr(virtualDiskAccessMask), uintptr(flags), uintptr(unsafe.Pointer(parameters)), uintptr(unsafe.Pointer(handle))) - if r1 != 0 { - err = errnoErr(e1) - } - return -} - -func attachVirtualDisk(handle syscall.Handle, sd uintptr, flags uint32, providerFlags uint32, params uintptr, overlapped uintptr) (err error) { - r1, _, e1 := syscall.Syscall6(procAttachVirtualDisk.Addr(), 6, uintptr(handle), uintptr(sd), uintptr(flags), uintptr(providerFlags), uintptr(params), uintptr(overlapped)) - if r1 != 0 { - err = errnoErr(e1) - } - return -} - -func getDiskFreeSpaceEx(directoryName string, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { - var _p0 *uint16 - _p0, err = syscall.UTF16PtrFromString(directoryName) - if err != nil { - return - } - return _getDiskFreeSpaceEx(_p0, freeBytesAvailableToCaller, totalNumberOfBytes, totalNumberOfFreeBytes) -} - -func _getDiskFreeSpaceEx(directoryName *uint16, freeBytesAvailableToCaller *int64, totalNumberOfBytes *int64, totalNumberOfFreeBytes *int64) (err error) { - r1, _, e1 := syscall.Syscall6(procGetDiskFreeSpaceExW.Addr(), 4, uintptr(unsafe.Pointer(directoryName)), uintptr(unsafe.Pointer(freeBytesAvailableToCaller)), uintptr(unsafe.Pointer(totalNumberOfBytes)), uintptr(unsafe.Pointer(totalNumberOfFreeBytes)), 0, 0) - if r1 == 0 { - err = errnoErr(e1) - } - return -} diff --git a/internal/winapi/winapi.go b/internal/winapi/winapi.go index d36a5a6ac6..6a90e3a69a 100644 --- a/internal/winapi/winapi.go +++ b/internal/winapi/winapi.go @@ -1,3 +1,3 @@ package winapi -//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -sort=false -output zsyscall_windows.go bindflt.go user.go console.go system.go net.go path.go thread.go jobobject.go logon.go memory.go process.go processor.go devices.go filesystem.go errors.go +//go:generate go run github.com/Microsoft/go-winio/tools/mkwinsyscall -output zsyscall_windows.go ./*.go diff --git a/internal/winapi/zsyscall_windows.go b/internal/winapi/zsyscall_windows.go index 3340f37fbe..47d1209f67 100644 --- a/internal/winapi/zsyscall_windows.go +++ b/internal/winapi/zsyscall_windows.go @@ -40,50 +40,58 @@ func errnoErr(e syscall.Errno) error { } var ( + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") modbindfltapi = windows.NewLazySystemDLL("bindfltapi.dll") - modnetapi32 = windows.NewLazySystemDLL("netapi32.dll") + modcfgmgr32 = windows.NewLazySystemDLL("cfgmgr32.dll") + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + modnetapi32 = windows.NewLazySystemDLL("netapi32.dll") modntdll = windows.NewLazySystemDLL("ntdll.dll") - modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") - modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") - modcfgmgr32 = windows.NewLazySystemDLL("cfgmgr32.dll") + procLogonUserW = modadvapi32.NewProc("LogonUserW") procBfSetupFilter = modbindfltapi.NewProc("BfSetupFilter") - procNetLocalGroupGetInfo = modnetapi32.NewProc("NetLocalGroupGetInfo") - procNetUserAdd = modnetapi32.NewProc("NetUserAdd") - procNetUserDel = modnetapi32.NewProc("NetUserDel") - procNetLocalGroupAddMembers = modnetapi32.NewProc("NetLocalGroupAddMembers") - procCreatePseudoConsole = modkernel32.NewProc("CreatePseudoConsole") - procClosePseudoConsole = modkernel32.NewProc("ClosePseudoConsole") - procResizePseudoConsole = modkernel32.NewProc("ResizePseudoConsole") - procNtQuerySystemInformation = modntdll.NewProc("NtQuerySystemInformation") + procCM_Get_DevNode_PropertyW = modcfgmgr32.NewProc("CM_Get_DevNode_PropertyW") + procCM_Get_Device_ID_ListA = modcfgmgr32.NewProc("CM_Get_Device_ID_ListA") + procCM_Get_Device_ID_List_SizeA = modcfgmgr32.NewProc("CM_Get_Device_ID_List_SizeA") + procCM_Locate_DevNodeW = modcfgmgr32.NewProc("CM_Locate_DevNodeW") procSetJobCompartmentId = modiphlpapi.NewProc("SetJobCompartmentId") - procSearchPathW = modkernel32.NewProc("SearchPathW") + procClosePseudoConsole = modkernel32.NewProc("ClosePseudoConsole") + procCopyFileW = modkernel32.NewProc("CopyFileW") + procCreatePseudoConsole = modkernel32.NewProc("CreatePseudoConsole") procCreateRemoteThread = modkernel32.NewProc("CreateRemoteThread") + procGetActiveProcessorCount = modkernel32.NewProc("GetActiveProcessorCount") procIsProcessInJob = modkernel32.NewProc("IsProcessInJob") - procQueryInformationJobObject = modkernel32.NewProc("QueryInformationJobObject") - procOpenJobObjectW = modkernel32.NewProc("OpenJobObjectW") - procSetIoRateControlInformationJobObject = modkernel32.NewProc("SetIoRateControlInformationJobObject") - procQueryIoRateControlInformationJobObject = modkernel32.NewProc("QueryIoRateControlInformationJobObject") - procNtOpenJobObject = modntdll.NewProc("NtOpenJobObject") - procNtCreateJobObject = modntdll.NewProc("NtCreateJobObject") - procLogonUserW = modadvapi32.NewProc("LogonUserW") procLocalAlloc = modkernel32.NewProc("LocalAlloc") procLocalFree = modkernel32.NewProc("LocalFree") - procNtQueryInformationProcess = modntdll.NewProc("NtQueryInformationProcess") - procGetActiveProcessorCount = modkernel32.NewProc("GetActiveProcessorCount") - procCM_Get_Device_ID_List_SizeA = modcfgmgr32.NewProc("CM_Get_Device_ID_List_SizeA") - procCM_Get_Device_ID_ListA = modcfgmgr32.NewProc("CM_Get_Device_ID_ListA") - procCM_Locate_DevNodeW = modcfgmgr32.NewProc("CM_Locate_DevNodeW") - procCM_Get_DevNode_PropertyW = modcfgmgr32.NewProc("CM_Get_DevNode_PropertyW") - procCopyFileW = modkernel32.NewProc("CopyFileW") + procOpenJobObjectW = modkernel32.NewProc("OpenJobObjectW") + procQueryInformationJobObject = modkernel32.NewProc("QueryInformationJobObject") + procQueryIoRateControlInformationJobObject = modkernel32.NewProc("QueryIoRateControlInformationJobObject") + procResizePseudoConsole = modkernel32.NewProc("ResizePseudoConsole") + procSearchPathW = modkernel32.NewProc("SearchPathW") + procSetIoRateControlInformationJobObject = modkernel32.NewProc("SetIoRateControlInformationJobObject") + procNetLocalGroupAddMembers = modnetapi32.NewProc("NetLocalGroupAddMembers") + procNetLocalGroupGetInfo = modnetapi32.NewProc("NetLocalGroupGetInfo") + procNetUserAdd = modnetapi32.NewProc("NetUserAdd") + procNetUserDel = modnetapi32.NewProc("NetUserDel") procNtCreateFile = modntdll.NewProc("NtCreateFile") - procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") + procNtCreateJobObject = modntdll.NewProc("NtCreateJobObject") procNtOpenDirectoryObject = modntdll.NewProc("NtOpenDirectoryObject") + procNtOpenJobObject = modntdll.NewProc("NtOpenJobObject") procNtQueryDirectoryObject = modntdll.NewProc("NtQueryDirectoryObject") + procNtQueryInformationProcess = modntdll.NewProc("NtQueryInformationProcess") + procNtQuerySystemInformation = modntdll.NewProc("NtQuerySystemInformation") + procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") procRtlNtStatusToDosError = modntdll.NewProc("RtlNtStatusToDosError") ) +func LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) { + r1, _, e1 := syscall.Syscall6(procLogonUserW.Addr(), 6, uintptr(unsafe.Pointer(username)), uintptr(unsafe.Pointer(domain)), uintptr(unsafe.Pointer(password)), uintptr(logonType), uintptr(logonProvider), uintptr(unsafe.Pointer(token))) + if r1 == 0 { + err = errnoErr(e1) + } + return +} + func BfSetupFilter(jobHandle windows.Handle, flags uint32, virtRootPath *uint16, virtTargetPath *uint16, virtExceptions **uint16, virtExceptionPathCount uint32) (hr error) { hr = procBfSetupFilter.Find() if hr != nil { @@ -99,40 +107,30 @@ func BfSetupFilter(jobHandle windows.Handle, flags uint32, virtRootPath *uint16, return } -func netLocalGroupGetInfo(serverName *uint16, groupName *uint16, level uint32, bufptr **byte) (status error) { - r0, _, _ := syscall.Syscall6(procNetLocalGroupGetInfo.Addr(), 4, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(groupName)), uintptr(level), uintptr(unsafe.Pointer(bufptr)), 0, 0) - if r0 != 0 { - status = syscall.Errno(r0) - } - return -} - -func netUserAdd(serverName *uint16, level uint32, buf *byte, parm_err *uint32) (status error) { - r0, _, _ := syscall.Syscall6(procNetUserAdd.Addr(), 4, uintptr(unsafe.Pointer(serverName)), uintptr(level), uintptr(unsafe.Pointer(buf)), uintptr(unsafe.Pointer(parm_err)), 0, 0) - if r0 != 0 { - status = syscall.Errno(r0) - } - return -} - -func netUserDel(serverName *uint16, username *uint16) (status error) { - r0, _, _ := syscall.Syscall(procNetUserDel.Addr(), 2, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(username)), 0) - if r0 != 0 { - status = syscall.Errno(r0) +func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall6(procCM_Get_DevNode_PropertyW.Addr(), 6, uintptr(dnDevInst), uintptr(unsafe.Pointer(propertyKey)), uintptr(unsafe.Pointer(propertyType)), uintptr(unsafe.Pointer(propertyBuffer)), uintptr(unsafe.Pointer(propertyBufferSize)), uintptr(uFlags)) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) } return } -func netLocalGroupAddMembers(serverName *uint16, groupName *uint16, level uint32, buf *byte, totalEntries uint32) (status error) { - r0, _, _ := syscall.Syscall6(procNetLocalGroupAddMembers.Addr(), 5, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(groupName)), uintptr(level), uintptr(unsafe.Pointer(buf)), uintptr(totalEntries), 0) - if r0 != 0 { - status = syscall.Errno(r0) +func CMGetDeviceIDList(pszFilter *byte, buffer *byte, bufferLen uint32, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall6(procCM_Get_Device_ID_ListA.Addr(), 4, uintptr(unsafe.Pointer(pszFilter)), uintptr(unsafe.Pointer(buffer)), uintptr(bufferLen), uintptr(uFlags), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) } return } -func createPseudoConsole(size uint32, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) (hr error) { - r0, _, _ := syscall.Syscall6(procCreatePseudoConsole.Addr(), 5, uintptr(size), uintptr(hInput), uintptr(hOutput), uintptr(dwFlags), uintptr(unsafe.Pointer(hpcon)), 0) +func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall(procCM_Get_Device_ID_List_SizeA.Addr(), 3, uintptr(unsafe.Pointer(pulLen)), uintptr(unsafe.Pointer(pszFilter)), uintptr(uFlags)) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -142,13 +140,17 @@ func createPseudoConsole(size uint32, hInput windows.Handle, hOutput windows.Han return } -func ClosePseudoConsole(hpc windows.Handle) { - syscall.Syscall(procClosePseudoConsole.Addr(), 1, uintptr(hpc), 0, 0) - return +func CMLocateDevNode(pdnDevInst *uint32, pDeviceID string, uFlags uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(pDeviceID) + if hr != nil { + return + } + return _CMLocateDevNode(pdnDevInst, _p0, uFlags) } -func resizePseudoConsole(hPc windows.Handle, size uint32) (hr error) { - r0, _, _ := syscall.Syscall(procResizePseudoConsole.Addr(), 2, uintptr(hPc), uintptr(size), 0) +func _CMLocateDevNode(pdnDevInst *uint32, pDeviceID *uint16, uFlags uint32) (hr error) { + r0, _, _ := syscall.Syscall(procCM_Locate_DevNodeW.Addr(), 3, uintptr(unsafe.Pointer(pdnDevInst)), uintptr(unsafe.Pointer(pDeviceID)), uintptr(uFlags)) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -158,12 +160,6 @@ func resizePseudoConsole(hPc windows.Handle, size uint32) (hr error) { return } -func NtQuerySystemInformation(systemInfoClass int, systemInformation unsafe.Pointer, systemInfoLength uint32, returnLength *uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtQuerySystemInformation.Addr(), 4, uintptr(systemInfoClass), uintptr(systemInformation), uintptr(systemInfoLength), uintptr(unsafe.Pointer(returnLength)), 0, 0) - status = uint32(r0) - return -} - func SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err error) { r0, _, _ := syscall.Syscall(procSetJobCompartmentId.Addr(), 2, uintptr(handle), uintptr(compartmentId), 0) if r0 != 0 { @@ -172,15 +168,30 @@ func SetJobCompartmentId(handle windows.Handle, compartmentId uint32) (win32Err return } -func SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) { - r0, _, e1 := syscall.Syscall6(procSearchPathW.Addr(), 6, uintptr(unsafe.Pointer(lpPath)), uintptr(unsafe.Pointer(lpFileName)), uintptr(unsafe.Pointer(lpExtension)), uintptr(nBufferLength), uintptr(unsafe.Pointer(lpBuffer)), uintptr(unsafe.Pointer(lpFilePath))) - size = uint32(r0) - if size == 0 { +func ClosePseudoConsole(hpc windows.Handle) { + syscall.Syscall(procClosePseudoConsole.Addr(), 1, uintptr(hpc), 0, 0) + return +} + +func CopyFileW(existingFileName *uint16, newFileName *uint16, failIfExists int32) (err error) { + r1, _, e1 := syscall.Syscall(procCopyFileW.Addr(), 3, uintptr(unsafe.Pointer(existingFileName)), uintptr(unsafe.Pointer(newFileName)), uintptr(failIfExists)) + if r1 == 0 { err = errnoErr(e1) } return } +func createPseudoConsole(size uint32, hInput windows.Handle, hOutput windows.Handle, dwFlags uint32, hpcon *windows.Handle) (hr error) { + r0, _, _ := syscall.Syscall6(procCreatePseudoConsole.Addr(), 5, uintptr(size), uintptr(hInput), uintptr(hOutput), uintptr(dwFlags), uintptr(unsafe.Pointer(hpcon)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, stackSize uint32, startAddr uintptr, parameter uintptr, creationFlags uint32, threadID *uint32) (handle windows.Handle, err error) { r0, _, e1 := syscall.Syscall9(procCreateRemoteThread.Addr(), 7, uintptr(process), uintptr(unsafe.Pointer(sa)), uintptr(stackSize), uintptr(startAddr), uintptr(parameter), uintptr(creationFlags), uintptr(unsafe.Pointer(threadID)), 0, 0) handle = windows.Handle(r0) @@ -190,6 +201,12 @@ func CreateRemoteThread(process windows.Handle, sa *windows.SecurityAttributes, return } +func GetActiveProcessorCount(groupNumber uint16) (amount uint32) { + r0, _, _ := syscall.Syscall(procGetActiveProcessorCount.Addr(), 1, uintptr(groupNumber), 0, 0) + amount = uint32(r0) + return +} + func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result *int32) (err error) { r1, _, e1 := syscall.Syscall(procIsProcessInJob.Addr(), 3, uintptr(procHandle), uintptr(jobHandle), uintptr(unsafe.Pointer(result))) if r1 == 0 { @@ -198,11 +215,14 @@ func IsProcessInJob(procHandle windows.Handle, jobHandle windows.Handle, result return } -func QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo unsafe.Pointer, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) { - r1, _, e1 := syscall.Syscall6(procQueryInformationJobObject.Addr(), 5, uintptr(jobHandle), uintptr(infoClass), uintptr(jobObjectInfo), uintptr(jobObjectInformationLength), uintptr(unsafe.Pointer(lpReturnLength)), 0) - if r1 == 0 { - err = errnoErr(e1) - } +func LocalAlloc(flags uint32, size int) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) + ptr = uintptr(r0) + return +} + +func LocalFree(ptr uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) return } @@ -215,10 +235,9 @@ func OpenJobObject(desiredAccess uint32, inheritHandle int32, lpName *uint16) (h return } -func SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) { - r0, _, e1 := syscall.Syscall(procSetIoRateControlInformationJobObject.Addr(), 2, uintptr(jobHandle), uintptr(unsafe.Pointer(ioRateControlInfo)), 0) - ret = uint32(r0) - if ret == 0 { +func QueryInformationJobObject(jobHandle windows.Handle, infoClass uint32, jobObjectInfo unsafe.Pointer, jobObjectInformationLength uint32, lpReturnLength *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procQueryInformationJobObject.Addr(), 5, uintptr(jobHandle), uintptr(infoClass), uintptr(jobObjectInfo), uintptr(jobObjectInformationLength), uintptr(unsafe.Pointer(lpReturnLength)), 0) + if r1 == 0 { err = errnoErr(e1) } return @@ -233,51 +252,8 @@ func QueryIoRateControlInformationJobObject(jobHandle windows.Handle, volumeName return } -func NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { - r0, _, _ := syscall.Syscall(procNtOpenJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) - status = uint32(r0) - return -} - -func NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { - r0, _, _ := syscall.Syscall(procNtCreateJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) - status = uint32(r0) - return -} - -func LogonUser(username *uint16, domain *uint16, password *uint16, logonType uint32, logonProvider uint32, token *windows.Token) (err error) { - r1, _, e1 := syscall.Syscall6(procLogonUserW.Addr(), 6, uintptr(unsafe.Pointer(username)), uintptr(unsafe.Pointer(domain)), uintptr(unsafe.Pointer(password)), uintptr(logonType), uintptr(logonProvider), uintptr(unsafe.Pointer(token))) - if r1 == 0 { - err = errnoErr(e1) - } - return -} - -func LocalAlloc(flags uint32, size int) (ptr uintptr) { - r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) - ptr = uintptr(r0) - return -} - -func LocalFree(ptr uintptr) { - syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) - return -} - -func NtQueryInformationProcess(processHandle windows.Handle, processInfoClass uint32, processInfo unsafe.Pointer, processInfoLength uint32, returnLength *uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtQueryInformationProcess.Addr(), 5, uintptr(processHandle), uintptr(processInfoClass), uintptr(processInfo), uintptr(processInfoLength), uintptr(unsafe.Pointer(returnLength)), 0) - status = uint32(r0) - return -} - -func GetActiveProcessorCount(groupNumber uint16) (amount uint32) { - r0, _, _ := syscall.Syscall(procGetActiveProcessorCount.Addr(), 1, uintptr(groupNumber), 0, 0) - amount = uint32(r0) - return -} - -func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall(procCM_Get_Device_ID_List_SizeA.Addr(), 3, uintptr(unsafe.Pointer(pulLen)), uintptr(unsafe.Pointer(pszFilter)), uintptr(uFlags)) +func resizePseudoConsole(hPc windows.Handle, size uint32) (hr error) { + r0, _, _ := syscall.Syscall(procResizePseudoConsole.Addr(), 2, uintptr(hPc), uintptr(size), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -287,52 +263,52 @@ func CMGetDeviceIDListSize(pulLen *uint32, pszFilter *byte, uFlags uint32) (hr e return } -func CMGetDeviceIDList(pszFilter *byte, buffer *byte, bufferLen uint32, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall6(procCM_Get_Device_ID_ListA.Addr(), 4, uintptr(unsafe.Pointer(pszFilter)), uintptr(unsafe.Pointer(buffer)), uintptr(bufferLen), uintptr(uFlags), 0, 0) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) +func SearchPath(lpPath *uint16, lpFileName *uint16, lpExtension *uint16, nBufferLength uint32, lpBuffer *uint16, lpFilePath *uint16) (size uint32, err error) { + r0, _, e1 := syscall.Syscall6(procSearchPathW.Addr(), 6, uintptr(unsafe.Pointer(lpPath)), uintptr(unsafe.Pointer(lpFileName)), uintptr(unsafe.Pointer(lpExtension)), uintptr(nBufferLength), uintptr(unsafe.Pointer(lpBuffer)), uintptr(unsafe.Pointer(lpFilePath))) + size = uint32(r0) + if size == 0 { + err = errnoErr(e1) } return } -func CMLocateDevNode(pdnDevInst *uint32, pDeviceID string, uFlags uint32) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(pDeviceID) - if hr != nil { - return +func SetIoRateControlInformationJobObject(jobHandle windows.Handle, ioRateControlInfo *JOBOBJECT_IO_RATE_CONTROL_INFORMATION) (ret uint32, err error) { + r0, _, e1 := syscall.Syscall(procSetIoRateControlInformationJobObject.Addr(), 2, uintptr(jobHandle), uintptr(unsafe.Pointer(ioRateControlInfo)), 0) + ret = uint32(r0) + if ret == 0 { + err = errnoErr(e1) } - return _CMLocateDevNode(pdnDevInst, _p0, uFlags) + return } -func _CMLocateDevNode(pdnDevInst *uint32, pDeviceID *uint16, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall(procCM_Locate_DevNodeW.Addr(), 3, uintptr(unsafe.Pointer(pdnDevInst)), uintptr(unsafe.Pointer(pDeviceID)), uintptr(uFlags)) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) +func netLocalGroupAddMembers(serverName *uint16, groupName *uint16, level uint32, buf *byte, totalEntries uint32) (status error) { + r0, _, _ := syscall.Syscall6(procNetLocalGroupAddMembers.Addr(), 5, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(groupName)), uintptr(level), uintptr(unsafe.Pointer(buf)), uintptr(totalEntries), 0) + if r0 != 0 { + status = syscall.Errno(r0) } return } -func CMGetDevNodeProperty(dnDevInst uint32, propertyKey *DevPropKey, propertyType *uint32, propertyBuffer *uint16, propertyBufferSize *uint32, uFlags uint32) (hr error) { - r0, _, _ := syscall.Syscall6(procCM_Get_DevNode_PropertyW.Addr(), 6, uintptr(dnDevInst), uintptr(unsafe.Pointer(propertyKey)), uintptr(unsafe.Pointer(propertyType)), uintptr(unsafe.Pointer(propertyBuffer)), uintptr(unsafe.Pointer(propertyBufferSize)), uintptr(uFlags)) - if int32(r0) < 0 { - if r0&0x1fff0000 == 0x00070000 { - r0 &= 0xffff - } - hr = syscall.Errno(r0) +func netLocalGroupGetInfo(serverName *uint16, groupName *uint16, level uint32, bufptr **byte) (status error) { + r0, _, _ := syscall.Syscall6(procNetLocalGroupGetInfo.Addr(), 4, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(groupName)), uintptr(level), uintptr(unsafe.Pointer(bufptr)), 0, 0) + if r0 != 0 { + status = syscall.Errno(r0) } return } -func CopyFileW(existingFileName *uint16, newFileName *uint16, failIfExists int32) (err error) { - r1, _, e1 := syscall.Syscall(procCopyFileW.Addr(), 3, uintptr(unsafe.Pointer(existingFileName)), uintptr(unsafe.Pointer(newFileName)), uintptr(failIfExists)) - if r1 == 0 { - err = errnoErr(e1) +func netUserAdd(serverName *uint16, level uint32, buf *byte, parm_err *uint32) (status error) { + r0, _, _ := syscall.Syscall6(procNetUserAdd.Addr(), 4, uintptr(unsafe.Pointer(serverName)), uintptr(level), uintptr(unsafe.Pointer(buf)), uintptr(unsafe.Pointer(parm_err)), 0, 0) + if r0 != 0 { + status = syscall.Errno(r0) + } + return +} + +func netUserDel(serverName *uint16, username *uint16) (status error) { + r0, _, _ := syscall.Syscall(procNetUserDel.Addr(), 2, uintptr(unsafe.Pointer(serverName)), uintptr(unsafe.Pointer(username)), 0) + if r0 != 0 { + status = syscall.Errno(r0) } return } @@ -343,8 +319,8 @@ func NtCreateFile(handle *uintptr, accessMask uint32, oa *ObjectAttributes, iosb return } -func NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) +func NtCreateJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtCreateJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) status = uint32(r0) return } @@ -355,6 +331,12 @@ func NtOpenDirectoryObject(handle *uintptr, accessMask uint32, oa *ObjectAttribu return } +func NtOpenJobObject(jobHandle *windows.Handle, desiredAccess uint32, objAttributes *ObjectAttributes) (status uint32) { + r0, _, _ := syscall.Syscall(procNtOpenJobObject.Addr(), 3, uintptr(unsafe.Pointer(jobHandle)), uintptr(desiredAccess), uintptr(unsafe.Pointer(objAttributes))) + status = uint32(r0) + return +} + func NtQueryDirectoryObject(handle uintptr, buffer *byte, length uint32, singleEntry bool, restartScan bool, context *uint32, returnLength *uint32) (status uint32) { var _p0 uint32 if singleEntry { @@ -369,6 +351,24 @@ func NtQueryDirectoryObject(handle uintptr, buffer *byte, length uint32, singleE return } +func NtQueryInformationProcess(processHandle windows.Handle, processInfoClass uint32, processInfo unsafe.Pointer, processInfoLength uint32, returnLength *uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtQueryInformationProcess.Addr(), 5, uintptr(processHandle), uintptr(processInfoClass), uintptr(processInfo), uintptr(processInfoLength), uintptr(unsafe.Pointer(returnLength)), 0) + status = uint32(r0) + return +} + +func NtQuerySystemInformation(systemInfoClass int, systemInformation unsafe.Pointer, systemInfoLength uint32, returnLength *uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtQuerySystemInformation.Addr(), 4, uintptr(systemInfoClass), uintptr(systemInformation), uintptr(systemInfoLength), uintptr(unsafe.Pointer(returnLength)), 0, 0) + status = uint32(r0) + return +} + +func NtSetInformationFile(handle uintptr, iosb *IOStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) + status = uint32(r0) + return +} + func RtlNtStatusToDosError(status uint32) (winerr error) { r0, _, _ := syscall.Syscall(procRtlNtStatusToDosError.Addr(), 1, uintptr(status), 0, 0) if r0 != 0 {