diff --git a/CHANGELOG.md b/CHANGELOG.md index ae4873132..c9fcc62ab 100644 --- a/CHANGELOG.md +++ b/CHANGELOG.md @@ -1,5 +1,19 @@ +## 1.5.0 +### Features +- #299 Pull Codecov bash script into the action + +### Dependencies +- #271 Bump typescript from 4.2.3 to 4.2.4 +- #277 Bump @typescript-eslint/eslint-plugin from 4.16.1 to 4.22.0 +- #278 Bump @typescript-eslint/parser from 4.20.0 to 4.22.0 +- #279 Bump @actions/core from 1.2.6 to 1.2.7 +- #292 Bump ts-jest from 26.5.3 to 26.5.5 +- #293 Bump eslint from 7.21.0 to 7.25.0 +- #297 Bump @types/jest from 26.0.20 to 26.0.23 +- #298 Upgrade to GitHub-native Dependabot + ## 1.4.1 -## Fixes +### Fixes - #287 Update VERSION regex to restrict on digits and dot and move checksums into script ## 1.4.0 diff --git a/dist/codecov b/dist/codecov new file mode 100644 index 000000000..9c5514092 --- /dev/null +++ b/dist/codecov @@ -0,0 +1,1884 @@ +#!/usr/bin/env bash + +# Apache License Version 2.0, January 2004 +# https://github.com/codecov/codecov-bash/blob/master/LICENSE + +set -e +o pipefail + +VERSION="1.0.2" + +codecov_flags=( ) +url="https://codecov.io" +env="$CODECOV_ENV" +service="" +token="" +search_in="" +# shellcheck disable=SC2153 +flags="$CODECOV_FLAGS" +exit_with=0 +curlargs="" +curlawsargs="" +dump="0" +clean="0" +curl_s="-s" +name="$CODECOV_NAME" +include_cov="" +exclude_cov="" +ddp="$HOME/Library/Developer/Xcode/DerivedData" +xp="" +files="" +save_to="" +direct_file_upload="" +cacert="$CODECOV_CA_BUNDLE" +gcov_ignore="-not -path './bower_components/**' -not -path './node_modules/**' -not -path './vendor/**'" +gcov_include="" + +ft_gcov="1" +ft_coveragepy="1" +ft_fix="1" +ft_search="1" +ft_s3="1" +ft_network="1" +ft_xcodellvm="1" +ft_xcodeplist="0" +ft_gcovout="1" +ft_html="0" +ft_yaml="0" + +_git_root=$(git rev-parse --show-toplevel 2>/dev/null || hg root 2>/dev/null || echo "$PWD") +git_root="$_git_root" +remote_addr="" +if [ "$git_root" = "$PWD" ]; +then + git_root="." +fi + +branch_o="" +build_o="" +commit_o="" +pr_o="" +prefix_o="" +network_filter_o="" +search_in_o="" +slug_o="" +tag_o="" +url_o="" +git_ls_files_recurse_submodules_o="" +package="bash" + +commit="$VCS_COMMIT_ID" +branch="$VCS_BRANCH_NAME" +pr="$VCS_PULL_REQUEST" +slug="$VCS_SLUG" +tag="$VCS_TAG" +build_url="$CI_BUILD_URL" +build="$CI_BUILD_ID" +job="$CI_JOB_ID" + +beta_xcode_partials="" + +proj_root="$git_root" +gcov_exe="gcov" +gcov_arg="" + +b="\033[0;36m" +g="\033[0;32m" +r="\033[0;31m" +e="\033[0;90m" +y="\033[0;33m" +x="\033[0m" + +show_help() { +cat << EOF + + Codecov Bash $VERSION + + Global report uploading tool for Codecov + Documentation at https://docs.codecov.io/docs + Contribute at https://github.com/codecov/codecov-bash + + + -h Display this help and exit + -f FILE Target file(s) to upload + + -f "path/to/file" only upload this file + skips searching unless provided patterns below + + -f '!*.bar' ignore all files at pattern *.bar + -f '*.foo' include all files at pattern *.foo + Must use single quotes. + This is non-exclusive, use -s "*.foo" to match specific paths. + + -s DIR Directory to search for coverage reports. + Already searches project root and artifact folders. + -t TOKEN Set the private repository token + (option) set environment variable CODECOV_TOKEN=:uuid + + -t @/path/to/token_file + -t uuid + + -n NAME Custom defined name of the upload. Visible in Codecov UI + + -e ENV Specify environment variables to be included with this build + Also accepting environment variables: CODECOV_ENV=VAR,VAR2 + + -e VAR,VAR2 + + -k prefix Prefix filepaths to help resolve path fixing + + -i prefix Only include files in the network with a certain prefix. Useful for upload-specific path fixing + + -X feature Toggle functionalities + + -X gcov Disable gcov + -X coveragepy Disable python coverage + -X fix Disable report fixing + -X search Disable searching for reports + -X xcode Disable xcode processing + -X network Disable uploading the file network + -X gcovout Disable gcov output + -X html Enable coverage for HTML files + -X recursesubs Enable recurse submodules in git projects when searching for source files + -X yaml Enable coverage for YAML files + + -N The commit SHA of the parent for which you are uploading coverage. If not present, + the parent will be determined using the API of your repository provider. + When using the repository provider's API, the parent is determined via finding + the closest ancestor to the commit. + + -R root dir Used when not in git/hg project to identify project root directory + -F flag Flag the upload to group coverage metrics + + -F unittests This upload is only unittests + -F integration This upload is only integration tests + -F ui,chrome This upload is Chrome - UI tests + + -c Move discovered coverage reports to the trash + -z FILE Upload specified file directly to Codecov and bypass all report generation. + This is inteded to be used only with a pre-formatted Codecov report and is not + expected to work under any other circumstances. + -Z Exit with 1 if not successful. Default will Exit with 0 + + -- xcode -- + -D Custom Derived Data Path for Coverage.profdata and gcov processing + Default '~/Library/Developer/Xcode/DerivedData' + -J Specify packages to build coverage. Uploader will only build these packages. + This can significantly reduces time to build coverage reports. + + -J 'MyAppName' Will match "MyAppName" and "MyAppNameTests" + -J '^ExampleApp$' Will match only "ExampleApp" not "ExampleAppTests" + + -- gcov -- + -g GLOB Paths to ignore during gcov gathering + -G GLOB Paths to include during gcov gathering + -p dir Project root directory + Also used when preparing gcov + -x gcovexe gcov executable to run. Defaults to 'gcov' + -a gcovargs extra arguments to pass to gcov + + -- Override CI Environment Variables -- + These variables are automatically detected by popular CI providers + + -B branch Specify the branch name + -C sha Specify the commit sha + -P pr Specify the pull request number + -b build Specify the build number + -T tag Specify the git tag + + -- Enterprise -- + -u URL Set the target url for Enterprise customers + Not required when retrieving the bash uploader from your CCE + (option) Set environment variable CODECOV_URL=https://my-hosted-codecov.com + -r SLUG owner/repo slug used instead of the private repo token in Enterprise + (option) set environment variable CODECOV_SLUG=:owner/:repo + (option) set in your codecov.yml "codecov.slug" + -S PATH File path to your cacert.pem file used to verify ssl with Codecov Enterprise (optional) + (option) Set environment variable: CODECOV_CA_BUNDLE="/path/to/ca.pem" + -U curlargs Extra curl arguments to communicate with Codecov. e.g., -U "--proxy http://http-proxy" + -A curlargs Extra curl arguments to communicate with AWS. + + -- Debugging -- + -d Don't upload, but dump upload file to stdout + -q PATH Write upload file to path + -K Remove color from the output + -v Verbose mode + +EOF +} + + +say() { + echo -e "$1" +} + + +urlencode() { + echo "$1" | curl -Gso /dev/null -w "%{url_effective}" --data-urlencode @- "" | cut -c 3- | sed -e 's/%0A//' +} + +swiftcov() { + _dir=$(dirname "$1" | sed 's/\(Build\).*/\1/g') + for _type in app framework xctest + do + find "$_dir" -name "*.$_type" | while read -r f + do + _proj=${f##*/} + _proj=${_proj%."$_type"} + if [ "$2" = "" ] || [ "$(echo "$_proj" | grep -i "$2")" != "" ]; + then + say " $g+$x Building reports for $_proj $_type" + dest=$([ -f "$f/$_proj" ] && echo "$f/$_proj" || echo "$f/Contents/MacOS/$_proj") + # shellcheck disable=SC2001 + _proj_name=$(echo "$_proj" | sed -e 's/[[:space:]]//g') + # shellcheck disable=SC2086 + xcrun llvm-cov show $beta_xcode_partials -instr-profile "$1" "$dest" > "$_proj_name.$_type.coverage.txt" \ + || say " ${r}x>${x} llvm-cov failed to produce results for $dest" + fi + done + done +} + + +# Credits to: https://gist.github.com/pkuczynski/8665367 +parse_yaml() { + local prefix=$2 + local s='[[:space:]]*' w='[a-zA-Z0-9_]*' + local fs + fs=$(echo @|tr @ '\034') + sed -ne "s|^\($s\)\($w\)$s:$s\"\(.*\)\"$s\$|\1$fs\2$fs\3|p" \ + -e "s|^\($s\)\($w\)$s:$s\(.*\)$s\$|\1$fs\2$fs\3|p" "$1" | + awk -F"$fs" '{ + indent = length($1)/2; + vname[indent] = $2; + for (i in vname) {if (i > indent) {delete vname[i]}} + if (length($3) > 0) { + vn=""; if (indent > 0) {vn=(vn)(vname[0])("_")} + printf("%s%s%s=\"%s\"\n", "'"$prefix"'",vn, $2, $3); + } + }' +} + +if [ $# != 0 ]; +then + while getopts "a:A:b:B:cC:dD:e:f:F:g:G:hi:J:k:Kn:p:P:Q:q:r:R:s:S:t:T:u:U:vx:X:Zz:N:-" o + do + codecov_flags+=( "$o" ) + case "$o" in + "-") + echo -e "${r}Long options are not supported${x}" + exit 2 + ;; + "?") + ;; + "N") + parent=$OPTARG + ;; + "a") + gcov_arg=$OPTARG + ;; + "A") + curlawsargs="$OPTARG" + ;; + "b") + build_o="$OPTARG" + ;; + "B") + branch_o="$OPTARG" + ;; + "c") + clean="1" + ;; + "C") + commit_o="$OPTARG" + ;; + "d") + dump="1" + ;; + "D") + ddp="$OPTARG" + ;; + "e") + env="$env,$OPTARG" + ;; + "f") + if [ "${OPTARG::1}" = "!" ]; + then + exclude_cov="$exclude_cov -not -path '${OPTARG:1}'" + + elif [[ "$OPTARG" = *"*"* ]]; + then + include_cov="$include_cov -or -path '$OPTARG'" + + else + ft_search=0 + if [ "$files" = "" ]; + then + files="$OPTARG" + else + files="$files +$OPTARG" + fi + fi + ;; + "F") + if [ "$flags" = "" ]; + then + flags="$OPTARG" + else + flags="$flags,$OPTARG" + fi + ;; + "g") + gcov_ignore="$gcov_ignore -not -path '$OPTARG'" + ;; + "G") + gcov_include="$gcov_include -path '$OPTARG'" + ;; + "h") + show_help + exit 0; + ;; + "i") + network_filter_o="$OPTARG" + ;; + "J") + ft_xcodellvm="1" + ft_xcodeplist="0" + if [ "$xp" = "" ]; + then + xp="$OPTARG" + else + xp="$xp\|$OPTARG" + fi + ;; + "k") + prefix_o=$(echo "$OPTARG" | sed -e 's:^/*::' -e 's:/*$::') + ;; + "K") + b="" + g="" + r="" + e="" + x="" + ;; + "n") + name="$OPTARG" + ;; + "p") + proj_root="$OPTARG" + ;; + "P") + pr_o="$OPTARG" + ;; + "Q") + # this is only meant for Codecov packages to overwrite + package="$OPTARG" + ;; + "q") + save_to="$OPTARG" + ;; + "r") + slug_o="$OPTARG" + ;; + "R") + git_root="$OPTARG" + ;; + "s") + if [ "$search_in_o" = "" ]; + then + search_in_o="$OPTARG" + else + search_in_o="$search_in_o $OPTARG" + fi + ;; + "S") + # shellcheck disable=SC2089 + cacert="--cacert \"$OPTARG\"" + ;; + "t") + if [ "${OPTARG::1}" = "@" ]; + then + token=$(< "${OPTARG:1}" tr -d ' \n') + else + token="$OPTARG" + fi + ;; + "T") + tag_o="$OPTARG" + ;; + "u") + url_o=$(echo "$OPTARG" | sed -e 's/\/$//') + ;; + "U") + curlargs="$OPTARG" + ;; + "v") + set -x + curl_s="" + ;; + "x") + gcov_exe=$OPTARG + ;; + "X") + if [ "$OPTARG" = "gcov" ]; + then + ft_gcov="0" + elif [ "$OPTARG" = "coveragepy" ] || [ "$OPTARG" = "py" ]; + then + ft_coveragepy="0" + elif [ "$OPTARG" = "gcovout" ]; + then + ft_gcovout="0" + elif [ "$OPTARG" = "xcodellvm" ]; + then + ft_xcodellvm="1" + ft_xcodeplist="0" + elif [ "$OPTARG" = "fix" ] || [ "$OPTARG" = "fixes" ]; + then + ft_fix="0" + elif [ "$OPTARG" = "xcode" ]; + then + ft_xcodellvm="0" + ft_xcodeplist="0" + elif [ "$OPTARG" = "search" ]; + then + ft_search="0" + elif [ "$OPTARG" = "xcodepartials" ]; + then + beta_xcode_partials="-use-color" + elif [ "$OPTARG" = "network" ]; + then + ft_network="0" + elif [ "$OPTARG" = "s3" ]; + then + ft_s3="0" + elif [ "$OPTARG" = "html" ]; + then + ft_html="1" + elif [ "$OPTARG" = "recursesubs" ]; + then + git_ls_files_recurse_submodules_o="--recurse-submodules" + elif [ "$OPTARG" = "yaml" ]; + then + ft_yaml="1" + fi + ;; + "Z") + exit_with=1 + ;; + "z") + direct_file_upload="$OPTARG" + ft_gcov="0" + ft_coveragepy="0" + ft_fix="0" + ft_search="0" + ft_network="0" + ft_xcodellvm="0" + ft_gcovout="0" + include_cov="" + ;; + *) + echo -e "${r}Unexpected flag not supported${x}" + ;; + esac + done +fi + +say " + _____ _ + / ____| | | +| | ___ __| | ___ ___ _____ __ +| | / _ \\ / _\` |/ _ \\/ __/ _ \\ \\ / / +| |___| (_) | (_| | __/ (_| (_) \\ V / + \\_____\\___/ \\__,_|\\___|\\___\\___/ \\_/ + Bash-$VERSION + +" + +# check for installed tools +# git/hg +if [ "$direct_file_upload" = "" ]; +then + if [ -x "$(command -v git)" ]; + then + say "$b==>$x $(git --version) found" + else + say "$y==>$x git not installed, testing for mercurial" + if [ -x "$(command -v hg)" ]; + then + say "$b==>$x $(hg --version) found" + else + say "$r==>$x git nor mercurial are installed. Uploader may fail or have unintended consequences" + fi + fi +fi +# curl +if [ -x "$(command -v curl)" ]; +then + say "$b==>$x $(curl --version)" +else + say "$r==>$x curl not installed. Exiting." + exit ${exit_with}; +fi + +search_in="$proj_root" + +#shellcheck disable=SC2154 +if [ "$JENKINS_URL" != "" ]; +then + say "$e==>$x Jenkins CI detected." + # https://wiki.jenkins-ci.org/display/JENKINS/Building+a+software+project + # https://wiki.jenkins-ci.org/display/JENKINS/GitHub+pull+request+builder+plugin#GitHubpullrequestbuilderplugin-EnvironmentVariables + service="jenkins" + + # shellcheck disable=SC2154 + if [ "$ghprbSourceBranch" != "" ]; + then + branch="$ghprbSourceBranch" + elif [ "$GIT_BRANCH" != "" ]; + then + branch="$GIT_BRANCH" + elif [ "$BRANCH_NAME" != "" ]; + then + branch="$BRANCH_NAME" + fi + + # shellcheck disable=SC2154 + if [ "$ghprbActualCommit" != "" ]; + then + commit="$ghprbActualCommit" + elif [ "$GIT_COMMIT" != "" ]; + then + commit="$GIT_COMMIT" + fi + + # shellcheck disable=SC2154 + if [ "$ghprbPullId" != "" ]; + then + pr="$ghprbPullId" + elif [ "$CHANGE_ID" != "" ]; + then + pr="$CHANGE_ID" + fi + + build="$BUILD_NUMBER" + # shellcheck disable=SC2153 + build_url=$(urlencode "$BUILD_URL") + +elif [ "$CI" = "true" ] && [ "$TRAVIS" = "true" ] && [ "$SHIPPABLE" != "true" ]; +then + say "$e==>$x Travis CI detected." + # https://docs.travis-ci.com/user/environment-variables/ + service="travis" + commit="${TRAVIS_PULL_REQUEST_SHA:-$TRAVIS_COMMIT}" + build="$TRAVIS_JOB_NUMBER" + pr="$TRAVIS_PULL_REQUEST" + job="$TRAVIS_JOB_ID" + slug="$TRAVIS_REPO_SLUG" + env="$env,TRAVIS_OS_NAME" + tag="$TRAVIS_TAG" + if [ "$TRAVIS_BRANCH" != "$TRAVIS_TAG" ]; + then + branch="${TRAVIS_PULL_REQUEST_BRANCH:-$TRAVIS_BRANCH}" + fi + + language=$(compgen -A variable | grep "^TRAVIS_.*_VERSION$" | head -1) + if [ "$language" != "" ]; + then + env="$env,${!language}" + fi + +elif [ "$CODEBUILD_CI" = "true" ]; +then + say "$e==>$x AWS Codebuild detected." + # https://docs.aws.amazon.com/codebuild/latest/userguide/build-env-ref-env-vars.html + service="codebuild" + commit="$CODEBUILD_RESOLVED_SOURCE_VERSION" + build="$CODEBUILD_BUILD_ID" + branch="$(echo "$CODEBUILD_WEBHOOK_HEAD_REF" | sed 's/^refs\/heads\///')" + if [ "${CODEBUILD_SOURCE_VERSION/pr}" = "$CODEBUILD_SOURCE_VERSION" ] ; then + pr="false" + else + pr="$(echo "$CODEBUILD_SOURCE_VERSION" | sed 's/^pr\///')" + fi + job="$CODEBUILD_BUILD_ID" + slug="$(echo "$CODEBUILD_SOURCE_REPO_URL" | sed 's/^.*:\/\/[^\/]*\///' | sed 's/\.git$//')" + +elif [ "$CI" = "true" ] && [ "$CI_NAME" = "codeship" ]; +then + say "$e==>$x Codeship CI detected." + # https://www.codeship.io/documentation/continuous-integration/set-environment-variables/ + service="codeship" + branch="$CI_BRANCH" + build="$CI_BUILD_NUMBER" + build_url=$(urlencode "$CI_BUILD_URL") + commit="$CI_COMMIT_ID" + +elif [ -n "$CF_BUILD_URL" ] && [ -n "$CF_BUILD_ID" ]; +then + say "$e==>$x Codefresh CI detected." + # https://docs.codefresh.io/v1.0/docs/variables + service="codefresh" + branch="$CF_BRANCH" + build="$CF_BUILD_ID" + build_url=$(urlencode "$CF_BUILD_URL") + commit="$CF_REVISION" + +elif [ "$TEAMCITY_VERSION" != "" ]; +then + say "$e==>$x TeamCity CI detected." + # https://confluence.jetbrains.com/display/TCD8/Predefined+Build+Parameters + # https://confluence.jetbrains.com/plugins/servlet/mobile#content/view/74847298 + if [ "$TEAMCITY_BUILD_BRANCH" = '' ]; + then + echo " Teamcity does not automatically make build parameters available as environment variables." + echo " Add the following environment parameters to the build configuration" + echo " env.TEAMCITY_BUILD_BRANCH = %teamcity.build.branch%" + echo " env.TEAMCITY_BUILD_ID = %teamcity.build.id%" + echo " env.TEAMCITY_BUILD_URL = %teamcity.serverUrl%/viewLog.html?buildId=%teamcity.build.id%" + echo " env.TEAMCITY_BUILD_COMMIT = %system.build.vcs.number%" + echo " env.TEAMCITY_BUILD_REPOSITORY = %vcsroot..url%" + fi + service="teamcity" + branch="$TEAMCITY_BUILD_BRANCH" + build="$TEAMCITY_BUILD_ID" + build_url=$(urlencode "$TEAMCITY_BUILD_URL") + if [ "$TEAMCITY_BUILD_COMMIT" != "" ]; + then + commit="$TEAMCITY_BUILD_COMMIT" + else + commit="$BUILD_VCS_NUMBER" + fi + remote_addr="$TEAMCITY_BUILD_REPOSITORY" + +elif [ "$CI" = "true" ] && [ "$CIRCLECI" = "true" ]; +then + say "$e==>$x Circle CI detected." + # https://circleci.com/docs/environment-variables + service="circleci" + branch="$CIRCLE_BRANCH" + build="$CIRCLE_BUILD_NUM" + job="$CIRCLE_NODE_INDEX" + if [ "$CIRCLE_PROJECT_REPONAME" != "" ]; + then + slug="$CIRCLE_PROJECT_USERNAME/$CIRCLE_PROJECT_REPONAME" + else + # git@github.com:owner/repo.git + slug="${CIRCLE_REPOSITORY_URL##*:}" + # owner/repo.git + slug="${slug%%.git}" + fi + pr="${CIRCLE_PULL_REQUEST##*/}" + commit="$CIRCLE_SHA1" + search_in="$search_in $CIRCLE_ARTIFACTS $CIRCLE_TEST_REPORTS" + +elif [ "$BUDDYBUILD_BRANCH" != "" ]; +then + say "$e==>$x buddybuild detected" + # http://docs.buddybuild.com/v6/docs/custom-prebuild-and-postbuild-steps + service="buddybuild" + branch="$BUDDYBUILD_BRANCH" + build="$BUDDYBUILD_BUILD_NUMBER" + build_url="https://dashboard.buddybuild.com/public/apps/$BUDDYBUILD_APP_ID/build/$BUDDYBUILD_BUILD_ID" + # BUDDYBUILD_TRIGGERED_BY + if [ "$ddp" = "$HOME/Library/Developer/Xcode/DerivedData" ]; + then + ddp="/private/tmp/sandbox/${BUDDYBUILD_APP_ID}/bbtest" + fi + +elif [ "${bamboo_planRepository_revision}" != "" ]; +then + say "$e==>$x Bamboo detected" + # https://confluence.atlassian.com/bamboo/bamboo-variables-289277087.html#Bamboovariables-Build-specificvariables + service="bamboo" + commit="${bamboo_planRepository_revision}" + # shellcheck disable=SC2154 + branch="${bamboo_planRepository_branch}" + # shellcheck disable=SC2154 + build="${bamboo_buildNumber}" + # shellcheck disable=SC2154 + build_url="${bamboo_buildResultsUrl}" + # shellcheck disable=SC2154 + remote_addr="${bamboo_planRepository_repositoryUrl}" + +elif [ "$CI" = "true" ] && [ "$BITRISE_IO" = "true" ]; +then + # http://devcenter.bitrise.io/faq/available-environment-variables/ + say "$e==>$x Bitrise CI detected." + service="bitrise" + branch="$BITRISE_GIT_BRANCH" + build="$BITRISE_BUILD_NUMBER" + build_url=$(urlencode "$BITRISE_BUILD_URL") + pr="$BITRISE_PULL_REQUEST" + if [ "$GIT_CLONE_COMMIT_HASH" != "" ]; + then + commit="$GIT_CLONE_COMMIT_HASH" + fi + +elif [ "$CI" = "true" ] && [ "$SEMAPHORE" = "true" ]; +then + say "$e==>$x Semaphore CI detected." +# https://docs.semaphoreci.com/ci-cd-environment/environment-variables/#semaphore-related + service="semaphore" + branch="$SEMAPHORE_GIT_BRANCH" + build="$SEMAPHORE_WORKFLOW_NUMBER" + job="$SEMAPHORE_JOB_ID" + pr="$PULL_REQUEST_NUMBER" + slug="$SEMAPHORE_REPO_SLUG" + commit="$REVISION" + env="$env,SEMAPHORE_TRIGGER_SOURCE" + +elif [ "$CI" = "true" ] && [ "$BUILDKITE" = "true" ]; +then + say "$e==>$x Buildkite CI detected." + # https://buildkite.com/docs/guides/environment-variables + service="buildkite" + branch="$BUILDKITE_BRANCH" + build="$BUILDKITE_BUILD_NUMBER" + job="$BUILDKITE_JOB_ID" + build_url=$(urlencode "$BUILDKITE_BUILD_URL") + slug="$BUILDKITE_PROJECT_SLUG" + commit="$BUILDKITE_COMMIT" + if [[ "$BUILDKITE_PULL_REQUEST" != "false" ]]; then + pr="$BUILDKITE_PULL_REQUEST" + fi + tag="$BUILDKITE_TAG" + +elif [ "$CI" = "drone" ] || [ "$DRONE" = "true" ]; +then + say "$e==>$x Drone CI detected." + # http://docs.drone.io/env.html + # drone commits are not full shas + service="drone.io" + branch="$DRONE_BRANCH" + build="$DRONE_BUILD_NUMBER" + build_url=$(urlencode "${DRONE_BUILD_LINK}") + pr="$DRONE_PULL_REQUEST" + job="$DRONE_JOB_NUMBER" + tag="$DRONE_TAG" + +elif [ "$CI" = "true" ] && [ "$HEROKU_TEST_RUN_BRANCH" != "" ]; +then + say "$e==>$x Heroku CI detected." + # https://devcenter.heroku.com/articles/heroku-ci#environment-variables + service="heroku" + branch="$HEROKU_TEST_RUN_BRANCH" + build="$HEROKU_TEST_RUN_ID" + commit="$HEROKU_TEST_RUN_COMMIT_VERSION" + +elif [[ "$CI" = "true" || "$CI" = "True" ]] && [[ "$APPVEYOR" = "true" || "$APPVEYOR" = "True" ]]; +then + say "$e==>$x Appveyor CI detected." + # http://www.appveyor.com/docs/environment-variables + service="appveyor" + branch="$APPVEYOR_REPO_BRANCH" + build=$(urlencode "$APPVEYOR_JOB_ID") + pr="$APPVEYOR_PULL_REQUEST_NUMBER" + job="$APPVEYOR_ACCOUNT_NAME%2F$APPVEYOR_PROJECT_SLUG%2F$APPVEYOR_BUILD_VERSION" + slug="$APPVEYOR_REPO_NAME" + commit="$APPVEYOR_REPO_COMMIT" + build_url=$(urlencode "${APPVEYOR_URL}/project/${APPVEYOR_REPO_NAME}/builds/$APPVEYOR_BUILD_ID/job/${APPVEYOR_JOB_ID}") + +elif [ "$CI" = "true" ] && [ "$WERCKER_GIT_BRANCH" != "" ]; +then + say "$e==>$x Wercker CI detected." + # http://devcenter.wercker.com/articles/steps/variables.html + service="wercker" + branch="$WERCKER_GIT_BRANCH" + build="$WERCKER_MAIN_PIPELINE_STARTED" + slug="$WERCKER_GIT_OWNER/$WERCKER_GIT_REPOSITORY" + commit="$WERCKER_GIT_COMMIT" + +elif [ "$CI" = "true" ] && [ "$MAGNUM" = "true" ]; +then + say "$e==>$x Magnum CI detected." + # https://magnum-ci.com/docs/environment + service="magnum" + branch="$CI_BRANCH" + build="$CI_BUILD_NUMBER" + commit="$CI_COMMIT" + +elif [ "$SHIPPABLE" = "true" ]; +then + say "$e==>$x Shippable CI detected." + # http://docs.shippable.com/ci_configure/ + service="shippable" + # shellcheck disable=SC2153 + branch=$([ "$HEAD_BRANCH" != "" ] && echo "$HEAD_BRANCH" || echo "$BRANCH") + build="$BUILD_NUMBER" + build_url=$(urlencode "$BUILD_URL") + pr="$PULL_REQUEST" + slug="$REPO_FULL_NAME" + # shellcheck disable=SC2153 + commit="$COMMIT" + +elif [ "$TDDIUM" = "true" ]; +then + say "Solano CI detected." + # http://docs.solanolabs.com/Setup/tddium-set-environment-variables/ + service="solano" + commit="$TDDIUM_CURRENT_COMMIT" + branch="$TDDIUM_CURRENT_BRANCH" + build="$TDDIUM_TID" + pr="$TDDIUM_PR_ID" + +elif [ "$GREENHOUSE" = "true" ]; +then + say "$e==>$x Greenhouse CI detected." + # http://docs.greenhouseci.com/docs/environment-variables-files + service="greenhouse" + branch="$GREENHOUSE_BRANCH" + build="$GREENHOUSE_BUILD_NUMBER" + build_url=$(urlencode "$GREENHOUSE_BUILD_URL") + pr="$GREENHOUSE_PULL_REQUEST" + commit="$GREENHOUSE_COMMIT" + search_in="$search_in $GREENHOUSE_EXPORT_DIR" + +elif [ "$GITLAB_CI" != "" ]; +then + say "$e==>$x GitLab CI detected." + # http://doc.gitlab.com/ce/ci/variables/README.html + service="gitlab" + branch="${CI_BUILD_REF_NAME:-$CI_COMMIT_REF_NAME}" + build="${CI_BUILD_ID:-$CI_JOB_ID}" + remote_addr="${CI_BUILD_REPO:-$CI_REPOSITORY_URL}" + commit="${CI_BUILD_REF:-$CI_COMMIT_SHA}" + slug="${CI_PROJECT_PATH}" + +elif [ "$GITHUB_ACTIONS" != "" ]; +then + say "$e==>$x GitHub Actions detected." + say " Env vars used:" + say " -> GITHUB_ACTIONS: ${GITHUB_ACTIONS}" + say " -> GITHUB_HEAD_REF: ${GITHUB_HEAD_REF}" + say " -> GITHUB_REF: ${GITHUB_REF}" + say " -> GITHUB_REPOSITORY: ${GITHUB_REPOSITORY}" + say " -> GITHUB_RUN_ID: ${GITHUB_RUN_ID}" + say " -> GITHUB_SHA: ${GITHUB_SHA}" + say " -> GITHUB_WORKFLOW: ${GITHUB_WORKFLOW}" + + # https://github.com/features/actions + service="github-actions" + + # https://help.github.com/en/articles/virtual-environments-for-github-actions#environment-variables + branch="${GITHUB_REF#refs/heads/}" + if [ "$GITHUB_HEAD_REF" != "" ]; + then + # PR refs are in the format: refs/pull/7/merge + pr="${GITHUB_REF#refs/pull/}" + pr="${pr%/merge}" + branch="${GITHUB_HEAD_REF}" + fi + commit="${GITHUB_SHA}" + slug="${GITHUB_REPOSITORY}" + build="${GITHUB_RUN_ID}" + build_url=$(urlencode "http://github.com/${GITHUB_REPOSITORY}/actions/runs/${GITHUB_RUN_ID}") + job="$(urlencode "${GITHUB_WORKFLOW}")" + + # actions/checkout runs in detached HEAD + mc= + if [ -n "$pr" ] && [ "$pr" != false ] && [ "$commit_o" == "" ]; + then + mc=$(git show --no-patch --format="%P" 2>/dev/null || echo "") + + if [[ "$mc" =~ ^[a-z0-9]{40}[[:space:]][a-z0-9]{40}$ ]]; + then + mc=$(echo "$mc" | cut -d' ' -f2) + say " Fixing merge commit SHA $commit -> $mc" + commit=$mc + elif [[ "$mc" = "" ]]; + then + say "$r-> Issue detecting commit SHA. Please run actions/checkout with fetch-depth > 1 or set to 0$x" + fi + fi + +elif [ "$SYSTEM_TEAMFOUNDATIONSERVERURI" != "" ]; +then + say "$e==>$x Azure Pipelines detected." + # https://docs.microsoft.com/en-us/azure/devops/pipelines/build/variables?view=vsts + # https://docs.microsoft.com/en-us/azure/devops/pipelines/build/variables?view=azure-devops&viewFallbackFrom=vsts&tabs=yaml + service="azure_pipelines" + commit="$BUILD_SOURCEVERSION" + build="$BUILD_BUILDNUMBER" + if [ -z "$SYSTEM_PULLREQUEST_PULLREQUESTNUMBER" ]; + then + pr="$SYSTEM_PULLREQUEST_PULLREQUESTID" + else + pr="$SYSTEM_PULLREQUEST_PULLREQUESTNUMBER" + fi + project="${SYSTEM_TEAMPROJECT}" + server_uri="${SYSTEM_TEAMFOUNDATIONSERVERURI}" + job="${BUILD_BUILDID}" + branch="${BUILD_SOURCEBRANCH#"refs/heads/"}" + build_url=$(urlencode "${SYSTEM_TEAMFOUNDATIONSERVERURI}${SYSTEM_TEAMPROJECT}/_build/results?buildId=${BUILD_BUILDID}") + + # azure/pipelines runs in detached HEAD + mc= + if [ -n "$pr" ] && [ "$pr" != false ]; + then + mc=$(git show --no-patch --format="%P" 2>/dev/null || echo "") + + if [[ "$mc" =~ ^[a-z0-9]{40}[[:space:]][a-z0-9]{40}$ ]]; + then + mc=$(echo "$mc" | cut -d' ' -f2) + say " Fixing merge commit SHA $commit -> $mc" + commit=$mc + fi + fi + +elif [ "$CI" = "true" ] && [ "$BITBUCKET_BUILD_NUMBER" != "" ]; +then + say "$e==>$x Bitbucket detected." + # https://confluence.atlassian.com/bitbucket/variables-in-pipelines-794502608.html + service="bitbucket" + branch="$BITBUCKET_BRANCH" + build="$BITBUCKET_BUILD_NUMBER" + slug="$BITBUCKET_REPO_OWNER/$BITBUCKET_REPO_SLUG" + job="$BITBUCKET_BUILD_NUMBER" + pr="$BITBUCKET_PR_ID" + commit="$BITBUCKET_COMMIT" + # See https://jira.atlassian.com/browse/BCLOUD-19393 + if [ "${#commit}" = 12 ]; + then + commit=$(git rev-parse "$BITBUCKET_COMMIT") + fi + +elif [ "$CI" = "true" ] && [ "$BUDDY" = "true" ]; +then + say "$e==>$x Buddy CI detected." + # https://buddy.works/docs/pipelines/environment-variables + service="buddy" + branch="$BUDDY_EXECUTION_BRANCH" + build="$BUDDY_EXECUTION_ID" + build_url=$(urlencode "$BUDDY_EXECUTION_URL") + commit="$BUDDY_EXECUTION_REVISION" + pr="$BUDDY_EXECUTION_PULL_REQUEST_NO" + tag="$BUDDY_EXECUTION_TAG" + slug="$BUDDY_REPO_SLUG" + +elif [ "$CIRRUS_CI" != "" ]; +then + say "$e==>$x Cirrus CI detected." + # https://cirrus-ci.org/guide/writing-tasks/#environment-variables + service="cirrus-ci" + slug="$CIRRUS_REPO_FULL_NAME" + branch="$CIRRUS_BRANCH" + pr="$CIRRUS_PR" + commit="$CIRRUS_CHANGE_IN_REPO" + build="$CIRRUS_BUILD_ID" + build_url=$(urlencode "https://cirrus-ci.com/task/$CIRRUS_TASK_ID") + job="$CIRRUS_TASK_NAME" + +elif [ "$DOCKER_REPO" != "" ]; +then + say "$e==>$x Docker detected." + # https://docs.docker.com/docker-cloud/builds/advanced/ + service="docker" + branch="$SOURCE_BRANCH" + commit="$SOURCE_COMMIT" + slug="$DOCKER_REPO" + tag="$CACHE_TAG" + env="$env,IMAGE_NAME" + +else + say "${r}x>${x} No CI provider detected." + say " Testing inside Docker? ${b}http://docs.codecov.io/docs/testing-with-docker${x}" + say " Testing with Tox? ${b}https://docs.codecov.io/docs/python#section-testing-with-tox${x}" + +fi + +say " ${e}project root:${x} $git_root" + +# find branch, commit, repo from git command +if [ "$GIT_BRANCH" != "" ]; +then + branch="$GIT_BRANCH" + +elif [ "$branch" = "" ]; +then + branch=$(git rev-parse --abbrev-ref HEAD 2>/dev/null || hg branch 2>/dev/null || echo "") + if [ "$branch" = "HEAD" ]; + then + branch="" + fi +fi + +if [ "$commit_o" = "" ]; +then + if [ "$GIT_COMMIT" != "" ]; + then + commit="$GIT_COMMIT" + elif [ "$commit" = "" ]; + then + commit=$(git log -1 --format="%H" 2>/dev/null || hg id -i --debug 2>/dev/null | tr -d '+' || echo "") + fi +else + commit="$commit_o" +fi + +if [ "$CODECOV_TOKEN" != "" ] && [ "$token" = "" ]; +then + say "${e}-->${x} token set from env" + token="$CODECOV_TOKEN" +fi + +if [ "$CODECOV_URL" != "" ] && [ "$url_o" = "" ]; +then + say "${e}-->${x} url set from env" + url_o=$(echo "$CODECOV_URL" | sed -e 's/\/$//') +fi + +if [ "$CODECOV_SLUG" != "" ]; +then + say "${e}-->${x} slug set from env" + slug_o="$CODECOV_SLUG" + +elif [ "$slug" = "" ]; +then + if [ "$remote_addr" = "" ]; + then + remote_addr=$(git config --get remote.origin.url || hg paths default || echo '') + fi + if [ "$remote_addr" != "" ]; + then + if echo "$remote_addr" | grep -q "//"; then + # https + slug=$(echo "$remote_addr" | cut -d / -f 4,5 | sed -e 's/\.git$//') + else + # ssh + slug=$(echo "$remote_addr" | cut -d : -f 2 | sed -e 's/\.git$//') + fi + fi + if [ "$slug" = "/" ]; + then + slug="" + fi +fi + +yaml=$(cd "$git_root" && \ + git ls-files "*codecov.yml" "*codecov.yaml" 2>/dev/null \ + || hg locate "*codecov.yml" "*codecov.yaml" 2>/dev/null \ + || cd "$proj_root" && find . -maxdepth 1 -type f -name '*codecov.y*ml' 2>/dev/null \ + || echo '') +yaml=$(echo "$yaml" | head -1) + +if [ "$yaml" != "" ]; +then + say " ${e}Yaml found at:${x} $yaml" + if [[ "$yaml" != /* ]]; then + # relative path for yaml file given, assume relative to the repo root + yaml="$git_root/$yaml" + fi + config=$(parse_yaml "$yaml" || echo '') + + # TODO validate the yaml here + + if [ "$(echo "$config" | grep 'codecov_token="')" != "" ] && [ "$token" = "" ]; + then + say "${e}-->${x} token set from yaml" + token="$(echo "$config" | grep 'codecov_token="' | sed -e 's/codecov_token="//' | sed -e 's/"\.*//')" + fi + + if [ "$(echo "$config" | grep 'codecov_url="')" != "" ] && [ "$url_o" = "" ]; + then + say "${e}-->${x} url set from yaml" + url_o="$(echo "$config" | grep 'codecov_url="' | sed -e 's/codecov_url="//' | sed -e 's/"\.*//')" + fi + + if [ "$(echo "$config" | grep 'codecov_slug="')" != "" ] && [ "$slug_o" = "" ]; + then + say "${e}-->${x} slug set from yaml" + slug_o="$(echo "$config" | grep 'codecov_slug="' | sed -e 's/codecov_slug="//' | sed -e 's/"\.*//')" + fi +else + say " ${g}Yaml not found, that's ok! Learn more at${x} ${b}http://docs.codecov.io/docs/codecov-yaml${x}" +fi + +if [ "$branch_o" != "" ]; +then + branch=$(urlencode "$branch_o") +else + branch=$(urlencode "$branch") +fi + +if [ "$slug_o" = "" ]; +then + urlencoded_slug=$(urlencode "$slug") +else + urlencoded_slug=$(urlencode "$slug_o") +fi + +query="branch=$branch\ + &commit=$commit\ + &build=$([ "$build_o" = "" ] && echo "$build" || echo "$build_o")\ + &build_url=$build_url\ + &name=$(urlencode "$name")\ + &tag=$([ "$tag_o" = "" ] && echo "$tag" || echo "$tag_o")\ + &slug=$urlencoded_slug\ + &service=$service\ + &flags=$flags\ + &pr=$([ "$pr_o" = "" ] && echo "${pr##\#}" || echo "${pr_o##\#}")\ + &job=$job\ + &cmd_args=$(IFS=,; echo "${codecov_flags[*]}")" + +if [ -n "$project" ] && [ -n "$server_uri" ]; +then + query=$(echo "$query&project=$project&server_uri=$server_uri" | tr -d ' ') +fi + +if [ "$parent" != "" ]; +then + query=$(echo "parent=$parent&$query" | tr -d ' ') +fi + +if [ "$ft_search" = "1" ]; +then + # detect bower comoponents location + bower_components="bower_components" + bower_rc=$(cd "$git_root" && cat .bowerrc 2>/dev/null || echo "") + if [ "$bower_rc" != "" ]; + then + bower_components=$(echo "$bower_rc" | tr -d '\n' | grep '"directory"' | cut -d'"' -f4 | sed -e 's/\/$//') + if [ "$bower_components" = "" ]; + then + bower_components="bower_components" + fi + fi + + # Swift Coverage + if [ "$ft_xcodellvm" = "1" ] && [ -d "$ddp" ]; + then + say "${e}==>${x} Processing Xcode reports via llvm-cov" + say " DerivedData folder: $ddp" + profdata_files=$(find "$ddp" -name '*.profdata' 2>/dev/null || echo '') + if [ "$profdata_files" != "" ]; + then + # xcode via profdata + if [ "$xp" = "" ]; + then + # xp=$(xcodebuild -showBuildSettings 2>/dev/null | grep -i "^\s*PRODUCT_NAME" | sed -e 's/.*= \(.*\)/\1/') + # say " ${e}->${x} Speed up Xcode processing by adding ${e}-J '$xp'${x}" + say " ${g}hint${x} Speed up Swift processing by using use ${g}-J 'AppName'${x} (regexp accepted)" + say " ${g}hint${x} This will remove Pods/ from your report. Also ${b}https://docs.codecov.io/docs/ignoring-paths${x}" + fi + while read -r profdata; + do + if [ "$profdata" != "" ]; + then + swiftcov "$profdata" "$xp" + fi + done <<< "$profdata_files" + else + say " ${e}->${x} No Swift coverage found" + fi + + # Obj-C Gcov Coverage + if [ "$ft_gcov" = "1" ]; + then + say " ${e}->${x} Running $gcov_exe for Obj-C" + if [ "$ft_gcovout" = "0" ]; + then + # suppress gcov output + bash -c "find $ddp -type f -name '*.gcda' $gcov_include $gcov_ignore -exec $gcov_exe -p $gcov_arg {} +" >/dev/null 2>&1 || true + else + bash -c "find $ddp -type f -name '*.gcda' $gcov_include $gcov_ignore -exec $gcov_exe -p $gcov_arg {} +" || true + fi + fi + fi + + if [ "$ft_xcodeplist" = "1" ] && [ -d "$ddp" ]; + then + say "${e}==>${x} Processing Xcode plists" + plists_files=$(find "$ddp" -name '*.xccoverage' 2>/dev/null || echo '') + if [ "$plists_files" != "" ]; + then + while read -r plist; + do + if [ "$plist" != "" ]; + then + say " ${g}Found${x} plist file at $plist" + plutil -convert xml1 -o "$(basename "$plist").plist" -- "$plist" + fi + done <<< "$plists_files" + fi + fi + + # Gcov Coverage + if [ "$ft_gcov" = "1" ]; + then + say "${e}==>${x} Running $gcov_exe in $proj_root ${e}(disable via -X gcov)${x}" + if [ "$ft_gcovout" = "0" ]; + then + # suppress gcov output + bash -c "find $proj_root -type f -name '*.gcno' $gcov_include $gcov_ignore -exec $gcov_exe -pb $gcov_arg {} +" >/dev/null 2>&1 || true + else + bash -c "find $proj_root -type f -name '*.gcno' $gcov_include $gcov_ignore -exec $gcov_exe -pb $gcov_arg {} +" || true + fi + else + say "${e}==>${x} gcov disabled" + fi + + # Python Coverage + if [ "$ft_coveragepy" = "1" ]; + then + if [ ! -f coverage.xml ]; + then + if command -v coverage >/dev/null 2>&1; + then + say "${e}==>${x} Python coveragepy exists ${e}disable via -X coveragepy${x}" + + dotcoverage=$(find "$git_root" -name '.coverage' -or -name '.coverage.*' | head -1 || echo '') + if [ "$dotcoverage" != "" ]; + then + cd "$(dirname "$dotcoverage")" + if [ ! -f .coverage ]; + then + say " ${e}->${x} Running coverage combine" + coverage combine -a + fi + say " ${e}->${x} Running coverage xml" + if [ "$(coverage xml -i)" != "No data to report." ]; + then + files="$files +$PWD/coverage.xml" + else + say " ${r}No data to report.${x}" + fi + cd "$proj_root" + else + say " ${r}No .coverage file found.${x}" + fi + else + say "${e}==>${x} Python coveragepy not found" + fi + fi + else + say "${e}==>${x} Python coveragepy disabled" + fi + + if [ "$search_in_o" != "" ]; + then + # location override + search_in="$search_in_o" + fi + + say "$e==>$x Searching for coverage reports in:" + for _path in $search_in + do + say " ${g}+${x} $_path" + done + + patterns="find $search_in \( \ + -name vendor \ + -or -name '$bower_components' \ + -or -name '.egg-info*' \ + -or -name 'conftest_*.c.gcov' \ + -or -name .env \ + -or -name .envs \ + -or -name .git \ + -or -name .hg \ + -or -name .tox \ + -or -name .venv \ + -or -name .venvs \ + -or -name .virtualenv \ + -or -name .virtualenvs \ + -or -name .yarn-cache \ + -or -name __pycache__ \ + -or -name env \ + -or -name envs \ + -or -name htmlcov \ + -or -name js/generated/coverage \ + -or -name node_modules \ + -or -name venv \ + -or -name venvs \ + -or -name virtualenv \ + -or -name virtualenvs \ + \) -prune -or \ + -type f \( -name '*coverage*.*' \ + -or -name '*.clover' \ + -or -name '*.codecov.*' \ + -or -name '*.gcov' \ + -or -name '*.lcov' \ + -or -name '*.lst' \ + -or -name 'clover.xml' \ + -or -name 'cobertura.xml' \ + -or -name 'codecov.*' \ + -or -name 'cover.out' \ + -or -name 'codecov-result.json' \ + -or -name 'coverage-final.json' \ + -or -name 'excoveralls.json' \ + -or -name 'gcov.info' \ + -or -name 'jacoco*.xml' \ + -or -name '*Jacoco*.xml' \ + -or -name 'lcov.dat' \ + -or -name 'lcov.info' \ + -or -name 'luacov.report.out' \ + -or -name 'naxsi.info' \ + -or -name 'nosetests.xml' \ + -or -name 'report.xml' \ + $include_cov \) \ + $exclude_cov \ + -not -name '*.am' \ + -not -name '*.bash' \ + -not -name '*.bat' \ + -not -name '*.bw' \ + -not -name '*.cfg' \ + -not -name '*.class' \ + -not -name '*.cmake' \ + -not -name '*.cmake' \ + -not -name '*.conf' \ + -not -name '*.coverage' \ + -not -name '*.cp' \ + -not -name '*.cpp' \ + -not -name '*.crt' \ + -not -name '*.css' \ + -not -name '*.csv' \ + -not -name '*.csv' \ + -not -name '*.data' \ + -not -name '*.db' \ + -not -name '*.dox' \ + -not -name '*.ec' \ + -not -name '*.ec' \ + -not -name '*.egg' \ + -not -name '*.el' \ + -not -name '*.env' \ + -not -name '*.erb' \ + -not -name '*.exe' \ + -not -name '*.ftl' \ + -not -name '*.gif' \ + -not -name '*.gradle' \ + -not -name '*.gz' \ + -not -name '*.h' \ + -not -name '*.html' \ + -not -name '*.in' \ + -not -name '*.jade' \ + -not -name '*.jar*' \ + -not -name '*.jpeg' \ + -not -name '*.jpg' \ + -not -name '*.js' \ + -not -name '*.less' \ + -not -name '*.log' \ + -not -name '*.m4' \ + -not -name '*.mak*' \ + -not -name '*.md' \ + -not -name '*.o' \ + -not -name '*.p12' \ + -not -name '*.pem' \ + -not -name '*.png' \ + -not -name '*.pom*' \ + -not -name '*.profdata' \ + -not -name '*.proto' \ + -not -name '*.ps1' \ + -not -name '*.pth' \ + -not -name '*.py' \ + -not -name '*.pyc' \ + -not -name '*.pyo' \ + -not -name '*.rb' \ + -not -name '*.rsp' \ + -not -name '*.rst' \ + -not -name '*.ru' \ + -not -name '*.sbt' \ + -not -name '*.scss' \ + -not -name '*.scss' \ + -not -name '*.serialized' \ + -not -name '*.sh' \ + -not -name '*.snapshot' \ + -not -name '*.sql' \ + -not -name '*.svg' \ + -not -name '*.tar.tz' \ + -not -name '*.template' \ + -not -name '*.whl' \ + -not -name '*.xcconfig' \ + -not -name '*.xcoverage.*' \ + -not -name '*/classycle/report.xml' \ + -not -name '*codecov.yml' \ + -not -name '*~' \ + -not -name '.*coveragerc' \ + -not -name '.coverage*' \ + -not -name 'coverage-summary.json' \ + -not -name 'createdFiles.lst' \ + -not -name 'fullLocaleNames.lst' \ + -not -name 'include.lst' \ + -not -name 'inputFiles.lst' \ + -not -name 'phpunit-code-coverage.xml' \ + -not -name 'phpunit-coverage.xml' \ + -not -name 'remapInstanbul.coverage*.json' \ + -not -name 'scoverage.measurements.*' \ + -not -name 'test_*_coverage.txt' \ + -not -name 'testrunner-coverage*' \ + -print 2>/dev/null" + files=$(eval "$patterns" || echo '') + +elif [ "$include_cov" != "" ]; +then + files=$(eval "find $search_in -type f \( ${include_cov:5} \)$exclude_cov 2>/dev/null" || echo '') +elif [ "$direct_file_upload" != "" ]; +then + files=$direct_file_upload +fi + +num_of_files=$(echo "$files" | wc -l | tr -d ' ') +if [ "$num_of_files" != '' ] && [ "$files" != '' ]; +then + say " ${e}->${x} Found $num_of_files reports" +fi + +# no files found +if [ "$files" = "" ]; +then + say "${r}-->${x} No coverage report found." + say " Please visit ${b}http://docs.codecov.io/docs/supported-languages${x}" + exit ${exit_with}; +fi + +if [ "$ft_network" == "1" ]; +then + say "${e}==>${x} Detecting git/mercurial file structure" + network=$(cd "$git_root" && git ls-files $git_ls_files_recurse_submodules_o 2>/dev/null || hg locate 2>/dev/null || echo "") + if [ "$network" = "" ]; + then + network=$(find "$git_root" \( \ + -name virtualenv \ + -name .virtualenv \ + -name virtualenvs \ + -name .virtualenvs \ + -name '*.png' \ + -name '*.gif' \ + -name '*.jpg' \ + -name '*.jpeg' \ + -name '*.md' \ + -name .env \ + -name .envs \ + -name env \ + -name envs \ + -name .venv \ + -name .venvs \ + -name venv \ + -name venvs \ + -name .git \ + -name .egg-info \ + -name shunit2-2.1.6 \ + -name vendor \ + -name __pycache__ \ + -name node_modules \ + -path "*/$bower_components/*" \ + -path '*/target/delombok/*' \ + -path '*/build/lib/*' \ + -path '*/js/generated/coverage/*' \ + \) -prune -or \ + -type f -print 2>/dev/null || echo '') + fi + + if [ "$network_filter_o" != "" ]; + then + network=$(echo "$network" | grep -e "$network_filter_o/*") + fi + if [ "$prefix_o" != "" ]; + then + network=$(echo "$network" | awk "{print \"$prefix_o/\"\$0}") + fi +fi + +upload_file=$(mktemp /tmp/codecov.XXXXXX) +adjustments_file=$(mktemp /tmp/codecov.adjustments.XXXXXX) + +cleanup() { + rm -f "$upload_file" "$adjustments_file" "$upload_file.gz" +} + +trap cleanup INT ABRT TERM + + +if [ "$env" != "" ]; +then + inc_env="" + say "${e}==>${x} Appending build variables" + for varname in $(echo "$env" | tr ',' ' ') + do + if [ "$varname" != "" ]; + then + say " ${g}+${x} $varname" + inc_env="${inc_env}${varname}=$(eval echo "\$${varname}") +" + fi + done + echo "$inc_env<<<<<< ENV" >> "$upload_file" +fi + +# Append git file list +# write discovered yaml location +if [ "$direct_file_upload" = "" ]; +then + echo "$yaml" >> "$upload_file" +fi + +if [ "$ft_network" == "1" ]; +then + i="woff|eot|otf" # fonts + i="$i|gif|png|jpg|jpeg|psd" # images + i="$i|ptt|pptx|numbers|pages|md|txt|xlsx|docx|doc|pdf|csv" # docs + i="$i|.gitignore" # supporting docs + + if [ "$ft_html" != "1" ]; + then + i="$i|html" + fi + + if [ "$ft_yaml" != "1" ]; + then + i="$i|yml|yaml" + fi + + echo "$network" | grep -vwE "($i)$" >> "$upload_file" +fi +echo "<<<<<< network" >> "$upload_file" + +if [ "$direct_file_upload" = "" ]; +then + fr=0 + say "${e}==>${x} Reading reports" + while IFS='' read -r file; + do + # read the coverage file + if [ "$(echo "$file" | tr -d ' ')" != '' ]; + then + if [ -f "$file" ]; + then + report_len=$(wc -c < "$file") + if [ "$report_len" -ne 0 ]; + then + say " ${g}+${x} $file ${e}bytes=$(echo "$report_len" | tr -d ' ')${x}" + # append to to upload + _filename=$(basename "$file") + if [ "${_filename##*.}" = 'gcov' ]; + then + { + echo "# path=$(echo "$file.reduced" | sed "s|^$git_root/||")"; + # get file name + head -1 "$file"; + } >> "$upload_file" + # 1. remove source code + # 2. remove ending bracket lines + # 3. remove whitespace + # 4. remove contextual lines + # 5. remove function names + awk -F': *' '{print $1":"$2":"}' "$file" \ + | sed '\/: *} *$/d' \ + | sed 's/^ *//' \ + | sed '/^-/d' \ + | sed 's/^function.*/func/' >> "$upload_file" + else + { + echo "# path=${file//^$git_root/||}"; + cat "$file"; + } >> "$upload_file" + fi + echo "<<<<<< EOF" >> "$upload_file" + fr=1 + if [ "$clean" = "1" ]; + then + rm "$file" + fi + else + say " ${r}-${x} Skipping empty file $file" + fi + else + say " ${r}-${x} file not found at $file" + fi + fi + done <<< "$(echo -e "$files")" + + if [ "$fr" = "0" ]; + then + say "${r}-->${x} No coverage data found." + say " Please visit ${b}http://docs.codecov.io/docs/supported-languages${x}" + say " search for your projects language to learn how to collect reports." + exit ${exit_with}; + fi +else + cp "$direct_file_upload" "$upload_file" + if [ "$clean" = "1" ]; + then + rm "$direct_file_upload" + fi +fi + +if [ "$ft_fix" = "1" ]; +then + say "${e}==>${x} Appending adjustments" + say " ${b}https://docs.codecov.io/docs/fixing-reports${x}" + + empty_line='^[[:space:]]*$' + # // + syntax_comment='^[[:space:]]*//.*' + # /* or */ + syntax_comment_block='^[[:space:]]*(\/\*|\*\/)[[:space:]]*$' + # { or } + syntax_bracket='^[[:space:]]*[\{\}][[:space:]]*(//.*)?$' + # [ or ] + syntax_list='^[[:space:]]*[][][[:space:]]*(//.*)?$' + # func ... { + syntax_go_func='^[[:space:]]*[func].*[\{][[:space:]]*$' + + # shellcheck disable=SC2089 + skip_dirs="-not -path '*/$bower_components/*' \ + -not -path '*/node_modules/*'" + + cut_and_join() { + awk 'BEGIN { FS=":" } + $3 ~ /\/\*/ || $3 ~ /\*\// { print $0 ; next } + $1!=key { if (key!="") print out ; key=$1 ; out=$1":"$2 ; next } + { out=out","$2 } + END { print out }' 2>/dev/null + } + + if echo "$network" | grep -m1 '.kt$' 1>/dev/null; + then + # skip brackets and comments + cd "$git_root" && \ + find . -type f \ + -name '*.kt' \ + -exec \ + grep -nIHE -e "$syntax_bracket" \ + -e "$syntax_comment_block" {} \; \ + | cut_and_join \ + >> "$adjustments_file" \ + || echo '' + + # last line in file + cd "$git_root" && \ + find . -type f \ + -name '*.kt' -exec \ + wc -l {} \; \ + | while read -r l; do echo "EOF: $l"; done \ + 2>/dev/null \ + >> "$adjustments_file" \ + || echo '' + fi + + if echo "$network" | grep -m1 '.go$' 1>/dev/null; + then + # skip empty lines, comments, and brackets + cd "$git_root" && \ + find . -type f \ + -not -path '*/vendor/*' \ + -not -path '*/caches/*' \ + -name '*.go' \ + -exec \ + grep -nIHE \ + -e "$empty_line" \ + -e "$syntax_comment" \ + -e "$syntax_comment_block" \ + -e "$syntax_bracket" \ + -e "$syntax_go_func" \ + {} \; \ + | cut_and_join \ + >> "$adjustments_file" \ + || echo '' + fi + + if echo "$network" | grep -m1 '.dart$' 1>/dev/null; + then + # skip brackets + cd "$git_root" && \ + find . -type f \ + -name '*.dart' \ + -exec \ + grep -nIHE \ + -e "$syntax_bracket" \ + {} \; \ + | cut_and_join \ + >> "$adjustments_file" \ + || echo '' + fi + + if echo "$network" | grep -m1 '.php$' 1>/dev/null; + then + # skip empty lines, comments, and brackets + cd "$git_root" && \ + find . -type f \ + -not -path "*/vendor/*" \ + -name '*.php' \ + -exec \ + grep -nIHE \ + -e "$syntax_list" \ + -e "$syntax_bracket" \ + -e '^[[:space:]]*\);[[:space:]]*(//.*)?$' \ + {} \; \ + | cut_and_join \ + >> "$adjustments_file" \ + || echo '' + fi + + if echo "$network" | grep -m1 '\(.c\.cpp\|.cxx\|.h\|.hpp\|.m\|.swift\|.vala\)$' 1>/dev/null; + then + # skip brackets + # shellcheck disable=SC2086,SC2090 + cd "$git_root" && \ + find . -type f \ + $skip_dirs \ + \( \ + -name '*.c' \ + -or -name '*.cpp' \ + -or -name '*.cxx' \ + -or -name '*.h' \ + -or -name '*.hpp' \ + -or -name '*.m' \ + -or -name '*.swift' \ + -or -name '*.vala' \ + \) -exec \ + grep -nIHE \ + -e "$empty_line" \ + -e "$syntax_bracket" \ + -e '// LCOV_EXCL' \ + {} \; \ + | cut_and_join \ + >> "$adjustments_file" \ + || echo '' + + # skip brackets + # shellcheck disable=SC2086,SC2090 + cd "$git_root" && \ + find . -type f \ + $skip_dirs \ + \( \ + -name '*.c' \ + -or -name '*.cpp' \ + -or -name '*.cxx' \ + -or -name '*.h' \ + -or -name '*.hpp' \ + -or -name '*.m' \ + -or -name '*.swift' \ + -or -name '*.vala' \ + \) -exec \ + grep -nIH '// LCOV_EXCL' \ + {} \; \ + >> "$adjustments_file" \ + || echo '' + + fi + + found=$(< "$adjustments_file" tr -d ' ') + + if [ "$found" != "" ]; + then + say " ${g}+${x} Found adjustments" + { + echo "# path=fixes"; + cat "$adjustments_file"; + echo "<<<<<< EOF"; + } >> "$upload_file" + rm -rf "$adjustments_file" + else + say " ${e}->${x} No adjustments found" + fi +fi + +if [ "$url_o" != "" ]; +then + url="$url_o" +fi + +if [ "$dump" != "0" ]; +then + # trim whitespace from query + say " ${e}->${x} Dumping upload file (no upload)" + echo "$url/upload/v4?$(echo "package=$package-$VERSION&token=$token&$query" | tr -d ' ')" + cat "$upload_file" +else + if [ "$save_to" != "" ]; + then + say "${e}==>${x} Copying upload file to ${save_to}" + mkdir -p "$(dirname "$save_to")" + cp "$upload_file" "$save_to" + fi + + say "${e}==>${x} Gzipping contents" + gzip -nf9 "$upload_file" + say " $(du -h "$upload_file.gz")" + + query=$(echo "${query}" | tr -d ' ') + say "${e}==>${x} Uploading reports" + say " ${e}url:${x} $url" + say " ${e}query:${x} $query" + + # Full query without token (to display on terminal output) + queryNoToken=$(echo "package=$package-$VERSION&token=secret&$query" | tr -d ' ') + # now add token to query + query=$(echo "package=$package-$VERSION&token=$token&$query" | tr -d ' ') + + if [ "$ft_s3" = "1" ]; + then + say "${e}->${x} Pinging Codecov" + say "$url/upload/v4?$queryNoToken" + # shellcheck disable=SC2086,2090 + res=$(curl $curl_s -X POST $cacert \ + --retry 5 --retry-delay 2 --connect-timeout 2 \ + -H 'X-Reduced-Redundancy: false' \ + -H 'X-Content-Type: application/x-gzip' \ + -H 'Content-Length: 0' \ + --write-out "\n%{response_code}\n" \ + $curlargs \ + "$url/upload/v4?$query" || true) + # a good reply is "https://codecov.io" + "\n" + "https://storage.googleapis.com/codecov/..." + s3target=$(echo "$res" | sed -n 2p) + status=$(tail -n1 <<< "$res") + + if [ "$status" = "200" ] && [ "$s3target" != "" ]; + then + say "${e}->${x} Uploading to" + say "${s3target}" + + # shellcheck disable=SC2086 + s3=$(curl -fiX PUT \ + --data-binary @"$upload_file.gz" \ + -H 'Content-Type: application/x-gzip' \ + -H 'Content-Encoding: gzip' \ + $curlawsargs \ + "$s3target" || true) + + if [ "$s3" != "" ]; + then + say " ${g}->${x} Reports have been successfully queued for processing at ${b}$(echo "$res" | sed -n 1p)${x}" + exit 0 + else + say " ${r}X>${x} Failed to upload" + fi + elif [ "$status" = "400" ]; + then + # 400 Error + say "${r}${res}${x}" + exit ${exit_with} + else + say "${r}${res}${x}" + fi + fi + + say "${e}==>${x} Uploading to Codecov" + + # shellcheck disable=SC2086,2090 + res=$(curl -X POST $cacert \ + --data-binary @"$upload_file.gz" \ + --retry 5 --retry-delay 2 --connect-timeout 2 \ + -H 'Content-Type: text/plain' \ + -H 'Content-Encoding: gzip' \ + -H 'X-Content-Encoding: gzip' \ + -H 'Accept: text/plain' \ + $curlargs \ + "$url/upload/v2?$query&attempt=$i" || echo 'HTTP 500') + # HTTP 200 + # http://.... + status=$(echo "$res" | head -1 | cut -d' ' -f2) + if [ "$status" = "" ] || [ "$status" = "200" ]; + then + say " Reports have been successfully queued for processing at ${b}$(echo "$res" | head -2 | tail -1)${x}" + exit 0 + else + say " ${g}${res}${x}" + exit ${exit_with} + fi + + say " ${r}X> Failed to upload coverage reports${x}" +fi + +exit ${exit_with} diff --git a/dist/index.js b/dist/index.js index fc6d4b4e1..feac67e67 100644 --- a/dist/index.js +++ b/dist/index.js @@ -42,16 +42,14 @@ module.exports = /******/ // Load entry module and return exports /******/ return __webpack_require__(325); /******/ }; -/******/ // initialize runtime -/******/ runtime(__webpack_require__); /******/ /******/ // run startup /******/ return startup(); /******/ }) /************************************************************************/ -/******/ ([ -/* 0 */, -/* 1 */ +/******/ ({ + +/***/ 1: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; @@ -347,8 +345,8 @@ function copyFile(srcFile, destFile, force) { //# sourceMappingURL=io.js.map /***/ }), -/* 2 */, -/* 3 */ + +/***/ 3: /***/ (function(__unusedmodule, exports) { "use strict"; @@ -393,84 +391,8 @@ exports.isPlainObject = isPlainObject; /***/ }), -/* 4 */, -/* 5 */, -/* 6 */, -/* 7 */ -/***/ (function(module) { - -function Caseless (dict) { - this.dict = dict || {} -} -Caseless.prototype.set = function (name, value, clobber) { - if (typeof name === 'object') { - for (var i in name) { - this.set(i, name[i], value) - } - } else { - if (typeof clobber === 'undefined') clobber = true - var has = this.has(name) - - if (!clobber && has) this.dict[has] = this.dict[has] + ',' + value - else this.dict[has || name] = value - return has - } -} -Caseless.prototype.has = function (name) { - var keys = Object.keys(this.dict) - , name = name.toLowerCase() - ; - for (var i=0;i 0 : it.util.schemaHasRules($schema, it.RULES.all))) { - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - var $key = 'key' + $lvl, - $idx = 'idx' + $lvl, - $i = 'i' + $lvl, - $invalidName = '\' + ' + $key + ' + \'', - $dataNxt = $it.dataLevel = it.dataLevel + 1, - $nextData = 'data' + $dataNxt, - $dataProperties = 'dataProperties' + $lvl, - $ownProperties = it.opts.ownProperties, - $currentBaseId = it.baseId; - if ($ownProperties) { - out += ' var ' + ($dataProperties) + ' = undefined; '; - } - if ($ownProperties) { - out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; - } else { - out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; - } - out += ' var startErrs' + ($lvl) + ' = errors; '; - var $passData = $key; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' All rights reserved. +/***/ 102: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -// If you have no idea what ASN.1 or BER is, see this: -// ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc +"use strict"; -var Ber = __webpack_require__(249); +// For internal use, subject to change. +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; + result["default"] = mod; + return result; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +// We use any as a valid input type +/* eslint-disable @typescript-eslint/no-explicit-any */ +const fs = __importStar(__webpack_require__(747)); +const os = __importStar(__webpack_require__(87)); +const utils_1 = __webpack_require__(82); +function issueCommand(command, message) { + const filePath = process.env[`GITHUB_${command}`]; + if (!filePath) { + throw new Error(`Unable to find environment variable for file command ${command}`); + } + if (!fs.existsSync(filePath)) { + throw new Error(`Missing file at path: ${filePath}`); + } + fs.appendFileSync(filePath, `${utils_1.toCommandValue(message)}${os.EOL}`, { + encoding: 'utf8' + }); +} +exports.issueCommand = issueCommand; +//# sourceMappingURL=file-command.js.map +/***/ }), +/***/ 127: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -// --- Exported API +"use strict"; -module.exports = { +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.getApiBaseUrl = exports.getProxyAgent = exports.getAuthString = void 0; +const httpClient = __importStar(__webpack_require__(539)); +function getAuthString(token, options) { + if (!token && !options.auth) { + throw new Error('Parameter token or opts.auth is required'); + } + else if (token && options.auth) { + throw new Error('Parameters token and opts.auth may not both be specified'); + } + return typeof options.auth === 'string' ? options.auth : `token ${token}`; +} +exports.getAuthString = getAuthString; +function getProxyAgent(destinationUrl) { + const hc = new httpClient.HttpClient(); + return hc.getAgent(destinationUrl); +} +exports.getProxyAgent = getProxyAgent; +function getApiBaseUrl() { + return process.env['GITHUB_API_URL'] || 'https://api.github.com'; +} +exports.getApiBaseUrl = getApiBaseUrl; +//# sourceMappingURL=utils.js.map - Ber: Ber, +/***/ }), - BerReader: Ber.Reader, +/***/ 129: +/***/ (function(module) { - BerWriter: Ber.Writer +module.exports = require("child_process"); -}; +/***/ }), +/***/ 141: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -/***/ }), -/* 63 */, -/* 64 */ -/***/ (function(module, __unusedexports, __webpack_require__) { +"use strict"; -// Copyright 2012 Joyent, Inc. All rights reserved. -var assert = __webpack_require__(477); -var crypto = __webpack_require__(417); +var net = __webpack_require__(631); +var tls = __webpack_require__(16); var http = __webpack_require__(605); +var https = __webpack_require__(211); +var events = __webpack_require__(614); +var assert = __webpack_require__(357); var util = __webpack_require__(669); -var sshpk = __webpack_require__(650); -var jsprim = __webpack_require__(348); -var utils = __webpack_require__(909); - -var sprintf = __webpack_require__(669).format; - -var HASH_ALGOS = utils.HASH_ALGOS; -var PK_ALGOS = utils.PK_ALGOS; -var InvalidAlgorithmError = utils.InvalidAlgorithmError; -var HttpSignatureError = utils.HttpSignatureError; -var validateAlgorithm = utils.validateAlgorithm; - -///--- Globals -var AUTHZ_FMT = - 'Signature keyId="%s",algorithm="%s",headers="%s",signature="%s"'; -///--- Specific Errors +exports.httpOverHttp = httpOverHttp; +exports.httpsOverHttp = httpsOverHttp; +exports.httpOverHttps = httpOverHttps; +exports.httpsOverHttps = httpsOverHttps; -function MissingHeaderError(message) { - HttpSignatureError.call(this, message, MissingHeaderError); -} -util.inherits(MissingHeaderError, HttpSignatureError); -function StrictParsingError(message) { - HttpSignatureError.call(this, message, StrictParsingError); +function httpOverHttp(options) { + var agent = new TunnelingAgent(options); + agent.request = http.request; + return agent; } -util.inherits(StrictParsingError, HttpSignatureError); -/* See createSigner() */ -function RequestSigner(options) { - assert.object(options, 'options'); +function httpsOverHttp(options) { + var agent = new TunnelingAgent(options); + agent.request = http.request; + agent.createSocket = createSecureSocket; + agent.defaultPort = 443; + return agent; +} - var alg = []; - if (options.algorithm !== undefined) { - assert.string(options.algorithm, 'options.algorithm'); - alg = validateAlgorithm(options.algorithm); - } - this.rs_alg = alg; +function httpOverHttps(options) { + var agent = new TunnelingAgent(options); + agent.request = https.request; + return agent; +} - /* - * RequestSigners come in two varieties: ones with an rs_signFunc, and ones - * with an rs_signer. - * - * rs_signFunc-based RequestSigners have to build up their entire signing - * string within the rs_lines array and give it to rs_signFunc as a single - * concat'd blob. rs_signer-based RequestSigners can add a line at a time to - * their signing state by using rs_signer.update(), thus only needing to - * buffer the hash function state and one line at a time. - */ - if (options.sign !== undefined) { - assert.func(options.sign, 'options.sign'); - this.rs_signFunc = options.sign; +function httpsOverHttps(options) { + var agent = new TunnelingAgent(options); + agent.request = https.request; + agent.createSocket = createSecureSocket; + agent.defaultPort = 443; + return agent; +} - } else if (alg[0] === 'hmac' && options.key !== undefined) { - assert.string(options.keyId, 'options.keyId'); - this.rs_keyId = options.keyId; - if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) - throw (new TypeError('options.key for HMAC must be a string or Buffer')); +function TunnelingAgent(options) { + var self = this; + self.options = options || {}; + self.proxyOptions = self.options.proxy || {}; + self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets; + self.requests = []; + self.sockets = []; - /* - * Make an rs_signer for HMACs, not a rs_signFunc -- HMACs digest their - * data in chunks rather than requiring it all to be given in one go - * at the end, so they are more similar to signers than signFuncs. - */ - this.rs_signer = crypto.createHmac(alg[1].toUpperCase(), options.key); - this.rs_signer.sign = function () { - var digest = this.digest('base64'); - return ({ - hashAlgorithm: alg[1], - toString: function () { return (digest); } - }); - }; + self.on('free', function onFree(socket, host, port, localAddress) { + var options = toOptions(host, port, localAddress); + for (var i = 0, len = self.requests.length; i < len; ++i) { + var pending = self.requests[i]; + if (pending.host === options.host && pending.port === options.port) { + // Detect the request to connect same origin server, + // reuse the connection. + self.requests.splice(i, 1); + pending.request.onSocket(socket); + return; + } + } + socket.destroy(); + self.removeSocket(socket); + }); +} +util.inherits(TunnelingAgent, events.EventEmitter); - } else if (options.key !== undefined) { - var key = options.key; - if (typeof (key) === 'string' || Buffer.isBuffer(key)) - key = sshpk.parsePrivateKey(key); +TunnelingAgent.prototype.addRequest = function addRequest(req, host, port, localAddress) { + var self = this; + var options = mergeOptions({request: req}, self.options, toOptions(host, port, localAddress)); - assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), - 'options.key must be a sshpk.PrivateKey'); - this.rs_key = key; + if (self.sockets.length >= this.maxSockets) { + // We are over limit so we'll add it to the queue. + self.requests.push(options); + return; + } - assert.string(options.keyId, 'options.keyId'); - this.rs_keyId = options.keyId; + // If we are under maxSockets create a new one. + self.createSocket(options, function(socket) { + socket.on('free', onFree); + socket.on('close', onCloseOrRemove); + socket.on('agentRemove', onCloseOrRemove); + req.onSocket(socket); - if (!PK_ALGOS[key.type]) { - throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + - 'keys are not supported')); + function onFree() { + self.emit('free', socket, options); } - if (alg[0] !== undefined && key.type !== alg[0]) { - throw (new InvalidAlgorithmError('options.key must be a ' + - alg[0].toUpperCase() + ' key, was given a ' + - key.type.toUpperCase() + ' key instead')); + function onCloseOrRemove(err) { + self.removeSocket(socket); + socket.removeListener('free', onFree); + socket.removeListener('close', onCloseOrRemove); + socket.removeListener('agentRemove', onCloseOrRemove); } + }); +}; - this.rs_signer = key.createSign(alg[1]); +TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { + var self = this; + var placeholder = {}; + self.sockets.push(placeholder); - } else { - throw (new TypeError('options.sign (func) or options.key is required')); + var connectOptions = mergeOptions({}, self.proxyOptions, { + method: 'CONNECT', + path: options.host + ':' + options.port, + agent: false, + headers: { + host: options.host + ':' + options.port + } + }); + if (options.localAddress) { + connectOptions.localAddress = options.localAddress; + } + if (connectOptions.proxyAuth) { + connectOptions.headers = connectOptions.headers || {}; + connectOptions.headers['Proxy-Authorization'] = 'Basic ' + + new Buffer(connectOptions.proxyAuth).toString('base64'); } - this.rs_headers = []; - this.rs_lines = []; -} + debug('making CONNECT request'); + var connectReq = self.request(connectOptions); + connectReq.useChunkedEncodingByDefault = false; // for v0.6 + connectReq.once('response', onResponse); // for v0.6 + connectReq.once('upgrade', onUpgrade); // for v0.6 + connectReq.once('connect', onConnect); // for v0.7 or later + connectReq.once('error', onError); + connectReq.end(); -/** - * Adds a header to be signed, with its value, into this signer. - * - * @param {String} header - * @param {String} value - * @return {String} value written - */ -RequestSigner.prototype.writeHeader = function (header, value) { - assert.string(header, 'header'); - header = header.toLowerCase(); - assert.string(value, 'value'); + function onResponse(res) { + // Very hacky. This is necessary to avoid http-parser leaks. + res.upgrade = true; + } - this.rs_headers.push(header); + function onUpgrade(res, socket, head) { + // Hacky. + process.nextTick(function() { + onConnect(res, socket, head); + }); + } - if (this.rs_signFunc) { - this.rs_lines.push(header + ': ' + value); + function onConnect(res, socket, head) { + connectReq.removeAllListeners(); + socket.removeAllListeners(); - } else { - var line = header + ': ' + value; - if (this.rs_headers.length > 0) - line = '\n' + line; - this.rs_signer.update(line); + if (res.statusCode !== 200) { + debug('tunneling socket could not be established, statusCode=%d', + res.statusCode); + socket.destroy(); + var error = new Error('tunneling socket could not be established, ' + + 'statusCode=' + res.statusCode); + error.code = 'ECONNRESET'; + options.request.emit('error', error); + self.removeSocket(placeholder); + return; + } + if (head.length > 0) { + debug('got illegal response body from proxy'); + socket.destroy(); + var error = new Error('got illegal response body from proxy'); + error.code = 'ECONNRESET'; + options.request.emit('error', error); + self.removeSocket(placeholder); + return; + } + debug('tunneling connection has established'); + self.sockets[self.sockets.indexOf(placeholder)] = socket; + return cb(socket); } - return (value); -}; + function onError(cause) { + connectReq.removeAllListeners(); -/** - * Adds a default Date header, returning its value. - * - * @return {String} - */ -RequestSigner.prototype.writeDateHeader = function () { - return (this.writeHeader('date', jsprim.rfc1123(new Date()))); + debug('tunneling socket could not be established, cause=%s\n', + cause.message, cause.stack); + var error = new Error('tunneling socket could not be established, ' + + 'cause=' + cause.message); + error.code = 'ECONNRESET'; + options.request.emit('error', error); + self.removeSocket(placeholder); + } }; -/** - * Adds the request target line to be signed. - * - * @param {String} method, HTTP method (e.g. 'get', 'post', 'put') - * @param {String} path - */ -RequestSigner.prototype.writeTarget = function (method, path) { - assert.string(method, 'method'); - assert.string(path, 'path'); - method = method.toLowerCase(); - this.writeHeader('(request-target)', method + ' ' + path); -}; +TunnelingAgent.prototype.removeSocket = function removeSocket(socket) { + var pos = this.sockets.indexOf(socket) + if (pos === -1) { + return; + } + this.sockets.splice(pos, 1); -/** - * Calculate the value for the Authorization header on this request - * asynchronously. - * - * @param {Func} callback (err, authz) - */ -RequestSigner.prototype.sign = function (cb) { - assert.func(cb, 'callback'); - - if (this.rs_headers.length < 1) - throw (new Error('At least one header must be signed')); - - var alg, authz; - if (this.rs_signFunc) { - var data = this.rs_lines.join('\n'); - var self = this; - this.rs_signFunc(data, function (err, sig) { - if (err) { - cb(err); - return; - } - try { - assert.object(sig, 'signature'); - assert.string(sig.keyId, 'signature.keyId'); - assert.string(sig.algorithm, 'signature.algorithm'); - assert.string(sig.signature, 'signature.signature'); - alg = validateAlgorithm(sig.algorithm); - - authz = sprintf(AUTHZ_FMT, - sig.keyId, - sig.algorithm, - self.rs_headers.join(' '), - sig.signature); - } catch (e) { - cb(e); - return; - } - cb(null, authz); + var pending = this.requests.shift(); + if (pending) { + // If we have pending requests and a socket gets closed a new one + // needs to be created to take over in the pool for the one that closed. + this.createSocket(pending, function(socket) { + pending.request.onSocket(socket); }); - - } else { - try { - var sigObj = this.rs_signer.sign(); - } catch (e) { - cb(e); - return; - } - alg = (this.rs_alg[0] || this.rs_key.type) + '-' + sigObj.hashAlgorithm; - var signature = sigObj.toString(); - authz = sprintf(AUTHZ_FMT, - this.rs_keyId, - alg, - this.rs_headers.join(' '), - signature); - cb(null, authz); } }; -///--- Exported API +function createSecureSocket(options, cb) { + var self = this; + TunnelingAgent.prototype.createSocket.call(self, options, function(socket) { + var hostHeader = options.request.getHeader('host'); + var tlsOptions = mergeOptions({}, self.options, { + socket: socket, + servername: hostHeader ? hostHeader.replace(/:.*$/, '') : options.host + }); -module.exports = { - /** - * Identifies whether a given object is a request signer or not. - * - * @param {Object} object, the object to identify - * @returns {Boolean} - */ - isSigner: function (obj) { - if (typeof (obj) === 'object' && obj instanceof RequestSigner) - return (true); - return (false); - }, + // 0 is dummy port for v0.6 + var secureSocket = tls.connect(0, tlsOptions); + self.sockets[self.sockets.indexOf(socket)] = secureSocket; + cb(secureSocket); + }); +} - /** - * Creates a request signer, used to asynchronously build a signature - * for a request (does not have to be an http.ClientRequest). - * - * @param {Object} options, either: - * - {String} keyId - * - {String|Buffer} key - * - {String} algorithm (optional, required for HMAC) - * or: - * - {Func} sign (data, cb) - * @return {RequestSigner} - */ - createSigner: function createSigner(options) { - return (new RequestSigner(options)); - }, - /** - * Adds an 'Authorization' header to an http.ClientRequest object. - * - * Note that this API will add a Date header if it's not already set. Any - * other headers in the options.headers array MUST be present, or this - * will throw. - * - * You shouldn't need to check the return type; it's just there if you want - * to be pedantic. - * - * The optional flag indicates whether parsing should use strict enforcement - * of the version draft-cavage-http-signatures-04 of the spec or beyond. - * The default is to be loose and support - * older versions for compatibility. - * - * @param {Object} request an instance of http.ClientRequest. - * @param {Object} options signing parameters object: - * - {String} keyId required. - * - {String} key required (either a PEM or HMAC key). - * - {Array} headers optional; defaults to ['date']. - * - {String} algorithm optional (unless key is HMAC); - * default is the same as the sshpk default - * signing algorithm for the type of key given - * - {String} httpVersion optional; defaults to '1.1'. - * - {Boolean} strict optional; defaults to 'false'. - * @return {Boolean} true if Authorization (and optionally Date) were added. - * @throws {TypeError} on bad parameter types (input). - * @throws {InvalidAlgorithmError} if algorithm was bad or incompatible with - * the given key. - * @throws {sshpk.KeyParseError} if key was bad. - * @throws {MissingHeaderError} if a header to be signed was specified but - * was not present. - */ - signRequest: function signRequest(request, options) { - assert.object(request, 'request'); - assert.object(options, 'options'); - assert.optionalString(options.algorithm, 'options.algorithm'); - assert.string(options.keyId, 'options.keyId'); - assert.optionalArrayOfString(options.headers, 'options.headers'); - assert.optionalString(options.httpVersion, 'options.httpVersion'); - - if (!request.getHeader('Date')) - request.setHeader('Date', jsprim.rfc1123(new Date())); - if (!options.headers) - options.headers = ['date']; - if (!options.httpVersion) - options.httpVersion = '1.1'; - - var alg = []; - if (options.algorithm) { - options.algorithm = options.algorithm.toLowerCase(); - alg = validateAlgorithm(options.algorithm); - } +function toOptions(host, port, localAddress) { + if (typeof host === 'string') { // since v0.10 + return { + host: host, + port: port, + localAddress: localAddress + }; + } + return host; // for v0.11 or later +} - var i; - var stringToSign = ''; - for (i = 0; i < options.headers.length; i++) { - if (typeof (options.headers[i]) !== 'string') - throw new TypeError('options.headers must be an array of Strings'); - - var h = options.headers[i].toLowerCase(); - - if (h === 'request-line') { - if (!options.strict) { - /** - * We allow headers from the older spec drafts if strict parsing isn't - * specified in options. - */ - stringToSign += - request.method + ' ' + request.path + ' HTTP/' + - options.httpVersion; - } else { - /* Strict parsing doesn't allow older draft headers. */ - throw (new StrictParsingError('request-line is not a valid header ' + - 'with strict parsing enabled.')); - } - } else if (h === '(request-target)') { - stringToSign += - '(request-target): ' + request.method.toLowerCase() + ' ' + - request.path; - } else { - var value = request.getHeader(h); - if (value === undefined || value === '') { - throw new MissingHeaderError(h + ' was not in the request'); +function mergeOptions(target) { + for (var i = 1, len = arguments.length; i < len; ++i) { + var overrides = arguments[i]; + if (typeof overrides === 'object') { + var keys = Object.keys(overrides); + for (var j = 0, keyLen = keys.length; j < keyLen; ++j) { + var k = keys[j]; + if (overrides[k] !== undefined) { + target[k] = overrides[k]; } - stringToSign += h + ': ' + value; } - - if ((i + 1) < options.headers.length) - stringToSign += '\n'; - } - - /* This is just for unit tests. */ - if (request.hasOwnProperty('_stringToSign')) { - request._stringToSign = stringToSign; } + } + return target; +} - var signature; - if (alg[0] === 'hmac') { - if (typeof (options.key) !== 'string' && !Buffer.isBuffer(options.key)) - throw (new TypeError('options.key must be a string or Buffer')); - - var hmac = crypto.createHmac(alg[1].toUpperCase(), options.key); - hmac.update(stringToSign); - signature = hmac.digest('base64'); +var debug; +if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) { + debug = function() { + var args = Array.prototype.slice.call(arguments); + if (typeof args[0] === 'string') { + args[0] = 'TUNNEL: ' + args[0]; } else { - var key = options.key; - if (typeof (key) === 'string' || Buffer.isBuffer(key)) - key = sshpk.parsePrivateKey(options.key); - - assert.ok(sshpk.PrivateKey.isPrivateKey(key, [1, 2]), - 'options.key must be a sshpk.PrivateKey'); - - if (!PK_ALGOS[key.type]) { - throw (new InvalidAlgorithmError(key.type.toUpperCase() + ' type ' + - 'keys are not supported')); - } - - if (alg[0] !== undefined && key.type !== alg[0]) { - throw (new InvalidAlgorithmError('options.key must be a ' + - alg[0].toUpperCase() + ' key, was given a ' + - key.type.toUpperCase() + ' key instead')); - } - - var signer = key.createSign(alg[1]); - signer.update(stringToSign); - var sigObj = signer.sign(); - if (!HASH_ALGOS[sigObj.hashAlgorithm]) { - throw (new InvalidAlgorithmError(sigObj.hashAlgorithm.toUpperCase() + - ' is not a supported hash algorithm')); - } - options.algorithm = key.type + '-' + sigObj.hashAlgorithm; - signature = sigObj.toString(); - assert.notStrictEqual(signature, '', 'empty signature produced'); + args.unshift('TUNNEL:'); } + console.error.apply(console, args); + } +} else { + debug = function() {}; +} +exports.debug = debug; // for test - var authzHeaderName = options.authorizationHeaderName || 'Authorization'; - - request.setHeader(authzHeaderName, sprintf(AUTHZ_FMT, - options.keyId, - options.algorithm, - options.headers.join(' '), - signature)); - return true; - } +/***/ }), -}; +/***/ 211: +/***/ (function(module) { +module.exports = require("https"); /***/ }), -/* 65 */, -/* 66 */, -/* 67 */, -/* 68 */ -/***/ (function(__unusedmodule, exports) { - -"use strict"; +/***/ 262: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -Object.defineProperty(exports, '__esModule', { value: true }); +"use strict"; -async function auth(token) { - const tokenType = token.split(/\./).length === 3 ? "app" : /^v\d+\./.test(token) ? "installation" : "oauth"; - return { - type: "token", - token: token, - tokenType - }; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.Context = void 0; +const fs_1 = __webpack_require__(747); +const os_1 = __webpack_require__(87); +class Context { + /** + * Hydrate the context from the environment + */ + constructor() { + this.payload = {}; + if (process.env.GITHUB_EVENT_PATH) { + if (fs_1.existsSync(process.env.GITHUB_EVENT_PATH)) { + this.payload = JSON.parse(fs_1.readFileSync(process.env.GITHUB_EVENT_PATH, { encoding: 'utf8' })); + } + else { + const path = process.env.GITHUB_EVENT_PATH; + process.stdout.write(`GITHUB_EVENT_PATH ${path} does not exist${os_1.EOL}`); + } + } + this.eventName = process.env.GITHUB_EVENT_NAME; + this.sha = process.env.GITHUB_SHA; + this.ref = process.env.GITHUB_REF; + this.workflow = process.env.GITHUB_WORKFLOW; + this.action = process.env.GITHUB_ACTION; + this.actor = process.env.GITHUB_ACTOR; + this.job = process.env.GITHUB_JOB; + this.runNumber = parseInt(process.env.GITHUB_RUN_NUMBER, 10); + this.runId = parseInt(process.env.GITHUB_RUN_ID, 10); + } + get issue() { + const payload = this.payload; + return Object.assign(Object.assign({}, this.repo), { number: (payload.issue || payload.pull_request || payload).number }); + } + get repo() { + if (process.env.GITHUB_REPOSITORY) { + const [owner, repo] = process.env.GITHUB_REPOSITORY.split('/'); + return { owner, repo }; + } + if (this.payload.repository) { + return { + owner: this.payload.repository.owner.login, + repo: this.payload.repository.name + }; + } + throw new Error("context.repo requires a GITHUB_REPOSITORY environment variable like 'owner/repo'"); + } } +exports.Context = Context; +//# sourceMappingURL=context.js.map -/** - * Prefix token for usage in the Authorization header - * - * @param token OAuth token or JSON Web Token - */ -function withAuthorizationPrefix(token) { - if (token.split(/\./).length === 3) { - return `bearer ${token}`; - } +/***/ }), - return `token ${token}`; -} +/***/ 280: +/***/ (function(module) { -async function hook(token, request, route, parameters) { - const endpoint = request.endpoint.merge(route, parameters); - endpoint.headers.authorization = withAuthorizationPrefix(token); - return request(endpoint); -} +module.exports = register; -const createTokenAuth = function createTokenAuth(token) { - if (!token) { - throw new Error("[@octokit/auth-token] No token passed to createTokenAuth"); +function register(state, name, method, options) { + if (typeof method !== "function") { + throw new Error("method for before hook must be a function"); } - if (typeof token !== "string") { - throw new Error("[@octokit/auth-token] Token passed to createTokenAuth is not a string"); + if (!options) { + options = {}; } - token = token.replace(/^(token|bearer) +/i, ""); - return Object.assign(auth.bind(null, token), { - hook: hook.bind(null, token) - }); -}; - -exports.createTokenAuth = createTokenAuth; -//# sourceMappingURL=index.js.map - - -/***/ }), -/* 69 */ -/***/ (function(module) { + if (Array.isArray(name)) { + return name.reverse().reduce(function (callback, name) { + return register.bind(null, state, name, callback, options); + }, method)(); + } -// populates missing values -module.exports = function(dst, src) { + return Promise.resolve().then(function () { + if (!state.registry[name]) { + return method(options); + } - Object.keys(src).forEach(function(prop) - { - dst[prop] = dst[prop] || src[prop]; + return state.registry[name].reduce(function (method, registered) { + return registered.hook.bind(null, method, options); + }, method)(); }); - - return dst; -}; +} /***/ }), -/* 70 */, -/* 71 */, -/* 72 */, -/* 73 */, -/* 74 */, -/* 75 */, -/* 76 */, -/* 77 */, -/* 78 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - read: read, - readSSHPrivate: readSSHPrivate, - write: write -}; -var assert = __webpack_require__(477); -var asn1 = __webpack_require__(62); -var Buffer = __webpack_require__(215).Buffer; -var algs = __webpack_require__(98); -var utils = __webpack_require__(270); -var crypto = __webpack_require__(417); +/***/ 299: +/***/ (function(__unusedmodule, exports) { -var Key = __webpack_require__(852); -var PrivateKey = __webpack_require__(502); -var pem = __webpack_require__(268); -var rfc4253 = __webpack_require__(538); -var SSHBuffer = __webpack_require__(940); -var errors = __webpack_require__(753); +"use strict"; -var bcrypt; -function read(buf, options) { - return (pem.read(buf, options)); -} +Object.defineProperty(exports, '__esModule', { value: true }); -var MAGIC = 'openssh-key-v1'; +const VERSION = "2.11.0"; -function readSSHPrivate(type, buf, options) { - buf = new SSHBuffer({buffer: buf}); +/** + * Some “list” response that can be paginated have a different response structure + * + * They have a `total_count` key in the response (search also has `incomplete_results`, + * /installation/repositories also has `repository_selection`), as well as a key with + * the list of the items which name varies from endpoint to endpoint. + * + * Octokit normalizes these responses so that paginated results are always returned following + * the same structure. One challenge is that if the list response has only one page, no Link + * header is provided, so this header alone is not sufficient to check wether a response is + * paginated or not. + * + * We check if a "total_count" key is present in the response data, but also make sure that + * a "url" property is not, as the "Get the combined status for a specific ref" endpoint would + * otherwise match: https://developer.github.com/v3/repos/statuses/#get-the-combined-status-for-a-specific-ref + */ +function normalizePaginatedListResponse(response) { + const responseNeedsNormalization = "total_count" in response.data && !("url" in response.data); + if (!responseNeedsNormalization) return response; // keep the additional properties intact as there is currently no other way + // to retrieve the same information. - var magic = buf.readCString(); - assert.strictEqual(magic, MAGIC, 'bad magic string'); + const incompleteResults = response.data.incomplete_results; + const repositorySelection = response.data.repository_selection; + const totalCount = response.data.total_count; + delete response.data.incomplete_results; + delete response.data.repository_selection; + delete response.data.total_count; + const namespaceKey = Object.keys(response.data)[0]; + const data = response.data[namespaceKey]; + response.data = data; - var cipher = buf.readString(); - var kdf = buf.readString(); - var kdfOpts = buf.readBuffer(); + if (typeof incompleteResults !== "undefined") { + response.data.incomplete_results = incompleteResults; + } - var nkeys = buf.readInt(); - if (nkeys !== 1) { - throw (new Error('OpenSSH-format key file contains ' + - 'multiple keys: this is unsupported.')); - } + if (typeof repositorySelection !== "undefined") { + response.data.repository_selection = repositorySelection; + } - var pubKey = buf.readBuffer(); + response.data.total_count = totalCount; + return response; +} - if (type === 'public') { - assert.ok(buf.atEnd(), 'excess bytes left after key'); - return (rfc4253.read(pubKey)); - } +function iterator(octokit, route, parameters) { + const options = typeof route === "function" ? route.endpoint(parameters) : octokit.request.endpoint(route, parameters); + const requestMethod = typeof route === "function" ? route : octokit.request; + const method = options.method; + const headers = options.headers; + let url = options.url; + return { + [Symbol.asyncIterator]: () => ({ + async next() { + if (!url) return { + done: true + }; + const response = await requestMethod({ + method, + url, + headers + }); + const normalizedResponse = normalizePaginatedListResponse(response); // `response.headers.link` format: + // '; rel="next", ; rel="last"' + // sets `url` to undefined if "next" URL is not present or `link` header is not set - var privKeyBlob = buf.readBuffer(); - assert.ok(buf.atEnd(), 'excess bytes left after key'); + url = ((normalizedResponse.headers.link || "").match(/<([^>]+)>;\s*rel="next"/) || [])[1]; + return { + value: normalizedResponse + }; + } - var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts }); - switch (kdf) { - case 'none': - if (cipher !== 'none') { - throw (new Error('OpenSSH-format key uses KDF "none" ' + - 'but specifies a cipher other than "none"')); - } - break; - case 'bcrypt': - var salt = kdfOptsBuf.readBuffer(); - var rounds = kdfOptsBuf.readInt(); - var cinf = utils.opensshCipherInfo(cipher); - if (bcrypt === undefined) { - bcrypt = __webpack_require__(641); - } + }) + }; +} - if (typeof (options.passphrase) === 'string') { - options.passphrase = Buffer.from(options.passphrase, - 'utf-8'); - } - if (!Buffer.isBuffer(options.passphrase)) { - throw (new errors.KeyEncryptedError( - options.filename, 'OpenSSH')); - } +function paginate(octokit, route, parameters, mapFn) { + if (typeof parameters === "function") { + mapFn = parameters; + parameters = undefined; + } - var pass = new Uint8Array(options.passphrase); - var salti = new Uint8Array(salt); - /* Use the pbkdf to derive both the key and the IV. */ - var out = new Uint8Array(cinf.keySize + cinf.blockSize); - var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, - out, out.length, rounds); - if (res !== 0) { - throw (new Error('bcrypt_pbkdf function returned ' + - 'failure, parameters invalid')); - } - out = Buffer.from(out); - var ckey = out.slice(0, cinf.keySize); - var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); - var cipherStream = crypto.createDecipheriv(cinf.opensslName, - ckey, iv); - cipherStream.setAutoPadding(false); - var chunk, chunks = []; - cipherStream.once('error', function (e) { - if (e.toString().indexOf('bad decrypt') !== -1) { - throw (new Error('Incorrect passphrase ' + - 'supplied, could not decrypt key')); - } - throw (e); - }); - cipherStream.write(privKeyBlob); - cipherStream.end(); - while ((chunk = cipherStream.read()) !== null) - chunks.push(chunk); - privKeyBlob = Buffer.concat(chunks); - break; - default: - throw (new Error( - 'OpenSSH-format key uses unknown KDF "' + kdf + '"')); - } + return gather(octokit, [], iterator(octokit, route, parameters)[Symbol.asyncIterator](), mapFn); +} - buf = new SSHBuffer({buffer: privKeyBlob}); +function gather(octokit, results, iterator, mapFn) { + return iterator.next().then(result => { + if (result.done) { + return results; + } - var checkInt1 = buf.readInt(); - var checkInt2 = buf.readInt(); - if (checkInt1 !== checkInt2) { - throw (new Error('Incorrect passphrase supplied, could not ' + - 'decrypt key')); - } + let earlyExit = false; - var ret = {}; - var key = rfc4253.readInternal(ret, 'private', buf.remainder()); + function done() { + earlyExit = true; + } - buf.skip(ret.consumed); + results = results.concat(mapFn ? mapFn(result.value, done) : result.value.data); - var comment = buf.readString(); - key.comment = comment; + if (earlyExit) { + return results; + } - return (key); + return gather(octokit, results, iterator, mapFn); + }); } -function write(key, options) { - var pubKey; - if (PrivateKey.isPrivateKey(key)) - pubKey = key.toPublic(); - else - pubKey = key; - - var cipher = 'none'; - var kdf = 'none'; - var kdfopts = Buffer.alloc(0); - var cinf = { blockSize: 8 }; - var passphrase; - if (options !== undefined) { - passphrase = options.passphrase; - if (typeof (passphrase) === 'string') - passphrase = Buffer.from(passphrase, 'utf-8'); - if (passphrase !== undefined) { - assert.buffer(passphrase, 'options.passphrase'); - assert.optionalString(options.cipher, 'options.cipher'); - cipher = options.cipher; - if (cipher === undefined) - cipher = 'aes128-ctr'; - cinf = utils.opensshCipherInfo(cipher); - kdf = 'bcrypt'; - } - } +const composePaginateRest = Object.assign(paginate, { + iterator +}); - var privBuf; - if (PrivateKey.isPrivateKey(key)) { - privBuf = new SSHBuffer({}); - var checkInt = crypto.randomBytes(4).readUInt32BE(0); - privBuf.writeInt(checkInt); - privBuf.writeInt(checkInt); - privBuf.write(key.toBuffer('rfc4253')); - privBuf.writeString(key.comment || ''); - - var n = 1; - while (privBuf._offset % cinf.blockSize !== 0) - privBuf.writeChar(n++); - privBuf = privBuf.toBuffer(); - } +/** + * @param octokit Octokit instance + * @param options Options passed to Octokit constructor + */ - switch (kdf) { - case 'none': - break; - case 'bcrypt': - var salt = crypto.randomBytes(16); - var rounds = 16; - var kdfssh = new SSHBuffer({}); - kdfssh.writeBuffer(salt); - kdfssh.writeInt(rounds); - kdfopts = kdfssh.toBuffer(); - - if (bcrypt === undefined) { - bcrypt = __webpack_require__(641); - } - var pass = new Uint8Array(passphrase); - var salti = new Uint8Array(salt); - /* Use the pbkdf to derive both the key and the IV. */ - var out = new Uint8Array(cinf.keySize + cinf.blockSize); - var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, - out, out.length, rounds); - if (res !== 0) { - throw (new Error('bcrypt_pbkdf function returned ' + - 'failure, parameters invalid')); - } - out = Buffer.from(out); - var ckey = out.slice(0, cinf.keySize); - var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); - - var cipherStream = crypto.createCipheriv(cinf.opensslName, - ckey, iv); - cipherStream.setAutoPadding(false); - var chunk, chunks = []; - cipherStream.once('error', function (e) { - throw (e); - }); - cipherStream.write(privBuf); - cipherStream.end(); - while ((chunk = cipherStream.read()) !== null) - chunks.push(chunk); - privBuf = Buffer.concat(chunks); - break; - default: - throw (new Error('Unsupported kdf ' + kdf)); - } - - var buf = new SSHBuffer({}); - - buf.writeCString(MAGIC); - buf.writeString(cipher); /* cipher */ - buf.writeString(kdf); /* kdf */ - buf.writeBuffer(kdfopts); /* kdfoptions */ - - buf.writeInt(1); /* nkeys */ - buf.writeBuffer(pubKey.toBuffer('rfc4253')); - - if (privBuf) - buf.writeBuffer(privBuf); - - buf = buf.toBuffer(); - - var header; - if (PrivateKey.isPrivateKey(key)) - header = 'OPENSSH PRIVATE KEY'; - else - header = 'OPENSSH PUBLIC KEY'; - - var tmp = buf.toString('base64'); - var len = tmp.length + (tmp.length / 70) + - 18 + 16 + header.length*2 + 10; - buf = Buffer.alloc(len); - var o = 0; - o += buf.write('-----BEGIN ' + header + '-----\n', o); - for (var i = 0; i < tmp.length; ) { - var limit = i + 70; - if (limit > tmp.length) - limit = tmp.length; - o += buf.write(tmp.slice(i, limit), o); - buf[o++] = 10; - i = limit; - } - o += buf.write('-----END ' + header + '-----\n', o); - - return (buf.slice(0, o)); +function paginateRest(octokit) { + return { + paginate: Object.assign(paginate.bind(null, octokit), { + iterator: iterator.bind(null, octokit) + }) + }; } +paginateRest.VERSION = VERSION; +exports.composePaginateRest = composePaginateRest; +exports.paginateRest = paginateRest; +//# sourceMappingURL=index.js.map -/***/ }), -/* 79 */, -/* 80 */, -/* 81 */, -/* 82 */ -/***/ (function(__unusedmodule, exports) { - -"use strict"; - -// We use any as a valid input type -/* eslint-disable @typescript-eslint/no-explicit-any */ -Object.defineProperty(exports, "__esModule", { value: true }); -/** - * Sanitizes an input into a string so it can be passed into issueCommand safely - * @param input input to sanitize into a string - */ -function toCommandValue(input) { - if (input === null || input === undefined) { - return ''; - } - else if (typeof input === 'string' || input instanceof String) { - return input; - } - return JSON.stringify(input); -} -exports.toCommandValue = toCommandValue; -//# sourceMappingURL=utils.js.map /***/ }), -/* 83 */, -/* 84 */, -/* 85 */ -/***/ (function(module) { + +/***/ 325: +/***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; -module.exports = function generate__limitItems(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $errorKeyword; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $op = $keyword == 'maxItems' ? '>' : '<'; - out += 'if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { '; - var $errorKeyword = $keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT have '; - if ($keyword == 'maxItems') { - out += 'more'; - } else { - out += 'fewer'; - } - out += ' than '; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + ($schema); - } - out += ' items\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; +exports.__esModule = true; +var core = __webpack_require__(470); +var exec = __webpack_require__(986); +var fs = __webpack_require__(747); +var buildExec_1 = __webpack_require__(983); +var codecovScript = fs.readFileSync(__webpack_require__.ab + "codecov"); +var failCi; +try { + var _a = buildExec_1["default"](), execArgs_1 = _a.execArgs, options_1 = _a.options, filepath_1 = _a.filepath, failCi_1 = _a.failCi; + fs.writeFile(filepath_1, codecovScript, function (err) { + if (err && failCi_1) { + throw err; + } + else if (err) { + core.warning("Codecov warning: " + err.message); + } + exec.exec('bash', execArgs_1, options_1)["catch"](function (err) { + if (failCi_1) { + core.setFailed("Codecov failed with the following error: " + err.message); + } + else { + core.warning("Codecov warning: " + err.message); + } + }) + .then(function () { + unlinkFile(); + }); + var unlinkFile = function () { + fs.unlink(filepath_1, function (err) { + if (err && failCi_1) { + throw err; + } + else if (err) { + core.warning("Codecov warning: " + err.message); + } + }); + }; + }); +} +catch (error) { + if (failCi) { + core.setFailed("Codecov failed with the following error: " + error.message); } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; + else { + core.warning("Codecov warning: " + error.message); } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; } /***/ }), -/* 86 */, -/* 87 */ -/***/ (function(module) { - -module.exports = require("os"); - -/***/ }), -/* 88 */, -/* 89 */, -/* 90 */, -/* 91 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -var serialOrdered = __webpack_require__(892); - -// Public API -module.exports = serial; -/** - * Runs iterator over provided array elements in series - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {function} callback - invoked when all elements processed - * @returns {function} - jobs terminator - */ -function serial(list, iterator, callback) -{ - return serialOrdered(list, iterator, null, callback); -} +/***/ 357: +/***/ (function(module) { +module.exports = require("assert"); /***/ }), -/* 92 */, -/* 93 */, -/* 94 */, -/* 95 */, -/* 96 */, -/* 97 */, -/* 98 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var Buffer = __webpack_require__(215).Buffer; - -var algInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y'], - sizePart: 'p' - }, - 'rsa': { - parts: ['e', 'n'], - sizePart: 'n' - }, - 'ecdsa': { - parts: ['curve', 'Q'], - sizePart: 'Q' - }, - 'ed25519': { - parts: ['A'], - sizePart: 'A' - } -}; -algInfo['curve25519'] = algInfo['ed25519']; - -var algPrivInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y', 'x'] - }, - 'rsa': { - parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] - }, - 'ecdsa': { - parts: ['curve', 'Q', 'd'] - }, - 'ed25519': { - parts: ['A', 'k'] - } -}; -algPrivInfo['curve25519'] = algPrivInfo['ed25519']; - -var hashAlgs = { - 'md5': true, - 'sha1': true, - 'sha256': true, - 'sha384': true, - 'sha512': true -}; - -/* - * Taken from - * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf - */ -var curves = { - 'nistp256': { - size: 256, - pkcs8oid: '1.2.840.10045.3.1.7', - p: Buffer.from(('00' + - 'ffffffff 00000001 00000000 00000000' + - '00000000 ffffffff ffffffff ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF 00000001 00000000 00000000' + - '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + - '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'c49d3608 86e70493 6a6678e1 139d26b7' + - '819f7e90'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff 00000000 ffffffff ffffffff' + - 'bce6faad a7179e84 f3b9cac2 fc632551'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + - '77037d81 2deb33a0 f4a13945 d898c296' + - '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + - '2bce3357 6b315ece cbb64068 37bf51f5'). - replace(/ /g, ''), 'hex') - }, - 'nistp384': { - size: 384, - pkcs8oid: '1.3.132.0.34', - p: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffe' + - 'ffffffff 00000000 00000000 ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + - 'FFFFFFFF 00000000 00000000 FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - 'b3312fa7 e23ee7e4 988e056b e3f82d19' + - '181d9c6e fe814112 0314088f 5013875a' + - 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'a335926a a319a27a 1d00896a 6773a482' + - '7acdac73'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff c7634d81 f4372ddf' + - '581a0db2 48b0a77a ecec196a ccc52973'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - 'aa87ca22 be8b0537 8eb1c71e f320ad74' + - '6e1d3b62 8ba79b98 59f741e0 82542a38' + - '5502f25d bf55296c 3a545e38 72760ab7' + - '3617de4a 96262c6f 5d9e98bf 9292dc29' + - 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + - '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). - replace(/ /g, ''), 'hex') - }, - 'nistp521': { - size: 521, - pkcs8oid: '1.3.132.0.35', - p: Buffer.from(( - '01ffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffff').replace(/ /g, ''), 'hex'), - a: Buffer.from(('01FF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(('51' + - '953eb961 8e1c9a1f 929a21a0 b68540ee' + - 'a2da725b 99b315f3 b8b48991 8ef109e1' + - '56193951 ec7e937b 1652c0bd 3bb1bf07' + - '3573df88 3d2c34f1 ef451fd4 6b503f00'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'd09e8800 291cb853 96cc6717 393284aa' + - 'a0da64ba').replace(/ /g, ''), 'hex'), - n: Buffer.from(('01ff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffa' + - '51868783 bf2f966b 7fcc0148 f709a5d0' + - '3bb5c9b8 899c47ae bb6fb71e 91386409'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + - '9c648139 053fb521 f828af60 6b4d3dba' + - 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + - '3348b3c1 856a429b f97e7e31 c2e5bd66' + - '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + - '98f54449 579b4468 17afbd17 273e662c' + - '97ee7299 5ef42640 c550b901 3fad0761' + - '353c7086 a272c240 88be9476 9fd16650'). - replace(/ /g, ''), 'hex') - } -}; - -module.exports = { - info: algInfo, - privInfo: algPrivInfo, - hashAlgs: hashAlgs, - curves: curves -}; - -/***/ }), -/* 99 */, -/* 100 */, -/* 101 */, -/* 102 */ +/***/ 385: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; -// For internal use, subject to change. -var __importStar = (this && this.__importStar) || function (mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result["default"] = mod; - return result; -}; -Object.defineProperty(exports, "__esModule", { value: true }); -// We use any as a valid input type -/* eslint-disable @typescript-eslint/no-explicit-any */ -const fs = __importStar(__webpack_require__(747)); -const os = __importStar(__webpack_require__(87)); -const utils_1 = __webpack_require__(82); -function issueCommand(command, message) { - const filePath = process.env[`GITHUB_${command}`]; - if (!filePath) { - throw new Error(`Unable to find environment variable for file command ${command}`); - } - if (!fs.existsSync(filePath)) { - throw new Error(`Missing file at path: ${filePath}`); - } - fs.appendFileSync(filePath, `${utils_1.toCommandValue(message)}${os.EOL}`, { - encoding: 'utf8' - }); -} -exports.issueCommand = issueCommand; -//# sourceMappingURL=file-command.js.map -/***/ }), -/* 103 */, -/* 104 */, -/* 105 */, -/* 106 */, -/* 107 */ -/***/ (function(module) { +Object.defineProperty(exports, '__esModule', { value: true }); -"use strict"; +var isPlainObject = __webpack_require__(3); +var universalUserAgent = __webpack_require__(796); -module.exports = function generate_allOf(it, $keyword, $ruleType) { - var out = ' '; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $currentBaseId = $it.baseId, - $allSchemasEmpty = true; - var arr1 = $schema; - if (arr1) { - var $sch, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $sch = arr1[$i += 1]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - $allSchemasEmpty = false; - $it.schema = $sch; - $it.schemaPath = $schemaPath + '[' + $i + ']'; - $it.errSchemaPath = $errSchemaPath + '/' + $i; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - } +function lowercaseKeys(object) { + if (!object) { + return {}; } - if ($breakOnError) { - if ($allSchemasEmpty) { - out += ' if (true) { '; + + return Object.keys(object).reduce((newObj, key) => { + newObj[key.toLowerCase()] = object[key]; + return newObj; + }, {}); +} + +function mergeDeep(defaults, options) { + const result = Object.assign({}, defaults); + Object.keys(options).forEach(key => { + if (isPlainObject.isPlainObject(options[key])) { + if (!(key in defaults)) Object.assign(result, { + [key]: options[key] + });else result[key] = mergeDeep(defaults[key], options[key]); } else { - out += ' ' + ($closingBraces.slice(0, -1)) + ' '; + Object.assign(result, { + [key]: options[key] + }); } - } - out = it.util.cleanUpCode(out); - return out; + }); + return result; } +function removeUndefinedProperties(obj) { + for (const key in obj) { + if (obj[key] === undefined) { + delete obj[key]; + } + } -/***/ }), -/* 108 */, -/* 109 */, -/* 110 */, -/* 111 */, -/* 112 */, -/* 113 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -var crypto = __webpack_require__(417) - -function sha (key, body, algorithm) { - return crypto.createHmac(algorithm, key).update(body).digest('base64') + return obj; } -function rsa (key, body) { - return crypto.createSign('RSA-SHA1').update(body).sign(key, 'base64') -} +function merge(defaults, route, options) { + if (typeof route === "string") { + let [method, url] = route.split(" "); + options = Object.assign(url ? { + method, + url + } : { + url: method + }, options); + } else { + options = Object.assign({}, route); + } // lowercase header names before merging with defaults to avoid duplicates -function rfc3986 (str) { - return encodeURIComponent(str) - .replace(/!/g,'%21') - .replace(/\*/g,'%2A') - .replace(/\(/g,'%28') - .replace(/\)/g,'%29') - .replace(/'/g,'%27') -} -// Maps object to bi-dimensional array -// Converts { foo: 'A', bar: [ 'b', 'B' ]} to -// [ ['foo', 'A'], ['bar', 'b'], ['bar', 'B'] ] -function map (obj) { - var key, val, arr = [] - for (key in obj) { - val = obj[key] - if (Array.isArray(val)) - for (var i = 0; i < val.length; i++) - arr.push([key, val[i]]) - else if (typeof val === 'object') - for (var prop in val) - arr.push([key + '[' + prop + ']', val[prop]]) - else - arr.push([key, val]) - } - return arr -} + options.headers = lowercaseKeys(options.headers); // remove properties with undefined values before merging -// Compare function for sort -function compare (a, b) { - return a > b ? 1 : a < b ? -1 : 0 -} + removeUndefinedProperties(options); + removeUndefinedProperties(options.headers); + const mergedOptions = mergeDeep(defaults || {}, options); // mediaType.previews arrays are merged, instead of overwritten -function generateBase (httpMethod, base_uri, params) { - // adapted from https://dev.twitter.com/docs/auth/oauth and - // https://dev.twitter.com/docs/auth/creating-signature + if (defaults && defaults.mediaType.previews.length) { + mergedOptions.mediaType.previews = defaults.mediaType.previews.filter(preview => !mergedOptions.mediaType.previews.includes(preview)).concat(mergedOptions.mediaType.previews); + } - // Parameter normalization - // http://tools.ietf.org/html/rfc5849#section-3.4.1.3.2 - var normalized = map(params) - // 1. First, the name and value of each parameter are encoded - .map(function (p) { - return [ rfc3986(p[0]), rfc3986(p[1] || '') ] - }) - // 2. The parameters are sorted by name, using ascending byte value - // ordering. If two or more parameters share the same name, they - // are sorted by their value. - .sort(function (a, b) { - return compare(a[0], b[0]) || compare(a[1], b[1]) - }) - // 3. The name of each parameter is concatenated to its corresponding - // value using an "=" character (ASCII code 61) as a separator, even - // if the value is empty. - .map(function (p) { return p.join('=') }) - // 4. The sorted name/value pairs are concatenated together into a - // single string by using an "&" character (ASCII code 38) as - // separator. - .join('&') - - var base = [ - rfc3986(httpMethod ? httpMethod.toUpperCase() : 'GET'), - rfc3986(base_uri), - rfc3986(normalized) - ].join('&') - - return base + mergedOptions.mediaType.previews = mergedOptions.mediaType.previews.map(preview => preview.replace(/-preview/, "")); + return mergedOptions; } -function hmacsign (httpMethod, base_uri, params, consumer_secret, token_secret) { - var base = generateBase(httpMethod, base_uri, params) - var key = [ - consumer_secret || '', - token_secret || '' - ].map(rfc3986).join('&') +function addQueryParameters(url, parameters) { + const separator = /\?/.test(url) ? "&" : "?"; + const names = Object.keys(parameters); - return sha(key, base, 'sha1') -} + if (names.length === 0) { + return url; + } -function hmacsign256 (httpMethod, base_uri, params, consumer_secret, token_secret) { - var base = generateBase(httpMethod, base_uri, params) - var key = [ - consumer_secret || '', - token_secret || '' - ].map(rfc3986).join('&') + return url + separator + names.map(name => { + if (name === "q") { + return "q=" + parameters.q.split("+").map(encodeURIComponent).join("+"); + } - return sha(key, base, 'sha256') + return `${name}=${encodeURIComponent(parameters[name])}`; + }).join("&"); } -function rsasign (httpMethod, base_uri, params, private_key, token_secret) { - var base = generateBase(httpMethod, base_uri, params) - var key = private_key || '' +const urlVariableRegex = /\{[^}]+\}/g; - return rsa(key, base) +function removeNonChars(variableName) { + return variableName.replace(/^\W+|\W+$/g, "").split(/,/); } -function plaintext (consumer_secret, token_secret) { - var key = [ - consumer_secret || '', - token_secret || '' - ].map(rfc3986).join('&') - - return key -} +function extractUrlVariableNames(url) { + const matches = url.match(urlVariableRegex); -function sign (signMethod, httpMethod, base_uri, params, consumer_secret, token_secret) { - var method - var skipArgs = 1 - - switch (signMethod) { - case 'RSA-SHA1': - method = rsasign - break - case 'HMAC-SHA1': - method = hmacsign - break - case 'HMAC-SHA256': - method = hmacsign256 - break - case 'PLAINTEXT': - method = plaintext - skipArgs = 4 - break - default: - throw new Error('Signature method not supported: ' + signMethod) + if (!matches) { + return []; } - return method.apply(null, [].slice.call(arguments, skipArgs)) + return matches.map(removeNonChars).reduce((a, b) => a.concat(b), []); } -exports.hmacsign = hmacsign -exports.hmacsign256 = hmacsign256 -exports.rsasign = rsasign -exports.plaintext = plaintext -exports.sign = sign -exports.rfc3986 = rfc3986 -exports.generateBase = generateBase - -/***/ }), -/* 114 */, -/* 115 */, -/* 116 */, -/* 117 */, -/* 118 */, -/* 119 */, -/* 120 */, -/* 121 */, -/* 122 */, -/* 123 */, -/* 124 */, -/* 125 */, -/* 126 */, -/* 127 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { +function omit(object, keysToOmit) { + return Object.keys(object).filter(option => !keysToOmit.includes(option)).reduce((obj, key) => { + obj[key] = object[key]; + return obj; + }, {}); +} -"use strict"; +// Based on https://github.com/bramstein/url-template, licensed under BSD +// TODO: create separate package. +// +// Copyright (c) 2012-2014, Bram Stein +// All rights reserved. +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions +// are met: +// 1. Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// 2. Redistributions in binary form must reproduce the above copyright +// notice, this list of conditions and the following disclaimer in the +// documentation and/or other materials provided with the distribution. +// 3. The name of the author may not be used to endorse or promote products +// derived from this software without specific prior written permission. +// THIS SOFTWARE IS PROVIDED BY THE AUTHOR "AS IS" AND ANY EXPRESS OR IMPLIED +// WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +// MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO +// EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, +// INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, +// BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY +// OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +// NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, +// EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. -var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); -}) : (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - o[k2] = m[k]; -})); -var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { - Object.defineProperty(o, "default", { enumerable: true, value: v }); -}) : function(o, v) { - o["default"] = v; -}); -var __importStar = (this && this.__importStar) || function (mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); - __setModuleDefault(result, mod); - return result; -}; -Object.defineProperty(exports, "__esModule", { value: true }); -exports.getApiBaseUrl = exports.getProxyAgent = exports.getAuthString = void 0; -const httpClient = __importStar(__webpack_require__(539)); -function getAuthString(token, options) { - if (!token && !options.auth) { - throw new Error('Parameter token or opts.auth is required'); - } - else if (token && options.auth) { - throw new Error('Parameters token and opts.auth may not both be specified'); +/* istanbul ignore file */ +function encodeReserved(str) { + return str.split(/(%[0-9A-Fa-f]{2})/g).map(function (part) { + if (!/%[0-9A-Fa-f]/.test(part)) { + part = encodeURI(part).replace(/%5B/g, "[").replace(/%5D/g, "]"); } - return typeof options.auth === 'string' ? options.auth : `token ${token}`; -} -exports.getAuthString = getAuthString; -function getProxyAgent(destinationUrl) { - const hc = new httpClient.HttpClient(); - return hc.getAgent(destinationUrl); -} -exports.getProxyAgent = getProxyAgent; -function getApiBaseUrl() { - return process.env['GITHUB_API_URL'] || 'https://api.github.com'; + + return part; + }).join(""); } -exports.getApiBaseUrl = getApiBaseUrl; -//# sourceMappingURL=utils.js.map -/***/ }), -/* 128 */, -/* 129 */ -/***/ (function(module) { +function encodeUnreserved(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function (c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); + }); +} -module.exports = require("child_process"); +function encodeValue(operator, value, key) { + value = operator === "+" || operator === "#" ? encodeReserved(value) : encodeUnreserved(value); -/***/ }), -/* 130 */, -/* 131 */, -/* 132 */, -/* 133 */, -/* 134 */, -/* 135 */, -/* 136 */, -/* 137 */, -/* 138 */, -/* 139 */ -/***/ (function(module) { + if (key) { + return encodeUnreserved(key) + "=" + value; + } else { + return value; + } +} -/** @license MIT License (c) copyright 2010-2014 original author or authors */ -/** @author Brian Cavalier */ -/** @author John Hann */ +function isDefined(value) { + return value !== undefined && value !== null; +} -(function(define) { 'use strict'; -define(function() { +function isKeyOperator(operator) { + return operator === ";" || operator === "&" || operator === "?"; +} - return { - pending: toPendingState, - fulfilled: toFulfilledState, - rejected: toRejectedState, - inspect: inspect - }; +function getValues(context, operator, key, modifier) { + var value = context[key], + result = []; - function toPendingState() { - return { state: 'pending' }; - } + if (isDefined(value) && value !== "") { + if (typeof value === "string" || typeof value === "number" || typeof value === "boolean") { + value = value.toString(); - function toRejectedState(e) { - return { state: 'rejected', reason: e }; - } + if (modifier && modifier !== "*") { + value = value.substring(0, parseInt(modifier, 10)); + } - function toFulfilledState(x) { - return { state: 'fulfilled', value: x }; - } + result.push(encodeValue(operator, value, isKeyOperator(operator) ? key : "")); + } else { + if (modifier === "*") { + if (Array.isArray(value)) { + value.filter(isDefined).forEach(function (value) { + result.push(encodeValue(operator, value, isKeyOperator(operator) ? key : "")); + }); + } else { + Object.keys(value).forEach(function (k) { + if (isDefined(value[k])) { + result.push(encodeValue(operator, value[k], k)); + } + }); + } + } else { + const tmp = []; - function inspect(handler) { - var state = handler.state(); - return state === 0 ? toPendingState() - : state > 0 ? toFulfilledState(handler.value) - : toRejectedState(handler.value); - } + if (Array.isArray(value)) { + value.filter(isDefined).forEach(function (value) { + tmp.push(encodeValue(operator, value)); + }); + } else { + Object.keys(value).forEach(function (k) { + if (isDefined(value[k])) { + tmp.push(encodeUnreserved(k)); + tmp.push(encodeValue(operator, value[k].toString())); + } + }); + } -}); -}(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); + if (isKeyOperator(operator)) { + result.push(encodeUnreserved(key) + "=" + tmp.join(",")); + } else if (tmp.length !== 0) { + result.push(tmp.join(",")); + } + } + } + } else { + if (operator === ";") { + if (isDefined(value)) { + result.push(encodeUnreserved(key)); + } + } else if (value === "" && (operator === "&" || operator === "?")) { + result.push(encodeUnreserved(key) + "="); + } else if (value === "") { + result.push(""); + } + } + return result; +} -/***/ }), -/* 140 */ -/***/ (function(module) { +function parseUrl(template) { + return { + expand: expand.bind(null, template) + }; +} -module.exports = {"$id":"afterRequest.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["lastAccess","eTag","hitCount"],"properties":{"expires":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"lastAccess":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"eTag":{"type":"string"},"hitCount":{"type":"integer"},"comment":{"type":"string"}}}; +function expand(template, context) { + var operators = ["+", "#", ".", "/", ";", "?", "&"]; + return template.replace(/\{([^\{\}]+)\}|([^\{\}]+)/g, function (_, expression, literal) { + if (expression) { + let operator = ""; + const values = []; -/***/ }), -/* 141 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { + if (operators.indexOf(expression.charAt(0)) !== -1) { + operator = expression.charAt(0); + expression = expression.substr(1); + } -"use strict"; + expression.split(/,/g).forEach(function (variable) { + var tmp = /([^:\*]*)(?::(\d+)|(\*))?/.exec(variable); + values.push(getValues(context, operator, tmp[1], tmp[2] || tmp[3])); + }); + if (operator && operator !== "+") { + var separator = ","; -var net = __webpack_require__(631); -var tls = __webpack_require__(16); -var http = __webpack_require__(605); -var https = __webpack_require__(211); -var events = __webpack_require__(614); -var assert = __webpack_require__(357); -var util = __webpack_require__(669); + if (operator === "?") { + separator = "&"; + } else if (operator !== "#") { + separator = operator; + } + return (values.length !== 0 ? operator : "") + values.join(separator); + } else { + return values.join(","); + } + } else { + return encodeReserved(literal); + } + }); +} -exports.httpOverHttp = httpOverHttp; -exports.httpsOverHttp = httpsOverHttp; -exports.httpOverHttps = httpOverHttps; -exports.httpsOverHttps = httpsOverHttps; +function parse(options) { + // https://fetch.spec.whatwg.org/#methods + let method = options.method.toUpperCase(); // replace :varname with {varname} to make it RFC 6570 compatible + let url = (options.url || "/").replace(/:([a-z]\w+)/g, "{$1}"); + let headers = Object.assign({}, options.headers); + let body; + let parameters = omit(options, ["method", "baseUrl", "url", "headers", "request", "mediaType"]); // extract variable names from URL to calculate remaining variables later -function httpOverHttp(options) { - var agent = new TunnelingAgent(options); - agent.request = http.request; - return agent; -} + const urlVariableNames = extractUrlVariableNames(url); + url = parseUrl(url).expand(parameters); -function httpsOverHttp(options) { - var agent = new TunnelingAgent(options); - agent.request = http.request; - agent.createSocket = createSecureSocket; - agent.defaultPort = 443; - return agent; -} + if (!/^http/.test(url)) { + url = options.baseUrl + url; + } -function httpOverHttps(options) { - var agent = new TunnelingAgent(options); - agent.request = https.request; - return agent; -} + const omittedParameters = Object.keys(options).filter(option => urlVariableNames.includes(option)).concat("baseUrl"); + const remainingParameters = omit(parameters, omittedParameters); + const isBinaryRequest = /application\/octet-stream/i.test(headers.accept); -function httpsOverHttps(options) { - var agent = new TunnelingAgent(options); - agent.request = https.request; - agent.createSocket = createSecureSocket; - agent.defaultPort = 443; - return agent; -} + if (!isBinaryRequest) { + if (options.mediaType.format) { + // e.g. application/vnd.github.v3+json => application/vnd.github.v3.raw + headers.accept = headers.accept.split(/,/).map(preview => preview.replace(/application\/vnd(\.\w+)(\.v3)?(\.\w+)?(\+json)?$/, `application/vnd$1$2.${options.mediaType.format}`)).join(","); + } + if (options.mediaType.previews.length) { + const previewsFromAcceptHeader = headers.accept.match(/[\w-]+(?=-preview)/g) || []; + headers.accept = previewsFromAcceptHeader.concat(options.mediaType.previews).map(preview => { + const format = options.mediaType.format ? `.${options.mediaType.format}` : "+json"; + return `application/vnd.github.${preview}-preview${format}`; + }).join(","); + } + } // for GET/HEAD requests, set URL query parameters from remaining parameters + // for PATCH/POST/PUT/DELETE requests, set request body from remaining parameters -function TunnelingAgent(options) { - var self = this; - self.options = options || {}; - self.proxyOptions = self.options.proxy || {}; - self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets; - self.requests = []; - self.sockets = []; - self.on('free', function onFree(socket, host, port, localAddress) { - var options = toOptions(host, port, localAddress); - for (var i = 0, len = self.requests.length; i < len; ++i) { - var pending = self.requests[i]; - if (pending.host === options.host && pending.port === options.port) { - // Detect the request to connect same origin server, - // reuse the connection. - self.requests.splice(i, 1); - pending.request.onSocket(socket); - return; + if (["GET", "HEAD"].includes(method)) { + url = addQueryParameters(url, remainingParameters); + } else { + if ("data" in remainingParameters) { + body = remainingParameters.data; + } else { + if (Object.keys(remainingParameters).length) { + body = remainingParameters; + } else { + headers["content-length"] = 0; } } - socket.destroy(); - self.removeSocket(socket); - }); -} -util.inherits(TunnelingAgent, events.EventEmitter); - -TunnelingAgent.prototype.addRequest = function addRequest(req, host, port, localAddress) { - var self = this; - var options = mergeOptions({request: req}, self.options, toOptions(host, port, localAddress)); + } // default content-type for JSON if body is set - if (self.sockets.length >= this.maxSockets) { - // We are over limit so we'll add it to the queue. - self.requests.push(options); - return; - } - // If we are under maxSockets create a new one. - self.createSocket(options, function(socket) { - socket.on('free', onFree); - socket.on('close', onCloseOrRemove); - socket.on('agentRemove', onCloseOrRemove); - req.onSocket(socket); + if (!headers["content-type"] && typeof body !== "undefined") { + headers["content-type"] = "application/json; charset=utf-8"; + } // GitHub expects 'content-length: 0' header for PUT/PATCH requests without body. + // fetch does not allow to set `content-length` header, but we can set body to an empty string - function onFree() { - self.emit('free', socket, options); - } - function onCloseOrRemove(err) { - self.removeSocket(socket); - socket.removeListener('free', onFree); - socket.removeListener('close', onCloseOrRemove); - socket.removeListener('agentRemove', onCloseOrRemove); - } - }); -}; + if (["PATCH", "PUT"].includes(method) && typeof body === "undefined") { + body = ""; + } // Only return body/request keys if present -TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { - var self = this; - var placeholder = {}; - self.sockets.push(placeholder); - var connectOptions = mergeOptions({}, self.proxyOptions, { - method: 'CONNECT', - path: options.host + ':' + options.port, - agent: false, - headers: { - host: options.host + ':' + options.port - } - }); - if (options.localAddress) { - connectOptions.localAddress = options.localAddress; - } - if (connectOptions.proxyAuth) { - connectOptions.headers = connectOptions.headers || {}; - connectOptions.headers['Proxy-Authorization'] = 'Basic ' + - new Buffer(connectOptions.proxyAuth).toString('base64'); - } + return Object.assign({ + method, + url, + headers + }, typeof body !== "undefined" ? { + body + } : null, options.request ? { + request: options.request + } : null); +} - debug('making CONNECT request'); - var connectReq = self.request(connectOptions); - connectReq.useChunkedEncodingByDefault = false; // for v0.6 - connectReq.once('response', onResponse); // for v0.6 - connectReq.once('upgrade', onUpgrade); // for v0.6 - connectReq.once('connect', onConnect); // for v0.7 or later - connectReq.once('error', onError); - connectReq.end(); +function endpointWithDefaults(defaults, route, options) { + return parse(merge(defaults, route, options)); +} - function onResponse(res) { - // Very hacky. This is necessary to avoid http-parser leaks. - res.upgrade = true; - } +function withDefaults(oldDefaults, newDefaults) { + const DEFAULTS = merge(oldDefaults, newDefaults); + const endpoint = endpointWithDefaults.bind(null, DEFAULTS); + return Object.assign(endpoint, { + DEFAULTS, + defaults: withDefaults.bind(null, DEFAULTS), + merge: merge.bind(null, DEFAULTS), + parse + }); +} - function onUpgrade(res, socket, head) { - // Hacky. - process.nextTick(function() { - onConnect(res, socket, head); - }); - } +const VERSION = "6.0.11"; - function onConnect(res, socket, head) { - connectReq.removeAllListeners(); - socket.removeAllListeners(); +const userAgent = `octokit-endpoint.js/${VERSION} ${universalUserAgent.getUserAgent()}`; // DEFAULTS has all properties set that EndpointOptions has, except url. +// So we use RequestParameters and add method as additional required property. - if (res.statusCode !== 200) { - debug('tunneling socket could not be established, statusCode=%d', - res.statusCode); - socket.destroy(); - var error = new Error('tunneling socket could not be established, ' + - 'statusCode=' + res.statusCode); - error.code = 'ECONNRESET'; - options.request.emit('error', error); - self.removeSocket(placeholder); - return; - } - if (head.length > 0) { - debug('got illegal response body from proxy'); - socket.destroy(); - var error = new Error('got illegal response body from proxy'); - error.code = 'ECONNRESET'; - options.request.emit('error', error); - self.removeSocket(placeholder); - return; - } - debug('tunneling connection has established'); - self.sockets[self.sockets.indexOf(placeholder)] = socket; - return cb(socket); +const DEFAULTS = { + method: "GET", + baseUrl: "https://api.github.com", + headers: { + accept: "application/vnd.github.v3+json", + "user-agent": userAgent + }, + mediaType: { + format: "", + previews: [] } +}; - function onError(cause) { - connectReq.removeAllListeners(); +const endpoint = withDefaults(null, DEFAULTS); - debug('tunneling socket could not be established, cause=%s\n', - cause.message, cause.stack); - var error = new Error('tunneling socket could not be established, ' + - 'cause=' + cause.message); - error.code = 'ECONNRESET'; - options.request.emit('error', error); - self.removeSocket(placeholder); - } -}; +exports.endpoint = endpoint; +//# sourceMappingURL=index.js.map -TunnelingAgent.prototype.removeSocket = function removeSocket(socket) { - var pos = this.sockets.indexOf(socket) - if (pos === -1) { - return; - } - this.sockets.splice(pos, 1); - var pending = this.requests.shift(); - if (pending) { - // If we have pending requests and a socket gets closed a new one - // needs to be created to take over in the pool for the one that closed. - this.createSocket(pending, function(socket) { - pending.request.onSocket(socket); - }); - } -}; +/***/ }), -function createSecureSocket(options, cb) { - var self = this; - TunnelingAgent.prototype.createSocket.call(self, options, function(socket) { - var hostHeader = options.request.getHeader('host'); - var tlsOptions = mergeOptions({}, self.options, { - socket: socket, - servername: hostHeader ? hostHeader.replace(/:.*$/, '') : options.host - }); +/***/ 413: +/***/ (function(module, __unusedexports, __webpack_require__) { - // 0 is dummy port for v0.6 - var secureSocket = tls.connect(0, tlsOptions); - self.sockets[self.sockets.indexOf(socket)] = secureSocket; - cb(secureSocket); - }); -} +module.exports = __webpack_require__(141); -function toOptions(host, port, localAddress) { - if (typeof host === 'string') { // since v0.10 - return { - host: host, - port: port, - localAddress: localAddress - }; - } - return host; // for v0.11 or later -} +/***/ }), -function mergeOptions(target) { - for (var i = 1, len = arguments.length; i < len; ++i) { - var overrides = arguments[i]; - if (typeof overrides === 'object') { - var keys = Object.keys(overrides); - for (var j = 0, keyLen = keys.length; j < keyLen; ++j) { - var k = keys[j]; - if (overrides[k] !== undefined) { - target[k] = overrides[k]; - } - } - } - } - return target; -} +/***/ 431: +/***/ (function(__unusedmodule, exports, __webpack_require__) { +"use strict"; -var debug; -if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) { - debug = function() { - var args = Array.prototype.slice.call(arguments); - if (typeof args[0] === 'string') { - args[0] = 'TUNNEL: ' + args[0]; - } else { - args.unshift('TUNNEL:'); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; + result["default"] = mod; + return result; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const os = __importStar(__webpack_require__(87)); +const utils_1 = __webpack_require__(82); +/** + * Commands + * + * Command Format: + * ::name key=value,key=value::message + * + * Examples: + * ::warning::This is the message + * ::set-env name=MY_VAR::some value + */ +function issueCommand(command, properties, message) { + const cmd = new Command(command, properties, message); + process.stdout.write(cmd.toString() + os.EOL); +} +exports.issueCommand = issueCommand; +function issue(name, message = '') { + issueCommand(name, {}, message); +} +exports.issue = issue; +const CMD_STRING = '::'; +class Command { + constructor(command, properties, message) { + if (!command) { + command = 'missing.command'; + } + this.command = command; + this.properties = properties; + this.message = message; + } + toString() { + let cmdStr = CMD_STRING + this.command; + if (this.properties && Object.keys(this.properties).length > 0) { + cmdStr += ' '; + let first = true; + for (const key in this.properties) { + if (this.properties.hasOwnProperty(key)) { + const val = this.properties[key]; + if (val) { + if (first) { + first = false; + } + else { + cmdStr += ','; + } + cmdStr += `${key}=${escapeProperty(val)}`; + } + } + } + } + cmdStr += `${CMD_STRING}${escapeData(this.message)}`; + return cmdStr; } - console.error.apply(console, args); - } -} else { - debug = function() {}; } -exports.debug = debug; // for test - +function escapeData(s) { + return utils_1.toCommandValue(s) + .replace(/%/g, '%25') + .replace(/\r/g, '%0D') + .replace(/\n/g, '%0A'); +} +function escapeProperty(s) { + return utils_1.toCommandValue(s) + .replace(/%/g, '%25') + .replace(/\r/g, '%0D') + .replace(/\n/g, '%0A') + .replace(/:/g, '%3A') + .replace(/,/g, '%2C'); +} +//# sourceMappingURL=command.js.map /***/ }), -/* 142 */, -/* 143 */, -/* 144 */, -/* 145 */, -/* 146 */, -/* 147 */ -/***/ (function(module) { -// API -module.exports = state; +/***/ 448: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -/** - * Creates initial state object - * for iteration over list - * - * @param {array|object} list - list to iterate over - * @param {function|null} sortMethod - function to use for keys sort, - * or `null` to keep them as is - * @returns {object} - initial state object - */ -function state(list, sortMethod) -{ - var isNamedList = !Array.isArray(list) - , initState = - { - index : 0, - keyedList: isNamedList || sortMethod ? Object.keys(list) : null, - jobs : {}, - results : isNamedList ? {} : [], - size : isNamedList ? Object.keys(list).length : list.length - } - ; - - if (sortMethod) - { - // sort array keys based on it's values - // sort object's keys just on own merit - initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) - { - return sortMethod(list[a], list[b]); - }); - } +"use strict"; - return initState; -} +Object.defineProperty(exports, '__esModule', { value: true }); -/***/ }), -/* 148 */, -/* 149 */ -/***/ (function(module, exports, __webpack_require__) { +var universalUserAgent = __webpack_require__(796); +var beforeAfterHook = __webpack_require__(523); +var request = __webpack_require__(753); +var graphql = __webpack_require__(898); +var authToken = __webpack_require__(813); -/* eslint-disable node/no-deprecated-api */ -var buffer = __webpack_require__(293) -var Buffer = buffer.Buffer +function _objectWithoutPropertiesLoose(source, excluded) { + if (source == null) return {}; + var target = {}; + var sourceKeys = Object.keys(source); + var key, i; -// alternative to using Object.keys for old browsers -function copyProps (src, dst) { - for (var key in src) { - dst[key] = src[key] + for (i = 0; i < sourceKeys.length; i++) { + key = sourceKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + target[key] = source[key]; } -} -if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { - module.exports = buffer -} else { - // Copy properties from require('buffer') - copyProps(buffer, exports) - exports.Buffer = SafeBuffer -} -function SafeBuffer (arg, encodingOrOffset, length) { - return Buffer(arg, encodingOrOffset, length) + return target; } -SafeBuffer.prototype = Object.create(Buffer.prototype) +function _objectWithoutProperties(source, excluded) { + if (source == null) return {}; -// Copy static methods from Buffer -copyProps(Buffer, SafeBuffer) + var target = _objectWithoutPropertiesLoose(source, excluded); -SafeBuffer.from = function (arg, encodingOrOffset, length) { - if (typeof arg === 'number') { - throw new TypeError('Argument must not be a number') - } - return Buffer(arg, encodingOrOffset, length) -} + var key, i; -SafeBuffer.alloc = function (size, fill, encoding) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') - } - var buf = Buffer(size) - if (fill !== undefined) { - if (typeof encoding === 'string') { - buf.fill(fill, encoding) - } else { - buf.fill(fill) + if (Object.getOwnPropertySymbols) { + var sourceSymbolKeys = Object.getOwnPropertySymbols(source); + + for (i = 0; i < sourceSymbolKeys.length; i++) { + key = sourceSymbolKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; + target[key] = source[key]; } - } else { - buf.fill(0) } - return buf -} -SafeBuffer.allocUnsafe = function (size) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') - } - return Buffer(size) + return target; } -SafeBuffer.allocUnsafeSlow = function (size) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') - } - return buffer.SlowBuffer(size) -} +const VERSION = "3.2.5"; +class Octokit { + constructor(options = {}) { + const hook = new beforeAfterHook.Collection(); + const requestDefaults = { + baseUrl: request.request.endpoint.DEFAULTS.baseUrl, + headers: {}, + request: Object.assign({}, options.request, { + hook: hook.bind(null, "request") + }), + mediaType: { + previews: [], + format: "" + } + }; // prepend default user agent with `options.userAgent` if set -/***/ }), -/* 150 */, -/* 151 */, -/* 152 */ -/***/ (function(module, __unusedexports, __webpack_require__) { + requestDefaults.headers["user-agent"] = [options.userAgent, `octokit-core.js/${VERSION} ${universalUserAgent.getUserAgent()}`].filter(Boolean).join(" "); -var Stream = __webpack_require__(413).Stream; -var util = __webpack_require__(669); + if (options.baseUrl) { + requestDefaults.baseUrl = options.baseUrl; + } -module.exports = DelayedStream; -function DelayedStream() { - this.source = null; - this.dataSize = 0; - this.maxDataSize = 1024 * 1024; - this.pauseStream = true; + if (options.previews) { + requestDefaults.mediaType.previews = options.previews; + } - this._maxDataSizeExceeded = false; - this._released = false; - this._bufferedEvents = []; -} -util.inherits(DelayedStream, Stream); + if (options.timeZone) { + requestDefaults.headers["time-zone"] = options.timeZone; + } -DelayedStream.create = function(source, options) { - var delayedStream = new this(); + this.request = request.request.defaults(requestDefaults); + this.graphql = graphql.withCustomRequest(this.request).defaults(requestDefaults); + this.log = Object.assign({ + debug: () => {}, + info: () => {}, + warn: console.warn.bind(console), + error: console.error.bind(console) + }, options.log); + this.hook = hook; // (1) If neither `options.authStrategy` nor `options.auth` are set, the `octokit` instance + // is unauthenticated. The `this.auth()` method is a no-op and no request hook is registered. + // (2) If only `options.auth` is set, use the default token authentication strategy. + // (3) If `options.authStrategy` is set then use it and pass in `options.auth`. Always pass own request as many strategies accept a custom request instance. + // TODO: type `options.auth` based on `options.authStrategy`. - options = options || {}; - for (var option in options) { - delayedStream[option] = options[option]; - } + if (!options.authStrategy) { + if (!options.auth) { + // (1) + this.auth = async () => ({ + type: "unauthenticated" + }); + } else { + // (2) + const auth = authToken.createTokenAuth(options.auth); // @ts-ignore ¯\_(ツ)_/¯ - delayedStream.source = source; + hook.wrap("request", auth.hook); + this.auth = auth; + } + } else { + const { + authStrategy + } = options, + otherOptions = _objectWithoutProperties(options, ["authStrategy"]); - var realEmit = source.emit; - source.emit = function() { - delayedStream._handleEmit(arguments); - return realEmit.apply(source, arguments); - }; + const auth = authStrategy(Object.assign({ + request: this.request, + log: this.log, + // we pass the current octokit instance as well as its constructor options + // to allow for authentication strategies that return a new octokit instance + // that shares the same internal state as the current one. The original + // requirement for this was the "event-octokit" authentication strategy + // of https://github.com/probot/octokit-auth-probot. + octokit: this, + octokitOptions: otherOptions + }, options.auth)); // @ts-ignore ¯\_(ツ)_/¯ - source.on('error', function() {}); - if (delayedStream.pauseStream) { - source.pause(); - } + hook.wrap("request", auth.hook); + this.auth = auth; + } // apply plugins + // https://stackoverflow.com/a/16345172 - return delayedStream; -}; -Object.defineProperty(DelayedStream.prototype, 'readable', { - configurable: true, - enumerable: true, - get: function() { - return this.source.readable; + const classConstructor = this.constructor; + classConstructor.plugins.forEach(plugin => { + Object.assign(this, plugin(this, options)); + }); } -}); - -DelayedStream.prototype.setEncoding = function() { - return this.source.setEncoding.apply(this.source, arguments); -}; -DelayedStream.prototype.resume = function() { - if (!this._released) { - this.release(); - } + static defaults(defaults) { + const OctokitWithDefaults = class extends this { + constructor(...args) { + const options = args[0] || {}; - this.source.resume(); -}; + if (typeof defaults === "function") { + super(defaults(options)); + return; + } -DelayedStream.prototype.pause = function() { - this.source.pause(); -}; + super(Object.assign({}, defaults, options, options.userAgent && defaults.userAgent ? { + userAgent: `${options.userAgent} ${defaults.userAgent}` + } : null)); + } -DelayedStream.prototype.release = function() { - this._released = true; + }; + return OctokitWithDefaults; + } + /** + * Attach a plugin (or many) to your Octokit instance. + * + * @example + * const API = Octokit.plugin(plugin1, plugin2, plugin3, ...) + */ - this._bufferedEvents.forEach(function(args) { - this.emit.apply(this, args); - }.bind(this)); - this._bufferedEvents = []; -}; -DelayedStream.prototype.pipe = function() { - var r = Stream.prototype.pipe.apply(this, arguments); - this.resume(); - return r; -}; + static plugin(...newPlugins) { + var _a; -DelayedStream.prototype._handleEmit = function(args) { - if (this._released) { - this.emit.apply(this, args); - return; + const currentPlugins = this.plugins; + const NewOctokit = (_a = class extends this {}, _a.plugins = currentPlugins.concat(newPlugins.filter(plugin => !currentPlugins.includes(plugin))), _a); + return NewOctokit; } - if (args[0] === 'data') { - this.dataSize += args[1].length; - this._checkIfMaxDataSizeExceeded(); - } +} +Octokit.VERSION = VERSION; +Octokit.plugins = []; - this._bufferedEvents.push(args); -}; - -DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() { - if (this._maxDataSizeExceeded) { - return; - } - - if (this.dataSize <= this.maxDataSize) { - return; - } - - this._maxDataSizeExceeded = true; - var message = - 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.' - this.emit('error', new Error(message)); -}; +exports.Octokit = Octokit; +//# sourceMappingURL=index.js.map /***/ }), -/* 153 */, -/* 154 */ -/***/ (function(module) { -"use strict"; +/***/ 454: +/***/ (function(module, exports, __webpack_require__) { -module.exports = function generate_contains(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $idx = 'i' + $lvl, - $dataNxt = $it.dataLevel = it.dataLevel + 1, - $nextData = 'data' + $dataNxt, - $currentBaseId = it.baseId, - $nonEmptySchema = (it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all)); - out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; - if ($nonEmptySchema) { - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - out += ' var ' + ($nextValid) + ' = false; for (var ' + ($idx) + ' = 0; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; - $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); - var $passData = $data + '[' + $idx + ']'; - $it.dataPathArr[$dataNxt] = $idx; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - out += ' if (' + ($nextValid) + ') break; } '; - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' ' + ($closingBraces) + ' if (!' + ($nextValid) + ') {'; - } else { - out += ' if (' + ($data) + '.length == 0) {'; - } - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('contains') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'should contain a valid item\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { '; - if ($nonEmptySchema) { - out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; - } - if (it.opts.allErrors) { - out += ' } '; - } - out = it.util.cleanUpCode(out); - return out; -} +"use strict"; -/***/ }), -/* 155 */, -/* 156 */, -/* 157 */ -/***/ (function(module, __unusedexports, __webpack_require__) { +Object.defineProperty(exports, '__esModule', { value: true }); -var async = __webpack_require__(751) - , abort = __webpack_require__(566) - ; +function _interopDefault (ex) { return (ex && (typeof ex === 'object') && 'default' in ex) ? ex['default'] : ex; } -// API -module.exports = iterate; +var Stream = _interopDefault(__webpack_require__(794)); +var http = _interopDefault(__webpack_require__(605)); +var Url = _interopDefault(__webpack_require__(835)); +var https = _interopDefault(__webpack_require__(211)); +var zlib = _interopDefault(__webpack_require__(761)); -/** - * Iterates over each job object - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {object} state - current job status - * @param {function} callback - invoked when all elements processed - */ -function iterate(list, iterator, state, callback) -{ - // store current index - var key = state['keyedList'] ? state['keyedList'][state.index] : state.index; - - state.jobs[key] = runJob(iterator, key, list[key], function(error, output) - { - // don't repeat yourself - // skip secondary callbacks - if (!(key in state.jobs)) - { - return; - } +// Based on https://github.com/tmpvar/jsdom/blob/aa85b2abf07766ff7bf5c1f6daafb3726f2f2db5/lib/jsdom/living/blob.js - // clean up jobs - delete state.jobs[key]; +// fix for "Readable" isn't a named export issue +const Readable = Stream.Readable; - if (error) - { - // don't process rest of the results - // stop still active jobs - // and reset the list - abort(state); - } - else - { - state.results[key] = output; - } +const BUFFER = Symbol('buffer'); +const TYPE = Symbol('type'); - // return salvaged results - callback(error, state.results); - }); -} +class Blob { + constructor() { + this[TYPE] = ''; -/** - * Runs iterator over provided job element - * - * @param {function} iterator - iterator to invoke - * @param {string|number} key - key/index of the element in the list of jobs - * @param {mixed} item - job description - * @param {function} callback - invoked after iterator is done with the job - * @returns {function|mixed} - job abort function or something else - */ -function runJob(iterator, key, item, callback) -{ - var aborter; - - // allow shortcut if iterator expects only two arguments - if (iterator.length == 2) - { - aborter = iterator(item, async(callback)); - } - // otherwise go with full three arguments - else - { - aborter = iterator(item, key, async(callback)); - } + const blobParts = arguments[0]; + const options = arguments[1]; - return aborter; -} + const buffers = []; + let size = 0; + if (blobParts) { + const a = blobParts; + const length = Number(a.length); + for (let i = 0; i < length; i++) { + const element = a[i]; + let buffer; + if (element instanceof Buffer) { + buffer = element; + } else if (ArrayBuffer.isView(element)) { + buffer = Buffer.from(element.buffer, element.byteOffset, element.byteLength); + } else if (element instanceof ArrayBuffer) { + buffer = Buffer.from(element); + } else if (element instanceof Blob) { + buffer = element[BUFFER]; + } else { + buffer = Buffer.from(typeof element === 'string' ? element : String(element)); + } + size += buffer.length; + buffers.push(buffer); + } + } -/***/ }), -/* 158 */, -/* 159 */, -/* 160 */, -/* 161 */, -/* 162 */ -/***/ (function(module) { + this[BUFFER] = Buffer.concat(buffers); -module.exports = {"$id":"content.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["size","mimeType"],"properties":{"size":{"type":"integer"},"compression":{"type":"integer"},"mimeType":{"type":"string"},"text":{"type":"string"},"encoding":{"type":"string"},"comment":{"type":"string"}}}; + let type = options && options.type !== undefined && String(options.type).toLowerCase(); + if (type && !/[^\u0020-\u007E]/.test(type)) { + this[TYPE] = type; + } + } + get size() { + return this[BUFFER].length; + } + get type() { + return this[TYPE]; + } + text() { + return Promise.resolve(this[BUFFER].toString()); + } + arrayBuffer() { + const buf = this[BUFFER]; + const ab = buf.buffer.slice(buf.byteOffset, buf.byteOffset + buf.byteLength); + return Promise.resolve(ab); + } + stream() { + const readable = new Readable(); + readable._read = function () {}; + readable.push(this[BUFFER]); + readable.push(null); + return readable; + } + toString() { + return '[object Blob]'; + } + slice() { + const size = this.size; -/***/ }), -/* 163 */, -/* 164 */, -/* 165 */, -/* 166 */, -/* 167 */, -/* 168 */, -/* 169 */, -/* 170 */, -/* 171 */, -/* 172 */, -/* 173 */, -/* 174 */, -/* 175 */, -/* 176 */, -/* 177 */, -/* 178 */, -/* 179 */, -/* 180 */, -/* 181 */ -/***/ (function(module) { + const start = arguments[0]; + const end = arguments[1]; + let relativeStart, relativeEnd; + if (start === undefined) { + relativeStart = 0; + } else if (start < 0) { + relativeStart = Math.max(size + start, 0); + } else { + relativeStart = Math.min(start, size); + } + if (end === undefined) { + relativeEnd = size; + } else if (end < 0) { + relativeEnd = Math.max(size + end, 0); + } else { + relativeEnd = Math.min(end, size); + } + const span = Math.max(relativeEnd - relativeStart, 0); -module.exports = {"$id":"pageTimings.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","properties":{"onContentLoad":{"type":"number","min":-1},"onLoad":{"type":"number","min":-1},"comment":{"type":"string"}}}; + const buffer = this[BUFFER]; + const slicedBuffer = buffer.slice(relativeStart, relativeStart + span); + const blob = new Blob([], { type: arguments[2] }); + blob[BUFFER] = slicedBuffer; + return blob; + } +} -/***/ }), -/* 182 */, -/* 183 */, -/* 184 */, -/* 185 */, -/* 186 */, -/* 187 */, -/* 188 */, -/* 189 */, -/* 190 */, -/* 191 */ -/***/ (function(module) { +Object.defineProperties(Blob.prototype, { + size: { enumerable: true }, + type: { enumerable: true }, + slice: { enumerable: true } +}); -module.exports = require("querystring"); +Object.defineProperty(Blob.prototype, Symbol.toStringTag, { + value: 'Blob', + writable: false, + enumerable: false, + configurable: true +}); -/***/ }), -/* 192 */, -/* 193 */, -/* 194 */, -/* 195 */, -/* 196 */ -/***/ (function(module, __unusedexports, __webpack_require__) { +/** + * fetch-error.js + * + * FetchError interface for operational errors + */ -(function(nacl) { -'use strict'; +/** + * Create FetchError instance + * + * @param String message Error message for human + * @param String type Error type for machine + * @param String systemError For Node.js system error + * @return FetchError + */ +function FetchError(message, type, systemError) { + Error.call(this, message); -// Ported in 2014 by Dmitry Chestnykh and Devi Mandiri. -// Public domain. -// -// Implementation derived from TweetNaCl version 20140427. -// See for details: http://tweetnacl.cr.yp.to/ + this.message = message; + this.type = type; -var gf = function(init) { - var i, r = new Float64Array(16); - if (init) for (i = 0; i < init.length; i++) r[i] = init[i]; - return r; -}; + // when err.type is `system`, err.code contains system error code + if (systemError) { + this.code = this.errno = systemError.code; + } -// Pluggable, initialized in high-level API below. -var randombytes = function(/* x, n */) { throw new Error('no PRNG'); }; - -var _0 = new Uint8Array(16); -var _9 = new Uint8Array(32); _9[0] = 9; - -var gf0 = gf(), - gf1 = gf([1]), - _121665 = gf([0xdb41, 1]), - D = gf([0x78a3, 0x1359, 0x4dca, 0x75eb, 0xd8ab, 0x4141, 0x0a4d, 0x0070, 0xe898, 0x7779, 0x4079, 0x8cc7, 0xfe73, 0x2b6f, 0x6cee, 0x5203]), - D2 = gf([0xf159, 0x26b2, 0x9b94, 0xebd6, 0xb156, 0x8283, 0x149a, 0x00e0, 0xd130, 0xeef3, 0x80f2, 0x198e, 0xfce7, 0x56df, 0xd9dc, 0x2406]), - X = gf([0xd51a, 0x8f25, 0x2d60, 0xc956, 0xa7b2, 0x9525, 0xc760, 0x692c, 0xdc5c, 0xfdd6, 0xe231, 0xc0a4, 0x53fe, 0xcd6e, 0x36d3, 0x2169]), - Y = gf([0x6658, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666, 0x6666]), - I = gf([0xa0b0, 0x4a0e, 0x1b27, 0xc4ee, 0xe478, 0xad2f, 0x1806, 0x2f43, 0xd7a7, 0x3dfb, 0x0099, 0x2b4d, 0xdf0b, 0x4fc1, 0x2480, 0x2b83]); - -function ts64(x, i, h, l) { - x[i] = (h >> 24) & 0xff; - x[i+1] = (h >> 16) & 0xff; - x[i+2] = (h >> 8) & 0xff; - x[i+3] = h & 0xff; - x[i+4] = (l >> 24) & 0xff; - x[i+5] = (l >> 16) & 0xff; - x[i+6] = (l >> 8) & 0xff; - x[i+7] = l & 0xff; + // hide custom error implementation details from end-users + Error.captureStackTrace(this, this.constructor); } -function vn(x, xi, y, yi, n) { - var i,d = 0; - for (i = 0; i < n; i++) d |= x[xi+i]^y[yi+i]; - return (1 & ((d - 1) >>> 8)) - 1; -} +FetchError.prototype = Object.create(Error.prototype); +FetchError.prototype.constructor = FetchError; +FetchError.prototype.name = 'FetchError'; -function crypto_verify_16(x, xi, y, yi) { - return vn(x,xi,y,yi,16); -} +let convert; +try { + convert = __webpack_require__(18).convert; +} catch (e) {} -function crypto_verify_32(x, xi, y, yi) { - return vn(x,xi,y,yi,32); -} +const INTERNALS = Symbol('Body internals'); -function core_salsa20(o, p, k, c) { - var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, - j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, - j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, - j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, - j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, - j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, - j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, - j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, - j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, - j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, - j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, - j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, - j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, - j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, - j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, - j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; - - var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, - x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, - x15 = j15, u; - - for (var i = 0; i < 20; i += 2) { - u = x0 + x12 | 0; - x4 ^= u<<7 | u>>>(32-7); - u = x4 + x0 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x4 | 0; - x12 ^= u<<13 | u>>>(32-13); - u = x12 + x8 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x1 | 0; - x9 ^= u<<7 | u>>>(32-7); - u = x9 + x5 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x9 | 0; - x1 ^= u<<13 | u>>>(32-13); - u = x1 + x13 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x6 | 0; - x14 ^= u<<7 | u>>>(32-7); - u = x14 + x10 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x14 | 0; - x6 ^= u<<13 | u>>>(32-13); - u = x6 + x2 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x11 | 0; - x3 ^= u<<7 | u>>>(32-7); - u = x3 + x15 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x3 | 0; - x11 ^= u<<13 | u>>>(32-13); - u = x11 + x7 | 0; - x15 ^= u<<18 | u>>>(32-18); - - u = x0 + x3 | 0; - x1 ^= u<<7 | u>>>(32-7); - u = x1 + x0 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x1 | 0; - x3 ^= u<<13 | u>>>(32-13); - u = x3 + x2 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x4 | 0; - x6 ^= u<<7 | u>>>(32-7); - u = x6 + x5 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x6 | 0; - x4 ^= u<<13 | u>>>(32-13); - u = x4 + x7 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x9 | 0; - x11 ^= u<<7 | u>>>(32-7); - u = x11 + x10 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x11 | 0; - x9 ^= u<<13 | u>>>(32-13); - u = x9 + x8 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x14 | 0; - x12 ^= u<<7 | u>>>(32-7); - u = x12 + x15 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x12 | 0; - x14 ^= u<<13 | u>>>(32-13); - u = x14 + x13 | 0; - x15 ^= u<<18 | u>>>(32-18); - } - x0 = x0 + j0 | 0; - x1 = x1 + j1 | 0; - x2 = x2 + j2 | 0; - x3 = x3 + j3 | 0; - x4 = x4 + j4 | 0; - x5 = x5 + j5 | 0; - x6 = x6 + j6 | 0; - x7 = x7 + j7 | 0; - x8 = x8 + j8 | 0; - x9 = x9 + j9 | 0; - x10 = x10 + j10 | 0; - x11 = x11 + j11 | 0; - x12 = x12 + j12 | 0; - x13 = x13 + j13 | 0; - x14 = x14 + j14 | 0; - x15 = x15 + j15 | 0; - - o[ 0] = x0 >>> 0 & 0xff; - o[ 1] = x0 >>> 8 & 0xff; - o[ 2] = x0 >>> 16 & 0xff; - o[ 3] = x0 >>> 24 & 0xff; - - o[ 4] = x1 >>> 0 & 0xff; - o[ 5] = x1 >>> 8 & 0xff; - o[ 6] = x1 >>> 16 & 0xff; - o[ 7] = x1 >>> 24 & 0xff; - - o[ 8] = x2 >>> 0 & 0xff; - o[ 9] = x2 >>> 8 & 0xff; - o[10] = x2 >>> 16 & 0xff; - o[11] = x2 >>> 24 & 0xff; - - o[12] = x3 >>> 0 & 0xff; - o[13] = x3 >>> 8 & 0xff; - o[14] = x3 >>> 16 & 0xff; - o[15] = x3 >>> 24 & 0xff; - - o[16] = x4 >>> 0 & 0xff; - o[17] = x4 >>> 8 & 0xff; - o[18] = x4 >>> 16 & 0xff; - o[19] = x4 >>> 24 & 0xff; - - o[20] = x5 >>> 0 & 0xff; - o[21] = x5 >>> 8 & 0xff; - o[22] = x5 >>> 16 & 0xff; - o[23] = x5 >>> 24 & 0xff; - - o[24] = x6 >>> 0 & 0xff; - o[25] = x6 >>> 8 & 0xff; - o[26] = x6 >>> 16 & 0xff; - o[27] = x6 >>> 24 & 0xff; - - o[28] = x7 >>> 0 & 0xff; - o[29] = x7 >>> 8 & 0xff; - o[30] = x7 >>> 16 & 0xff; - o[31] = x7 >>> 24 & 0xff; - - o[32] = x8 >>> 0 & 0xff; - o[33] = x8 >>> 8 & 0xff; - o[34] = x8 >>> 16 & 0xff; - o[35] = x8 >>> 24 & 0xff; - - o[36] = x9 >>> 0 & 0xff; - o[37] = x9 >>> 8 & 0xff; - o[38] = x9 >>> 16 & 0xff; - o[39] = x9 >>> 24 & 0xff; - - o[40] = x10 >>> 0 & 0xff; - o[41] = x10 >>> 8 & 0xff; - o[42] = x10 >>> 16 & 0xff; - o[43] = x10 >>> 24 & 0xff; - - o[44] = x11 >>> 0 & 0xff; - o[45] = x11 >>> 8 & 0xff; - o[46] = x11 >>> 16 & 0xff; - o[47] = x11 >>> 24 & 0xff; - - o[48] = x12 >>> 0 & 0xff; - o[49] = x12 >>> 8 & 0xff; - o[50] = x12 >>> 16 & 0xff; - o[51] = x12 >>> 24 & 0xff; - - o[52] = x13 >>> 0 & 0xff; - o[53] = x13 >>> 8 & 0xff; - o[54] = x13 >>> 16 & 0xff; - o[55] = x13 >>> 24 & 0xff; - - o[56] = x14 >>> 0 & 0xff; - o[57] = x14 >>> 8 & 0xff; - o[58] = x14 >>> 16 & 0xff; - o[59] = x14 >>> 24 & 0xff; - - o[60] = x15 >>> 0 & 0xff; - o[61] = x15 >>> 8 & 0xff; - o[62] = x15 >>> 16 & 0xff; - o[63] = x15 >>> 24 & 0xff; -} +// fix an issue where "PassThrough" isn't a named export for node <10 +const PassThrough = Stream.PassThrough; -function core_hsalsa20(o,p,k,c) { - var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, - j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, - j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, - j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, - j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, - j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, - j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, - j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, - j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, - j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, - j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, - j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, - j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, - j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, - j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, - j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; - - var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, - x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, - x15 = j15, u; - - for (var i = 0; i < 20; i += 2) { - u = x0 + x12 | 0; - x4 ^= u<<7 | u>>>(32-7); - u = x4 + x0 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x4 | 0; - x12 ^= u<<13 | u>>>(32-13); - u = x12 + x8 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x1 | 0; - x9 ^= u<<7 | u>>>(32-7); - u = x9 + x5 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x9 | 0; - x1 ^= u<<13 | u>>>(32-13); - u = x1 + x13 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x6 | 0; - x14 ^= u<<7 | u>>>(32-7); - u = x14 + x10 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x14 | 0; - x6 ^= u<<13 | u>>>(32-13); - u = x6 + x2 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x11 | 0; - x3 ^= u<<7 | u>>>(32-7); - u = x3 + x15 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x3 | 0; - x11 ^= u<<13 | u>>>(32-13); - u = x11 + x7 | 0; - x15 ^= u<<18 | u>>>(32-18); - - u = x0 + x3 | 0; - x1 ^= u<<7 | u>>>(32-7); - u = x1 + x0 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x1 | 0; - x3 ^= u<<13 | u>>>(32-13); - u = x3 + x2 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x4 | 0; - x6 ^= u<<7 | u>>>(32-7); - u = x6 + x5 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x6 | 0; - x4 ^= u<<13 | u>>>(32-13); - u = x4 + x7 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x9 | 0; - x11 ^= u<<7 | u>>>(32-7); - u = x11 + x10 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x11 | 0; - x9 ^= u<<13 | u>>>(32-13); - u = x9 + x8 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x14 | 0; - x12 ^= u<<7 | u>>>(32-7); - u = x12 + x15 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x12 | 0; - x14 ^= u<<13 | u>>>(32-13); - u = x14 + x13 | 0; - x15 ^= u<<18 | u>>>(32-18); - } +/** + * Body mixin + * + * Ref: https://fetch.spec.whatwg.org/#body + * + * @param Stream body Readable stream + * @param Object opts Response options + * @return Void + */ +function Body(body) { + var _this = this; - o[ 0] = x0 >>> 0 & 0xff; - o[ 1] = x0 >>> 8 & 0xff; - o[ 2] = x0 >>> 16 & 0xff; - o[ 3] = x0 >>> 24 & 0xff; - - o[ 4] = x5 >>> 0 & 0xff; - o[ 5] = x5 >>> 8 & 0xff; - o[ 6] = x5 >>> 16 & 0xff; - o[ 7] = x5 >>> 24 & 0xff; - - o[ 8] = x10 >>> 0 & 0xff; - o[ 9] = x10 >>> 8 & 0xff; - o[10] = x10 >>> 16 & 0xff; - o[11] = x10 >>> 24 & 0xff; - - o[12] = x15 >>> 0 & 0xff; - o[13] = x15 >>> 8 & 0xff; - o[14] = x15 >>> 16 & 0xff; - o[15] = x15 >>> 24 & 0xff; - - o[16] = x6 >>> 0 & 0xff; - o[17] = x6 >>> 8 & 0xff; - o[18] = x6 >>> 16 & 0xff; - o[19] = x6 >>> 24 & 0xff; - - o[20] = x7 >>> 0 & 0xff; - o[21] = x7 >>> 8 & 0xff; - o[22] = x7 >>> 16 & 0xff; - o[23] = x7 >>> 24 & 0xff; - - o[24] = x8 >>> 0 & 0xff; - o[25] = x8 >>> 8 & 0xff; - o[26] = x8 >>> 16 & 0xff; - o[27] = x8 >>> 24 & 0xff; - - o[28] = x9 >>> 0 & 0xff; - o[29] = x9 >>> 8 & 0xff; - o[30] = x9 >>> 16 & 0xff; - o[31] = x9 >>> 24 & 0xff; -} + var _ref = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}, + _ref$size = _ref.size; -function crypto_core_salsa20(out,inp,k,c) { - core_salsa20(out,inp,k,c); -} + let size = _ref$size === undefined ? 0 : _ref$size; + var _ref$timeout = _ref.timeout; + let timeout = _ref$timeout === undefined ? 0 : _ref$timeout; -function crypto_core_hsalsa20(out,inp,k,c) { - core_hsalsa20(out,inp,k,c); -} + if (body == null) { + // body is undefined or null + body = null; + } else if (isURLSearchParams(body)) { + // body is a URLSearchParams + body = Buffer.from(body.toString()); + } else if (isBlob(body)) ; else if (Buffer.isBuffer(body)) ; else if (Object.prototype.toString.call(body) === '[object ArrayBuffer]') { + // body is ArrayBuffer + body = Buffer.from(body); + } else if (ArrayBuffer.isView(body)) { + // body is ArrayBufferView + body = Buffer.from(body.buffer, body.byteOffset, body.byteLength); + } else if (body instanceof Stream) ; else { + // none of the above + // coerce to string then buffer + body = Buffer.from(String(body)); + } + this[INTERNALS] = { + body, + disturbed: false, + error: null + }; + this.size = size; + this.timeout = timeout; -var sigma = new Uint8Array([101, 120, 112, 97, 110, 100, 32, 51, 50, 45, 98, 121, 116, 101, 32, 107]); - // "expand 32-byte k" - -function crypto_stream_salsa20_xor(c,cpos,m,mpos,b,n,k) { - var z = new Uint8Array(16), x = new Uint8Array(64); - var u, i; - for (i = 0; i < 16; i++) z[i] = 0; - for (i = 0; i < 8; i++) z[i] = n[i]; - while (b >= 64) { - crypto_core_salsa20(x,z,k,sigma); - for (i = 0; i < 64; i++) c[cpos+i] = m[mpos+i] ^ x[i]; - u = 1; - for (i = 8; i < 16; i++) { - u = u + (z[i] & 0xff) | 0; - z[i] = u & 0xff; - u >>>= 8; - } - b -= 64; - cpos += 64; - mpos += 64; - } - if (b > 0) { - crypto_core_salsa20(x,z,k,sigma); - for (i = 0; i < b; i++) c[cpos+i] = m[mpos+i] ^ x[i]; - } - return 0; + if (body instanceof Stream) { + body.on('error', function (err) { + const error = err.name === 'AbortError' ? err : new FetchError(`Invalid response body while trying to fetch ${_this.url}: ${err.message}`, 'system', err); + _this[INTERNALS].error = error; + }); + } } -function crypto_stream_salsa20(c,cpos,b,n,k) { - var z = new Uint8Array(16), x = new Uint8Array(64); - var u, i; - for (i = 0; i < 16; i++) z[i] = 0; - for (i = 0; i < 8; i++) z[i] = n[i]; - while (b >= 64) { - crypto_core_salsa20(x,z,k,sigma); - for (i = 0; i < 64; i++) c[cpos+i] = x[i]; - u = 1; - for (i = 8; i < 16; i++) { - u = u + (z[i] & 0xff) | 0; - z[i] = u & 0xff; - u >>>= 8; - } - b -= 64; - cpos += 64; - } - if (b > 0) { - crypto_core_salsa20(x,z,k,sigma); - for (i = 0; i < b; i++) c[cpos+i] = x[i]; - } - return 0; -} +Body.prototype = { + get body() { + return this[INTERNALS].body; + }, -function crypto_stream(c,cpos,d,n,k) { - var s = new Uint8Array(32); - crypto_core_hsalsa20(s,n,k,sigma); - var sn = new Uint8Array(8); - for (var i = 0; i < 8; i++) sn[i] = n[i+16]; - return crypto_stream_salsa20(c,cpos,d,sn,s); -} + get bodyUsed() { + return this[INTERNALS].disturbed; + }, -function crypto_stream_xor(c,cpos,m,mpos,d,n,k) { - var s = new Uint8Array(32); - crypto_core_hsalsa20(s,n,k,sigma); - var sn = new Uint8Array(8); - for (var i = 0; i < 8; i++) sn[i] = n[i+16]; - return crypto_stream_salsa20_xor(c,cpos,m,mpos,d,sn,s); -} + /** + * Decode response as ArrayBuffer + * + * @return Promise + */ + arrayBuffer() { + return consumeBody.call(this).then(function (buf) { + return buf.buffer.slice(buf.byteOffset, buf.byteOffset + buf.byteLength); + }); + }, -/* -* Port of Andrew Moon's Poly1305-donna-16. Public domain. -* https://github.com/floodyberry/poly1305-donna -*/ - -var poly1305 = function(key) { - this.buffer = new Uint8Array(16); - this.r = new Uint16Array(10); - this.h = new Uint16Array(10); - this.pad = new Uint16Array(8); - this.leftover = 0; - this.fin = 0; - - var t0, t1, t2, t3, t4, t5, t6, t7; - - t0 = key[ 0] & 0xff | (key[ 1] & 0xff) << 8; this.r[0] = ( t0 ) & 0x1fff; - t1 = key[ 2] & 0xff | (key[ 3] & 0xff) << 8; this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff; - t2 = key[ 4] & 0xff | (key[ 5] & 0xff) << 8; this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03; - t3 = key[ 6] & 0xff | (key[ 7] & 0xff) << 8; this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff; - t4 = key[ 8] & 0xff | (key[ 9] & 0xff) << 8; this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff; - this.r[5] = ((t4 >>> 1)) & 0x1ffe; - t5 = key[10] & 0xff | (key[11] & 0xff) << 8; this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff; - t6 = key[12] & 0xff | (key[13] & 0xff) << 8; this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81; - t7 = key[14] & 0xff | (key[15] & 0xff) << 8; this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff; - this.r[9] = ((t7 >>> 5)) & 0x007f; - - this.pad[0] = key[16] & 0xff | (key[17] & 0xff) << 8; - this.pad[1] = key[18] & 0xff | (key[19] & 0xff) << 8; - this.pad[2] = key[20] & 0xff | (key[21] & 0xff) << 8; - this.pad[3] = key[22] & 0xff | (key[23] & 0xff) << 8; - this.pad[4] = key[24] & 0xff | (key[25] & 0xff) << 8; - this.pad[5] = key[26] & 0xff | (key[27] & 0xff) << 8; - this.pad[6] = key[28] & 0xff | (key[29] & 0xff) << 8; - this.pad[7] = key[30] & 0xff | (key[31] & 0xff) << 8; -}; + /** + * Return raw response as Blob + * + * @return Promise + */ + blob() { + let ct = this.headers && this.headers.get('content-type') || ''; + return consumeBody.call(this).then(function (buf) { + return Object.assign( + // Prevent copying + new Blob([], { + type: ct.toLowerCase() + }), { + [BUFFER]: buf + }); + }); + }, -poly1305.prototype.blocks = function(m, mpos, bytes) { - var hibit = this.fin ? 0 : (1 << 11); - var t0, t1, t2, t3, t4, t5, t6, t7, c; - var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9; - - var h0 = this.h[0], - h1 = this.h[1], - h2 = this.h[2], - h3 = this.h[3], - h4 = this.h[4], - h5 = this.h[5], - h6 = this.h[6], - h7 = this.h[7], - h8 = this.h[8], - h9 = this.h[9]; - - var r0 = this.r[0], - r1 = this.r[1], - r2 = this.r[2], - r3 = this.r[3], - r4 = this.r[4], - r5 = this.r[5], - r6 = this.r[6], - r7 = this.r[7], - r8 = this.r[8], - r9 = this.r[9]; - - while (bytes >= 16) { - t0 = m[mpos+ 0] & 0xff | (m[mpos+ 1] & 0xff) << 8; h0 += ( t0 ) & 0x1fff; - t1 = m[mpos+ 2] & 0xff | (m[mpos+ 3] & 0xff) << 8; h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff; - t2 = m[mpos+ 4] & 0xff | (m[mpos+ 5] & 0xff) << 8; h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff; - t3 = m[mpos+ 6] & 0xff | (m[mpos+ 7] & 0xff) << 8; h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff; - t4 = m[mpos+ 8] & 0xff | (m[mpos+ 9] & 0xff) << 8; h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff; - h5 += ((t4 >>> 1)) & 0x1fff; - t5 = m[mpos+10] & 0xff | (m[mpos+11] & 0xff) << 8; h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff; - t6 = m[mpos+12] & 0xff | (m[mpos+13] & 0xff) << 8; h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff; - t7 = m[mpos+14] & 0xff | (m[mpos+15] & 0xff) << 8; h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff; - h9 += ((t7 >>> 5)) | hibit; - - c = 0; - - d0 = c; - d0 += h0 * r0; - d0 += h1 * (5 * r9); - d0 += h2 * (5 * r8); - d0 += h3 * (5 * r7); - d0 += h4 * (5 * r6); - c = (d0 >>> 13); d0 &= 0x1fff; - d0 += h5 * (5 * r5); - d0 += h6 * (5 * r4); - d0 += h7 * (5 * r3); - d0 += h8 * (5 * r2); - d0 += h9 * (5 * r1); - c += (d0 >>> 13); d0 &= 0x1fff; - - d1 = c; - d1 += h0 * r1; - d1 += h1 * r0; - d1 += h2 * (5 * r9); - d1 += h3 * (5 * r8); - d1 += h4 * (5 * r7); - c = (d1 >>> 13); d1 &= 0x1fff; - d1 += h5 * (5 * r6); - d1 += h6 * (5 * r5); - d1 += h7 * (5 * r4); - d1 += h8 * (5 * r3); - d1 += h9 * (5 * r2); - c += (d1 >>> 13); d1 &= 0x1fff; - - d2 = c; - d2 += h0 * r2; - d2 += h1 * r1; - d2 += h2 * r0; - d2 += h3 * (5 * r9); - d2 += h4 * (5 * r8); - c = (d2 >>> 13); d2 &= 0x1fff; - d2 += h5 * (5 * r7); - d2 += h6 * (5 * r6); - d2 += h7 * (5 * r5); - d2 += h8 * (5 * r4); - d2 += h9 * (5 * r3); - c += (d2 >>> 13); d2 &= 0x1fff; - - d3 = c; - d3 += h0 * r3; - d3 += h1 * r2; - d3 += h2 * r1; - d3 += h3 * r0; - d3 += h4 * (5 * r9); - c = (d3 >>> 13); d3 &= 0x1fff; - d3 += h5 * (5 * r8); - d3 += h6 * (5 * r7); - d3 += h7 * (5 * r6); - d3 += h8 * (5 * r5); - d3 += h9 * (5 * r4); - c += (d3 >>> 13); d3 &= 0x1fff; - - d4 = c; - d4 += h0 * r4; - d4 += h1 * r3; - d4 += h2 * r2; - d4 += h3 * r1; - d4 += h4 * r0; - c = (d4 >>> 13); d4 &= 0x1fff; - d4 += h5 * (5 * r9); - d4 += h6 * (5 * r8); - d4 += h7 * (5 * r7); - d4 += h8 * (5 * r6); - d4 += h9 * (5 * r5); - c += (d4 >>> 13); d4 &= 0x1fff; - - d5 = c; - d5 += h0 * r5; - d5 += h1 * r4; - d5 += h2 * r3; - d5 += h3 * r2; - d5 += h4 * r1; - c = (d5 >>> 13); d5 &= 0x1fff; - d5 += h5 * r0; - d5 += h6 * (5 * r9); - d5 += h7 * (5 * r8); - d5 += h8 * (5 * r7); - d5 += h9 * (5 * r6); - c += (d5 >>> 13); d5 &= 0x1fff; - - d6 = c; - d6 += h0 * r6; - d6 += h1 * r5; - d6 += h2 * r4; - d6 += h3 * r3; - d6 += h4 * r2; - c = (d6 >>> 13); d6 &= 0x1fff; - d6 += h5 * r1; - d6 += h6 * r0; - d6 += h7 * (5 * r9); - d6 += h8 * (5 * r8); - d6 += h9 * (5 * r7); - c += (d6 >>> 13); d6 &= 0x1fff; - - d7 = c; - d7 += h0 * r7; - d7 += h1 * r6; - d7 += h2 * r5; - d7 += h3 * r4; - d7 += h4 * r3; - c = (d7 >>> 13); d7 &= 0x1fff; - d7 += h5 * r2; - d7 += h6 * r1; - d7 += h7 * r0; - d7 += h8 * (5 * r9); - d7 += h9 * (5 * r8); - c += (d7 >>> 13); d7 &= 0x1fff; - - d8 = c; - d8 += h0 * r8; - d8 += h1 * r7; - d8 += h2 * r6; - d8 += h3 * r5; - d8 += h4 * r4; - c = (d8 >>> 13); d8 &= 0x1fff; - d8 += h5 * r3; - d8 += h6 * r2; - d8 += h7 * r1; - d8 += h8 * r0; - d8 += h9 * (5 * r9); - c += (d8 >>> 13); d8 &= 0x1fff; - - d9 = c; - d9 += h0 * r9; - d9 += h1 * r8; - d9 += h2 * r7; - d9 += h3 * r6; - d9 += h4 * r5; - c = (d9 >>> 13); d9 &= 0x1fff; - d9 += h5 * r4; - d9 += h6 * r3; - d9 += h7 * r2; - d9 += h8 * r1; - d9 += h9 * r0; - c += (d9 >>> 13); d9 &= 0x1fff; - - c = (((c << 2) + c)) | 0; - c = (c + d0) | 0; - d0 = c & 0x1fff; - c = (c >>> 13); - d1 += c; - - h0 = d0; - h1 = d1; - h2 = d2; - h3 = d3; - h4 = d4; - h5 = d5; - h6 = d6; - h7 = d7; - h8 = d8; - h9 = d9; - - mpos += 16; - bytes -= 16; - } - this.h[0] = h0; - this.h[1] = h1; - this.h[2] = h2; - this.h[3] = h3; - this.h[4] = h4; - this.h[5] = h5; - this.h[6] = h6; - this.h[7] = h7; - this.h[8] = h8; - this.h[9] = h9; -}; + /** + * Decode response as json + * + * @return Promise + */ + json() { + var _this2 = this; -poly1305.prototype.finish = function(mac, macpos) { - var g = new Uint16Array(10); - var c, mask, f, i; + return consumeBody.call(this).then(function (buffer) { + try { + return JSON.parse(buffer.toString()); + } catch (err) { + return Body.Promise.reject(new FetchError(`invalid json response body at ${_this2.url} reason: ${err.message}`, 'invalid-json')); + } + }); + }, - if (this.leftover) { - i = this.leftover; - this.buffer[i++] = 1; - for (; i < 16; i++) this.buffer[i] = 0; - this.fin = 1; - this.blocks(this.buffer, 0, 16); - } + /** + * Decode response as text + * + * @return Promise + */ + text() { + return consumeBody.call(this).then(function (buffer) { + return buffer.toString(); + }); + }, - c = this.h[1] >>> 13; - this.h[1] &= 0x1fff; - for (i = 2; i < 10; i++) { - this.h[i] += c; - c = this.h[i] >>> 13; - this.h[i] &= 0x1fff; - } - this.h[0] += (c * 5); - c = this.h[0] >>> 13; - this.h[0] &= 0x1fff; - this.h[1] += c; - c = this.h[1] >>> 13; - this.h[1] &= 0x1fff; - this.h[2] += c; - - g[0] = this.h[0] + 5; - c = g[0] >>> 13; - g[0] &= 0x1fff; - for (i = 1; i < 10; i++) { - g[i] = this.h[i] + c; - c = g[i] >>> 13; - g[i] &= 0x1fff; - } - g[9] -= (1 << 13); - - mask = (c ^ 1) - 1; - for (i = 0; i < 10; i++) g[i] &= mask; - mask = ~mask; - for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i]; - - this.h[0] = ((this.h[0] ) | (this.h[1] << 13) ) & 0xffff; - this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10) ) & 0xffff; - this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7) ) & 0xffff; - this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4) ) & 0xffff; - this.h[4] = ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff; - this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11) ) & 0xffff; - this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8) ) & 0xffff; - this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5) ) & 0xffff; - - f = this.h[0] + this.pad[0]; - this.h[0] = f & 0xffff; - for (i = 1; i < 8; i++) { - f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0; - this.h[i] = f & 0xffff; - } + /** + * Decode response as buffer (non-spec api) + * + * @return Promise + */ + buffer() { + return consumeBody.call(this); + }, - mac[macpos+ 0] = (this.h[0] >>> 0) & 0xff; - mac[macpos+ 1] = (this.h[0] >>> 8) & 0xff; - mac[macpos+ 2] = (this.h[1] >>> 0) & 0xff; - mac[macpos+ 3] = (this.h[1] >>> 8) & 0xff; - mac[macpos+ 4] = (this.h[2] >>> 0) & 0xff; - mac[macpos+ 5] = (this.h[2] >>> 8) & 0xff; - mac[macpos+ 6] = (this.h[3] >>> 0) & 0xff; - mac[macpos+ 7] = (this.h[3] >>> 8) & 0xff; - mac[macpos+ 8] = (this.h[4] >>> 0) & 0xff; - mac[macpos+ 9] = (this.h[4] >>> 8) & 0xff; - mac[macpos+10] = (this.h[5] >>> 0) & 0xff; - mac[macpos+11] = (this.h[5] >>> 8) & 0xff; - mac[macpos+12] = (this.h[6] >>> 0) & 0xff; - mac[macpos+13] = (this.h[6] >>> 8) & 0xff; - mac[macpos+14] = (this.h[7] >>> 0) & 0xff; - mac[macpos+15] = (this.h[7] >>> 8) & 0xff; -}; + /** + * Decode response as text, while automatically detecting the encoding and + * trying to decode to UTF-8 (non-spec api) + * + * @return Promise + */ + textConverted() { + var _this3 = this; -poly1305.prototype.update = function(m, mpos, bytes) { - var i, want; - - if (this.leftover) { - want = (16 - this.leftover); - if (want > bytes) - want = bytes; - for (i = 0; i < want; i++) - this.buffer[this.leftover + i] = m[mpos+i]; - bytes -= want; - mpos += want; - this.leftover += want; - if (this.leftover < 16) - return; - this.blocks(this.buffer, 0, 16); - this.leftover = 0; - } + return consumeBody.call(this).then(function (buffer) { + return convertBody(buffer, _this3.headers); + }); + } +}; - if (bytes >= 16) { - want = bytes - (bytes % 16); - this.blocks(m, mpos, want); - mpos += want; - bytes -= want; - } +// In browsers, all properties are enumerable. +Object.defineProperties(Body.prototype, { + body: { enumerable: true }, + bodyUsed: { enumerable: true }, + arrayBuffer: { enumerable: true }, + blob: { enumerable: true }, + json: { enumerable: true }, + text: { enumerable: true } +}); - if (bytes) { - for (i = 0; i < bytes; i++) - this.buffer[this.leftover + i] = m[mpos+i]; - this.leftover += bytes; - } +Body.mixIn = function (proto) { + for (const name of Object.getOwnPropertyNames(Body.prototype)) { + // istanbul ignore else: future proof + if (!(name in proto)) { + const desc = Object.getOwnPropertyDescriptor(Body.prototype, name); + Object.defineProperty(proto, name, desc); + } + } }; -function crypto_onetimeauth(out, outpos, m, mpos, n, k) { - var s = new poly1305(k); - s.update(m, mpos, n); - s.finish(out, outpos); - return 0; -} +/** + * Consume and convert an entire Body to a Buffer. + * + * Ref: https://fetch.spec.whatwg.org/#concept-body-consume-body + * + * @return Promise + */ +function consumeBody() { + var _this4 = this; -function crypto_onetimeauth_verify(h, hpos, m, mpos, n, k) { - var x = new Uint8Array(16); - crypto_onetimeauth(x,0,m,mpos,n,k); - return crypto_verify_16(h,hpos,x,0); -} + if (this[INTERNALS].disturbed) { + return Body.Promise.reject(new TypeError(`body used already for: ${this.url}`)); + } -function crypto_secretbox(c,m,d,n,k) { - var i; - if (d < 32) return -1; - crypto_stream_xor(c,0,m,0,d,n,k); - crypto_onetimeauth(c, 16, c, 32, d - 32, c); - for (i = 0; i < 16; i++) c[i] = 0; - return 0; -} + this[INTERNALS].disturbed = true; -function crypto_secretbox_open(m,c,d,n,k) { - var i; - var x = new Uint8Array(32); - if (d < 32) return -1; - crypto_stream(x,0,32,n,k); - if (crypto_onetimeauth_verify(c, 16,c, 32,d - 32,x) !== 0) return -1; - crypto_stream_xor(m,0,c,0,d,n,k); - for (i = 0; i < 32; i++) m[i] = 0; - return 0; -} + if (this[INTERNALS].error) { + return Body.Promise.reject(this[INTERNALS].error); + } -function set25519(r, a) { - var i; - for (i = 0; i < 16; i++) r[i] = a[i]|0; -} + let body = this.body; -function car25519(o) { - var i, v, c = 1; - for (i = 0; i < 16; i++) { - v = o[i] + c + 65535; - c = Math.floor(v / 65536); - o[i] = v - c * 65536; - } - o[0] += c-1 + 37 * (c-1); -} + // body is null + if (body === null) { + return Body.Promise.resolve(Buffer.alloc(0)); + } -function sel25519(p, q, b) { - var t, c = ~(b-1); - for (var i = 0; i < 16; i++) { - t = c & (p[i] ^ q[i]); - p[i] ^= t; - q[i] ^= t; - } -} + // body is blob + if (isBlob(body)) { + body = body.stream(); + } -function pack25519(o, n) { - var i, j, b; - var m = gf(), t = gf(); - for (i = 0; i < 16; i++) t[i] = n[i]; - car25519(t); - car25519(t); - car25519(t); - for (j = 0; j < 2; j++) { - m[0] = t[0] - 0xffed; - for (i = 1; i < 15; i++) { - m[i] = t[i] - 0xffff - ((m[i-1]>>16) & 1); - m[i-1] &= 0xffff; - } - m[15] = t[15] - 0x7fff - ((m[14]>>16) & 1); - b = (m[15]>>16) & 1; - m[14] &= 0xffff; - sel25519(t, m, 1-b); - } - for (i = 0; i < 16; i++) { - o[2*i] = t[i] & 0xff; - o[2*i+1] = t[i]>>8; - } -} + // body is buffer + if (Buffer.isBuffer(body)) { + return Body.Promise.resolve(body); + } -function neq25519(a, b) { - var c = new Uint8Array(32), d = new Uint8Array(32); - pack25519(c, a); - pack25519(d, b); - return crypto_verify_32(c, 0, d, 0); -} + // istanbul ignore if: should never happen + if (!(body instanceof Stream)) { + return Body.Promise.resolve(Buffer.alloc(0)); + } -function par25519(a) { - var d = new Uint8Array(32); - pack25519(d, a); - return d[0] & 1; -} + // body is stream + // get ready to actually consume the body + let accum = []; + let accumBytes = 0; + let abort = false; -function unpack25519(o, n) { - var i; - for (i = 0; i < 16; i++) o[i] = n[2*i] + (n[2*i+1] << 8); - o[15] &= 0x7fff; -} + return new Body.Promise(function (resolve, reject) { + let resTimeout; -function A(o, a, b) { - for (var i = 0; i < 16; i++) o[i] = a[i] + b[i]; -} + // allow timeout on slow response body + if (_this4.timeout) { + resTimeout = setTimeout(function () { + abort = true; + reject(new FetchError(`Response timeout while trying to fetch ${_this4.url} (over ${_this4.timeout}ms)`, 'body-timeout')); + }, _this4.timeout); + } -function Z(o, a, b) { - for (var i = 0; i < 16; i++) o[i] = a[i] - b[i]; -} + // handle stream errors + body.on('error', function (err) { + if (err.name === 'AbortError') { + // if the request was aborted, reject with this Error + abort = true; + reject(err); + } else { + // other errors, such as incorrect content-encoding + reject(new FetchError(`Invalid response body while trying to fetch ${_this4.url}: ${err.message}`, 'system', err)); + } + }); -function M(o, a, b) { - var v, c, - t0 = 0, t1 = 0, t2 = 0, t3 = 0, t4 = 0, t5 = 0, t6 = 0, t7 = 0, - t8 = 0, t9 = 0, t10 = 0, t11 = 0, t12 = 0, t13 = 0, t14 = 0, t15 = 0, - t16 = 0, t17 = 0, t18 = 0, t19 = 0, t20 = 0, t21 = 0, t22 = 0, t23 = 0, - t24 = 0, t25 = 0, t26 = 0, t27 = 0, t28 = 0, t29 = 0, t30 = 0, - b0 = b[0], - b1 = b[1], - b2 = b[2], - b3 = b[3], - b4 = b[4], - b5 = b[5], - b6 = b[6], - b7 = b[7], - b8 = b[8], - b9 = b[9], - b10 = b[10], - b11 = b[11], - b12 = b[12], - b13 = b[13], - b14 = b[14], - b15 = b[15]; - - v = a[0]; - t0 += v * b0; - t1 += v * b1; - t2 += v * b2; - t3 += v * b3; - t4 += v * b4; - t5 += v * b5; - t6 += v * b6; - t7 += v * b7; - t8 += v * b8; - t9 += v * b9; - t10 += v * b10; - t11 += v * b11; - t12 += v * b12; - t13 += v * b13; - t14 += v * b14; - t15 += v * b15; - v = a[1]; - t1 += v * b0; - t2 += v * b1; - t3 += v * b2; - t4 += v * b3; - t5 += v * b4; - t6 += v * b5; - t7 += v * b6; - t8 += v * b7; - t9 += v * b8; - t10 += v * b9; - t11 += v * b10; - t12 += v * b11; - t13 += v * b12; - t14 += v * b13; - t15 += v * b14; - t16 += v * b15; - v = a[2]; - t2 += v * b0; - t3 += v * b1; - t4 += v * b2; - t5 += v * b3; - t6 += v * b4; - t7 += v * b5; - t8 += v * b6; - t9 += v * b7; - t10 += v * b8; - t11 += v * b9; - t12 += v * b10; - t13 += v * b11; - t14 += v * b12; - t15 += v * b13; - t16 += v * b14; - t17 += v * b15; - v = a[3]; - t3 += v * b0; - t4 += v * b1; - t5 += v * b2; - t6 += v * b3; - t7 += v * b4; - t8 += v * b5; - t9 += v * b6; - t10 += v * b7; - t11 += v * b8; - t12 += v * b9; - t13 += v * b10; - t14 += v * b11; - t15 += v * b12; - t16 += v * b13; - t17 += v * b14; - t18 += v * b15; - v = a[4]; - t4 += v * b0; - t5 += v * b1; - t6 += v * b2; - t7 += v * b3; - t8 += v * b4; - t9 += v * b5; - t10 += v * b6; - t11 += v * b7; - t12 += v * b8; - t13 += v * b9; - t14 += v * b10; - t15 += v * b11; - t16 += v * b12; - t17 += v * b13; - t18 += v * b14; - t19 += v * b15; - v = a[5]; - t5 += v * b0; - t6 += v * b1; - t7 += v * b2; - t8 += v * b3; - t9 += v * b4; - t10 += v * b5; - t11 += v * b6; - t12 += v * b7; - t13 += v * b8; - t14 += v * b9; - t15 += v * b10; - t16 += v * b11; - t17 += v * b12; - t18 += v * b13; - t19 += v * b14; - t20 += v * b15; - v = a[6]; - t6 += v * b0; - t7 += v * b1; - t8 += v * b2; - t9 += v * b3; - t10 += v * b4; - t11 += v * b5; - t12 += v * b6; - t13 += v * b7; - t14 += v * b8; - t15 += v * b9; - t16 += v * b10; - t17 += v * b11; - t18 += v * b12; - t19 += v * b13; - t20 += v * b14; - t21 += v * b15; - v = a[7]; - t7 += v * b0; - t8 += v * b1; - t9 += v * b2; - t10 += v * b3; - t11 += v * b4; - t12 += v * b5; - t13 += v * b6; - t14 += v * b7; - t15 += v * b8; - t16 += v * b9; - t17 += v * b10; - t18 += v * b11; - t19 += v * b12; - t20 += v * b13; - t21 += v * b14; - t22 += v * b15; - v = a[8]; - t8 += v * b0; - t9 += v * b1; - t10 += v * b2; - t11 += v * b3; - t12 += v * b4; - t13 += v * b5; - t14 += v * b6; - t15 += v * b7; - t16 += v * b8; - t17 += v * b9; - t18 += v * b10; - t19 += v * b11; - t20 += v * b12; - t21 += v * b13; - t22 += v * b14; - t23 += v * b15; - v = a[9]; - t9 += v * b0; - t10 += v * b1; - t11 += v * b2; - t12 += v * b3; - t13 += v * b4; - t14 += v * b5; - t15 += v * b6; - t16 += v * b7; - t17 += v * b8; - t18 += v * b9; - t19 += v * b10; - t20 += v * b11; - t21 += v * b12; - t22 += v * b13; - t23 += v * b14; - t24 += v * b15; - v = a[10]; - t10 += v * b0; - t11 += v * b1; - t12 += v * b2; - t13 += v * b3; - t14 += v * b4; - t15 += v * b5; - t16 += v * b6; - t17 += v * b7; - t18 += v * b8; - t19 += v * b9; - t20 += v * b10; - t21 += v * b11; - t22 += v * b12; - t23 += v * b13; - t24 += v * b14; - t25 += v * b15; - v = a[11]; - t11 += v * b0; - t12 += v * b1; - t13 += v * b2; - t14 += v * b3; - t15 += v * b4; - t16 += v * b5; - t17 += v * b6; - t18 += v * b7; - t19 += v * b8; - t20 += v * b9; - t21 += v * b10; - t22 += v * b11; - t23 += v * b12; - t24 += v * b13; - t25 += v * b14; - t26 += v * b15; - v = a[12]; - t12 += v * b0; - t13 += v * b1; - t14 += v * b2; - t15 += v * b3; - t16 += v * b4; - t17 += v * b5; - t18 += v * b6; - t19 += v * b7; - t20 += v * b8; - t21 += v * b9; - t22 += v * b10; - t23 += v * b11; - t24 += v * b12; - t25 += v * b13; - t26 += v * b14; - t27 += v * b15; - v = a[13]; - t13 += v * b0; - t14 += v * b1; - t15 += v * b2; - t16 += v * b3; - t17 += v * b4; - t18 += v * b5; - t19 += v * b6; - t20 += v * b7; - t21 += v * b8; - t22 += v * b9; - t23 += v * b10; - t24 += v * b11; - t25 += v * b12; - t26 += v * b13; - t27 += v * b14; - t28 += v * b15; - v = a[14]; - t14 += v * b0; - t15 += v * b1; - t16 += v * b2; - t17 += v * b3; - t18 += v * b4; - t19 += v * b5; - t20 += v * b6; - t21 += v * b7; - t22 += v * b8; - t23 += v * b9; - t24 += v * b10; - t25 += v * b11; - t26 += v * b12; - t27 += v * b13; - t28 += v * b14; - t29 += v * b15; - v = a[15]; - t15 += v * b0; - t16 += v * b1; - t17 += v * b2; - t18 += v * b3; - t19 += v * b4; - t20 += v * b5; - t21 += v * b6; - t22 += v * b7; - t23 += v * b8; - t24 += v * b9; - t25 += v * b10; - t26 += v * b11; - t27 += v * b12; - t28 += v * b13; - t29 += v * b14; - t30 += v * b15; - - t0 += 38 * t16; - t1 += 38 * t17; - t2 += 38 * t18; - t3 += 38 * t19; - t4 += 38 * t20; - t5 += 38 * t21; - t6 += 38 * t22; - t7 += 38 * t23; - t8 += 38 * t24; - t9 += 38 * t25; - t10 += 38 * t26; - t11 += 38 * t27; - t12 += 38 * t28; - t13 += 38 * t29; - t14 += 38 * t30; - // t15 left as is - - // first car - c = 1; - v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; - v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; - v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; - v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; - v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; - v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; - v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; - v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; - v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; - v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; - v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; - v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; - v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; - v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; - v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; - v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; - t0 += c-1 + 37 * (c-1); - - // second car - c = 1; - v = t0 + c + 65535; c = Math.floor(v / 65536); t0 = v - c * 65536; - v = t1 + c + 65535; c = Math.floor(v / 65536); t1 = v - c * 65536; - v = t2 + c + 65535; c = Math.floor(v / 65536); t2 = v - c * 65536; - v = t3 + c + 65535; c = Math.floor(v / 65536); t3 = v - c * 65536; - v = t4 + c + 65535; c = Math.floor(v / 65536); t4 = v - c * 65536; - v = t5 + c + 65535; c = Math.floor(v / 65536); t5 = v - c * 65536; - v = t6 + c + 65535; c = Math.floor(v / 65536); t6 = v - c * 65536; - v = t7 + c + 65535; c = Math.floor(v / 65536); t7 = v - c * 65536; - v = t8 + c + 65535; c = Math.floor(v / 65536); t8 = v - c * 65536; - v = t9 + c + 65535; c = Math.floor(v / 65536); t9 = v - c * 65536; - v = t10 + c + 65535; c = Math.floor(v / 65536); t10 = v - c * 65536; - v = t11 + c + 65535; c = Math.floor(v / 65536); t11 = v - c * 65536; - v = t12 + c + 65535; c = Math.floor(v / 65536); t12 = v - c * 65536; - v = t13 + c + 65535; c = Math.floor(v / 65536); t13 = v - c * 65536; - v = t14 + c + 65535; c = Math.floor(v / 65536); t14 = v - c * 65536; - v = t15 + c + 65535; c = Math.floor(v / 65536); t15 = v - c * 65536; - t0 += c-1 + 37 * (c-1); - - o[ 0] = t0; - o[ 1] = t1; - o[ 2] = t2; - o[ 3] = t3; - o[ 4] = t4; - o[ 5] = t5; - o[ 6] = t6; - o[ 7] = t7; - o[ 8] = t8; - o[ 9] = t9; - o[10] = t10; - o[11] = t11; - o[12] = t12; - o[13] = t13; - o[14] = t14; - o[15] = t15; -} + body.on('data', function (chunk) { + if (abort || chunk === null) { + return; + } -function S(o, a) { - M(o, a, a); -} + if (_this4.size && accumBytes + chunk.length > _this4.size) { + abort = true; + reject(new FetchError(`content size at ${_this4.url} over limit: ${_this4.size}`, 'max-size')); + return; + } -function inv25519(o, i) { - var c = gf(); - var a; - for (a = 0; a < 16; a++) c[a] = i[a]; - for (a = 253; a >= 0; a--) { - S(c, c); - if(a !== 2 && a !== 4) M(c, c, i); - } - for (a = 0; a < 16; a++) o[a] = c[a]; -} + accumBytes += chunk.length; + accum.push(chunk); + }); -function pow2523(o, i) { - var c = gf(); - var a; - for (a = 0; a < 16; a++) c[a] = i[a]; - for (a = 250; a >= 0; a--) { - S(c, c); - if(a !== 1) M(c, c, i); - } - for (a = 0; a < 16; a++) o[a] = c[a]; -} + body.on('end', function () { + if (abort) { + return; + } -function crypto_scalarmult(q, n, p) { - var z = new Uint8Array(32); - var x = new Float64Array(80), r, i; - var a = gf(), b = gf(), c = gf(), - d = gf(), e = gf(), f = gf(); - for (i = 0; i < 31; i++) z[i] = n[i]; - z[31]=(n[31]&127)|64; - z[0]&=248; - unpack25519(x,p); - for (i = 0; i < 16; i++) { - b[i]=x[i]; - d[i]=a[i]=c[i]=0; - } - a[0]=d[0]=1; - for (i=254; i>=0; --i) { - r=(z[i>>>3]>>>(i&7))&1; - sel25519(a,b,r); - sel25519(c,d,r); - A(e,a,c); - Z(a,a,c); - A(c,b,d); - Z(b,b,d); - S(d,e); - S(f,a); - M(a,c,a); - M(c,b,e); - A(e,a,c); - Z(a,a,c); - S(b,a); - Z(c,d,f); - M(a,c,_121665); - A(a,a,d); - M(c,c,a); - M(a,d,f); - M(d,b,x); - S(b,e); - sel25519(a,b,r); - sel25519(c,d,r); - } - for (i = 0; i < 16; i++) { - x[i+16]=a[i]; - x[i+32]=c[i]; - x[i+48]=b[i]; - x[i+64]=d[i]; - } - var x32 = x.subarray(32); - var x16 = x.subarray(16); - inv25519(x32,x32); - M(x16,x16,x32); - pack25519(q,x16); - return 0; -} + clearTimeout(resTimeout); -function crypto_scalarmult_base(q, n) { - return crypto_scalarmult(q, n, _9); + try { + resolve(Buffer.concat(accum, accumBytes)); + } catch (err) { + // handle streams that have accumulated too much data (issue #414) + reject(new FetchError(`Could not create Buffer from response body for ${_this4.url}: ${err.message}`, 'system', err)); + } + }); + }); } -function crypto_box_keypair(y, x) { - randombytes(x, 32); - return crypto_scalarmult_base(y, x); -} +/** + * Detect buffer encoding and convert to target encoding + * ref: http://www.w3.org/TR/2011/WD-html5-20110113/parsing.html#determining-the-character-encoding + * + * @param Buffer buffer Incoming buffer + * @param String encoding Target encoding + * @return String + */ +function convertBody(buffer, headers) { + if (typeof convert !== 'function') { + throw new Error('The package `encoding` must be installed to use the textConverted() function'); + } -function crypto_box_beforenm(k, y, x) { - var s = new Uint8Array(32); - crypto_scalarmult(s, x, y); - return crypto_core_hsalsa20(k, _0, s, sigma); -} + const ct = headers.get('content-type'); + let charset = 'utf-8'; + let res, str; -var crypto_box_afternm = crypto_secretbox; -var crypto_box_open_afternm = crypto_secretbox_open; + // header + if (ct) { + res = /charset=([^;]*)/i.exec(ct); + } -function crypto_box(c, m, d, n, y, x) { - var k = new Uint8Array(32); - crypto_box_beforenm(k, y, x); - return crypto_box_afternm(c, m, d, n, k); -} + // no charset in content type, peek at response body for at most 1024 bytes + str = buffer.slice(0, 1024).toString(); -function crypto_box_open(m, c, d, n, y, x) { - var k = new Uint8Array(32); - crypto_box_beforenm(k, y, x); - return crypto_box_open_afternm(m, c, d, n, k); -} + // html5 + if (!res && str) { + res = /= 128) { - for (i = 0; i < 16; i++) { - j = 8 * i + pos; - wh[i] = (m[j+0] << 24) | (m[j+1] << 16) | (m[j+2] << 8) | m[j+3]; - wl[i] = (m[j+4] << 24) | (m[j+5] << 16) | (m[j+6] << 8) | m[j+7]; - } - for (i = 0; i < 80; i++) { - bh0 = ah0; - bh1 = ah1; - bh2 = ah2; - bh3 = ah3; - bh4 = ah4; - bh5 = ah5; - bh6 = ah6; - bh7 = ah7; + if (res) { + res = /charset=(.*)/i.exec(res.pop()); + } + } - bl0 = al0; - bl1 = al1; - bl2 = al2; - bl3 = al3; - bl4 = al4; - bl5 = al5; - bl6 = al6; - bl7 = al7; + // xml + if (!res && str) { + res = /<\?xml.+?encoding=(['"])(.+?)\1/i.exec(str); + } - // add - h = ah7; - l = al7; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - // Sigma1 - h = ((ah4 >>> 14) | (al4 << (32-14))) ^ ((ah4 >>> 18) | (al4 << (32-18))) ^ ((al4 >>> (41-32)) | (ah4 << (32-(41-32)))); - l = ((al4 >>> 14) | (ah4 << (32-14))) ^ ((al4 >>> 18) | (ah4 << (32-18))) ^ ((ah4 >>> (41-32)) | (al4 << (32-(41-32)))); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // Ch - h = (ah4 & ah5) ^ (~ah4 & ah6); - l = (al4 & al5) ^ (~al4 & al6); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // K - h = K[i*2]; - l = K[i*2+1]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // w - h = wh[i%16]; - l = wl[i%16]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - th = c & 0xffff | d << 16; - tl = a & 0xffff | b << 16; - - // add - h = th; - l = tl; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - // Sigma0 - h = ((ah0 >>> 28) | (al0 << (32-28))) ^ ((al0 >>> (34-32)) | (ah0 << (32-(34-32)))) ^ ((al0 >>> (39-32)) | (ah0 << (32-(39-32)))); - l = ((al0 >>> 28) | (ah0 << (32-28))) ^ ((ah0 >>> (34-32)) | (al0 << (32-(34-32)))) ^ ((ah0 >>> (39-32)) | (al0 << (32-(39-32)))); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - // Maj - h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2); - l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2); - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - bh7 = (c & 0xffff) | (d << 16); - bl7 = (a & 0xffff) | (b << 16); - - // add - h = bh3; - l = bl3; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = th; - l = tl; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - bh3 = (c & 0xffff) | (d << 16); - bl3 = (a & 0xffff) | (b << 16); + // found charset + if (res) { + charset = res.pop(); - ah1 = bh0; - ah2 = bh1; - ah3 = bh2; - ah4 = bh3; - ah5 = bh4; - ah6 = bh5; - ah7 = bh6; - ah0 = bh7; + // prevent decode issues when sites use incorrect encoding + // ref: https://hsivonen.fi/encoding-menu/ + if (charset === 'gb2312' || charset === 'gbk') { + charset = 'gb18030'; + } + } - al1 = bl0; - al2 = bl1; - al3 = bl2; - al4 = bl3; - al5 = bl4; - al6 = bl5; - al7 = bl6; - al0 = bl7; + // turn raw buffers into a single utf-8 buffer + return convert(buffer, 'UTF-8', charset).toString(); +} - if (i%16 === 15) { - for (j = 0; j < 16; j++) { - // add - h = wh[j]; - l = wl[j]; +/** + * Detect a URLSearchParams object + * ref: https://github.com/bitinn/node-fetch/issues/296#issuecomment-307598143 + * + * @param Object obj Object to detect by type or brand + * @return String + */ +function isURLSearchParams(obj) { + // Duck-typing as a necessary condition. + if (typeof obj !== 'object' || typeof obj.append !== 'function' || typeof obj.delete !== 'function' || typeof obj.get !== 'function' || typeof obj.getAll !== 'function' || typeof obj.has !== 'function' || typeof obj.set !== 'function') { + return false; + } - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; + // Brand-checking and more duck-typing as optional condition. + return obj.constructor.name === 'URLSearchParams' || Object.prototype.toString.call(obj) === '[object URLSearchParams]' || typeof obj.sort === 'function'; +} - h = wh[(j+9)%16]; - l = wl[(j+9)%16]; +/** + * Check if `obj` is a W3C `Blob` object (which `File` inherits from) + * @param {*} obj + * @return {boolean} + */ +function isBlob(obj) { + return typeof obj === 'object' && typeof obj.arrayBuffer === 'function' && typeof obj.type === 'string' && typeof obj.stream === 'function' && typeof obj.constructor === 'function' && typeof obj.constructor.name === 'string' && /^(Blob|File)$/.test(obj.constructor.name) && /^(Blob|File)$/.test(obj[Symbol.toStringTag]); +} - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; +/** + * Clone body given Res/Req instance + * + * @param Mixed instance Response or Request instance + * @return Mixed + */ +function clone(instance) { + let p1, p2; + let body = instance.body; - // sigma0 - th = wh[(j+1)%16]; - tl = wl[(j+1)%16]; - h = ((th >>> 1) | (tl << (32-1))) ^ ((th >>> 8) | (tl << (32-8))) ^ (th >>> 7); - l = ((tl >>> 1) | (th << (32-1))) ^ ((tl >>> 8) | (th << (32-8))) ^ ((tl >>> 7) | (th << (32-7))); + // don't allow cloning a used body + if (instance.bodyUsed) { + throw new Error('cannot clone body after it is used'); + } - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; + // check that body is a stream and not form-data object + // note: we can't clone the form-data object without having it as a dependency + if (body instanceof Stream && typeof body.getBoundary !== 'function') { + // tee instance body + p1 = new PassThrough(); + p2 = new PassThrough(); + body.pipe(p1); + body.pipe(p2); + // set instance body to teed body and return the other teed body + instance[INTERNALS].body = p1; + body = p2; + } - // sigma1 - th = wh[(j+14)%16]; - tl = wl[(j+14)%16]; - h = ((th >>> 19) | (tl << (32-19))) ^ ((tl >>> (61-32)) | (th << (32-(61-32)))) ^ (th >>> 6); - l = ((tl >>> 19) | (th << (32-19))) ^ ((th >>> (61-32)) | (tl << (32-(61-32)))) ^ ((tl >>> 6) | (th << (32-6))); + return body; +} - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; +/** + * Performs the operation "extract a `Content-Type` value from |object|" as + * specified in the specification: + * https://fetch.spec.whatwg.org/#concept-bodyinit-extract + * + * This function assumes that instance.body is present. + * + * @param Mixed instance Any options.body input + */ +function extractContentType(body) { + if (body === null) { + // body is null + return null; + } else if (typeof body === 'string') { + // body is string + return 'text/plain;charset=UTF-8'; + } else if (isURLSearchParams(body)) { + // body is a URLSearchParams + return 'application/x-www-form-urlencoded;charset=UTF-8'; + } else if (isBlob(body)) { + // body is blob + return body.type || null; + } else if (Buffer.isBuffer(body)) { + // body is buffer + return null; + } else if (Object.prototype.toString.call(body) === '[object ArrayBuffer]') { + // body is ArrayBuffer + return null; + } else if (ArrayBuffer.isView(body)) { + // body is ArrayBufferView + return null; + } else if (typeof body.getBoundary === 'function') { + // detect form data input from form-data module + return `multipart/form-data;boundary=${body.getBoundary()}`; + } else if (body instanceof Stream) { + // body is stream + // can't really do much about this + return null; + } else { + // Body constructor defaults other things to string + return 'text/plain;charset=UTF-8'; + } +} - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; +/** + * The Fetch Standard treats this as if "total bytes" is a property on the body. + * For us, we have to explicitly get it with a function. + * + * ref: https://fetch.spec.whatwg.org/#concept-body-total-bytes + * + * @param Body instance Instance of Body + * @return Number? Number of bytes, or null if not possible + */ +function getTotalBytes(instance) { + const body = instance.body; - wh[j] = (c & 0xffff) | (d << 16); - wl[j] = (a & 0xffff) | (b << 16); - } - } - } - // add - h = ah0; - l = al0; + if (body === null) { + // body is null + return 0; + } else if (isBlob(body)) { + return body.size; + } else if (Buffer.isBuffer(body)) { + // body is buffer + return body.length; + } else if (body && typeof body.getLengthSync === 'function') { + // detect form data input from form-data module + if (body._lengthRetrievers && body._lengthRetrievers.length == 0 || // 1.x + body.hasKnownLength && body.hasKnownLength()) { + // 2.x + return body.getLengthSync(); + } + return null; + } else { + // body is stream + return null; + } +} - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; +/** + * Write a Body to a Node.js WritableStream (e.g. http.Request) object. + * + * @param Body instance Instance of Body + * @return Void + */ +function writeToStream(dest, instance) { + const body = instance.body; - h = hh[0]; - l = hl[0]; - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; + if (body === null) { + // body is null + dest.end(); + } else if (isBlob(body)) { + body.stream().pipe(dest); + } else if (Buffer.isBuffer(body)) { + // body is buffer + dest.write(body); + dest.end(); + } else { + // body is stream + body.pipe(dest); + } +} - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; +// expose Promise +Body.Promise = global.Promise; - hh[0] = ah0 = (c & 0xffff) | (d << 16); - hl[0] = al0 = (a & 0xffff) | (b << 16); +/** + * headers.js + * + * Headers class offers convenient helpers + */ - h = ah1; - l = al1; +const invalidTokenRegex = /[^\^_`a-zA-Z\-0-9!#$%&'*+.|~]/; +const invalidHeaderCharRegex = /[^\t\x20-\x7e\x80-\xff]/; - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; +function validateName(name) { + name = `${name}`; + if (invalidTokenRegex.test(name) || name === '') { + throw new TypeError(`${name} is not a legal HTTP header name`); + } +} - h = hh[1]; - l = hl[1]; +function validateValue(value) { + value = `${value}`; + if (invalidHeaderCharRegex.test(value)) { + throw new TypeError(`${value} is not a legal HTTP header value`); + } +} - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; +/** + * Find the key in the map object given a header name. + * + * Returns undefined if not found. + * + * @param String name Header name + * @return String|Undefined + */ +function find(map, name) { + name = name.toLowerCase(); + for (const key in map) { + if (key.toLowerCase() === name) { + return key; + } + } + return undefined; +} - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; +const MAP = Symbol('map'); +class Headers { + /** + * Headers class + * + * @param Object headers Response headers + * @return Void + */ + constructor() { + let init = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : undefined; - hh[1] = ah1 = (c & 0xffff) | (d << 16); - hl[1] = al1 = (a & 0xffff) | (b << 16); + this[MAP] = Object.create(null); - h = ah2; - l = al2; + if (init instanceof Headers) { + const rawHeaders = init.raw(); + const headerNames = Object.keys(rawHeaders); - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; + for (const headerName of headerNames) { + for (const value of rawHeaders[headerName]) { + this.append(headerName, value); + } + } - h = hh[2]; - l = hl[2]; + return; + } - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; + // We don't worry about converting prop to ByteString here as append() + // will handle it. + if (init == null) ; else if (typeof init === 'object') { + const method = init[Symbol.iterator]; + if (method != null) { + if (typeof method !== 'function') { + throw new TypeError('Header pairs must be iterable'); + } - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; + // sequence> + // Note: per spec we have to first exhaust the lists then process them + const pairs = []; + for (const pair of init) { + if (typeof pair !== 'object' || typeof pair[Symbol.iterator] !== 'function') { + throw new TypeError('Each header pair must be iterable'); + } + pairs.push(Array.from(pair)); + } - hh[2] = ah2 = (c & 0xffff) | (d << 16); - hl[2] = al2 = (a & 0xffff) | (b << 16); - - h = ah3; - l = al3; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[3]; - l = hl[3]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[3] = ah3 = (c & 0xffff) | (d << 16); - hl[3] = al3 = (a & 0xffff) | (b << 16); - - h = ah4; - l = al4; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[4]; - l = hl[4]; - - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[4] = ah4 = (c & 0xffff) | (d << 16); - hl[4] = al4 = (a & 0xffff) | (b << 16); - - h = ah5; - l = al5; - - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; - - h = hh[5]; - l = hl[5]; + for (const pair of pairs) { + if (pair.length !== 2) { + throw new TypeError('Each header pair must be a name/value tuple'); + } + this.append(pair[0], pair[1]); + } + } else { + // record + for (const key of Object.keys(init)) { + const value = init[key]; + this.append(key, value); + } + } + } else { + throw new TypeError('Provided initializer must be an object'); + } + } - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; + /** + * Return combined header value given name + * + * @param String name Header name + * @return Mixed + */ + get(name) { + name = `${name}`; + validateName(name); + const key = find(this[MAP], name); + if (key === undefined) { + return null; + } - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; + return this[MAP][key].join(', '); + } - hh[5] = ah5 = (c & 0xffff) | (d << 16); - hl[5] = al5 = (a & 0xffff) | (b << 16); + /** + * Iterate over all headers + * + * @param Function callback Executed for each item with parameters (value, name, thisArg) + * @param Boolean thisArg `this` context for callback function + * @return Void + */ + forEach(callback) { + let thisArg = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : undefined; - h = ah6; - l = al6; + let pairs = getHeaders(this); + let i = 0; + while (i < pairs.length) { + var _pairs$i = pairs[i]; + const name = _pairs$i[0], + value = _pairs$i[1]; - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; + callback.call(thisArg, value, name, this); + pairs = getHeaders(this); + i++; + } + } - h = hh[6]; - l = hl[6]; + /** + * Overwrite header values given name + * + * @param String name Header name + * @param String value Header value + * @return Void + */ + set(name, value) { + name = `${name}`; + value = `${value}`; + validateName(name); + validateValue(value); + const key = find(this[MAP], name); + this[MAP][key !== undefined ? key : name] = [value]; + } - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; + /** + * Append a value onto existing header + * + * @param String name Header name + * @param String value Header value + * @return Void + */ + append(name, value) { + name = `${name}`; + value = `${value}`; + validateName(name); + validateValue(value); + const key = find(this[MAP], name); + if (key !== undefined) { + this[MAP][key].push(value); + } else { + this[MAP][name] = [value]; + } + } - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; + /** + * Check for header name existence + * + * @param String name Header name + * @return Boolean + */ + has(name) { + name = `${name}`; + validateName(name); + return find(this[MAP], name) !== undefined; + } - hh[6] = ah6 = (c & 0xffff) | (d << 16); - hl[6] = al6 = (a & 0xffff) | (b << 16); + /** + * Delete all header values given name + * + * @param String name Header name + * @return Void + */ + delete(name) { + name = `${name}`; + validateName(name); + const key = find(this[MAP], name); + if (key !== undefined) { + delete this[MAP][key]; + } + } - h = ah7; - l = al7; + /** + * Return raw headers (non-spec api) + * + * @return Object + */ + raw() { + return this[MAP]; + } - a = l & 0xffff; b = l >>> 16; - c = h & 0xffff; d = h >>> 16; + /** + * Get an iterator on keys. + * + * @return Iterator + */ + keys() { + return createHeadersIterator(this, 'key'); + } - h = hh[7]; - l = hl[7]; + /** + * Get an iterator on values. + * + * @return Iterator + */ + values() { + return createHeadersIterator(this, 'value'); + } - a += l & 0xffff; b += l >>> 16; - c += h & 0xffff; d += h >>> 16; + /** + * Get an iterator on entries. + * + * This is the default iterator of the Headers object. + * + * @return Iterator + */ + [Symbol.iterator]() { + return createHeadersIterator(this, 'key+value'); + } +} +Headers.prototype.entries = Headers.prototype[Symbol.iterator]; - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; +Object.defineProperty(Headers.prototype, Symbol.toStringTag, { + value: 'Headers', + writable: false, + enumerable: false, + configurable: true +}); - hh[7] = ah7 = (c & 0xffff) | (d << 16); - hl[7] = al7 = (a & 0xffff) | (b << 16); +Object.defineProperties(Headers.prototype, { + get: { enumerable: true }, + forEach: { enumerable: true }, + set: { enumerable: true }, + append: { enumerable: true }, + has: { enumerable: true }, + delete: { enumerable: true }, + keys: { enumerable: true }, + values: { enumerable: true }, + entries: { enumerable: true } +}); - pos += 128; - n -= 128; - } +function getHeaders(headers) { + let kind = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'key+value'; - return n; + const keys = Object.keys(headers[MAP]).sort(); + return keys.map(kind === 'key' ? function (k) { + return k.toLowerCase(); + } : kind === 'value' ? function (k) { + return headers[MAP][k].join(', '); + } : function (k) { + return [k.toLowerCase(), headers[MAP][k].join(', ')]; + }); } -function crypto_hash(out, m, n) { - var hh = new Int32Array(8), - hl = new Int32Array(8), - x = new Uint8Array(256), - i, b = n; - - hh[0] = 0x6a09e667; - hh[1] = 0xbb67ae85; - hh[2] = 0x3c6ef372; - hh[3] = 0xa54ff53a; - hh[4] = 0x510e527f; - hh[5] = 0x9b05688c; - hh[6] = 0x1f83d9ab; - hh[7] = 0x5be0cd19; - - hl[0] = 0xf3bcc908; - hl[1] = 0x84caa73b; - hl[2] = 0xfe94f82b; - hl[3] = 0x5f1d36f1; - hl[4] = 0xade682d1; - hl[5] = 0x2b3e6c1f; - hl[6] = 0xfb41bd6b; - hl[7] = 0x137e2179; - - crypto_hashblocks_hl(hh, hl, m, n); - n %= 128; - - for (i = 0; i < n; i++) x[i] = m[b-n+i]; - x[n] = 128; - - n = 256-128*(n<112?1:0); - x[n-9] = 0; - ts64(x, n-8, (b / 0x20000000) | 0, b << 3); - crypto_hashblocks_hl(hh, hl, x, n); - - for (i = 0; i < 8; i++) ts64(out, 8*i, hh[i], hl[i]); - - return 0; -} +const INTERNAL = Symbol('internal'); -function add(p, q) { - var a = gf(), b = gf(), c = gf(), - d = gf(), e = gf(), f = gf(), - g = gf(), h = gf(), t = gf(); - - Z(a, p[1], p[0]); - Z(t, q[1], q[0]); - M(a, a, t); - A(b, p[0], p[1]); - A(t, q[0], q[1]); - M(b, b, t); - M(c, p[3], q[3]); - M(c, c, D2); - M(d, p[2], q[2]); - A(d, d, d); - Z(e, b, a); - Z(f, d, c); - A(g, d, c); - A(h, b, a); - - M(p[0], e, f); - M(p[1], h, g); - M(p[2], g, f); - M(p[3], e, h); +function createHeadersIterator(target, kind) { + const iterator = Object.create(HeadersIteratorPrototype); + iterator[INTERNAL] = { + target, + kind, + index: 0 + }; + return iterator; } -function cswap(p, q, b) { - var i; - for (i = 0; i < 4; i++) { - sel25519(p[i], q[i], b); - } -} +const HeadersIteratorPrototype = Object.setPrototypeOf({ + next() { + // istanbul ignore if + if (!this || Object.getPrototypeOf(this) !== HeadersIteratorPrototype) { + throw new TypeError('Value of `this` is not a HeadersIterator'); + } -function pack(r, p) { - var tx = gf(), ty = gf(), zi = gf(); - inv25519(zi, p[2]); - M(tx, p[0], zi); - M(ty, p[1], zi); - pack25519(r, ty); - r[31] ^= par25519(tx) << 7; -} + var _INTERNAL = this[INTERNAL]; + const target = _INTERNAL.target, + kind = _INTERNAL.kind, + index = _INTERNAL.index; -function scalarmult(p, q, s) { - var b, i; - set25519(p[0], gf0); - set25519(p[1], gf1); - set25519(p[2], gf1); - set25519(p[3], gf0); - for (i = 255; i >= 0; --i) { - b = (s[(i/8)|0] >> (i&7)) & 1; - cswap(p, q, b); - add(q, p); - add(p, p); - cswap(p, q, b); - } -} + const values = getHeaders(target, kind); + const len = values.length; + if (index >= len) { + return { + value: undefined, + done: true + }; + } -function scalarbase(p, s) { - var q = [gf(), gf(), gf(), gf()]; - set25519(q[0], X); - set25519(q[1], Y); - set25519(q[2], gf1); - M(q[3], X, Y); - scalarmult(p, q, s); -} + this[INTERNAL].index = index + 1; + + return { + value: values[index], + done: false + }; + } +}, Object.getPrototypeOf(Object.getPrototypeOf([][Symbol.iterator]()))); -function crypto_sign_keypair(pk, sk, seeded) { - var d = new Uint8Array(64); - var p = [gf(), gf(), gf(), gf()]; - var i; +Object.defineProperty(HeadersIteratorPrototype, Symbol.toStringTag, { + value: 'HeadersIterator', + writable: false, + enumerable: false, + configurable: true +}); - if (!seeded) randombytes(sk, 32); - crypto_hash(d, sk, 32); - d[0] &= 248; - d[31] &= 127; - d[31] |= 64; +/** + * Export the Headers object in a form that Node.js can consume. + * + * @param Headers headers + * @return Object + */ +function exportNodeCompatibleHeaders(headers) { + const obj = Object.assign({ __proto__: null }, headers[MAP]); - scalarbase(p, d); - pack(pk, p); + // http.request() only supports string as Host header. This hack makes + // specifying custom Host header possible. + const hostHeaderKey = find(headers[MAP], 'Host'); + if (hostHeaderKey !== undefined) { + obj[hostHeaderKey] = obj[hostHeaderKey][0]; + } - for (i = 0; i < 32; i++) sk[i+32] = pk[i]; - return 0; + return obj; } -var L = new Float64Array([0xed, 0xd3, 0xf5, 0x5c, 0x1a, 0x63, 0x12, 0x58, 0xd6, 0x9c, 0xf7, 0xa2, 0xde, 0xf9, 0xde, 0x14, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0x10]); - -function modL(r, x) { - var carry, i, j, k; - for (i = 63; i >= 32; --i) { - carry = 0; - for (j = i - 32, k = i - 12; j < k; ++j) { - x[j] += carry - 16 * x[i] * L[j - (i - 32)]; - carry = (x[j] + 128) >> 8; - x[j] -= carry * 256; - } - x[j] += carry; - x[i] = 0; - } - carry = 0; - for (j = 0; j < 32; j++) { - x[j] += carry - (x[31] >> 4) * L[j]; - carry = x[j] >> 8; - x[j] &= 255; - } - for (j = 0; j < 32; j++) x[j] -= carry * L[j]; - for (i = 0; i < 32; i++) { - x[i+1] += x[i] >> 8; - r[i] = x[i] & 255; - } -} - -function reduce(r) { - var x = new Float64Array(64), i; - for (i = 0; i < 64; i++) x[i] = r[i]; - for (i = 0; i < 64; i++) r[i] = 0; - modL(r, x); +/** + * Create a Headers object from an object of headers, ignoring those that do + * not conform to HTTP grammar productions. + * + * @param Object obj Object of headers + * @return Headers + */ +function createHeadersLenient(obj) { + const headers = new Headers(); + for (const name of Object.keys(obj)) { + if (invalidTokenRegex.test(name)) { + continue; + } + if (Array.isArray(obj[name])) { + for (const val of obj[name]) { + if (invalidHeaderCharRegex.test(val)) { + continue; + } + if (headers[MAP][name] === undefined) { + headers[MAP][name] = [val]; + } else { + headers[MAP][name].push(val); + } + } + } else if (!invalidHeaderCharRegex.test(obj[name])) { + headers[MAP][name] = [obj[name]]; + } + } + return headers; } -// Note: difference from C - smlen returned, not passed as argument. -function crypto_sign(sm, m, n, sk) { - var d = new Uint8Array(64), h = new Uint8Array(64), r = new Uint8Array(64); - var i, j, x = new Float64Array(64); - var p = [gf(), gf(), gf(), gf()]; - - crypto_hash(d, sk, 32); - d[0] &= 248; - d[31] &= 127; - d[31] |= 64; - - var smlen = n + 64; - for (i = 0; i < n; i++) sm[64 + i] = m[i]; - for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i]; - - crypto_hash(r, sm.subarray(32), n+32); - reduce(r); - scalarbase(p, r); - pack(sm, p); - - for (i = 32; i < 64; i++) sm[i] = sk[i]; - crypto_hash(h, sm, n + 64); - reduce(h); - - for (i = 0; i < 64; i++) x[i] = 0; - for (i = 0; i < 32; i++) x[i] = r[i]; - for (i = 0; i < 32; i++) { - for (j = 0; j < 32; j++) { - x[i+j] += h[i] * d[j]; - } - } +const INTERNALS$1 = Symbol('Response internals'); - modL(sm.subarray(32), x); - return smlen; -} +// fix an issue where "STATUS_CODES" aren't a named export for node <10 +const STATUS_CODES = http.STATUS_CODES; -function unpackneg(r, p) { - var t = gf(), chk = gf(), num = gf(), - den = gf(), den2 = gf(), den4 = gf(), - den6 = gf(); - - set25519(r[2], gf1); - unpack25519(r[1], p); - S(num, r[1]); - M(den, num, D); - Z(num, num, r[2]); - A(den, r[2], den); - - S(den2, den); - S(den4, den2); - M(den6, den4, den2); - M(t, den6, num); - M(t, t, den); - - pow2523(t, t); - M(t, t, num); - M(t, t, den); - M(t, t, den); - M(r[0], t, den); - - S(chk, r[0]); - M(chk, chk, den); - if (neq25519(chk, num)) M(r[0], r[0], I); - - S(chk, r[0]); - M(chk, chk, den); - if (neq25519(chk, num)) return -1; - - if (par25519(r[0]) === (p[31]>>7)) Z(r[0], gf0, r[0]); - - M(r[3], r[0], r[1]); - return 0; -} +/** + * Response class + * + * @param Stream body Readable stream + * @param Object opts Response options + * @return Void + */ +class Response { + constructor() { + let body = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null; + let opts = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; -function crypto_sign_open(m, sm, n, pk) { - var i, mlen; - var t = new Uint8Array(32), h = new Uint8Array(64); - var p = [gf(), gf(), gf(), gf()], - q = [gf(), gf(), gf(), gf()]; + Body.call(this, body, opts); - mlen = -1; - if (n < 64) return -1; + const status = opts.status || 200; + const headers = new Headers(opts.headers); - if (unpackneg(q, pk)) return -1; + if (body != null && !headers.has('Content-Type')) { + const contentType = extractContentType(body); + if (contentType) { + headers.append('Content-Type', contentType); + } + } - for (i = 0; i < n; i++) m[i] = sm[i]; - for (i = 0; i < 32; i++) m[i+32] = pk[i]; - crypto_hash(h, m, n); - reduce(h); - scalarmult(p, q, h); + this[INTERNALS$1] = { + url: opts.url, + status, + statusText: opts.statusText || STATUS_CODES[status], + headers, + counter: opts.counter + }; + } - scalarbase(q, sm.subarray(32)); - add(p, q); - pack(t, p); + get url() { + return this[INTERNALS$1].url || ''; + } - n -= 64; - if (crypto_verify_32(sm, 0, t, 0)) { - for (i = 0; i < n; i++) m[i] = 0; - return -1; - } + get status() { + return this[INTERNALS$1].status; + } - for (i = 0; i < n; i++) m[i] = sm[i + 64]; - mlen = n; - return mlen; -} + /** + * Convenience property representing if the request ended normally + */ + get ok() { + return this[INTERNALS$1].status >= 200 && this[INTERNALS$1].status < 300; + } -var crypto_secretbox_KEYBYTES = 32, - crypto_secretbox_NONCEBYTES = 24, - crypto_secretbox_ZEROBYTES = 32, - crypto_secretbox_BOXZEROBYTES = 16, - crypto_scalarmult_BYTES = 32, - crypto_scalarmult_SCALARBYTES = 32, - crypto_box_PUBLICKEYBYTES = 32, - crypto_box_SECRETKEYBYTES = 32, - crypto_box_BEFORENMBYTES = 32, - crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES, - crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES, - crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES, - crypto_sign_BYTES = 64, - crypto_sign_PUBLICKEYBYTES = 32, - crypto_sign_SECRETKEYBYTES = 64, - crypto_sign_SEEDBYTES = 32, - crypto_hash_BYTES = 64; - -nacl.lowlevel = { - crypto_core_hsalsa20: crypto_core_hsalsa20, - crypto_stream_xor: crypto_stream_xor, - crypto_stream: crypto_stream, - crypto_stream_salsa20_xor: crypto_stream_salsa20_xor, - crypto_stream_salsa20: crypto_stream_salsa20, - crypto_onetimeauth: crypto_onetimeauth, - crypto_onetimeauth_verify: crypto_onetimeauth_verify, - crypto_verify_16: crypto_verify_16, - crypto_verify_32: crypto_verify_32, - crypto_secretbox: crypto_secretbox, - crypto_secretbox_open: crypto_secretbox_open, - crypto_scalarmult: crypto_scalarmult, - crypto_scalarmult_base: crypto_scalarmult_base, - crypto_box_beforenm: crypto_box_beforenm, - crypto_box_afternm: crypto_box_afternm, - crypto_box: crypto_box, - crypto_box_open: crypto_box_open, - crypto_box_keypair: crypto_box_keypair, - crypto_hash: crypto_hash, - crypto_sign: crypto_sign, - crypto_sign_keypair: crypto_sign_keypair, - crypto_sign_open: crypto_sign_open, - - crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES, - crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES, - crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES, - crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES, - crypto_scalarmult_BYTES: crypto_scalarmult_BYTES, - crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES, - crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES, - crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES, - crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES, - crypto_box_NONCEBYTES: crypto_box_NONCEBYTES, - crypto_box_ZEROBYTES: crypto_box_ZEROBYTES, - crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES, - crypto_sign_BYTES: crypto_sign_BYTES, - crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES, - crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES, - crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES, - crypto_hash_BYTES: crypto_hash_BYTES -}; + get redirected() { + return this[INTERNALS$1].counter > 0; + } -/* High-level API */ + get statusText() { + return this[INTERNALS$1].statusText; + } -function checkLengths(k, n) { - if (k.length !== crypto_secretbox_KEYBYTES) throw new Error('bad key size'); - if (n.length !== crypto_secretbox_NONCEBYTES) throw new Error('bad nonce size'); -} + get headers() { + return this[INTERNALS$1].headers; + } -function checkBoxLengths(pk, sk) { - if (pk.length !== crypto_box_PUBLICKEYBYTES) throw new Error('bad public key size'); - if (sk.length !== crypto_box_SECRETKEYBYTES) throw new Error('bad secret key size'); + /** + * Clone this response + * + * @return Response + */ + clone() { + return new Response(clone(this), { + url: this.url, + status: this.status, + statusText: this.statusText, + headers: this.headers, + ok: this.ok, + redirected: this.redirected + }); + } } -function checkArrayTypes() { - var t, i; - for (i = 0; i < arguments.length; i++) { - if ((t = Object.prototype.toString.call(arguments[i])) !== '[object Uint8Array]') - throw new TypeError('unexpected type ' + t + ', use Uint8Array'); - } -} +Body.mixIn(Response.prototype); -function cleanup(arr) { - for (var i = 0; i < arr.length; i++) arr[i] = 0; -} +Object.defineProperties(Response.prototype, { + url: { enumerable: true }, + status: { enumerable: true }, + ok: { enumerable: true }, + redirected: { enumerable: true }, + statusText: { enumerable: true }, + headers: { enumerable: true }, + clone: { enumerable: true } +}); -// TODO: Completely remove this in v0.15. -if (!nacl.util) { - nacl.util = {}; - nacl.util.decodeUTF8 = nacl.util.encodeUTF8 = nacl.util.encodeBase64 = nacl.util.decodeBase64 = function() { - throw new Error('nacl.util moved into separate package: https://github.com/dchest/tweetnacl-util-js'); - }; -} +Object.defineProperty(Response.prototype, Symbol.toStringTag, { + value: 'Response', + writable: false, + enumerable: false, + configurable: true +}); -nacl.randomBytes = function(n) { - var b = new Uint8Array(n); - randombytes(b, n); - return b; -}; +const INTERNALS$2 = Symbol('Request internals'); -nacl.secretbox = function(msg, nonce, key) { - checkArrayTypes(msg, nonce, key); - checkLengths(key, nonce); - var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length); - var c = new Uint8Array(m.length); - for (var i = 0; i < msg.length; i++) m[i+crypto_secretbox_ZEROBYTES] = msg[i]; - crypto_secretbox(c, m, m.length, nonce, key); - return c.subarray(crypto_secretbox_BOXZEROBYTES); -}; +// fix an issue where "format", "parse" aren't a named export for node <10 +const parse_url = Url.parse; +const format_url = Url.format; -nacl.secretbox.open = function(box, nonce, key) { - checkArrayTypes(box, nonce, key); - checkLengths(key, nonce); - var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length); - var m = new Uint8Array(c.length); - for (var i = 0; i < box.length; i++) c[i+crypto_secretbox_BOXZEROBYTES] = box[i]; - if (c.length < 32) return false; - if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return false; - return m.subarray(crypto_secretbox_ZEROBYTES); -}; +const streamDestructionSupported = 'destroy' in Stream.Readable.prototype; -nacl.secretbox.keyLength = crypto_secretbox_KEYBYTES; -nacl.secretbox.nonceLength = crypto_secretbox_NONCEBYTES; -nacl.secretbox.overheadLength = crypto_secretbox_BOXZEROBYTES; - -nacl.scalarMult = function(n, p) { - checkArrayTypes(n, p); - if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); - if (p.length !== crypto_scalarmult_BYTES) throw new Error('bad p size'); - var q = new Uint8Array(crypto_scalarmult_BYTES); - crypto_scalarmult(q, n, p); - return q; -}; +/** + * Check if a value is an instance of Request. + * + * @param Mixed input + * @return Boolean + */ +function isRequest(input) { + return typeof input === 'object' && typeof input[INTERNALS$2] === 'object'; +} -nacl.scalarMult.base = function(n) { - checkArrayTypes(n); - if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error('bad n size'); - var q = new Uint8Array(crypto_scalarmult_BYTES); - crypto_scalarmult_base(q, n); - return q; -}; +function isAbortSignal(signal) { + const proto = signal && typeof signal === 'object' && Object.getPrototypeOf(signal); + return !!(proto && proto.constructor.name === 'AbortSignal'); +} -nacl.scalarMult.scalarLength = crypto_scalarmult_SCALARBYTES; -nacl.scalarMult.groupElementLength = crypto_scalarmult_BYTES; +/** + * Request class + * + * @param Mixed input Url or Request instance + * @param Object init Custom options + * @return Void + */ +class Request { + constructor(input) { + let init = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; -nacl.box = function(msg, nonce, publicKey, secretKey) { - var k = nacl.box.before(publicKey, secretKey); - return nacl.secretbox(msg, nonce, k); -}; + let parsedURL; -nacl.box.before = function(publicKey, secretKey) { - checkArrayTypes(publicKey, secretKey); - checkBoxLengths(publicKey, secretKey); - var k = new Uint8Array(crypto_box_BEFORENMBYTES); - crypto_box_beforenm(k, publicKey, secretKey); - return k; -}; + // normalize input + if (!isRequest(input)) { + if (input && input.href) { + // in order to support Node.js' Url objects; though WHATWG's URL objects + // will fall into this branch also (since their `toString()` will return + // `href` property anyway) + parsedURL = parse_url(input.href); + } else { + // coerce input to a string before attempting to parse + parsedURL = parse_url(`${input}`); + } + input = {}; + } else { + parsedURL = parse_url(input.url); + } -nacl.box.after = nacl.secretbox; + let method = init.method || input.method || 'GET'; + method = method.toUpperCase(); -nacl.box.open = function(msg, nonce, publicKey, secretKey) { - var k = nacl.box.before(publicKey, secretKey); - return nacl.secretbox.open(msg, nonce, k); -}; + if ((init.body != null || isRequest(input) && input.body !== null) && (method === 'GET' || method === 'HEAD')) { + throw new TypeError('Request with GET/HEAD method cannot have body'); + } -nacl.box.open.after = nacl.secretbox.open; + let inputBody = init.body != null ? init.body : isRequest(input) && input.body !== null ? clone(input) : null; -nacl.box.keyPair = function() { - var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_box_SECRETKEYBYTES); - crypto_box_keypair(pk, sk); - return {publicKey: pk, secretKey: sk}; -}; + Body.call(this, inputBody, { + timeout: init.timeout || input.timeout || 0, + size: init.size || input.size || 0 + }); -nacl.box.keyPair.fromSecretKey = function(secretKey) { - checkArrayTypes(secretKey); - if (secretKey.length !== crypto_box_SECRETKEYBYTES) - throw new Error('bad secret key size'); - var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); - crypto_scalarmult_base(pk, secretKey); - return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; -}; + const headers = new Headers(init.headers || input.headers || {}); -nacl.box.publicKeyLength = crypto_box_PUBLICKEYBYTES; -nacl.box.secretKeyLength = crypto_box_SECRETKEYBYTES; -nacl.box.sharedKeyLength = crypto_box_BEFORENMBYTES; -nacl.box.nonceLength = crypto_box_NONCEBYTES; -nacl.box.overheadLength = nacl.secretbox.overheadLength; - -nacl.sign = function(msg, secretKey) { - checkArrayTypes(msg, secretKey); - if (secretKey.length !== crypto_sign_SECRETKEYBYTES) - throw new Error('bad secret key size'); - var signedMsg = new Uint8Array(crypto_sign_BYTES+msg.length); - crypto_sign(signedMsg, msg, msg.length, secretKey); - return signedMsg; -}; + if (inputBody != null && !headers.has('Content-Type')) { + const contentType = extractContentType(inputBody); + if (contentType) { + headers.append('Content-Type', contentType); + } + } -nacl.sign.open = function(signedMsg, publicKey) { - if (arguments.length !== 2) - throw new Error('nacl.sign.open accepts 2 arguments; did you mean to use nacl.sign.detached.verify?'); - checkArrayTypes(signedMsg, publicKey); - if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) - throw new Error('bad public key size'); - var tmp = new Uint8Array(signedMsg.length); - var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey); - if (mlen < 0) return null; - var m = new Uint8Array(mlen); - for (var i = 0; i < m.length; i++) m[i] = tmp[i]; - return m; -}; + let signal = isRequest(input) ? input.signal : null; + if ('signal' in init) signal = init.signal; -nacl.sign.detached = function(msg, secretKey) { - var signedMsg = nacl.sign(msg, secretKey); - var sig = new Uint8Array(crypto_sign_BYTES); - for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i]; - return sig; -}; + if (signal != null && !isAbortSignal(signal)) { + throw new TypeError('Expected signal to be an instanceof AbortSignal'); + } -nacl.sign.detached.verify = function(msg, sig, publicKey) { - checkArrayTypes(msg, sig, publicKey); - if (sig.length !== crypto_sign_BYTES) - throw new Error('bad signature size'); - if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) - throw new Error('bad public key size'); - var sm = new Uint8Array(crypto_sign_BYTES + msg.length); - var m = new Uint8Array(crypto_sign_BYTES + msg.length); - var i; - for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i]; - for (i = 0; i < msg.length; i++) sm[i+crypto_sign_BYTES] = msg[i]; - return (crypto_sign_open(m, sm, sm.length, publicKey) >= 0); -}; + this[INTERNALS$2] = { + method, + redirect: init.redirect || input.redirect || 'follow', + headers, + parsedURL, + signal + }; -nacl.sign.keyPair = function() { - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); - crypto_sign_keypair(pk, sk); - return {publicKey: pk, secretKey: sk}; -}; + // node-fetch-only options + this.follow = init.follow !== undefined ? init.follow : input.follow !== undefined ? input.follow : 20; + this.compress = init.compress !== undefined ? init.compress : input.compress !== undefined ? input.compress : true; + this.counter = init.counter || input.counter || 0; + this.agent = init.agent || input.agent; + } -nacl.sign.keyPair.fromSecretKey = function(secretKey) { - checkArrayTypes(secretKey); - if (secretKey.length !== crypto_sign_SECRETKEYBYTES) - throw new Error('bad secret key size'); - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32+i]; - return {publicKey: pk, secretKey: new Uint8Array(secretKey)}; -}; + get method() { + return this[INTERNALS$2].method; + } -nacl.sign.keyPair.fromSeed = function(seed) { - checkArrayTypes(seed); - if (seed.length !== crypto_sign_SEEDBYTES) - throw new Error('bad seed size'); - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); - for (var i = 0; i < 32; i++) sk[i] = seed[i]; - crypto_sign_keypair(pk, sk, true); - return {publicKey: pk, secretKey: sk}; -}; + get url() { + return format_url(this[INTERNALS$2].parsedURL); + } -nacl.sign.publicKeyLength = crypto_sign_PUBLICKEYBYTES; -nacl.sign.secretKeyLength = crypto_sign_SECRETKEYBYTES; -nacl.sign.seedLength = crypto_sign_SEEDBYTES; -nacl.sign.signatureLength = crypto_sign_BYTES; + get headers() { + return this[INTERNALS$2].headers; + } -nacl.hash = function(msg) { - checkArrayTypes(msg); - var h = new Uint8Array(crypto_hash_BYTES); - crypto_hash(h, msg, msg.length); - return h; -}; + get redirect() { + return this[INTERNALS$2].redirect; + } -nacl.hash.hashLength = crypto_hash_BYTES; + get signal() { + return this[INTERNALS$2].signal; + } -nacl.verify = function(x, y) { - checkArrayTypes(x, y); - // Zero length arguments are considered not equal. - if (x.length === 0 || y.length === 0) return false; - if (x.length !== y.length) return false; - return (vn(x, 0, y, 0, x.length) === 0) ? true : false; -}; + /** + * Clone this request + * + * @return Request + */ + clone() { + return new Request(this); + } +} -nacl.setPRNG = function(fn) { - randombytes = fn; -}; - -(function() { - // Initialize PRNG if environment provides CSPRNG. - // If not, methods calling randombytes will throw. - var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; - if (crypto && crypto.getRandomValues) { - // Browsers. - var QUOTA = 65536; - nacl.setPRNG(function(x, n) { - var i, v = new Uint8Array(n); - for (i = 0; i < n; i += QUOTA) { - crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); - } - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } else if (true) { - // Node.js. - crypto = __webpack_require__(417); - if (crypto && crypto.randomBytes) { - nacl.setPRNG(function(x, n) { - var i, v = crypto.randomBytes(n); - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } - } -})(); - -})( true && module.exports ? module.exports : (self.nacl = self.nacl || {})); +Body.mixIn(Request.prototype); +Object.defineProperty(Request.prototype, Symbol.toStringTag, { + value: 'Request', + writable: false, + enumerable: false, + configurable: true +}); -/***/ }), -/* 197 */, -/* 198 */, -/* 199 */, -/* 200 */, -/* 201 */, -/* 202 */, -/* 203 */, -/* 204 */, -/* 205 */, -/* 206 */, -/* 207 */, -/* 208 */, -/* 209 */, -/* 210 */, -/* 211 */ -/***/ (function(module) { +Object.defineProperties(Request.prototype, { + method: { enumerable: true }, + url: { enumerable: true }, + headers: { enumerable: true }, + redirect: { enumerable: true }, + clone: { enumerable: true }, + signal: { enumerable: true } +}); -module.exports = require("https"); +/** + * Convert a Request to Node.js http request options. + * + * @param Request A Request instance + * @return Object The options object to be passed to http.request + */ +function getNodeRequestOptions(request) { + const parsedURL = request[INTERNALS$2].parsedURL; + const headers = new Headers(request[INTERNALS$2].headers); -/***/ }), -/* 212 */, -/* 213 */ -/***/ (function(module) { + // fetch step 1.3 + if (!headers.has('Accept')) { + headers.set('Accept', '*/*'); + } -module.exports = require("punycode"); + // Basic fetch + if (!parsedURL.protocol || !parsedURL.hostname) { + throw new TypeError('Only absolute URLs are supported'); + } -/***/ }), -/* 214 */, -/* 215 */ -/***/ (function(module, __unusedexports, __webpack_require__) { + if (!/^https?:$/.test(parsedURL.protocol)) { + throw new TypeError('Only HTTP(S) protocols are supported'); + } -"use strict"; -/* eslint-disable node/no-deprecated-api */ + if (request.signal && request.body instanceof Stream.Readable && !streamDestructionSupported) { + throw new Error('Cancellation of streamed requests with AbortSignal is not supported in node < 8'); + } + // HTTP-network-or-cache fetch steps 2.4-2.7 + let contentLengthValue = null; + if (request.body == null && /^(POST|PUT)$/i.test(request.method)) { + contentLengthValue = '0'; + } + if (request.body != null) { + const totalBytes = getTotalBytes(request); + if (typeof totalBytes === 'number') { + contentLengthValue = String(totalBytes); + } + } + if (contentLengthValue) { + headers.set('Content-Length', contentLengthValue); + } + // HTTP-network-or-cache fetch step 2.11 + if (!headers.has('User-Agent')) { + headers.set('User-Agent', 'node-fetch/1.0 (+https://github.com/bitinn/node-fetch)'); + } -var buffer = __webpack_require__(293) -var Buffer = buffer.Buffer + // HTTP-network-or-cache fetch step 2.15 + if (request.compress && !headers.has('Accept-Encoding')) { + headers.set('Accept-Encoding', 'gzip,deflate'); + } -var safer = {} + let agent = request.agent; + if (typeof agent === 'function') { + agent = agent(parsedURL); + } -var key + if (!headers.has('Connection') && !agent) { + headers.set('Connection', 'close'); + } -for (key in buffer) { - if (!buffer.hasOwnProperty(key)) continue - if (key === 'SlowBuffer' || key === 'Buffer') continue - safer[key] = buffer[key] -} + // HTTP-network fetch step 4.2 + // chunked encoding is handled by Node.js -var Safer = safer.Buffer = {} -for (key in Buffer) { - if (!Buffer.hasOwnProperty(key)) continue - if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue - Safer[key] = Buffer[key] + return Object.assign({}, parsedURL, { + method: request.method, + headers: exportNodeCompatibleHeaders(headers), + agent + }); } -safer.Buffer.prototype = Buffer.prototype +/** + * abort-error.js + * + * AbortError interface for cancelled requests + */ -if (!Safer.from || Safer.from === Uint8Array.from) { - Safer.from = function (value, encodingOrOffset, length) { - if (typeof value === 'number') { - throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) - } - if (value && typeof value.length === 'undefined') { - throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) - } - return Buffer(value, encodingOrOffset, length) - } -} +/** + * Create AbortError instance + * + * @param String message Error message for human + * @return AbortError + */ +function AbortError(message) { + Error.call(this, message); -if (!Safer.alloc) { - Safer.alloc = function (size, fill, encoding) { - if (typeof size !== 'number') { - throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) - } - if (size < 0 || size >= 2 * (1 << 30)) { - throw new RangeError('The value "' + size + '" is invalid for option "size"') - } - var buf = Buffer(size) - if (!fill || fill.length === 0) { - buf.fill(0) - } else if (typeof encoding === 'string') { - buf.fill(fill, encoding) - } else { - buf.fill(fill) - } - return buf - } -} + this.type = 'aborted'; + this.message = message; -if (!safer.kStringMaxLength) { - try { - safer.kStringMaxLength = process.binding('buffer').kStringMaxLength - } catch (e) { - // we can't determine kStringMaxLength in environments where process.binding - // is unsupported, so let's not set it - } + // hide custom error implementation details from end-users + Error.captureStackTrace(this, this.constructor); } -if (!safer.constants) { - safer.constants = { - MAX_LENGTH: safer.kMaxLength - } - if (safer.kStringMaxLength) { - safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength - } -} +AbortError.prototype = Object.create(Error.prototype); +AbortError.prototype.constructor = AbortError; +AbortError.prototype.name = 'AbortError'; -module.exports = safer +// fix an issue where "PassThrough", "resolve" aren't a named export for node <10 +const PassThrough$1 = Stream.PassThrough; +const resolve_url = Url.resolve; +/** + * Fetch function + * + * @param Mixed url Absolute url or Request instance + * @param Object opts Fetch options + * @return Promise + */ +function fetch(url, opts) { -/***/ }), -/* 216 */, -/* 217 */, -/* 218 */, -/* 219 */, -/* 220 */, -/* 221 */ -/***/ (function(module) { + // allow custom promise + if (!fetch.Promise) { + throw new Error('native promise missing, set fetch.Promise to your favorite alternative'); + } -/** @license MIT License (c) copyright 2010-2014 original author or authors */ -/** @author Brian Cavalier */ -/** @author John Hann */ + Body.Promise = fetch.Promise; -(function(define) { 'use strict'; -define(function() { + // wrap http.request into fetch + return new fetch.Promise(function (resolve, reject) { + // build request object + const request = new Request(url, opts); + const options = getNodeRequestOptions(request); - return { - formatError: formatError, - formatObject: formatObject, - tryStringify: tryStringify - }; + const send = (options.protocol === 'https:' ? https : http).request; + const signal = request.signal; - /** - * Format an error into a string. If e is an Error and has a stack property, - * it's returned. Otherwise, e is formatted using formatObject, with a - * warning added about e not being a proper Error. - * @param {*} e - * @returns {String} formatted string, suitable for output to developers - */ - function formatError(e) { - var s = typeof e === 'object' && e !== null && (e.stack || e.message) ? e.stack || e.message : formatObject(e); - return e instanceof Error ? s : s + ' (WARNING: non-Error used)'; - } + let response = null; - /** - * Format an object, detecting "plain" objects and running them through - * JSON.stringify if possible. - * @param {Object} o - * @returns {string} - */ - function formatObject(o) { - var s = String(o); - if(s === '[object Object]' && typeof JSON !== 'undefined') { - s = tryStringify(o, s); - } - return s; - } + const abort = function abort() { + let error = new AbortError('The user aborted a request.'); + reject(error); + if (request.body && request.body instanceof Stream.Readable) { + request.body.destroy(error); + } + if (!response || !response.body) return; + response.body.emit('error', error); + }; - /** - * Try to return the result of JSON.stringify(x). If that fails, return - * defaultValue - * @param {*} x - * @param {*} defaultValue - * @returns {String|*} JSON.stringify(x) or defaultValue - */ - function tryStringify(x, defaultValue) { - try { - return JSON.stringify(x); - } catch(e) { - return defaultValue; + if (signal && signal.aborted) { + abort(); + return; } - } - -}); -}(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); + const abortAndFinalize = function abortAndFinalize() { + abort(); + finalize(); + }; -/***/ }), -/* 222 */ -/***/ (function(module) { - -module.exports = {"$id":"browser.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; + // send request + const req = send(options); + let reqTimeout; -/***/ }), -/* 223 */, -/* 224 */, -/* 225 */, -/* 226 */ -/***/ (function(module) { + if (signal) { + signal.addEventListener('abort', abortAndFinalize); + } -module.exports = {"$id":"response.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["status","statusText","httpVersion","cookies","headers","content","redirectURL","headersSize","bodySize"],"properties":{"status":{"type":"integer"},"statusText":{"type":"string"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"content":{"$ref":"content.json#"},"redirectURL":{"type":"string"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; + function finalize() { + req.abort(); + if (signal) signal.removeEventListener('abort', abortAndFinalize); + clearTimeout(reqTimeout); + } -/***/ }), -/* 227 */, -/* 228 */, -/* 229 */, -/* 230 */, -/* 231 */, -/* 232 */, -/* 233 */ -/***/ (function(module) { + if (request.timeout) { + req.once('socket', function (socket) { + reqTimeout = setTimeout(function () { + reject(new FetchError(`network timeout at: ${request.url}`, 'request-timeout')); + finalize(); + }, request.timeout); + }); + } -"use strict"; + req.on('error', function (err) { + reject(new FetchError(`request to ${request.url} failed, reason: ${err.message}`, 'system', err)); + finalize(); + }); -module.exports = function generate_dependencies(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $schemaDeps = {}, - $propertyDeps = {}, - $ownProperties = it.opts.ownProperties; - for ($property in $schema) { - var $sch = $schema[$property]; - var $deps = Array.isArray($sch) ? $propertyDeps : $schemaDeps; - $deps[$property] = $sch; - } - out += 'var ' + ($errs) + ' = errors;'; - var $currentErrorPath = it.errorPath; - out += 'var missing' + ($lvl) + ';'; - for (var $property in $propertyDeps) { - $deps = $propertyDeps[$property]; - if ($deps.length) { - out += ' if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; - if ($ownProperties) { - out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; - } - if ($breakOnError) { - out += ' && ( '; - var arr1 = $deps; - if (arr1) { - var $propertyKey, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $propertyKey = arr1[$i += 1]; - if ($i) { - out += ' || '; - } - var $prop = it.util.getProperty($propertyKey), - $useData = $data + $prop; - out += ' ( ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; - } - } - out += ')) { '; - var $propertyPath = 'missing' + $lvl, - $missingProperty = '\' + ' + $propertyPath + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; - } - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should have '; - if ($deps.length == 1) { - out += 'property ' + (it.util.escapeQuotes($deps[0])); - } else { - out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); - } - out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - } else { - out += ' ) { '; - var arr2 = $deps; - if (arr2) { - var $propertyKey, i2 = -1, - l2 = arr2.length - 1; - while (i2 < l2) { - $propertyKey = arr2[i2 += 1]; - var $prop = it.util.getProperty($propertyKey), - $missingProperty = it.util.escapeQuotes($propertyKey), - $useData = $data + $prop; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); - } - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('dependencies') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { property: \'' + (it.util.escapeQuotes($property)) + '\', missingProperty: \'' + ($missingProperty) + '\', depsCount: ' + ($deps.length) + ', deps: \'' + (it.util.escapeQuotes($deps.length == 1 ? $deps[0] : $deps.join(", "))) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should have '; - if ($deps.length == 1) { - out += 'property ' + (it.util.escapeQuotes($deps[0])); - } else { - out += 'properties ' + (it.util.escapeQuotes($deps.join(", "))); - } - out += ' when property ' + (it.util.escapeQuotes($property)) + ' is present\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; - } - } - } - out += ' } '; - if ($breakOnError) { - $closingBraces += '}'; - out += ' else { '; - } - } - } - it.errorPath = $currentErrorPath; - var $currentBaseId = $it.baseId; - for (var $property in $schemaDeps) { - var $sch = $schemaDeps[$property]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - out += ' ' + ($nextValid) + ' = true; if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined '; - if ($ownProperties) { - out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') '; - } - out += ') { '; - $it.schema = $sch; - $it.schemaPath = $schemaPath + it.util.getProperty($property); - $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property); - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - } - if ($breakOnError) { - out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; - } - out = it.util.cleanUpCode(out); - return out; -} + req.on('response', function (res) { + clearTimeout(reqTimeout); + const headers = createHeadersLenient(res.headers); -/***/ }), -/* 234 */, -/* 235 */, -/* 236 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { + // HTTP fetch step 5 + if (fetch.isRedirect(res.statusCode)) { + // HTTP fetch step 5.2 + const location = headers.get('Location'); -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ + // HTTP fetch step 5.3 + const locationURL = location === null ? null : resolve_url(request.url, location); -var net = __webpack_require__(631); -var urlParse = __webpack_require__(835).parse; -var util = __webpack_require__(669); -var pubsuffix = __webpack_require__(847); -var Store = __webpack_require__(582).Store; -var MemoryCookieStore = __webpack_require__(530).MemoryCookieStore; -var pathMatch = __webpack_require__(542).pathMatch; -var VERSION = __webpack_require__(525); + // HTTP fetch step 5.5 + switch (request.redirect) { + case 'error': + reject(new FetchError(`uri requested responds with a redirect, redirect mode is set to error: ${request.url}`, 'no-redirect')); + finalize(); + return; + case 'manual': + // node-fetch-specific step: make manual redirect a bit easier to use by setting the Location header value to the resolved URL. + if (locationURL !== null) { + // handle corrupted header + try { + headers.set('Location', locationURL); + } catch (err) { + // istanbul ignore next: nodejs server prevent invalid response headers, we can't test this through normal request + reject(err); + } + } + break; + case 'follow': + // HTTP-redirect fetch step 2 + if (locationURL === null) { + break; + } -var punycode; -try { - punycode = __webpack_require__(213); -} catch(e) { - console.warn("tough-cookie: can't load punycode; won't use punycode for domain normalization"); -} + // HTTP-redirect fetch step 5 + if (request.counter >= request.follow) { + reject(new FetchError(`maximum redirect reached at: ${request.url}`, 'max-redirect')); + finalize(); + return; + } + + // HTTP-redirect fetch step 6 (counter increment) + // Create a new Request object. + const requestOpts = { + headers: new Headers(request.headers), + follow: request.follow, + counter: request.counter + 1, + agent: request.agent, + compress: request.compress, + method: request.method, + body: request.body, + signal: request.signal, + timeout: request.timeout, + size: request.size + }; -// From RFC6265 S4.1.1 -// note that it excludes \x3B ";" -var COOKIE_OCTETS = /^[\x21\x23-\x2B\x2D-\x3A\x3C-\x5B\x5D-\x7E]+$/; + // HTTP-redirect fetch step 9 + if (res.statusCode !== 303 && request.body && getTotalBytes(request) === null) { + reject(new FetchError('Cannot follow redirect with body being a readable stream', 'unsupported-redirect')); + finalize(); + return; + } -var CONTROL_CHARS = /[\x00-\x1F]/; + // HTTP-redirect fetch step 11 + if (res.statusCode === 303 || (res.statusCode === 301 || res.statusCode === 302) && request.method === 'POST') { + requestOpts.method = 'GET'; + requestOpts.body = undefined; + requestOpts.headers.delete('content-length'); + } -// From Chromium // '\r', '\n' and '\0' should be treated as a terminator in -// the "relaxed" mode, see: -// https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/parsed_cookie.cc#L60 -var TERMINATORS = ['\n', '\r', '\0']; + // HTTP-redirect fetch step 15 + resolve(fetch(new Request(locationURL, requestOpts))); + finalize(); + return; + } + } -// RFC6265 S4.1.1 defines path value as 'any CHAR except CTLs or ";"' -// Note ';' is \x3B -var PATH_VALUE = /[\x20-\x3A\x3C-\x7E]+/; + // prepare response + res.once('end', function () { + if (signal) signal.removeEventListener('abort', abortAndFinalize); + }); + let body = res.pipe(new PassThrough$1()); -// date-time parsing constants (RFC6265 S5.1.1) + const response_options = { + url: request.url, + status: res.statusCode, + statusText: res.statusMessage, + headers: headers, + size: request.size, + timeout: request.timeout, + counter: request.counter + }; -var DATE_DELIM = /[\x09\x20-\x2F\x3B-\x40\x5B-\x60\x7B-\x7E]/; + // HTTP-network fetch step 12.1.1.3 + const codings = headers.get('Content-Encoding'); -var MONTH_TO_NUM = { - jan:0, feb:1, mar:2, apr:3, may:4, jun:5, - jul:6, aug:7, sep:8, oct:9, nov:10, dec:11 -}; -var NUM_TO_MONTH = [ - 'Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec' -]; -var NUM_TO_DAY = [ - 'Sun','Mon','Tue','Wed','Thu','Fri','Sat' -]; + // HTTP-network fetch step 12.1.1.4: handle content codings -var MAX_TIME = 2147483647000; // 31-bit max -var MIN_TIME = 0; // 31-bit min + // in following scenarios we ignore compression support + // 1. compression support is disabled + // 2. HEAD request + // 3. no Content-Encoding header + // 4. no content response (204) + // 5. content not modified response (304) + if (!request.compress || request.method === 'HEAD' || codings === null || res.statusCode === 204 || res.statusCode === 304) { + response = new Response(body, response_options); + resolve(response); + return; + } -/* - * Parses a Natural number (i.e., non-negative integer) with either the - * *DIGIT ( non-digit *OCTET ) - * or - * *DIGIT - * grammar (RFC6265 S5.1.1). - * - * The "trailingOK" boolean controls if the grammar accepts a - * "( non-digit *OCTET )" trailer. - */ -function parseDigits(token, minDigits, maxDigits, trailingOK) { - var count = 0; - while (count < token.length) { - var c = token.charCodeAt(count); - // "non-digit = %x00-2F / %x3A-FF" - if (c <= 0x2F || c >= 0x3A) { - break; - } - count++; - } + // For Node v6+ + // Be less strict when decoding compressed responses, since sometimes + // servers send slightly invalid responses that are still accepted + // by common browsers. + // Always using Z_SYNC_FLUSH is what cURL does. + const zlibOptions = { + flush: zlib.Z_SYNC_FLUSH, + finishFlush: zlib.Z_SYNC_FLUSH + }; - // constrain to a minimum and maximum number of digits. - if (count < minDigits || count > maxDigits) { - return null; - } + // for gzip + if (codings == 'gzip' || codings == 'x-gzip') { + body = body.pipe(zlib.createGunzip(zlibOptions)); + response = new Response(body, response_options); + resolve(response); + return; + } - if (!trailingOK && count != token.length) { - return null; - } + // for deflate + if (codings == 'deflate' || codings == 'x-deflate') { + // handle the infamous raw deflate response from old servers + // a hack for old IIS and Apache servers + const raw = res.pipe(new PassThrough$1()); + raw.once('data', function (chunk) { + // see http://stackoverflow.com/questions/37519828 + if ((chunk[0] & 0x0F) === 0x08) { + body = body.pipe(zlib.createInflate()); + } else { + body = body.pipe(zlib.createInflateRaw()); + } + response = new Response(body, response_options); + resolve(response); + }); + return; + } + + // for br + if (codings == 'br' && typeof zlib.createBrotliDecompress === 'function') { + body = body.pipe(zlib.createBrotliDecompress()); + response = new Response(body, response_options); + resolve(response); + return; + } + + // otherwise, use response as-is + response = new Response(body, response_options); + resolve(response); + }); - return parseInt(token.substr(0,count), 10); + writeToStream(req, request); + }); } +/** + * Redirect code matching + * + * @param Number code Status code + * @return Boolean + */ +fetch.isRedirect = function (code) { + return code === 301 || code === 302 || code === 303 || code === 307 || code === 308; +}; -function parseTime(token) { - var parts = token.split(':'); - var result = [0,0,0]; +// expose Promise +fetch.Promise = global.Promise; - /* RF6256 S5.1.1: - * time = hms-time ( non-digit *OCTET ) - * hms-time = time-field ":" time-field ":" time-field - * time-field = 1*2DIGIT - */ +module.exports = exports = fetch; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.default = exports; +exports.Headers = Headers; +exports.Request = Request; +exports.Response = Response; +exports.FetchError = FetchError; - if (parts.length !== 3) { - return null; - } - for (var i = 0; i < 3; i++) { - // "time-field" must be strictly "1*2DIGIT", HOWEVER, "hms-time" can be - // followed by "( non-digit *OCTET )" so therefore the last time-field can - // have a trailer - var trailingOK = (i == 2); - var num = parseDigits(parts[i], 1, 2, trailingOK); - if (num === null) { - return null; - } - result[i] = num; - } +/***/ }), - return result; -} +/***/ 463: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -function parseMonth(token) { - token = String(token).substr(0,3).toLowerCase(); - var num = MONTH_TO_NUM[token]; - return num >= 0 ? num : null; -} +"use strict"; -/* - * RFC6265 S5.1.1 date parser (see RFC for full grammar) - */ -function parseDate(str) { - if (!str) { - return; - } - /* RFC6265 S5.1.1: - * 2. Process each date-token sequentially in the order the date-tokens - * appear in the cookie-date - */ - var tokens = str.split(DATE_DELIM); - if (!tokens) { - return; - } +Object.defineProperty(exports, '__esModule', { value: true }); - var hour = null; - var minute = null; - var second = null; - var dayOfMonth = null; - var month = null; - var year = null; - - for (var i=0; i console.warn(deprecation)); +/** + * Error with extra properties to help with debugging + */ - /* 2.2. If the found-day-of-month flag is not set and the date-token matches - * the day-of-month production, set the found-day-of- month flag and set - * the day-of-month-value to the number denoted by the date-token. Skip - * the remaining sub-steps and continue to the next date-token. - */ - if (dayOfMonth === null) { - // "day-of-month = 1*2DIGIT ( non-digit *OCTET )" - result = parseDigits(token, 1, 2, true); - if (result !== null) { - dayOfMonth = result; - continue; - } - } +class RequestError extends Error { + constructor(message, statusCode, options) { + super(message); // Maintains proper stack trace (only available on V8) - /* 2.3. If the found-month flag is not set and the date-token matches the - * month production, set the found-month flag and set the month-value to - * the month denoted by the date-token. Skip the remaining sub-steps and - * continue to the next date-token. - */ - if (month === null) { - result = parseMonth(token); - if (result !== null) { - month = result; - continue; - } - } + /* istanbul ignore next */ - /* 2.4. If the found-year flag is not set and the date-token matches the - * year production, set the found-year flag and set the year-value to the - * number denoted by the date-token. Skip the remaining sub-steps and - * continue to the next date-token. - */ - if (year === null) { - // "year = 2*4DIGIT ( non-digit *OCTET )" - result = parseDigits(token, 2, 4, true); - if (result !== null) { - year = result; - /* From S5.1.1: - * 3. If the year-value is greater than or equal to 70 and less - * than or equal to 99, increment the year-value by 1900. - * 4. If the year-value is greater than or equal to 0 and less - * than or equal to 69, increment the year-value by 2000. - */ - if (year >= 70 && year <= 99) { - year += 1900; - } else if (year >= 0 && year <= 69) { - year += 2000; - } - } + if (Error.captureStackTrace) { + Error.captureStackTrace(this, this.constructor); } - } - /* RFC 6265 S5.1.1 - * "5. Abort these steps and fail to parse the cookie-date if: - * * at least one of the found-day-of-month, found-month, found- - * year, or found-time flags is not set, - * * the day-of-month-value is less than 1 or greater than 31, - * * the year-value is less than 1601, - * * the hour-value is greater than 23, - * * the minute-value is greater than 59, or - * * the second-value is greater than 59. - * (Note that leap seconds cannot be represented in this syntax.)" - * - * So, in order as above: - */ - if ( - dayOfMonth === null || month === null || year === null || second === null || - dayOfMonth < 1 || dayOfMonth > 31 || - year < 1601 || - hour > 23 || - minute > 59 || - second > 59 - ) { - return; - } + this.name = "HttpError"; + this.status = statusCode; + Object.defineProperty(this, "code", { + get() { + logOnce(new deprecation.Deprecation("[@octokit/request-error] `error.code` is deprecated, use `error.status`.")); + return statusCode; + } - return new Date(Date.UTC(year, month, dayOfMonth, hour, minute, second)); -} + }); + this.headers = options.headers || {}; // redact request credentials without mutating original request options -function formatDate(date) { - var d = date.getUTCDate(); d = d >= 10 ? d : '0'+d; - var h = date.getUTCHours(); h = h >= 10 ? h : '0'+h; - var m = date.getUTCMinutes(); m = m >= 10 ? m : '0'+m; - var s = date.getUTCSeconds(); s = s >= 10 ? s : '0'+s; - return NUM_TO_DAY[date.getUTCDay()] + ', ' + - d+' '+ NUM_TO_MONTH[date.getUTCMonth()] +' '+ date.getUTCFullYear() +' '+ - h+':'+m+':'+s+' GMT'; -} + const requestCopy = Object.assign({}, options.request); -// S5.1.2 Canonicalized Host Names -function canonicalDomain(str) { - if (str == null) { - return null; - } - str = str.trim().replace(/^\./,''); // S4.1.2.3 & S5.2.3: ignore leading . + if (options.request.headers.authorization) { + requestCopy.headers = Object.assign({}, options.request.headers, { + authorization: options.request.headers.authorization.replace(/ .*$/, " [REDACTED]") + }); + } - // convert to IDN if any non-ASCII characters - if (punycode && /[^\u0001-\u007f]/.test(str)) { - str = punycode.toASCII(str); + requestCopy.url = requestCopy.url // client_id & client_secret can be passed as URL query parameters to increase rate limit + // see https://developer.github.com/v3/#increasing-the-unauthenticated-rate-limit-for-oauth-applications + .replace(/\bclient_secret=\w+/g, "client_secret=[REDACTED]") // OAuth tokens can be passed as URL query parameters, although it is not recommended + // see https://developer.github.com/v3/#oauth2-token-sent-in-a-header + .replace(/\baccess_token=\w+/g, "access_token=[REDACTED]"); + this.request = requestCopy; } - return str.toLowerCase(); } -// S5.1.3 Domain Matching -function domainMatch(str, domStr, canonicalize) { - if (str == null || domStr == null) { - return null; - } - if (canonicalize !== false) { - str = canonicalDomain(str); - domStr = canonicalDomain(domStr); - } +exports.RequestError = RequestError; +//# sourceMappingURL=index.js.map - /* - * "The domain string and the string are identical. (Note that both the - * domain string and the string will have been canonicalized to lower case at - * this point)" - */ - if (str == domStr) { - return true; - } - /* "All of the following [three] conditions hold:" (order adjusted from the RFC) */ +/***/ }), - /* "* The string is a host name (i.e., not an IP address)." */ - if (net.isIP(str)) { - return false; - } +/***/ 469: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - /* "* The domain string is a suffix of the string" */ - var idx = str.indexOf(domStr); - if (idx <= 0) { - return false; // it's a non-match (-1) or prefix (0) - } +"use strict"; - // e.g "a.b.c".indexOf("b.c") === 2 - // 5 === 3+2 - if (str.length !== domStr.length + idx) { // it's not a suffix - return false; - } - - /* "* The last character of the string that is not included in the domain - * string is a %x2E (".") character." */ - if (str.substr(idx-1,1) !== '.') { - return false; - } - - return true; -} - - -// RFC6265 S5.1.4 Paths and Path-Match - -/* - * "The user agent MUST use an algorithm equivalent to the following algorithm - * to compute the default-path of a cookie:" +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.getOctokit = exports.context = void 0; +const Context = __importStar(__webpack_require__(262)); +const utils_1 = __webpack_require__(521); +exports.context = new Context.Context(); +/** + * Returns a hydrated octokit ready to use for GitHub Actions * - * Assumption: the path (and not query part or absolute uri) is passed in. + * @param token the repo PAT or GITHUB_TOKEN + * @param options other options to set */ -function defaultPath(path) { - // "2. If the uri-path is empty or if the first character of the uri-path is not - // a %x2F ("/") character, output %x2F ("/") and skip the remaining steps. - if (!path || path.substr(0,1) !== "/") { - return "/"; - } - - // "3. If the uri-path contains no more than one %x2F ("/") character, output - // %x2F ("/") and skip the remaining step." - if (path === "/") { - return path; - } - - var rightSlash = path.lastIndexOf("/"); - if (rightSlash === 0) { - return "/"; - } - - // "4. Output the characters of the uri-path from the first character up to, - // but not including, the right-most %x2F ("/")." - return path.slice(0, rightSlash); -} - -function trimTerminator(str) { - for (var t = 0; t < TERMINATORS.length; t++) { - var terminatorIdx = str.indexOf(TERMINATORS[t]); - if (terminatorIdx !== -1) { - str = str.substr(0,terminatorIdx); - } - } - - return str; -} - -function parseCookiePair(cookiePair, looseMode) { - cookiePair = trimTerminator(cookiePair); - - var firstEq = cookiePair.indexOf('='); - if (looseMode) { - if (firstEq === 0) { // '=' is immediately at start - cookiePair = cookiePair.substr(1); - firstEq = cookiePair.indexOf('='); // might still need to split on '=' - } - } else { // non-loose mode - if (firstEq <= 0) { // no '=' or is at start - return; // needs to have non-empty "cookie-name" - } - } - - var cookieName, cookieValue; - if (firstEq <= 0) { - cookieName = ""; - cookieValue = cookiePair.trim(); - } else { - cookieName = cookiePair.substr(0, firstEq).trim(); - cookieValue = cookiePair.substr(firstEq+1).trim(); - } - - if (CONTROL_CHARS.test(cookieName) || CONTROL_CHARS.test(cookieValue)) { - return; - } - - var c = new Cookie(); - c.key = cookieName; - c.value = cookieValue; - return c; +function getOctokit(token, options) { + return new utils_1.GitHub(utils_1.getOctokitOptions(token, options)); } +exports.getOctokit = getOctokit; +//# sourceMappingURL=github.js.map -function parse(str, options) { - if (!options || typeof options !== 'object') { - options = {}; - } - str = str.trim(); - - // We use a regex to parse the "name-value-pair" part of S5.2 - var firstSemi = str.indexOf(';'); // S5.2 step 1 - var cookiePair = (firstSemi === -1) ? str : str.substr(0, firstSemi); - var c = parseCookiePair(cookiePair, !!options.loose); - if (!c) { - return; - } - - if (firstSemi === -1) { - return c; - } - - // S5.2.3 "unparsed-attributes consist of the remainder of the set-cookie-string - // (including the %x3B (";") in question)." plus later on in the same section - // "discard the first ";" and trim". - var unparsed = str.slice(firstSemi + 1).trim(); - - // "If the unparsed-attributes string is empty, skip the rest of these - // steps." - if (unparsed.length === 0) { - return c; - } - - /* - * S5.2 says that when looping over the items "[p]rocess the attribute-name - * and attribute-value according to the requirements in the following - * subsections" for every item. Plus, for many of the individual attributes - * in S5.3 it says to use the "attribute-value of the last attribute in the - * cookie-attribute-list". Therefore, in this implementation, we overwrite - * the previous value. - */ - var cookie_avs = unparsed.split(';'); - while (cookie_avs.length) { - var av = cookie_avs.shift().trim(); - if (av.length === 0) { // happens if ";;" appears - continue; - } - var av_sep = av.indexOf('='); - var av_key, av_value; +/***/ }), - if (av_sep === -1) { - av_key = av; - av_value = null; - } else { - av_key = av.substr(0,av_sep); - av_value = av.substr(av_sep+1); - } +/***/ 470: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - av_key = av_key.trim().toLowerCase(); +"use strict"; - if (av_value) { - av_value = av_value.trim(); +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; + result["default"] = mod; + return result; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const command_1 = __webpack_require__(431); +const file_command_1 = __webpack_require__(102); +const utils_1 = __webpack_require__(82); +const os = __importStar(__webpack_require__(87)); +const path = __importStar(__webpack_require__(622)); +/** + * The code to exit an action + */ +var ExitCode; +(function (ExitCode) { + /** + * A code indicating that the action was successful + */ + ExitCode[ExitCode["Success"] = 0] = "Success"; + /** + * A code indicating that the action was a failure + */ + ExitCode[ExitCode["Failure"] = 1] = "Failure"; +})(ExitCode = exports.ExitCode || (exports.ExitCode = {})); +//----------------------------------------------------------------------- +// Variables +//----------------------------------------------------------------------- +/** + * Sets env variable for this action and future actions in the job + * @param name the name of the variable to set + * @param val the value of the variable. Non-string values will be converted to a string via JSON.stringify + */ +// eslint-disable-next-line @typescript-eslint/no-explicit-any +function exportVariable(name, val) { + const convertedVal = utils_1.toCommandValue(val); + process.env[name] = convertedVal; + const filePath = process.env['GITHUB_ENV'] || ''; + if (filePath) { + const delimiter = '_GitHubActionsFileCommandDelimeter_'; + const commandValue = `${name}<<${delimiter}${os.EOL}${convertedVal}${os.EOL}${delimiter}`; + file_command_1.issueCommand('ENV', commandValue); } - - switch(av_key) { - case 'expires': // S5.2.1 - if (av_value) { - var exp = parseDate(av_value); - // "If the attribute-value failed to parse as a cookie date, ignore the - // cookie-av." - if (exp) { - // over and underflow not realistically a concern: V8's getTime() seems to - // store something larger than a 32-bit time_t (even with 32-bit node) - c.expires = exp; - } - } - break; - - case 'max-age': // S5.2.2 - if (av_value) { - // "If the first character of the attribute-value is not a DIGIT or a "-" - // character ...[or]... If the remainder of attribute-value contains a - // non-DIGIT character, ignore the cookie-av." - if (/^-?[0-9]+$/.test(av_value)) { - var delta = parseInt(av_value, 10); - // "If delta-seconds is less than or equal to zero (0), let expiry-time - // be the earliest representable date and time." - c.setMaxAge(delta); - } - } - break; - - case 'domain': // S5.2.3 - // "If the attribute-value is empty, the behavior is undefined. However, - // the user agent SHOULD ignore the cookie-av entirely." - if (av_value) { - // S5.2.3 "Let cookie-domain be the attribute-value without the leading %x2E - // (".") character." - var domain = av_value.trim().replace(/^\./, ''); - if (domain) { - // "Convert the cookie-domain to lower case." - c.domain = domain.toLowerCase(); - } - } - break; - - case 'path': // S5.2.4 - /* - * "If the attribute-value is empty or if the first character of the - * attribute-value is not %x2F ("/"): - * Let cookie-path be the default-path. - * Otherwise: - * Let cookie-path be the attribute-value." - * - * We'll represent the default-path as null since it depends on the - * context of the parsing. - */ - c.path = av_value && av_value[0] === "/" ? av_value : null; - break; - - case 'secure': // S5.2.5 - /* - * "If the attribute-name case-insensitively matches the string "Secure", - * the user agent MUST append an attribute to the cookie-attribute-list - * with an attribute-name of Secure and an empty attribute-value." - */ - c.secure = true; - break; - - case 'httponly': // S5.2.6 -- effectively the same as 'secure' - c.httpOnly = true; - break; - - default: - c.extensions = c.extensions || []; - c.extensions.push(av); - break; + else { + command_1.issueCommand('set-env', { name }, convertedVal); } - } - - return c; } - -// avoid the V8 deoptimization monster! -function jsonParse(str) { - var obj; - try { - obj = JSON.parse(str); - } catch (e) { - return e; - } - return obj; +exports.exportVariable = exportVariable; +/** + * Registers a secret which will get masked from logs + * @param secret value of the secret + */ +function setSecret(secret) { + command_1.issueCommand('add-mask', {}, secret); } - -function fromJSON(str) { - if (!str) { - return null; - } - - var obj; - if (typeof str === 'string') { - obj = jsonParse(str); - if (obj instanceof Error) { - return null; - } - } else { - // assume it's an Object - obj = str; - } - - var c = new Cookie(); - for (var i=0; i 1) { - var lindex = path.lastIndexOf('/'); - if (lindex === 0) { - break; +function getInput(name, options) { + const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || ''; + if (options && options.required && !val) { + throw new Error(`Input required and not supplied: ${name}`); } - path = path.substr(0,lindex); - permutations.push(path); - } - permutations.push('/'); - return permutations; -} - -function getCookieContext(url) { - if (url instanceof Object) { - return url; - } - // NOTE: decodeURI will throw on malformed URIs (see GH-32). - // Therefore, we will just skip decoding for such URIs. - try { - url = decodeURI(url); - } - catch(err) { - // Silently swallow error - } - - return urlParse(url); + return val.trim(); } - -function Cookie(options) { - options = options || {}; - - Object.keys(options).forEach(function(prop) { - if (Cookie.prototype.hasOwnProperty(prop) && - Cookie.prototype[prop] !== options[prop] && - prop.substr(0,1) !== '_') - { - this[prop] = options[prop]; - } - }, this); - - this.creation = this.creation || new Date(); - - // used to break creation ties in cookieCompare(): - Object.defineProperty(this, 'creationIndex', { - configurable: false, - enumerable: false, // important for assert.deepEqual checks - writable: true, - value: ++Cookie.cookiesCreated - }); +exports.getInput = getInput; +/** + * Sets the value of an output. + * + * @param name name of the output to set + * @param value value to store. Non-string values will be converted to a string via JSON.stringify + */ +// eslint-disable-next-line @typescript-eslint/no-explicit-any +function setOutput(name, value) { + command_1.issueCommand('set-output', { name }, value); } - -Cookie.cookiesCreated = 0; // incremented each time a cookie is created - -Cookie.parse = parse; -Cookie.fromJSON = fromJSON; - -Cookie.prototype.key = ""; -Cookie.prototype.value = ""; - -// the order in which the RFC has them: -Cookie.prototype.expires = "Infinity"; // coerces to literal Infinity -Cookie.prototype.maxAge = null; // takes precedence over expires for TTL -Cookie.prototype.domain = null; -Cookie.prototype.path = null; -Cookie.prototype.secure = false; -Cookie.prototype.httpOnly = false; -Cookie.prototype.extensions = null; - -// set by the CookieJar: -Cookie.prototype.hostOnly = null; // boolean when set -Cookie.prototype.pathIsDefault = null; // boolean when set -Cookie.prototype.creation = null; // Date when set; defaulted by Cookie.parse -Cookie.prototype.lastAccessed = null; // Date when set -Object.defineProperty(Cookie.prototype, 'creationIndex', { - configurable: true, - enumerable: false, - writable: true, - value: 0 -}); - -Cookie.serializableProperties = Object.keys(Cookie.prototype) - .filter(function(prop) { - return !( - Cookie.prototype[prop] instanceof Function || - prop === 'creationIndex' || - prop.substr(0,1) === '_' - ); - }); - -Cookie.prototype.inspect = function inspect() { - var now = Date.now(); - return 'Cookie="'+this.toString() + - '; hostOnly='+(this.hostOnly != null ? this.hostOnly : '?') + - '; aAge='+(this.lastAccessed ? (now-this.lastAccessed.getTime())+'ms' : '?') + - '; cAge='+(this.creation ? (now-this.creation.getTime())+'ms' : '?') + - '"'; -}; - -// Use the new custom inspection symbol to add the custom inspect function if -// available. -if (util.inspect.custom) { - Cookie.prototype[util.inspect.custom] = Cookie.prototype.inspect; +exports.setOutput = setOutput; +/** + * Enables or disables the echoing of commands into stdout for the rest of the step. + * Echoing is disabled by default if ACTIONS_STEP_DEBUG is not set. + * + */ +function setCommandEcho(enabled) { + command_1.issue('echo', enabled ? 'on' : 'off'); } +exports.setCommandEcho = setCommandEcho; +//----------------------------------------------------------------------- +// Results +//----------------------------------------------------------------------- +/** + * Sets the action status to failed. + * When the action exits it will be with an exit code of 1 + * @param message add error issue message + */ +function setFailed(message) { + process.exitCode = ExitCode.Failure; + error(message); +} +exports.setFailed = setFailed; +//----------------------------------------------------------------------- +// Logging Commands +//----------------------------------------------------------------------- +/** + * Gets whether Actions Step Debug is on or not + */ +function isDebug() { + return process.env['RUNNER_DEBUG'] === '1'; +} +exports.isDebug = isDebug; +/** + * Writes debug message to user log + * @param message debug message + */ +function debug(message) { + command_1.issueCommand('debug', {}, message); +} +exports.debug = debug; +/** + * Adds an error issue + * @param message error issue message. Errors will be converted to string via toString() + */ +function error(message) { + command_1.issue('error', message instanceof Error ? message.toString() : message); +} +exports.error = error; +/** + * Adds an warning issue + * @param message warning issue message. Errors will be converted to string via toString() + */ +function warning(message) { + command_1.issue('warning', message instanceof Error ? message.toString() : message); +} +exports.warning = warning; +/** + * Writes info to log with console.log. + * @param message info message + */ +function info(message) { + process.stdout.write(message + os.EOL); +} +exports.info = info; +/** + * Begin an output group. + * + * Output until the next `groupEnd` will be foldable in this group + * + * @param name The name of the output group + */ +function startGroup(name) { + command_1.issue('group', name); +} +exports.startGroup = startGroup; +/** + * End an output group. + */ +function endGroup() { + command_1.issue('endgroup'); +} +exports.endGroup = endGroup; +/** + * Wrap an asynchronous function call in a group. + * + * Returns the same type as the function itself. + * + * @param name The name of the group + * @param fn The function to wrap in the group + */ +function group(name, fn) { + return __awaiter(this, void 0, void 0, function* () { + startGroup(name); + let result; + try { + result = yield fn(); + } + finally { + endGroup(); + } + return result; + }); +} +exports.group = group; +//----------------------------------------------------------------------- +// Wrapper action state +//----------------------------------------------------------------------- +/** + * Saves state for current action, the state can only be retrieved by this action's post job execution. + * + * @param name name of the state to store + * @param value value to store. Non-string values will be converted to a string via JSON.stringify + */ +// eslint-disable-next-line @typescript-eslint/no-explicit-any +function saveState(name, value) { + command_1.issueCommand('save-state', { name }, value); +} +exports.saveState = saveState; +/** + * Gets the value of an state set by this action's main execution. + * + * @param name name of the state to get + * @returns string + */ +function getState(name) { + return process.env[`STATE_${name}`] || ''; +} +exports.getState = getState; +//# sourceMappingURL=core.js.map -Cookie.prototype.toJSON = function() { - var obj = {}; - - var props = Cookie.serializableProperties; - for (var i=0; i { + let output = Buffer.alloc(0); + this.message.on('data', (chunk) => { + output = Buffer.concat([output, chunk]); + }); + this.message.on('end', () => { + resolve(output.toString()); + }); + }); } - - // "The request-uri's path path-matches the cookie's path." - if (!allPaths && !pathMatch(path, c.path)) { - return false; +} +exports.HttpClientResponse = HttpClientResponse; +function isHttps(requestUrl) { + let parsedUrl = new URL(requestUrl); + return parsedUrl.protocol === 'https:'; +} +exports.isHttps = isHttps; +class HttpClient { + constructor(userAgent, handlers, requestOptions) { + this._ignoreSslError = false; + this._allowRedirects = true; + this._allowRedirectDowngrade = false; + this._maxRedirects = 50; + this._allowRetries = false; + this._maxRetries = 1; + this._keepAlive = false; + this._disposed = false; + this.userAgent = userAgent; + this.handlers = handlers || []; + this.requestOptions = requestOptions; + if (requestOptions) { + if (requestOptions.ignoreSslError != null) { + this._ignoreSslError = requestOptions.ignoreSslError; + } + this._socketTimeout = requestOptions.socketTimeout; + if (requestOptions.allowRedirects != null) { + this._allowRedirects = requestOptions.allowRedirects; + } + if (requestOptions.allowRedirectDowngrade != null) { + this._allowRedirectDowngrade = requestOptions.allowRedirectDowngrade; + } + if (requestOptions.maxRedirects != null) { + this._maxRedirects = Math.max(requestOptions.maxRedirects, 0); + } + if (requestOptions.keepAlive != null) { + this._keepAlive = requestOptions.keepAlive; + } + if (requestOptions.allowRetries != null) { + this._allowRetries = requestOptions.allowRetries; + } + if (requestOptions.maxRetries != null) { + this._maxRetries = requestOptions.maxRetries; + } + } } - - // "If the cookie's secure-only-flag is true, then the request-uri's - // scheme must denote a "secure" protocol" - if (c.secure && !secure) { - return false; + options(requestUrl, additionalHeaders) { + return this.request('OPTIONS', requestUrl, null, additionalHeaders || {}); } - - // "If the cookie's http-only-flag is true, then exclude the cookie if the - // cookie-string is being generated for a "non-HTTP" API" - if (c.httpOnly && !http) { - return false; + get(requestUrl, additionalHeaders) { + return this.request('GET', requestUrl, null, additionalHeaders || {}); } - - // deferred from S5.3 - // non-RFC: allow retention of expired cookies by choice - if (expireCheck && c.expiryTime() <= now) { - store.removeCookie(c.domain, c.path, c.key, function(){}); // result ignored - return false; + del(requestUrl, additionalHeaders) { + return this.request('DELETE', requestUrl, null, additionalHeaders || {}); } - - return true; - } - - store.findCookies(host, allPaths ? null : path, function(err,cookies) { - if (err) { - return cb(err); + post(requestUrl, data, additionalHeaders) { + return this.request('POST', requestUrl, data, additionalHeaders || {}); } - - cookies = cookies.filter(matchingCookie); - - // sorting of S5.4 part 2 - if (options.sort !== false) { - cookies = cookies.sort(cookieCompare); + patch(requestUrl, data, additionalHeaders) { + return this.request('PATCH', requestUrl, data, additionalHeaders || {}); } - - // S5.4 part 3 - var now = new Date(); - cookies.forEach(function(c) { - c.lastAccessed = now; - }); - // TODO persist lastAccessed - - cb(null,cookies); - }); -}; - -CAN_BE_SYNC.push('getCookieString'); -CookieJar.prototype.getCookieString = function(/*..., cb*/) { - var args = Array.prototype.slice.call(arguments,0); - var cb = args.pop(); - var next = function(err,cookies) { - if (err) { - cb(err); - } else { - cb(null, cookies - .sort(cookieCompare) - .map(function(c){ - return c.cookieString(); - }) - .join('; ')); + put(requestUrl, data, additionalHeaders) { + return this.request('PUT', requestUrl, data, additionalHeaders || {}); } - }; - args.push(next); - this.getCookies.apply(this,args); -}; - -CAN_BE_SYNC.push('getSetCookieStrings'); -CookieJar.prototype.getSetCookieStrings = function(/*..., cb*/) { - var args = Array.prototype.slice.call(arguments,0); - var cb = args.pop(); - var next = function(err,cookies) { - if (err) { - cb(err); - } else { - cb(null, cookies.map(function(c){ - return c.toString(); - })); + head(requestUrl, additionalHeaders) { + return this.request('HEAD', requestUrl, null, additionalHeaders || {}); } - }; - args.push(next); - this.getCookies.apply(this,args); -}; - -CAN_BE_SYNC.push('serialize'); -CookieJar.prototype.serialize = function(cb) { - var type = this.store.constructor.name; - if (type === 'Object') { - type = null; - } - - // update README.md "Serialization Format" if you change this, please! - var serialized = { - // The version of tough-cookie that serialized this jar. Generally a good - // practice since future versions can make data import decisions based on - // known past behavior. When/if this matters, use `semver`. - version: 'tough-cookie@'+VERSION, - - // add the store type, to make humans happy: - storeType: type, - - // CookieJar configuration: - rejectPublicSuffixes: !!this.rejectPublicSuffixes, - - // this gets filled from getAllCookies: - cookies: [] - }; - - if (!(this.store.getAllCookies && - typeof this.store.getAllCookies === 'function')) - { - return cb(new Error('store does not support getAllCookies and cannot be serialized')); - } - - this.store.getAllCookies(function(err,cookies) { - if (err) { - return cb(err); + sendStream(verb, requestUrl, stream, additionalHeaders) { + return this.request(verb, requestUrl, stream, additionalHeaders); } - - serialized.cookies = cookies.map(function(cookie) { - // convert to serialized 'raw' cookies - cookie = (cookie instanceof Cookie) ? cookie.toJSON() : cookie; - - // Remove the index so new ones get assigned during deserialization - delete cookie.creationIndex; - - return cookie; - }); - - return cb(null, serialized); - }); -}; - -// well-known name that JSON.stringify calls -CookieJar.prototype.toJSON = function() { - return this.serializeSync(); -}; - -// use the class method CookieJar.deserialize instead of calling this directly -CAN_BE_SYNC.push('_importCookies'); -CookieJar.prototype._importCookies = function(serialized, cb) { - var jar = this; - var cookies = serialized.cookies; - if (!cookies || !Array.isArray(cookies)) { - return cb(new Error('serialized jar has no cookies array')); - } - cookies = cookies.slice(); // do not modify the original - - function putNext(err) { - if (err) { - return cb(err); + /** + * Gets a typed object from an endpoint + * Be aware that not found returns a null. Other errors (4xx, 5xx) reject the promise + */ + async getJson(requestUrl, additionalHeaders = {}) { + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + let res = await this.get(requestUrl, additionalHeaders); + return this._processResponse(res, this.requestOptions); } - - if (!cookies.length) { - return cb(err, jar); + async postJson(requestUrl, obj, additionalHeaders = {}) { + let data = JSON.stringify(obj, null, 2); + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + let res = await this.post(requestUrl, data, additionalHeaders); + return this._processResponse(res, this.requestOptions); } - - var cookie; - try { - cookie = fromJSON(cookies.shift()); - } catch (e) { - return cb(e); + async putJson(requestUrl, obj, additionalHeaders = {}) { + let data = JSON.stringify(obj, null, 2); + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + let res = await this.put(requestUrl, data, additionalHeaders); + return this._processResponse(res, this.requestOptions); } - - if (cookie === null) { - return putNext(null); // skip this cookie + async patchJson(requestUrl, obj, additionalHeaders = {}) { + let data = JSON.stringify(obj, null, 2); + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + let res = await this.patch(requestUrl, data, additionalHeaders); + return this._processResponse(res, this.requestOptions); } - - jar.store.putCookie(cookie, putNext); - } - - putNext(); -}; - -CookieJar.deserialize = function(strOrObj, store, cb) { - if (arguments.length !== 3) { - // store is optional - cb = store; - store = null; - } - - var serialized; - if (typeof strOrObj === 'string') { - serialized = jsonParse(strOrObj); - if (serialized instanceof Error) { - return cb(serialized); + /** + * Makes a raw http request. + * All other methods such as get, post, patch, and request ultimately call this. + * Prefer get, del, post and patch + */ + async request(verb, requestUrl, data, headers) { + if (this._disposed) { + throw new Error('Client has already been disposed.'); + } + let parsedUrl = new URL(requestUrl); + let info = this._prepareRequest(verb, parsedUrl, headers); + // Only perform retries on reads since writes may not be idempotent. + let maxTries = this._allowRetries && RetryableHttpVerbs.indexOf(verb) != -1 + ? this._maxRetries + 1 + : 1; + let numTries = 0; + let response; + while (numTries < maxTries) { + response = await this.requestRaw(info, data); + // Check if it's an authentication challenge + if (response && + response.message && + response.message.statusCode === HttpCodes.Unauthorized) { + let authenticationHandler; + for (let i = 0; i < this.handlers.length; i++) { + if (this.handlers[i].canHandleAuthentication(response)) { + authenticationHandler = this.handlers[i]; + break; + } + } + if (authenticationHandler) { + return authenticationHandler.handleAuthentication(this, info, data); + } + else { + // We have received an unauthorized response but have no handlers to handle it. + // Let the response return to the caller. + return response; + } + } + let redirectsRemaining = this._maxRedirects; + while (HttpRedirectCodes.indexOf(response.message.statusCode) != -1 && + this._allowRedirects && + redirectsRemaining > 0) { + const redirectUrl = response.message.headers['location']; + if (!redirectUrl) { + // if there's no location to redirect to, we won't + break; + } + let parsedRedirectUrl = new URL(redirectUrl); + if (parsedUrl.protocol == 'https:' && + parsedUrl.protocol != parsedRedirectUrl.protocol && + !this._allowRedirectDowngrade) { + throw new Error('Redirect from HTTPS to HTTP protocol. This downgrade is not allowed for security reasons. If you want to allow this behavior, set the allowRedirectDowngrade option to true.'); + } + // we need to finish reading the response before reassigning response + // which will leak the open socket. + await response.readBody(); + // strip authorization header if redirected to a different hostname + if (parsedRedirectUrl.hostname !== parsedUrl.hostname) { + for (let header in headers) { + // header names are case insensitive + if (header.toLowerCase() === 'authorization') { + delete headers[header]; + } + } + } + // let's make the request with the new redirectUrl + info = this._prepareRequest(verb, parsedRedirectUrl, headers); + response = await this.requestRaw(info, data); + redirectsRemaining--; + } + if (HttpResponseRetryCodes.indexOf(response.message.statusCode) == -1) { + // If not a retry code, return immediately instead of retrying + return response; + } + numTries += 1; + if (numTries < maxTries) { + await response.readBody(); + await this._performExponentialBackoff(numTries); + } + } + return response; } - } else { - serialized = strOrObj; - } - - var jar = new CookieJar(store, serialized.rejectPublicSuffixes); - jar._importCookies(serialized, function(err) { - if (err) { - return cb(err); + /** + * Needs to be called if keepAlive is set to true in request options. + */ + dispose() { + if (this._agent) { + this._agent.destroy(); + } + this._disposed = true; } - cb(null, jar); - }); -}; - -CookieJar.deserializeSync = function(strOrObj, store) { - var serialized = typeof strOrObj === 'string' ? - JSON.parse(strOrObj) : strOrObj; - var jar = new CookieJar(store, serialized.rejectPublicSuffixes); - - // catch this mistake early: - if (!jar.store.synchronous) { - throw new Error('CookieJar store is not synchronous; use async API instead.'); - } - - jar._importCookiesSync(serialized); - return jar; -}; -CookieJar.fromJSON = CookieJar.deserializeSync; - -CookieJar.prototype.clone = function(newStore, cb) { - if (arguments.length === 1) { - cb = newStore; - newStore = null; - } - - this.serialize(function(err,serialized) { - if (err) { - return cb(err); + /** + * Raw request. + * @param info + * @param data + */ + requestRaw(info, data) { + return new Promise((resolve, reject) => { + let callbackForResult = function (err, res) { + if (err) { + reject(err); + } + resolve(res); + }; + this.requestRawWithCallback(info, data, callbackForResult); + }); } - CookieJar.deserialize(serialized, newStore, cb); - }); -}; - -CAN_BE_SYNC.push('removeAllCookies'); -CookieJar.prototype.removeAllCookies = function(cb) { - var store = this.store; - - // Check that the store implements its own removeAllCookies(). The default - // implementation in Store will immediately call the callback with a "not - // implemented" Error. - if (store.removeAllCookies instanceof Function && - store.removeAllCookies !== Store.prototype.removeAllCookies) - { - return store.removeAllCookies(cb); - } - - store.getAllCookies(function(err, cookies) { - if (err) { - return cb(err); + /** + * Raw request with callback. + * @param info + * @param data + * @param onResult + */ + requestRawWithCallback(info, data, onResult) { + let socket; + if (typeof data === 'string') { + info.options.headers['Content-Length'] = Buffer.byteLength(data, 'utf8'); + } + let callbackCalled = false; + let handleResult = (err, res) => { + if (!callbackCalled) { + callbackCalled = true; + onResult(err, res); + } + }; + let req = info.httpModule.request(info.options, (msg) => { + let res = new HttpClientResponse(msg); + handleResult(null, res); + }); + req.on('socket', sock => { + socket = sock; + }); + // If we ever get disconnected, we want the socket to timeout eventually + req.setTimeout(this._socketTimeout || 3 * 60000, () => { + if (socket) { + socket.end(); + } + handleResult(new Error('Request timeout: ' + info.options.path), null); + }); + req.on('error', function (err) { + // err has statusCode property + // res should have headers + handleResult(err, null); + }); + if (data && typeof data === 'string') { + req.write(data, 'utf8'); + } + if (data && typeof data !== 'string') { + data.on('close', function () { + req.end(); + }); + data.pipe(req); + } + else { + req.end(); + } } - - if (cookies.length === 0) { - return cb(null); + /** + * Gets an http agent. This function is useful when you need an http agent that handles + * routing through a proxy server - depending upon the url and proxy environment variables. + * @param serverUrl The server URL where the request will be sent. For example, https://api.github.com + */ + getAgent(serverUrl) { + let parsedUrl = new URL(serverUrl); + return this._getAgent(parsedUrl); } - - var completedCount = 0; - var removeErrors = []; - - function removeCookieCb(removeErr) { - if (removeErr) { - removeErrors.push(removeErr); - } - - completedCount++; - - if (completedCount === cookies.length) { - return cb(removeErrors.length ? removeErrors[0] : null); - } + _prepareRequest(method, requestUrl, headers) { + const info = {}; + info.parsedUrl = requestUrl; + const usingSsl = info.parsedUrl.protocol === 'https:'; + info.httpModule = usingSsl ? https : http; + const defaultPort = usingSsl ? 443 : 80; + info.options = {}; + info.options.host = info.parsedUrl.hostname; + info.options.port = info.parsedUrl.port + ? parseInt(info.parsedUrl.port) + : defaultPort; + info.options.path = + (info.parsedUrl.pathname || '') + (info.parsedUrl.search || ''); + info.options.method = method; + info.options.headers = this._mergeHeaders(headers); + if (this.userAgent != null) { + info.options.headers['user-agent'] = this.userAgent; + } + info.options.agent = this._getAgent(info.parsedUrl); + // gives handlers an opportunity to participate + if (this.handlers) { + this.handlers.forEach(handler => { + handler.prepareRequest(info.options); + }); + } + return info; } - - cookies.forEach(function(cookie) { - store.removeCookie(cookie.domain, cookie.path, cookie.key, removeCookieCb); - }); - }); -}; - -CookieJar.prototype._cloneSync = syncWrap('clone'); -CookieJar.prototype.cloneSync = function(newStore) { - if (!newStore.synchronous) { - throw new Error('CookieJar clone destination store is not synchronous; use async API instead.'); - } - return this._cloneSync(newStore); -}; - -// Use a closure to provide a true imperative API for synchronous stores. -function syncWrap(method) { - return function() { - if (!this.store.synchronous) { - throw new Error('CookieJar store is not synchronous; use async API instead.'); + _mergeHeaders(headers) { + const lowercaseKeys = obj => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {}); + if (this.requestOptions && this.requestOptions.headers) { + return Object.assign({}, lowercaseKeys(this.requestOptions.headers), lowercaseKeys(headers)); + } + return lowercaseKeys(headers || {}); } - - var args = Array.prototype.slice.call(arguments); - var syncErr, syncResult; - args.push(function syncCb(err, result) { - syncErr = err; - syncResult = result; - }); - this[method].apply(this, args); - - if (syncErr) { - throw syncErr; + _getExistingOrDefaultHeader(additionalHeaders, header, _default) { + const lowercaseKeys = obj => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {}); + let clientHeader; + if (this.requestOptions && this.requestOptions.headers) { + clientHeader = lowercaseKeys(this.requestOptions.headers)[header]; + } + return additionalHeaders[header] || clientHeader || _default; + } + _getAgent(parsedUrl) { + let agent; + let proxyUrl = pm.getProxyUrl(parsedUrl); + let useProxy = proxyUrl && proxyUrl.hostname; + if (this._keepAlive && useProxy) { + agent = this._proxyAgent; + } + if (this._keepAlive && !useProxy) { + agent = this._agent; + } + // if agent is already assigned use that agent. + if (!!agent) { + return agent; + } + const usingSsl = parsedUrl.protocol === 'https:'; + let maxSockets = 100; + if (!!this.requestOptions) { + maxSockets = this.requestOptions.maxSockets || http.globalAgent.maxSockets; + } + if (useProxy) { + // If using proxy, need tunnel + if (!tunnel) { + tunnel = __webpack_require__(413); + } + const agentOptions = { + maxSockets: maxSockets, + keepAlive: this._keepAlive, + proxy: { + proxyAuth: `${proxyUrl.username}:${proxyUrl.password}`, + host: proxyUrl.hostname, + port: proxyUrl.port + } + }; + let tunnelAgent; + const overHttps = proxyUrl.protocol === 'https:'; + if (usingSsl) { + tunnelAgent = overHttps ? tunnel.httpsOverHttps : tunnel.httpsOverHttp; + } + else { + tunnelAgent = overHttps ? tunnel.httpOverHttps : tunnel.httpOverHttp; + } + agent = tunnelAgent(agentOptions); + this._proxyAgent = agent; + } + // if reusing agent across request and tunneling agent isn't assigned create a new agent + if (this._keepAlive && !agent) { + const options = { keepAlive: this._keepAlive, maxSockets: maxSockets }; + agent = usingSsl ? new https.Agent(options) : new http.Agent(options); + this._agent = agent; + } + // if not using private agent and tunnel agent isn't setup then use global agent + if (!agent) { + agent = usingSsl ? https.globalAgent : http.globalAgent; + } + if (usingSsl && this._ignoreSslError) { + // we don't want to set NODE_TLS_REJECT_UNAUTHORIZED=0 since that will affect request for entire process + // http.RequestOptions doesn't expose a way to modify RequestOptions.agent.options + // we have to cast it to any and change it directly + agent.options = Object.assign(agent.options || {}, { + rejectUnauthorized: false + }); + } + return agent; + } + _performExponentialBackoff(retryNumber) { + retryNumber = Math.min(ExponentialBackoffCeiling, retryNumber); + const ms = ExponentialBackoffTimeSlice * Math.pow(2, retryNumber); + return new Promise(resolve => setTimeout(() => resolve(), ms)); + } + static dateTimeDeserializer(key, value) { + if (typeof value === 'string') { + let a = new Date(value); + if (!isNaN(a.valueOf())) { + return a; + } + } + return value; + } + async _processResponse(res, options) { + return new Promise(async (resolve, reject) => { + const statusCode = res.message.statusCode; + const response = { + statusCode: statusCode, + result: null, + headers: {} + }; + // not found leads to null obj returned + if (statusCode == HttpCodes.NotFound) { + resolve(response); + } + let obj; + let contents; + // get the result from the body + try { + contents = await res.readBody(); + if (contents && contents.length > 0) { + if (options && options.deserializeDates) { + obj = JSON.parse(contents, HttpClient.dateTimeDeserializer); + } + else { + obj = JSON.parse(contents); + } + response.result = obj; + } + response.headers = res.message.headers; + } + catch (err) { + // Invalid resource (contents not json); leaving result obj null + } + // note that 3xx redirects are handled by the http layer. + if (statusCode > 299) { + let msg; + // if exception/error in body, attempt to get better error + if (obj && obj.message) { + msg = obj.message; + } + else if (contents && contents.length > 0) { + // it may be the case that the exception is in the body message as string + msg = contents; + } + else { + msg = 'Failed request: (' + statusCode + ')'; + } + let err = new HttpClientError(msg, statusCode); + err.result = response.result; + reject(err); + } + else { + resolve(response); + } + }); } - return syncResult; - }; } - -// wrap all declared CAN_BE_SYNC methods in the sync wrapper -CAN_BE_SYNC.forEach(function(method) { - CookieJar.prototype[method+'Sync'] = syncWrap(method); -}); - -exports.version = VERSION; -exports.CookieJar = CookieJar; -exports.Cookie = Cookie; -exports.Store = Store; -exports.MemoryCookieStore = MemoryCookieStore; -exports.parseDate = parseDate; -exports.formatDate = formatDate; -exports.parse = parse; -exports.fromJSON = fromJSON; -exports.domainMatch = domainMatch; -exports.defaultPath = defaultPath; -exports.pathMatch = pathMatch; -exports.getPublicSuffix = pubsuffix.getPublicSuffix; -exports.cookieCompare = cookieCompare; -exports.permuteDomain = __webpack_require__(467).permuteDomain; -exports.permutePath = permutePath; -exports.canonicalDomain = canonicalDomain; +exports.HttpClient = HttpClient; /***/ }), -/* 237 */, -/* 238 */, -/* 239 */, -/* 240 */, -/* 241 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2018 Joyent, Inc. -module.exports = { - read: read, - write: write -}; +/***/ 605: +/***/ (function(module) { -var assert = __webpack_require__(477); -var Buffer = __webpack_require__(215).Buffer; -var utils = __webpack_require__(270); -var Key = __webpack_require__(852); -var PrivateKey = __webpack_require__(502); - -var pem = __webpack_require__(268); -var ssh = __webpack_require__(603); -var rfc4253 = __webpack_require__(538); -var dnssec = __webpack_require__(982); -var putty = __webpack_require__(624); - -var DNSSEC_PRIVKEY_HEADER_PREFIX = 'Private-key-format: v1'; - -function read(buf, options) { - if (typeof (buf) === 'string') { - if (buf.trim().match(/^[-]+[ ]*BEGIN/)) - return (pem.read(buf, options)); - if (buf.match(/^\s*ssh-[a-z]/)) - return (ssh.read(buf, options)); - if (buf.match(/^\s*ecdsa-/)) - return (ssh.read(buf, options)); - if (buf.match(/^putty-user-key-file-2:/i)) - return (putty.read(buf, options)); - if (findDNSSECHeader(buf)) - return (dnssec.read(buf, options)); - buf = Buffer.from(buf, 'binary'); - } else { - assert.buffer(buf); - if (findPEMHeader(buf)) - return (pem.read(buf, options)); - if (findSSHHeader(buf)) - return (ssh.read(buf, options)); - if (findPuTTYHeader(buf)) - return (putty.read(buf, options)); - if (findDNSSECHeader(buf)) - return (dnssec.read(buf, options)); - } - if (buf.readUInt32BE(0) < buf.length) - return (rfc4253.read(buf, options)); - throw (new Error('Failed to auto-detect format of key')); -} +module.exports = require("http"); -function findPuTTYHeader(buf) { - var offset = 0; - while (offset < buf.length && - (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) - ++offset; - if (offset + 22 <= buf.length && - buf.slice(offset, offset + 22).toString('ascii').toLowerCase() === - 'putty-user-key-file-2:') - return (true); - return (false); -} +/***/ }), -function findSSHHeader(buf) { - var offset = 0; - while (offset < buf.length && - (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) - ++offset; - if (offset + 4 <= buf.length && - buf.slice(offset, offset + 4).toString('ascii') === 'ssh-') - return (true); - if (offset + 6 <= buf.length && - buf.slice(offset, offset + 6).toString('ascii') === 'ecdsa-') - return (true); - return (false); -} +/***/ 614: +/***/ (function(module) { -function findPEMHeader(buf) { - var offset = 0; - while (offset < buf.length && - (buf[offset] === 32 || buf[offset] === 10)) - ++offset; - if (buf[offset] !== 45) - return (false); - while (offset < buf.length && - (buf[offset] === 45)) - ++offset; - while (offset < buf.length && - (buf[offset] === 32)) - ++offset; - if (offset + 5 > buf.length || - buf.slice(offset, offset + 5).toString('ascii') !== 'BEGIN') - return (false); - return (true); -} +module.exports = require("events"); -function findDNSSECHeader(buf) { - // private case first - if (buf.length <= DNSSEC_PRIVKEY_HEADER_PREFIX.length) - return (false); - var headerCheck = buf.slice(0, DNSSEC_PRIVKEY_HEADER_PREFIX.length); - if (headerCheck.toString('ascii') === DNSSEC_PRIVKEY_HEADER_PREFIX) - return (true); - - // public-key RFC3110 ? - // 'domain.com. IN KEY ...' or 'domain.com. IN DNSKEY ...' - // skip any comment-lines - if (typeof (buf) !== 'string') { - buf = buf.toString('ascii'); - } - var lines = buf.split('\n'); - var line = 0; - /* JSSTYLED */ - while (lines[line].match(/^\;/)) - line++; - if (lines[line].toString('ascii').match(/\. IN KEY /)) - return (true); - if (lines[line].toString('ascii').match(/\. IN DNSKEY /)) - return (true); - return (false); -} +/***/ }), -function write(key, options) { - throw (new Error('"auto" format cannot be used for writing')); -} +/***/ 622: +/***/ (function(module) { +module.exports = require("path"); /***/ }), -/* 242 */ -/***/ (function(module, exports) { -(function(){ - - // Copyright (c) 2005 Tom Wu - // All Rights Reserved. - // See "LICENSE" for details. - - // Basic JavaScript BN library - subset useful for RSA encryption. +/***/ 631: +/***/ (function(module) { - // Bits per digit - var dbits; +module.exports = require("net"); - // JavaScript engine analysis - var canary = 0xdeadbeefcafe; - var j_lm = ((canary&0xffffff)==0xefcafe); +/***/ }), - // (public) Constructor - function BigInteger(a,b,c) { - if(a != null) - if("number" == typeof a) this.fromNumber(a,b,c); - else if(b == null && "string" != typeof a) this.fromString(a,256); - else this.fromString(a,b); - } +/***/ 669: +/***/ (function(module) { - // return new, unset BigInteger - function nbi() { return new BigInteger(null); } - - // am: Compute w_j += (x*this_i), propagate carries, - // c is initial carry, returns final carry. - // c < 3*dvalue, x < 2*dvalue, this_i < dvalue - // We need to select the fastest one that works in this environment. - - // am1: use a single mult and divide to get the high bits, - // max digit bits should be 26 because - // max internal value = 2*dvalue^2-2*dvalue (< 2^53) - function am1(i,x,w,j,c,n) { - while(--n >= 0) { - var v = x*this[i++]+w[j]+c; - c = Math.floor(v/0x4000000); - w[j++] = v&0x3ffffff; - } - return c; - } - // am2 avoids a big mult-and-extract completely. - // Max digit bits should be <= 30 because we do bitwise ops - // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) - function am2(i,x,w,j,c,n) { - var xl = x&0x7fff, xh = x>>15; - while(--n >= 0) { - var l = this[i]&0x7fff; - var h = this[i++]>>15; - var m = xh*l+h*xl; - l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); - c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); - w[j++] = l&0x3fffffff; - } - return c; - } - // Alternately, set max digit bits to 28 since some - // browsers slow down when dealing with 32-bit numbers. - function am3(i,x,w,j,c,n) { - var xl = x&0x3fff, xh = x>>14; - while(--n >= 0) { - var l = this[i]&0x3fff; - var h = this[i++]>>14; - var m = xh*l+h*xl; - l = xl*l+((m&0x3fff)<<14)+w[j]+c; - c = (l>>28)+(m>>14)+xh*h; - w[j++] = l&0xfffffff; - } - return c; - } - var inBrowser = typeof navigator !== "undefined"; - if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { - BigInteger.prototype.am = am2; - dbits = 30; - } - else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { - BigInteger.prototype.am = am1; - dbits = 26; - } - else { // Mozilla/Netscape seems to prefer am3 - BigInteger.prototype.am = am3; - dbits = 28; - } +module.exports = require("util"); - BigInteger.prototype.DB = dbits; - BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; - r.t = this.t; - r.s = this.s; - } +/***/ 672: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - // (protected) set from integer value x, -DV <= x < DV - function bnpFromInt(x) { - this.t = 1; - this.s = (x<0)?-1:0; - if(x > 0) this[0] = x; - else if(x < -1) this[0] = x+this.DV; - else this.t = 0; - } +"use strict"; - // return bigint initialized to value - function nbv(i) { var r = nbi(); r.fromInt(i); return r; } - - // (protected) set from string and radix - function bnpFromString(s,b) { - var k; - if(b == 16) k = 4; - else if(b == 8) k = 3; - else if(b == 256) k = 8; // byte array - else if(b == 2) k = 1; - else if(b == 32) k = 5; - else if(b == 4) k = 2; - else { this.fromRadix(s,b); return; } - this.t = 0; - this.s = 0; - var i = s.length, mi = false, sh = 0; - while(--i >= 0) { - var x = (k==8)?s[i]&0xff:intAt(s,i); - if(x < 0) { - if(s.charAt(i) == "-") mi = true; - continue; - } - mi = false; - if(sh == 0) - this[this.t++] = x; - else if(sh+k > this.DB) { - this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +var _a; +Object.defineProperty(exports, "__esModule", { value: true }); +const assert_1 = __webpack_require__(357); +const fs = __webpack_require__(747); +const path = __webpack_require__(622); +_a = fs.promises, exports.chmod = _a.chmod, exports.copyFile = _a.copyFile, exports.lstat = _a.lstat, exports.mkdir = _a.mkdir, exports.readdir = _a.readdir, exports.readlink = _a.readlink, exports.rename = _a.rename, exports.rmdir = _a.rmdir, exports.stat = _a.stat, exports.symlink = _a.symlink, exports.unlink = _a.unlink; +exports.IS_WINDOWS = process.platform === 'win32'; +function exists(fsPath) { + return __awaiter(this, void 0, void 0, function* () { + try { + yield exports.stat(fsPath); } - else - this[this.t-1] |= x<= this.DB) sh -= this.DB; - } - if(k == 8 && (s[0]&0x80) != 0) { - this.s = -1; - if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0 && this[this.t-1] == c) --this.t; + if (exports.IS_WINDOWS) { + return (p.startsWith('\\') || /^[A-Z]:/i.test(p) // e.g. \ or \hello or \\hello + ); // e.g. C: or C:\hello } - - // (public) return string representation in given radix - function bnToString(b) { - if(this.s < 0) return "-"+this.negate().toString(b); - var k; - if(b == 16) k = 4; - else if(b == 8) k = 3; - else if(b == 2) k = 1; - else if(b == 32) k = 5; - else if(b == 4) k = 2; - else return this.toRadix(b); - var km = (1< 0) { - if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } - while(i >= 0) { - if(p < k) { - d = (this[i]&((1<>(p+=this.DB-k); - } - else { - d = (this[i]>>(p-=k))&km; - if(p <= 0) { p += this.DB; --i; } - } - if(d > 0) m = true; - if(m) r += int2char(d); + return p.startsWith('/'); +} +exports.isRooted = isRooted; +/** + * Recursively create a directory at `fsPath`. + * + * This implementation is optimistic, meaning it attempts to create the full + * path first, and backs up the path stack from there. + * + * @param fsPath The path to create + * @param maxDepth The maximum recursion depth + * @param depth The current recursion depth + */ +function mkdirP(fsPath, maxDepth = 1000, depth = 1) { + return __awaiter(this, void 0, void 0, function* () { + assert_1.ok(fsPath, 'a path argument must be provided'); + fsPath = path.resolve(fsPath); + if (depth >= maxDepth) + return exports.mkdir(fsPath); + try { + yield exports.mkdir(fsPath); + return; } - } - return m?r:"0"; + catch (err) { + switch (err.code) { + case 'ENOENT': { + yield mkdirP(path.dirname(fsPath), maxDepth, depth + 1); + yield exports.mkdir(fsPath); + return; + } + default: { + let stats; + try { + stats = yield exports.stat(fsPath); + } + catch (err2) { + throw err; + } + if (!stats.isDirectory()) + throw err; + } + } + } + }); +} +exports.mkdirP = mkdirP; +/** + * Best effort attempt to determine whether a file exists and is executable. + * @param filePath file path to check + * @param extensions additional file extensions to try + * @return if file exists and is executable, returns the file path. otherwise empty string. + */ +function tryGetExecutablePath(filePath, extensions) { + return __awaiter(this, void 0, void 0, function* () { + let stats = undefined; + try { + // test file exists + stats = yield exports.stat(filePath); + } + catch (err) { + if (err.code !== 'ENOENT') { + // eslint-disable-next-line no-console + console.log(`Unexpected error attempting to determine if executable file exists '${filePath}': ${err}`); + } + } + if (stats && stats.isFile()) { + if (exports.IS_WINDOWS) { + // on Windows, test for valid extension + const upperExt = path.extname(filePath).toUpperCase(); + if (extensions.some(validExt => validExt.toUpperCase() === upperExt)) { + return filePath; + } + } + else { + if (isUnixExecutable(stats)) { + return filePath; + } + } + } + // try each extension + const originalFilePath = filePath; + for (const extension of extensions) { + filePath = originalFilePath + extension; + stats = undefined; + try { + stats = yield exports.stat(filePath); + } + catch (err) { + if (err.code !== 'ENOENT') { + // eslint-disable-next-line no-console + console.log(`Unexpected error attempting to determine if executable file exists '${filePath}': ${err}`); + } + } + if (stats && stats.isFile()) { + if (exports.IS_WINDOWS) { + // preserve the case of the actual file (since an extension was appended) + try { + const directory = path.dirname(filePath); + const upperName = path.basename(filePath).toUpperCase(); + for (const actualName of yield exports.readdir(directory)) { + if (upperName === actualName.toUpperCase()) { + filePath = path.join(directory, actualName); + break; + } + } + } + catch (err) { + // eslint-disable-next-line no-console + console.log(`Unexpected error attempting to determine the actual case of the file '${filePath}': ${err}`); + } + return filePath; + } + else { + if (isUnixExecutable(stats)) { + return filePath; + } + } + } + } + return ''; + }); +} +exports.tryGetExecutablePath = tryGetExecutablePath; +function normalizeSeparators(p) { + p = p || ''; + if (exports.IS_WINDOWS) { + // convert slashes on Windows + p = p.replace(/\//g, '\\'); + // remove redundant slashes + return p.replace(/\\\\+/g, '\\'); } + // remove redundant slashes + return p.replace(/\/\/+/g, '/'); +} +// on Mac/Linux, test the execute bit +// R W X R W X R W X +// 256 128 64 32 16 8 4 2 1 +function isUnixExecutable(stats) { + return ((stats.mode & 1) > 0 || + ((stats.mode & 8) > 0 && stats.gid === process.getgid()) || + ((stats.mode & 64) > 0 && stats.uid === process.getuid())); +} +//# sourceMappingURL=io-util.js.map - // (public) -this - function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } - - // (public) |this| - function bnAbs() { return (this.s<0)?this.negate():this; } - - // (public) return + if this > a, - if this < a, 0 if equal - function bnCompareTo(a) { - var r = this.s-a.s; - if(r != 0) return r; - var i = this.t; - r = i-a.t; - if(r != 0) return (this.s<0)?-r:r; - while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; - return 0; - } +/***/ }), - // returns bit length of the integer x - function nbits(x) { - var r = 1, t; - if((t=x>>>16) != 0) { x = t; r += 16; } - if((t=x>>8) != 0) { x = t; r += 8; } - if((t=x>>4) != 0) { x = t; r += 4; } - if((t=x>>2) != 0) { x = t; r += 2; } - if((t=x>>1) != 0) { x = t; r += 1; } - return r; - } +/***/ 692: +/***/ (function(__unusedmodule, exports) { - // (public) return the number of bits in "this" - function bnBitLength() { - if(this.t <= 0) return 0; - return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); - } +"use strict"; - // (protected) r = this << n*DB - function bnpDLShiftTo(n,r) { - var i; - for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; - for(i = n-1; i >= 0; --i) r[i] = 0; - r.t = this.t+n; - r.s = this.s; - } - // (protected) r = this >> n*DB - function bnpDRShiftTo(n,r) { - for(var i = n; i < this.t; ++i) r[i-n] = this[i]; - r.t = Math.max(this.t-n,0); - r.s = this.s; - } +Object.defineProperty(exports, '__esModule', { value: true }); - // (protected) r = this << n - function bnpLShiftTo(n,r) { - var bs = n%this.DB; - var cbs = this.DB-bs; - var bm = (1<= 0; --i) { - r[i+ds+1] = (this[i]>>cbs)|c; - c = (this[i]&bm)<= 0; --i) r[i] = 0; - r[ds] = c; - r.t = this.t+ds+1; - r.s = this.s; - r.clamp(); - } +class Deprecation extends Error { + constructor(message) { + super(message); // Maintains proper stack trace (only available on V8) - // (protected) r = this >> n - function bnpRShiftTo(n,r) { - r.s = this.s; - var ds = Math.floor(n/this.DB); - if(ds >= this.t) { r.t = 0; return; } - var bs = n%this.DB; - var cbs = this.DB-bs; - var bm = (1<>bs; - for(var i = ds+1; i < this.t; ++i) { - r[i-ds-1] |= (this[i]&bm)<>bs; - } - if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; - } - if(a.t < this.t) { - c -= a.s; - while(i < this.t) { - c += this[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += this.s; - } - else { - c += this.s; - while(i < a.t) { - c -= a[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c -= a.s; - } - r.s = (c<0)?-1:0; - if(c < -1) r[i++] = this.DV+c; - else if(c > 0) r[i++] = c; - r.t = i; - r.clamp(); + if (Error.captureStackTrace) { + Error.captureStackTrace(this, this.constructor); } - // (protected) r = this * a, r != this,a (HAC 14.12) - // "this" should be the larger one if appropriate. - function bnpMultiplyTo(a,r) { - var x = this.abs(), y = a.abs(); - var i = x.t; - r.t = i+y.t; - while(--i >= 0) r[i] = 0; - for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); - r.s = 0; - r.clamp(); - if(this.s != a.s) BigInteger.ZERO.subTo(r,r); - } + this.name = 'Deprecation'; + } - // (protected) r = this^2, r != this (HAC 14.16) - function bnpSquareTo(r) { - var x = this.abs(); - var i = r.t = 2*x.t; - while(--i >= 0) r[i] = 0; - for(i = 0; i < x.t-1; ++i) { - var c = x.am(i,x[i],r,2*i,0,1); - if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { - r[i+x.t] -= x.DV; - r[i+x.t+1] = 1; - } - } - if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); - r.s = 0; - r.clamp(); - } +} - // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) - // r != q, this != m. q or r may be null. - function bnpDivRemTo(m,q,r) { - var pm = m.abs(); - if(pm.t <= 0) return; - var pt = this.abs(); - if(pt.t < pm.t) { - if(q != null) q.fromInt(0); - if(r != null) this.copyTo(r); - return; - } - if(r == null) r = nbi(); - var y = nbi(), ts = this.s, ms = m.s; - var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus - if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } - else { pm.copyTo(y); pt.copyTo(r); } - var ys = y.t; - var y0 = y[ys-1]; - if(y0 == 0) return; - var yt = y0*(1<1)?y[ys-2]>>this.F2:0); - var d1 = this.FV/yt, d2 = (1<= 0) { - r[r.t++] = 1; - r.subTo(t,r); - } - BigInteger.ONE.dlShiftTo(ys,t); - t.subTo(y,y); // "negative" y so we can replace sub with am later - while(y.t < ys) y[y.t++] = 0; - while(--j >= 0) { - // Estimate quotient digit - var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); - if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out - y.dlShiftTo(j,t); - r.subTo(t,r); - while(r[i] < --qd) r.subTo(t,r); - } - } - if(q != null) { - r.drShiftTo(ys,q); - if(ts != ms) BigInteger.ZERO.subTo(q,q); - } - r.t = ys; - r.clamp(); - if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder - if(ts < 0) BigInteger.ZERO.subTo(r,r); - } +exports.Deprecation = Deprecation; - // (public) this mod a - function bnMod(a) { - var r = nbi(); - this.abs().divRemTo(a,null,r); - if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); - return r; - } - // Modular reduction using "classic" algorithm - function Classic(m) { this.m = m; } - function cConvert(x) { - if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); - else return x; - } - function cRevert(x) { return x; } - function cReduce(x) { x.divRemTo(this.m,null,x); } - function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - Classic.prototype.convert = cConvert; - Classic.prototype.revert = cRevert; - Classic.prototype.reduce = cReduce; - Classic.prototype.mulTo = cMulTo; - Classic.prototype.sqrTo = cSqrTo; - - // (protected) return "-1/this % 2^DB"; useful for Mont. reduction - // justification: - // xy == 1 (mod m) - // xy = 1+km - // xy(2-xy) = (1+km)(1-km) - // x[y(2-xy)] = 1-k^2m^2 - // x[y(2-xy)] == 1 (mod m^2) - // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 - // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. - // JS multiply "overflows" differently from C/C++, so care is needed here. - function bnpInvDigit() { - if(this.t < 1) return 0; - var x = this[0]; - if((x&1) == 0) return 0; - var y = x&3; // y == 1/x mod 2^2 - y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 - y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 - y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 - // last step - calculate inverse mod DV directly; - // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints - y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits - // we really want the negative inverse, and -DV < y < DV - return (y>0)?this.DV-y:-y; - } +/***/ }), - // Montgomery reduction - function Montgomery(m) { - this.m = m; - this.mp = m.invDigit(); - this.mpl = this.mp&0x7fff; - this.mph = this.mp>>15; - this.um = (1<<(m.DB-15))-1; - this.mt2 = 2*m.t; - } +/***/ 701: +/***/ (function(__unusedmodule, exports) { - // xR mod m - function montConvert(x) { - var r = nbi(); - x.abs().dlShiftTo(this.m.t,r); - r.divRemTo(this.m,null,r); - if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); - return r; - } +"use strict"; - // x/R mod m - function montRevert(x) { - var r = nbi(); - x.copyTo(r); - this.reduce(r); - return r; - } - // x = x/R mod m (HAC 14.32) - function montReduce(x) { - while(x.t <= this.mt2) // pad x so am has enough room later - x[x.t++] = 0; - for(var i = 0; i < this.m.t; ++i) { - // faster way of calculating u0 = x[i]*mp mod DV - var j = x[i]&0x7fff; - var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; - // use am to combine the multiply-shift-add into one call - j = i+this.m.t; - x[j] += this.m.am(0,u0,x,i,0,this.m.t); - // propagate carry - while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } - } - x.clamp(); - x.drShiftTo(this.m.t,x); - if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); - } +Object.defineProperty(exports, '__esModule', { value: true }); - // r = "x^2/R mod m"; x != r - function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - // r = "xy/R mod m"; x,y != r - function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - - Montgomery.prototype.convert = montConvert; - Montgomery.prototype.revert = montRevert; - Montgomery.prototype.reduce = montReduce; - Montgomery.prototype.mulTo = montMulTo; - Montgomery.prototype.sqrTo = montSqrTo; - - // (protected) true iff this is even - function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } - - // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) - function bnpExp(e,z) { - if(e > 0xffffffff || e < 1) return BigInteger.ONE; - var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; - g.copyTo(r); - while(--i >= 0) { - z.sqrTo(r,r2); - if((e&(1< 0) z.mulTo(r2,g,r); - else { var t = r; r = r2; r2 = t; } - } - return z.revert(r); - } +/*! + * is-plain-object + * + * Copyright (c) 2014-2017, Jon Schlinkert. + * Released under the MIT License. + */ - // (public) this^e % m, 0 <= e < 2^32 - function bnModPowInt(e,m) { - var z; - if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); - return this.exp(e,z); - } +function isObject(o) { + return Object.prototype.toString.call(o) === '[object Object]'; +} - // protected - BigInteger.prototype.copyTo = bnpCopyTo; - BigInteger.prototype.fromInt = bnpFromInt; - BigInteger.prototype.fromString = bnpFromString; - BigInteger.prototype.clamp = bnpClamp; - BigInteger.prototype.dlShiftTo = bnpDLShiftTo; - BigInteger.prototype.drShiftTo = bnpDRShiftTo; - BigInteger.prototype.lShiftTo = bnpLShiftTo; - BigInteger.prototype.rShiftTo = bnpRShiftTo; - BigInteger.prototype.subTo = bnpSubTo; - BigInteger.prototype.multiplyTo = bnpMultiplyTo; - BigInteger.prototype.squareTo = bnpSquareTo; - BigInteger.prototype.divRemTo = bnpDivRemTo; - BigInteger.prototype.invDigit = bnpInvDigit; - BigInteger.prototype.isEven = bnpIsEven; - BigInteger.prototype.exp = bnpExp; - - // public - BigInteger.prototype.toString = bnToString; - BigInteger.prototype.negate = bnNegate; - BigInteger.prototype.abs = bnAbs; - BigInteger.prototype.compareTo = bnCompareTo; - BigInteger.prototype.bitLength = bnBitLength; - BigInteger.prototype.mod = bnMod; - BigInteger.prototype.modPowInt = bnModPowInt; - - // "constants" - BigInteger.ZERO = nbv(0); - BigInteger.ONE = nbv(1); - - // Copyright (c) 2005-2009 Tom Wu - // All Rights Reserved. - // See "LICENSE" for details. - - // Extended JavaScript BN functions, required for RSA private ops. - - // Version 1.1: new BigInteger("0", 10) returns "proper" zero - // Version 1.2: square() API, isProbablePrime fix - - // (public) - function bnClone() { var r = nbi(); this.copyTo(r); return r; } - - // (public) return value as integer - function bnIntValue() { - if(this.s < 0) { - if(this.t == 1) return this[0]-this.DV; - else if(this.t == 0) return -1; - } - else if(this.t == 1) return this[0]; - else if(this.t == 0) return 0; - // assumes 16 < DB < 32 - return ((this[1]&((1<<(32-this.DB))-1))<>24; } + if (isObject(o) === false) return false; - // (public) return value as short (assumes DB>=16) - function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } + // If has modified constructor + ctor = o.constructor; + if (ctor === undefined) return true; - // (protected) return x s.t. r^x < DV - function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } + // If has modified prototype + prot = ctor.prototype; + if (isObject(prot) === false) return false; - // (public) 0 if this == 0, 1 if this > 0 - function bnSigNum() { - if(this.s < 0) return -1; - else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; - else return 1; - } + // If constructor does not have an Object-specific method + if (prot.hasOwnProperty('isPrototypeOf') === false) { + return false; + } - // (protected) convert to radix string - function bnpToRadix(b) { - if(b == null) b = 10; - if(this.signum() == 0 || b < 2 || b > 36) return "0"; - var cs = this.chunkSize(b); - var a = Math.pow(b,cs); - var d = nbv(a), y = nbi(), z = nbi(), r = ""; - this.divRemTo(d,y,z); - while(y.signum() > 0) { - r = (a+z.intValue()).toString(b).substr(1) + r; - y.divRemTo(d,y,z); - } - return z.intValue().toString(b) + r; - } + // Most likely a plain Object + return true; +} - // (protected) convert from radix string - function bnpFromRadix(s,b) { - this.fromInt(0); - if(b == null) b = 10; - var cs = this.chunkSize(b); - var d = Math.pow(b,cs), mi = false, j = 0, w = 0; - for(var i = 0; i < s.length; ++i) { - var x = intAt(s,i); - if(x < 0) { - if(s.charAt(i) == "-" && this.signum() == 0) mi = true; - continue; - } - w = b*w+x; - if(++j >= cs) { - this.dMultiply(d); - this.dAddOffset(w,0); - j = 0; - w = 0; - } - } - if(j > 0) { - this.dMultiply(Math.pow(b,j)); - this.dAddOffset(w,0); - } - if(mi) BigInteger.ZERO.subTo(this,this); - } +exports.isPlainObject = isPlainObject; - // (protected) alternate constructor - function bnpFromNumber(a,b,c) { - if("number" == typeof b) { - // new BigInteger(int,int,RNG) - if(a < 2) this.fromInt(1); - else { - this.fromNumber(a,c); - if(!this.testBit(a-1)) // force MSB set - this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); - if(this.isEven()) this.dAddOffset(1,0); // force odd - while(!this.isProbablePrime(b)) { - this.dAddOffset(2,0); - if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); - } - } - } - else { - // new BigInteger(int,RNG) - var x = new Array(), t = a&7; - x.length = (a>>3)+1; - b.nextBytes(x); - if(t > 0) x[0] &= ((1< 0) { - if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) - r[k++] = d|(this.s<<(this.DB-p)); - while(i >= 0) { - if(p < 8) { - d = (this[i]&((1<>(p+=this.DB-8); - } - else { - d = (this[i]>>(p-=8))&0xff; - if(p <= 0) { p += this.DB; --i; } - } - if((d&0x80) != 0) d |= -256; - if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; - if(k > 0 || d != this.s) r[k++] = d; - } - } - return r; - } +/***/ }), - function bnEquals(a) { return(this.compareTo(a)==0); } - function bnMin(a) { return(this.compareTo(a)<0)?this:a; } - function bnMax(a) { return(this.compareTo(a)>0)?this:a; } - - // (protected) r = this op a (bitwise) - function bnpBitwiseTo(a,op,r) { - var i, f, m = Math.min(a.t,this.t); - for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); - if(a.t < this.t) { - f = a.s&this.DM; - for(i = m; i < this.t; ++i) r[i] = op(this[i],f); - r.t = this.t; - } - else { - f = this.s&this.DM; - for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); - r.t = a.t; - } - r.s = op(this.s,a.s); - r.clamp(); - } +/***/ 747: +/***/ (function(module) { - // (public) this & a - function op_and(x,y) { return x&y; } - function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } - - // (public) this | a - function op_or(x,y) { return x|y; } - function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } - - // (public) this ^ a - function op_xor(x,y) { return x^y; } - function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } - - // (public) this & ~a - function op_andnot(x,y) { return x&~y; } - function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } - - // (public) ~this - function bnNot() { - var r = nbi(); - for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; - r.t = this.t; - r.s = ~this.s; - return r; - } +module.exports = require("fs"); - // (public) this << n - function bnShiftLeft(n) { - var r = nbi(); - if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); - return r; - } +/***/ }), - // (public) this >> n - function bnShiftRight(n) { - var r = nbi(); - if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); - return r; - } +/***/ 753: +/***/ (function(__unusedmodule, exports, __webpack_require__) { - // return index of lowest 1-bit in x, x < 2^31 - function lbit(x) { - if(x == 0) return -1; - var r = 0; - if((x&0xffff) == 0) { x >>= 16; r += 16; } - if((x&0xff) == 0) { x >>= 8; r += 8; } - if((x&0xf) == 0) { x >>= 4; r += 4; } - if((x&3) == 0) { x >>= 2; r += 2; } - if((x&1) == 0) ++r; - return r; - } +"use strict"; - // (public) returns index of lowest 1-bit (or -1 if none) - function bnGetLowestSetBit() { - for(var i = 0; i < this.t; ++i) - if(this[i] != 0) return i*this.DB+lbit(this[i]); - if(this.s < 0) return this.t*this.DB; - return -1; - } - // return number of 1 bits in x - function cbit(x) { - var r = 0; - while(x != 0) { x &= x-1; ++r; } - return r; - } +Object.defineProperty(exports, '__esModule', { value: true }); - // (public) return number of set bits - function bnBitCount() { - var r = 0, x = this.s&this.DM; - for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); - return r; - } +function _interopDefault (ex) { return (ex && (typeof ex === 'object') && 'default' in ex) ? ex['default'] : ex; } - // (public) true iff nth bit is set - function bnTestBit(n) { - var j = Math.floor(n/this.DB); - if(j >= this.t) return(this.s!=0); - return((this[j]&(1<<(n%this.DB)))!=0); - } +var endpoint = __webpack_require__(385); +var universalUserAgent = __webpack_require__(796); +var isPlainObject = __webpack_require__(701); +var nodeFetch = _interopDefault(__webpack_require__(454)); +var requestError = __webpack_require__(463); - // (protected) this op (1< { + url = response.url; + status = response.status; - // (protected) r = this + a - function bnpAddTo(a,r) { - var i = 0, c = 0, m = Math.min(a.t,this.t); - while(i < m) { - c += this[i]+a[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - if(a.t < this.t) { - c += a.s; - while(i < this.t) { - c += this[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += this.s; - } - else { - c += this.s; - while(i < a.t) { - c += a[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += a.s; - } - r.s = (c<0)?-1:0; - if(c > 0) r[i++] = c; - else if(c < -1) r[i++] = this.DV+c; - r.t = i; - r.clamp(); + for (const keyAndValue of response.headers) { + headers[keyAndValue[0]] = keyAndValue[1]; } - // (public) this + a - function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } - - // (public) this - a - function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } - - // (public) this * a - function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } - - // (public) this^2 - function bnSquare() { var r = nbi(); this.squareTo(r); return r; } + if (status === 204 || status === 205) { + return; + } // GitHub API returns 200 for HEAD requests - // (public) this / a - function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } - // (public) this % a - function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } + if (requestOptions.method === "HEAD") { + if (status < 400) { + return; + } - // (public) [this/a,this%a] - function bnDivideAndRemainder(a) { - var q = nbi(), r = nbi(); - this.divRemTo(a,q,r); - return new Array(q,r); + throw new requestError.RequestError(response.statusText, status, { + headers, + request: requestOptions + }); } - // (protected) this *= n, this >= 0, 1 < n < DV - function bnpDMultiply(n) { - this[this.t] = this.am(0,n-1,this,0,0,this.t); - ++this.t; - this.clamp(); + if (status === 304) { + throw new requestError.RequestError("Not modified", status, { + headers, + request: requestOptions + }); } - // (protected) this += n << w words, this >= 0 - function bnpDAddOffset(n,w) { - if(n == 0) return; - while(this.t <= w) this[this.t++] = 0; - this[w] += n; - while(this[w] >= this.DV) { - this[w] -= this.DV; - if(++w >= this.t) this[this.t++] = 0; - ++this[w]; - } - } + if (status >= 400) { + return response.text().then(message => { + const error = new requestError.RequestError(message, status, { + headers, + request: requestOptions + }); - // A "null" reducer - function NullExp() {} - function nNop(x) { return x; } - function nMulTo(x,y,r) { x.multiplyTo(y,r); } - function nSqrTo(x,r) { x.squareTo(r); } - - NullExp.prototype.convert = nNop; - NullExp.prototype.revert = nNop; - NullExp.prototype.mulTo = nMulTo; - NullExp.prototype.sqrTo = nSqrTo; - - // (public) this^e - function bnPow(e) { return this.exp(e,new NullExp()); } - - // (protected) r = lower n words of "this * a", a.t <= n - // "this" should be the larger one if appropriate. - function bnpMultiplyLowerTo(a,n,r) { - var i = Math.min(this.t+a.t,n); - r.s = 0; // assumes a,this >= 0 - r.t = i; - while(i > 0) r[--i] = 0; - var j; - for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); - for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); - r.clamp(); - } + try { + let responseBody = JSON.parse(error.message); + Object.assign(error, responseBody); + let errors = responseBody.errors; // Assumption `errors` would always be in Array format - // (protected) r = "this * a" without lower n words, n > 0 - // "this" should be the larger one if appropriate. - function bnpMultiplyUpperTo(a,n,r) { - --n; - var i = r.t = this.t+a.t-n; - r.s = 0; // assumes a,this >= 0 - while(--i >= 0) r[i] = 0; - for(i = Math.max(n-this.t,0); i < a.t; ++i) - r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); - r.clamp(); - r.drShiftTo(1,r); - } + error.message = error.message + ": " + errors.map(JSON.stringify).join(", "); + } catch (e) {// ignore, see octokit/rest.js#684 + } - // Barrett modular reduction - function Barrett(m) { - // setup Barrett - this.r2 = nbi(); - this.q3 = nbi(); - BigInteger.ONE.dlShiftTo(2*m.t,this.r2); - this.mu = this.r2.divide(m); - this.m = m; + throw error; + }); } - function barrettConvert(x) { - if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); - else if(x.compareTo(this.m) < 0) return x; - else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } + const contentType = response.headers.get("content-type"); + + if (/application\/json/.test(contentType)) { + return response.json(); } - function barrettRevert(x) { return x; } - - // x = x mod m (HAC 14.42) - function barrettReduce(x) { - x.drShiftTo(this.m.t-1,this.r2); - if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } - this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); - this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); - while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); - x.subTo(this.r2,x); - while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); + if (!contentType || /^text\/|charset=utf-8$/.test(contentType)) { + return response.text(); } - // r = x^2 mod m; x != r - function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - // r = x*y mod m; x,y != r - function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - - Barrett.prototype.convert = barrettConvert; - Barrett.prototype.revert = barrettRevert; - Barrett.prototype.reduce = barrettReduce; - Barrett.prototype.mulTo = barrettMulTo; - Barrett.prototype.sqrTo = barrettSqrTo; - - // (public) this^e % m (HAC 14.85) - function bnModPow(e,m) { - var i = e.bitLength(), k, r = nbv(1), z; - if(i <= 0) return r; - else if(i < 18) k = 1; - else if(i < 48) k = 3; - else if(i < 144) k = 4; - else if(i < 768) k = 5; - else k = 6; - if(i < 8) - z = new Classic(m); - else if(m.isEven()) - z = new Barrett(m); - else - z = new Montgomery(m); - - // precomputation - var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { - var g2 = nbi(); - z.sqrTo(g[1],g2); - while(n <= km) { - g[n] = nbi(); - z.mulTo(g2,g[n-2],g[n]); - n += 2; - } - } + return getBufferResponse(response); + }).then(data => { + return { + status, + url, + headers, + data + }; + }).catch(error => { + if (error instanceof requestError.RequestError) { + throw error; + } - var j = e.t-1, w, is1 = true, r2 = nbi(), t; - i = nbits(e[j])-1; - while(j >= 0) { - if(i >= k1) w = (e[j]>>(i-k1))&km; - else { - w = (e[j]&((1<<(i+1))-1))<<(k1-i); - if(j > 0) w |= e[j-1]>>(this.DB+i-k1); - } + throw new requestError.RequestError(error.message, 500, { + headers, + request: requestOptions + }); + }); +} - n = k; - while((w&1) == 0) { w >>= 1; --n; } - if((i -= n) < 0) { i += this.DB; --j; } - if(is1) { // ret == 1, don't bother squaring or multiplying it - g[w].copyTo(r); - is1 = false; - } - else { - while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } - if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } - z.mulTo(r2,g[w],r); - } +function withDefaults(oldEndpoint, newDefaults) { + const endpoint = oldEndpoint.defaults(newDefaults); - while(j >= 0 && (e[j]&(1< 0) { - x.rShiftTo(g,x); - y.rShiftTo(g,y); - } - while(x.signum() > 0) { - if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); - if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); - if(x.compareTo(y) >= 0) { - x.subTo(y,x); - x.rShiftTo(1,x); - } - else { - y.subTo(x,y); - y.rShiftTo(1,y); - } - } - if(g > 0) y.lShiftTo(g,y); - return y; + if (!endpointOptions.request || !endpointOptions.request.hook) { + return fetchWrapper(endpoint.parse(endpointOptions)); } - // (protected) this % n, n < 2^26 - function bnpModInt(n) { - if(n <= 0) return 0; - var d = this.DV%n, r = (this.s<0)?n-1:0; - if(this.t > 0) - if(d == 0) r = this[0]%n; - else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; - return r; - } + const request = (route, parameters) => { + return fetchWrapper(endpoint.parse(endpoint.merge(route, parameters))); + }; - // (public) 1/this % m (HAC 14.61) - function bnModInverse(m) { - var ac = m.isEven(); - if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; - var u = m.clone(), v = this.clone(); - var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); - while(u.signum() != 0) { - while(u.isEven()) { - u.rShiftTo(1,u); - if(ac) { - if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } - a.rShiftTo(1,a); - } - else if(!b.isEven()) b.subTo(m,b); - b.rShiftTo(1,b); - } - while(v.isEven()) { - v.rShiftTo(1,v); - if(ac) { - if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } - c.rShiftTo(1,c); - } - else if(!d.isEven()) d.subTo(m,d); - d.rShiftTo(1,d); - } - if(u.compareTo(v) >= 0) { - u.subTo(v,u); - if(ac) a.subTo(c,a); - b.subTo(d,b); - } - else { - v.subTo(u,v); - if(ac) c.subTo(a,c); - d.subTo(b,d); - } - } - if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; - if(d.compareTo(m) >= 0) return d.subtract(m); - if(d.signum() < 0) d.addTo(m,d); else return d; - if(d.signum() < 0) return d.add(m); else return d; - } + Object.assign(request, { + endpoint, + defaults: withDefaults.bind(null, endpoint) + }); + return endpointOptions.request.hook(request, endpointOptions); + }; - var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; - var lplim = (1<<26)/lowprimes[lowprimes.length-1]; + return Object.assign(newApi, { + endpoint, + defaults: withDefaults.bind(null, endpoint) + }); +} - // (public) test primality with certainty >= 1-.5^t - function bnIsProbablePrime(t) { - var i, x = this.abs(); - if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { - for(i = 0; i < lowprimes.length; ++i) - if(x[0] == lowprimes[i]) return true; - return false; - } - if(x.isEven()) return false; - i = 1; - while(i < lowprimes.length) { - var m = lowprimes[i], j = i+1; - while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; - m = x.modInt(m); - while(i < j) if(m%lowprimes[i++] == 0) return false; - } - return x.millerRabin(t); - } +const request = withDefaults(endpoint.endpoint, { + headers: { + "user-agent": `octokit-request.js/${VERSION} ${universalUserAgent.getUserAgent()}` + } +}); - // (protected) true if probably prime (HAC 4.24, Miller-Rabin) - function bnpMillerRabin(t) { - var n1 = this.subtract(BigInteger.ONE); - var k = n1.getLowestSetBit(); - if(k <= 0) return false; - var r = n1.shiftRight(k); - t = (t+1)>>1; - if(t > lowprimes.length) t = lowprimes.length; - var a = nbi(); - for(var i = 0; i < t; ++i) { - //Pick bases at random, instead of starting at 2 - a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); - var y = a.modPow(r,this); - if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { - var j = 1; - while(j++ < k && y.compareTo(n1) != 0) { - y = y.modPowInt(2,this); - if(y.compareTo(BigInteger.ONE) == 0) return false; - } - if(y.compareTo(n1) != 0) return false; - } - } - return true; - } +exports.request = request; +//# sourceMappingURL=index.js.map - // protected - BigInteger.prototype.chunkSize = bnpChunkSize; - BigInteger.prototype.toRadix = bnpToRadix; - BigInteger.prototype.fromRadix = bnpFromRadix; - BigInteger.prototype.fromNumber = bnpFromNumber; - BigInteger.prototype.bitwiseTo = bnpBitwiseTo; - BigInteger.prototype.changeBit = bnpChangeBit; - BigInteger.prototype.addTo = bnpAddTo; - BigInteger.prototype.dMultiply = bnpDMultiply; - BigInteger.prototype.dAddOffset = bnpDAddOffset; - BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; - BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; - BigInteger.prototype.modInt = bnpModInt; - BigInteger.prototype.millerRabin = bnpMillerRabin; - - // public - BigInteger.prototype.clone = bnClone; - BigInteger.prototype.intValue = bnIntValue; - BigInteger.prototype.byteValue = bnByteValue; - BigInteger.prototype.shortValue = bnShortValue; - BigInteger.prototype.signum = bnSigNum; - BigInteger.prototype.toByteArray = bnToByteArray; - BigInteger.prototype.equals = bnEquals; - BigInteger.prototype.min = bnMin; - BigInteger.prototype.max = bnMax; - BigInteger.prototype.and = bnAnd; - BigInteger.prototype.or = bnOr; - BigInteger.prototype.xor = bnXor; - BigInteger.prototype.andNot = bnAndNot; - BigInteger.prototype.not = bnNot; - BigInteger.prototype.shiftLeft = bnShiftLeft; - BigInteger.prototype.shiftRight = bnShiftRight; - BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; - BigInteger.prototype.bitCount = bnBitCount; - BigInteger.prototype.testBit = bnTestBit; - BigInteger.prototype.setBit = bnSetBit; - BigInteger.prototype.clearBit = bnClearBit; - BigInteger.prototype.flipBit = bnFlipBit; - BigInteger.prototype.add = bnAdd; - BigInteger.prototype.subtract = bnSubtract; - BigInteger.prototype.multiply = bnMultiply; - BigInteger.prototype.divide = bnDivide; - BigInteger.prototype.remainder = bnRemainder; - BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; - BigInteger.prototype.modPow = bnModPow; - BigInteger.prototype.modInverse = bnModInverse; - BigInteger.prototype.pow = bnPow; - BigInteger.prototype.gcd = bnGCD; - BigInteger.prototype.isProbablePrime = bnIsProbablePrime; - - // JSBN-specific extension - BigInteger.prototype.square = bnSquare; - - // Expose the Barrett function - BigInteger.prototype.Barrett = Barrett - - // BigInteger interfaces not implemented in jsbn: - - // BigInteger(int signum, byte[] magnitude) - // double doubleValue() - // float floatValue() - // int hashCode() - // long longValue() - // static BigInteger valueOf(long val) - - // Random number generator - requires a PRNG backend, e.g. prng4.js - - // For best results, put code like - // - // in your main HTML document. - - var rng_state; - var rng_pool; - var rng_pptr; - - // Mix in a 32-bit integer into the pool - function rng_seed_int(x) { - rng_pool[rng_pptr++] ^= x & 255; - rng_pool[rng_pptr++] ^= (x >> 8) & 255; - rng_pool[rng_pptr++] ^= (x >> 16) & 255; - rng_pool[rng_pptr++] ^= (x >> 24) & 255; - if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; - } - // Mix in the current time (w/milliseconds) into the pool - function rng_seed_time() { - rng_seed_int(new Date().getTime()); - } +/***/ }), - // Initialize the pool with junk if needed. - if(rng_pool == null) { - rng_pool = new Array(); - rng_pptr = 0; - var t; - if(typeof window !== "undefined" && window.crypto) { - if (window.crypto.getRandomValues) { - // Use webcrypto if available - var ua = new Uint8Array(32); - window.crypto.getRandomValues(ua); - for(t = 0; t < 32; ++t) - rng_pool[rng_pptr++] = ua[t]; - } - else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { - // Extract entropy (256 bits) from NS4 RNG if available - var z = window.crypto.random(32); - for(t = 0; t < z.length; ++t) - rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; - } - } - while(rng_pptr < rng_psize) { // extract some randomness from Math.random() - t = Math.floor(65536 * Math.random()); - rng_pool[rng_pptr++] = t >>> 8; - rng_pool[rng_pptr++] = t & 255; - } - rng_pptr = 0; - rng_seed_time(); - //rng_seed_int(window.screenX); - //rng_seed_int(window.screenY); - } +/***/ 761: +/***/ (function(module) { - function rng_get_byte() { - if(rng_state == null) { - rng_seed_time(); - rng_state = prng_newstate(); - rng_state.init(rng_pool); - for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) - rng_pool[rng_pptr] = 0; - rng_pptr = 0; - //rng_pool = null; - } - // TODO: allow reseeding after first request - return rng_state.next(); - } +module.exports = require("zlib"); - function rng_get_bytes(ba) { - var i; - for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); - } +/***/ }), - function SecureRandom() {} +/***/ 794: +/***/ (function(module) { - SecureRandom.prototype.nextBytes = rng_get_bytes; +module.exports = require("stream"); - // prng4.js - uses Arcfour as a PRNG +/***/ }), - function Arcfour() { - this.i = 0; - this.j = 0; - this.S = new Array(); - } +/***/ 796: +/***/ (function(__unusedmodule, exports) { - // Initialize arcfour context from key, an array of ints, each from [0..255] - function ARC4init(key) { - var i, j, t; - for(i = 0; i < 256; ++i) - this.S[i] = i; - j = 0; - for(i = 0; i < 256; ++i) { - j = (j + this.S[i] + key[i % key.length]) & 255; - t = this.S[i]; - this.S[i] = this.S[j]; - this.S[j] = t; - } - this.i = 0; - this.j = 0; - } +"use strict"; - function ARC4next() { - var t; - this.i = (this.i + 1) & 255; - this.j = (this.j + this.S[this.i]) & 255; - t = this.S[this.i]; - this.S[this.i] = this.S[this.j]; - this.S[this.j] = t; - return this.S[(t + this.S[this.i]) & 255]; - } - Arcfour.prototype.init = ARC4init; - Arcfour.prototype.next = ARC4next; +Object.defineProperty(exports, '__esModule', { value: true }); - // Plug in your RNG constructor here - function prng_newstate() { - return new Arcfour(); - } +function getUserAgent() { + if (typeof navigator === "object" && "userAgent" in navigator) { + return navigator.userAgent; + } - // Pool size must be a multiple of 4 and greater than 32. - // An array of bytes the size of the pool will be passed to init() - var rng_psize = 256; + if (typeof process === "object" && "version" in process) { + return `Node.js/${process.version.substr(1)} (${process.platform}; ${process.arch})`; + } - BigInteger.SecureRandom = SecureRandom; - BigInteger.BigInteger = BigInteger; - if (true) { - exports = module.exports = BigInteger; - } else {} + return ""; +} -}).call(this); +exports.getUserAgent = getUserAgent; +//# sourceMappingURL=index.js.map /***/ }), -/* 243 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { + +/***/ 813: +/***/ (function(__unusedmodule, exports) { "use strict"; -var net = __webpack_require__(631) - , tls = __webpack_require__(16) - , http = __webpack_require__(605) - , https = __webpack_require__(211) - , events = __webpack_require__(614) - , assert = __webpack_require__(357) - , util = __webpack_require__(669) - , Buffer = __webpack_require__(149).Buffer - ; +Object.defineProperty(exports, '__esModule', { value: true }); -exports.httpOverHttp = httpOverHttp -exports.httpsOverHttp = httpsOverHttp -exports.httpOverHttps = httpOverHttps -exports.httpsOverHttps = httpsOverHttps +async function auth(token) { + const tokenType = token.split(/\./).length === 3 ? "app" : /^v\d+\./.test(token) ? "installation" : "oauth"; + return { + type: "token", + token: token, + tokenType + }; +} +/** + * Prefix token for usage in the Authorization header + * + * @param token OAuth token or JSON Web Token + */ +function withAuthorizationPrefix(token) { + if (token.split(/\./).length === 3) { + return `bearer ${token}`; + } -function httpOverHttp(options) { - var agent = new TunnelingAgent(options) - agent.request = http.request - return agent + return `token ${token}`; } -function httpsOverHttp(options) { - var agent = new TunnelingAgent(options) - agent.request = http.request - agent.createSocket = createSecureSocket - agent.defaultPort = 443 - return agent +async function hook(token, request, route, parameters) { + const endpoint = request.endpoint.merge(route, parameters); + endpoint.headers.authorization = withAuthorizationPrefix(token); + return request(endpoint); } -function httpOverHttps(options) { - var agent = new TunnelingAgent(options) - agent.request = https.request - return agent -} - -function httpsOverHttps(options) { - var agent = new TunnelingAgent(options) - agent.request = https.request - agent.createSocket = createSecureSocket - agent.defaultPort = 443 - return agent -} - - -function TunnelingAgent(options) { - var self = this - self.options = options || {} - self.proxyOptions = self.options.proxy || {} - self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets - self.requests = [] - self.sockets = [] - - self.on('free', function onFree(socket, host, port) { - for (var i = 0, len = self.requests.length; i < len; ++i) { - var pending = self.requests[i] - if (pending.host === host && pending.port === port) { - // Detect the request to connect same origin server, - // reuse the connection. - self.requests.splice(i, 1) - pending.request.onSocket(socket) - return - } - } - socket.destroy() - self.removeSocket(socket) - }) -} -util.inherits(TunnelingAgent, events.EventEmitter) - -TunnelingAgent.prototype.addRequest = function addRequest(req, options) { - var self = this - - // Legacy API: addRequest(req, host, port, path) - if (typeof options === 'string') { - options = { - host: options, - port: arguments[2], - path: arguments[3] - }; - } - - if (self.sockets.length >= this.maxSockets) { - // We are over limit so we'll add it to the queue. - self.requests.push({host: options.host, port: options.port, request: req}) - return - } - - // If we are under maxSockets create a new one. - self.createConnection({host: options.host, port: options.port, request: req}) -} - -TunnelingAgent.prototype.createConnection = function createConnection(pending) { - var self = this - - self.createSocket(pending, function(socket) { - socket.on('free', onFree) - socket.on('close', onCloseOrRemove) - socket.on('agentRemove', onCloseOrRemove) - pending.request.onSocket(socket) - - function onFree() { - self.emit('free', socket, pending.host, pending.port) - } - - function onCloseOrRemove(err) { - self.removeSocket(socket) - socket.removeListener('free', onFree) - socket.removeListener('close', onCloseOrRemove) - socket.removeListener('agentRemove', onCloseOrRemove) - } - }) -} - -TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { - var self = this - var placeholder = {} - self.sockets.push(placeholder) - - var connectOptions = mergeOptions({}, self.proxyOptions, - { method: 'CONNECT' - , path: options.host + ':' + options.port - , agent: false - } - ) - if (connectOptions.proxyAuth) { - connectOptions.headers = connectOptions.headers || {} - connectOptions.headers['Proxy-Authorization'] = 'Basic ' + - Buffer.from(connectOptions.proxyAuth).toString('base64') - } - - debug('making CONNECT request') - var connectReq = self.request(connectOptions) - connectReq.useChunkedEncodingByDefault = false // for v0.6 - connectReq.once('response', onResponse) // for v0.6 - connectReq.once('upgrade', onUpgrade) // for v0.6 - connectReq.once('connect', onConnect) // for v0.7 or later - connectReq.once('error', onError) - connectReq.end() - - function onResponse(res) { - // Very hacky. This is necessary to avoid http-parser leaks. - res.upgrade = true - } - - function onUpgrade(res, socket, head) { - // Hacky. - process.nextTick(function() { - onConnect(res, socket, head) - }) - } - - function onConnect(res, socket, head) { - connectReq.removeAllListeners() - socket.removeAllListeners() - - if (res.statusCode === 200) { - assert.equal(head.length, 0) - debug('tunneling connection has established') - self.sockets[self.sockets.indexOf(placeholder)] = socket - cb(socket) - } else { - debug('tunneling socket could not be established, statusCode=%d', res.statusCode) - var error = new Error('tunneling socket could not be established, ' + 'statusCode=' + res.statusCode) - error.code = 'ECONNRESET' - options.request.emit('error', error) - self.removeSocket(placeholder) - } - } - - function onError(cause) { - connectReq.removeAllListeners() - - debug('tunneling socket could not be established, cause=%s\n', cause.message, cause.stack) - var error = new Error('tunneling socket could not be established, ' + 'cause=' + cause.message) - error.code = 'ECONNRESET' - options.request.emit('error', error) - self.removeSocket(placeholder) - } -} - -TunnelingAgent.prototype.removeSocket = function removeSocket(socket) { - var pos = this.sockets.indexOf(socket) - if (pos === -1) return - - this.sockets.splice(pos, 1) - - var pending = this.requests.shift() - if (pending) { - // If we have pending requests and a socket gets closed a new one - // needs to be created to take over in the pool for the one that closed. - this.createConnection(pending) - } -} - -function createSecureSocket(options, cb) { - var self = this - TunnelingAgent.prototype.createSocket.call(self, options, function(socket) { - // 0 is dummy port for v0.6 - var secureSocket = tls.connect(0, mergeOptions({}, self.options, - { servername: options.host - , socket: socket - } - )) - self.sockets[self.sockets.indexOf(socket)] = secureSocket - cb(secureSocket) - }) -} - - -function mergeOptions(target) { - for (var i = 1, len = arguments.length; i < len; ++i) { - var overrides = arguments[i] - if (typeof overrides === 'object') { - var keys = Object.keys(overrides) - for (var j = 0, keyLen = keys.length; j < keyLen; ++j) { - var k = keys[j] - if (overrides[k] !== undefined) { - target[k] = overrides[k] - } - } - } +const createTokenAuth = function createTokenAuth(token) { + if (!token) { + throw new Error("[@octokit/auth-token] No token passed to createTokenAuth"); } - return target -} - -var debug -if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) { - debug = function() { - var args = Array.prototype.slice.call(arguments) - if (typeof args[0] === 'string') { - args[0] = 'TUNNEL: ' + args[0] - } else { - args.unshift('TUNNEL:') - } - console.error.apply(console, args) + if (typeof token !== "string") { + throw new Error("[@octokit/auth-token] Token passed to createTokenAuth is not a string"); } -} else { - debug = function() {} -} -exports.debug = debug // for test - - -/***/ }), -/* 244 */, -/* 245 */, -/* 246 */, -/* 247 */, -/* 248 */, -/* 249 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2011 Mark Cavage All rights reserved. - -var errors = __webpack_require__(584); -var types = __webpack_require__(362); - -var Reader = __webpack_require__(733); -var Writer = __webpack_require__(998); - - -// --- Exports - -module.exports = { - - Reader: Reader, - - Writer: Writer + token = token.replace(/^(token|bearer) +/i, ""); + return Object.assign(auth.bind(null, token), { + hook: hook.bind(null, token) + }); }; -for (var t in types) { - if (types.hasOwnProperty(t)) - module.exports[t] = types[t]; -} -for (var e in errors) { - if (errors.hasOwnProperty(e)) - module.exports[e] = errors[e]; -} - - -/***/ }), -/* 250 */, -/* 251 */, -/* 252 */, -/* 253 */, -/* 254 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -/** @license MIT License (c) copyright 2010-2014 original author or authors */ -/** @author Brian Cavalier */ -/** @author John Hann */ - -(function(define) { 'use strict'; -define(function () { - - var makePromise = __webpack_require__(313); - var Scheduler = __webpack_require__(483); - var async = __webpack_require__(709).asap; - - return makePromise({ - scheduler: new Scheduler(async) - }); - -}); -})(typeof define === 'function' && define.amd ? define : function (factory) { module.exports = factory(require); }); +exports.createTokenAuth = createTokenAuth; +//# sourceMappingURL=index.js.map /***/ }), -/* 255 */, -/* 256 */, -/* 257 */, -/* 258 */, -/* 259 */, -/* 260 */, -/* 261 */, -/* 262 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - -Object.defineProperty(exports, "__esModule", { value: true }); -exports.Context = void 0; -const fs_1 = __webpack_require__(747); -const os_1 = __webpack_require__(87); -class Context { - /** - * Hydrate the context from the environment - */ - constructor() { - this.payload = {}; - if (process.env.GITHUB_EVENT_PATH) { - if (fs_1.existsSync(process.env.GITHUB_EVENT_PATH)) { - this.payload = JSON.parse(fs_1.readFileSync(process.env.GITHUB_EVENT_PATH, { encoding: 'utf8' })); - } - else { - const path = process.env.GITHUB_EVENT_PATH; - process.stdout.write(`GITHUB_EVENT_PATH ${path} does not exist${os_1.EOL}`); - } - } - this.eventName = process.env.GITHUB_EVENT_NAME; - this.sha = process.env.GITHUB_SHA; - this.ref = process.env.GITHUB_REF; - this.workflow = process.env.GITHUB_WORKFLOW; - this.action = process.env.GITHUB_ACTION; - this.actor = process.env.GITHUB_ACTOR; - this.job = process.env.GITHUB_JOB; - this.runNumber = parseInt(process.env.GITHUB_RUN_NUMBER, 10); - this.runId = parseInt(process.env.GITHUB_RUN_ID, 10); - } - get issue() { - const payload = this.payload; - return Object.assign(Object.assign({}, this.repo), { number: (payload.issue || payload.pull_request || payload).number }); - } - get repo() { - if (process.env.GITHUB_REPOSITORY) { - const [owner, repo] = process.env.GITHUB_REPOSITORY.split('/'); - return { owner, repo }; - } - if (this.payload.repository) { - return { - owner: this.payload.repository.owner.login, - repo: this.payload.repository.name - }; - } - throw new Error("context.repo requires a GITHUB_REPOSITORY environment variable like 'owner/repo'"); - } -} -exports.Context = Context; -//# sourceMappingURL=context.js.map -/***/ }), -/* 263 */, -/* 264 */, -/* 265 */, -/* 266 */ +/***/ 835: /***/ (function(module) { -"use strict"; - -module.exports = function generate_ref(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $async, $refCode; - if ($schema == '#' || $schema == '#/') { - if (it.isRoot) { - $async = it.async; - $refCode = 'validate'; - } else { - $async = it.root.schema.$async === true; - $refCode = 'root.refVal[0]'; - } - } else { - var $refVal = it.resolveRef(it.baseId, $schema, it.isRoot); - if ($refVal === undefined) { - var $message = it.MissingRefError.message(it.baseId, $schema); - if (it.opts.missingRefs == 'fail') { - it.logger.error($message); - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('$ref') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { ref: \'' + (it.util.escapeQuotes($schema)) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'can\\\'t resolve reference ' + (it.util.escapeQuotes($schema)) + '\' '; - } - if (it.opts.verbose) { - out += ' , schema: ' + (it.util.toQuotedString($schema)) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - if ($breakOnError) { - out += ' if (false) { '; - } - } else if (it.opts.missingRefs == 'ignore') { - it.logger.warn($message); - if ($breakOnError) { - out += ' if (true) { '; - } - } else { - throw new it.MissingRefError(it.baseId, $schema, $message); - } - } else if ($refVal.inline) { - var $it = it.util.copy(it); - $it.level++; - var $nextValid = 'valid' + $it.level; - $it.schema = $refVal.schema; - $it.schemaPath = ''; - $it.errSchemaPath = $schema; - var $code = it.validate($it).replace(/validate\.schema/g, $refVal.code); - out += ' ' + ($code) + ' '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - } - } else { - $async = $refVal.$async === true || (it.async && $refVal.$async !== false); - $refCode = $refVal.code; - } - } - if ($refCode) { - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; - if (it.opts.passContext) { - out += ' ' + ($refCode) + '.call(this, '; - } else { - out += ' ' + ($refCode) + '( '; - } - out += ' ' + ($data) + ', (dataPath || \'\')'; - if (it.errorPath != '""') { - out += ' + ' + (it.errorPath); - } - var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', - $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; - out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ', rootData) '; - var __callValidate = out; - out = $$outStack.pop(); - if ($async) { - if (!it.async) throw new Error('async schema referenced by sync schema'); - if ($breakOnError) { - out += ' var ' + ($valid) + '; '; - } - out += ' try { await ' + (__callValidate) + '; '; - if ($breakOnError) { - out += ' ' + ($valid) + ' = true; '; - } - out += ' } catch (e) { if (!(e instanceof ValidationError)) throw e; if (vErrors === null) vErrors = e.errors; else vErrors = vErrors.concat(e.errors); errors = vErrors.length; '; - if ($breakOnError) { - out += ' ' + ($valid) + ' = false; '; - } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($valid) + ') { '; - } - } else { - out += ' if (!' + (__callValidate) + ') { if (vErrors === null) vErrors = ' + ($refCode) + '.errors; else vErrors = vErrors.concat(' + ($refCode) + '.errors); errors = vErrors.length; } '; - if ($breakOnError) { - out += ' else { '; - } - } - } - return out; -} - +module.exports = require("url"); /***/ }), -/* 267 */, -/* 268 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2018 Joyent, Inc. -module.exports = { - read: read, - write: write -}; - -var assert = __webpack_require__(477); -var asn1 = __webpack_require__(62); -var crypto = __webpack_require__(417); -var Buffer = __webpack_require__(215).Buffer; -var algs = __webpack_require__(98); -var utils = __webpack_require__(270); -var Key = __webpack_require__(852); -var PrivateKey = __webpack_require__(502); - -var pkcs1 = __webpack_require__(449); -var pkcs8 = __webpack_require__(707); -var sshpriv = __webpack_require__(78); -var rfc4253 = __webpack_require__(538); - -var errors = __webpack_require__(753); - -var OID_PBES2 = '1.2.840.113549.1.5.13'; -var OID_PBKDF2 = '1.2.840.113549.1.5.12'; - -var OID_TO_CIPHER = { - '1.2.840.113549.3.7': '3des-cbc', - '2.16.840.1.101.3.4.1.2': 'aes128-cbc', - '2.16.840.1.101.3.4.1.42': 'aes256-cbc' -}; -var CIPHER_TO_OID = {}; -Object.keys(OID_TO_CIPHER).forEach(function (k) { - CIPHER_TO_OID[OID_TO_CIPHER[k]] = k; -}); - -var OID_TO_HASH = { - '1.2.840.113549.2.7': 'sha1', - '1.2.840.113549.2.9': 'sha256', - '1.2.840.113549.2.11': 'sha512' -}; -var HASH_TO_OID = {}; -Object.keys(OID_TO_HASH).forEach(function (k) { - HASH_TO_OID[OID_TO_HASH[k]] = k; -}); - -/* - * For reading we support both PKCS#1 and PKCS#8. If we find a private key, - * we just take the public component of it and use that. - */ -function read(buf, options, forceType) { - var input = buf; - if (typeof (buf) !== 'string') { - assert.buffer(buf, 'buf'); - buf = buf.toString('ascii'); - } - - var lines = buf.trim().split(/[\r\n]+/g); - - var m; - var si = -1; - while (!m && si < lines.length) { - m = lines[++si].match(/*JSSTYLED*/ - /[-]+[ ]*BEGIN ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); - } - assert.ok(m, 'invalid PEM header'); - - var m2; - var ei = lines.length; - while (!m2 && ei > 0) { - m2 = lines[--ei].match(/*JSSTYLED*/ - /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); - } - assert.ok(m2, 'invalid PEM footer'); - - /* Begin and end banners must match key type */ - assert.equal(m[2], m2[2]); - var type = m[2].toLowerCase(); - - var alg; - if (m[1]) { - /* They also must match algorithms, if given */ - assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); - alg = m[1].trim(); - } - - lines = lines.slice(si, ei + 1); - - var headers = {}; - while (true) { - lines = lines.slice(1); - m = lines[0].match(/*JSSTYLED*/ - /^([A-Za-z0-9-]+): (.+)$/); - if (!m) - break; - headers[m[1].toLowerCase()] = m[2]; - } - - /* Chop off the first and last lines */ - lines = lines.slice(0, -1).join(''); - buf = Buffer.from(lines, 'base64'); - - var cipher, key, iv; - if (headers['proc-type']) { - var parts = headers['proc-type'].split(','); - if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { - if (typeof (options.passphrase) === 'string') { - options.passphrase = Buffer.from( - options.passphrase, 'utf-8'); - } - if (!Buffer.isBuffer(options.passphrase)) { - throw (new errors.KeyEncryptedError( - options.filename, 'PEM')); - } else { - parts = headers['dek-info'].split(','); - assert.ok(parts.length === 2); - cipher = parts[0].toLowerCase(); - iv = Buffer.from(parts[1], 'hex'); - key = utils.opensslKeyDeriv(cipher, iv, - options.passphrase, 1).key; - } - } - } +/***/ 842: +/***/ (function(__unusedmodule, exports) { - if (alg && alg.toLowerCase() === 'encrypted') { - var eder = new asn1.BerReader(buf); - var pbesEnd; - eder.readSequence(); +"use strict"; - eder.readSequence(); - pbesEnd = eder.offset + eder.length; - var method = eder.readOID(); - if (method !== OID_PBES2) { - throw (new Error('Unsupported PEM/PKCS8 encryption ' + - 'scheme: ' + method)); - } +Object.defineProperty(exports, '__esModule', { value: true }); - eder.readSequence(); /* PBES2-params */ - - eder.readSequence(); /* keyDerivationFunc */ - var kdfEnd = eder.offset + eder.length; - var kdfOid = eder.readOID(); - if (kdfOid !== OID_PBKDF2) - throw (new Error('Unsupported PBES2 KDF: ' + kdfOid)); - eder.readSequence(); - var salt = eder.readString(asn1.Ber.OctetString, true); - var iterations = eder.readInt(); - var hashAlg = 'sha1'; - if (eder.offset < kdfEnd) { - eder.readSequence(); - var hashAlgOid = eder.readOID(); - hashAlg = OID_TO_HASH[hashAlgOid]; - if (hashAlg === undefined) { - throw (new Error('Unsupported PBKDF2 hash: ' + - hashAlgOid)); - } - } - eder._offset = kdfEnd; - - eder.readSequence(); /* encryptionScheme */ - var cipherOid = eder.readOID(); - cipher = OID_TO_CIPHER[cipherOid]; - if (cipher === undefined) { - throw (new Error('Unsupported PBES2 cipher: ' + - cipherOid)); - } - iv = eder.readString(asn1.Ber.OctetString, true); - - eder._offset = pbesEnd; - buf = eder.readString(asn1.Ber.OctetString, true); - - if (typeof (options.passphrase) === 'string') { - options.passphrase = Buffer.from( - options.passphrase, 'utf-8'); - } - if (!Buffer.isBuffer(options.passphrase)) { - throw (new errors.KeyEncryptedError( - options.filename, 'PEM')); - } - - var cinfo = utils.opensshCipherInfo(cipher); - - cipher = cinfo.opensslName; - key = utils.pbkdf2(hashAlg, salt, iterations, cinfo.keySize, - options.passphrase); - alg = undefined; - } - - if (cipher && key && iv) { - var cipherStream = crypto.createDecipheriv(cipher, key, iv); - var chunk, chunks = []; - cipherStream.once('error', function (e) { - if (e.toString().indexOf('bad decrypt') !== -1) { - throw (new Error('Incorrect passphrase ' + - 'supplied, could not decrypt key')); - } - throw (e); - }); - cipherStream.write(buf); - cipherStream.end(); - while ((chunk = cipherStream.read()) !== null) - chunks.push(chunk); - buf = Buffer.concat(chunks); - } - - /* The new OpenSSH internal format abuses PEM headers */ - if (alg && alg.toLowerCase() === 'openssh') - return (sshpriv.readSSHPrivate(type, buf, options)); - if (alg && alg.toLowerCase() === 'ssh2') - return (rfc4253.readType(type, buf, options)); - - var der = new asn1.BerReader(buf); - der.originalInput = input; - - /* - * All of the PEM file types start with a sequence tag, so chop it - * off here - */ - der.readSequence(); - - /* PKCS#1 type keys name an algorithm in the banner explicitly */ - if (alg) { - if (forceType) - assert.strictEqual(forceType, 'pkcs1'); - return (pkcs1.readPkcs1(alg, type, der)); - } else { - if (forceType) - assert.strictEqual(forceType, 'pkcs8'); - return (pkcs8.readPkcs8(alg, type, der)); - } -} - -function write(key, options, type) { - assert.object(key); - - var alg = { - 'ecdsa': 'EC', - 'rsa': 'RSA', - 'dsa': 'DSA', - 'ed25519': 'EdDSA' - }[key.type]; - var header; - - var der = new asn1.BerWriter(); - - if (PrivateKey.isPrivateKey(key)) { - if (type && type === 'pkcs8') { - header = 'PRIVATE KEY'; - pkcs8.writePkcs8(der, key); - } else { - if (type) - assert.strictEqual(type, 'pkcs1'); - header = alg + ' PRIVATE KEY'; - pkcs1.writePkcs1(der, key); - } - - } else if (Key.isKey(key)) { - if (type && type === 'pkcs1') { - header = alg + ' PUBLIC KEY'; - pkcs1.writePkcs1(der, key); - } else { - if (type) - assert.strictEqual(type, 'pkcs8'); - header = 'PUBLIC KEY'; - pkcs8.writePkcs8(der, key); - } - - } else { - throw (new Error('key is not a Key or PrivateKey')); - } - - var tmp = der.buffer.toString('base64'); - var len = tmp.length + (tmp.length / 64) + - 18 + 16 + header.length*2 + 10; - var buf = Buffer.alloc(len); - var o = 0; - o += buf.write('-----BEGIN ' + header + '-----\n', o); - for (var i = 0; i < tmp.length; ) { - var limit = i + 64; - if (limit > tmp.length) - limit = tmp.length; - o += buf.write(tmp.slice(i, limit), o); - buf[o++] = 10; - i = limit; - } - o += buf.write('-----END ' + header + '-----\n', o); - - return (buf.slice(0, o)); -} - - -/***/ }), -/* 269 */, -/* 270 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - bufferSplit: bufferSplit, - addRSAMissing: addRSAMissing, - calculateDSAPublic: calculateDSAPublic, - calculateED25519Public: calculateED25519Public, - calculateX25519Public: calculateX25519Public, - mpNormalize: mpNormalize, - mpDenormalize: mpDenormalize, - ecNormalize: ecNormalize, - countZeros: countZeros, - assertCompatible: assertCompatible, - isCompatible: isCompatible, - opensslKeyDeriv: opensslKeyDeriv, - opensshCipherInfo: opensshCipherInfo, - publicFromPrivateECDSA: publicFromPrivateECDSA, - zeroPadToLength: zeroPadToLength, - writeBitString: writeBitString, - readBitString: readBitString, - pbkdf2: pbkdf2 -}; - -var assert = __webpack_require__(477); -var Buffer = __webpack_require__(215).Buffer; -var PrivateKey = __webpack_require__(502); -var Key = __webpack_require__(852); -var crypto = __webpack_require__(417); -var algs = __webpack_require__(98); -var asn1 = __webpack_require__(62); - -var ec = __webpack_require__(729); -var jsbn = __webpack_require__(242).BigInteger; -var nacl = __webpack_require__(196); - -var MAX_CLASS_DEPTH = 3; - -function isCompatible(obj, klass, needVer) { - if (obj === null || typeof (obj) !== 'object') - return (false); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return (true); - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - if (!proto || ++depth > MAX_CLASS_DEPTH) - return (false); - } - if (proto.constructor.name !== klass.name) - return (false); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - if (ver[0] != needVer[0] || ver[1] < needVer[1]) - return (false); - return (true); -} - -function assertCompatible(obj, klass, needVer, name) { - if (name === undefined) - name = 'object'; - assert.ok(obj, name + ' must not be null'); - assert.object(obj, name + ' must be an object'); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return; - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, - name + ' must be a ' + klass.name + ' instance'); - } - assert.strictEqual(proto.constructor.name, klass.name, - name + ' must be a ' + klass.name + ' instance'); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], - name + ' must be compatible with ' + klass.name + ' klass ' + - 'version ' + needVer[0] + '.' + needVer[1]); -} - -var CIPHER_LEN = { - 'des-ede3-cbc': { key: 24, iv: 8 }, - 'aes-128-cbc': { key: 16, iv: 16 }, - 'aes-256-cbc': { key: 32, iv: 16 } -}; -var PKCS5_SALT_LEN = 8; - -function opensslKeyDeriv(cipher, salt, passphrase, count) { - assert.buffer(salt, 'salt'); - assert.buffer(passphrase, 'passphrase'); - assert.number(count, 'iteration count'); - - var clen = CIPHER_LEN[cipher]; - assert.object(clen, 'supported cipher'); - - salt = salt.slice(0, PKCS5_SALT_LEN); - - var D, D_prev, bufs; - var material = Buffer.alloc(0); - while (material.length < clen.key + clen.iv) { - bufs = []; - if (D_prev) - bufs.push(D_prev); - bufs.push(passphrase); - bufs.push(salt); - D = Buffer.concat(bufs); - for (var j = 0; j < count; ++j) - D = crypto.createHash('md5').update(D).digest(); - material = Buffer.concat([material, D]); - D_prev = D; - } - - return ({ - key: material.slice(0, clen.key), - iv: material.slice(clen.key, clen.key + clen.iv) - }); -} - -/* See: RFC2898 */ -function pbkdf2(hashAlg, salt, iterations, size, passphrase) { - var hkey = Buffer.alloc(salt.length + 4); - salt.copy(hkey); - - var gen = 0, ts = []; - var i = 1; - while (gen < size) { - var t = T(i++); - gen += t.length; - ts.push(t); - } - return (Buffer.concat(ts).slice(0, size)); - - function T(I) { - hkey.writeUInt32BE(I, hkey.length - 4); - - var hmac = crypto.createHmac(hashAlg, passphrase); - hmac.update(hkey); - - var Ti = hmac.digest(); - var Uc = Ti; - var c = 1; - while (c++ < iterations) { - hmac = crypto.createHmac(hashAlg, passphrase); - hmac.update(Uc); - Uc = hmac.digest(); - for (var x = 0; x < Ti.length; ++x) - Ti[x] ^= Uc[x]; - } - return (Ti); - } -} - -/* Count leading zero bits on a buffer */ -function countZeros(buf) { - var o = 0, obit = 8; - while (o < buf.length) { - var mask = (1 << obit); - if ((buf[o] & mask) === mask) - break; - obit--; - if (obit < 0) { - o++; - obit = 8; - } - } - return (o*8 + (8 - obit) - 1); -} - -function bufferSplit(buf, chr) { - assert.buffer(buf); - assert.string(chr); - - var parts = []; - var lastPart = 0; - var matches = 0; - for (var i = 0; i < buf.length; ++i) { - if (buf[i] === chr.charCodeAt(matches)) - ++matches; - else if (buf[i] === chr.charCodeAt(0)) - matches = 1; - else - matches = 0; - - if (matches >= chr.length) { - var newPart = i + 1; - parts.push(buf.slice(lastPart, newPart - matches)); - lastPart = newPart; - matches = 0; - } - } - if (lastPart <= buf.length) - parts.push(buf.slice(lastPart, buf.length)); - - return (parts); -} - -function ecNormalize(buf, addZero) { - assert.buffer(buf); - if (buf[0] === 0x00 && buf[1] === 0x04) { - if (addZero) - return (buf); - return (buf.slice(1)); - } else if (buf[0] === 0x04) { - if (!addZero) - return (buf); - } else { - while (buf[0] === 0x00) - buf = buf.slice(1); - if (buf[0] === 0x02 || buf[0] === 0x03) - throw (new Error('Compressed elliptic curve points ' + - 'are not supported')); - if (buf[0] !== 0x04) - throw (new Error('Not a valid elliptic curve point')); - if (!addZero) - return (buf); - } - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x0; - buf.copy(b, 1); - return (b); -} - -function readBitString(der, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var buf = der.readString(tag, true); - assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + - 'not supported (0x' + buf[0].toString(16) + ')'); - return (buf.slice(1)); -} - -function writeBitString(der, buf, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - der.writeBuffer(b, tag); -} - -function mpNormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) - buf = buf.slice(1); - if ((buf[0] & 0x80) === 0x80) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function mpDenormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00) - buf = buf.slice(1); - return (buf); -} - -function zeroPadToLength(buf, len) { - assert.buffer(buf); - assert.number(len); - while (buf.length > len) { - assert.equal(buf[0], 0x00); - buf = buf.slice(1); - } - while (buf.length < len) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function bigintToMpBuf(bigint) { - var buf = Buffer.from(bigint.toByteArray()); - buf = mpNormalize(buf); - return (buf); -} - -function calculateDSAPublic(g, p, x) { - assert.buffer(g); - assert.buffer(p); - assert.buffer(x); - g = new jsbn(g); - p = new jsbn(p); - x = new jsbn(x); - var y = g.modPow(x, p); - var ybuf = bigintToMpBuf(y); - return (ybuf); -} - -function calculateED25519Public(k) { - assert.buffer(k); - - var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function calculateX25519Public(k) { - assert.buffer(k); - - var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function addRSAMissing(key) { - assert.object(key); - assertCompatible(key, PrivateKey, [1, 1]); - - var d = new jsbn(key.part.d.data); - var buf; - - if (!key.part.dmodp) { - var p = new jsbn(key.part.p.data); - var dmodp = d.mod(p.subtract(1)); - - buf = bigintToMpBuf(dmodp); - key.part.dmodp = {name: 'dmodp', data: buf}; - key.parts.push(key.part.dmodp); - } - if (!key.part.dmodq) { - var q = new jsbn(key.part.q.data); - var dmodq = d.mod(q.subtract(1)); - - buf = bigintToMpBuf(dmodq); - key.part.dmodq = {name: 'dmodq', data: buf}; - key.parts.push(key.part.dmodq); - } -} - -function publicFromPrivateECDSA(curveName, priv) { - assert.string(curveName, 'curveName'); - assert.buffer(priv); - var params = algs.curves[curveName]; - var p = new jsbn(params.p); - var a = new jsbn(params.a); - var b = new jsbn(params.b); - var curve = new ec.ECCurveFp(p, a, b); - var G = curve.decodePointHex(params.G.toString('hex')); - - var d = new jsbn(mpNormalize(priv)); - var pub = G.multiply(d); - pub = Buffer.from(curve.encodePointHex(pub), 'hex'); - - var parts = []; - parts.push({name: 'curve', data: Buffer.from(curveName)}); - parts.push({name: 'Q', data: pub}); - - var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); - return (key); -} - -function opensshCipherInfo(cipher) { - var inf = {}; - switch (cipher) { - case '3des-cbc': - inf.keySize = 24; - inf.blockSize = 8; - inf.opensslName = 'des-ede3-cbc'; - break; - case 'blowfish-cbc': - inf.keySize = 16; - inf.blockSize = 8; - inf.opensslName = 'bf-cbc'; - break; - case 'aes128-cbc': - case 'aes128-ctr': - case 'aes128-gcm@openssh.com': - inf.keySize = 16; - inf.blockSize = 16; - inf.opensslName = 'aes-128-' + cipher.slice(7, 10); - break; - case 'aes192-cbc': - case 'aes192-ctr': - case 'aes192-gcm@openssh.com': - inf.keySize = 24; - inf.blockSize = 16; - inf.opensslName = 'aes-192-' + cipher.slice(7, 10); - break; - case 'aes256-cbc': - case 'aes256-ctr': - case 'aes256-gcm@openssh.com': - inf.keySize = 32; - inf.blockSize = 16; - inf.opensslName = 'aes-256-' + cipher.slice(7, 10); - break; - default: - throw (new Error( - 'Unsupported openssl cipher "' + cipher + '"')); - } - return (inf); -} - - -/***/ }), -/* 271 */, -/* 272 */, -/* 273 */, -/* 274 */, -/* 275 */, -/* 276 */, -/* 277 */, -/* 278 */, -/* 279 */, -/* 280 */ -/***/ (function(module) { - -/** @license MIT License (c) copyright 2010-2014 original author or authors */ -/** @author Brian Cavalier */ -/** @author John Hann */ - -(function(define) { 'use strict'; -define(function() { - - /** - * Custom error type for promises rejected by promise.timeout - * @param {string} message - * @constructor - */ - function TimeoutError (message) { - Error.call(this); - this.message = message; - this.name = TimeoutError.name; - if (typeof Error.captureStackTrace === 'function') { - Error.captureStackTrace(this, TimeoutError); - } - } - - TimeoutError.prototype = Object.create(Error.prototype); - TimeoutError.prototype.constructor = TimeoutError; - - return TimeoutError; -}); -}(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); - -/***/ }), -/* 281 */ -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_enum(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $i = 'i' + $lvl, - $vSchema = 'schema' + $lvl; - if (!$isData) { - out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + ';'; - } - out += 'var ' + ($valid) + ';'; - if ($isData) { - out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; - } - out += '' + ($valid) + ' = false;for (var ' + ($i) + '=0; ' + ($i) + '<' + ($vSchema) + '.length; ' + ($i) + '++) if (equal(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + '])) { ' + ($valid) + ' = true; break; }'; - if ($isData) { - out += ' } '; - } - out += ' if (!' + ($valid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('enum') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValues: schema' + ($lvl) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be equal to one of the allowed values\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' }'; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), -/* 282 */, -/* 283 */, -/* 284 */, -/* 285 */, -/* 286 */ -/***/ (function(__unusedmodule, exports) { - -// Copyright Joyent, Inc. and other Node contributors. -// -// Permission is hereby granted, free of charge, to any person obtaining a -// copy of this software and associated documentation files (the -// "Software"), to deal in the Software without restriction, including -// without limitation the rights to use, copy, modify, merge, publish, -// distribute, sublicense, and/or sell copies of the Software, and to permit -// persons to whom the Software is furnished to do so, subject to the -// following conditions: -// -// The above copyright notice and this permission notice shall be included -// in all copies or substantial portions of the Software. -// -// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS -// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF -// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN -// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR -// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE -// USE OR OTHER DEALINGS IN THE SOFTWARE. - -// NOTE: These type checking functions intentionally don't use `instanceof` -// because it is fragile and can be easily faked with `Object.create()`. - -function isArray(arg) { - if (Array.isArray) { - return Array.isArray(arg); - } - return objectToString(arg) === '[object Array]'; -} -exports.isArray = isArray; - -function isBoolean(arg) { - return typeof arg === 'boolean'; -} -exports.isBoolean = isBoolean; - -function isNull(arg) { - return arg === null; -} -exports.isNull = isNull; - -function isNullOrUndefined(arg) { - return arg == null; -} -exports.isNullOrUndefined = isNullOrUndefined; - -function isNumber(arg) { - return typeof arg === 'number'; -} -exports.isNumber = isNumber; - -function isString(arg) { - return typeof arg === 'string'; -} -exports.isString = isString; - -function isSymbol(arg) { - return typeof arg === 'symbol'; -} -exports.isSymbol = isSymbol; - -function isUndefined(arg) { - return arg === void 0; -} -exports.isUndefined = isUndefined; - -function isRegExp(re) { - return objectToString(re) === '[object RegExp]'; -} -exports.isRegExp = isRegExp; - -function isObject(arg) { - return typeof arg === 'object' && arg !== null; -} -exports.isObject = isObject; - -function isDate(d) { - return objectToString(d) === '[object Date]'; -} -exports.isDate = isDate; - -function isError(e) { - return (objectToString(e) === '[object Error]' || e instanceof Error); -} -exports.isError = isError; - -function isFunction(arg) { - return typeof arg === 'function'; -} -exports.isFunction = isFunction; - -function isPrimitive(arg) { - return arg === null || - typeof arg === 'boolean' || - typeof arg === 'number' || - typeof arg === 'string' || - typeof arg === 'symbol' || // ES6 symbol - typeof arg === 'undefined'; -} -exports.isPrimitive = isPrimitive; - -exports.isBuffer = Buffer.isBuffer; - -function objectToString(o) { - return Object.prototype.toString.call(o); -} - - -/***/ }), -/* 287 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var url = __webpack_require__(835) -var qs = __webpack_require__(386) -var caseless = __webpack_require__(7) -var uuid = __webpack_require__(826) -var oauth = __webpack_require__(113) -var crypto = __webpack_require__(417) -var Buffer = __webpack_require__(149).Buffer - -function OAuth (request) { - this.request = request - this.params = null -} - -OAuth.prototype.buildParams = function (_oauth, uri, method, query, form, qsLib) { - var oa = {} - for (var i in _oauth) { - oa['oauth_' + i] = _oauth[i] - } - if (!oa.oauth_version) { - oa.oauth_version = '1.0' - } - if (!oa.oauth_timestamp) { - oa.oauth_timestamp = Math.floor(Date.now() / 1000).toString() - } - if (!oa.oauth_nonce) { - oa.oauth_nonce = uuid().replace(/-/g, '') - } - if (!oa.oauth_signature_method) { - oa.oauth_signature_method = 'HMAC-SHA1' - } - - var consumer_secret_or_private_key = oa.oauth_consumer_secret || oa.oauth_private_key // eslint-disable-line camelcase - delete oa.oauth_consumer_secret - delete oa.oauth_private_key - - var token_secret = oa.oauth_token_secret // eslint-disable-line camelcase - delete oa.oauth_token_secret - - var realm = oa.oauth_realm - delete oa.oauth_realm - delete oa.oauth_transport_method - - var baseurl = uri.protocol + '//' + uri.host + uri.pathname - var params = qsLib.parse([].concat(query, form, qsLib.stringify(oa)).join('&')) - - oa.oauth_signature = oauth.sign( - oa.oauth_signature_method, - method, - baseurl, - params, - consumer_secret_or_private_key, // eslint-disable-line camelcase - token_secret // eslint-disable-line camelcase - ) - - if (realm) { - oa.realm = realm - } - - return oa -} - -OAuth.prototype.buildBodyHash = function (_oauth, body) { - if (['HMAC-SHA1', 'RSA-SHA1'].indexOf(_oauth.signature_method || 'HMAC-SHA1') < 0) { - this.request.emit('error', new Error('oauth: ' + _oauth.signature_method + - ' signature_method not supported with body_hash signing.')) - } - - var shasum = crypto.createHash('sha1') - shasum.update(body || '') - var sha1 = shasum.digest('hex') - - return Buffer.from(sha1, 'hex').toString('base64') -} - -OAuth.prototype.concatParams = function (oa, sep, wrap) { - wrap = wrap || '' - - var params = Object.keys(oa).filter(function (i) { - return i !== 'realm' && i !== 'oauth_signature' - }).sort() - - if (oa.realm) { - params.splice(0, 0, 'realm') - } - params.push('oauth_signature') - - return params.map(function (i) { - return i + '=' + wrap + oauth.rfc3986(oa[i]) + wrap - }).join(sep) -} - -OAuth.prototype.onRequest = function (_oauth) { - var self = this - self.params = _oauth - - var uri = self.request.uri || {} - var method = self.request.method || '' - var headers = caseless(self.request.headers) - var body = self.request.body || '' - var qsLib = self.request.qsLib || qs - - var form - var query - var contentType = headers.get('content-type') || '' - var formContentType = 'application/x-www-form-urlencoded' - var transport = _oauth.transport_method || 'header' - - if (contentType.slice(0, formContentType.length) === formContentType) { - contentType = formContentType - form = body - } - if (uri.query) { - query = uri.query - } - if (transport === 'body' && (method !== 'POST' || contentType !== formContentType)) { - self.request.emit('error', new Error('oauth: transport_method of body requires POST ' + - 'and content-type ' + formContentType)) - } - - if (!form && typeof _oauth.body_hash === 'boolean') { - _oauth.body_hash = self.buildBodyHash(_oauth, self.request.body.toString()) - } - - var oa = self.buildParams(_oauth, uri, method, query, form, qsLib) - - switch (transport) { - case 'header': - self.request.setHeader('Authorization', 'OAuth ' + self.concatParams(oa, ',', '"')) - break - - case 'query': - var href = self.request.uri.href += (query ? '&' : '?') + self.concatParams(oa, '&') - self.request.uri = url.parse(href) - self.request.path = self.request.uri.path - break - - case 'body': - self.request.body = (form ? form + '&' : '') + self.concatParams(oa, '&') - break - - default: - self.request.emit('error', new Error('oauth: transport_method invalid')) - } -} - -exports.OAuth = OAuth - - -/***/ }), -/* 288 */, -/* 289 */, -/* 290 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = { - DiffieHellman: DiffieHellman, - generateECDSA: generateECDSA, - generateED25519: generateED25519 -}; - -var assert = __webpack_require__(477); -var crypto = __webpack_require__(417); -var Buffer = __webpack_require__(215).Buffer; -var algs = __webpack_require__(98); -var utils = __webpack_require__(270); -var nacl = __webpack_require__(196); - -var Key = __webpack_require__(852); -var PrivateKey = __webpack_require__(502); - -var CRYPTO_HAVE_ECDH = (crypto.createECDH !== undefined); - -var ecdh = __webpack_require__(886); -var ec = __webpack_require__(729); -var jsbn = __webpack_require__(242).BigInteger; - -function DiffieHellman(key) { - utils.assertCompatible(key, Key, [1, 4], 'key'); - this._isPriv = PrivateKey.isPrivateKey(key, [1, 3]); - this._algo = key.type; - this._curve = key.curve; - this._key = key; - if (key.type === 'dsa') { - if (!CRYPTO_HAVE_ECDH) { - throw (new Error('Due to bugs in the node 0.10 ' + - 'crypto API, node 0.12.x or later is required ' + - 'to use DH')); - } - this._dh = crypto.createDiffieHellman( - key.part.p.data, undefined, - key.part.g.data, undefined); - this._p = key.part.p; - this._g = key.part.g; - if (this._isPriv) - this._dh.setPrivateKey(key.part.x.data); - this._dh.setPublicKey(key.part.y.data); - - } else if (key.type === 'ecdsa') { - if (!CRYPTO_HAVE_ECDH) { - this._ecParams = new X9ECParameters(this._curve); - - if (this._isPriv) { - this._priv = new ECPrivate( - this._ecParams, key.part.d.data); - } - return; - } - - var curve = { - 'nistp256': 'prime256v1', - 'nistp384': 'secp384r1', - 'nistp521': 'secp521r1' - }[key.curve]; - this._dh = crypto.createECDH(curve); - if (typeof (this._dh) !== 'object' || - typeof (this._dh.setPrivateKey) !== 'function') { - CRYPTO_HAVE_ECDH = false; - DiffieHellman.call(this, key); - return; - } - if (this._isPriv) - this._dh.setPrivateKey(key.part.d.data); - this._dh.setPublicKey(key.part.Q.data); - - } else if (key.type === 'curve25519') { - if (this._isPriv) { - utils.assertCompatible(key, PrivateKey, [1, 5], 'key'); - this._priv = key.part.k.data; - } - - } else { - throw (new Error('DH not supported for ' + key.type + ' keys')); - } -} - -DiffieHellman.prototype.getPublicKey = function () { - if (this._isPriv) - return (this._key.toPublic()); - return (this._key); -}; - -DiffieHellman.prototype.getPrivateKey = function () { - if (this._isPriv) - return (this._key); - else - return (undefined); -}; -DiffieHellman.prototype.getKey = DiffieHellman.prototype.getPrivateKey; - -DiffieHellman.prototype._keyCheck = function (pk, isPub) { - assert.object(pk, 'key'); - if (!isPub) - utils.assertCompatible(pk, PrivateKey, [1, 3], 'key'); - utils.assertCompatible(pk, Key, [1, 4], 'key'); - - if (pk.type !== this._algo) { - throw (new Error('A ' + pk.type + ' key cannot be used in ' + - this._algo + ' Diffie-Hellman')); - } - - if (pk.curve !== this._curve) { - throw (new Error('A key from the ' + pk.curve + ' curve ' + - 'cannot be used with a ' + this._curve + - ' Diffie-Hellman')); - } - - if (pk.type === 'dsa') { - assert.deepEqual(pk.part.p, this._p, - 'DSA key prime does not match'); - assert.deepEqual(pk.part.g, this._g, - 'DSA key generator does not match'); - } -}; - -DiffieHellman.prototype.setKey = function (pk) { - this._keyCheck(pk); - - if (pk.type === 'dsa') { - this._dh.setPrivateKey(pk.part.x.data); - this._dh.setPublicKey(pk.part.y.data); - - } else if (pk.type === 'ecdsa') { - if (CRYPTO_HAVE_ECDH) { - this._dh.setPrivateKey(pk.part.d.data); - this._dh.setPublicKey(pk.part.Q.data); - } else { - this._priv = new ECPrivate( - this._ecParams, pk.part.d.data); - } - - } else if (pk.type === 'curve25519') { - var k = pk.part.k; - if (!pk.part.k) - k = pk.part.r; - this._priv = k.data; - if (this._priv[0] === 0x00) - this._priv = this._priv.slice(1); - this._priv = this._priv.slice(0, 32); - } - this._key = pk; - this._isPriv = true; -}; -DiffieHellman.prototype.setPrivateKey = DiffieHellman.prototype.setKey; - -DiffieHellman.prototype.computeSecret = function (otherpk) { - this._keyCheck(otherpk, true); - if (!this._isPriv) - throw (new Error('DH exchange has not been initialized with ' + - 'a private key yet')); - - var pub; - if (this._algo === 'dsa') { - return (this._dh.computeSecret( - otherpk.part.y.data)); - - } else if (this._algo === 'ecdsa') { - if (CRYPTO_HAVE_ECDH) { - return (this._dh.computeSecret( - otherpk.part.Q.data)); - } else { - pub = new ECPublic( - this._ecParams, otherpk.part.Q.data); - return (this._priv.deriveSharedSecret(pub)); - } - - } else if (this._algo === 'curve25519') { - pub = otherpk.part.A.data; - while (pub[0] === 0x00 && pub.length > 32) - pub = pub.slice(1); - var priv = this._priv; - assert.strictEqual(pub.length, 32); - assert.strictEqual(priv.length, 32); - - var secret = nacl.box.before(new Uint8Array(pub), - new Uint8Array(priv)); - - return (Buffer.from(secret)); - } - - throw (new Error('Invalid algorithm: ' + this._algo)); -}; - -DiffieHellman.prototype.generateKey = function () { - var parts = []; - var priv, pub; - if (this._algo === 'dsa') { - this._dh.generateKeys(); - - parts.push({name: 'p', data: this._p.data}); - parts.push({name: 'q', data: this._key.part.q.data}); - parts.push({name: 'g', data: this._g.data}); - parts.push({name: 'y', data: this._dh.getPublicKey()}); - parts.push({name: 'x', data: this._dh.getPrivateKey()}); - this._key = new PrivateKey({ - type: 'dsa', - parts: parts - }); - this._isPriv = true; - return (this._key); - - } else if (this._algo === 'ecdsa') { - if (CRYPTO_HAVE_ECDH) { - this._dh.generateKeys(); - - parts.push({name: 'curve', - data: Buffer.from(this._curve)}); - parts.push({name: 'Q', data: this._dh.getPublicKey()}); - parts.push({name: 'd', data: this._dh.getPrivateKey()}); - this._key = new PrivateKey({ - type: 'ecdsa', - curve: this._curve, - parts: parts - }); - this._isPriv = true; - return (this._key); - - } else { - var n = this._ecParams.getN(); - var r = new jsbn(crypto.randomBytes(n.bitLength())); - var n1 = n.subtract(jsbn.ONE); - priv = r.mod(n1).add(jsbn.ONE); - pub = this._ecParams.getG().multiply(priv); - - priv = Buffer.from(priv.toByteArray()); - pub = Buffer.from(this._ecParams.getCurve(). - encodePointHex(pub), 'hex'); - - this._priv = new ECPrivate(this._ecParams, priv); - - parts.push({name: 'curve', - data: Buffer.from(this._curve)}); - parts.push({name: 'Q', data: pub}); - parts.push({name: 'd', data: priv}); - - this._key = new PrivateKey({ - type: 'ecdsa', - curve: this._curve, - parts: parts - }); - this._isPriv = true; - return (this._key); - } - - } else if (this._algo === 'curve25519') { - var pair = nacl.box.keyPair(); - priv = Buffer.from(pair.secretKey); - pub = Buffer.from(pair.publicKey); - priv = Buffer.concat([priv, pub]); - assert.strictEqual(priv.length, 64); - assert.strictEqual(pub.length, 32); - - parts.push({name: 'A', data: pub}); - parts.push({name: 'k', data: priv}); - this._key = new PrivateKey({ - type: 'curve25519', - parts: parts - }); - this._isPriv = true; - return (this._key); - } - - throw (new Error('Invalid algorithm: ' + this._algo)); -}; -DiffieHellman.prototype.generateKeys = DiffieHellman.prototype.generateKey; - -/* These are helpers for using ecc-jsbn (for node 0.10 compatibility). */ - -function X9ECParameters(name) { - var params = algs.curves[name]; - assert.object(params); - - var p = new jsbn(params.p); - var a = new jsbn(params.a); - var b = new jsbn(params.b); - var n = new jsbn(params.n); - var h = jsbn.ONE; - var curve = new ec.ECCurveFp(p, a, b); - var G = curve.decodePointHex(params.G.toString('hex')); - - this.curve = curve; - this.g = G; - this.n = n; - this.h = h; -} -X9ECParameters.prototype.getCurve = function () { return (this.curve); }; -X9ECParameters.prototype.getG = function () { return (this.g); }; -X9ECParameters.prototype.getN = function () { return (this.n); }; -X9ECParameters.prototype.getH = function () { return (this.h); }; - -function ECPublic(params, buffer) { - this._params = params; - if (buffer[0] === 0x00) - buffer = buffer.slice(1); - this._pub = params.getCurve().decodePointHex(buffer.toString('hex')); -} - -function ECPrivate(params, buffer) { - this._params = params; - this._priv = new jsbn(utils.mpNormalize(buffer)); -} -ECPrivate.prototype.deriveSharedSecret = function (pubKey) { - assert.ok(pubKey instanceof ECPublic); - var S = pubKey._pub.multiply(this._priv); - return (Buffer.from(S.getX().toBigInteger().toByteArray())); -}; - -function generateED25519() { - var pair = nacl.sign.keyPair(); - var priv = Buffer.from(pair.secretKey); - var pub = Buffer.from(pair.publicKey); - assert.strictEqual(priv.length, 64); - assert.strictEqual(pub.length, 32); - - var parts = []; - parts.push({name: 'A', data: pub}); - parts.push({name: 'k', data: priv.slice(0, 32)}); - var key = new PrivateKey({ - type: 'ed25519', - parts: parts - }); - return (key); -} - -/* Generates a new ECDSA private key on a given curve. */ -function generateECDSA(curve) { - var parts = []; - var key; - - if (CRYPTO_HAVE_ECDH) { - /* - * Node crypto doesn't expose key generation directly, but the - * ECDH instances can generate keys. It turns out this just - * calls into the OpenSSL generic key generator, and we can - * read its output happily without doing an actual DH. So we - * use that here. - */ - var osCurve = { - 'nistp256': 'prime256v1', - 'nistp384': 'secp384r1', - 'nistp521': 'secp521r1' - }[curve]; - - var dh = crypto.createECDH(osCurve); - dh.generateKeys(); - - parts.push({name: 'curve', - data: Buffer.from(curve)}); - parts.push({name: 'Q', data: dh.getPublicKey()}); - parts.push({name: 'd', data: dh.getPrivateKey()}); - - key = new PrivateKey({ - type: 'ecdsa', - curve: curve, - parts: parts - }); - return (key); - } else { - - var ecParams = new X9ECParameters(curve); - - /* This algorithm taken from FIPS PUB 186-4 (section B.4.1) */ - var n = ecParams.getN(); - /* - * The crypto.randomBytes() function can only give us whole - * bytes, so taking a nod from X9.62, we round up. - */ - var cByteLen = Math.ceil((n.bitLength() + 64) / 8); - var c = new jsbn(crypto.randomBytes(cByteLen)); - - var n1 = n.subtract(jsbn.ONE); - var priv = c.mod(n1).add(jsbn.ONE); - var pub = ecParams.getG().multiply(priv); - - priv = Buffer.from(priv.toByteArray()); - pub = Buffer.from(ecParams.getCurve(). - encodePointHex(pub), 'hex'); - - parts.push({name: 'curve', data: Buffer.from(curve)}); - parts.push({name: 'Q', data: pub}); - parts.push({name: 'd', data: priv}); - - key = new PrivateKey({ - type: 'ecdsa', - curve: curve, - parts: parts - }); - return (key); - } -} - - -/***/ }), -/* 291 */, -/* 292 */, -/* 293 */ -/***/ (function(module) { - -module.exports = require("buffer"); - -/***/ }), -/* 294 */, -/* 295 */, -/* 296 */, -/* 297 */, -/* 298 */ -/***/ (function(module) { - -"use strict"; - - -function formatHostname (hostname) { - // canonicalize the hostname, so that 'oogle.com' won't match 'google.com' - return hostname.replace(/^\.*/, '.').toLowerCase() -} - -function parseNoProxyZone (zone) { - zone = zone.trim().toLowerCase() - - var zoneParts = zone.split(':', 2) - var zoneHost = formatHostname(zoneParts[0]) - var zonePort = zoneParts[1] - var hasPort = zone.indexOf(':') > -1 - - return {hostname: zoneHost, port: zonePort, hasPort: hasPort} -} - -function uriInNoProxy (uri, noProxy) { - var port = uri.port || (uri.protocol === 'https:' ? '443' : '80') - var hostname = formatHostname(uri.hostname) - var noProxyList = noProxy.split(',') - - // iterate through the noProxyList until it finds a match. - return noProxyList.map(parseNoProxyZone).some(function (noProxyZone) { - var isMatchedAt = hostname.indexOf(noProxyZone.hostname) - var hostnameMatched = ( - isMatchedAt > -1 && - (isMatchedAt === hostname.length - noProxyZone.hostname.length) - ) - - if (noProxyZone.hasPort) { - return (port === noProxyZone.port) && hostnameMatched - } - - return hostnameMatched - }) -} - -function getProxyFromURI (uri) { - // Decide the proper request proxy to use based on the request URI object and the - // environmental variables (NO_PROXY, HTTP_PROXY, etc.) - // respect NO_PROXY environment variables (see: https://lynx.invisible-island.net/lynx2.8.7/breakout/lynx_help/keystrokes/environments.html) - - var noProxy = process.env.NO_PROXY || process.env.no_proxy || '' - - // if the noProxy is a wildcard then return null - - if (noProxy === '*') { - return null - } - - // if the noProxy is not empty and the uri is found return null - - if (noProxy !== '' && uriInNoProxy(uri, noProxy)) { - return null - } - - // Check for HTTP or HTTPS Proxy in environment Else default to null - - if (uri.protocol === 'http:') { - return process.env.HTTP_PROXY || - process.env.http_proxy || null - } - - if (uri.protocol === 'https:') { - return process.env.HTTPS_PROXY || - process.env.https_proxy || - process.env.HTTP_PROXY || - process.env.http_proxy || null - } - - // if none of that works, return null - // (What uri protocol are you using then?) - - return null -} - -module.exports = getProxyFromURI - - -/***/ }), -/* 299 */ -/***/ (function(__unusedmodule, exports) { - -"use strict"; - - -Object.defineProperty(exports, '__esModule', { value: true }); - -const VERSION = "2.11.0"; - -/** - * Some “list” response that can be paginated have a different response structure - * - * They have a `total_count` key in the response (search also has `incomplete_results`, - * /installation/repositories also has `repository_selection`), as well as a key with - * the list of the items which name varies from endpoint to endpoint. - * - * Octokit normalizes these responses so that paginated results are always returned following - * the same structure. One challenge is that if the list response has only one page, no Link - * header is provided, so this header alone is not sufficient to check wether a response is - * paginated or not. - * - * We check if a "total_count" key is present in the response data, but also make sure that - * a "url" property is not, as the "Get the combined status for a specific ref" endpoint would - * otherwise match: https://developer.github.com/v3/repos/statuses/#get-the-combined-status-for-a-specific-ref - */ -function normalizePaginatedListResponse(response) { - const responseNeedsNormalization = "total_count" in response.data && !("url" in response.data); - if (!responseNeedsNormalization) return response; // keep the additional properties intact as there is currently no other way - // to retrieve the same information. - - const incompleteResults = response.data.incomplete_results; - const repositorySelection = response.data.repository_selection; - const totalCount = response.data.total_count; - delete response.data.incomplete_results; - delete response.data.repository_selection; - delete response.data.total_count; - const namespaceKey = Object.keys(response.data)[0]; - const data = response.data[namespaceKey]; - response.data = data; - - if (typeof incompleteResults !== "undefined") { - response.data.incomplete_results = incompleteResults; - } - - if (typeof repositorySelection !== "undefined") { - response.data.repository_selection = repositorySelection; - } - - response.data.total_count = totalCount; - return response; -} - -function iterator(octokit, route, parameters) { - const options = typeof route === "function" ? route.endpoint(parameters) : octokit.request.endpoint(route, parameters); - const requestMethod = typeof route === "function" ? route : octokit.request; - const method = options.method; - const headers = options.headers; - let url = options.url; - return { - [Symbol.asyncIterator]: () => ({ - async next() { - if (!url) return { - done: true - }; - const response = await requestMethod({ - method, - url, - headers - }); - const normalizedResponse = normalizePaginatedListResponse(response); // `response.headers.link` format: - // '; rel="next", ; rel="last"' - // sets `url` to undefined if "next" URL is not present or `link` header is not set - - url = ((normalizedResponse.headers.link || "").match(/<([^>]+)>;\s*rel="next"/) || [])[1]; - return { - value: normalizedResponse - }; - } - - }) - }; -} - -function paginate(octokit, route, parameters, mapFn) { - if (typeof parameters === "function") { - mapFn = parameters; - parameters = undefined; - } - - return gather(octokit, [], iterator(octokit, route, parameters)[Symbol.asyncIterator](), mapFn); -} - -function gather(octokit, results, iterator, mapFn) { - return iterator.next().then(result => { - if (result.done) { - return results; - } - - let earlyExit = false; - - function done() { - earlyExit = true; - } - - results = results.concat(mapFn ? mapFn(result.value, done) : result.value.data); - - if (earlyExit) { - return results; - } - - return gather(octokit, results, iterator, mapFn); - }); -} - -const composePaginateRest = Object.assign(paginate, { - iterator -}); - -/** - * @param octokit Octokit instance - * @param options Options passed to Octokit constructor - */ - -function paginateRest(octokit) { - return { - paginate: Object.assign(paginate.bind(null, octokit), { - iterator: iterator.bind(null, octokit) - }) - }; -} -paginateRest.VERSION = VERSION; - -exports.composePaginateRest = composePaginateRest; -exports.paginateRest = paginateRest; -//# sourceMappingURL=index.js.map - - -/***/ }), -/* 300 */, -/* 301 */, -/* 302 */, -/* 303 */, -/* 304 */, -/* 305 */, -/* 306 */, -/* 307 */, -/* 308 */, -/* 309 */, -/* 310 */, -/* 311 */, -/* 312 */, -/* 313 */ -/***/ (function(module) { - -/** @license MIT License (c) copyright 2010-2014 original author or authors */ -/** @author Brian Cavalier */ -/** @author John Hann */ - -(function(define) { 'use strict'; -define(function() { - - return function makePromise(environment) { - - var tasks = environment.scheduler; - var emitRejection = initEmitRejection(); - - var objectCreate = Object.create || - function(proto) { - function Child() {} - Child.prototype = proto; - return new Child(); - }; - - /** - * Create a promise whose fate is determined by resolver - * @constructor - * @returns {Promise} promise - * @name Promise - */ - function Promise(resolver, handler) { - this._handler = resolver === Handler ? handler : init(resolver); - } - - /** - * Run the supplied resolver - * @param resolver - * @returns {Pending} - */ - function init(resolver) { - var handler = new Pending(); - - try { - resolver(promiseResolve, promiseReject, promiseNotify); - } catch (e) { - promiseReject(e); - } - - return handler; - - /** - * Transition from pre-resolution state to post-resolution state, notifying - * all listeners of the ultimate fulfillment or rejection - * @param {*} x resolution value - */ - function promiseResolve (x) { - handler.resolve(x); - } - /** - * Reject this promise with reason, which will be used verbatim - * @param {Error|*} reason rejection reason, strongly suggested - * to be an Error type - */ - function promiseReject (reason) { - handler.reject(reason); - } - - /** - * @deprecated - * Issue a progress event, notifying all progress listeners - * @param {*} x progress event payload to pass to all listeners - */ - function promiseNotify (x) { - handler.notify(x); - } - } - - // Creation - - Promise.resolve = resolve; - Promise.reject = reject; - Promise.never = never; - - Promise._defer = defer; - Promise._handler = getHandler; - - /** - * Returns a trusted promise. If x is already a trusted promise, it is - * returned, otherwise returns a new trusted Promise which follows x. - * @param {*} x - * @return {Promise} promise - */ - function resolve(x) { - return isPromise(x) ? x - : new Promise(Handler, new Async(getHandler(x))); - } - - /** - * Return a reject promise with x as its reason (x is used verbatim) - * @param {*} x - * @returns {Promise} rejected promise - */ - function reject(x) { - return new Promise(Handler, new Async(new Rejected(x))); - } - - /** - * Return a promise that remains pending forever - * @returns {Promise} forever-pending promise. - */ - function never() { - return foreverPendingPromise; // Should be frozen - } - - /** - * Creates an internal {promise, resolver} pair - * @private - * @returns {Promise} - */ - function defer() { - return new Promise(Handler, new Pending()); - } - - // Transformation and flow control - - /** - * Transform this promise's fulfillment value, returning a new Promise - * for the transformed result. If the promise cannot be fulfilled, onRejected - * is called with the reason. onProgress *may* be called with updates toward - * this promise's fulfillment. - * @param {function=} onFulfilled fulfillment handler - * @param {function=} onRejected rejection handler - * @param {function=} onProgress @deprecated progress handler - * @return {Promise} new promise - */ - Promise.prototype.then = function(onFulfilled, onRejected, onProgress) { - var parent = this._handler; - var state = parent.join().state(); - - if ((typeof onFulfilled !== 'function' && state > 0) || - (typeof onRejected !== 'function' && state < 0)) { - // Short circuit: value will not change, simply share handler - return new this.constructor(Handler, parent); - } - - var p = this._beget(); - var child = p._handler; - - parent.chain(child, parent.receiver, onFulfilled, onRejected, onProgress); - - return p; - }; - - /** - * If this promise cannot be fulfilled due to an error, call onRejected to - * handle the error. Shortcut for .then(undefined, onRejected) - * @param {function?} onRejected - * @return {Promise} - */ - Promise.prototype['catch'] = function(onRejected) { - return this.then(void 0, onRejected); - }; - - /** - * Creates a new, pending promise of the same type as this promise - * @private - * @returns {Promise} - */ - Promise.prototype._beget = function() { - return begetFrom(this._handler, this.constructor); - }; - - function begetFrom(parent, Promise) { - var child = new Pending(parent.receiver, parent.join().context); - return new Promise(Handler, child); - } - - // Array combinators - - Promise.all = all; - Promise.race = race; - Promise._traverse = traverse; - - /** - * Return a promise that will fulfill when all promises in the - * input array have fulfilled, or will reject when one of the - * promises rejects. - * @param {array} promises array of promises - * @returns {Promise} promise for array of fulfillment values - */ - function all(promises) { - return traverseWith(snd, null, promises); - } - - /** - * Array> -> Promise> - * @private - * @param {function} f function to apply to each promise's value - * @param {Array} promises array of promises - * @returns {Promise} promise for transformed values - */ - function traverse(f, promises) { - return traverseWith(tryCatch2, f, promises); - } - - function traverseWith(tryMap, f, promises) { - var handler = typeof f === 'function' ? mapAt : settleAt; - - var resolver = new Pending(); - var pending = promises.length >>> 0; - var results = new Array(pending); - - for (var i = 0, x; i < promises.length && !resolver.resolved; ++i) { - x = promises[i]; - - if (x === void 0 && !(i in promises)) { - --pending; - continue; - } - - traverseAt(promises, handler, i, x, resolver); - } - - if(pending === 0) { - resolver.become(new Fulfilled(results)); - } - - return new Promise(Handler, resolver); - - function mapAt(i, x, resolver) { - if(!resolver.resolved) { - traverseAt(promises, settleAt, i, tryMap(f, x, i), resolver); - } - } - - function settleAt(i, x, resolver) { - results[i] = x; - if(--pending === 0) { - resolver.become(new Fulfilled(results)); - } - } - } - - function traverseAt(promises, handler, i, x, resolver) { - if (maybeThenable(x)) { - var h = getHandlerMaybeThenable(x); - var s = h.state(); - - if (s === 0) { - h.fold(handler, i, void 0, resolver); - } else if (s > 0) { - handler(i, h.value, resolver); - } else { - resolver.become(h); - visitRemaining(promises, i+1, h); - } - } else { - handler(i, x, resolver); - } - } - - Promise._visitRemaining = visitRemaining; - function visitRemaining(promises, start, handler) { - for(var i=start; i { - url = response.url; - status = response.status; - - for (const keyAndValue of response.headers) { - headers[keyAndValue[0]] = keyAndValue[1]; - } - - if (status === 204 || status === 205) { - return; - } // GitHub API returns 200 for HEAD requests - - - if (requestOptions.method === "HEAD") { - if (status < 400) { - return; - } - - throw new requestError.RequestError(response.statusText, status, { - headers, - request: requestOptions - }); - } - - if (status === 304) { - throw new requestError.RequestError("Not modified", status, { - headers, - request: requestOptions - }); - } - - if (status >= 400) { - return response.text().then(message => { - const error = new requestError.RequestError(message, status, { - headers, - request: requestOptions - }); - - try { - let responseBody = JSON.parse(error.message); - Object.assign(error, responseBody); - let errors = responseBody.errors; // Assumption `errors` would always be in Array format - - error.message = error.message + ": " + errors.map(JSON.stringify).join(", "); - } catch (e) {// ignore, see octokit/rest.js#684 - } - - throw error; - }); - } - - const contentType = response.headers.get("content-type"); - - if (/application\/json/.test(contentType)) { - return response.json(); - } - - if (!contentType || /^text\/|charset=utf-8$/.test(contentType)) { - return response.text(); - } - - return getBufferResponse(response); - }).then(data => { - return { - status, - url, - headers, - data - }; - }).catch(error => { - if (error instanceof requestError.RequestError) { - throw error; - } - - throw new requestError.RequestError(error.message, 500, { - headers, - request: requestOptions - }); - }); -} - -function withDefaults(oldEndpoint, newDefaults) { - const endpoint = oldEndpoint.defaults(newDefaults); - - const newApi = function (route, parameters) { - const endpointOptions = endpoint.merge(route, parameters); - - if (!endpointOptions.request || !endpointOptions.request.hook) { - return fetchWrapper(endpoint.parse(endpointOptions)); - } - - const request = (route, parameters) => { - return fetchWrapper(endpoint.parse(endpoint.merge(route, parameters))); - }; - - Object.assign(request, { - endpoint, - defaults: withDefaults.bind(null, endpoint) - }); - return endpointOptions.request.hook(request, endpointOptions); - }; - - return Object.assign(newApi, { - endpoint, - defaults: withDefaults.bind(null, endpoint) - }); -} - -const request = withDefaults(endpoint.endpoint, { - headers: { - "user-agent": `octokit-request.js/${VERSION} ${universalUserAgent.getUserAgent()}` - } -}); - -exports.request = request; -//# sourceMappingURL=index.js.map - - -/***/ }), -/* 318 */, -/* 319 */ -/***/ (function(module) { - -module.exports = {"$id":"log.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["version","creator","entries"],"properties":{"version":{"type":"string"},"creator":{"$ref":"creator.json#"},"browser":{"$ref":"browser.json#"},"pages":{"type":"array","items":{"$ref":"page.json#"}},"entries":{"type":"array","items":{"$ref":"entry.json#"}},"comment":{"type":"string"}}}; - -/***/ }), -/* 320 */, -/* 321 */, -/* 322 */, -/* 323 */, -/* 324 */, -/* 325 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -}; -var __generator = (this && this.__generator) || function (thisArg, body) { - var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g; - return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g; - function verb(n) { return function (v) { return step([n, v]); }; } - function step(op) { - if (f) throw new TypeError("Generator is already executing."); - while (_) try { - if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; - if (y = 0, t) op = [op[0] & 2, t.value]; - switch (op[0]) { - case 0: case 1: t = op; break; - case 4: _.label++; return { value: op[1], done: false }; - case 5: _.label++; y = op[1]; op = [0]; continue; - case 7: op = _.ops.pop(); _.trys.pop(); continue; - default: - if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; } - if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; } - if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; } - if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; } - if (t[2]) _.ops.pop(); - _.trys.pop(); continue; - } - op = body.call(thisArg, _); - } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; } - if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true }; - } -}; -exports.__esModule = true; -var core = __webpack_require__(470); -var exec = __webpack_require__(986); -var fs = __webpack_require__(747); -var request = __webpack_require__(335); -var buildExec_1 = __webpack_require__(983); -var validate_1 = __webpack_require__(743); -var failCi; -try { - request({ - json: false, - maxAttempts: 10, - timeout: 3000, - url: 'https://codecov.io/bash', - }, function (error, response, body) { return __awaiter(void 0, void 0, void 0, function () { - var _a, execArgs, options, filepath, failCi, isValid, failure; - return __generator(this, function (_b) { - _a = buildExec_1["default"](), execArgs = _a.execArgs, options = _a.options, filepath = _a.filepath, failCi = _a.failCi; - try { - isValid = validate_1["default"](body); - if (!isValid) { - failure = 'Codecov failure: ' + - 'Bash script checksums do not match published values. ' + - 'Please contact security@codecov.io immediately.'; - core.setFailed(failure); - throw new Error(failure); - } - if (error && failCi) { - throw error; - } - else if (error) { - core.warning("Codecov warning: " + error.message); - } - fs.writeFile(filepath, body, function (err) { - if (err && failCi) { - throw err; - } - else if (err) { - core.warning("Codecov warning: " + err.message); - } - exec.exec('bash', execArgs, options)["catch"](function (err) { - if (failCi) { - core.setFailed("Codecov failed with the following error: " + err.message); - } - else { - core.warning("Codecov warning: " + err.message); - } - }) - .then(function () { - unlinkFile(); - }); - var unlinkFile = function () { - fs.unlink(filepath, function (err) { - if (err && failCi) { - throw err; - } - else if (err) { - core.warning("Codecov warning: " + err.message); - } - }); - }; - }); - } - catch (error) { - core.setFailed("Codecov failed with the following error: " + error.message); - } - return [2 /*return*/]; - }); - }); }); -} -catch (error) { - if (failCi) { - core.setFailed("Codecov failed with the following error: " + error.message); - } - else { - core.warning("Codecov warning: " + error.message); - } -} - - -/***/ }), -/* 326 */ -/***/ (function(module) { - -module.exports = {"$id":"cookie.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","value"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"path":{"type":"string"},"domain":{"type":"string"},"expires":{"type":["string","null"],"format":"date-time"},"httpOnly":{"type":"boolean"},"secure":{"type":"boolean"},"comment":{"type":"string"}}}; - -/***/ }), -/* 327 */, -/* 328 */, -/* 329 */, -/* 330 */, -/* 331 */, -/* 332 */, -/* 333 */, -/* 334 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -module.exports = -{ - parallel : __webpack_require__(424), - serial : __webpack_require__(91), - serialOrdered : __webpack_require__(892) -}; - - -/***/ }), -/* 335 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -/* - * Request - * - * Copyright(c) 2014 Francois-Guillaume Ribreau - * MIT Licensed - * - */ -var extend = __webpack_require__(374); -var when = __webpack_require__(493); -var request = __webpack_require__(830); -var RetryStrategies = __webpack_require__(689); -var _ = __webpack_require__(557); - -var DEFAULTS = { - maxAttempts: 5, // try 5 times - retryDelay: 5000, // wait for 5s before trying again - fullResponse: true, // resolve promise with the full response object - promiseFactory: defaultPromiseFactory // Function to use a different promise implementation library -}; - -// Default promise factory which use bluebird -function defaultPromiseFactory(resolver) { - return when.promise(resolver); -} - -function _cloneOptions(options) { - const cloned = {}; - for (let key in options) { - if (options.hasOwnProperty(key)) { - cloned[key] = key === 'agent' ? options[key] : _.cloneDeep(options[key]); - } - } - return cloned; -} - -/** - * It calls the promiseFactory function passing it the resolver for the promise - * - * @param {Object} requestInstance - The Request Retry instance - * @param {Function} promiseFactoryFn - The Request Retry instance - * @return {Object} - The promise instance - */ -function makePromise(requestInstance, promiseFactoryFn) { - - // Resolver function wich assigns the promise (resolve, reject) functions - // to the requestInstance - function Resolver(resolve, reject) { - this._resolve = resolve; - this._reject = reject; - } - - return promiseFactoryFn(Resolver.bind(requestInstance)); -} - -function Request(url, options, f, retryConfig) { - // ('url') - if(_.isString(url)){ - // ('url', f) - if(_.isFunction(options)){ - f = options; - } - - if(!_.isObject(options)){ - options = {}; - } - - // ('url', {object}) - options.url = url; - } - - if(_.isObject(url)){ - if(_.isFunction(options)){ - f = options; - } - options = url; - } - - this.maxAttempts = retryConfig.maxAttempts; - this.retryDelay = retryConfig.retryDelay; - this.fullResponse = retryConfig.fullResponse; - this.attempts = 0; - - /** - * Option object - * @type {Object} - */ - this.options = options; - - /** - * Return true if the request should be retried - * @type {Function} (err, response, body, options) -> [Boolean, Object (optional)] - */ - this.retryStrategy = _.isFunction(options.retryStrategy) ? options.retryStrategy : RetryStrategies.HTTPOrNetworkError; - - /** - * Return a number representing how long request-retry should wait before trying again the request - * @type {Boolean} (err, response, body) -> Number - */ - this.delayStrategy = _.isFunction(options.delayStrategy) ? options.delayStrategy : function() { return this.retryDelay; }; - - this._timeout = null; - this._req = null; - - this._callback = _.isFunction(f) ? _.once(f) : null; - - // create the promise only when no callback was provided - if (!this._callback) { - this._promise = makePromise(this, retryConfig.promiseFactory); - } - - this.reply = function requestRetryReply(err, response, body) { - if (this._callback) { - return this._callback(err, response, body); - } - - if (err) { - return this._reject(err); - } - - // resolve with the full response or just the body - response = this.fullResponse ? response : body; - this._resolve(response); - }; -} - -Request.request = request; - -Request.prototype._tryUntilFail = function () { - this.maxAttempts--; - this.attempts++; - - this._req = Request.request(this.options, async function (err, response, body) { - if (response) { - response.attempts = this.attempts; - } - - if (err) { - err.attempts = this.attempts; - } - - var mustRetry = await Promise.resolve(this.retryStrategy(err, response, body, _cloneOptions(this.options))); - if (_.isObject(mustRetry) && _.has(mustRetry, 'mustRetry')) { - if (_.isObject(mustRetry.options)) { - this.options = mustRetry.options; //if retryStrategy supposes different request options for retry - } - mustRetry = mustRetry.mustRetry; - } - - if (mustRetry && this.maxAttempts > 0) { - this._timeout = setTimeout(this._tryUntilFail.bind(this), this.delayStrategy.call(this, err, response, body)); - return; - } - - this.reply(err, response, body); - }.bind(this)); -}; - -Request.prototype.abort = function () { - if (this._req) { - this._req.abort(); - } - clearTimeout(this._timeout); - this.reply(new Error('Aborted')); -}; - -// expose request methods from RequestRetry -['end', 'on', 'emit', 'once', 'setMaxListeners', 'start', 'removeListener', 'pipe', 'write', 'auth'].forEach(function (requestMethod) { - Request.prototype[requestMethod] = function exposedRequestMethod () { - return this._req[requestMethod].apply(this._req, arguments); - }; -}); - -// expose promise methods -['then', 'catch', 'finally', 'fail', 'done'].forEach(function (promiseMethod) { - Request.prototype[promiseMethod] = function exposedPromiseMethod () { - if (this._callback) { - throw new Error('A callback was provided but waiting a promise, use only one pattern'); - } - return this._promise[promiseMethod].apply(this._promise, arguments); - }; -}); - -function Factory(url, options, f) { - var retryConfig = _.chain(_.isObject(url) ? url : options || {}).defaults(DEFAULTS).pick(Object.keys(DEFAULTS)).value(); - var req = new Factory.Request(url, options, f, retryConfig); - req._tryUntilFail(); - return req; -} - -// adds a helper for HTTP method `verb` to object `obj` -function makeHelper(obj, verb) { - obj[verb] = function helper(url, options, f) { - // ('url') - if(_.isString(url)){ - // ('url', f) - if(_.isFunction(options)){ - f = options; - } - - if(!_.isObject(options)){ - options = {}; - } - - // ('url', {object}) - options.url = url; - } - - if(_.isObject(url)){ - if(_.isFunction(options)){ - f = options; - } - options = url; - } - - options.method = verb.toUpperCase(); - return obj(options, f); - }; -} - -function defaults(defaultOptions, defaultF) { - var factory = function (options, f) { - if (typeof options === "string") { - options = { uri: options }; - } - return Factory.apply(null, [ extend(true, {}, defaultOptions, options), f || defaultF ]); - }; - - factory.defaults = function (newDefaultOptions, newDefaultF) { - return defaults.apply(null, [ extend(true, {}, defaultOptions, newDefaultOptions), newDefaultF || defaultF ]); - }; - - factory.Request = Request; - factory.RetryStrategies = RetryStrategies; - - ['get', 'head', 'post', 'put', 'patch', 'delete'].forEach(function (verb) { - makeHelper(factory, verb); - }); - factory.del = factory['delete']; - - ['jar', 'cookie'].forEach(function (method) { - factory[method] = factory.Request.request[method]; - }); - - return factory; -} - -module.exports = Factory; - -Factory.defaults = defaults; -Factory.Request = Request; -Factory.RetryStrategies = RetryStrategies; - -// define .get/.post/... helpers -['get', 'head', 'post', 'put', 'patch', 'delete'].forEach(function (verb) { - makeHelper(Factory, verb); -}); -Factory.del = Factory['delete']; - -['jar', 'cookie'].forEach(function (method) { - Factory[method] = Factory.Request.request[method]; -}); - - -/***/ }), -/* 336 */, -/* 337 */ -/***/ (function(module) { - -module.exports = {"$schema":"http://json-schema.org/draft-06/schema#","$id":"http://json-schema.org/draft-06/schema#","title":"Core schema meta-schema","definitions":{"schemaArray":{"type":"array","minItems":1,"items":{"$ref":"#"}},"nonNegativeInteger":{"type":"integer","minimum":0},"nonNegativeIntegerDefault0":{"allOf":[{"$ref":"#/definitions/nonNegativeInteger"},{"default":0}]},"simpleTypes":{"enum":["array","boolean","integer","null","number","object","string"]},"stringArray":{"type":"array","items":{"type":"string"},"uniqueItems":true,"default":[]}},"type":["object","boolean"],"properties":{"$id":{"type":"string","format":"uri-reference"},"$schema":{"type":"string","format":"uri"},"$ref":{"type":"string","format":"uri-reference"},"title":{"type":"string"},"description":{"type":"string"},"default":{},"examples":{"type":"array","items":{}},"multipleOf":{"type":"number","exclusiveMinimum":0},"maximum":{"type":"number"},"exclusiveMaximum":{"type":"number"},"minimum":{"type":"number"},"exclusiveMinimum":{"type":"number"},"maxLength":{"$ref":"#/definitions/nonNegativeInteger"},"minLength":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"pattern":{"type":"string","format":"regex"},"additionalItems":{"$ref":"#"},"items":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/schemaArray"}],"default":{}},"maxItems":{"$ref":"#/definitions/nonNegativeInteger"},"minItems":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"uniqueItems":{"type":"boolean","default":false},"contains":{"$ref":"#"},"maxProperties":{"$ref":"#/definitions/nonNegativeInteger"},"minProperties":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"required":{"$ref":"#/definitions/stringArray"},"additionalProperties":{"$ref":"#"},"definitions":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"properties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"patternProperties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"dependencies":{"type":"object","additionalProperties":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/stringArray"}]}},"propertyNames":{"$ref":"#"},"const":{},"enum":{"type":"array","minItems":1,"uniqueItems":true},"type":{"anyOf":[{"$ref":"#/definitions/simpleTypes"},{"type":"array","items":{"$ref":"#/definitions/simpleTypes"},"minItems":1,"uniqueItems":true}]},"format":{"type":"string"},"allOf":{"$ref":"#/definitions/schemaArray"},"anyOf":{"$ref":"#/definitions/schemaArray"},"oneOf":{"$ref":"#/definitions/schemaArray"},"not":{"$ref":"#"}},"default":{}}; - -/***/ }), -/* 338 */, -/* 339 */ -/***/ (function(module) { - -module.exports = {"$schema":"http://json-schema.org/draft-07/schema#","$id":"https://raw.githubusercontent.com/epoberezkin/ajv/master/lib/refs/data.json#","description":"Meta-schema for $data reference (JSON Schema extension proposal)","type":"object","required":["$data"],"properties":{"$data":{"type":"string","anyOf":[{"format":"relative-json-pointer"},{"format":"json-pointer"}]}},"additionalProperties":false}; - -/***/ }), -/* 340 */ -/***/ (function(module) { - -"use strict"; - - -var traverse = module.exports = function (schema, opts, cb) { - // Legacy support for v0.3.1 and earlier. - if (typeof opts == 'function') { - cb = opts; - opts = {}; - } - - cb = opts.cb || cb; - var pre = (typeof cb == 'function') ? cb : cb.pre || function() {}; - var post = cb.post || function() {}; - - _traverse(opts, pre, post, schema, '', schema); -}; - - -traverse.keywords = { - additionalItems: true, - items: true, - contains: true, - additionalProperties: true, - propertyNames: true, - not: true -}; - -traverse.arrayKeywords = { - items: true, - allOf: true, - anyOf: true, - oneOf: true -}; - -traverse.propsKeywords = { - definitions: true, - properties: true, - patternProperties: true, - dependencies: true -}; - -traverse.skipKeywords = { - default: true, - enum: true, - const: true, - required: true, - maximum: true, - minimum: true, - exclusiveMaximum: true, - exclusiveMinimum: true, - multipleOf: true, - maxLength: true, - minLength: true, - pattern: true, - format: true, - maxItems: true, - minItems: true, - uniqueItems: true, - maxProperties: true, - minProperties: true -}; - - -function _traverse(opts, pre, post, schema, jsonPtr, rootSchema, parentJsonPtr, parentKeyword, parentSchema, keyIndex) { - if (schema && typeof schema == 'object' && !Array.isArray(schema)) { - pre(schema, jsonPtr, rootSchema, parentJsonPtr, parentKeyword, parentSchema, keyIndex); - for (var key in schema) { - var sch = schema[key]; - if (Array.isArray(sch)) { - if (key in traverse.arrayKeywords) { - for (var i=0; i', - $notOp = $isMax ? '>' : '<', - $errorKeyword = undefined; - if ($isDataExcl) { - var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr), - $exclusive = 'exclusive' + $lvl, - $exclType = 'exclType' + $lvl, - $exclIsNumber = 'exclIsNumber' + $lvl, - $opExpr = 'op' + $lvl, - $opStr = '\' + ' + $opExpr + ' + \''; - out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; '; - $schemaValueExcl = 'schemaExcl' + $lvl; - out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { '; - var $errorKeyword = $exclusiveKeyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; '; - if ($schema === undefined) { - $errorKeyword = $exclusiveKeyword; - $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; - $schemaValue = $schemaValueExcl; - $isData = $isDataExcl; - } - } else { - var $exclIsNumber = typeof $schemaExcl == 'number', - $opStr = $op; - if ($exclIsNumber && $isData) { - var $opExpr = '\'' + $opStr + '\''; - out += ' if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { '; - } else { - if ($exclIsNumber && $schema === undefined) { - $exclusive = true; - $errorKeyword = $exclusiveKeyword; - $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; - $schemaValue = $schemaExcl; - $notOp += '='; - } else { - if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); - if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { - $exclusive = true; - $errorKeyword = $exclusiveKeyword; - $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; - $notOp += '='; - } else { - $exclusive = false; - $opStr += '='; - } - } - var $opExpr = '\'' + $opStr + '\''; - out += ' if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { '; - } - } - $errorKeyword = $errorKeyword || $keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be ' + ($opStr) + ' '; - if ($isData) { - out += '\' + ' + ($schemaValue); - } else { - out += '' + ($schemaValue) + '\''; - } - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), -/* 342 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2012 Joyent, Inc. All rights reserved. - -var assert = __webpack_require__(477); -var util = __webpack_require__(669); -var utils = __webpack_require__(909); - - - -///--- Globals - -var HASH_ALGOS = utils.HASH_ALGOS; -var PK_ALGOS = utils.PK_ALGOS; -var HttpSignatureError = utils.HttpSignatureError; -var InvalidAlgorithmError = utils.InvalidAlgorithmError; -var validateAlgorithm = utils.validateAlgorithm; - -var State = { - New: 0, - Params: 1 -}; - -var ParamsState = { - Name: 0, - Quote: 1, - Value: 2, - Comma: 3 -}; - - -///--- Specific Errors - - -function ExpiredRequestError(message) { - HttpSignatureError.call(this, message, ExpiredRequestError); -} -util.inherits(ExpiredRequestError, HttpSignatureError); - - -function InvalidHeaderError(message) { - HttpSignatureError.call(this, message, InvalidHeaderError); -} -util.inherits(InvalidHeaderError, HttpSignatureError); - - -function InvalidParamsError(message) { - HttpSignatureError.call(this, message, InvalidParamsError); -} -util.inherits(InvalidParamsError, HttpSignatureError); - - -function MissingHeaderError(message) { - HttpSignatureError.call(this, message, MissingHeaderError); -} -util.inherits(MissingHeaderError, HttpSignatureError); - -function StrictParsingError(message) { - HttpSignatureError.call(this, message, StrictParsingError); -} -util.inherits(StrictParsingError, HttpSignatureError); - -///--- Exported API - -module.exports = { - - /** - * Parses the 'Authorization' header out of an http.ServerRequest object. - * - * Note that this API will fully validate the Authorization header, and throw - * on any error. It will not however check the signature, or the keyId format - * as those are specific to your environment. You can use the options object - * to pass in extra constraints. - * - * As a response object you can expect this: - * - * { - * "scheme": "Signature", - * "params": { - * "keyId": "foo", - * "algorithm": "rsa-sha256", - * "headers": [ - * "date" or "x-date", - * "digest" - * ], - * "signature": "base64" - * }, - * "signingString": "ready to be passed to crypto.verify()" - * } - * - * @param {Object} request an http.ServerRequest. - * @param {Object} options an optional options object with: - * - clockSkew: allowed clock skew in seconds (default 300). - * - headers: required header names (def: date or x-date) - * - algorithms: algorithms to support (default: all). - * - strict: should enforce latest spec parsing - * (default: false). - * @return {Object} parsed out object (see above). - * @throws {TypeError} on invalid input. - * @throws {InvalidHeaderError} on an invalid Authorization header error. - * @throws {InvalidParamsError} if the params in the scheme are invalid. - * @throws {MissingHeaderError} if the params indicate a header not present, - * either in the request headers from the params, - * or not in the params from a required header - * in options. - * @throws {StrictParsingError} if old attributes are used in strict parsing - * mode. - * @throws {ExpiredRequestError} if the value of date or x-date exceeds skew. - */ - parseRequest: function parseRequest(request, options) { - assert.object(request, 'request'); - assert.object(request.headers, 'request.headers'); - if (options === undefined) { - options = {}; - } - if (options.headers === undefined) { - options.headers = [request.headers['x-date'] ? 'x-date' : 'date']; - } - assert.object(options, 'options'); - assert.arrayOfString(options.headers, 'options.headers'); - assert.optionalFinite(options.clockSkew, 'options.clockSkew'); - - var authzHeaderName = options.authorizationHeaderName || 'authorization'; - - if (!request.headers[authzHeaderName]) { - throw new MissingHeaderError('no ' + authzHeaderName + ' header ' + - 'present in the request'); - } - - options.clockSkew = options.clockSkew || 300; - - - var i = 0; - var state = State.New; - var substate = ParamsState.Name; - var tmpName = ''; - var tmpValue = ''; - - var parsed = { - scheme: '', - params: {}, - signingString: '' - }; - - var authz = request.headers[authzHeaderName]; - for (i = 0; i < authz.length; i++) { - var c = authz.charAt(i); - - switch (Number(state)) { - - case State.New: - if (c !== ' ') parsed.scheme += c; - else state = State.Params; - break; - - case State.Params: - switch (Number(substate)) { - - case ParamsState.Name: - var code = c.charCodeAt(0); - // restricted name of A-Z / a-z - if ((code >= 0x41 && code <= 0x5a) || // A-Z - (code >= 0x61 && code <= 0x7a)) { // a-z - tmpName += c; - } else if (c === '=') { - if (tmpName.length === 0) - throw new InvalidHeaderError('bad param format'); - substate = ParamsState.Quote; - } else { - throw new InvalidHeaderError('bad param format'); - } - break; - - case ParamsState.Quote: - if (c === '"') { - tmpValue = ''; - substate = ParamsState.Value; - } else { - throw new InvalidHeaderError('bad param format'); - } - break; - - case ParamsState.Value: - if (c === '"') { - parsed.params[tmpName] = tmpValue; - substate = ParamsState.Comma; - } else { - tmpValue += c; - } - break; - - case ParamsState.Comma: - if (c === ',') { - tmpName = ''; - substate = ParamsState.Name; - } else { - throw new InvalidHeaderError('bad param format'); - } - break; - - default: - throw new Error('Invalid substate'); - } - break; - - default: - throw new Error('Invalid substate'); - } - - } - - if (!parsed.params.headers || parsed.params.headers === '') { - if (request.headers['x-date']) { - parsed.params.headers = ['x-date']; - } else { - parsed.params.headers = ['date']; - } - } else { - parsed.params.headers = parsed.params.headers.split(' '); - } - - // Minimally validate the parsed object - if (!parsed.scheme || parsed.scheme !== 'Signature') - throw new InvalidHeaderError('scheme was not "Signature"'); - - if (!parsed.params.keyId) - throw new InvalidHeaderError('keyId was not specified'); - - if (!parsed.params.algorithm) - throw new InvalidHeaderError('algorithm was not specified'); - - if (!parsed.params.signature) - throw new InvalidHeaderError('signature was not specified'); - - // Check the algorithm against the official list - parsed.params.algorithm = parsed.params.algorithm.toLowerCase(); - try { - validateAlgorithm(parsed.params.algorithm); - } catch (e) { - if (e instanceof InvalidAlgorithmError) - throw (new InvalidParamsError(parsed.params.algorithm + ' is not ' + - 'supported')); - else - throw (e); - } - - // Build the signingString - for (i = 0; i < parsed.params.headers.length; i++) { - var h = parsed.params.headers[i].toLowerCase(); - parsed.params.headers[i] = h; - - if (h === 'request-line') { - if (!options.strict) { - /* - * We allow headers from the older spec drafts if strict parsing isn't - * specified in options. - */ - parsed.signingString += - request.method + ' ' + request.url + ' HTTP/' + request.httpVersion; - } else { - /* Strict parsing doesn't allow older draft headers. */ - throw (new StrictParsingError('request-line is not a valid header ' + - 'with strict parsing enabled.')); - } - } else if (h === '(request-target)') { - parsed.signingString += - '(request-target): ' + request.method.toLowerCase() + ' ' + - request.url; - } else { - var value = request.headers[h]; - if (value === undefined) - throw new MissingHeaderError(h + ' was not in the request'); - parsed.signingString += h + ': ' + value; - } - - if ((i + 1) < parsed.params.headers.length) - parsed.signingString += '\n'; - } - - // Check against the constraints - var date; - if (request.headers.date || request.headers['x-date']) { - if (request.headers['x-date']) { - date = new Date(request.headers['x-date']); - } else { - date = new Date(request.headers.date); - } - var now = new Date(); - var skew = Math.abs(now.getTime() - date.getTime()); - - if (skew > options.clockSkew * 1000) { - throw new ExpiredRequestError('clock skew of ' + - (skew / 1000) + - 's was greater than ' + - options.clockSkew + 's'); - } - } - - options.headers.forEach(function (hdr) { - // Remember that we already checked any headers in the params - // were in the request, so if this passes we're good. - if (parsed.params.headers.indexOf(hdr.toLowerCase()) < 0) - throw new MissingHeaderError(hdr + ' was not a signed header'); - }); - - if (options.algorithms) { - if (options.algorithms.indexOf(parsed.params.algorithm) === -1) - throw new InvalidParamsError(parsed.params.algorithm + - ' is not a supported algorithm'); - } - - parsed.algorithm = parsed.params.algorithm.toUpperCase(); - parsed.keyId = parsed.params.keyId; - return parsed; - } - -}; - - -/***/ }), -/* 343 */ -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_properties(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $key = 'key' + $lvl, - $idx = 'idx' + $lvl, - $dataNxt = $it.dataLevel = it.dataLevel + 1, - $nextData = 'data' + $dataNxt, - $dataProperties = 'dataProperties' + $lvl; - var $schemaKeys = Object.keys($schema || {}), - $pProperties = it.schema.patternProperties || {}, - $pPropertyKeys = Object.keys($pProperties), - $aProperties = it.schema.additionalProperties, - $someProperties = $schemaKeys.length || $pPropertyKeys.length, - $noAdditional = $aProperties === false, - $additionalIsSchema = typeof $aProperties == 'object' && Object.keys($aProperties).length, - $removeAdditional = it.opts.removeAdditional, - $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional, - $ownProperties = it.opts.ownProperties, - $currentBaseId = it.baseId; - var $required = it.schema.required; - if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) var $requiredHash = it.util.toHash($required); - out += 'var ' + ($errs) + ' = errors;var ' + ($nextValid) + ' = true;'; - if ($ownProperties) { - out += ' var ' + ($dataProperties) + ' = undefined;'; - } - if ($checkAdditional) { - if ($ownProperties) { - out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; - } else { - out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; - } - if ($someProperties) { - out += ' var isAdditional' + ($lvl) + ' = !(false '; - if ($schemaKeys.length) { - if ($schemaKeys.length > 8) { - out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') '; - } else { - var arr1 = $schemaKeys; - if (arr1) { - var $propertyKey, i1 = -1, - l1 = arr1.length - 1; - while (i1 < l1) { - $propertyKey = arr1[i1 += 1]; - out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' '; - } - } - } - } - if ($pPropertyKeys.length) { - var arr2 = $pPropertyKeys; - if (arr2) { - var $pProperty, $i = -1, - l2 = arr2.length - 1; - while ($i < l2) { - $pProperty = arr2[$i += 1]; - out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') '; - } - } - } - out += ' ); if (isAdditional' + ($lvl) + ') { '; - } - if ($removeAdditional == 'all') { - out += ' delete ' + ($data) + '[' + ($key) + ']; '; - } else { - var $currentErrorPath = it.errorPath; - var $additionalProperty = '\' + ' + $key + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - } - if ($noAdditional) { - if ($removeAdditional) { - out += ' delete ' + ($data) + '[' + ($key) + ']; '; - } else { - out += ' ' + ($nextValid) + ' = false; '; - var $currErrSchemaPath = $errSchemaPath; - $errSchemaPath = it.errSchemaPath + '/additionalProperties'; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is an invalid additional property'; - } else { - out += 'should NOT have additional properties'; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - $errSchemaPath = $currErrSchemaPath; - if ($breakOnError) { - out += ' break; '; - } - } - } else if ($additionalIsSchema) { - if ($removeAdditional == 'failing') { - out += ' var ' + ($errs) + ' = errors; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - $it.schema = $aProperties; - $it.schemaPath = it.schemaPath + '.additionalProperties'; - $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; - $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - var $passData = $data + '[' + $key + ']'; - $it.dataPathArr[$dataNxt] = $key; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } '; - it.compositeRule = $it.compositeRule = $wasComposite; - } else { - $it.schema = $aProperties; - $it.schemaPath = it.schemaPath + '.additionalProperties'; - $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; - $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - var $passData = $data + '[' + $key + ']'; - $it.dataPathArr[$dataNxt] = $key; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; - } - } - } - it.errorPath = $currentErrorPath; - } - if ($someProperties) { - out += ' } '; - } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - var $useDefaults = it.opts.useDefaults && !it.compositeRule; - if ($schemaKeys.length) { - var arr3 = $schemaKeys; - if (arr3) { - var $propertyKey, i3 = -1, - l3 = arr3.length - 1; - while (i3 < l3) { - $propertyKey = arr3[i3 += 1]; - var $sch = $schema[$propertyKey]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - var $prop = it.util.getProperty($propertyKey), - $passData = $data + $prop, - $hasDefault = $useDefaults && $sch.default !== undefined; - $it.schema = $sch; - $it.schemaPath = $schemaPath + $prop; - $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); - $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); - $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - $code = it.util.varReplace($code, $nextData, $passData); - var $useData = $passData; - } else { - var $useData = $nextData; - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; '; - } - if ($hasDefault) { - out += ' ' + ($code) + ' '; - } else { - if ($requiredHash && $requiredHash[$propertyKey]) { - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') { ' + ($nextValid) + ' = false; '; - var $currentErrorPath = it.errorPath, - $currErrSchemaPath = $errSchemaPath, - $missingProperty = it.util.escapeQuotes($propertyKey); - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); - } - $errSchemaPath = it.errSchemaPath + '/required'; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - $errSchemaPath = $currErrSchemaPath; - it.errorPath = $currentErrorPath; - out += ' } else { '; - } else { - if ($breakOnError) { - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') { ' + ($nextValid) + ' = true; } else { '; - } else { - out += ' if (' + ($useData) + ' !== undefined '; - if ($ownProperties) { - out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ' ) { '; - } - } - out += ' ' + ($code) + ' } '; - } - } - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - } - } - if ($pPropertyKeys.length) { - var arr4 = $pPropertyKeys; - if (arr4) { - var $pProperty, i4 = -1, - l4 = arr4.length - 1; - while (i4 < l4) { - $pProperty = arr4[i4 += 1]; - var $sch = $pProperties[$pProperty]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - $it.schema = $sch; - $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); - $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty); - if ($ownProperties) { - out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; - } else { - out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; - } - out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { '; - $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - var $passData = $data + '[' + $key + ']'; - $it.dataPathArr[$dataNxt] = $key; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; - } - out += ' } '; - if ($breakOnError) { - out += ' else ' + ($nextValid) + ' = true; '; - } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - } - } - } - if ($breakOnError) { - out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; - } - out = it.util.cleanUpCode(out); - return out; -} - - -/***/ }), -/* 344 */, -/* 345 */, -/* 346 */, -/* 347 */, -/* 348 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -/* - * lib/jsprim.js: utilities for primitive JavaScript types - */ - -var mod_assert = __webpack_require__(477); -var mod_util = __webpack_require__(669); - -var mod_extsprintf = __webpack_require__(697); -var mod_verror = __webpack_require__(956); -var mod_jsonschema = __webpack_require__(703); - -/* - * Public interface - */ -exports.deepCopy = deepCopy; -exports.deepEqual = deepEqual; -exports.isEmpty = isEmpty; -exports.hasKey = hasKey; -exports.forEachKey = forEachKey; -exports.pluck = pluck; -exports.flattenObject = flattenObject; -exports.flattenIter = flattenIter; -exports.validateJsonObject = validateJsonObjectJS; -exports.validateJsonObjectJS = validateJsonObjectJS; -exports.randElt = randElt; -exports.extraProperties = extraProperties; -exports.mergeObjects = mergeObjects; - -exports.startsWith = startsWith; -exports.endsWith = endsWith; - -exports.parseInteger = parseInteger; - -exports.iso8601 = iso8601; -exports.rfc1123 = rfc1123; -exports.parseDateTime = parseDateTime; - -exports.hrtimediff = hrtimeDiff; -exports.hrtimeDiff = hrtimeDiff; -exports.hrtimeAccum = hrtimeAccum; -exports.hrtimeAdd = hrtimeAdd; -exports.hrtimeNanosec = hrtimeNanosec; -exports.hrtimeMicrosec = hrtimeMicrosec; -exports.hrtimeMillisec = hrtimeMillisec; - - -/* - * Deep copy an acyclic *basic* Javascript object. This only handles basic - * scalars (strings, numbers, booleans) and arbitrarily deep arrays and objects - * containing these. This does *not* handle instances of other classes. - */ -function deepCopy(obj) -{ - var ret, key; - var marker = '__deepCopy'; - - if (obj && obj[marker]) - throw (new Error('attempted deep copy of cyclic object')); - - if (obj && obj.constructor == Object) { - ret = {}; - obj[marker] = true; - - for (key in obj) { - if (key == marker) - continue; - - ret[key] = deepCopy(obj[key]); - } - - delete (obj[marker]); - return (ret); - } - - if (obj && obj.constructor == Array) { - ret = []; - obj[marker] = true; - - for (key = 0; key < obj.length; key++) - ret.push(deepCopy(obj[key])); - - delete (obj[marker]); - return (ret); - } - - /* - * It must be a primitive type -- just return it. - */ - return (obj); -} - -function deepEqual(obj1, obj2) -{ - if (typeof (obj1) != typeof (obj2)) - return (false); - - if (obj1 === null || obj2 === null || typeof (obj1) != 'object') - return (obj1 === obj2); - - if (obj1.constructor != obj2.constructor) - return (false); - - var k; - for (k in obj1) { - if (!obj2.hasOwnProperty(k)) - return (false); - - if (!deepEqual(obj1[k], obj2[k])) - return (false); - } - - for (k in obj2) { - if (!obj1.hasOwnProperty(k)) - return (false); - } - - return (true); -} - -function isEmpty(obj) -{ - var key; - for (key in obj) - return (false); - return (true); -} - -function hasKey(obj, key) -{ - mod_assert.equal(typeof (key), 'string'); - return (Object.prototype.hasOwnProperty.call(obj, key)); -} - -function forEachKey(obj, callback) -{ - for (var key in obj) { - if (hasKey(obj, key)) { - callback(key, obj[key]); - } - } -} - -function pluck(obj, key) -{ - mod_assert.equal(typeof (key), 'string'); - return (pluckv(obj, key)); -} - -function pluckv(obj, key) -{ - if (obj === null || typeof (obj) !== 'object') - return (undefined); - - if (obj.hasOwnProperty(key)) - return (obj[key]); - - var i = key.indexOf('.'); - if (i == -1) - return (undefined); - - var key1 = key.substr(0, i); - if (!obj.hasOwnProperty(key1)) - return (undefined); - - return (pluckv(obj[key1], key.substr(i + 1))); -} - -/* - * Invoke callback(row) for each entry in the array that would be returned by - * flattenObject(data, depth). This is just like flattenObject(data, - * depth).forEach(callback), except that the intermediate array is never - * created. - */ -function flattenIter(data, depth, callback) -{ - doFlattenIter(data, depth, [], callback); -} - -function doFlattenIter(data, depth, accum, callback) -{ - var each; - var key; - - if (depth === 0) { - each = accum.slice(0); - each.push(data); - callback(each); - return; - } - - mod_assert.ok(data !== null); - mod_assert.equal(typeof (data), 'object'); - mod_assert.equal(typeof (depth), 'number'); - mod_assert.ok(depth >= 0); - - for (key in data) { - each = accum.slice(0); - each.push(key); - doFlattenIter(data[key], depth - 1, each, callback); - } -} - -function flattenObject(data, depth) -{ - if (depth === 0) - return ([ data ]); - - mod_assert.ok(data !== null); - mod_assert.equal(typeof (data), 'object'); - mod_assert.equal(typeof (depth), 'number'); - mod_assert.ok(depth >= 0); - - var rv = []; - var key; - - for (key in data) { - flattenObject(data[key], depth - 1).forEach(function (p) { - rv.push([ key ].concat(p)); - }); - } - - return (rv); -} - -function startsWith(str, prefix) -{ - return (str.substr(0, prefix.length) == prefix); -} - -function endsWith(str, suffix) -{ - return (str.substr( - str.length - suffix.length, suffix.length) == suffix); -} - -function iso8601(d) -{ - if (typeof (d) == 'number') - d = new Date(d); - mod_assert.ok(d.constructor === Date); - return (mod_extsprintf.sprintf('%4d-%02d-%02dT%02d:%02d:%02d.%03dZ', - d.getUTCFullYear(), d.getUTCMonth() + 1, d.getUTCDate(), - d.getUTCHours(), d.getUTCMinutes(), d.getUTCSeconds(), - d.getUTCMilliseconds())); -} - -var RFC1123_MONTHS = [ - 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', - 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec']; -var RFC1123_DAYS = [ - 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat']; - -function rfc1123(date) { - return (mod_extsprintf.sprintf('%s, %02d %s %04d %02d:%02d:%02d GMT', - RFC1123_DAYS[date.getUTCDay()], date.getUTCDate(), - RFC1123_MONTHS[date.getUTCMonth()], date.getUTCFullYear(), - date.getUTCHours(), date.getUTCMinutes(), - date.getUTCSeconds())); -} - -/* - * Parses a date expressed as a string, as either a number of milliseconds since - * the epoch or any string format that Date accepts, giving preference to the - * former where these two sets overlap (e.g., small numbers). - */ -function parseDateTime(str) -{ - /* - * This is irritatingly implicit, but significantly more concise than - * alternatives. The "+str" will convert a string containing only a - * number directly to a Number, or NaN for other strings. Thus, if the - * conversion succeeds, we use it (this is the milliseconds-since-epoch - * case). Otherwise, we pass the string directly to the Date - * constructor to parse. - */ - var numeric = +str; - if (!isNaN(numeric)) { - return (new Date(numeric)); - } else { - return (new Date(str)); - } -} - - -/* - * Number.*_SAFE_INTEGER isn't present before node v0.12, so we hardcode - * the ES6 definitions here, while allowing for them to someday be higher. - */ -var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; -var MIN_SAFE_INTEGER = Number.MIN_SAFE_INTEGER || -9007199254740991; - - -/* - * Default options for parseInteger(). - */ -var PI_DEFAULTS = { - base: 10, - allowSign: true, - allowPrefix: false, - allowTrailing: false, - allowImprecise: false, - trimWhitespace: false, - leadingZeroIsOctal: false -}; - -var CP_0 = 0x30; -var CP_9 = 0x39; - -var CP_A = 0x41; -var CP_B = 0x42; -var CP_O = 0x4f; -var CP_T = 0x54; -var CP_X = 0x58; -var CP_Z = 0x5a; - -var CP_a = 0x61; -var CP_b = 0x62; -var CP_o = 0x6f; -var CP_t = 0x74; -var CP_x = 0x78; -var CP_z = 0x7a; - -var PI_CONV_DEC = 0x30; -var PI_CONV_UC = 0x37; -var PI_CONV_LC = 0x57; - - -/* - * A stricter version of parseInt() that provides options for changing what - * is an acceptable string (for example, disallowing trailing characters). - */ -function parseInteger(str, uopts) -{ - mod_assert.string(str, 'str'); - mod_assert.optionalObject(uopts, 'options'); - - var baseOverride = false; - var options = PI_DEFAULTS; - - if (uopts) { - baseOverride = hasKey(uopts, 'base'); - options = mergeObjects(options, uopts); - mod_assert.number(options.base, 'options.base'); - mod_assert.ok(options.base >= 2, 'options.base >= 2'); - mod_assert.ok(options.base <= 36, 'options.base <= 36'); - mod_assert.bool(options.allowSign, 'options.allowSign'); - mod_assert.bool(options.allowPrefix, 'options.allowPrefix'); - mod_assert.bool(options.allowTrailing, - 'options.allowTrailing'); - mod_assert.bool(options.allowImprecise, - 'options.allowImprecise'); - mod_assert.bool(options.trimWhitespace, - 'options.trimWhitespace'); - mod_assert.bool(options.leadingZeroIsOctal, - 'options.leadingZeroIsOctal'); - - if (options.leadingZeroIsOctal) { - mod_assert.ok(!baseOverride, - '"base" and "leadingZeroIsOctal" are ' + - 'mutually exclusive'); - } - } - - var c; - var pbase = -1; - var base = options.base; - var start; - var mult = 1; - var value = 0; - var idx = 0; - var len = str.length; - - /* Trim any whitespace on the left side. */ - if (options.trimWhitespace) { - while (idx < len && isSpace(str.charCodeAt(idx))) { - ++idx; - } - } - - /* Check the number for a leading sign. */ - if (options.allowSign) { - if (str[idx] === '-') { - idx += 1; - mult = -1; - } else if (str[idx] === '+') { - idx += 1; - } - } - - /* Parse the base-indicating prefix if there is one. */ - if (str[idx] === '0') { - if (options.allowPrefix) { - pbase = prefixToBase(str.charCodeAt(idx + 1)); - if (pbase !== -1 && (!baseOverride || pbase === base)) { - base = pbase; - idx += 2; - } - } - - if (pbase === -1 && options.leadingZeroIsOctal) { - base = 8; - } - } - - /* Parse the actual digits. */ - for (start = idx; idx < len; ++idx) { - c = translateDigit(str.charCodeAt(idx)); - if (c !== -1 && c < base) { - value *= base; - value += c; - } else { - break; - } - } - - /* If we didn't parse any digits, we have an invalid number. */ - if (start === idx) { - return (new Error('invalid number: ' + JSON.stringify(str))); - } - - /* Trim any whitespace on the right side. */ - if (options.trimWhitespace) { - while (idx < len && isSpace(str.charCodeAt(idx))) { - ++idx; - } - } - - /* Check for trailing characters. */ - if (idx < len && !options.allowTrailing) { - return (new Error('trailing characters after number: ' + - JSON.stringify(str.slice(idx)))); - } - - /* If our value is 0, we return now, to avoid returning -0. */ - if (value === 0) { - return (0); - } - - /* Calculate our final value. */ - var result = value * mult; - - /* - * If the string represents a value that cannot be precisely represented - * by JavaScript, then we want to check that: - * - * - We never increased the value past MAX_SAFE_INTEGER - * - We don't make the result negative and below MIN_SAFE_INTEGER - * - * Because we only ever increment the value during parsing, there's no - * chance of moving past MAX_SAFE_INTEGER and then dropping below it - * again, losing precision in the process. This means that we only need - * to do our checks here, at the end. - */ - if (!options.allowImprecise && - (value > MAX_SAFE_INTEGER || result < MIN_SAFE_INTEGER)) { - return (new Error('number is outside of the supported range: ' + - JSON.stringify(str.slice(start, idx)))); - } - - return (result); -} - - -/* - * Interpret a character code as a base-36 digit. - */ -function translateDigit(d) -{ - if (d >= CP_0 && d <= CP_9) { - /* '0' to '9' -> 0 to 9 */ - return (d - PI_CONV_DEC); - } else if (d >= CP_A && d <= CP_Z) { - /* 'A' - 'Z' -> 10 to 35 */ - return (d - PI_CONV_UC); - } else if (d >= CP_a && d <= CP_z) { - /* 'a' - 'z' -> 10 to 35 */ - return (d - PI_CONV_LC); - } else { - /* Invalid character code */ - return (-1); - } -} - - -/* - * Test if a value matches the ECMAScript definition of trimmable whitespace. - */ -function isSpace(c) -{ - return (c === 0x20) || - (c >= 0x0009 && c <= 0x000d) || - (c === 0x00a0) || - (c === 0x1680) || - (c === 0x180e) || - (c >= 0x2000 && c <= 0x200a) || - (c === 0x2028) || - (c === 0x2029) || - (c === 0x202f) || - (c === 0x205f) || - (c === 0x3000) || - (c === 0xfeff); -} - - -/* - * Determine which base a character indicates (e.g., 'x' indicates hex). - */ -function prefixToBase(c) -{ - if (c === CP_b || c === CP_B) { - /* 0b/0B (binary) */ - return (2); - } else if (c === CP_o || c === CP_O) { - /* 0o/0O (octal) */ - return (8); - } else if (c === CP_t || c === CP_T) { - /* 0t/0T (decimal) */ - return (10); - } else if (c === CP_x || c === CP_X) { - /* 0x/0X (hexadecimal) */ - return (16); - } else { - /* Not a meaningful character */ - return (-1); - } -} - - -function validateJsonObjectJS(schema, input) -{ - var report = mod_jsonschema.validate(input, schema); - - if (report.errors.length === 0) - return (null); - - /* Currently, we only do anything useful with the first error. */ - var error = report.errors[0]; - - /* The failed property is given by a URI with an irrelevant prefix. */ - var propname = error['property']; - var reason = error['message'].toLowerCase(); - var i, j; - - /* - * There's at least one case where the property error message is - * confusing at best. We work around this here. - */ - if ((i = reason.indexOf('the property ')) != -1 && - (j = reason.indexOf(' is not defined in the schema and the ' + - 'schema does not allow additional properties')) != -1) { - i += 'the property '.length; - if (propname === '') - propname = reason.substr(i, j - i); - else - propname = propname + '.' + reason.substr(i, j - i); - - reason = 'unsupported property'; - } - - var rv = new mod_verror.VError('property "%s": %s', propname, reason); - rv.jsv_details = error; - return (rv); -} - -function randElt(arr) -{ - mod_assert.ok(Array.isArray(arr) && arr.length > 0, - 'randElt argument must be a non-empty array'); - - return (arr[Math.floor(Math.random() * arr.length)]); -} - -function assertHrtime(a) -{ - mod_assert.ok(a[0] >= 0 && a[1] >= 0, - 'negative numbers not allowed in hrtimes'); - mod_assert.ok(a[1] < 1e9, 'nanoseconds column overflow'); -} - -/* - * Compute the time elapsed between hrtime readings A and B, where A is later - * than B. hrtime readings come from Node's process.hrtime(). There is no - * defined way to represent negative deltas, so it's illegal to diff B from A - * where the time denoted by B is later than the time denoted by A. If this - * becomes valuable, we can define a representation and extend the - * implementation to support it. - */ -function hrtimeDiff(a, b) -{ - assertHrtime(a); - assertHrtime(b); - mod_assert.ok(a[0] > b[0] || (a[0] == b[0] && a[1] >= b[1]), - 'negative differences not allowed'); - - var rv = [ a[0] - b[0], 0 ]; - - if (a[1] >= b[1]) { - rv[1] = a[1] - b[1]; - } else { - rv[0]--; - rv[1] = 1e9 - (b[1] - a[1]); - } - - return (rv); -} - -/* - * Convert a hrtime reading from the array format returned by Node's - * process.hrtime() into a scalar number of nanoseconds. - */ -function hrtimeNanosec(a) -{ - assertHrtime(a); - - return (Math.floor(a[0] * 1e9 + a[1])); -} - -/* - * Convert a hrtime reading from the array format returned by Node's - * process.hrtime() into a scalar number of microseconds. - */ -function hrtimeMicrosec(a) -{ - assertHrtime(a); - - return (Math.floor(a[0] * 1e6 + a[1] / 1e3)); -} - -/* - * Convert a hrtime reading from the array format returned by Node's - * process.hrtime() into a scalar number of milliseconds. - */ -function hrtimeMillisec(a) -{ - assertHrtime(a); - - return (Math.floor(a[0] * 1e3 + a[1] / 1e6)); -} - -/* - * Add two hrtime readings A and B, overwriting A with the result of the - * addition. This function is useful for accumulating several hrtime intervals - * into a counter. Returns A. - */ -function hrtimeAccum(a, b) -{ - assertHrtime(a); - assertHrtime(b); - - /* - * Accumulate the nanosecond component. - */ - a[1] += b[1]; - if (a[1] >= 1e9) { - /* - * The nanosecond component overflowed, so carry to the seconds - * field. - */ - a[0]++; - a[1] -= 1e9; - } - - /* - * Accumulate the seconds component. - */ - a[0] += b[0]; - - return (a); -} - -/* - * Add two hrtime readings A and B, returning the result as a new hrtime array. - * Does not modify either input argument. - */ -function hrtimeAdd(a, b) -{ - assertHrtime(a); - - var rv = [ a[0], a[1] ]; - - return (hrtimeAccum(rv, b)); -} - - -/* - * Check an object for unexpected properties. Accepts the object to check, and - * an array of allowed property names (strings). Returns an array of key names - * that were found on the object, but did not appear in the list of allowed - * properties. If no properties were found, the returned array will be of - * zero length. - */ -function extraProperties(obj, allowed) -{ - mod_assert.ok(typeof (obj) === 'object' && obj !== null, - 'obj argument must be a non-null object'); - mod_assert.ok(Array.isArray(allowed), - 'allowed argument must be an array of strings'); - for (var i = 0; i < allowed.length; i++) { - mod_assert.ok(typeof (allowed[i]) === 'string', - 'allowed argument must be an array of strings'); - } - - return (Object.keys(obj).filter(function (key) { - return (allowed.indexOf(key) === -1); - })); -} - -/* - * Given three sets of properties "provided" (may be undefined), "overrides" - * (required), and "defaults" (may be undefined), construct an object containing - * the union of these sets with "overrides" overriding "provided", and - * "provided" overriding "defaults". None of the input objects are modified. - */ -function mergeObjects(provided, overrides, defaults) -{ - var rv, k; - - rv = {}; - if (defaults) { - for (k in defaults) - rv[k] = defaults[k]; - } - - if (provided) { - for (k in provided) - rv[k] = provided[k]; - } - - if (overrides) { - for (k in overrides) - rv[k] = overrides[k]; - } - - return (rv); -} - - -/***/ }), -/* 349 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = { - read: read, - verify: verify, - sign: sign, - signAsync: signAsync, - write: write -}; - -var assert = __webpack_require__(477); -var asn1 = __webpack_require__(62); -var Buffer = __webpack_require__(215).Buffer; -var algs = __webpack_require__(98); -var utils = __webpack_require__(270); -var Key = __webpack_require__(852); -var PrivateKey = __webpack_require__(502); -var pem = __webpack_require__(268); -var Identity = __webpack_require__(378); -var Signature = __webpack_require__(575); -var Certificate = __webpack_require__(752); -var pkcs8 = __webpack_require__(707); - -/* - * This file is based on RFC5280 (X.509). - */ - -/* Helper to read in a single mpint */ -function readMPInt(der, nm) { - assert.strictEqual(der.peek(), asn1.Ber.Integer, - nm + ' is not an Integer'); - return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); -} - -function verify(cert, key) { - var sig = cert.signatures.x509; - assert.object(sig, 'x509 signature'); - - var algParts = sig.algo.split('-'); - if (algParts[0] !== key.type) - return (false); - - var blob = sig.cache; - if (blob === undefined) { - var der = new asn1.BerWriter(); - writeTBSCert(cert, der); - blob = der.buffer; - } - - var verifier = key.createVerify(algParts[1]); - verifier.write(blob); - return (verifier.verify(sig.signature)); -} - -function Local(i) { - return (asn1.Ber.Context | asn1.Ber.Constructor | i); -} - -function Context(i) { - return (asn1.Ber.Context | i); -} - -var SIGN_ALGS = { - 'rsa-md5': '1.2.840.113549.1.1.4', - 'rsa-sha1': '1.2.840.113549.1.1.5', - 'rsa-sha256': '1.2.840.113549.1.1.11', - 'rsa-sha384': '1.2.840.113549.1.1.12', - 'rsa-sha512': '1.2.840.113549.1.1.13', - 'dsa-sha1': '1.2.840.10040.4.3', - 'dsa-sha256': '2.16.840.1.101.3.4.3.2', - 'ecdsa-sha1': '1.2.840.10045.4.1', - 'ecdsa-sha256': '1.2.840.10045.4.3.2', - 'ecdsa-sha384': '1.2.840.10045.4.3.3', - 'ecdsa-sha512': '1.2.840.10045.4.3.4', - 'ed25519-sha512': '1.3.101.112' -}; -Object.keys(SIGN_ALGS).forEach(function (k) { - SIGN_ALGS[SIGN_ALGS[k]] = k; -}); -SIGN_ALGS['1.3.14.3.2.3'] = 'rsa-md5'; -SIGN_ALGS['1.3.14.3.2.29'] = 'rsa-sha1'; - -var EXTS = { - 'issuerKeyId': '2.5.29.35', - 'altName': '2.5.29.17', - 'basicConstraints': '2.5.29.19', - 'keyUsage': '2.5.29.15', - 'extKeyUsage': '2.5.29.37' -}; - -function read(buf, options) { - if (typeof (buf) === 'string') { - buf = Buffer.from(buf, 'binary'); - } - assert.buffer(buf, 'buf'); - - var der = new asn1.BerReader(buf); - - der.readSequence(); - if (Math.abs(der.length - der.remain) > 1) { - throw (new Error('DER sequence does not contain whole byte ' + - 'stream')); - } - - var tbsStart = der.offset; - der.readSequence(); - var sigOffset = der.offset + der.length; - var tbsEnd = sigOffset; - - if (der.peek() === Local(0)) { - der.readSequence(Local(0)); - var version = der.readInt(); - assert.ok(version <= 3, - 'only x.509 versions up to v3 supported'); - } - - var cert = {}; - cert.signatures = {}; - var sig = (cert.signatures.x509 = {}); - sig.extras = {}; - - cert.serial = readMPInt(der, 'serial'); - - der.readSequence(); - var after = der.offset + der.length; - var certAlgOid = der.readOID(); - var certAlg = SIGN_ALGS[certAlgOid]; - if (certAlg === undefined) - throw (new Error('unknown signature algorithm ' + certAlgOid)); - - der._offset = after; - cert.issuer = Identity.parseAsn1(der); - - der.readSequence(); - cert.validFrom = readDate(der); - cert.validUntil = readDate(der); - - cert.subjects = [Identity.parseAsn1(der)]; - - der.readSequence(); - after = der.offset + der.length; - cert.subjectKey = pkcs8.readPkcs8(undefined, 'public', der); - der._offset = after; - - /* issuerUniqueID */ - if (der.peek() === Local(1)) { - der.readSequence(Local(1)); - sig.extras.issuerUniqueID = - buf.slice(der.offset, der.offset + der.length); - der._offset += der.length; - } - - /* subjectUniqueID */ - if (der.peek() === Local(2)) { - der.readSequence(Local(2)); - sig.extras.subjectUniqueID = - buf.slice(der.offset, der.offset + der.length); - der._offset += der.length; - } - - /* extensions */ - if (der.peek() === Local(3)) { - der.readSequence(Local(3)); - var extEnd = der.offset + der.length; - der.readSequence(); - - while (der.offset < extEnd) - readExtension(cert, buf, der); - - assert.strictEqual(der.offset, extEnd); - } - - assert.strictEqual(der.offset, sigOffset); - - der.readSequence(); - after = der.offset + der.length; - var sigAlgOid = der.readOID(); - var sigAlg = SIGN_ALGS[sigAlgOid]; - if (sigAlg === undefined) - throw (new Error('unknown signature algorithm ' + sigAlgOid)); - der._offset = after; - - var sigData = der.readString(asn1.Ber.BitString, true); - if (sigData[0] === 0) - sigData = sigData.slice(1); - var algParts = sigAlg.split('-'); - - sig.signature = Signature.parse(sigData, algParts[0], 'asn1'); - sig.signature.hashAlgorithm = algParts[1]; - sig.algo = sigAlg; - sig.cache = buf.slice(tbsStart, tbsEnd); - - return (new Certificate(cert)); -} - -function readDate(der) { - if (der.peek() === asn1.Ber.UTCTime) { - return (utcTimeToDate(der.readString(asn1.Ber.UTCTime))); - } else if (der.peek() === asn1.Ber.GeneralizedTime) { - return (gTimeToDate(der.readString(asn1.Ber.GeneralizedTime))); - } else { - throw (new Error('Unsupported date format')); - } -} - -function writeDate(der, date) { - if (date.getUTCFullYear() >= 2050 || date.getUTCFullYear() < 1950) { - der.writeString(dateToGTime(date), asn1.Ber.GeneralizedTime); - } else { - der.writeString(dateToUTCTime(date), asn1.Ber.UTCTime); - } -} - -/* RFC5280, section 4.2.1.6 (GeneralName type) */ -var ALTNAME = { - OtherName: Local(0), - RFC822Name: Context(1), - DNSName: Context(2), - X400Address: Local(3), - DirectoryName: Local(4), - EDIPartyName: Local(5), - URI: Context(6), - IPAddress: Context(7), - OID: Context(8) -}; - -/* RFC5280, section 4.2.1.12 (KeyPurposeId) */ -var EXTPURPOSE = { - 'serverAuth': '1.3.6.1.5.5.7.3.1', - 'clientAuth': '1.3.6.1.5.5.7.3.2', - 'codeSigning': '1.3.6.1.5.5.7.3.3', - - /* See https://github.com/joyent/oid-docs/blob/master/root.md */ - 'joyentDocker': '1.3.6.1.4.1.38678.1.4.1', - 'joyentCmon': '1.3.6.1.4.1.38678.1.4.2' -}; -var EXTPURPOSE_REV = {}; -Object.keys(EXTPURPOSE).forEach(function (k) { - EXTPURPOSE_REV[EXTPURPOSE[k]] = k; -}); - -var KEYUSEBITS = [ - 'signature', 'identity', 'keyEncryption', - 'encryption', 'keyAgreement', 'ca', 'crl' -]; - -function readExtension(cert, buf, der) { - der.readSequence(); - var after = der.offset + der.length; - var extId = der.readOID(); - var id; - var sig = cert.signatures.x509; - if (!sig.extras.exts) - sig.extras.exts = []; - - var critical; - if (der.peek() === asn1.Ber.Boolean) - critical = der.readBoolean(); - - switch (extId) { - case (EXTS.basicConstraints): - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - var bcEnd = der.offset + der.length; - var ca = false; - if (der.peek() === asn1.Ber.Boolean) - ca = der.readBoolean(); - if (cert.purposes === undefined) - cert.purposes = []; - if (ca === true) - cert.purposes.push('ca'); - var bc = { oid: extId, critical: critical }; - if (der.offset < bcEnd && der.peek() === asn1.Ber.Integer) - bc.pathLen = der.readInt(); - sig.extras.exts.push(bc); - break; - case (EXTS.extKeyUsage): - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - if (cert.purposes === undefined) - cert.purposes = []; - var ekEnd = der.offset + der.length; - while (der.offset < ekEnd) { - var oid = der.readOID(); - cert.purposes.push(EXTPURPOSE_REV[oid] || oid); - } - /* - * This is a bit of a hack: in the case where we have a cert - * that's only allowed to do serverAuth or clientAuth (and not - * the other), we want to make sure all our Subjects are of - * the right type. But we already parsed our Subjects and - * decided if they were hosts or users earlier (since it appears - * first in the cert). - * - * So we go through and mutate them into the right kind here if - * it doesn't match. This might not be hugely beneficial, as it - * seems that single-purpose certs are not often seen in the - * wild. - */ - if (cert.purposes.indexOf('serverAuth') !== -1 && - cert.purposes.indexOf('clientAuth') === -1) { - cert.subjects.forEach(function (ide) { - if (ide.type !== 'host') { - ide.type = 'host'; - ide.hostname = ide.uid || - ide.email || - ide.components[0].value; - } - }); - } else if (cert.purposes.indexOf('clientAuth') !== -1 && - cert.purposes.indexOf('serverAuth') === -1) { - cert.subjects.forEach(function (ide) { - if (ide.type !== 'user') { - ide.type = 'user'; - ide.uid = ide.hostname || - ide.email || - ide.components[0].value; - } - }); - } - sig.extras.exts.push({ oid: extId, critical: critical }); - break; - case (EXTS.keyUsage): - der.readSequence(asn1.Ber.OctetString); - var bits = der.readString(asn1.Ber.BitString, true); - var setBits = readBitField(bits, KEYUSEBITS); - setBits.forEach(function (bit) { - if (cert.purposes === undefined) - cert.purposes = []; - if (cert.purposes.indexOf(bit) === -1) - cert.purposes.push(bit); - }); - sig.extras.exts.push({ oid: extId, critical: critical, - bits: bits }); - break; - case (EXTS.altName): - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - var aeEnd = der.offset + der.length; - while (der.offset < aeEnd) { - switch (der.peek()) { - case ALTNAME.OtherName: - case ALTNAME.EDIPartyName: - der.readSequence(); - der._offset += der.length; - break; - case ALTNAME.OID: - der.readOID(ALTNAME.OID); - break; - case ALTNAME.RFC822Name: - /* RFC822 specifies email addresses */ - var email = der.readString(ALTNAME.RFC822Name); - id = Identity.forEmail(email); - if (!cert.subjects[0].equals(id)) - cert.subjects.push(id); - break; - case ALTNAME.DirectoryName: - der.readSequence(ALTNAME.DirectoryName); - id = Identity.parseAsn1(der); - if (!cert.subjects[0].equals(id)) - cert.subjects.push(id); - break; - case ALTNAME.DNSName: - var host = der.readString( - ALTNAME.DNSName); - id = Identity.forHost(host); - if (!cert.subjects[0].equals(id)) - cert.subjects.push(id); - break; - default: - der.readString(der.peek()); - break; - } - } - sig.extras.exts.push({ oid: extId, critical: critical }); - break; - default: - sig.extras.exts.push({ - oid: extId, - critical: critical, - data: der.readString(asn1.Ber.OctetString, true) - }); - break; - } - - der._offset = after; -} - -var UTCTIME_RE = - /^([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; -function utcTimeToDate(t) { - var m = t.match(UTCTIME_RE); - assert.ok(m, 'timestamps must be in UTC'); - var d = new Date(); - - var thisYear = d.getUTCFullYear(); - var century = Math.floor(thisYear / 100) * 100; - - var year = parseInt(m[1], 10); - if (thisYear % 100 < 50 && year >= 60) - year += (century - 1); - else - year += century; - d.setUTCFullYear(year, parseInt(m[2], 10) - 1, parseInt(m[3], 10)); - d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); - if (m[6] && m[6].length > 0) - d.setUTCSeconds(parseInt(m[6], 10)); - return (d); -} - -var GTIME_RE = - /^([0-9]{4})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; -function gTimeToDate(t) { - var m = t.match(GTIME_RE); - assert.ok(m); - var d = new Date(); - - d.setUTCFullYear(parseInt(m[1], 10), parseInt(m[2], 10) - 1, - parseInt(m[3], 10)); - d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); - if (m[6] && m[6].length > 0) - d.setUTCSeconds(parseInt(m[6], 10)); - return (d); -} - -function zeroPad(n, m) { - if (m === undefined) - m = 2; - var s = '' + n; - while (s.length < m) - s = '0' + s; - return (s); -} - -function dateToUTCTime(d) { - var s = ''; - s += zeroPad(d.getUTCFullYear() % 100); - s += zeroPad(d.getUTCMonth() + 1); - s += zeroPad(d.getUTCDate()); - s += zeroPad(d.getUTCHours()); - s += zeroPad(d.getUTCMinutes()); - s += zeroPad(d.getUTCSeconds()); - s += 'Z'; - return (s); -} - -function dateToGTime(d) { - var s = ''; - s += zeroPad(d.getUTCFullYear(), 4); - s += zeroPad(d.getUTCMonth() + 1); - s += zeroPad(d.getUTCDate()); - s += zeroPad(d.getUTCHours()); - s += zeroPad(d.getUTCMinutes()); - s += zeroPad(d.getUTCSeconds()); - s += 'Z'; - return (s); -} - -function sign(cert, key) { - if (cert.signatures.x509 === undefined) - cert.signatures.x509 = {}; - var sig = cert.signatures.x509; - - sig.algo = key.type + '-' + key.defaultHashAlgorithm(); - if (SIGN_ALGS[sig.algo] === undefined) - return (false); - - var der = new asn1.BerWriter(); - writeTBSCert(cert, der); - var blob = der.buffer; - sig.cache = blob; - - var signer = key.createSign(); - signer.write(blob); - cert.signatures.x509.signature = signer.sign(); - - return (true); -} - -function signAsync(cert, signer, done) { - if (cert.signatures.x509 === undefined) - cert.signatures.x509 = {}; - var sig = cert.signatures.x509; - - var der = new asn1.BerWriter(); - writeTBSCert(cert, der); - var blob = der.buffer; - sig.cache = blob; - - signer(blob, function (err, signature) { - if (err) { - done(err); - return; - } - sig.algo = signature.type + '-' + signature.hashAlgorithm; - if (SIGN_ALGS[sig.algo] === undefined) { - done(new Error('Invalid signing algorithm "' + - sig.algo + '"')); - return; - } - sig.signature = signature; - done(); - }); -} - -function write(cert, options) { - var sig = cert.signatures.x509; - assert.object(sig, 'x509 signature'); - - var der = new asn1.BerWriter(); - der.startSequence(); - if (sig.cache) { - der._ensure(sig.cache.length); - sig.cache.copy(der._buf, der._offset); - der._offset += sig.cache.length; - } else { - writeTBSCert(cert, der); - } - - der.startSequence(); - der.writeOID(SIGN_ALGS[sig.algo]); - if (sig.algo.match(/^rsa-/)) - der.writeNull(); - der.endSequence(); - - var sigData = sig.signature.toBuffer('asn1'); - var data = Buffer.alloc(sigData.length + 1); - data[0] = 0; - sigData.copy(data, 1); - der.writeBuffer(data, asn1.Ber.BitString); - der.endSequence(); - - return (der.buffer); -} - -function writeTBSCert(cert, der) { - var sig = cert.signatures.x509; - assert.object(sig, 'x509 signature'); - - der.startSequence(); - - der.startSequence(Local(0)); - der.writeInt(2); - der.endSequence(); - - der.writeBuffer(utils.mpNormalize(cert.serial), asn1.Ber.Integer); - - der.startSequence(); - der.writeOID(SIGN_ALGS[sig.algo]); - if (sig.algo.match(/^rsa-/)) - der.writeNull(); - der.endSequence(); - - cert.issuer.toAsn1(der); - - der.startSequence(); - writeDate(der, cert.validFrom); - writeDate(der, cert.validUntil); - der.endSequence(); - - var subject = cert.subjects[0]; - var altNames = cert.subjects.slice(1); - subject.toAsn1(der); - - pkcs8.writePkcs8(der, cert.subjectKey); - - if (sig.extras && sig.extras.issuerUniqueID) { - der.writeBuffer(sig.extras.issuerUniqueID, Local(1)); - } - - if (sig.extras && sig.extras.subjectUniqueID) { - der.writeBuffer(sig.extras.subjectUniqueID, Local(2)); - } - - if (altNames.length > 0 || subject.type === 'host' || - (cert.purposes !== undefined && cert.purposes.length > 0) || - (sig.extras && sig.extras.exts)) { - der.startSequence(Local(3)); - der.startSequence(); - - var exts = []; - if (cert.purposes !== undefined && cert.purposes.length > 0) { - exts.push({ - oid: EXTS.basicConstraints, - critical: true - }); - exts.push({ - oid: EXTS.keyUsage, - critical: true - }); - exts.push({ - oid: EXTS.extKeyUsage, - critical: true - }); - } - exts.push({ oid: EXTS.altName }); - if (sig.extras && sig.extras.exts) - exts = sig.extras.exts; - - for (var i = 0; i < exts.length; ++i) { - der.startSequence(); - der.writeOID(exts[i].oid); - - if (exts[i].critical !== undefined) - der.writeBoolean(exts[i].critical); - - if (exts[i].oid === EXTS.altName) { - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - if (subject.type === 'host') { - der.writeString(subject.hostname, - Context(2)); - } - for (var j = 0; j < altNames.length; ++j) { - if (altNames[j].type === 'host') { - der.writeString( - altNames[j].hostname, - ALTNAME.DNSName); - } else if (altNames[j].type === - 'email') { - der.writeString( - altNames[j].email, - ALTNAME.RFC822Name); - } else { - /* - * Encode anything else as a - * DN style name for now. - */ - der.startSequence( - ALTNAME.DirectoryName); - altNames[j].toAsn1(der); - der.endSequence(); - } - } - der.endSequence(); - der.endSequence(); - } else if (exts[i].oid === EXTS.basicConstraints) { - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - var ca = (cert.purposes.indexOf('ca') !== -1); - var pathLen = exts[i].pathLen; - der.writeBoolean(ca); - if (pathLen !== undefined) - der.writeInt(pathLen); - der.endSequence(); - der.endSequence(); - } else if (exts[i].oid === EXTS.extKeyUsage) { - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - cert.purposes.forEach(function (purpose) { - if (purpose === 'ca') - return; - if (KEYUSEBITS.indexOf(purpose) !== -1) - return; - var oid = purpose; - if (EXTPURPOSE[purpose] !== undefined) - oid = EXTPURPOSE[purpose]; - der.writeOID(oid); - }); - der.endSequence(); - der.endSequence(); - } else if (exts[i].oid === EXTS.keyUsage) { - der.startSequence(asn1.Ber.OctetString); - /* - * If we parsed this certificate from a byte - * stream (i.e. we didn't generate it in sshpk) - * then we'll have a ".bits" property on the - * ext with the original raw byte contents. - * - * If we have this, use it here instead of - * regenerating it. This guarantees we output - * the same data we parsed, so signatures still - * validate. - */ - if (exts[i].bits !== undefined) { - der.writeBuffer(exts[i].bits, - asn1.Ber.BitString); - } else { - var bits = writeBitField(cert.purposes, - KEYUSEBITS); - der.writeBuffer(bits, - asn1.Ber.BitString); - } - der.endSequence(); - } else { - der.writeBuffer(exts[i].data, - asn1.Ber.OctetString); - } - - der.endSequence(); - } - - der.endSequence(); - der.endSequence(); - } - - der.endSequence(); -} - -/* - * Reads an ASN.1 BER bitfield out of the Buffer produced by doing - * `BerReader#readString(asn1.Ber.BitString)`. That function gives us the raw - * contents of the BitString tag, which is a count of unused bits followed by - * the bits as a right-padded byte string. - * - * `bits` is the Buffer, `bitIndex` should contain an array of string names - * for the bits in the string, ordered starting with bit #0 in the ASN.1 spec. - * - * Returns an array of Strings, the names of the bits that were set to 1. - */ -function readBitField(bits, bitIndex) { - var bitLen = 8 * (bits.length - 1) - bits[0]; - var setBits = {}; - for (var i = 0; i < bitLen; ++i) { - var byteN = 1 + Math.floor(i / 8); - var bit = 7 - (i % 8); - var mask = 1 << bit; - var bitVal = ((bits[byteN] & mask) !== 0); - var name = bitIndex[i]; - if (bitVal && typeof (name) === 'string') { - setBits[name] = true; - } - } - return (Object.keys(setBits)); -} - -/* - * `setBits` is an array of strings, containing the names for each bit that - * sould be set to 1. `bitIndex` is same as in `readBitField()`. - * - * Returns a Buffer, ready to be written out with `BerWriter#writeString()`. - */ -function writeBitField(setBits, bitIndex) { - var bitLen = bitIndex.length; - var blen = Math.ceil(bitLen / 8); - var unused = blen * 8 - bitLen; - var bits = Buffer.alloc(1 + blen); // zero-filled - bits[0] = unused; - for (var i = 0; i < bitLen; ++i) { - var byteN = 1 + Math.floor(i / 8); - var bit = 7 - (i % 8); - var mask = 1 << bit; - var name = bitIndex[i]; - if (name === undefined) - continue; - var bitVal = (setBits.indexOf(name) !== -1); - if (bitVal) { - bits[byteN] |= mask; - } - } - return (bits); -} - - -/***/ }), -/* 350 */, -/* 351 */, -/* 352 */, -/* 353 */, -/* 354 */, -/* 355 */, -/* 356 */, -/* 357 */ -/***/ (function(module) { - -module.exports = require("assert"); - -/***/ }), -/* 358 */, -/* 359 */ -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_pattern(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $regexp = $isData ? '(new RegExp(' + $schemaValue + '))' : it.usePattern($schema); - out += 'if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; - } - out += ' !' + ($regexp) + '.test(' + ($data) + ') ) { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('pattern') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { pattern: '; - if ($isData) { - out += '' + ($schemaValue); - } else { - out += '' + (it.util.toQuotedString($schema)); - } - out += ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should match pattern "'; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + (it.util.escapeQuotes($schema)); - } - out += '"\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + (it.util.toQuotedString($schema)); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), -/* 360 */, -/* 361 */, -/* 362 */ -/***/ (function(module) { - -// Copyright 2011 Mark Cavage All rights reserved. - - -module.exports = { - EOC: 0, - Boolean: 1, - Integer: 2, - BitString: 3, - OctetString: 4, - Null: 5, - OID: 6, - ObjectDescriptor: 7, - External: 8, - Real: 9, // float - Enumeration: 10, - PDV: 11, - Utf8String: 12, - RelativeOID: 13, - Sequence: 16, - Set: 17, - NumericString: 18, - PrintableString: 19, - T61String: 20, - VideotexString: 21, - IA5String: 22, - UTCTime: 23, - GeneralizedTime: 24, - GraphicString: 25, - VisibleString: 26, - GeneralString: 28, - UniversalString: 29, - CharacterString: 30, - BMPString: 31, - Constructor: 32, - Context: 128 -}; - - -/***/ }), -/* 363 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - Verifier: Verifier, - Signer: Signer -}; - -var nacl = __webpack_require__(196); -var stream = __webpack_require__(413); -var util = __webpack_require__(669); -var assert = __webpack_require__(477); -var Buffer = __webpack_require__(215).Buffer; -var Signature = __webpack_require__(575); - -function Verifier(key, hashAlgo) { - if (hashAlgo.toLowerCase() !== 'sha512') - throw (new Error('ED25519 only supports the use of ' + - 'SHA-512 hashes')); - - this.key = key; - this.chunks = []; - - stream.Writable.call(this, {}); -} -util.inherits(Verifier, stream.Writable); - -Verifier.prototype._write = function (chunk, enc, cb) { - this.chunks.push(chunk); - cb(); -}; - -Verifier.prototype.update = function (chunk) { - if (typeof (chunk) === 'string') - chunk = Buffer.from(chunk, 'binary'); - this.chunks.push(chunk); -}; - -Verifier.prototype.verify = function (signature, fmt) { - var sig; - if (Signature.isSignature(signature, [2, 0])) { - if (signature.type !== 'ed25519') - return (false); - sig = signature.toBuffer('raw'); - - } else if (typeof (signature) === 'string') { - sig = Buffer.from(signature, 'base64'); - - } else if (Signature.isSignature(signature, [1, 0])) { - throw (new Error('signature was created by too old ' + - 'a version of sshpk and cannot be verified')); - } - - assert.buffer(sig); - return (nacl.sign.detached.verify( - new Uint8Array(Buffer.concat(this.chunks)), - new Uint8Array(sig), - new Uint8Array(this.key.part.A.data))); -}; - -function Signer(key, hashAlgo) { - if (hashAlgo.toLowerCase() !== 'sha512') - throw (new Error('ED25519 only supports the use of ' + - 'SHA-512 hashes')); - - this.key = key; - this.chunks = []; - - stream.Writable.call(this, {}); -} -util.inherits(Signer, stream.Writable); - -Signer.prototype._write = function (chunk, enc, cb) { - this.chunks.push(chunk); - cb(); -}; - -Signer.prototype.update = function (chunk) { - if (typeof (chunk) === 'string') - chunk = Buffer.from(chunk, 'binary'); - this.chunks.push(chunk); -}; - -Signer.prototype.sign = function () { - var sig = nacl.sign.detached( - new Uint8Array(Buffer.concat(this.chunks)), - new Uint8Array(Buffer.concat([ - this.key.part.k.data, this.key.part.A.data]))); - var sigBuf = Buffer.from(sig); - var sigObj = Signature.parse(sigBuf, 'ed25519', 'raw'); - sigObj.hashAlgorithm = 'sha512'; - return (sigObj); -}; - - -/***/ }), -/* 364 */, -/* 365 */, -/* 366 */, -/* 367 */, -/* 368 */, -/* 369 */, -/* 370 */, -/* 371 */, -/* 372 */, -/* 373 */, -/* 374 */ -/***/ (function(module) { - -"use strict"; - - -var hasOwn = Object.prototype.hasOwnProperty; -var toStr = Object.prototype.toString; -var defineProperty = Object.defineProperty; -var gOPD = Object.getOwnPropertyDescriptor; - -var isArray = function isArray(arr) { - if (typeof Array.isArray === 'function') { - return Array.isArray(arr); - } - - return toStr.call(arr) === '[object Array]'; -}; - -var isPlainObject = function isPlainObject(obj) { - if (!obj || toStr.call(obj) !== '[object Object]') { - return false; - } - - var hasOwnConstructor = hasOwn.call(obj, 'constructor'); - var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf'); - // Not own constructor property must be Object - if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) { - return false; - } - - // Own properties are enumerated firstly, so to speed up, - // if last one is own, then all properties are own. - var key; - for (key in obj) { /**/ } - - return typeof key === 'undefined' || hasOwn.call(obj, key); -}; - -// If name is '__proto__', and Object.defineProperty is available, define __proto__ as an own property on target -var setProperty = function setProperty(target, options) { - if (defineProperty && options.name === '__proto__') { - defineProperty(target, options.name, { - enumerable: true, - configurable: true, - value: options.newValue, - writable: true - }); - } else { - target[options.name] = options.newValue; - } -}; - -// Return undefined instead of __proto__ if '__proto__' is not an own property -var getProperty = function getProperty(obj, name) { - if (name === '__proto__') { - if (!hasOwn.call(obj, name)) { - return void 0; - } else if (gOPD) { - // In early versions of node, obj['__proto__'] is buggy when obj has - // __proto__ as an own property. Object.getOwnPropertyDescriptor() works. - return gOPD(obj, name).value; - } - } - - return obj[name]; -}; - -module.exports = function extend() { - var options, name, src, copy, copyIsArray, clone; - var target = arguments[0]; - var i = 1; - var length = arguments.length; - var deep = false; - - // Handle a deep copy situation - if (typeof target === 'boolean') { - deep = target; - target = arguments[1] || {}; - // skip the boolean and the target - i = 2; - } - if (target == null || (typeof target !== 'object' && typeof target !== 'function')) { - target = {}; - } - - for (; i < length; ++i) { - options = arguments[i]; - // Only deal with non-null/undefined values - if (options != null) { - // Extend the base object - for (name in options) { - src = getProperty(target, name); - copy = getProperty(options, name); - - // Prevent never-ending loop - if (target !== copy) { - // Recurse if we're merging plain objects or arrays - if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) { - if (copyIsArray) { - copyIsArray = false; - clone = src && isArray(src) ? src : []; - } else { - clone = src && isPlainObject(src) ? src : {}; - } - - // Never move original objects, clone them - setProperty(target, { name: name, newValue: extend(deep, clone, copy) }); - - // Don't bring in undefined values - } else if (typeof copy !== 'undefined') { - setProperty(target, { name: name, newValue: copy }); - } - } - } - } - } - - // Return the modified object - return target; -}; - - -/***/ }), -/* 375 */, -/* 376 */, -/* 377 */, -/* 378 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = Identity; - -var assert = __webpack_require__(477); -var algs = __webpack_require__(98); -var crypto = __webpack_require__(417); -var Fingerprint = __webpack_require__(400); -var Signature = __webpack_require__(575); -var errs = __webpack_require__(753); -var util = __webpack_require__(669); -var utils = __webpack_require__(270); -var asn1 = __webpack_require__(62); -var Buffer = __webpack_require__(215).Buffer; - -/*JSSTYLED*/ -var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; - -var oids = {}; -oids.cn = '2.5.4.3'; -oids.o = '2.5.4.10'; -oids.ou = '2.5.4.11'; -oids.l = '2.5.4.7'; -oids.s = '2.5.4.8'; -oids.c = '2.5.4.6'; -oids.sn = '2.5.4.4'; -oids.postalCode = '2.5.4.17'; -oids.serialNumber = '2.5.4.5'; -oids.street = '2.5.4.9'; -oids.x500UniqueIdentifier = '2.5.4.45'; -oids.role = '2.5.4.72'; -oids.telephoneNumber = '2.5.4.20'; -oids.description = '2.5.4.13'; -oids.dc = '0.9.2342.19200300.100.1.25'; -oids.uid = '0.9.2342.19200300.100.1.1'; -oids.mail = '0.9.2342.19200300.100.1.3'; -oids.title = '2.5.4.12'; -oids.gn = '2.5.4.42'; -oids.initials = '2.5.4.43'; -oids.pseudonym = '2.5.4.65'; -oids.emailAddress = '1.2.840.113549.1.9.1'; - -var unoids = {}; -Object.keys(oids).forEach(function (k) { - unoids[oids[k]] = k; -}); - -function Identity(opts) { - var self = this; - assert.object(opts, 'options'); - assert.arrayOfObject(opts.components, 'options.components'); - this.components = opts.components; - this.componentLookup = {}; - this.components.forEach(function (c) { - if (c.name && !c.oid) - c.oid = oids[c.name]; - if (c.oid && !c.name) - c.name = unoids[c.oid]; - if (self.componentLookup[c.name] === undefined) - self.componentLookup[c.name] = []; - self.componentLookup[c.name].push(c); - }); - if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { - this.cn = this.componentLookup.cn[0].value; - } - assert.optionalString(opts.type, 'options.type'); - if (opts.type === undefined) { - if (this.components.length === 1 && - this.componentLookup.cn && - this.componentLookup.cn.length === 1 && - this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { - this.type = 'host'; - this.hostname = this.componentLookup.cn[0].value; - - } else if (this.componentLookup.dc && - this.components.length === this.componentLookup.dc.length) { - this.type = 'host'; - this.hostname = this.componentLookup.dc.map( - function (c) { - return (c.value); - }).join('.'); - - } else if (this.componentLookup.uid && - this.components.length === - this.componentLookup.uid.length) { - this.type = 'user'; - this.uid = this.componentLookup.uid[0].value; - - } else if (this.componentLookup.cn && - this.componentLookup.cn.length === 1 && - this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { - this.type = 'host'; - this.hostname = this.componentLookup.cn[0].value; - - } else if (this.componentLookup.uid && - this.componentLookup.uid.length === 1) { - this.type = 'user'; - this.uid = this.componentLookup.uid[0].value; - - } else if (this.componentLookup.mail && - this.componentLookup.mail.length === 1) { - this.type = 'email'; - this.email = this.componentLookup.mail[0].value; - - } else if (this.componentLookup.cn && - this.componentLookup.cn.length === 1) { - this.type = 'user'; - this.uid = this.componentLookup.cn[0].value; - - } else { - this.type = 'unknown'; - } - } else { - this.type = opts.type; - if (this.type === 'host') - this.hostname = opts.hostname; - else if (this.type === 'user') - this.uid = opts.uid; - else if (this.type === 'email') - this.email = opts.email; - else - throw (new Error('Unknown type ' + this.type)); - } -} - -Identity.prototype.toString = function () { - return (this.components.map(function (c) { - var n = c.name.toUpperCase(); - /*JSSTYLED*/ - n = n.replace(/=/g, '\\='); - var v = c.value; - /*JSSTYLED*/ - v = v.replace(/,/g, '\\,'); - return (n + '=' + v); - }).join(', ')); -}; - -Identity.prototype.get = function (name, asArray) { - assert.string(name, 'name'); - var arr = this.componentLookup[name]; - if (arr === undefined || arr.length === 0) - return (undefined); - if (!asArray && arr.length > 1) - throw (new Error('Multiple values for attribute ' + name)); - if (!asArray) - return (arr[0].value); - return (arr.map(function (c) { - return (c.value); - })); -}; - -Identity.prototype.toArray = function (idx) { - return (this.components.map(function (c) { - return ({ - name: c.name, - value: c.value - }); - })); -}; - -/* - * These are from X.680 -- PrintableString allowed chars are in section 37.4 - * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to - * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 - * (the basic ASCII character set). - */ -/* JSSTYLED */ -var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; -/* JSSTYLED */ -var NOT_IA5 = /[^\x00-\x7f]/; - -Identity.prototype.toAsn1 = function (der, tag) { - der.startSequence(tag); - this.components.forEach(function (c) { - der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); - der.startSequence(); - der.writeOID(c.oid); - /* - * If we fit in a PrintableString, use that. Otherwise use an - * IA5String or UTF8String. - * - * If this identity was parsed from a DN, use the ASN.1 types - * from the original representation (otherwise this might not - * be a full match for the original in some validators). - */ - if (c.asn1type === asn1.Ber.Utf8String || - c.value.match(NOT_IA5)) { - var v = Buffer.from(c.value, 'utf8'); - der.writeBuffer(v, asn1.Ber.Utf8String); - - } else if (c.asn1type === asn1.Ber.IA5String || - c.value.match(NOT_PRINTABLE)) { - der.writeString(c.value, asn1.Ber.IA5String); - - } else { - var type = asn1.Ber.PrintableString; - if (c.asn1type !== undefined) - type = c.asn1type; - der.writeString(c.value, type); - } - der.endSequence(); - der.endSequence(); - }); - der.endSequence(); -}; - -function globMatch(a, b) { - if (a === '**' || b === '**') - return (true); - var aParts = a.split('.'); - var bParts = b.split('.'); - if (aParts.length !== bParts.length) - return (false); - for (var i = 0; i < aParts.length; ++i) { - if (aParts[i] === '*' || bParts[i] === '*') - continue; - if (aParts[i] !== bParts[i]) - return (false); - } - return (true); -} - -Identity.prototype.equals = function (other) { - if (!Identity.isIdentity(other, [1, 0])) - return (false); - if (other.components.length !== this.components.length) - return (false); - for (var i = 0; i < this.components.length; ++i) { - if (this.components[i].oid !== other.components[i].oid) - return (false); - if (!globMatch(this.components[i].value, - other.components[i].value)) { - return (false); - } - } - return (true); -}; - -Identity.forHost = function (hostname) { - assert.string(hostname, 'hostname'); - return (new Identity({ - type: 'host', - hostname: hostname, - components: [ { name: 'cn', value: hostname } ] - })); -}; - -Identity.forUser = function (uid) { - assert.string(uid, 'uid'); - return (new Identity({ - type: 'user', - uid: uid, - components: [ { name: 'uid', value: uid } ] - })); -}; - -Identity.forEmail = function (email) { - assert.string(email, 'email'); - return (new Identity({ - type: 'email', - email: email, - components: [ { name: 'mail', value: email } ] - })); -}; - -Identity.parseDN = function (dn) { - assert.string(dn, 'dn'); - var parts = ['']; - var idx = 0; - var rem = dn; - while (rem.length > 0) { - var m; - /*JSSTYLED*/ - if ((m = /^,/.exec(rem)) !== null) { - parts[++idx] = ''; - rem = rem.slice(m[0].length); - /*JSSTYLED*/ - } else if ((m = /^\\,/.exec(rem)) !== null) { - parts[idx] += ','; - rem = rem.slice(m[0].length); - /*JSSTYLED*/ - } else if ((m = /^\\./.exec(rem)) !== null) { - parts[idx] += m[0]; - rem = rem.slice(m[0].length); - /*JSSTYLED*/ - } else if ((m = /^[^\\,]+/.exec(rem)) !== null) { - parts[idx] += m[0]; - rem = rem.slice(m[0].length); - } else { - throw (new Error('Failed to parse DN')); - } - } - var cmps = parts.map(function (c) { - c = c.trim(); - var eqPos = c.indexOf('='); - while (eqPos > 0 && c.charAt(eqPos - 1) === '\\') - eqPos = c.indexOf('=', eqPos + 1); - if (eqPos === -1) { - throw (new Error('Failed to parse DN')); - } - /*JSSTYLED*/ - var name = c.slice(0, eqPos).toLowerCase().replace(/\\=/g, '='); - var value = c.slice(eqPos + 1); - return ({ name: name, value: value }); - }); - return (new Identity({ components: cmps })); -}; - -Identity.fromArray = function (components) { - assert.arrayOfObject(components, 'components'); - components.forEach(function (cmp) { - assert.object(cmp, 'component'); - assert.string(cmp.name, 'component.name'); - if (!Buffer.isBuffer(cmp.value) && - !(typeof (cmp.value) === 'string')) { - throw (new Error('Invalid component value')); - } - }); - return (new Identity({ components: components })); -}; - -Identity.parseAsn1 = function (der, top) { - var components = []; - der.readSequence(top); - var end = der.offset + der.length; - while (der.offset < end) { - der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); - var after = der.offset + der.length; - der.readSequence(); - var oid = der.readOID(); - var type = der.peek(); - var value; - switch (type) { - case asn1.Ber.PrintableString: - case asn1.Ber.IA5String: - case asn1.Ber.OctetString: - case asn1.Ber.T61String: - value = der.readString(type); - break; - case asn1.Ber.Utf8String: - value = der.readString(type, true); - value = value.toString('utf8'); - break; - case asn1.Ber.CharacterString: - case asn1.Ber.BMPString: - value = der.readString(type, true); - value = value.toString('utf16le'); - break; - default: - throw (new Error('Unknown asn1 type ' + type)); - } - components.push({ oid: oid, asn1type: type, value: value }); - der._offset = after; - } - der._offset = end; - return (new Identity({ - components: components - })); -}; - -Identity.isIdentity = function (obj, ver) { - return (utils.isCompatible(obj, Identity, ver)); -}; - -/* - * API versions for Identity: - * [1,0] -- initial ver - */ -Identity.prototype._sshpkApiVersion = [1, 0]; - -Identity._oldVersionDetect = function (obj) { - return ([1, 0]); -}; - - -/***/ }), -/* 379 */, -/* 380 */ -/***/ (function(module) { - -module.exports = {"$id":"request.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["method","url","httpVersion","cookies","headers","queryString","headersSize","bodySize"],"properties":{"method":{"type":"string"},"url":{"type":"string","format":"uri"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"queryString":{"type":"array","items":{"$ref":"query.json#"}},"postData":{"$ref":"postData.json#"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; - -/***/ }), -/* 381 */, -/* 382 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -var stream = __webpack_require__(413) - - -function isStream (obj) { - return obj instanceof stream.Stream -} - - -function isReadable (obj) { - return isStream(obj) && typeof obj._read == 'function' && typeof obj._readableState == 'object' -} - - -function isWritable (obj) { - return isStream(obj) && typeof obj._write == 'function' && typeof obj._writableState == 'object' -} - - -function isDuplex (obj) { - return isReadable(obj) && isWritable(obj) -} - - -module.exports = isStream -module.exports.isReadable = isReadable -module.exports.isWritable = isWritable -module.exports.isDuplex = isDuplex - - -/***/ }), -/* 383 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -//all requires must be explicit because browserify won't work with dynamic requires -module.exports = { - '$ref': __webpack_require__(266), - allOf: __webpack_require__(107), - anyOf: __webpack_require__(902), - '$comment': __webpack_require__(28), - const: __webpack_require__(662), - contains: __webpack_require__(154), - dependencies: __webpack_require__(233), - 'enum': __webpack_require__(281), - format: __webpack_require__(687), - 'if': __webpack_require__(479), - items: __webpack_require__(643), - maximum: __webpack_require__(341), - minimum: __webpack_require__(341), - maxItems: __webpack_require__(85), - minItems: __webpack_require__(85), - maxLength: __webpack_require__(772), - minLength: __webpack_require__(772), - maxProperties: __webpack_require__(560), - minProperties: __webpack_require__(560), - multipleOf: __webpack_require__(397), - not: __webpack_require__(673), - oneOf: __webpack_require__(653), - pattern: __webpack_require__(359), - properties: __webpack_require__(343), - propertyNames: __webpack_require__(35), - required: __webpack_require__(858), - uniqueItems: __webpack_require__(899), - validate: __webpack_require__(967) -}; - - -/***/ }), -/* 384 */, -/* 385 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, '__esModule', { value: true }); - -var isPlainObject = __webpack_require__(3); -var universalUserAgent = __webpack_require__(796); - -function lowercaseKeys(object) { - if (!object) { - return {}; - } - - return Object.keys(object).reduce((newObj, key) => { - newObj[key.toLowerCase()] = object[key]; - return newObj; - }, {}); -} - -function mergeDeep(defaults, options) { - const result = Object.assign({}, defaults); - Object.keys(options).forEach(key => { - if (isPlainObject.isPlainObject(options[key])) { - if (!(key in defaults)) Object.assign(result, { - [key]: options[key] - });else result[key] = mergeDeep(defaults[key], options[key]); - } else { - Object.assign(result, { - [key]: options[key] - }); - } - }); - return result; -} - -function removeUndefinedProperties(obj) { - for (const key in obj) { - if (obj[key] === undefined) { - delete obj[key]; - } - } - - return obj; -} - -function merge(defaults, route, options) { - if (typeof route === "string") { - let [method, url] = route.split(" "); - options = Object.assign(url ? { - method, - url - } : { - url: method - }, options); - } else { - options = Object.assign({}, route); - } // lowercase header names before merging with defaults to avoid duplicates - - - options.headers = lowercaseKeys(options.headers); // remove properties with undefined values before merging - - removeUndefinedProperties(options); - removeUndefinedProperties(options.headers); - const mergedOptions = mergeDeep(defaults || {}, options); // mediaType.previews arrays are merged, instead of overwritten - - if (defaults && defaults.mediaType.previews.length) { - mergedOptions.mediaType.previews = defaults.mediaType.previews.filter(preview => !mergedOptions.mediaType.previews.includes(preview)).concat(mergedOptions.mediaType.previews); - } - - mergedOptions.mediaType.previews = mergedOptions.mediaType.previews.map(preview => preview.replace(/-preview/, "")); - return mergedOptions; -} - -function addQueryParameters(url, parameters) { - const separator = /\?/.test(url) ? "&" : "?"; - const names = Object.keys(parameters); - - if (names.length === 0) { - return url; - } - - return url + separator + names.map(name => { - if (name === "q") { - return "q=" + parameters.q.split("+").map(encodeURIComponent).join("+"); - } - - return `${name}=${encodeURIComponent(parameters[name])}`; - }).join("&"); -} - -const urlVariableRegex = /\{[^}]+\}/g; - -function removeNonChars(variableName) { - return variableName.replace(/^\W+|\W+$/g, "").split(/,/); -} - -function extractUrlVariableNames(url) { - const matches = url.match(urlVariableRegex); - - if (!matches) { - return []; - } - - return matches.map(removeNonChars).reduce((a, b) => a.concat(b), []); -} - -function omit(object, keysToOmit) { - return Object.keys(object).filter(option => !keysToOmit.includes(option)).reduce((obj, key) => { - obj[key] = object[key]; - return obj; - }, {}); -} - -// Based on https://github.com/bramstein/url-template, licensed under BSD -// TODO: create separate package. -// -// Copyright (c) 2012-2014, Bram Stein -// All rights reserved. -// Redistribution and use in source and binary forms, with or without -// modification, are permitted provided that the following conditions -// are met: -// 1. Redistributions of source code must retain the above copyright -// notice, this list of conditions and the following disclaimer. -// 2. Redistributions in binary form must reproduce the above copyright -// notice, this list of conditions and the following disclaimer in the -// documentation and/or other materials provided with the distribution. -// 3. The name of the author may not be used to endorse or promote products -// derived from this software without specific prior written permission. -// THIS SOFTWARE IS PROVIDED BY THE AUTHOR "AS IS" AND ANY EXPRESS OR IMPLIED -// WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF -// MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO -// EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, -// INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, -// BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, -// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY -// OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING -// NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, -// EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - -/* istanbul ignore file */ -function encodeReserved(str) { - return str.split(/(%[0-9A-Fa-f]{2})/g).map(function (part) { - if (!/%[0-9A-Fa-f]/.test(part)) { - part = encodeURI(part).replace(/%5B/g, "[").replace(/%5D/g, "]"); - } - - return part; - }).join(""); -} - -function encodeUnreserved(str) { - return encodeURIComponent(str).replace(/[!'()*]/g, function (c) { - return "%" + c.charCodeAt(0).toString(16).toUpperCase(); - }); -} - -function encodeValue(operator, value, key) { - value = operator === "+" || operator === "#" ? encodeReserved(value) : encodeUnreserved(value); - - if (key) { - return encodeUnreserved(key) + "=" + value; - } else { - return value; - } -} - -function isDefined(value) { - return value !== undefined && value !== null; -} - -function isKeyOperator(operator) { - return operator === ";" || operator === "&" || operator === "?"; -} - -function getValues(context, operator, key, modifier) { - var value = context[key], - result = []; - - if (isDefined(value) && value !== "") { - if (typeof value === "string" || typeof value === "number" || typeof value === "boolean") { - value = value.toString(); - - if (modifier && modifier !== "*") { - value = value.substring(0, parseInt(modifier, 10)); - } - - result.push(encodeValue(operator, value, isKeyOperator(operator) ? key : "")); - } else { - if (modifier === "*") { - if (Array.isArray(value)) { - value.filter(isDefined).forEach(function (value) { - result.push(encodeValue(operator, value, isKeyOperator(operator) ? key : "")); - }); - } else { - Object.keys(value).forEach(function (k) { - if (isDefined(value[k])) { - result.push(encodeValue(operator, value[k], k)); - } - }); - } - } else { - const tmp = []; - - if (Array.isArray(value)) { - value.filter(isDefined).forEach(function (value) { - tmp.push(encodeValue(operator, value)); - }); - } else { - Object.keys(value).forEach(function (k) { - if (isDefined(value[k])) { - tmp.push(encodeUnreserved(k)); - tmp.push(encodeValue(operator, value[k].toString())); - } - }); - } - - if (isKeyOperator(operator)) { - result.push(encodeUnreserved(key) + "=" + tmp.join(",")); - } else if (tmp.length !== 0) { - result.push(tmp.join(",")); - } - } - } - } else { - if (operator === ";") { - if (isDefined(value)) { - result.push(encodeUnreserved(key)); - } - } else if (value === "" && (operator === "&" || operator === "?")) { - result.push(encodeUnreserved(key) + "="); - } else if (value === "") { - result.push(""); - } - } - - return result; -} - -function parseUrl(template) { - return { - expand: expand.bind(null, template) - }; -} - -function expand(template, context) { - var operators = ["+", "#", ".", "/", ";", "?", "&"]; - return template.replace(/\{([^\{\}]+)\}|([^\{\}]+)/g, function (_, expression, literal) { - if (expression) { - let operator = ""; - const values = []; - - if (operators.indexOf(expression.charAt(0)) !== -1) { - operator = expression.charAt(0); - expression = expression.substr(1); - } - - expression.split(/,/g).forEach(function (variable) { - var tmp = /([^:\*]*)(?::(\d+)|(\*))?/.exec(variable); - values.push(getValues(context, operator, tmp[1], tmp[2] || tmp[3])); - }); - - if (operator && operator !== "+") { - var separator = ","; - - if (operator === "?") { - separator = "&"; - } else if (operator !== "#") { - separator = operator; - } - - return (values.length !== 0 ? operator : "") + values.join(separator); - } else { - return values.join(","); - } - } else { - return encodeReserved(literal); - } - }); -} - -function parse(options) { - // https://fetch.spec.whatwg.org/#methods - let method = options.method.toUpperCase(); // replace :varname with {varname} to make it RFC 6570 compatible - - let url = (options.url || "/").replace(/:([a-z]\w+)/g, "{$1}"); - let headers = Object.assign({}, options.headers); - let body; - let parameters = omit(options, ["method", "baseUrl", "url", "headers", "request", "mediaType"]); // extract variable names from URL to calculate remaining variables later - - const urlVariableNames = extractUrlVariableNames(url); - url = parseUrl(url).expand(parameters); - - if (!/^http/.test(url)) { - url = options.baseUrl + url; - } - - const omittedParameters = Object.keys(options).filter(option => urlVariableNames.includes(option)).concat("baseUrl"); - const remainingParameters = omit(parameters, omittedParameters); - const isBinaryRequest = /application\/octet-stream/i.test(headers.accept); - - if (!isBinaryRequest) { - if (options.mediaType.format) { - // e.g. application/vnd.github.v3+json => application/vnd.github.v3.raw - headers.accept = headers.accept.split(/,/).map(preview => preview.replace(/application\/vnd(\.\w+)(\.v3)?(\.\w+)?(\+json)?$/, `application/vnd$1$2.${options.mediaType.format}`)).join(","); - } - - if (options.mediaType.previews.length) { - const previewsFromAcceptHeader = headers.accept.match(/[\w-]+(?=-preview)/g) || []; - headers.accept = previewsFromAcceptHeader.concat(options.mediaType.previews).map(preview => { - const format = options.mediaType.format ? `.${options.mediaType.format}` : "+json"; - return `application/vnd.github.${preview}-preview${format}`; - }).join(","); - } - } // for GET/HEAD requests, set URL query parameters from remaining parameters - // for PATCH/POST/PUT/DELETE requests, set request body from remaining parameters - - - if (["GET", "HEAD"].includes(method)) { - url = addQueryParameters(url, remainingParameters); - } else { - if ("data" in remainingParameters) { - body = remainingParameters.data; - } else { - if (Object.keys(remainingParameters).length) { - body = remainingParameters; - } else { - headers["content-length"] = 0; - } - } - } // default content-type for JSON if body is set - - - if (!headers["content-type"] && typeof body !== "undefined") { - headers["content-type"] = "application/json; charset=utf-8"; - } // GitHub expects 'content-length: 0' header for PUT/PATCH requests without body. - // fetch does not allow to set `content-length` header, but we can set body to an empty string - - - if (["PATCH", "PUT"].includes(method) && typeof body === "undefined") { - body = ""; - } // Only return body/request keys if present - - - return Object.assign({ - method, - url, - headers - }, typeof body !== "undefined" ? { - body - } : null, options.request ? { - request: options.request - } : null); -} - -function endpointWithDefaults(defaults, route, options) { - return parse(merge(defaults, route, options)); -} - -function withDefaults(oldDefaults, newDefaults) { - const DEFAULTS = merge(oldDefaults, newDefaults); - const endpoint = endpointWithDefaults.bind(null, DEFAULTS); - return Object.assign(endpoint, { - DEFAULTS, - defaults: withDefaults.bind(null, DEFAULTS), - merge: merge.bind(null, DEFAULTS), - parse - }); -} - -const VERSION = "6.0.11"; - -const userAgent = `octokit-endpoint.js/${VERSION} ${universalUserAgent.getUserAgent()}`; // DEFAULTS has all properties set that EndpointOptions has, except url. -// So we use RequestParameters and add method as additional required property. - -const DEFAULTS = { - method: "GET", - baseUrl: "https://api.github.com", - headers: { - accept: "application/vnd.github.v3+json", - "user-agent": userAgent - }, - mediaType: { - format: "", - previews: [] - } -}; - -const endpoint = withDefaults(null, DEFAULTS); - -exports.endpoint = endpoint; -//# sourceMappingURL=index.js.map - - -/***/ }), -/* 386 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var stringify = __webpack_require__(897); -var parse = __webpack_require__(755); -var formats = __webpack_require__(13); - -module.exports = { - formats: formats, - parse: parse, - stringify: stringify -}; - - -/***/ }), -/* 387 */, -/* 388 */, -/* 389 */, -/* 390 */, -/* 391 */, -/* 392 */, -/* 393 */, -/* 394 */, -/* 395 */, -/* 396 */, -/* 397 */ -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_multipleOf(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - out += 'var division' + ($lvl) + ';if ('; - if ($isData) { - out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || '; - } - out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', '; - if (it.opts.multipleOfPrecision) { - out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' '; - } else { - out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') '; - } - out += ' ) '; - if ($isData) { - out += ' ) '; - } - out += ' ) { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be multiple of '; - if ($isData) { - out += '\' + ' + ($schemaValue); - } else { - out += '' + ($schemaValue) + '\''; - } - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), -/* 398 */, -/* 399 */, -/* 400 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2018 Joyent, Inc. - -module.exports = Fingerprint; - -var assert = __webpack_require__(477); -var Buffer = __webpack_require__(215).Buffer; -var algs = __webpack_require__(98); -var crypto = __webpack_require__(417); -var errs = __webpack_require__(753); -var Key = __webpack_require__(852); -var PrivateKey = __webpack_require__(502); -var Certificate = __webpack_require__(752); -var utils = __webpack_require__(270); - -var FingerprintFormatError = errs.FingerprintFormatError; -var InvalidAlgorithmError = errs.InvalidAlgorithmError; - -function Fingerprint(opts) { - assert.object(opts, 'options'); - assert.string(opts.type, 'options.type'); - assert.buffer(opts.hash, 'options.hash'); - assert.string(opts.algorithm, 'options.algorithm'); - - this.algorithm = opts.algorithm.toLowerCase(); - if (algs.hashAlgs[this.algorithm] !== true) - throw (new InvalidAlgorithmError(this.algorithm)); - - this.hash = opts.hash; - this.type = opts.type; - this.hashType = opts.hashType; -} - -Fingerprint.prototype.toString = function (format) { - if (format === undefined) { - if (this.algorithm === 'md5' || this.hashType === 'spki') - format = 'hex'; - else - format = 'base64'; - } - assert.string(format); - - switch (format) { - case 'hex': - if (this.hashType === 'spki') - return (this.hash.toString('hex')); - return (addColons(this.hash.toString('hex'))); - case 'base64': - if (this.hashType === 'spki') - return (this.hash.toString('base64')); - return (sshBase64Format(this.algorithm, - this.hash.toString('base64'))); - default: - throw (new FingerprintFormatError(undefined, format)); - } -}; - -Fingerprint.prototype.matches = function (other) { - assert.object(other, 'key or certificate'); - if (this.type === 'key' && this.hashType !== 'ssh') { - utils.assertCompatible(other, Key, [1, 7], 'key with spki'); - if (PrivateKey.isPrivateKey(other)) { - utils.assertCompatible(other, PrivateKey, [1, 6], - 'privatekey with spki support'); - } - } else if (this.type === 'key') { - utils.assertCompatible(other, Key, [1, 0], 'key'); - } else { - utils.assertCompatible(other, Certificate, [1, 0], - 'certificate'); - } - - var theirHash = other.hash(this.algorithm, this.hashType); - var theirHash2 = crypto.createHash(this.algorithm). - update(theirHash).digest('base64'); - - if (this.hash2 === undefined) - this.hash2 = crypto.createHash(this.algorithm). - update(this.hash).digest('base64'); - - return (this.hash2 === theirHash2); -}; - -/*JSSTYLED*/ -var base64RE = /^[A-Za-z0-9+\/=]+$/; -/*JSSTYLED*/ -var hexRE = /^[a-fA-F0-9]+$/; - -Fingerprint.parse = function (fp, options) { - assert.string(fp, 'fingerprint'); - - var alg, hash, enAlgs; - if (Array.isArray(options)) { - enAlgs = options; - options = {}; - } - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - if (options.enAlgs !== undefined) - enAlgs = options.enAlgs; - if (options.algorithms !== undefined) - enAlgs = options.algorithms; - assert.optionalArrayOfString(enAlgs, 'algorithms'); - - var hashType = 'ssh'; - if (options.hashType !== undefined) - hashType = options.hashType; - assert.string(hashType, 'options.hashType'); - - var parts = fp.split(':'); - if (parts.length == 2) { - alg = parts[0].toLowerCase(); - if (!base64RE.test(parts[1])) - throw (new FingerprintFormatError(fp)); - try { - hash = Buffer.from(parts[1], 'base64'); - } catch (e) { - throw (new FingerprintFormatError(fp)); - } - } else if (parts.length > 2) { - alg = 'md5'; - if (parts[0].toLowerCase() === 'md5') - parts = parts.slice(1); - parts = parts.map(function (p) { - while (p.length < 2) - p = '0' + p; - if (p.length > 2) - throw (new FingerprintFormatError(fp)); - return (p); - }); - parts = parts.join(''); - if (!hexRE.test(parts) || parts.length % 2 !== 0) - throw (new FingerprintFormatError(fp)); - try { - hash = Buffer.from(parts, 'hex'); - } catch (e) { - throw (new FingerprintFormatError(fp)); - } - } else { - if (hexRE.test(fp)) { - hash = Buffer.from(fp, 'hex'); - } else if (base64RE.test(fp)) { - hash = Buffer.from(fp, 'base64'); - } else { - throw (new FingerprintFormatError(fp)); - } - - switch (hash.length) { - case 32: - alg = 'sha256'; - break; - case 16: - alg = 'md5'; - break; - case 20: - alg = 'sha1'; - break; - case 64: - alg = 'sha512'; - break; - default: - throw (new FingerprintFormatError(fp)); - } - - /* Plain hex/base64: guess it's probably SPKI unless told. */ - if (options.hashType === undefined) - hashType = 'spki'; - } - - if (alg === undefined) - throw (new FingerprintFormatError(fp)); - - if (algs.hashAlgs[alg] === undefined) - throw (new InvalidAlgorithmError(alg)); - - if (enAlgs !== undefined) { - enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); - if (enAlgs.indexOf(alg) === -1) - throw (new InvalidAlgorithmError(alg)); - } - - return (new Fingerprint({ - algorithm: alg, - hash: hash, - type: options.type || 'key', - hashType: hashType - })); -}; - -function addColons(s) { - /*JSSTYLED*/ - return (s.replace(/(.{2})(?=.)/g, '$1:')); -} - -function base64Strip(s) { - /*JSSTYLED*/ - return (s.replace(/=*$/, '')); -} - -function sshBase64Format(alg, h) { - return (alg.toUpperCase() + ':' + base64Strip(h)); -} - -Fingerprint.isFingerprint = function (obj, ver) { - return (utils.isCompatible(obj, Fingerprint, ver)); -}; - -/* - * API versions for Fingerprint: - * [1,0] -- initial ver - * [1,1] -- first tagged ver - * [1,2] -- hashType and spki support - */ -Fingerprint.prototype._sshpkApiVersion = [1, 2]; - -Fingerprint._oldVersionDetect = function (obj) { - assert.func(obj.toString); - assert.func(obj.matches); - return ([1, 0]); -}; - - -/***/ }), -/* 401 */, -/* 402 */, -/* 403 */, -/* 404 */, -/* 405 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var RETRIABLE_ERRORS = ['ECONNRESET', 'ENOTFOUND', 'ESOCKETTIMEDOUT', 'ETIMEDOUT', 'ECONNREFUSED', 'EHOSTUNREACH', 'EPIPE', 'EAI_AGAIN']; -var _ = __webpack_require__(557); - -/** - * @param {Null | Object} err - * @param {Object} response - * @return {Boolean} true if the request had a network error - */ -function NetworkError(err /*, response*/ ) { - return err && _.includes(RETRIABLE_ERRORS, err.code); -} - -NetworkError.RETRIABLE_ERRORS = RETRIABLE_ERRORS; -module.exports = NetworkError; - - -/***/ }), -/* 406 */, -/* 407 */, -/* 408 */, -/* 409 */, -/* 410 */, -/* 411 */, -/* 412 */, -/* 413 */ -/***/ (function(module) { - -module.exports = require("stream"); - -/***/ }), -/* 414 */, -/* 415 */, -/* 416 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var fs = __webpack_require__(747) -var qs = __webpack_require__(191) -var validate = __webpack_require__(846) -var extend = __webpack_require__(374) - -function Har (request) { - this.request = request -} - -Har.prototype.reducer = function (obj, pair) { - // new property ? - if (obj[pair.name] === undefined) { - obj[pair.name] = pair.value - return obj - } - - // existing? convert to array - var arr = [ - obj[pair.name], - pair.value - ] - - obj[pair.name] = arr - - return obj -} - -Har.prototype.prep = function (data) { - // construct utility properties - data.queryObj = {} - data.headersObj = {} - data.postData.jsonObj = false - data.postData.paramsObj = false - - // construct query objects - if (data.queryString && data.queryString.length) { - data.queryObj = data.queryString.reduce(this.reducer, {}) - } - - // construct headers objects - if (data.headers && data.headers.length) { - // loweCase header keys - data.headersObj = data.headers.reduceRight(function (headers, header) { - headers[header.name] = header.value - return headers - }, {}) - } - - // construct Cookie header - if (data.cookies && data.cookies.length) { - var cookies = data.cookies.map(function (cookie) { - return cookie.name + '=' + cookie.value - }) - - if (cookies.length) { - data.headersObj.cookie = cookies.join('; ') - } - } - - // prep body - function some (arr) { - return arr.some(function (type) { - return data.postData.mimeType.indexOf(type) === 0 - }) - } - - if (some([ - 'multipart/mixed', - 'multipart/related', - 'multipart/form-data', - 'multipart/alternative'])) { - // reset values - data.postData.mimeType = 'multipart/form-data' - } else if (some([ - 'application/x-www-form-urlencoded'])) { - if (!data.postData.params) { - data.postData.text = '' - } else { - data.postData.paramsObj = data.postData.params.reduce(this.reducer, {}) - - // always overwrite - data.postData.text = qs.stringify(data.postData.paramsObj) - } - } else if (some([ - 'text/json', - 'text/x-json', - 'application/json', - 'application/x-json'])) { - data.postData.mimeType = 'application/json' - - if (data.postData.text) { - try { - data.postData.jsonObj = JSON.parse(data.postData.text) - } catch (e) { - this.request.debug(e) - - // force back to text/plain - data.postData.mimeType = 'text/plain' - } - } - } - - return data -} - -Har.prototype.options = function (options) { - // skip if no har property defined - if (!options.har) { - return options - } - - var har = {} - extend(har, options.har) - - // only process the first entry - if (har.log && har.log.entries) { - har = har.log.entries[0] - } - - // add optional properties to make validation successful - har.url = har.url || options.url || options.uri || options.baseUrl || '/' - har.httpVersion = har.httpVersion || 'HTTP/1.1' - har.queryString = har.queryString || [] - har.headers = har.headers || [] - har.cookies = har.cookies || [] - har.postData = har.postData || {} - har.postData.mimeType = har.postData.mimeType || 'application/octet-stream' - - har.bodySize = 0 - har.headersSize = 0 - har.postData.size = 0 - - if (!validate.request(har)) { - return options - } - - // clean up and get some utility properties - var req = this.prep(har) - - // construct new options - if (req.url) { - options.url = req.url - } - - if (req.method) { - options.method = req.method - } - - if (Object.keys(req.queryObj).length) { - options.qs = req.queryObj - } - - if (Object.keys(req.headersObj).length) { - options.headers = req.headersObj - } - - function test (type) { - return req.postData.mimeType.indexOf(type) === 0 - } - if (test('application/x-www-form-urlencoded')) { - options.form = req.postData.paramsObj - } else if (test('application/json')) { - if (req.postData.jsonObj) { - options.body = req.postData.jsonObj - options.json = true - } - } else if (test('multipart/form-data')) { - options.formData = {} - - req.postData.params.forEach(function (param) { - var attachment = {} - - if (!param.fileName && !param.contentType) { - options.formData[param.name] = param.value - return - } - - // attempt to read from disk! - if (param.fileName && !param.value) { - attachment.value = fs.createReadStream(param.fileName) - } else if (param.value) { - attachment.value = param.value - } - - if (param.fileName) { - attachment.options = { - filename: param.fileName, - contentType: param.contentType ? param.contentType : null - } - } - - options.formData[param.name] = attachment - }) - } else { - if (req.postData.text) { - options.body = req.postData.text - } - } - - return options -} - -exports.Har = Har - - -/***/ }), -/* 417 */ -/***/ (function(module) { - -module.exports = require("crypto"); - -/***/ }), -/* 418 */, -/* 419 */, -/* 420 */, -/* 421 */, -/* 422 */, -/* 423 */, -/* 424 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -var iterate = __webpack_require__(157) - , initState = __webpack_require__(147) - , terminator = __webpack_require__(939) - ; - -// Public API -module.exports = parallel; - -/** - * Runs iterator over provided array elements in parallel - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {function} callback - invoked when all elements processed - * @returns {function} - jobs terminator - */ -function parallel(list, iterator, callback) -{ - var state = initState(list); - - while (state.index < (state['keyedList'] || list).length) - { - iterate(list, iterator, state, function(error, result) - { - if (error) - { - callback(error, result); - return; - } - - // looks like it's the last one - if (Object.keys(state.jobs).length === 0) - { - callback(null, state.results); - return; - } - }); - - state.index++; - } - - return terminator.bind(state, callback); -} - - -/***/ }), -/* 425 */, -/* 426 */, -/* 427 */, -/* 428 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(477); -var crypto = __webpack_require__(417); -var sshpk = __webpack_require__(650); -var utils = __webpack_require__(909); - -var HASH_ALGOS = utils.HASH_ALGOS; -var PK_ALGOS = utils.PK_ALGOS; -var InvalidAlgorithmError = utils.InvalidAlgorithmError; -var HttpSignatureError = utils.HttpSignatureError; -var validateAlgorithm = utils.validateAlgorithm; - -///--- Exported API - -module.exports = { - /** - * Verify RSA/DSA signature against public key. You are expected to pass in - * an object that was returned from `parse()`. - * - * @param {Object} parsedSignature the object you got from `parse`. - * @param {String} pubkey RSA/DSA private key PEM. - * @return {Boolean} true if valid, false otherwise. - * @throws {TypeError} if you pass in bad arguments. - * @throws {InvalidAlgorithmError} - */ - verifySignature: function verifySignature(parsedSignature, pubkey) { - assert.object(parsedSignature, 'parsedSignature'); - if (typeof (pubkey) === 'string' || Buffer.isBuffer(pubkey)) - pubkey = sshpk.parseKey(pubkey); - assert.ok(sshpk.Key.isKey(pubkey, [1, 1]), 'pubkey must be a sshpk.Key'); - - var alg = validateAlgorithm(parsedSignature.algorithm); - if (alg[0] === 'hmac' || alg[0] !== pubkey.type) - return (false); - - var v = pubkey.createVerify(alg[1]); - v.update(parsedSignature.signingString); - return (v.verify(parsedSignature.params.signature, 'base64')); - }, - - /** - * Verify HMAC against shared secret. You are expected to pass in an object - * that was returned from `parse()`. - * - * @param {Object} parsedSignature the object you got from `parse`. - * @param {String} secret HMAC shared secret. - * @return {Boolean} true if valid, false otherwise. - * @throws {TypeError} if you pass in bad arguments. - * @throws {InvalidAlgorithmError} - */ - verifyHMAC: function verifyHMAC(parsedSignature, secret) { - assert.object(parsedSignature, 'parsedHMAC'); - assert.string(secret, 'secret'); - - var alg = validateAlgorithm(parsedSignature.algorithm); - if (alg[0] !== 'hmac') - return (false); - - var hashAlg = alg[1].toUpperCase(); - - var hmac = crypto.createHmac(hashAlg, secret); - hmac.update(parsedSignature.signingString); - - /* - * Now double-hash to avoid leaking timing information - there's - * no easy constant-time compare in JS, so we use this approach - * instead. See for more info: - * https://www.isecpartners.com/blog/2011/february/double-hmac- - * verification.aspx - */ - var h1 = crypto.createHmac(hashAlg, secret); - h1.update(hmac.digest()); - h1 = h1.digest(); - var h2 = crypto.createHmac(hashAlg, secret); - h2.update(new Buffer(parsedSignature.params.signature, 'base64')); - h2 = h2.digest(); - - /* Node 0.8 returns strings from .digest(). */ - if (typeof (h1) === 'string') - return (h1 === h2); - /* And node 0.10 lacks the .equals() method on Buffers. */ - if (Buffer.isBuffer(h1) && !h1.equals) - return (h1.toString('binary') === h2.toString('binary')); - - return (h1.equals(h2)); - } -}; - - -/***/ }), -/* 429 */, -/* 430 */, -/* 431 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - -var __importStar = (this && this.__importStar) || function (mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result["default"] = mod; - return result; -}; -Object.defineProperty(exports, "__esModule", { value: true }); -const os = __importStar(__webpack_require__(87)); -const utils_1 = __webpack_require__(82); -/** - * Commands - * - * Command Format: - * ::name key=value,key=value::message - * - * Examples: - * ::warning::This is the message - * ::set-env name=MY_VAR::some value - */ -function issueCommand(command, properties, message) { - const cmd = new Command(command, properties, message); - process.stdout.write(cmd.toString() + os.EOL); -} -exports.issueCommand = issueCommand; -function issue(name, message = '') { - issueCommand(name, {}, message); -} -exports.issue = issue; -const CMD_STRING = '::'; -class Command { - constructor(command, properties, message) { - if (!command) { - command = 'missing.command'; - } - this.command = command; - this.properties = properties; - this.message = message; - } - toString() { - let cmdStr = CMD_STRING + this.command; - if (this.properties && Object.keys(this.properties).length > 0) { - cmdStr += ' '; - let first = true; - for (const key in this.properties) { - if (this.properties.hasOwnProperty(key)) { - const val = this.properties[key]; - if (val) { - if (first) { - first = false; - } - else { - cmdStr += ','; - } - cmdStr += `${key}=${escapeProperty(val)}`; - } - } - } - } - cmdStr += `${CMD_STRING}${escapeData(this.message)}`; - return cmdStr; - } -} -function escapeData(s) { - return utils_1.toCommandValue(s) - .replace(/%/g, '%25') - .replace(/\r/g, '%0D') - .replace(/\n/g, '%0A'); -} -function escapeProperty(s) { - return utils_1.toCommandValue(s) - .replace(/%/g, '%25') - .replace(/\r/g, '%0D') - .replace(/\n/g, '%0A') - .replace(/:/g, '%3A') - .replace(/,/g, '%2C'); -} -//# sourceMappingURL=command.js.map - -/***/ }), -/* 432 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; -/*! - * mime-types - * Copyright(c) 2014 Jonathan Ong - * Copyright(c) 2015 Douglas Christopher Wilson - * MIT Licensed - */ - - - -/** - * Module dependencies. - * @private - */ - -var db = __webpack_require__(972) -var extname = __webpack_require__(622).extname - -/** - * Module variables. - * @private - */ - -var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ -var TEXT_TYPE_REGEXP = /^text\//i - -/** - * Module exports. - * @public - */ - -exports.charset = charset -exports.charsets = { lookup: charset } -exports.contentType = contentType -exports.extension = extension -exports.extensions = Object.create(null) -exports.lookup = lookup -exports.types = Object.create(null) - -// Populate the extensions/types maps -populateMaps(exports.extensions, exports.types) - -/** - * Get the default charset for a MIME type. - * - * @param {string} type - * @return {boolean|string} - */ - -function charset (type) { - if (!type || typeof type !== 'string') { - return false - } - - // TODO: use media-typer - var match = EXTRACT_TYPE_REGEXP.exec(type) - var mime = match && db[match[1].toLowerCase()] - - if (mime && mime.charset) { - return mime.charset - } - - // default text/* to utf-8 - if (match && TEXT_TYPE_REGEXP.test(match[1])) { - return 'UTF-8' - } - - return false -} - -/** - * Create a full Content-Type header given a MIME type or extension. - * - * @param {string} str - * @return {boolean|string} - */ - -function contentType (str) { - // TODO: should this even be in this module? - if (!str || typeof str !== 'string') { - return false - } - - var mime = str.indexOf('/') === -1 - ? exports.lookup(str) - : str - - if (!mime) { - return false - } - - // TODO: use content-type or other module - if (mime.indexOf('charset') === -1) { - var charset = exports.charset(mime) - if (charset) mime += '; charset=' + charset.toLowerCase() - } - - return mime -} - -/** - * Get the default extension for a MIME type. - * - * @param {string} type - * @return {boolean|string} - */ - -function extension (type) { - if (!type || typeof type !== 'string') { - return false - } - - // TODO: use media-typer - var match = EXTRACT_TYPE_REGEXP.exec(type) - - // get extensions - var exts = match && exports.extensions[match[1].toLowerCase()] - - if (!exts || !exts.length) { - return false - } - - return exts[0] -} - -/** - * Lookup the MIME type for a file path/extension. - * - * @param {string} path - * @return {boolean|string} - */ - -function lookup (path) { - if (!path || typeof path !== 'string') { - return false - } - - // get the extension ("ext" or ".ext" or full path) - var extension = extname('x.' + path) - .toLowerCase() - .substr(1) - - if (!extension) { - return false - } - - return exports.types[extension] || false -} - -/** - * Populate the extensions and types maps. - * @private - */ - -function populateMaps (extensions, types) { - // source preference (least -> most) - var preference = ['nginx', 'apache', undefined, 'iana'] - - Object.keys(db).forEach(function forEachMimeType (type) { - var mime = db[type] - var exts = mime.extensions - - if (!exts || !exts.length) { - return - } - - // mime -> extensions - extensions[type] = exts - - // extension -> mime - for (var i = 0; i < exts.length; i++) { - var extension = exts[i] - - if (types[extension]) { - var from = preference.indexOf(db[types[extension]].source) - var to = preference.indexOf(mime.source) - - if (types[extension] !== 'application/octet-stream' && - (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { - // skip the remapping - continue - } - } - - // set the extension -> mime - types[extension] = type - } - }) -} - - -/***/ }), -/* 433 */, -/* 434 */, -/* 435 */ -/***/ (function(module) { - -module.exports = {"$id":"cache.json#","$schema":"http://json-schema.org/draft-06/schema#","properties":{"beforeRequest":{"oneOf":[{"type":"null"},{"$ref":"beforeRequest.json#"}]},"afterRequest":{"oneOf":[{"type":"null"},{"$ref":"afterRequest.json#"}]},"comment":{"type":"string"}}}; - -/***/ }), -/* 436 */, -/* 437 */, -/* 438 */, -/* 439 */, -/* 440 */, -/* 441 */, -/* 442 */, -/* 443 */, -/* 444 */, -/* 445 */, -/* 446 */, -/* 447 */, -/* 448 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, '__esModule', { value: true }); - -var universalUserAgent = __webpack_require__(796); -var beforeAfterHook = __webpack_require__(523); -var request = __webpack_require__(317); -var graphql = __webpack_require__(898); -var authToken = __webpack_require__(68); - -function _objectWithoutPropertiesLoose(source, excluded) { - if (source == null) return {}; - var target = {}; - var sourceKeys = Object.keys(source); - var key, i; - - for (i = 0; i < sourceKeys.length; i++) { - key = sourceKeys[i]; - if (excluded.indexOf(key) >= 0) continue; - target[key] = source[key]; - } - - return target; -} - -function _objectWithoutProperties(source, excluded) { - if (source == null) return {}; - - var target = _objectWithoutPropertiesLoose(source, excluded); - - var key, i; - - if (Object.getOwnPropertySymbols) { - var sourceSymbolKeys = Object.getOwnPropertySymbols(source); - - for (i = 0; i < sourceSymbolKeys.length; i++) { - key = sourceSymbolKeys[i]; - if (excluded.indexOf(key) >= 0) continue; - if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; - target[key] = source[key]; - } - } - - return target; -} - -const VERSION = "3.2.5"; - -class Octokit { - constructor(options = {}) { - const hook = new beforeAfterHook.Collection(); - const requestDefaults = { - baseUrl: request.request.endpoint.DEFAULTS.baseUrl, - headers: {}, - request: Object.assign({}, options.request, { - hook: hook.bind(null, "request") - }), - mediaType: { - previews: [], - format: "" - } - }; // prepend default user agent with `options.userAgent` if set - - requestDefaults.headers["user-agent"] = [options.userAgent, `octokit-core.js/${VERSION} ${universalUserAgent.getUserAgent()}`].filter(Boolean).join(" "); - - if (options.baseUrl) { - requestDefaults.baseUrl = options.baseUrl; - } - - if (options.previews) { - requestDefaults.mediaType.previews = options.previews; - } - - if (options.timeZone) { - requestDefaults.headers["time-zone"] = options.timeZone; - } - - this.request = request.request.defaults(requestDefaults); - this.graphql = graphql.withCustomRequest(this.request).defaults(requestDefaults); - this.log = Object.assign({ - debug: () => {}, - info: () => {}, - warn: console.warn.bind(console), - error: console.error.bind(console) - }, options.log); - this.hook = hook; // (1) If neither `options.authStrategy` nor `options.auth` are set, the `octokit` instance - // is unauthenticated. The `this.auth()` method is a no-op and no request hook is registered. - // (2) If only `options.auth` is set, use the default token authentication strategy. - // (3) If `options.authStrategy` is set then use it and pass in `options.auth`. Always pass own request as many strategies accept a custom request instance. - // TODO: type `options.auth` based on `options.authStrategy`. - - if (!options.authStrategy) { - if (!options.auth) { - // (1) - this.auth = async () => ({ - type: "unauthenticated" - }); - } else { - // (2) - const auth = authToken.createTokenAuth(options.auth); // @ts-ignore ¯\_(ツ)_/¯ - - hook.wrap("request", auth.hook); - this.auth = auth; - } - } else { - const { - authStrategy - } = options, - otherOptions = _objectWithoutProperties(options, ["authStrategy"]); - - const auth = authStrategy(Object.assign({ - request: this.request, - log: this.log, - // we pass the current octokit instance as well as its constructor options - // to allow for authentication strategies that return a new octokit instance - // that shares the same internal state as the current one. The original - // requirement for this was the "event-octokit" authentication strategy - // of https://github.com/probot/octokit-auth-probot. - octokit: this, - octokitOptions: otherOptions - }, options.auth)); // @ts-ignore ¯\_(ツ)_/¯ - - hook.wrap("request", auth.hook); - this.auth = auth; - } // apply plugins - // https://stackoverflow.com/a/16345172 - - - const classConstructor = this.constructor; - classConstructor.plugins.forEach(plugin => { - Object.assign(this, plugin(this, options)); - }); - } - - static defaults(defaults) { - const OctokitWithDefaults = class extends this { - constructor(...args) { - const options = args[0] || {}; - - if (typeof defaults === "function") { - super(defaults(options)); - return; - } - - super(Object.assign({}, defaults, options, options.userAgent && defaults.userAgent ? { - userAgent: `${options.userAgent} ${defaults.userAgent}` - } : null)); - } - - }; - return OctokitWithDefaults; - } - /** - * Attach a plugin (or many) to your Octokit instance. - * - * @example - * const API = Octokit.plugin(plugin1, plugin2, plugin3, ...) - */ - - - static plugin(...newPlugins) { - var _a; - - const currentPlugins = this.plugins; - const NewOctokit = (_a = class extends this {}, _a.plugins = currentPlugins.concat(newPlugins.filter(plugin => !currentPlugins.includes(plugin))), _a); - return NewOctokit; - } - -} -Octokit.VERSION = VERSION; -Octokit.plugins = []; - -exports.Octokit = Octokit; -//# sourceMappingURL=index.js.map - - -/***/ }), -/* 449 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - read: read, - readPkcs1: readPkcs1, - write: write, - writePkcs1: writePkcs1 -}; - -var assert = __webpack_require__(477); -var asn1 = __webpack_require__(62); -var Buffer = __webpack_require__(215).Buffer; -var algs = __webpack_require__(98); -var utils = __webpack_require__(270); - -var Key = __webpack_require__(852); -var PrivateKey = __webpack_require__(502); -var pem = __webpack_require__(268); - -var pkcs8 = __webpack_require__(707); -var readECDSACurve = pkcs8.readECDSACurve; - -function read(buf, options) { - return (pem.read(buf, options, 'pkcs1')); -} - -function write(key, options) { - return (pem.write(key, options, 'pkcs1')); -} - -/* Helper to read in a single mpint */ -function readMPInt(der, nm) { - assert.strictEqual(der.peek(), asn1.Ber.Integer, - nm + ' is not an Integer'); - return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); -} - -function readPkcs1(alg, type, der) { - switch (alg) { - case 'RSA': - if (type === 'public') - return (readPkcs1RSAPublic(der)); - else if (type === 'private') - return (readPkcs1RSAPrivate(der)); - throw (new Error('Unknown key type: ' + type)); - case 'DSA': - if (type === 'public') - return (readPkcs1DSAPublic(der)); - else if (type === 'private') - return (readPkcs1DSAPrivate(der)); - throw (new Error('Unknown key type: ' + type)); - case 'EC': - case 'ECDSA': - if (type === 'private') - return (readPkcs1ECDSAPrivate(der)); - else if (type === 'public') - return (readPkcs1ECDSAPublic(der)); - throw (new Error('Unknown key type: ' + type)); - case 'EDDSA': - case 'EdDSA': - if (type === 'private') - return (readPkcs1EdDSAPrivate(der)); - throw (new Error(type + ' keys not supported with EdDSA')); - default: - throw (new Error('Unknown key algo: ' + alg)); - } -} - -function readPkcs1RSAPublic(der) { - // modulus and exponent - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'exponent'); - - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'e', data: e }, - { name: 'n', data: n } - ] - }; - - return (new Key(key)); -} - -function readPkcs1RSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version[0], 0); - - // modulus then public exponent - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'public exponent'); - var d = readMPInt(der, 'private exponent'); - var p = readMPInt(der, 'prime1'); - var q = readMPInt(der, 'prime2'); - var dmodp = readMPInt(der, 'exponent1'); - var dmodq = readMPInt(der, 'exponent2'); - var iqmp = readMPInt(der, 'iqmp'); - - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'n', data: n }, - { name: 'e', data: e }, - { name: 'd', data: d }, - { name: 'iqmp', data: iqmp }, - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'dmodp', data: dmodp }, - { name: 'dmodq', data: dmodq } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs1DSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version.readUInt8(0), 0); - - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - var y = readMPInt(der, 'y'); - var x = readMPInt(der, 'x'); - - // now, make the key - var key = { - type: 'dsa', - parts: [ - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g }, - { name: 'y', data: y }, - { name: 'x', data: x } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs1EdDSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version.readUInt8(0), 1); - - // private key - var k = der.readString(asn1.Ber.OctetString, true); - - der.readSequence(0xa0); - var oid = der.readOID(); - assert.strictEqual(oid, '1.3.101.112', 'the ed25519 curve identifier'); - - der.readSequence(0xa1); - var A = utils.readBitString(der); - - var key = { - type: 'ed25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) }, - { name: 'k', data: k } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs1DSAPublic(der) { - var y = readMPInt(der, 'y'); - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - - var key = { - type: 'dsa', - parts: [ - { name: 'y', data: y }, - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g } - ] - }; - - return (new Key(key)); -} - -function readPkcs1ECDSAPublic(der) { - der.readSequence(); - - var oid = der.readOID(); - assert.strictEqual(oid, '1.2.840.10045.2.1', 'must be ecPublicKey'); - - var curveOid = der.readOID(); - - var curve; - var curves = Object.keys(algs.curves); - for (var j = 0; j < curves.length; ++j) { - var c = curves[j]; - var cd = algs.curves[c]; - if (cd.pkcs8oid === curveOid) { - curve = c; - break; - } - } - assert.string(curve, 'a known ECDSA named curve'); - - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); - - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curve) }, - { name: 'Q', data: Q } - ] - }; - - return (new Key(key)); -} - -function readPkcs1ECDSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version.readUInt8(0), 1); - - // private key - var d = der.readString(asn1.Ber.OctetString, true); - - der.readSequence(0xa0); - var curve = readECDSACurve(der); - assert.string(curve, 'a known elliptic curve'); - - der.readSequence(0xa1); - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); - - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curve) }, - { name: 'Q', data: Q }, - { name: 'd', data: d } - ] - }; - - return (new PrivateKey(key)); -} - -function writePkcs1(der, key) { - der.startSequence(); - - switch (key.type) { - case 'rsa': - if (PrivateKey.isPrivateKey(key)) - writePkcs1RSAPrivate(der, key); - else - writePkcs1RSAPublic(der, key); - break; - case 'dsa': - if (PrivateKey.isPrivateKey(key)) - writePkcs1DSAPrivate(der, key); - else - writePkcs1DSAPublic(der, key); - break; - case 'ecdsa': - if (PrivateKey.isPrivateKey(key)) - writePkcs1ECDSAPrivate(der, key); - else - writePkcs1ECDSAPublic(der, key); - break; - case 'ed25519': - if (PrivateKey.isPrivateKey(key)) - writePkcs1EdDSAPrivate(der, key); - else - writePkcs1EdDSAPublic(der, key); - break; - default: - throw (new Error('Unknown key algo: ' + key.type)); - } - - der.endSequence(); -} - -function writePkcs1RSAPublic(der, key) { - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); -} - -function writePkcs1RSAPrivate(der, key) { - var ver = Buffer.from([0]); - der.writeBuffer(ver, asn1.Ber.Integer); - - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); - der.writeBuffer(key.part.d.data, asn1.Ber.Integer); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - if (!key.part.dmodp || !key.part.dmodq) - utils.addRSAMissing(key); - der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); - der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); - der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); -} - -function writePkcs1DSAPrivate(der, key) { - var ver = Buffer.from([0]); - der.writeBuffer(ver, asn1.Ber.Integer); - - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); - der.writeBuffer(key.part.y.data, asn1.Ber.Integer); - der.writeBuffer(key.part.x.data, asn1.Ber.Integer); -} - -function writePkcs1DSAPublic(der, key) { - der.writeBuffer(key.part.y.data, asn1.Ber.Integer); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); -} - -function writePkcs1ECDSAPublic(der, key) { - der.startSequence(); - - der.writeOID('1.2.840.10045.2.1'); /* ecPublicKey */ - var curve = key.part.curve.data.toString(); - var curveOid = algs.curves[curve].pkcs8oid; - assert.string(curveOid, 'a known ECDSA named curve'); - der.writeOID(curveOid); - - der.endSequence(); - - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); -} - -function writePkcs1ECDSAPrivate(der, key) { - var ver = Buffer.from([1]); - der.writeBuffer(ver, asn1.Ber.Integer); - - der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); - - der.startSequence(0xa0); - var curve = key.part.curve.data.toString(); - var curveOid = algs.curves[curve].pkcs8oid; - assert.string(curveOid, 'a known ECDSA named curve'); - der.writeOID(curveOid); - der.endSequence(); - - der.startSequence(0xa1); - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); - der.endSequence(); -} - -function writePkcs1EdDSAPrivate(der, key) { - var ver = Buffer.from([1]); - der.writeBuffer(ver, asn1.Ber.Integer); - - der.writeBuffer(key.part.k.data, asn1.Ber.OctetString); - - der.startSequence(0xa0); - der.writeOID('1.3.101.112'); - der.endSequence(); - - der.startSequence(0xa1); - utils.writeBitString(der, key.part.A.data); - der.endSequence(); -} - -function writePkcs1EdDSAPublic(der, key) { - throw (new Error('Public keys are not supported for EdDSA PKCS#1')); -} - - -/***/ }), -/* 450 */, -/* 451 */, -/* 452 */, -/* 453 */, -/* 454 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, '__esModule', { value: true }); - -function _interopDefault (ex) { return (ex && (typeof ex === 'object') && 'default' in ex) ? ex['default'] : ex; } - -var Stream = _interopDefault(__webpack_require__(413)); -var http = _interopDefault(__webpack_require__(605)); -var Url = _interopDefault(__webpack_require__(835)); -var https = _interopDefault(__webpack_require__(211)); -var zlib = _interopDefault(__webpack_require__(761)); - -// Based on https://github.com/tmpvar/jsdom/blob/aa85b2abf07766ff7bf5c1f6daafb3726f2f2db5/lib/jsdom/living/blob.js - -// fix for "Readable" isn't a named export issue -const Readable = Stream.Readable; - -const BUFFER = Symbol('buffer'); -const TYPE = Symbol('type'); - -class Blob { - constructor() { - this[TYPE] = ''; - - const blobParts = arguments[0]; - const options = arguments[1]; - - const buffers = []; - let size = 0; - - if (blobParts) { - const a = blobParts; - const length = Number(a.length); - for (let i = 0; i < length; i++) { - const element = a[i]; - let buffer; - if (element instanceof Buffer) { - buffer = element; - } else if (ArrayBuffer.isView(element)) { - buffer = Buffer.from(element.buffer, element.byteOffset, element.byteLength); - } else if (element instanceof ArrayBuffer) { - buffer = Buffer.from(element); - } else if (element instanceof Blob) { - buffer = element[BUFFER]; - } else { - buffer = Buffer.from(typeof element === 'string' ? element : String(element)); - } - size += buffer.length; - buffers.push(buffer); - } - } - - this[BUFFER] = Buffer.concat(buffers); - - let type = options && options.type !== undefined && String(options.type).toLowerCase(); - if (type && !/[^\u0020-\u007E]/.test(type)) { - this[TYPE] = type; - } - } - get size() { - return this[BUFFER].length; - } - get type() { - return this[TYPE]; - } - text() { - return Promise.resolve(this[BUFFER].toString()); - } - arrayBuffer() { - const buf = this[BUFFER]; - const ab = buf.buffer.slice(buf.byteOffset, buf.byteOffset + buf.byteLength); - return Promise.resolve(ab); - } - stream() { - const readable = new Readable(); - readable._read = function () {}; - readable.push(this[BUFFER]); - readable.push(null); - return readable; - } - toString() { - return '[object Blob]'; - } - slice() { - const size = this.size; - - const start = arguments[0]; - const end = arguments[1]; - let relativeStart, relativeEnd; - if (start === undefined) { - relativeStart = 0; - } else if (start < 0) { - relativeStart = Math.max(size + start, 0); - } else { - relativeStart = Math.min(start, size); - } - if (end === undefined) { - relativeEnd = size; - } else if (end < 0) { - relativeEnd = Math.max(size + end, 0); - } else { - relativeEnd = Math.min(end, size); - } - const span = Math.max(relativeEnd - relativeStart, 0); - - const buffer = this[BUFFER]; - const slicedBuffer = buffer.slice(relativeStart, relativeStart + span); - const blob = new Blob([], { type: arguments[2] }); - blob[BUFFER] = slicedBuffer; - return blob; - } -} - -Object.defineProperties(Blob.prototype, { - size: { enumerable: true }, - type: { enumerable: true }, - slice: { enumerable: true } -}); - -Object.defineProperty(Blob.prototype, Symbol.toStringTag, { - value: 'Blob', - writable: false, - enumerable: false, - configurable: true -}); - -/** - * fetch-error.js - * - * FetchError interface for operational errors - */ - -/** - * Create FetchError instance - * - * @param String message Error message for human - * @param String type Error type for machine - * @param String systemError For Node.js system error - * @return FetchError - */ -function FetchError(message, type, systemError) { - Error.call(this, message); - - this.message = message; - this.type = type; - - // when err.type is `system`, err.code contains system error code - if (systemError) { - this.code = this.errno = systemError.code; - } - - // hide custom error implementation details from end-users - Error.captureStackTrace(this, this.constructor); -} - -FetchError.prototype = Object.create(Error.prototype); -FetchError.prototype.constructor = FetchError; -FetchError.prototype.name = 'FetchError'; - -let convert; -try { - convert = __webpack_require__(18).convert; -} catch (e) {} - -const INTERNALS = Symbol('Body internals'); - -// fix an issue where "PassThrough" isn't a named export for node <10 -const PassThrough = Stream.PassThrough; - -/** - * Body mixin - * - * Ref: https://fetch.spec.whatwg.org/#body - * - * @param Stream body Readable stream - * @param Object opts Response options - * @return Void - */ -function Body(body) { - var _this = this; - - var _ref = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}, - _ref$size = _ref.size; - - let size = _ref$size === undefined ? 0 : _ref$size; - var _ref$timeout = _ref.timeout; - let timeout = _ref$timeout === undefined ? 0 : _ref$timeout; - - if (body == null) { - // body is undefined or null - body = null; - } else if (isURLSearchParams(body)) { - // body is a URLSearchParams - body = Buffer.from(body.toString()); - } else if (isBlob(body)) ; else if (Buffer.isBuffer(body)) ; else if (Object.prototype.toString.call(body) === '[object ArrayBuffer]') { - // body is ArrayBuffer - body = Buffer.from(body); - } else if (ArrayBuffer.isView(body)) { - // body is ArrayBufferView - body = Buffer.from(body.buffer, body.byteOffset, body.byteLength); - } else if (body instanceof Stream) ; else { - // none of the above - // coerce to string then buffer - body = Buffer.from(String(body)); - } - this[INTERNALS] = { - body, - disturbed: false, - error: null - }; - this.size = size; - this.timeout = timeout; - - if (body instanceof Stream) { - body.on('error', function (err) { - const error = err.name === 'AbortError' ? err : new FetchError(`Invalid response body while trying to fetch ${_this.url}: ${err.message}`, 'system', err); - _this[INTERNALS].error = error; - }); - } -} - -Body.prototype = { - get body() { - return this[INTERNALS].body; - }, - - get bodyUsed() { - return this[INTERNALS].disturbed; - }, - - /** - * Decode response as ArrayBuffer - * - * @return Promise - */ - arrayBuffer() { - return consumeBody.call(this).then(function (buf) { - return buf.buffer.slice(buf.byteOffset, buf.byteOffset + buf.byteLength); - }); - }, - - /** - * Return raw response as Blob - * - * @return Promise - */ - blob() { - let ct = this.headers && this.headers.get('content-type') || ''; - return consumeBody.call(this).then(function (buf) { - return Object.assign( - // Prevent copying - new Blob([], { - type: ct.toLowerCase() - }), { - [BUFFER]: buf - }); - }); - }, - - /** - * Decode response as json - * - * @return Promise - */ - json() { - var _this2 = this; - - return consumeBody.call(this).then(function (buffer) { - try { - return JSON.parse(buffer.toString()); - } catch (err) { - return Body.Promise.reject(new FetchError(`invalid json response body at ${_this2.url} reason: ${err.message}`, 'invalid-json')); - } - }); - }, - - /** - * Decode response as text - * - * @return Promise - */ - text() { - return consumeBody.call(this).then(function (buffer) { - return buffer.toString(); - }); - }, - - /** - * Decode response as buffer (non-spec api) - * - * @return Promise - */ - buffer() { - return consumeBody.call(this); - }, - - /** - * Decode response as text, while automatically detecting the encoding and - * trying to decode to UTF-8 (non-spec api) - * - * @return Promise - */ - textConverted() { - var _this3 = this; - - return consumeBody.call(this).then(function (buffer) { - return convertBody(buffer, _this3.headers); - }); - } -}; - -// In browsers, all properties are enumerable. -Object.defineProperties(Body.prototype, { - body: { enumerable: true }, - bodyUsed: { enumerable: true }, - arrayBuffer: { enumerable: true }, - blob: { enumerable: true }, - json: { enumerable: true }, - text: { enumerable: true } -}); - -Body.mixIn = function (proto) { - for (const name of Object.getOwnPropertyNames(Body.prototype)) { - // istanbul ignore else: future proof - if (!(name in proto)) { - const desc = Object.getOwnPropertyDescriptor(Body.prototype, name); - Object.defineProperty(proto, name, desc); - } - } -}; - -/** - * Consume and convert an entire Body to a Buffer. - * - * Ref: https://fetch.spec.whatwg.org/#concept-body-consume-body - * - * @return Promise - */ -function consumeBody() { - var _this4 = this; - - if (this[INTERNALS].disturbed) { - return Body.Promise.reject(new TypeError(`body used already for: ${this.url}`)); - } - - this[INTERNALS].disturbed = true; - - if (this[INTERNALS].error) { - return Body.Promise.reject(this[INTERNALS].error); - } - - let body = this.body; - - // body is null - if (body === null) { - return Body.Promise.resolve(Buffer.alloc(0)); - } - - // body is blob - if (isBlob(body)) { - body = body.stream(); - } - - // body is buffer - if (Buffer.isBuffer(body)) { - return Body.Promise.resolve(body); - } - - // istanbul ignore if: should never happen - if (!(body instanceof Stream)) { - return Body.Promise.resolve(Buffer.alloc(0)); - } - - // body is stream - // get ready to actually consume the body - let accum = []; - let accumBytes = 0; - let abort = false; - - return new Body.Promise(function (resolve, reject) { - let resTimeout; - - // allow timeout on slow response body - if (_this4.timeout) { - resTimeout = setTimeout(function () { - abort = true; - reject(new FetchError(`Response timeout while trying to fetch ${_this4.url} (over ${_this4.timeout}ms)`, 'body-timeout')); - }, _this4.timeout); - } - - // handle stream errors - body.on('error', function (err) { - if (err.name === 'AbortError') { - // if the request was aborted, reject with this Error - abort = true; - reject(err); - } else { - // other errors, such as incorrect content-encoding - reject(new FetchError(`Invalid response body while trying to fetch ${_this4.url}: ${err.message}`, 'system', err)); - } - }); - - body.on('data', function (chunk) { - if (abort || chunk === null) { - return; - } - - if (_this4.size && accumBytes + chunk.length > _this4.size) { - abort = true; - reject(new FetchError(`content size at ${_this4.url} over limit: ${_this4.size}`, 'max-size')); - return; - } - - accumBytes += chunk.length; - accum.push(chunk); - }); - - body.on('end', function () { - if (abort) { - return; - } - - clearTimeout(resTimeout); - - try { - resolve(Buffer.concat(accum, accumBytes)); - } catch (err) { - // handle streams that have accumulated too much data (issue #414) - reject(new FetchError(`Could not create Buffer from response body for ${_this4.url}: ${err.message}`, 'system', err)); - } - }); - }); -} - -/** - * Detect buffer encoding and convert to target encoding - * ref: http://www.w3.org/TR/2011/WD-html5-20110113/parsing.html#determining-the-character-encoding - * - * @param Buffer buffer Incoming buffer - * @param String encoding Target encoding - * @return String - */ -function convertBody(buffer, headers) { - if (typeof convert !== 'function') { - throw new Error('The package `encoding` must be installed to use the textConverted() function'); - } - - const ct = headers.get('content-type'); - let charset = 'utf-8'; - let res, str; - - // header - if (ct) { - res = /charset=([^;]*)/i.exec(ct); - } - - // no charset in content type, peek at response body for at most 1024 bytes - str = buffer.slice(0, 1024).toString(); - - // html5 - if (!res && str) { - res = / 0 && arguments[0] !== undefined ? arguments[0] : undefined; - - this[MAP] = Object.create(null); - - if (init instanceof Headers) { - const rawHeaders = init.raw(); - const headerNames = Object.keys(rawHeaders); - - for (const headerName of headerNames) { - for (const value of rawHeaders[headerName]) { - this.append(headerName, value); - } - } - - return; - } - - // We don't worry about converting prop to ByteString here as append() - // will handle it. - if (init == null) ; else if (typeof init === 'object') { - const method = init[Symbol.iterator]; - if (method != null) { - if (typeof method !== 'function') { - throw new TypeError('Header pairs must be iterable'); - } - - // sequence> - // Note: per spec we have to first exhaust the lists then process them - const pairs = []; - for (const pair of init) { - if (typeof pair !== 'object' || typeof pair[Symbol.iterator] !== 'function') { - throw new TypeError('Each header pair must be iterable'); - } - pairs.push(Array.from(pair)); - } - - for (const pair of pairs) { - if (pair.length !== 2) { - throw new TypeError('Each header pair must be a name/value tuple'); - } - this.append(pair[0], pair[1]); - } - } else { - // record - for (const key of Object.keys(init)) { - const value = init[key]; - this.append(key, value); - } - } - } else { - throw new TypeError('Provided initializer must be an object'); - } - } - - /** - * Return combined header value given name - * - * @param String name Header name - * @return Mixed - */ - get(name) { - name = `${name}`; - validateName(name); - const key = find(this[MAP], name); - if (key === undefined) { - return null; - } - - return this[MAP][key].join(', '); - } - - /** - * Iterate over all headers - * - * @param Function callback Executed for each item with parameters (value, name, thisArg) - * @param Boolean thisArg `this` context for callback function - * @return Void - */ - forEach(callback) { - let thisArg = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : undefined; - - let pairs = getHeaders(this); - let i = 0; - while (i < pairs.length) { - var _pairs$i = pairs[i]; - const name = _pairs$i[0], - value = _pairs$i[1]; - - callback.call(thisArg, value, name, this); - pairs = getHeaders(this); - i++; - } - } - - /** - * Overwrite header values given name - * - * @param String name Header name - * @param String value Header value - * @return Void - */ - set(name, value) { - name = `${name}`; - value = `${value}`; - validateName(name); - validateValue(value); - const key = find(this[MAP], name); - this[MAP][key !== undefined ? key : name] = [value]; - } - - /** - * Append a value onto existing header - * - * @param String name Header name - * @param String value Header value - * @return Void - */ - append(name, value) { - name = `${name}`; - value = `${value}`; - validateName(name); - validateValue(value); - const key = find(this[MAP], name); - if (key !== undefined) { - this[MAP][key].push(value); - } else { - this[MAP][name] = [value]; - } - } - - /** - * Check for header name existence - * - * @param String name Header name - * @return Boolean - */ - has(name) { - name = `${name}`; - validateName(name); - return find(this[MAP], name) !== undefined; - } - - /** - * Delete all header values given name - * - * @param String name Header name - * @return Void - */ - delete(name) { - name = `${name}`; - validateName(name); - const key = find(this[MAP], name); - if (key !== undefined) { - delete this[MAP][key]; - } - } - - /** - * Return raw headers (non-spec api) - * - * @return Object - */ - raw() { - return this[MAP]; - } - - /** - * Get an iterator on keys. - * - * @return Iterator - */ - keys() { - return createHeadersIterator(this, 'key'); - } - - /** - * Get an iterator on values. - * - * @return Iterator - */ - values() { - return createHeadersIterator(this, 'value'); - } - - /** - * Get an iterator on entries. - * - * This is the default iterator of the Headers object. - * - * @return Iterator - */ - [Symbol.iterator]() { - return createHeadersIterator(this, 'key+value'); - } -} -Headers.prototype.entries = Headers.prototype[Symbol.iterator]; - -Object.defineProperty(Headers.prototype, Symbol.toStringTag, { - value: 'Headers', - writable: false, - enumerable: false, - configurable: true -}); - -Object.defineProperties(Headers.prototype, { - get: { enumerable: true }, - forEach: { enumerable: true }, - set: { enumerable: true }, - append: { enumerable: true }, - has: { enumerable: true }, - delete: { enumerable: true }, - keys: { enumerable: true }, - values: { enumerable: true }, - entries: { enumerable: true } -}); - -function getHeaders(headers) { - let kind = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'key+value'; - - const keys = Object.keys(headers[MAP]).sort(); - return keys.map(kind === 'key' ? function (k) { - return k.toLowerCase(); - } : kind === 'value' ? function (k) { - return headers[MAP][k].join(', '); - } : function (k) { - return [k.toLowerCase(), headers[MAP][k].join(', ')]; - }); -} - -const INTERNAL = Symbol('internal'); - -function createHeadersIterator(target, kind) { - const iterator = Object.create(HeadersIteratorPrototype); - iterator[INTERNAL] = { - target, - kind, - index: 0 - }; - return iterator; -} - -const HeadersIteratorPrototype = Object.setPrototypeOf({ - next() { - // istanbul ignore if - if (!this || Object.getPrototypeOf(this) !== HeadersIteratorPrototype) { - throw new TypeError('Value of `this` is not a HeadersIterator'); - } - - var _INTERNAL = this[INTERNAL]; - const target = _INTERNAL.target, - kind = _INTERNAL.kind, - index = _INTERNAL.index; - - const values = getHeaders(target, kind); - const len = values.length; - if (index >= len) { - return { - value: undefined, - done: true - }; - } - - this[INTERNAL].index = index + 1; - - return { - value: values[index], - done: false - }; - } -}, Object.getPrototypeOf(Object.getPrototypeOf([][Symbol.iterator]()))); - -Object.defineProperty(HeadersIteratorPrototype, Symbol.toStringTag, { - value: 'HeadersIterator', - writable: false, - enumerable: false, - configurable: true -}); - -/** - * Export the Headers object in a form that Node.js can consume. - * - * @param Headers headers - * @return Object - */ -function exportNodeCompatibleHeaders(headers) { - const obj = Object.assign({ __proto__: null }, headers[MAP]); - - // http.request() only supports string as Host header. This hack makes - // specifying custom Host header possible. - const hostHeaderKey = find(headers[MAP], 'Host'); - if (hostHeaderKey !== undefined) { - obj[hostHeaderKey] = obj[hostHeaderKey][0]; - } - - return obj; -} - -/** - * Create a Headers object from an object of headers, ignoring those that do - * not conform to HTTP grammar productions. - * - * @param Object obj Object of headers - * @return Headers - */ -function createHeadersLenient(obj) { - const headers = new Headers(); - for (const name of Object.keys(obj)) { - if (invalidTokenRegex.test(name)) { - continue; - } - if (Array.isArray(obj[name])) { - for (const val of obj[name]) { - if (invalidHeaderCharRegex.test(val)) { - continue; - } - if (headers[MAP][name] === undefined) { - headers[MAP][name] = [val]; - } else { - headers[MAP][name].push(val); - } - } - } else if (!invalidHeaderCharRegex.test(obj[name])) { - headers[MAP][name] = [obj[name]]; - } - } - return headers; -} - -const INTERNALS$1 = Symbol('Response internals'); - -// fix an issue where "STATUS_CODES" aren't a named export for node <10 -const STATUS_CODES = http.STATUS_CODES; - -/** - * Response class - * - * @param Stream body Readable stream - * @param Object opts Response options - * @return Void - */ -class Response { - constructor() { - let body = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null; - let opts = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; - - Body.call(this, body, opts); - - const status = opts.status || 200; - const headers = new Headers(opts.headers); - - if (body != null && !headers.has('Content-Type')) { - const contentType = extractContentType(body); - if (contentType) { - headers.append('Content-Type', contentType); - } - } - - this[INTERNALS$1] = { - url: opts.url, - status, - statusText: opts.statusText || STATUS_CODES[status], - headers, - counter: opts.counter - }; - } - - get url() { - return this[INTERNALS$1].url || ''; - } - - get status() { - return this[INTERNALS$1].status; - } - - /** - * Convenience property representing if the request ended normally - */ - get ok() { - return this[INTERNALS$1].status >= 200 && this[INTERNALS$1].status < 300; - } - - get redirected() { - return this[INTERNALS$1].counter > 0; - } - - get statusText() { - return this[INTERNALS$1].statusText; - } - - get headers() { - return this[INTERNALS$1].headers; - } - - /** - * Clone this response - * - * @return Response - */ - clone() { - return new Response(clone(this), { - url: this.url, - status: this.status, - statusText: this.statusText, - headers: this.headers, - ok: this.ok, - redirected: this.redirected - }); - } -} - -Body.mixIn(Response.prototype); - -Object.defineProperties(Response.prototype, { - url: { enumerable: true }, - status: { enumerable: true }, - ok: { enumerable: true }, - redirected: { enumerable: true }, - statusText: { enumerable: true }, - headers: { enumerable: true }, - clone: { enumerable: true } -}); - -Object.defineProperty(Response.prototype, Symbol.toStringTag, { - value: 'Response', - writable: false, - enumerable: false, - configurable: true -}); - -const INTERNALS$2 = Symbol('Request internals'); - -// fix an issue where "format", "parse" aren't a named export for node <10 -const parse_url = Url.parse; -const format_url = Url.format; - -const streamDestructionSupported = 'destroy' in Stream.Readable.prototype; - -/** - * Check if a value is an instance of Request. - * - * @param Mixed input - * @return Boolean - */ -function isRequest(input) { - return typeof input === 'object' && typeof input[INTERNALS$2] === 'object'; -} - -function isAbortSignal(signal) { - const proto = signal && typeof signal === 'object' && Object.getPrototypeOf(signal); - return !!(proto && proto.constructor.name === 'AbortSignal'); -} - -/** - * Request class - * - * @param Mixed input Url or Request instance - * @param Object init Custom options - * @return Void - */ -class Request { - constructor(input) { - let init = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; - - let parsedURL; - - // normalize input - if (!isRequest(input)) { - if (input && input.href) { - // in order to support Node.js' Url objects; though WHATWG's URL objects - // will fall into this branch also (since their `toString()` will return - // `href` property anyway) - parsedURL = parse_url(input.href); - } else { - // coerce input to a string before attempting to parse - parsedURL = parse_url(`${input}`); - } - input = {}; - } else { - parsedURL = parse_url(input.url); - } - - let method = init.method || input.method || 'GET'; - method = method.toUpperCase(); - - if ((init.body != null || isRequest(input) && input.body !== null) && (method === 'GET' || method === 'HEAD')) { - throw new TypeError('Request with GET/HEAD method cannot have body'); - } - - let inputBody = init.body != null ? init.body : isRequest(input) && input.body !== null ? clone(input) : null; - - Body.call(this, inputBody, { - timeout: init.timeout || input.timeout || 0, - size: init.size || input.size || 0 - }); - - const headers = new Headers(init.headers || input.headers || {}); - - if (inputBody != null && !headers.has('Content-Type')) { - const contentType = extractContentType(inputBody); - if (contentType) { - headers.append('Content-Type', contentType); - } - } - - let signal = isRequest(input) ? input.signal : null; - if ('signal' in init) signal = init.signal; - - if (signal != null && !isAbortSignal(signal)) { - throw new TypeError('Expected signal to be an instanceof AbortSignal'); - } - - this[INTERNALS$2] = { - method, - redirect: init.redirect || input.redirect || 'follow', - headers, - parsedURL, - signal - }; - - // node-fetch-only options - this.follow = init.follow !== undefined ? init.follow : input.follow !== undefined ? input.follow : 20; - this.compress = init.compress !== undefined ? init.compress : input.compress !== undefined ? input.compress : true; - this.counter = init.counter || input.counter || 0; - this.agent = init.agent || input.agent; - } - - get method() { - return this[INTERNALS$2].method; - } - - get url() { - return format_url(this[INTERNALS$2].parsedURL); - } - - get headers() { - return this[INTERNALS$2].headers; - } - - get redirect() { - return this[INTERNALS$2].redirect; - } - - get signal() { - return this[INTERNALS$2].signal; - } - - /** - * Clone this request - * - * @return Request - */ - clone() { - return new Request(this); - } -} - -Body.mixIn(Request.prototype); - -Object.defineProperty(Request.prototype, Symbol.toStringTag, { - value: 'Request', - writable: false, - enumerable: false, - configurable: true -}); - -Object.defineProperties(Request.prototype, { - method: { enumerable: true }, - url: { enumerable: true }, - headers: { enumerable: true }, - redirect: { enumerable: true }, - clone: { enumerable: true }, - signal: { enumerable: true } -}); - -/** - * Convert a Request to Node.js http request options. - * - * @param Request A Request instance - * @return Object The options object to be passed to http.request - */ -function getNodeRequestOptions(request) { - const parsedURL = request[INTERNALS$2].parsedURL; - const headers = new Headers(request[INTERNALS$2].headers); - - // fetch step 1.3 - if (!headers.has('Accept')) { - headers.set('Accept', '*/*'); - } - - // Basic fetch - if (!parsedURL.protocol || !parsedURL.hostname) { - throw new TypeError('Only absolute URLs are supported'); - } - - if (!/^https?:$/.test(parsedURL.protocol)) { - throw new TypeError('Only HTTP(S) protocols are supported'); - } - - if (request.signal && request.body instanceof Stream.Readable && !streamDestructionSupported) { - throw new Error('Cancellation of streamed requests with AbortSignal is not supported in node < 8'); - } - - // HTTP-network-or-cache fetch steps 2.4-2.7 - let contentLengthValue = null; - if (request.body == null && /^(POST|PUT)$/i.test(request.method)) { - contentLengthValue = '0'; - } - if (request.body != null) { - const totalBytes = getTotalBytes(request); - if (typeof totalBytes === 'number') { - contentLengthValue = String(totalBytes); - } - } - if (contentLengthValue) { - headers.set('Content-Length', contentLengthValue); - } - - // HTTP-network-or-cache fetch step 2.11 - if (!headers.has('User-Agent')) { - headers.set('User-Agent', 'node-fetch/1.0 (+https://github.com/bitinn/node-fetch)'); - } - - // HTTP-network-or-cache fetch step 2.15 - if (request.compress && !headers.has('Accept-Encoding')) { - headers.set('Accept-Encoding', 'gzip,deflate'); - } - - let agent = request.agent; - if (typeof agent === 'function') { - agent = agent(parsedURL); - } - - if (!headers.has('Connection') && !agent) { - headers.set('Connection', 'close'); - } - - // HTTP-network fetch step 4.2 - // chunked encoding is handled by Node.js - - return Object.assign({}, parsedURL, { - method: request.method, - headers: exportNodeCompatibleHeaders(headers), - agent - }); -} - -/** - * abort-error.js - * - * AbortError interface for cancelled requests - */ - -/** - * Create AbortError instance - * - * @param String message Error message for human - * @return AbortError - */ -function AbortError(message) { - Error.call(this, message); - - this.type = 'aborted'; - this.message = message; - - // hide custom error implementation details from end-users - Error.captureStackTrace(this, this.constructor); -} - -AbortError.prototype = Object.create(Error.prototype); -AbortError.prototype.constructor = AbortError; -AbortError.prototype.name = 'AbortError'; - -// fix an issue where "PassThrough", "resolve" aren't a named export for node <10 -const PassThrough$1 = Stream.PassThrough; -const resolve_url = Url.resolve; - -/** - * Fetch function - * - * @param Mixed url Absolute url or Request instance - * @param Object opts Fetch options - * @return Promise - */ -function fetch(url, opts) { - - // allow custom promise - if (!fetch.Promise) { - throw new Error('native promise missing, set fetch.Promise to your favorite alternative'); - } - - Body.Promise = fetch.Promise; - - // wrap http.request into fetch - return new fetch.Promise(function (resolve, reject) { - // build request object - const request = new Request(url, opts); - const options = getNodeRequestOptions(request); - - const send = (options.protocol === 'https:' ? https : http).request; - const signal = request.signal; - - let response = null; - - const abort = function abort() { - let error = new AbortError('The user aborted a request.'); - reject(error); - if (request.body && request.body instanceof Stream.Readable) { - request.body.destroy(error); - } - if (!response || !response.body) return; - response.body.emit('error', error); - }; - - if (signal && signal.aborted) { - abort(); - return; - } - - const abortAndFinalize = function abortAndFinalize() { - abort(); - finalize(); - }; - - // send request - const req = send(options); - let reqTimeout; - - if (signal) { - signal.addEventListener('abort', abortAndFinalize); - } - - function finalize() { - req.abort(); - if (signal) signal.removeEventListener('abort', abortAndFinalize); - clearTimeout(reqTimeout); - } - - if (request.timeout) { - req.once('socket', function (socket) { - reqTimeout = setTimeout(function () { - reject(new FetchError(`network timeout at: ${request.url}`, 'request-timeout')); - finalize(); - }, request.timeout); - }); - } - - req.on('error', function (err) { - reject(new FetchError(`request to ${request.url} failed, reason: ${err.message}`, 'system', err)); - finalize(); - }); - - req.on('response', function (res) { - clearTimeout(reqTimeout); - - const headers = createHeadersLenient(res.headers); - - // HTTP fetch step 5 - if (fetch.isRedirect(res.statusCode)) { - // HTTP fetch step 5.2 - const location = headers.get('Location'); - - // HTTP fetch step 5.3 - const locationURL = location === null ? null : resolve_url(request.url, location); - - // HTTP fetch step 5.5 - switch (request.redirect) { - case 'error': - reject(new FetchError(`uri requested responds with a redirect, redirect mode is set to error: ${request.url}`, 'no-redirect')); - finalize(); - return; - case 'manual': - // node-fetch-specific step: make manual redirect a bit easier to use by setting the Location header value to the resolved URL. - if (locationURL !== null) { - // handle corrupted header - try { - headers.set('Location', locationURL); - } catch (err) { - // istanbul ignore next: nodejs server prevent invalid response headers, we can't test this through normal request - reject(err); - } - } - break; - case 'follow': - // HTTP-redirect fetch step 2 - if (locationURL === null) { - break; - } - - // HTTP-redirect fetch step 5 - if (request.counter >= request.follow) { - reject(new FetchError(`maximum redirect reached at: ${request.url}`, 'max-redirect')); - finalize(); - return; - } - - // HTTP-redirect fetch step 6 (counter increment) - // Create a new Request object. - const requestOpts = { - headers: new Headers(request.headers), - follow: request.follow, - counter: request.counter + 1, - agent: request.agent, - compress: request.compress, - method: request.method, - body: request.body, - signal: request.signal, - timeout: request.timeout, - size: request.size - }; - - // HTTP-redirect fetch step 9 - if (res.statusCode !== 303 && request.body && getTotalBytes(request) === null) { - reject(new FetchError('Cannot follow redirect with body being a readable stream', 'unsupported-redirect')); - finalize(); - return; - } - - // HTTP-redirect fetch step 11 - if (res.statusCode === 303 || (res.statusCode === 301 || res.statusCode === 302) && request.method === 'POST') { - requestOpts.method = 'GET'; - requestOpts.body = undefined; - requestOpts.headers.delete('content-length'); - } - - // HTTP-redirect fetch step 15 - resolve(fetch(new Request(locationURL, requestOpts))); - finalize(); - return; - } - } - - // prepare response - res.once('end', function () { - if (signal) signal.removeEventListener('abort', abortAndFinalize); - }); - let body = res.pipe(new PassThrough$1()); - - const response_options = { - url: request.url, - status: res.statusCode, - statusText: res.statusMessage, - headers: headers, - size: request.size, - timeout: request.timeout, - counter: request.counter - }; - - // HTTP-network fetch step 12.1.1.3 - const codings = headers.get('Content-Encoding'); - - // HTTP-network fetch step 12.1.1.4: handle content codings - - // in following scenarios we ignore compression support - // 1. compression support is disabled - // 2. HEAD request - // 3. no Content-Encoding header - // 4. no content response (204) - // 5. content not modified response (304) - if (!request.compress || request.method === 'HEAD' || codings === null || res.statusCode === 204 || res.statusCode === 304) { - response = new Response(body, response_options); - resolve(response); - return; - } - - // For Node v6+ - // Be less strict when decoding compressed responses, since sometimes - // servers send slightly invalid responses that are still accepted - // by common browsers. - // Always using Z_SYNC_FLUSH is what cURL does. - const zlibOptions = { - flush: zlib.Z_SYNC_FLUSH, - finishFlush: zlib.Z_SYNC_FLUSH - }; - - // for gzip - if (codings == 'gzip' || codings == 'x-gzip') { - body = body.pipe(zlib.createGunzip(zlibOptions)); - response = new Response(body, response_options); - resolve(response); - return; - } - - // for deflate - if (codings == 'deflate' || codings == 'x-deflate') { - // handle the infamous raw deflate response from old servers - // a hack for old IIS and Apache servers - const raw = res.pipe(new PassThrough$1()); - raw.once('data', function (chunk) { - // see http://stackoverflow.com/questions/37519828 - if ((chunk[0] & 0x0F) === 0x08) { - body = body.pipe(zlib.createInflate()); - } else { - body = body.pipe(zlib.createInflateRaw()); - } - response = new Response(body, response_options); - resolve(response); - }); - return; - } - - // for br - if (codings == 'br' && typeof zlib.createBrotliDecompress === 'function') { - body = body.pipe(zlib.createBrotliDecompress()); - response = new Response(body, response_options); - resolve(response); - return; - } - - // otherwise, use response as-is - response = new Response(body, response_options); - resolve(response); - }); - - writeToStream(req, request); - }); -} -/** - * Redirect code matching - * - * @param Number code Status code - * @return Boolean - */ -fetch.isRedirect = function (code) { - return code === 301 || code === 302 || code === 303 || code === 307 || code === 308; -}; - -// expose Promise -fetch.Promise = global.Promise; - -module.exports = exports = fetch; -Object.defineProperty(exports, "__esModule", { value: true }); -exports.default = exports; -exports.Headers = Headers; -exports.Request = Request; -exports.Response = Response; -exports.FetchError = FetchError; - - -/***/ }), -/* 455 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var http = __webpack_require__(605) -var https = __webpack_require__(211) -var url = __webpack_require__(835) -var util = __webpack_require__(669) -var stream = __webpack_require__(413) -var zlib = __webpack_require__(761) -var aws2 = __webpack_require__(942) -var aws4 = __webpack_require__(658) -var httpSignature = __webpack_require__(789) -var mime = __webpack_require__(432) -var caseless = __webpack_require__(7) -var ForeverAgent = __webpack_require__(792) -var FormData = __webpack_require__(928) -var extend = __webpack_require__(374) -var isstream = __webpack_require__(382) -var isTypedArray = __webpack_require__(944).strict -var helpers = __webpack_require__(810) -var cookies = __webpack_require__(602) -var getProxyFromURI = __webpack_require__(298) -var Querystring = __webpack_require__(629).Querystring -var Har = __webpack_require__(416).Har -var Auth = __webpack_require__(554).Auth -var OAuth = __webpack_require__(287).OAuth -var hawk = __webpack_require__(964) -var Multipart = __webpack_require__(469).Multipart -var Redirect = __webpack_require__(552).Redirect -var Tunnel = __webpack_require__(461).Tunnel -var now = __webpack_require__(742) -var Buffer = __webpack_require__(149).Buffer - -var safeStringify = helpers.safeStringify -var isReadStream = helpers.isReadStream -var toBase64 = helpers.toBase64 -var defer = helpers.defer -var copy = helpers.copy -var version = helpers.version -var globalCookieJar = cookies.jar() - -var globalPool = {} - -function filterForNonReserved (reserved, options) { - // Filter out properties that are not reserved. - // Reserved values are passed in at call site. - - var object = {} - for (var i in options) { - var notReserved = (reserved.indexOf(i) === -1) - if (notReserved) { - object[i] = options[i] - } - } - return object -} - -function filterOutReservedFunctions (reserved, options) { - // Filter out properties that are functions and are reserved. - // Reserved values are passed in at call site. - - var object = {} - for (var i in options) { - var isReserved = !(reserved.indexOf(i) === -1) - var isFunction = (typeof options[i] === 'function') - if (!(isReserved && isFunction)) { - object[i] = options[i] - } - } - return object -} - -// Return a simpler request object to allow serialization -function requestToJSON () { - var self = this - return { - uri: self.uri, - method: self.method, - headers: self.headers - } -} - -// Return a simpler response object to allow serialization -function responseToJSON () { - var self = this - return { - statusCode: self.statusCode, - body: self.body, - headers: self.headers, - request: requestToJSON.call(self.request) - } -} - -function Request (options) { - // if given the method property in options, set property explicitMethod to true - - // extend the Request instance with any non-reserved properties - // remove any reserved functions from the options object - // set Request instance to be readable and writable - // call init - - var self = this - - // start with HAR, then override with additional options - if (options.har) { - self._har = new Har(self) - options = self._har.options(options) - } - - stream.Stream.call(self) - var reserved = Object.keys(Request.prototype) - var nonReserved = filterForNonReserved(reserved, options) - - extend(self, nonReserved) - options = filterOutReservedFunctions(reserved, options) - - self.readable = true - self.writable = true - if (options.method) { - self.explicitMethod = true - } - self._qs = new Querystring(self) - self._auth = new Auth(self) - self._oauth = new OAuth(self) - self._multipart = new Multipart(self) - self._redirect = new Redirect(self) - self._tunnel = new Tunnel(self) - self.init(options) -} - -util.inherits(Request, stream.Stream) - -// Debugging -Request.debug = process.env.NODE_DEBUG && /\brequest\b/.test(process.env.NODE_DEBUG) -function debug () { - if (Request.debug) { - console.error('REQUEST %s', util.format.apply(util, arguments)) - } -} -Request.prototype.debug = debug - -Request.prototype.init = function (options) { - // init() contains all the code to setup the request object. - // the actual outgoing request is not started until start() is called - // this function is called from both the constructor and on redirect. - var self = this - if (!options) { - options = {} - } - self.headers = self.headers ? copy(self.headers) : {} - - // Delete headers with value undefined since they break - // ClientRequest.OutgoingMessage.setHeader in node 0.12 - for (var headerName in self.headers) { - if (typeof self.headers[headerName] === 'undefined') { - delete self.headers[headerName] - } - } - - caseless.httpify(self, self.headers) - - if (!self.method) { - self.method = options.method || 'GET' - } - if (!self.localAddress) { - self.localAddress = options.localAddress - } - - self._qs.init(options) - - debug(options) - if (!self.pool && self.pool !== false) { - self.pool = globalPool - } - self.dests = self.dests || [] - self.__isRequestRequest = true - - // Protect against double callback - if (!self._callback && self.callback) { - self._callback = self.callback - self.callback = function () { - if (self._callbackCalled) { - return // Print a warning maybe? - } - self._callbackCalled = true - self._callback.apply(self, arguments) - } - self.on('error', self.callback.bind()) - self.on('complete', self.callback.bind(self, null)) - } - - // People use this property instead all the time, so support it - if (!self.uri && self.url) { - self.uri = self.url - delete self.url - } - - // If there's a baseUrl, then use it as the base URL (i.e. uri must be - // specified as a relative path and is appended to baseUrl). - if (self.baseUrl) { - if (typeof self.baseUrl !== 'string') { - return self.emit('error', new Error('options.baseUrl must be a string')) - } - - if (typeof self.uri !== 'string') { - return self.emit('error', new Error('options.uri must be a string when using options.baseUrl')) - } - - if (self.uri.indexOf('//') === 0 || self.uri.indexOf('://') !== -1) { - return self.emit('error', new Error('options.uri must be a path when using options.baseUrl')) - } - - // Handle all cases to make sure that there's only one slash between - // baseUrl and uri. - var baseUrlEndsWithSlash = self.baseUrl.lastIndexOf('/') === self.baseUrl.length - 1 - var uriStartsWithSlash = self.uri.indexOf('/') === 0 - - if (baseUrlEndsWithSlash && uriStartsWithSlash) { - self.uri = self.baseUrl + self.uri.slice(1) - } else if (baseUrlEndsWithSlash || uriStartsWithSlash) { - self.uri = self.baseUrl + self.uri - } else if (self.uri === '') { - self.uri = self.baseUrl - } else { - self.uri = self.baseUrl + '/' + self.uri - } - delete self.baseUrl - } - - // A URI is needed by this point, emit error if we haven't been able to get one - if (!self.uri) { - return self.emit('error', new Error('options.uri is a required argument')) - } - - // If a string URI/URL was given, parse it into a URL object - if (typeof self.uri === 'string') { - self.uri = url.parse(self.uri) - } - - // Some URL objects are not from a URL parsed string and need href added - if (!self.uri.href) { - self.uri.href = url.format(self.uri) - } - - // DEPRECATED: Warning for users of the old Unix Sockets URL Scheme - if (self.uri.protocol === 'unix:') { - return self.emit('error', new Error('`unix://` URL scheme is no longer supported. Please use the format `http://unix:SOCKET:PATH`')) - } - - // Support Unix Sockets - if (self.uri.host === 'unix') { - self.enableUnixSocket() - } - - if (self.strictSSL === false) { - self.rejectUnauthorized = false - } - - if (!self.uri.pathname) { self.uri.pathname = '/' } - - if (!(self.uri.host || (self.uri.hostname && self.uri.port)) && !self.uri.isUnix) { - // Invalid URI: it may generate lot of bad errors, like 'TypeError: Cannot call method `indexOf` of undefined' in CookieJar - // Detect and reject it as soon as possible - var faultyUri = url.format(self.uri) - var message = 'Invalid URI "' + faultyUri + '"' - if (Object.keys(options).length === 0) { - // No option ? This can be the sign of a redirect - // As this is a case where the user cannot do anything (they didn't call request directly with this URL) - // they should be warned that it can be caused by a redirection (can save some hair) - message += '. This can be caused by a crappy redirection.' - } - // This error was fatal - self.abort() - return self.emit('error', new Error(message)) - } - - if (!self.hasOwnProperty('proxy')) { - self.proxy = getProxyFromURI(self.uri) - } - - self.tunnel = self._tunnel.isEnabled() - if (self.proxy) { - self._tunnel.setup(options) - } - - self._redirect.onRequest(options) - - self.setHost = false - if (!self.hasHeader('host')) { - var hostHeaderName = self.originalHostHeaderName || 'host' - self.setHeader(hostHeaderName, self.uri.host) - // Drop :port suffix from Host header if known protocol. - if (self.uri.port) { - if ((self.uri.port === '80' && self.uri.protocol === 'http:') || - (self.uri.port === '443' && self.uri.protocol === 'https:')) { - self.setHeader(hostHeaderName, self.uri.hostname) - } - } - self.setHost = true - } - - self.jar(self._jar || options.jar) - - if (!self.uri.port) { - if (self.uri.protocol === 'http:') { self.uri.port = 80 } else if (self.uri.protocol === 'https:') { self.uri.port = 443 } - } - - if (self.proxy && !self.tunnel) { - self.port = self.proxy.port - self.host = self.proxy.hostname - } else { - self.port = self.uri.port - self.host = self.uri.hostname - } - - if (options.form) { - self.form(options.form) - } - - if (options.formData) { - var formData = options.formData - var requestForm = self.form() - var appendFormValue = function (key, value) { - if (value && value.hasOwnProperty('value') && value.hasOwnProperty('options')) { - requestForm.append(key, value.value, value.options) - } else { - requestForm.append(key, value) - } - } - for (var formKey in formData) { - if (formData.hasOwnProperty(formKey)) { - var formValue = formData[formKey] - if (formValue instanceof Array) { - for (var j = 0; j < formValue.length; j++) { - appendFormValue(formKey, formValue[j]) - } - } else { - appendFormValue(formKey, formValue) - } - } - } - } - - if (options.qs) { - self.qs(options.qs) - } - - if (self.uri.path) { - self.path = self.uri.path - } else { - self.path = self.uri.pathname + (self.uri.search || '') - } - - if (self.path.length === 0) { - self.path = '/' - } - - // Auth must happen last in case signing is dependent on other headers - if (options.aws) { - self.aws(options.aws) - } - - if (options.hawk) { - self.hawk(options.hawk) - } - - if (options.httpSignature) { - self.httpSignature(options.httpSignature) - } - - if (options.auth) { - if (Object.prototype.hasOwnProperty.call(options.auth, 'username')) { - options.auth.user = options.auth.username - } - if (Object.prototype.hasOwnProperty.call(options.auth, 'password')) { - options.auth.pass = options.auth.password - } - - self.auth( - options.auth.user, - options.auth.pass, - options.auth.sendImmediately, - options.auth.bearer - ) - } - - if (self.gzip && !self.hasHeader('accept-encoding')) { - self.setHeader('accept-encoding', 'gzip, deflate') - } - - if (self.uri.auth && !self.hasHeader('authorization')) { - var uriAuthPieces = self.uri.auth.split(':').map(function (item) { return self._qs.unescape(item) }) - self.auth(uriAuthPieces[0], uriAuthPieces.slice(1).join(':'), true) - } - - if (!self.tunnel && self.proxy && self.proxy.auth && !self.hasHeader('proxy-authorization')) { - var proxyAuthPieces = self.proxy.auth.split(':').map(function (item) { return self._qs.unescape(item) }) - var authHeader = 'Basic ' + toBase64(proxyAuthPieces.join(':')) - self.setHeader('proxy-authorization', authHeader) - } - - if (self.proxy && !self.tunnel) { - self.path = (self.uri.protocol + '//' + self.uri.host + self.path) - } - - if (options.json) { - self.json(options.json) - } - if (options.multipart) { - self.multipart(options.multipart) - } - - if (options.time) { - self.timing = true - - // NOTE: elapsedTime is deprecated in favor of .timings - self.elapsedTime = self.elapsedTime || 0 - } - - function setContentLength () { - if (isTypedArray(self.body)) { - self.body = Buffer.from(self.body) - } - - if (!self.hasHeader('content-length')) { - var length - if (typeof self.body === 'string') { - length = Buffer.byteLength(self.body) - } else if (Array.isArray(self.body)) { - length = self.body.reduce(function (a, b) { return a + b.length }, 0) - } else { - length = self.body.length - } - - if (length) { - self.setHeader('content-length', length) - } else { - self.emit('error', new Error('Argument error, options.body.')) - } - } - } - if (self.body && !isstream(self.body)) { - setContentLength() - } - - if (options.oauth) { - self.oauth(options.oauth) - } else if (self._oauth.params && self.hasHeader('authorization')) { - self.oauth(self._oauth.params) - } - - var protocol = self.proxy && !self.tunnel ? self.proxy.protocol : self.uri.protocol - var defaultModules = {'http:': http, 'https:': https} - var httpModules = self.httpModules || {} - - self.httpModule = httpModules[protocol] || defaultModules[protocol] - - if (!self.httpModule) { - return self.emit('error', new Error('Invalid protocol: ' + protocol)) - } - - if (options.ca) { - self.ca = options.ca - } - - if (!self.agent) { - if (options.agentOptions) { - self.agentOptions = options.agentOptions - } - - if (options.agentClass) { - self.agentClass = options.agentClass - } else if (options.forever) { - var v = version() - // use ForeverAgent in node 0.10- only - if (v.major === 0 && v.minor <= 10) { - self.agentClass = protocol === 'http:' ? ForeverAgent : ForeverAgent.SSL - } else { - self.agentClass = self.httpModule.Agent - self.agentOptions = self.agentOptions || {} - self.agentOptions.keepAlive = true - } - } else { - self.agentClass = self.httpModule.Agent - } - } - - if (self.pool === false) { - self.agent = false - } else { - self.agent = self.agent || self.getNewAgent() - } - - self.on('pipe', function (src) { - if (self.ntick && self._started) { - self.emit('error', new Error('You cannot pipe to this stream after the outbound request has started.')) - } - self.src = src - if (isReadStream(src)) { - if (!self.hasHeader('content-type')) { - self.setHeader('content-type', mime.lookup(src.path)) - } - } else { - if (src.headers) { - for (var i in src.headers) { - if (!self.hasHeader(i)) { - self.setHeader(i, src.headers[i]) - } - } - } - if (self._json && !self.hasHeader('content-type')) { - self.setHeader('content-type', 'application/json') - } - if (src.method && !self.explicitMethod) { - self.method = src.method - } - } - - // self.on('pipe', function () { - // console.error('You have already piped to this stream. Pipeing twice is likely to break the request.') - // }) - }) - - defer(function () { - if (self._aborted) { - return - } - - var end = function () { - if (self._form) { - if (!self._auth.hasAuth) { - self._form.pipe(self) - } else if (self._auth.hasAuth && self._auth.sentAuth) { - self._form.pipe(self) - } - } - if (self._multipart && self._multipart.chunked) { - self._multipart.body.pipe(self) - } - if (self.body) { - if (isstream(self.body)) { - self.body.pipe(self) - } else { - setContentLength() - if (Array.isArray(self.body)) { - self.body.forEach(function (part) { - self.write(part) - }) - } else { - self.write(self.body) - } - self.end() - } - } else if (self.requestBodyStream) { - console.warn('options.requestBodyStream is deprecated, please pass the request object to stream.pipe.') - self.requestBodyStream.pipe(self) - } else if (!self.src) { - if (self._auth.hasAuth && !self._auth.sentAuth) { - self.end() - return - } - if (self.method !== 'GET' && typeof self.method !== 'undefined') { - self.setHeader('content-length', 0) - } - self.end() - } - } - - if (self._form && !self.hasHeader('content-length')) { - // Before ending the request, we had to compute the length of the whole form, asyncly - self.setHeader(self._form.getHeaders(), true) - self._form.getLength(function (err, length) { - if (!err && !isNaN(length)) { - self.setHeader('content-length', length) - } - end() - }) - } else { - end() - } - - self.ntick = true - }) -} - -Request.prototype.getNewAgent = function () { - var self = this - var Agent = self.agentClass - var options = {} - if (self.agentOptions) { - for (var i in self.agentOptions) { - options[i] = self.agentOptions[i] - } - } - if (self.ca) { - options.ca = self.ca - } - if (self.ciphers) { - options.ciphers = self.ciphers - } - if (self.secureProtocol) { - options.secureProtocol = self.secureProtocol - } - if (self.secureOptions) { - options.secureOptions = self.secureOptions - } - if (typeof self.rejectUnauthorized !== 'undefined') { - options.rejectUnauthorized = self.rejectUnauthorized - } - - if (self.cert && self.key) { - options.key = self.key - options.cert = self.cert - } - - if (self.pfx) { - options.pfx = self.pfx - } - - if (self.passphrase) { - options.passphrase = self.passphrase - } - - var poolKey = '' - - // different types of agents are in different pools - if (Agent !== self.httpModule.Agent) { - poolKey += Agent.name - } - - // ca option is only relevant if proxy or destination are https - var proxy = self.proxy - if (typeof proxy === 'string') { - proxy = url.parse(proxy) - } - var isHttps = (proxy && proxy.protocol === 'https:') || this.uri.protocol === 'https:' - - if (isHttps) { - if (options.ca) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.ca - } - - if (typeof options.rejectUnauthorized !== 'undefined') { - if (poolKey) { - poolKey += ':' - } - poolKey += options.rejectUnauthorized - } - - if (options.cert) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.cert.toString('ascii') + options.key.toString('ascii') - } - - if (options.pfx) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.pfx.toString('ascii') - } - - if (options.ciphers) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.ciphers - } - - if (options.secureProtocol) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.secureProtocol - } - - if (options.secureOptions) { - if (poolKey) { - poolKey += ':' - } - poolKey += options.secureOptions - } - } - - if (self.pool === globalPool && !poolKey && Object.keys(options).length === 0 && self.httpModule.globalAgent) { - // not doing anything special. Use the globalAgent - return self.httpModule.globalAgent - } - - // we're using a stored agent. Make sure it's protocol-specific - poolKey = self.uri.protocol + poolKey - - // generate a new agent for this setting if none yet exists - if (!self.pool[poolKey]) { - self.pool[poolKey] = new Agent(options) - // properly set maxSockets on new agents - if (self.pool.maxSockets) { - self.pool[poolKey].maxSockets = self.pool.maxSockets - } - } - - return self.pool[poolKey] -} - -Request.prototype.start = function () { - // start() is called once we are ready to send the outgoing HTTP request. - // this is usually called on the first write(), end() or on nextTick() - var self = this - - if (self.timing) { - // All timings will be relative to this request's startTime. In order to do this, - // we need to capture the wall-clock start time (via Date), immediately followed - // by the high-resolution timer (via now()). While these two won't be set - // at the _exact_ same time, they should be close enough to be able to calculate - // high-resolution, monotonically non-decreasing timestamps relative to startTime. - var startTime = new Date().getTime() - var startTimeNow = now() - } - - if (self._aborted) { - return - } - - self._started = true - self.method = self.method || 'GET' - self.href = self.uri.href - - if (self.src && self.src.stat && self.src.stat.size && !self.hasHeader('content-length')) { - self.setHeader('content-length', self.src.stat.size) - } - if (self._aws) { - self.aws(self._aws, true) - } - - // We have a method named auth, which is completely different from the http.request - // auth option. If we don't remove it, we're gonna have a bad time. - var reqOptions = copy(self) - delete reqOptions.auth - - debug('make request', self.uri.href) - - // node v6.8.0 now supports a `timeout` value in `http.request()`, but we - // should delete it for now since we handle timeouts manually for better - // consistency with node versions before v6.8.0 - delete reqOptions.timeout - - try { - self.req = self.httpModule.request(reqOptions) - } catch (err) { - self.emit('error', err) - return - } - - if (self.timing) { - self.startTime = startTime - self.startTimeNow = startTimeNow - - // Timing values will all be relative to startTime (by comparing to startTimeNow - // so we have an accurate clock) - self.timings = {} - } - - var timeout - if (self.timeout && !self.timeoutTimer) { - if (self.timeout < 0) { - timeout = 0 - } else if (typeof self.timeout === 'number' && isFinite(self.timeout)) { - timeout = self.timeout - } - } - - self.req.on('response', self.onRequestResponse.bind(self)) - self.req.on('error', self.onRequestError.bind(self)) - self.req.on('drain', function () { - self.emit('drain') - }) - - self.req.on('socket', function (socket) { - // `._connecting` was the old property which was made public in node v6.1.0 - var isConnecting = socket._connecting || socket.connecting - if (self.timing) { - self.timings.socket = now() - self.startTimeNow - - if (isConnecting) { - var onLookupTiming = function () { - self.timings.lookup = now() - self.startTimeNow - } - - var onConnectTiming = function () { - self.timings.connect = now() - self.startTimeNow - } - - socket.once('lookup', onLookupTiming) - socket.once('connect', onConnectTiming) - - // clean up timing event listeners if needed on error - self.req.once('error', function () { - socket.removeListener('lookup', onLookupTiming) - socket.removeListener('connect', onConnectTiming) - }) - } - } - - var setReqTimeout = function () { - // This timeout sets the amount of time to wait *between* bytes sent - // from the server once connected. - // - // In particular, it's useful for erroring if the server fails to send - // data halfway through streaming a response. - self.req.setTimeout(timeout, function () { - if (self.req) { - self.abort() - var e = new Error('ESOCKETTIMEDOUT') - e.code = 'ESOCKETTIMEDOUT' - e.connect = false - self.emit('error', e) - } - }) - } - if (timeout !== undefined) { - // Only start the connection timer if we're actually connecting a new - // socket, otherwise if we're already connected (because this is a - // keep-alive connection) do not bother. This is important since we won't - // get a 'connect' event for an already connected socket. - if (isConnecting) { - var onReqSockConnect = function () { - socket.removeListener('connect', onReqSockConnect) - self.clearTimeout() - setReqTimeout() - } - - socket.on('connect', onReqSockConnect) - - self.req.on('error', function (err) { // eslint-disable-line handle-callback-err - socket.removeListener('connect', onReqSockConnect) - }) - - // Set a timeout in memory - this block will throw if the server takes more - // than `timeout` to write the HTTP status and headers (corresponding to - // the on('response') event on the client). NB: this measures wall-clock - // time, not the time between bytes sent by the server. - self.timeoutTimer = setTimeout(function () { - socket.removeListener('connect', onReqSockConnect) - self.abort() - var e = new Error('ETIMEDOUT') - e.code = 'ETIMEDOUT' - e.connect = true - self.emit('error', e) - }, timeout) - } else { - // We're already connected - setReqTimeout() - } - } - self.emit('socket', socket) - }) - - self.emit('request', self.req) -} - -Request.prototype.onRequestError = function (error) { - var self = this - if (self._aborted) { - return - } - if (self.req && self.req._reusedSocket && error.code === 'ECONNRESET' && - self.agent.addRequestNoreuse) { - self.agent = { addRequest: self.agent.addRequestNoreuse.bind(self.agent) } - self.start() - self.req.end() - return - } - self.clearTimeout() - self.emit('error', error) -} - -Request.prototype.onRequestResponse = function (response) { - var self = this - - if (self.timing) { - self.timings.response = now() - self.startTimeNow - } - - debug('onRequestResponse', self.uri.href, response.statusCode, response.headers) - response.on('end', function () { - if (self.timing) { - self.timings.end = now() - self.startTimeNow - response.timingStart = self.startTime - - // fill in the blanks for any periods that didn't trigger, such as - // no lookup or connect due to keep alive - if (!self.timings.socket) { - self.timings.socket = 0 - } - if (!self.timings.lookup) { - self.timings.lookup = self.timings.socket - } - if (!self.timings.connect) { - self.timings.connect = self.timings.lookup - } - if (!self.timings.response) { - self.timings.response = self.timings.connect - } - - debug('elapsed time', self.timings.end) - - // elapsedTime includes all redirects - self.elapsedTime += Math.round(self.timings.end) - - // NOTE: elapsedTime is deprecated in favor of .timings - response.elapsedTime = self.elapsedTime - - // timings is just for the final fetch - response.timings = self.timings - - // pre-calculate phase timings as well - response.timingPhases = { - wait: self.timings.socket, - dns: self.timings.lookup - self.timings.socket, - tcp: self.timings.connect - self.timings.lookup, - firstByte: self.timings.response - self.timings.connect, - download: self.timings.end - self.timings.response, - total: self.timings.end - } - } - debug('response end', self.uri.href, response.statusCode, response.headers) - }) - - if (self._aborted) { - debug('aborted', self.uri.href) - response.resume() - return - } - - self.response = response - response.request = self - response.toJSON = responseToJSON - - // XXX This is different on 0.10, because SSL is strict by default - if (self.httpModule === https && - self.strictSSL && (!response.hasOwnProperty('socket') || - !response.socket.authorized)) { - debug('strict ssl error', self.uri.href) - var sslErr = response.hasOwnProperty('socket') ? response.socket.authorizationError : self.uri.href + ' does not support SSL' - self.emit('error', new Error('SSL Error: ' + sslErr)) - return - } - - // Save the original host before any redirect (if it changes, we need to - // remove any authorization headers). Also remember the case of the header - // name because lots of broken servers expect Host instead of host and we - // want the caller to be able to specify this. - self.originalHost = self.getHeader('host') - if (!self.originalHostHeaderName) { - self.originalHostHeaderName = self.hasHeader('host') - } - if (self.setHost) { - self.removeHeader('host') - } - self.clearTimeout() - - var targetCookieJar = (self._jar && self._jar.setCookie) ? self._jar : globalCookieJar - var addCookie = function (cookie) { - // set the cookie if it's domain in the href's domain. - try { - targetCookieJar.setCookie(cookie, self.uri.href, {ignoreError: true}) - } catch (e) { - self.emit('error', e) - } - } - - response.caseless = caseless(response.headers) - - if (response.caseless.has('set-cookie') && (!self._disableCookies)) { - var headerName = response.caseless.has('set-cookie') - if (Array.isArray(response.headers[headerName])) { - response.headers[headerName].forEach(addCookie) - } else { - addCookie(response.headers[headerName]) - } - } - - if (self._redirect.onResponse(response)) { - return // Ignore the rest of the response - } else { - // Be a good stream and emit end when the response is finished. - // Hack to emit end on close because of a core bug that never fires end - response.on('close', function () { - if (!self._ended) { - self.response.emit('end') - } - }) - - response.once('end', function () { - self._ended = true - }) - - var noBody = function (code) { - return ( - self.method === 'HEAD' || - // Informational - (code >= 100 && code < 200) || - // No Content - code === 204 || - // Not Modified - code === 304 - ) - } - - var responseContent - if (self.gzip && !noBody(response.statusCode)) { - var contentEncoding = response.headers['content-encoding'] || 'identity' - contentEncoding = contentEncoding.trim().toLowerCase() - - // Be more lenient with decoding compressed responses, since (very rarely) - // servers send slightly invalid gzip responses that are still accepted - // by common browsers. - // Always using Z_SYNC_FLUSH is what cURL does. - var zlibOptions = { - flush: zlib.Z_SYNC_FLUSH, - finishFlush: zlib.Z_SYNC_FLUSH - } - - if (contentEncoding === 'gzip') { - responseContent = zlib.createGunzip(zlibOptions) - response.pipe(responseContent) - } else if (contentEncoding === 'deflate') { - responseContent = zlib.createInflate(zlibOptions) - response.pipe(responseContent) - } else { - // Since previous versions didn't check for Content-Encoding header, - // ignore any invalid values to preserve backwards-compatibility - if (contentEncoding !== 'identity') { - debug('ignoring unrecognized Content-Encoding ' + contentEncoding) - } - responseContent = response - } - } else { - responseContent = response - } - - if (self.encoding) { - if (self.dests.length !== 0) { - console.error('Ignoring encoding parameter as this stream is being piped to another stream which makes the encoding option invalid.') - } else { - responseContent.setEncoding(self.encoding) - } - } - - if (self._paused) { - responseContent.pause() - } - - self.responseContent = responseContent - - self.emit('response', response) - - self.dests.forEach(function (dest) { - self.pipeDest(dest) - }) - - responseContent.on('data', function (chunk) { - if (self.timing && !self.responseStarted) { - self.responseStartTime = (new Date()).getTime() - - // NOTE: responseStartTime is deprecated in favor of .timings - response.responseStartTime = self.responseStartTime - } - self._destdata = true - self.emit('data', chunk) - }) - responseContent.once('end', function (chunk) { - self.emit('end', chunk) - }) - responseContent.on('error', function (error) { - self.emit('error', error) - }) - responseContent.on('close', function () { self.emit('close') }) - - if (self.callback) { - self.readResponseBody(response) - } else { // if no callback - self.on('end', function () { - if (self._aborted) { - debug('aborted', self.uri.href) - return - } - self.emit('complete', response) - }) - } - } - debug('finish init function', self.uri.href) -} - -Request.prototype.readResponseBody = function (response) { - var self = this - debug("reading response's body") - var buffers = [] - var bufferLength = 0 - var strings = [] - - self.on('data', function (chunk) { - if (!Buffer.isBuffer(chunk)) { - strings.push(chunk) - } else if (chunk.length) { - bufferLength += chunk.length - buffers.push(chunk) - } - }) - self.on('end', function () { - debug('end event', self.uri.href) - if (self._aborted) { - debug('aborted', self.uri.href) - // `buffer` is defined in the parent scope and used in a closure it exists for the life of the request. - // This can lead to leaky behavior if the user retains a reference to the request object. - buffers = [] - bufferLength = 0 - return - } - - if (bufferLength) { - debug('has body', self.uri.href, bufferLength) - response.body = Buffer.concat(buffers, bufferLength) - if (self.encoding !== null) { - response.body = response.body.toString(self.encoding) - } - // `buffer` is defined in the parent scope and used in a closure it exists for the life of the Request. - // This can lead to leaky behavior if the user retains a reference to the request object. - buffers = [] - bufferLength = 0 - } else if (strings.length) { - // The UTF8 BOM [0xEF,0xBB,0xBF] is converted to [0xFE,0xFF] in the JS UTC16/UCS2 representation. - // Strip this value out when the encoding is set to 'utf8', as upstream consumers won't expect it and it breaks JSON.parse(). - if (self.encoding === 'utf8' && strings[0].length > 0 && strings[0][0] === '\uFEFF') { - strings[0] = strings[0].substring(1) - } - response.body = strings.join('') - } - - if (self._json) { - try { - response.body = JSON.parse(response.body, self._jsonReviver) - } catch (e) { - debug('invalid JSON received', self.uri.href) - } - } - debug('emitting complete', self.uri.href) - if (typeof response.body === 'undefined' && !self._json) { - response.body = self.encoding === null ? Buffer.alloc(0) : '' - } - self.emit('complete', response, response.body) - }) -} - -Request.prototype.abort = function () { - var self = this - self._aborted = true - - if (self.req) { - self.req.abort() - } else if (self.response) { - self.response.destroy() - } - - self.clearTimeout() - self.emit('abort') -} - -Request.prototype.pipeDest = function (dest) { - var self = this - var response = self.response - // Called after the response is received - if (dest.headers && !dest.headersSent) { - if (response.caseless.has('content-type')) { - var ctname = response.caseless.has('content-type') - if (dest.setHeader) { - dest.setHeader(ctname, response.headers[ctname]) - } else { - dest.headers[ctname] = response.headers[ctname] - } - } - - if (response.caseless.has('content-length')) { - var clname = response.caseless.has('content-length') - if (dest.setHeader) { - dest.setHeader(clname, response.headers[clname]) - } else { - dest.headers[clname] = response.headers[clname] - } - } - } - if (dest.setHeader && !dest.headersSent) { - for (var i in response.headers) { - // If the response content is being decoded, the Content-Encoding header - // of the response doesn't represent the piped content, so don't pass it. - if (!self.gzip || i !== 'content-encoding') { - dest.setHeader(i, response.headers[i]) - } - } - dest.statusCode = response.statusCode - } - if (self.pipefilter) { - self.pipefilter(response, dest) - } -} - -Request.prototype.qs = function (q, clobber) { - var self = this - var base - if (!clobber && self.uri.query) { - base = self._qs.parse(self.uri.query) - } else { - base = {} - } - - for (var i in q) { - base[i] = q[i] - } - - var qs = self._qs.stringify(base) - - if (qs === '') { - return self - } - - self.uri = url.parse(self.uri.href.split('?')[0] + '?' + qs) - self.url = self.uri - self.path = self.uri.path - - if (self.uri.host === 'unix') { - self.enableUnixSocket() - } - - return self -} -Request.prototype.form = function (form) { - var self = this - if (form) { - if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { - self.setHeader('content-type', 'application/x-www-form-urlencoded') - } - self.body = (typeof form === 'string') - ? self._qs.rfc3986(form.toString('utf8')) - : self._qs.stringify(form).toString('utf8') - return self - } - // create form-data object - self._form = new FormData() - self._form.on('error', function (err) { - err.message = 'form-data: ' + err.message - self.emit('error', err) - self.abort() - }) - return self._form -} -Request.prototype.multipart = function (multipart) { - var self = this - - self._multipart.onRequest(multipart) - - if (!self._multipart.chunked) { - self.body = self._multipart.body - } - - return self -} -Request.prototype.json = function (val) { - var self = this - - if (!self.hasHeader('accept')) { - self.setHeader('accept', 'application/json') - } - - if (typeof self.jsonReplacer === 'function') { - self._jsonReplacer = self.jsonReplacer - } - - self._json = true - if (typeof val === 'boolean') { - if (self.body !== undefined) { - if (!/^application\/x-www-form-urlencoded\b/.test(self.getHeader('content-type'))) { - self.body = safeStringify(self.body, self._jsonReplacer) - } else { - self.body = self._qs.rfc3986(self.body) - } - if (!self.hasHeader('content-type')) { - self.setHeader('content-type', 'application/json') - } - } - } else { - self.body = safeStringify(val, self._jsonReplacer) - if (!self.hasHeader('content-type')) { - self.setHeader('content-type', 'application/json') - } - } - - if (typeof self.jsonReviver === 'function') { - self._jsonReviver = self.jsonReviver - } - - return self -} -Request.prototype.getHeader = function (name, headers) { - var self = this - var result, re, match - if (!headers) { - headers = self.headers - } - Object.keys(headers).forEach(function (key) { - if (key.length !== name.length) { - return - } - re = new RegExp(name, 'i') - match = key.match(re) - if (match) { - result = headers[key] - } - }) - return result -} -Request.prototype.enableUnixSocket = function () { - // Get the socket & request paths from the URL - var unixParts = this.uri.path.split(':') - var host = unixParts[0] - var path = unixParts[1] - // Apply unix properties to request - this.socketPath = host - this.uri.pathname = path - this.uri.path = path - this.uri.host = host - this.uri.hostname = host - this.uri.isUnix = true -} - -Request.prototype.auth = function (user, pass, sendImmediately, bearer) { - var self = this - - self._auth.onRequest(user, pass, sendImmediately, bearer) - - return self -} -Request.prototype.aws = function (opts, now) { - var self = this - - if (!now) { - self._aws = opts - return self - } - - if (opts.sign_version === 4 || opts.sign_version === '4') { - // use aws4 - var options = { - host: self.uri.host, - path: self.uri.path, - method: self.method, - headers: self.headers, - body: self.body - } - if (opts.service) { - options.service = opts.service - } - var signRes = aws4.sign(options, { - accessKeyId: opts.key, - secretAccessKey: opts.secret, - sessionToken: opts.session - }) - self.setHeader('authorization', signRes.headers.Authorization) - self.setHeader('x-amz-date', signRes.headers['X-Amz-Date']) - if (signRes.headers['X-Amz-Security-Token']) { - self.setHeader('x-amz-security-token', signRes.headers['X-Amz-Security-Token']) - } - } else { - // default: use aws-sign2 - var date = new Date() - self.setHeader('date', date.toUTCString()) - var auth = { - key: opts.key, - secret: opts.secret, - verb: self.method.toUpperCase(), - date: date, - contentType: self.getHeader('content-type') || '', - md5: self.getHeader('content-md5') || '', - amazonHeaders: aws2.canonicalizeHeaders(self.headers) - } - var path = self.uri.path - if (opts.bucket && path) { - auth.resource = '/' + opts.bucket + path - } else if (opts.bucket && !path) { - auth.resource = '/' + opts.bucket - } else if (!opts.bucket && path) { - auth.resource = path - } else if (!opts.bucket && !path) { - auth.resource = '/' - } - auth.resource = aws2.canonicalizeResource(auth.resource) - self.setHeader('authorization', aws2.authorization(auth)) - } - - return self -} -Request.prototype.httpSignature = function (opts) { - var self = this - httpSignature.signRequest({ - getHeader: function (header) { - return self.getHeader(header, self.headers) - }, - setHeader: function (header, value) { - self.setHeader(header, value) - }, - method: self.method, - path: self.path - }, opts) - debug('httpSignature authorization', self.getHeader('authorization')) - - return self -} -Request.prototype.hawk = function (opts) { - var self = this - self.setHeader('Authorization', hawk.header(self.uri, self.method, opts)) -} -Request.prototype.oauth = function (_oauth) { - var self = this - - self._oauth.onRequest(_oauth) - - return self -} - -Request.prototype.jar = function (jar) { - var self = this - var cookies - - if (self._redirect.redirectsFollowed === 0) { - self.originalCookieHeader = self.getHeader('cookie') - } - - if (!jar) { - // disable cookies - cookies = false - self._disableCookies = true - } else { - var targetCookieJar = jar.getCookieString ? jar : globalCookieJar - var urihref = self.uri.href - // fetch cookie in the Specified host - if (targetCookieJar) { - cookies = targetCookieJar.getCookieString(urihref) - } - } - - // if need cookie and cookie is not empty - if (cookies && cookies.length) { - if (self.originalCookieHeader) { - // Don't overwrite existing Cookie header - self.setHeader('cookie', self.originalCookieHeader + '; ' + cookies) - } else { - self.setHeader('cookie', cookies) - } - } - self._jar = jar - return self -} - -// Stream API -Request.prototype.pipe = function (dest, opts) { - var self = this - - if (self.response) { - if (self._destdata) { - self.emit('error', new Error('You cannot pipe after data has been emitted from the response.')) - } else if (self._ended) { - self.emit('error', new Error('You cannot pipe after the response has been ended.')) - } else { - stream.Stream.prototype.pipe.call(self, dest, opts) - self.pipeDest(dest) - return dest - } - } else { - self.dests.push(dest) - stream.Stream.prototype.pipe.call(self, dest, opts) - return dest - } -} -Request.prototype.write = function () { - var self = this - if (self._aborted) { return } - - if (!self._started) { - self.start() - } - if (self.req) { - return self.req.write.apply(self.req, arguments) - } -} -Request.prototype.end = function (chunk) { - var self = this - if (self._aborted) { return } - - if (chunk) { - self.write(chunk) - } - if (!self._started) { - self.start() - } - if (self.req) { - self.req.end() - } -} -Request.prototype.pause = function () { - var self = this - if (!self.responseContent) { - self._paused = true - } else { - self.responseContent.pause.apply(self.responseContent, arguments) - } -} -Request.prototype.resume = function () { - var self = this - if (!self.responseContent) { - self._paused = false - } else { - self.responseContent.resume.apply(self.responseContent, arguments) - } -} -Request.prototype.destroy = function () { - var self = this - this.clearTimeout() - if (!self._ended) { - self.end() - } else if (self.response) { - self.response.destroy() - } -} - -Request.prototype.clearTimeout = function () { - if (this.timeoutTimer) { - clearTimeout(this.timeoutTimer) - this.timeoutTimer = null - } -} - -Request.defaultProxyHeaderWhiteList = - Tunnel.defaultProxyHeaderWhiteList.slice() - -Request.defaultProxyHeaderExclusiveList = - Tunnel.defaultProxyHeaderExclusiveList.slice() - -// Exports - -Request.prototype.toJSON = requestToJSON -module.exports = Request - - -/***/ }), -/* 456 */ -/***/ (function(module) { - -/** @license MIT License (c) copyright 2010-2014 original author or authors */ -/** @author Brian Cavalier */ -/** @author John Hann */ - -(function(define) { 'use strict'; -define(function() { - - return function flow(Promise) { - - var resolve = Promise.resolve; - var reject = Promise.reject; - var origCatch = Promise.prototype['catch']; - - /** - * Handle the ultimate fulfillment value or rejection reason, and assume - * responsibility for all errors. If an error propagates out of result - * or handleFatalError, it will be rethrown to the host, resulting in a - * loud stack track on most platforms and a crash on some. - * @param {function?} onResult - * @param {function?} onError - * @returns {undefined} - */ - Promise.prototype.done = function(onResult, onError) { - this._handler.visit(this._handler.receiver, onResult, onError); - }; - - /** - * Add Error-type and predicate matching to catch. Examples: - * promise.catch(TypeError, handleTypeError) - * .catch(predicate, handleMatchedErrors) - * .catch(handleRemainingErrors) - * @param onRejected - * @returns {*} - */ - Promise.prototype['catch'] = Promise.prototype.otherwise = function(onRejected) { - if (arguments.length < 2) { - return origCatch.call(this, onRejected); - } - - if(typeof onRejected !== 'function') { - return this.ensure(rejectInvalidPredicate); - } - - return origCatch.call(this, createCatchFilter(arguments[1], onRejected)); - }; - - /** - * Wraps the provided catch handler, so that it will only be called - * if the predicate evaluates truthy - * @param {?function} handler - * @param {function} predicate - * @returns {function} conditional catch handler - */ - function createCatchFilter(handler, predicate) { - return function(e) { - return evaluatePredicate(e, predicate) - ? handler.call(this, e) - : reject(e); - }; - } - - /** - * Ensures that onFulfilledOrRejected will be called regardless of whether - * this promise is fulfilled or rejected. onFulfilledOrRejected WILL NOT - * receive the promises' value or reason. Any returned value will be disregarded. - * onFulfilledOrRejected may throw or return a rejected promise to signal - * an additional error. - * @param {function} handler handler to be called regardless of - * fulfillment or rejection - * @returns {Promise} - */ - Promise.prototype['finally'] = Promise.prototype.ensure = function(handler) { - if(typeof handler !== 'function') { - return this; - } - - return this.then(function(x) { - return runSideEffect(handler, this, identity, x); - }, function(e) { - return runSideEffect(handler, this, reject, e); - }); - }; - - function runSideEffect (handler, thisArg, propagate, value) { - var result = handler.call(thisArg); - return maybeThenable(result) - ? propagateValue(result, propagate, value) - : propagate(value); - } - - function propagateValue (result, propagate, x) { - return resolve(result).then(function () { - return propagate(x); - }); - } - - /** - * Recover from a failure by returning a defaultValue. If defaultValue - * is a promise, it's fulfillment value will be used. If defaultValue is - * a promise that rejects, the returned promise will reject with the - * same reason. - * @param {*} defaultValue - * @returns {Promise} new promise - */ - Promise.prototype['else'] = Promise.prototype.orElse = function(defaultValue) { - return this.then(void 0, function() { - return defaultValue; - }); - }; - - /** - * Shortcut for .then(function() { return value; }) - * @param {*} value - * @return {Promise} a promise that: - * - is fulfilled if value is not a promise, or - * - if value is a promise, will fulfill with its value, or reject - * with its reason. - */ - Promise.prototype['yield'] = function(value) { - return this.then(function() { - return value; - }); - }; - - /** - * Runs a side effect when this promise fulfills, without changing the - * fulfillment value. - * @param {function} onFulfilledSideEffect - * @returns {Promise} - */ - Promise.prototype.tap = function(onFulfilledSideEffect) { - return this.then(onFulfilledSideEffect)['yield'](this); - }; - - return Promise; - }; - - function rejectInvalidPredicate() { - throw new TypeError('catch predicate must be a function'); - } - - function evaluatePredicate(e, predicate) { - return isError(predicate) ? e instanceof predicate : predicate(e); - } - - function isError(predicate) { - return predicate === Error - || (predicate != null && predicate.prototype instanceof Error); - } - - function maybeThenable(x) { - return (typeof x === 'object' || typeof x === 'function') && x !== null; - } - - function identity(x) { - return x; - } - -}); -}(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); - - -/***/ }), -/* 457 */, -/* 458 */, -/* 459 */, -/* 460 */, -/* 461 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var url = __webpack_require__(835) -var tunnel = __webpack_require__(243) - -var defaultProxyHeaderWhiteList = [ - 'accept', - 'accept-charset', - 'accept-encoding', - 'accept-language', - 'accept-ranges', - 'cache-control', - 'content-encoding', - 'content-language', - 'content-location', - 'content-md5', - 'content-range', - 'content-type', - 'connection', - 'date', - 'expect', - 'max-forwards', - 'pragma', - 'referer', - 'te', - 'user-agent', - 'via' -] - -var defaultProxyHeaderExclusiveList = [ - 'proxy-authorization' -] - -function constructProxyHost (uriObject) { - var port = uriObject.port - var protocol = uriObject.protocol - var proxyHost = uriObject.hostname + ':' - - if (port) { - proxyHost += port - } else if (protocol === 'https:') { - proxyHost += '443' - } else { - proxyHost += '80' - } - - return proxyHost -} - -function constructProxyHeaderWhiteList (headers, proxyHeaderWhiteList) { - var whiteList = proxyHeaderWhiteList - .reduce(function (set, header) { - set[header.toLowerCase()] = true - return set - }, {}) - - return Object.keys(headers) - .filter(function (header) { - return whiteList[header.toLowerCase()] - }) - .reduce(function (set, header) { - set[header] = headers[header] - return set - }, {}) -} - -function constructTunnelOptions (request, proxyHeaders) { - var proxy = request.proxy - - var tunnelOptions = { - proxy: { - host: proxy.hostname, - port: +proxy.port, - proxyAuth: proxy.auth, - headers: proxyHeaders - }, - headers: request.headers, - ca: request.ca, - cert: request.cert, - key: request.key, - passphrase: request.passphrase, - pfx: request.pfx, - ciphers: request.ciphers, - rejectUnauthorized: request.rejectUnauthorized, - secureOptions: request.secureOptions, - secureProtocol: request.secureProtocol - } - - return tunnelOptions -} - -function constructTunnelFnName (uri, proxy) { - var uriProtocol = (uri.protocol === 'https:' ? 'https' : 'http') - var proxyProtocol = (proxy.protocol === 'https:' ? 'Https' : 'Http') - return [uriProtocol, proxyProtocol].join('Over') -} - -function getTunnelFn (request) { - var uri = request.uri - var proxy = request.proxy - var tunnelFnName = constructTunnelFnName(uri, proxy) - return tunnel[tunnelFnName] -} - -function Tunnel (request) { - this.request = request - this.proxyHeaderWhiteList = defaultProxyHeaderWhiteList - this.proxyHeaderExclusiveList = [] - if (typeof request.tunnel !== 'undefined') { - this.tunnelOverride = request.tunnel - } -} - -Tunnel.prototype.isEnabled = function () { - var self = this - var request = self.request - // Tunnel HTTPS by default. Allow the user to override this setting. - - // If self.tunnelOverride is set (the user specified a value), use it. - if (typeof self.tunnelOverride !== 'undefined') { - return self.tunnelOverride - } - - // If the destination is HTTPS, tunnel. - if (request.uri.protocol === 'https:') { - return true - } - - // Otherwise, do not use tunnel. - return false -} - -Tunnel.prototype.setup = function (options) { - var self = this - var request = self.request - - options = options || {} - - if (typeof request.proxy === 'string') { - request.proxy = url.parse(request.proxy) - } - - if (!request.proxy || !request.tunnel) { - return false - } - - // Setup Proxy Header Exclusive List and White List - if (options.proxyHeaderWhiteList) { - self.proxyHeaderWhiteList = options.proxyHeaderWhiteList - } - if (options.proxyHeaderExclusiveList) { - self.proxyHeaderExclusiveList = options.proxyHeaderExclusiveList - } - - var proxyHeaderExclusiveList = self.proxyHeaderExclusiveList.concat(defaultProxyHeaderExclusiveList) - var proxyHeaderWhiteList = self.proxyHeaderWhiteList.concat(proxyHeaderExclusiveList) - - // Setup Proxy Headers and Proxy Headers Host - // Only send the Proxy White Listed Header names - var proxyHeaders = constructProxyHeaderWhiteList(request.headers, proxyHeaderWhiteList) - proxyHeaders.host = constructProxyHost(request.uri) - - proxyHeaderExclusiveList.forEach(request.removeHeader, request) - - // Set Agent from Tunnel Data - var tunnelFn = getTunnelFn(request) - var tunnelOptions = constructTunnelOptions(request, proxyHeaders) - request.agent = tunnelFn(tunnelOptions) - - return true -} - -Tunnel.defaultProxyHeaderWhiteList = defaultProxyHeaderWhiteList -Tunnel.defaultProxyHeaderExclusiveList = defaultProxyHeaderExclusiveList -exports.Tunnel = Tunnel - - -/***/ }), -/* 462 */, -/* 463 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, '__esModule', { value: true }); - -function _interopDefault (ex) { return (ex && (typeof ex === 'object') && 'default' in ex) ? ex['default'] : ex; } - -var deprecation = __webpack_require__(692); -var once = _interopDefault(__webpack_require__(49)); - -const logOnce = once(deprecation => console.warn(deprecation)); -/** - * Error with extra properties to help with debugging - */ - -class RequestError extends Error { - constructor(message, statusCode, options) { - super(message); // Maintains proper stack trace (only available on V8) - - /* istanbul ignore next */ - - if (Error.captureStackTrace) { - Error.captureStackTrace(this, this.constructor); - } - - this.name = "HttpError"; - this.status = statusCode; - Object.defineProperty(this, "code", { - get() { - logOnce(new deprecation.Deprecation("[@octokit/request-error] `error.code` is deprecated, use `error.status`.")); - return statusCode; - } - - }); - this.headers = options.headers || {}; // redact request credentials without mutating original request options - - const requestCopy = Object.assign({}, options.request); - - if (options.request.headers.authorization) { - requestCopy.headers = Object.assign({}, options.request.headers, { - authorization: options.request.headers.authorization.replace(/ .*$/, " [REDACTED]") - }); - } - - requestCopy.url = requestCopy.url // client_id & client_secret can be passed as URL query parameters to increase rate limit - // see https://developer.github.com/v3/#increasing-the-unauthenticated-rate-limit-for-oauth-applications - .replace(/\bclient_secret=\w+/g, "client_secret=[REDACTED]") // OAuth tokens can be passed as URL query parameters, although it is not recommended - // see https://developer.github.com/v3/#oauth2-token-sent-in-a-header - .replace(/\baccess_token=\w+/g, "access_token=[REDACTED]"); - this.request = requestCopy; - } - -} - -exports.RequestError = RequestError; -//# sourceMappingURL=index.js.map - - -/***/ }), -/* 464 */, -/* 465 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -/** @license MIT License (c) copyright 2010-2014 original author or authors */ -/** @author Brian Cavalier */ -/** @author John Hann */ - -(function(define) { 'use strict'; -define(function() { - - var env = __webpack_require__(709); - var TimeoutError = __webpack_require__(280); - - function setTimeout(f, ms, x, y) { - return env.setTimer(function() { - f(x, y, ms); - }, ms); - } - - return function timed(Promise) { - /** - * Return a new promise whose fulfillment value is revealed only - * after ms milliseconds - * @param {number} ms milliseconds - * @returns {Promise} - */ - Promise.prototype.delay = function(ms) { - var p = this._beget(); - this._handler.fold(handleDelay, ms, void 0, p._handler); - return p; - }; - - function handleDelay(ms, x, h) { - setTimeout(resolveDelay, ms, x, h); - } - - function resolveDelay(x, h) { - h.resolve(x); - } - - /** - * Return a new promise that rejects after ms milliseconds unless - * this promise fulfills earlier, in which case the returned promise - * fulfills with the same value. - * @param {number} ms milliseconds - * @param {Error|*=} reason optional rejection reason to use, defaults - * to a TimeoutError if not provided - * @returns {Promise} - */ - Promise.prototype.timeout = function(ms, reason) { - var p = this._beget(); - var h = p._handler; - - var t = setTimeout(onTimeout, ms, reason, p._handler); - - this._handler.visit(h, - function onFulfill(x) { - env.clearTimer(t); - this.resolve(x); // this = h - }, - function onReject(x) { - env.clearTimer(t); - this.reject(x); // this = h - }, - h.notify); - - return p; - }; - - function onTimeout(reason, h, ms) { - var e = typeof reason === 'undefined' - ? new TimeoutError('timed out after ' + ms + 'ms') - : reason; - h.reject(e); - } - - return Promise; - }; - -}); -}(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(require); })); - - -/***/ }), -/* 466 */, -/* 467 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ - -var pubsuffix = __webpack_require__(847); - -// Gives the permutation of all possible domainMatch()es of a given domain. The -// array is in shortest-to-longest order. Handy for indexing. -function permuteDomain (domain) { - var pubSuf = pubsuffix.getPublicSuffix(domain); - if (!pubSuf) { - return null; - } - if (pubSuf == domain) { - return [domain]; - } - - var prefix = domain.slice(0, -(pubSuf.length + 1)); // ".example.com" - var parts = prefix.split('.').reverse(); - var cur = pubSuf; - var permutations = [cur]; - while (parts.length) { - cur = parts.shift() + '.' + cur; - permutations.push(cur); - } - return permutations; -} - -exports.permuteDomain = permuteDomain; - - -/***/ }), -/* 468 */, -/* 469 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var uuid = __webpack_require__(826) -var CombinedStream = __webpack_require__(547) -var isstream = __webpack_require__(382) -var Buffer = __webpack_require__(149).Buffer - -function Multipart (request) { - this.request = request - this.boundary = uuid() - this.chunked = false - this.body = null -} - -Multipart.prototype.isChunked = function (options) { - var self = this - var chunked = false - var parts = options.data || options - - if (!parts.forEach) { - self.request.emit('error', new Error('Argument error, options.multipart.')) - } - - if (options.chunked !== undefined) { - chunked = options.chunked - } - - if (self.request.getHeader('transfer-encoding') === 'chunked') { - chunked = true - } - - if (!chunked) { - parts.forEach(function (part) { - if (typeof part.body === 'undefined') { - self.request.emit('error', new Error('Body attribute missing in multipart.')) - } - if (isstream(part.body)) { - chunked = true - } - }) - } - - return chunked -} - -Multipart.prototype.setHeaders = function (chunked) { - var self = this - - if (chunked && !self.request.hasHeader('transfer-encoding')) { - self.request.setHeader('transfer-encoding', 'chunked') - } - - var header = self.request.getHeader('content-type') - - if (!header || header.indexOf('multipart') === -1) { - self.request.setHeader('content-type', 'multipart/related; boundary=' + self.boundary) - } else { - if (header.indexOf('boundary') !== -1) { - self.boundary = header.replace(/.*boundary=([^\s;]+).*/, '$1') - } else { - self.request.setHeader('content-type', header + '; boundary=' + self.boundary) - } - } -} - -Multipart.prototype.build = function (parts, chunked) { - var self = this - var body = chunked ? new CombinedStream() : [] - - function add (part) { - if (typeof part === 'number') { - part = part.toString() - } - return chunked ? body.append(part) : body.push(Buffer.from(part)) - } - - if (self.request.preambleCRLF) { - add('\r\n') - } - - parts.forEach(function (part) { - var preamble = '--' + self.boundary + '\r\n' - Object.keys(part).forEach(function (key) { - if (key === 'body') { return } - preamble += key + ': ' + part[key] + '\r\n' - }) - preamble += '\r\n' - add(preamble) - add(part.body) - add('\r\n') - }) - add('--' + self.boundary + '--') - - if (self.request.postambleCRLF) { - add('\r\n') - } - - return body -} - -Multipart.prototype.onRequest = function (options) { - var self = this - - var chunked = self.isChunked(options) - var parts = options.data || options - - self.setHeaders(chunked) - self.chunked = chunked - self.body = self.build(parts, chunked) -} - -exports.Multipart = Multipart - - -/***/ }), -/* 470 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -}; -var __importStar = (this && this.__importStar) || function (mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result["default"] = mod; - return result; -}; -Object.defineProperty(exports, "__esModule", { value: true }); -const command_1 = __webpack_require__(431); -const file_command_1 = __webpack_require__(102); -const utils_1 = __webpack_require__(82); -const os = __importStar(__webpack_require__(87)); -const path = __importStar(__webpack_require__(622)); -/** - * The code to exit an action - */ -var ExitCode; -(function (ExitCode) { - /** - * A code indicating that the action was successful - */ - ExitCode[ExitCode["Success"] = 0] = "Success"; - /** - * A code indicating that the action was a failure - */ - ExitCode[ExitCode["Failure"] = 1] = "Failure"; -})(ExitCode = exports.ExitCode || (exports.ExitCode = {})); -//----------------------------------------------------------------------- -// Variables -//----------------------------------------------------------------------- -/** - * Sets env variable for this action and future actions in the job - * @param name the name of the variable to set - * @param val the value of the variable. Non-string values will be converted to a string via JSON.stringify - */ -// eslint-disable-next-line @typescript-eslint/no-explicit-any -function exportVariable(name, val) { - const convertedVal = utils_1.toCommandValue(val); - process.env[name] = convertedVal; - const filePath = process.env['GITHUB_ENV'] || ''; - if (filePath) { - const delimiter = '_GitHubActionsFileCommandDelimeter_'; - const commandValue = `${name}<<${delimiter}${os.EOL}${convertedVal}${os.EOL}${delimiter}`; - file_command_1.issueCommand('ENV', commandValue); - } - else { - command_1.issueCommand('set-env', { name }, convertedVal); - } -} -exports.exportVariable = exportVariable; -/** - * Registers a secret which will get masked from logs - * @param secret value of the secret - */ -function setSecret(secret) { - command_1.issueCommand('add-mask', {}, secret); -} -exports.setSecret = setSecret; -/** - * Prepends inputPath to the PATH (for this action and future actions) - * @param inputPath - */ -function addPath(inputPath) { - const filePath = process.env['GITHUB_PATH'] || ''; - if (filePath) { - file_command_1.issueCommand('PATH', inputPath); - } - else { - command_1.issueCommand('add-path', {}, inputPath); - } - process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`; -} -exports.addPath = addPath; -/** - * Gets the value of an input. The value is also trimmed. - * - * @param name name of the input to get - * @param options optional. See InputOptions. - * @returns string - */ -function getInput(name, options) { - const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || ''; - if (options && options.required && !val) { - throw new Error(`Input required and not supplied: ${name}`); - } - return val.trim(); -} -exports.getInput = getInput; -/** - * Sets the value of an output. - * - * @param name name of the output to set - * @param value value to store. Non-string values will be converted to a string via JSON.stringify - */ -// eslint-disable-next-line @typescript-eslint/no-explicit-any -function setOutput(name, value) { - command_1.issueCommand('set-output', { name }, value); -} -exports.setOutput = setOutput; -/** - * Enables or disables the echoing of commands into stdout for the rest of the step. - * Echoing is disabled by default if ACTIONS_STEP_DEBUG is not set. - * - */ -function setCommandEcho(enabled) { - command_1.issue('echo', enabled ? 'on' : 'off'); -} -exports.setCommandEcho = setCommandEcho; -//----------------------------------------------------------------------- -// Results -//----------------------------------------------------------------------- -/** - * Sets the action status to failed. - * When the action exits it will be with an exit code of 1 - * @param message add error issue message - */ -function setFailed(message) { - process.exitCode = ExitCode.Failure; - error(message); -} -exports.setFailed = setFailed; -//----------------------------------------------------------------------- -// Logging Commands -//----------------------------------------------------------------------- -/** - * Gets whether Actions Step Debug is on or not - */ -function isDebug() { - return process.env['RUNNER_DEBUG'] === '1'; -} -exports.isDebug = isDebug; -/** - * Writes debug message to user log - * @param message debug message - */ -function debug(message) { - command_1.issueCommand('debug', {}, message); -} -exports.debug = debug; -/** - * Adds an error issue - * @param message error issue message. Errors will be converted to string via toString() - */ -function error(message) { - command_1.issue('error', message instanceof Error ? message.toString() : message); -} -exports.error = error; -/** - * Adds an warning issue - * @param message warning issue message. Errors will be converted to string via toString() - */ -function warning(message) { - command_1.issue('warning', message instanceof Error ? message.toString() : message); -} -exports.warning = warning; -/** - * Writes info to log with console.log. - * @param message info message - */ -function info(message) { - process.stdout.write(message + os.EOL); -} -exports.info = info; -/** - * Begin an output group. - * - * Output until the next `groupEnd` will be foldable in this group - * - * @param name The name of the output group - */ -function startGroup(name) { - command_1.issue('group', name); -} -exports.startGroup = startGroup; -/** - * End an output group. - */ -function endGroup() { - command_1.issue('endgroup'); -} -exports.endGroup = endGroup; -/** - * Wrap an asynchronous function call in a group. - * - * Returns the same type as the function itself. - * - * @param name The name of the group - * @param fn The function to wrap in the group - */ -function group(name, fn) { - return __awaiter(this, void 0, void 0, function* () { - startGroup(name); - let result; - try { - result = yield fn(); - } - finally { - endGroup(); - } - return result; - }); -} -exports.group = group; -//----------------------------------------------------------------------- -// Wrapper action state -//----------------------------------------------------------------------- -/** - * Saves state for current action, the state can only be retrieved by this action's post job execution. - * - * @param name name of the state to store - * @param value value to store. Non-string values will be converted to a string via JSON.stringify - */ -// eslint-disable-next-line @typescript-eslint/no-explicit-any -function saveState(name, value) { - command_1.issueCommand('save-state', { name }, value); -} -exports.saveState = saveState; -/** - * Gets the value of an state set by this action's main execution. - * - * @param name name of the state to get - * @returns string - */ -function getState(name) { - return process.env[`STATE_${name}`] || ''; -} -exports.getState = getState; -//# sourceMappingURL=core.js.map - -/***/ }), -/* 471 */, -/* 472 */, -/* 473 */, -/* 474 */, -/* 475 */, -/* 476 */, -/* 477 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright (c) 2012, Mark Cavage. All rights reserved. -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(357); -var Stream = __webpack_require__(413).Stream; -var util = __webpack_require__(669); - - -///--- Globals - -/* JSSTYLED */ -var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; - - -///--- Internal - -function _capitalize(str) { - return (str.charAt(0).toUpperCase() + str.slice(1)); -} - -function _toss(name, expected, oper, arg, actual) { - throw new assert.AssertionError({ - message: util.format('%s (%s) is required', name, expected), - actual: (actual === undefined) ? typeof (arg) : actual(arg), - expected: expected, - operator: oper || '===', - stackStartFunction: _toss.caller - }); -} - -function _getClass(arg) { - return (Object.prototype.toString.call(arg).slice(8, -1)); -} - -function noop() { - // Why even bother with asserts? -} - - -///--- Exports - -var types = { - bool: { - check: function (arg) { return typeof (arg) === 'boolean'; } - }, - func: { - check: function (arg) { return typeof (arg) === 'function'; } - }, - string: { - check: function (arg) { return typeof (arg) === 'string'; } - }, - object: { - check: function (arg) { - return typeof (arg) === 'object' && arg !== null; - } - }, - number: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg); - } - }, - finite: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); - } - }, - buffer: { - check: function (arg) { return Buffer.isBuffer(arg); }, - operator: 'Buffer.isBuffer' - }, - array: { - check: function (arg) { return Array.isArray(arg); }, - operator: 'Array.isArray' - }, - stream: { - check: function (arg) { return arg instanceof Stream; }, - operator: 'instanceof', - actual: _getClass - }, - date: { - check: function (arg) { return arg instanceof Date; }, - operator: 'instanceof', - actual: _getClass - }, - regexp: { - check: function (arg) { return arg instanceof RegExp; }, - operator: 'instanceof', - actual: _getClass - }, - uuid: { - check: function (arg) { - return typeof (arg) === 'string' && UUID_REGEXP.test(arg); - }, - operator: 'isUUID' - } -}; - -function _setExports(ndebug) { - var keys = Object.keys(types); - var out; - - /* re-export standard assert */ - if (process.env.NODE_NDEBUG) { - out = noop; - } else { - out = function (arg, msg) { - if (!arg) { - _toss(msg, 'true', arg); - } - }; - } - - /* standard checks */ - keys.forEach(function (k) { - if (ndebug) { - out[k] = noop; - return; - } - var type = types[k]; - out[k] = function (arg, msg) { - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); - - /* optional checks */ - keys.forEach(function (k) { - var name = 'optional' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); - - /* arrayOf checks */ - keys.forEach(function (k) { - var name = 'arrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); - - /* optionalArrayOf checks */ - keys.forEach(function (k) { - var name = 'optionalArrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); - - /* re-export built-in assertions */ - Object.keys(assert).forEach(function (k) { - if (k === 'AssertionError') { - out[k] = assert[k]; - return; - } - if (ndebug) { - out[k] = noop; - return; - } - out[k] = assert[k]; - }); - - /* export ourselves (for unit tests _only_) */ - out._setExports = _setExports; - - return out; -} - -module.exports = _setExports(process.env.NODE_NDEBUG); - - -/***/ }), -/* 478 */, -/* 479 */ -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_if(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - $it.level++; - var $nextValid = 'valid' + $it.level; - var $thenSch = it.schema['then'], - $elseSch = it.schema['else'], - $thenPresent = $thenSch !== undefined && (it.opts.strictKeywords ? typeof $thenSch == 'object' && Object.keys($thenSch).length > 0 : it.util.schemaHasRules($thenSch, it.RULES.all)), - $elsePresent = $elseSch !== undefined && (it.opts.strictKeywords ? typeof $elseSch == 'object' && Object.keys($elseSch).length > 0 : it.util.schemaHasRules($elseSch, it.RULES.all)), - $currentBaseId = $it.baseId; - if ($thenPresent || $elsePresent) { - var $ifClause; - $it.createErrors = false; - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = true; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - $it.createErrors = true; - out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; - it.compositeRule = $it.compositeRule = $wasComposite; - if ($thenPresent) { - out += ' if (' + ($nextValid) + ') { '; - $it.schema = it.schema['then']; - $it.schemaPath = it.schemaPath + '.then'; - $it.errSchemaPath = it.errSchemaPath + '/then'; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; - if ($thenPresent && $elsePresent) { - $ifClause = 'ifClause' + $lvl; - out += ' var ' + ($ifClause) + ' = \'then\'; '; - } else { - $ifClause = '\'then\''; - } - out += ' } '; - if ($elsePresent) { - out += ' else { '; - } - } else { - out += ' if (!' + ($nextValid) + ') { '; - } - if ($elsePresent) { - $it.schema = it.schema['else']; - $it.schemaPath = it.schemaPath + '.else'; - $it.errSchemaPath = it.errSchemaPath + '/else'; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; - if ($thenPresent && $elsePresent) { - $ifClause = 'ifClause' + $lvl; - out += ' var ' + ($ifClause) + ' = \'else\'; '; - } else { - $ifClause = '\'else\''; - } - out += ' } '; - } - out += ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('if') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { failingKeyword: ' + ($ifClause) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should match "\' + ' + ($ifClause) + ' + \'" schema\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError(vErrors); '; - } else { - out += ' validate.errors = vErrors; return false; '; - } - } - out += ' } '; - if ($breakOnError) { - out += ' else { '; - } - out = it.util.cleanUpCode(out); - } else { - if ($breakOnError) { - out += ' if (true) { '; - } - } - return out; -} - - -/***/ }), -/* 480 */, -/* 481 */, -/* 482 */, -/* 483 */ -/***/ (function(module) { - -/** @license MIT License (c) copyright 2010-2014 original author or authors */ -/** @author Brian Cavalier */ -/** @author John Hann */ - -(function(define) { 'use strict'; -define(function() { - - // Credit to Twisol (https://github.com/Twisol) for suggesting - // this type of extensible queue + trampoline approach for next-tick conflation. - - /** - * Async task scheduler - * @param {function} async function to schedule a single async function - * @constructor - */ - function Scheduler(async) { - this._async = async; - this._running = false; - - this._queue = this; - this._queueLen = 0; - this._afterQueue = {}; - this._afterQueueLen = 0; - - var self = this; - this.drain = function() { - self._drain(); - }; - } - - /** - * Enqueue a task - * @param {{ run:function }} task - */ - Scheduler.prototype.enqueue = function(task) { - this._queue[this._queueLen++] = task; - this.run(); - }; - - /** - * Enqueue a task to run after the main task queue - * @param {{ run:function }} task - */ - Scheduler.prototype.afterQueue = function(task) { - this._afterQueue[this._afterQueueLen++] = task; - this.run(); - }; - - Scheduler.prototype.run = function() { - if (!this._running) { - this._running = true; - this._async(this.drain); - } - }; - - /** - * Drain the handler queue entirely, and then the after queue - */ - Scheduler.prototype._drain = function() { - var i = 0; - for (; i < this._queueLen; ++i) { - this._queue[i].run(); - this._queue[i] = void 0; - } - - this._queueLen = 0; - this._running = false; - - for (i = 0; i < this._afterQueueLen; ++i) { - this._afterQueue[i].run(); - this._afterQueue[i] = void 0; - } - - this._afterQueueLen = 0; - }; - - return Scheduler; - -}); -}(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); - - -/***/ }), -/* 484 */, -/* 485 */, -/* 486 */, -/* 487 */, -/* 488 */, -/* 489 */, -/* 490 */, -/* 491 */, -/* 492 */, -/* 493 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -/** @license MIT License (c) copyright 2010-2014 original author or authors */ - -/** - * Promises/A+ and when() implementation - * when is part of the cujoJS family of libraries (http://cujojs.com/) - * @author Brian Cavalier - * @author John Hann - */ -(function(define) { 'use strict'; -define(function () { - - var timed = __webpack_require__(465); - var array = __webpack_require__(993); - var flow = __webpack_require__(456); - var fold = __webpack_require__(779); - var inspect = __webpack_require__(515); - var generate = __webpack_require__(748); - var progress = __webpack_require__(548); - var withThis = __webpack_require__(713); - var unhandledRejection = __webpack_require__(721); - var TimeoutError = __webpack_require__(280); - - var Promise = [array, flow, fold, generate, progress, - inspect, withThis, timed, unhandledRejection] - .reduce(function(Promise, feature) { - return feature(Promise); - }, __webpack_require__(254)); - - var apply = __webpack_require__(572)(Promise); - - // Public API - - when.promise = promise; // Create a pending promise - when.resolve = Promise.resolve; // Create a resolved promise - when.reject = Promise.reject; // Create a rejected promise - - when.lift = lift; // lift a function to return promises - when['try'] = attempt; // call a function and return a promise - when.attempt = attempt; // alias for when.try - - when.iterate = Promise.iterate; // DEPRECATED (use cujojs/most streams) Generate a stream of promises - when.unfold = Promise.unfold; // DEPRECATED (use cujojs/most streams) Generate a stream of promises - - when.join = join; // Join 2 or more promises - - when.all = all; // Resolve a list of promises - when.settle = settle; // Settle a list of promises - - when.any = lift(Promise.any); // One-winner race - when.some = lift(Promise.some); // Multi-winner race - when.race = lift(Promise.race); // First-to-settle race - - when.map = map; // Array.map() for promises - when.filter = filter; // Array.filter() for promises - when.reduce = lift(Promise.reduce); // Array.reduce() for promises - when.reduceRight = lift(Promise.reduceRight); // Array.reduceRight() for promises - - when.isPromiseLike = isPromiseLike; // Is something promise-like, aka thenable - - when.Promise = Promise; // Promise constructor - when.defer = defer; // Create a {promise, resolve, reject} tuple - - // Error types - - when.TimeoutError = TimeoutError; - - /** - * Get a trusted promise for x, or by transforming x with onFulfilled - * - * @param {*} x - * @param {function?} onFulfilled callback to be called when x is - * successfully fulfilled. If promiseOrValue is an immediate value, callback - * will be invoked immediately. - * @param {function?} onRejected callback to be called when x is - * rejected. - * @param {function?} onProgress callback to be called when progress updates - * are issued for x. @deprecated - * @returns {Promise} a new promise that will fulfill with the return - * value of callback or errback or the completion value of promiseOrValue if - * callback and/or errback is not supplied. - */ - function when(x, onFulfilled, onRejected, onProgress) { - var p = Promise.resolve(x); - if (arguments.length < 2) { - return p; - } - - return p.then(onFulfilled, onRejected, onProgress); - } - - /** - * Creates a new promise whose fate is determined by resolver. - * @param {function} resolver function(resolve, reject, notify) - * @returns {Promise} promise whose fate is determine by resolver - */ - function promise(resolver) { - return new Promise(resolver); - } - - /** - * Lift the supplied function, creating a version of f that returns - * promises, and accepts promises as arguments. - * @param {function} f - * @returns {Function} version of f that returns promises - */ - function lift(f) { - return function() { - for(var i=0, l=arguments.length, a=new Array(l); i} errors optional array of validation errors, if not passed errors from the instance are used. - * @param {Object} options optional options with properties `separator` and `dataVar`. - * @return {String} human readable string with all errors descriptions - */ -function errorsText(errors, options) { - errors = errors || this.errors; - if (!errors) return 'No errors'; - options = options || {}; - var separator = options.separator === undefined ? ', ' : options.separator; - var dataVar = options.dataVar === undefined ? 'data' : options.dataVar; - - var text = ''; - for (var i=0; i= 1, - 'key must have at least one part'); - assert.ok(partial || sshbuf.atEnd(), - 'leftover bytes at end of key'); - - var Constructor = Key; - var algInfo = algs.info[key.type]; - if (type === 'private' || algInfo.parts.length !== parts.length) { - algInfo = algs.privInfo[key.type]; - Constructor = PrivateKey; - } - assert.strictEqual(algInfo.parts.length, parts.length); - - if (key.type === 'ecdsa') { - var res = /^ecdsa-sha2-(.+)$/.exec(alg); - assert.ok(res !== null); - assert.strictEqual(res[1], parts[0].data.toString()); - } - - var normalized = true; - for (var i = 0; i < algInfo.parts.length; ++i) { - var p = parts[i]; - p.name = algInfo.parts[i]; - /* - * OpenSSH stores ed25519 "private" keys as seed + public key - * concat'd together (k followed by A). We want to keep them - * separate for other formats that don't do this. - */ - if (key.type === 'ed25519' && p.name === 'k') - p.data = p.data.slice(0, 32); - - if (p.name !== 'curve' && algInfo.normalize !== false) { - var nd; - if (key.type === 'ed25519') { - nd = utils.zeroPadToLength(p.data, 32); - } else { - nd = utils.mpNormalize(p.data); - } - if (nd.toString('binary') !== - p.data.toString('binary')) { - p.data = nd; - normalized = false; - } - } - } - - if (normalized) - key._rfc4253Cache = sshbuf.toBuffer(); - - if (partial && typeof (partial) === 'object') { - partial.remainder = sshbuf.remainder(); - partial.consumed = sshbuf._offset; - } - - return (new Constructor(key)); -} - -function write(key, options) { - assert.object(key); - - var alg = keyTypeToAlg(key); - var i; - - var algInfo = algs.info[key.type]; - if (PrivateKey.isPrivateKey(key)) - algInfo = algs.privInfo[key.type]; - var parts = algInfo.parts; - - var buf = new SSHBuffer({}); - - buf.writeString(alg); - - for (i = 0; i < parts.length; ++i) { - var data = key.part[parts[i]].data; - if (algInfo.normalize !== false) { - if (key.type === 'ed25519') - data = utils.zeroPadToLength(data, 32); - else - data = utils.mpNormalize(data); - } - if (key.type === 'ed25519' && parts[i] === 'k') - data = Buffer.concat([data, key.part.A.data]); - buf.writeBuffer(data); - } - - return (buf.toBuffer()); -} - - -/***/ }), -/* 539 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - -Object.defineProperty(exports, "__esModule", { value: true }); -const http = __webpack_require__(605); -const https = __webpack_require__(211); -const pm = __webpack_require__(950); -let tunnel; -var HttpCodes; -(function (HttpCodes) { - HttpCodes[HttpCodes["OK"] = 200] = "OK"; - HttpCodes[HttpCodes["MultipleChoices"] = 300] = "MultipleChoices"; - HttpCodes[HttpCodes["MovedPermanently"] = 301] = "MovedPermanently"; - HttpCodes[HttpCodes["ResourceMoved"] = 302] = "ResourceMoved"; - HttpCodes[HttpCodes["SeeOther"] = 303] = "SeeOther"; - HttpCodes[HttpCodes["NotModified"] = 304] = "NotModified"; - HttpCodes[HttpCodes["UseProxy"] = 305] = "UseProxy"; - HttpCodes[HttpCodes["SwitchProxy"] = 306] = "SwitchProxy"; - HttpCodes[HttpCodes["TemporaryRedirect"] = 307] = "TemporaryRedirect"; - HttpCodes[HttpCodes["PermanentRedirect"] = 308] = "PermanentRedirect"; - HttpCodes[HttpCodes["BadRequest"] = 400] = "BadRequest"; - HttpCodes[HttpCodes["Unauthorized"] = 401] = "Unauthorized"; - HttpCodes[HttpCodes["PaymentRequired"] = 402] = "PaymentRequired"; - HttpCodes[HttpCodes["Forbidden"] = 403] = "Forbidden"; - HttpCodes[HttpCodes["NotFound"] = 404] = "NotFound"; - HttpCodes[HttpCodes["MethodNotAllowed"] = 405] = "MethodNotAllowed"; - HttpCodes[HttpCodes["NotAcceptable"] = 406] = "NotAcceptable"; - HttpCodes[HttpCodes["ProxyAuthenticationRequired"] = 407] = "ProxyAuthenticationRequired"; - HttpCodes[HttpCodes["RequestTimeout"] = 408] = "RequestTimeout"; - HttpCodes[HttpCodes["Conflict"] = 409] = "Conflict"; - HttpCodes[HttpCodes["Gone"] = 410] = "Gone"; - HttpCodes[HttpCodes["TooManyRequests"] = 429] = "TooManyRequests"; - HttpCodes[HttpCodes["InternalServerError"] = 500] = "InternalServerError"; - HttpCodes[HttpCodes["NotImplemented"] = 501] = "NotImplemented"; - HttpCodes[HttpCodes["BadGateway"] = 502] = "BadGateway"; - HttpCodes[HttpCodes["ServiceUnavailable"] = 503] = "ServiceUnavailable"; - HttpCodes[HttpCodes["GatewayTimeout"] = 504] = "GatewayTimeout"; -})(HttpCodes = exports.HttpCodes || (exports.HttpCodes = {})); -var Headers; -(function (Headers) { - Headers["Accept"] = "accept"; - Headers["ContentType"] = "content-type"; -})(Headers = exports.Headers || (exports.Headers = {})); -var MediaTypes; -(function (MediaTypes) { - MediaTypes["ApplicationJson"] = "application/json"; -})(MediaTypes = exports.MediaTypes || (exports.MediaTypes = {})); -/** - * Returns the proxy URL, depending upon the supplied url and proxy environment variables. - * @param serverUrl The server URL where the request will be sent. For example, https://api.github.com - */ -function getProxyUrl(serverUrl) { - let proxyUrl = pm.getProxyUrl(new URL(serverUrl)); - return proxyUrl ? proxyUrl.href : ''; -} -exports.getProxyUrl = getProxyUrl; -const HttpRedirectCodes = [ - HttpCodes.MovedPermanently, - HttpCodes.ResourceMoved, - HttpCodes.SeeOther, - HttpCodes.TemporaryRedirect, - HttpCodes.PermanentRedirect -]; -const HttpResponseRetryCodes = [ - HttpCodes.BadGateway, - HttpCodes.ServiceUnavailable, - HttpCodes.GatewayTimeout -]; -const RetryableHttpVerbs = ['OPTIONS', 'GET', 'DELETE', 'HEAD']; -const ExponentialBackoffCeiling = 10; -const ExponentialBackoffTimeSlice = 5; -class HttpClientError extends Error { - constructor(message, statusCode) { - super(message); - this.name = 'HttpClientError'; - this.statusCode = statusCode; - Object.setPrototypeOf(this, HttpClientError.prototype); - } -} -exports.HttpClientError = HttpClientError; -class HttpClientResponse { - constructor(message) { - this.message = message; - } - readBody() { - return new Promise(async (resolve, reject) => { - let output = Buffer.alloc(0); - this.message.on('data', (chunk) => { - output = Buffer.concat([output, chunk]); - }); - this.message.on('end', () => { - resolve(output.toString()); - }); - }); - } -} -exports.HttpClientResponse = HttpClientResponse; -function isHttps(requestUrl) { - let parsedUrl = new URL(requestUrl); - return parsedUrl.protocol === 'https:'; -} -exports.isHttps = isHttps; -class HttpClient { - constructor(userAgent, handlers, requestOptions) { - this._ignoreSslError = false; - this._allowRedirects = true; - this._allowRedirectDowngrade = false; - this._maxRedirects = 50; - this._allowRetries = false; - this._maxRetries = 1; - this._keepAlive = false; - this._disposed = false; - this.userAgent = userAgent; - this.handlers = handlers || []; - this.requestOptions = requestOptions; - if (requestOptions) { - if (requestOptions.ignoreSslError != null) { - this._ignoreSslError = requestOptions.ignoreSslError; - } - this._socketTimeout = requestOptions.socketTimeout; - if (requestOptions.allowRedirects != null) { - this._allowRedirects = requestOptions.allowRedirects; - } - if (requestOptions.allowRedirectDowngrade != null) { - this._allowRedirectDowngrade = requestOptions.allowRedirectDowngrade; - } - if (requestOptions.maxRedirects != null) { - this._maxRedirects = Math.max(requestOptions.maxRedirects, 0); - } - if (requestOptions.keepAlive != null) { - this._keepAlive = requestOptions.keepAlive; - } - if (requestOptions.allowRetries != null) { - this._allowRetries = requestOptions.allowRetries; - } - if (requestOptions.maxRetries != null) { - this._maxRetries = requestOptions.maxRetries; - } - } - } - options(requestUrl, additionalHeaders) { - return this.request('OPTIONS', requestUrl, null, additionalHeaders || {}); - } - get(requestUrl, additionalHeaders) { - return this.request('GET', requestUrl, null, additionalHeaders || {}); - } - del(requestUrl, additionalHeaders) { - return this.request('DELETE', requestUrl, null, additionalHeaders || {}); - } - post(requestUrl, data, additionalHeaders) { - return this.request('POST', requestUrl, data, additionalHeaders || {}); - } - patch(requestUrl, data, additionalHeaders) { - return this.request('PATCH', requestUrl, data, additionalHeaders || {}); - } - put(requestUrl, data, additionalHeaders) { - return this.request('PUT', requestUrl, data, additionalHeaders || {}); - } - head(requestUrl, additionalHeaders) { - return this.request('HEAD', requestUrl, null, additionalHeaders || {}); - } - sendStream(verb, requestUrl, stream, additionalHeaders) { - return this.request(verb, requestUrl, stream, additionalHeaders); - } - /** - * Gets a typed object from an endpoint - * Be aware that not found returns a null. Other errors (4xx, 5xx) reject the promise - */ - async getJson(requestUrl, additionalHeaders = {}) { - additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); - let res = await this.get(requestUrl, additionalHeaders); - return this._processResponse(res, this.requestOptions); - } - async postJson(requestUrl, obj, additionalHeaders = {}) { - let data = JSON.stringify(obj, null, 2); - additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); - additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); - let res = await this.post(requestUrl, data, additionalHeaders); - return this._processResponse(res, this.requestOptions); - } - async putJson(requestUrl, obj, additionalHeaders = {}) { - let data = JSON.stringify(obj, null, 2); - additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); - additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); - let res = await this.put(requestUrl, data, additionalHeaders); - return this._processResponse(res, this.requestOptions); - } - async patchJson(requestUrl, obj, additionalHeaders = {}) { - let data = JSON.stringify(obj, null, 2); - additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); - additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); - let res = await this.patch(requestUrl, data, additionalHeaders); - return this._processResponse(res, this.requestOptions); - } - /** - * Makes a raw http request. - * All other methods such as get, post, patch, and request ultimately call this. - * Prefer get, del, post and patch - */ - async request(verb, requestUrl, data, headers) { - if (this._disposed) { - throw new Error('Client has already been disposed.'); - } - let parsedUrl = new URL(requestUrl); - let info = this._prepareRequest(verb, parsedUrl, headers); - // Only perform retries on reads since writes may not be idempotent. - let maxTries = this._allowRetries && RetryableHttpVerbs.indexOf(verb) != -1 - ? this._maxRetries + 1 - : 1; - let numTries = 0; - let response; - while (numTries < maxTries) { - response = await this.requestRaw(info, data); - // Check if it's an authentication challenge - if (response && - response.message && - response.message.statusCode === HttpCodes.Unauthorized) { - let authenticationHandler; - for (let i = 0; i < this.handlers.length; i++) { - if (this.handlers[i].canHandleAuthentication(response)) { - authenticationHandler = this.handlers[i]; - break; - } - } - if (authenticationHandler) { - return authenticationHandler.handleAuthentication(this, info, data); - } - else { - // We have received an unauthorized response but have no handlers to handle it. - // Let the response return to the caller. - return response; - } - } - let redirectsRemaining = this._maxRedirects; - while (HttpRedirectCodes.indexOf(response.message.statusCode) != -1 && - this._allowRedirects && - redirectsRemaining > 0) { - const redirectUrl = response.message.headers['location']; - if (!redirectUrl) { - // if there's no location to redirect to, we won't - break; - } - let parsedRedirectUrl = new URL(redirectUrl); - if (parsedUrl.protocol == 'https:' && - parsedUrl.protocol != parsedRedirectUrl.protocol && - !this._allowRedirectDowngrade) { - throw new Error('Redirect from HTTPS to HTTP protocol. This downgrade is not allowed for security reasons. If you want to allow this behavior, set the allowRedirectDowngrade option to true.'); - } - // we need to finish reading the response before reassigning response - // which will leak the open socket. - await response.readBody(); - // strip authorization header if redirected to a different hostname - if (parsedRedirectUrl.hostname !== parsedUrl.hostname) { - for (let header in headers) { - // header names are case insensitive - if (header.toLowerCase() === 'authorization') { - delete headers[header]; - } - } - } - // let's make the request with the new redirectUrl - info = this._prepareRequest(verb, parsedRedirectUrl, headers); - response = await this.requestRaw(info, data); - redirectsRemaining--; - } - if (HttpResponseRetryCodes.indexOf(response.message.statusCode) == -1) { - // If not a retry code, return immediately instead of retrying - return response; - } - numTries += 1; - if (numTries < maxTries) { - await response.readBody(); - await this._performExponentialBackoff(numTries); - } - } - return response; - } - /** - * Needs to be called if keepAlive is set to true in request options. - */ - dispose() { - if (this._agent) { - this._agent.destroy(); - } - this._disposed = true; - } - /** - * Raw request. - * @param info - * @param data - */ - requestRaw(info, data) { - return new Promise((resolve, reject) => { - let callbackForResult = function (err, res) { - if (err) { - reject(err); - } - resolve(res); - }; - this.requestRawWithCallback(info, data, callbackForResult); - }); - } - /** - * Raw request with callback. - * @param info - * @param data - * @param onResult - */ - requestRawWithCallback(info, data, onResult) { - let socket; - if (typeof data === 'string') { - info.options.headers['Content-Length'] = Buffer.byteLength(data, 'utf8'); - } - let callbackCalled = false; - let handleResult = (err, res) => { - if (!callbackCalled) { - callbackCalled = true; - onResult(err, res); - } - }; - let req = info.httpModule.request(info.options, (msg) => { - let res = new HttpClientResponse(msg); - handleResult(null, res); - }); - req.on('socket', sock => { - socket = sock; - }); - // If we ever get disconnected, we want the socket to timeout eventually - req.setTimeout(this._socketTimeout || 3 * 60000, () => { - if (socket) { - socket.end(); - } - handleResult(new Error('Request timeout: ' + info.options.path), null); - }); - req.on('error', function (err) { - // err has statusCode property - // res should have headers - handleResult(err, null); - }); - if (data && typeof data === 'string') { - req.write(data, 'utf8'); - } - if (data && typeof data !== 'string') { - data.on('close', function () { - req.end(); - }); - data.pipe(req); - } - else { - req.end(); - } - } - /** - * Gets an http agent. This function is useful when you need an http agent that handles - * routing through a proxy server - depending upon the url and proxy environment variables. - * @param serverUrl The server URL where the request will be sent. For example, https://api.github.com - */ - getAgent(serverUrl) { - let parsedUrl = new URL(serverUrl); - return this._getAgent(parsedUrl); - } - _prepareRequest(method, requestUrl, headers) { - const info = {}; - info.parsedUrl = requestUrl; - const usingSsl = info.parsedUrl.protocol === 'https:'; - info.httpModule = usingSsl ? https : http; - const defaultPort = usingSsl ? 443 : 80; - info.options = {}; - info.options.host = info.parsedUrl.hostname; - info.options.port = info.parsedUrl.port - ? parseInt(info.parsedUrl.port) - : defaultPort; - info.options.path = - (info.parsedUrl.pathname || '') + (info.parsedUrl.search || ''); - info.options.method = method; - info.options.headers = this._mergeHeaders(headers); - if (this.userAgent != null) { - info.options.headers['user-agent'] = this.userAgent; - } - info.options.agent = this._getAgent(info.parsedUrl); - // gives handlers an opportunity to participate - if (this.handlers) { - this.handlers.forEach(handler => { - handler.prepareRequest(info.options); - }); - } - return info; - } - _mergeHeaders(headers) { - const lowercaseKeys = obj => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {}); - if (this.requestOptions && this.requestOptions.headers) { - return Object.assign({}, lowercaseKeys(this.requestOptions.headers), lowercaseKeys(headers)); - } - return lowercaseKeys(headers || {}); - } - _getExistingOrDefaultHeader(additionalHeaders, header, _default) { - const lowercaseKeys = obj => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {}); - let clientHeader; - if (this.requestOptions && this.requestOptions.headers) { - clientHeader = lowercaseKeys(this.requestOptions.headers)[header]; - } - return additionalHeaders[header] || clientHeader || _default; - } - _getAgent(parsedUrl) { - let agent; - let proxyUrl = pm.getProxyUrl(parsedUrl); - let useProxy = proxyUrl && proxyUrl.hostname; - if (this._keepAlive && useProxy) { - agent = this._proxyAgent; - } - if (this._keepAlive && !useProxy) { - agent = this._agent; - } - // if agent is already assigned use that agent. - if (!!agent) { - return agent; - } - const usingSsl = parsedUrl.protocol === 'https:'; - let maxSockets = 100; - if (!!this.requestOptions) { - maxSockets = this.requestOptions.maxSockets || http.globalAgent.maxSockets; - } - if (useProxy) { - // If using proxy, need tunnel - if (!tunnel) { - tunnel = __webpack_require__(856); - } - const agentOptions = { - maxSockets: maxSockets, - keepAlive: this._keepAlive, - proxy: { - proxyAuth: `${proxyUrl.username}:${proxyUrl.password}`, - host: proxyUrl.hostname, - port: proxyUrl.port - } - }; - let tunnelAgent; - const overHttps = proxyUrl.protocol === 'https:'; - if (usingSsl) { - tunnelAgent = overHttps ? tunnel.httpsOverHttps : tunnel.httpsOverHttp; - } - else { - tunnelAgent = overHttps ? tunnel.httpOverHttps : tunnel.httpOverHttp; - } - agent = tunnelAgent(agentOptions); - this._proxyAgent = agent; - } - // if reusing agent across request and tunneling agent isn't assigned create a new agent - if (this._keepAlive && !agent) { - const options = { keepAlive: this._keepAlive, maxSockets: maxSockets }; - agent = usingSsl ? new https.Agent(options) : new http.Agent(options); - this._agent = agent; - } - // if not using private agent and tunnel agent isn't setup then use global agent - if (!agent) { - agent = usingSsl ? https.globalAgent : http.globalAgent; - } - if (usingSsl && this._ignoreSslError) { - // we don't want to set NODE_TLS_REJECT_UNAUTHORIZED=0 since that will affect request for entire process - // http.RequestOptions doesn't expose a way to modify RequestOptions.agent.options - // we have to cast it to any and change it directly - agent.options = Object.assign(agent.options || {}, { - rejectUnauthorized: false - }); - } - return agent; - } - _performExponentialBackoff(retryNumber) { - retryNumber = Math.min(ExponentialBackoffCeiling, retryNumber); - const ms = ExponentialBackoffTimeSlice * Math.pow(2, retryNumber); - return new Promise(resolve => setTimeout(() => resolve(), ms)); - } - static dateTimeDeserializer(key, value) { - if (typeof value === 'string') { - let a = new Date(value); - if (!isNaN(a.valueOf())) { - return a; - } - } - return value; - } - async _processResponse(res, options) { - return new Promise(async (resolve, reject) => { - const statusCode = res.message.statusCode; - const response = { - statusCode: statusCode, - result: null, - headers: {} - }; - // not found leads to null obj returned - if (statusCode == HttpCodes.NotFound) { - resolve(response); - } - let obj; - let contents; - // get the result from the body - try { - contents = await res.readBody(); - if (contents && contents.length > 0) { - if (options && options.deserializeDates) { - obj = JSON.parse(contents, HttpClient.dateTimeDeserializer); - } - else { - obj = JSON.parse(contents); - } - response.result = obj; - } - response.headers = res.message.headers; - } - catch (err) { - // Invalid resource (contents not json); leaving result obj null - } - // note that 3xx redirects are handled by the http layer. - if (statusCode > 299) { - let msg; - // if exception/error in body, attempt to get better error - if (obj && obj.message) { - msg = obj.message; - } - else if (contents && contents.length > 0) { - // it may be the case that the exception is in the body message as string - msg = contents; - } - else { - msg = 'Failed request: (' + statusCode + ')'; - } - let err = new HttpClientError(msg, statusCode); - err.result = response.result; - reject(err); - } - else { - resolve(response); - } - }); - } -} -exports.HttpClient = HttpClient; - - -/***/ }), -/* 540 */, -/* 541 */, -/* 542 */ -/***/ (function(__unusedmodule, exports) { - -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ - -/* - * "A request-path path-matches a given cookie-path if at least one of the - * following conditions holds:" - */ -function pathMatch (reqPath, cookiePath) { - // "o The cookie-path and the request-path are identical." - if (cookiePath === reqPath) { - return true; - } - - var idx = reqPath.indexOf(cookiePath); - if (idx === 0) { - // "o The cookie-path is a prefix of the request-path, and the last - // character of the cookie-path is %x2F ("/")." - if (cookiePath.substr(-1) === "/") { - return true; - } - - // " o The cookie-path is a prefix of the request-path, and the first - // character of the request-path that is not included in the cookie- path - // is a %x2F ("/") character." - if (reqPath.substr(cookiePath.length, 1) === "/") { - return true; - } - } - - return false; -} - -exports.pathMatch = pathMatch; - - -/***/ }), -/* 543 */, -/* 544 */, -/* 545 */, -/* 546 */, -/* 547 */ -/***/ (function(module, __unusedexports, __webpack_require__) { - -var util = __webpack_require__(669); -var Stream = __webpack_require__(413).Stream; -var DelayedStream = __webpack_require__(152); - -module.exports = CombinedStream; -function CombinedStream() { - this.writable = false; - this.readable = true; - this.dataSize = 0; - this.maxDataSize = 2 * 1024 * 1024; - this.pauseStreams = true; - - this._released = false; - this._streams = []; - this._currentStream = null; - this._insideLoop = false; - this._pendingNext = false; -} -util.inherits(CombinedStream, Stream); - -CombinedStream.create = function(options) { - var combinedStream = new this(); - - options = options || {}; - for (var option in options) { - combinedStream[option] = options[option]; - } - - return combinedStream; -}; - -CombinedStream.isStreamLike = function(stream) { - return (typeof stream !== 'function') - && (typeof stream !== 'string') - && (typeof stream !== 'boolean') - && (typeof stream !== 'number') - && (!Buffer.isBuffer(stream)); -}; - -CombinedStream.prototype.append = function(stream) { - var isStreamLike = CombinedStream.isStreamLike(stream); - - if (isStreamLike) { - if (!(stream instanceof DelayedStream)) { - var newStream = DelayedStream.create(stream, { - maxDataSize: Infinity, - pauseStream: this.pauseStreams, - }); - stream.on('data', this._checkDataSize.bind(this)); - stream = newStream; - } - - this._handleErrors(stream); - - if (this.pauseStreams) { - stream.pause(); - } - } - - this._streams.push(stream); - return this; -}; - -CombinedStream.prototype.pipe = function(dest, options) { - Stream.prototype.pipe.call(this, dest, options); - this.resume(); - return dest; -}; - -CombinedStream.prototype._getNext = function() { - this._currentStream = null; - - if (this._insideLoop) { - this._pendingNext = true; - return; // defer call - } - - this._insideLoop = true; - try { - do { - this._pendingNext = false; - this._realGetNext(); - } while (this._pendingNext); - } finally { - this._insideLoop = false; - } -}; - -CombinedStream.prototype._realGetNext = function() { - var stream = this._streams.shift(); - - - if (typeof stream == 'undefined') { - this.end(); - return; - } - - if (typeof stream !== 'function') { - this._pipeNext(stream); - return; - } - - var getStream = stream; - getStream(function(stream) { - var isStreamLike = CombinedStream.isStreamLike(stream); - if (isStreamLike) { - stream.on('data', this._checkDataSize.bind(this)); - this._handleErrors(stream); - } - - this._pipeNext(stream); - }.bind(this)); -}; - -CombinedStream.prototype._pipeNext = function(stream) { - this._currentStream = stream; - - var isStreamLike = CombinedStream.isStreamLike(stream); - if (isStreamLike) { - stream.on('end', this._getNext.bind(this)); - stream.pipe(this, {end: false}); - return; - } - - var value = stream; - this.write(value); - this._getNext(); -}; - -CombinedStream.prototype._handleErrors = function(stream) { - var self = this; - stream.on('error', function(err) { - self._emitError(err); - }); -}; - -CombinedStream.prototype.write = function(data) { - this.emit('data', data); -}; - -CombinedStream.prototype.pause = function() { - if (!this.pauseStreams) { - return; - } - - if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause(); - this.emit('pause'); -}; - -CombinedStream.prototype.resume = function() { - if (!this._released) { - this._released = true; - this.writable = true; - this._getNext(); - } - - if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume(); - this.emit('resume'); -}; - -CombinedStream.prototype.end = function() { - this._reset(); - this.emit('end'); -}; - -CombinedStream.prototype.destroy = function() { - this._reset(); - this.emit('close'); -}; - -CombinedStream.prototype._reset = function() { - this.writable = false; - this._streams = []; - this._currentStream = null; -}; - -CombinedStream.prototype._checkDataSize = function() { - this._updateDataSize(); - if (this.dataSize <= this.maxDataSize) { - return; - } - - var message = - 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'; - this._emitError(new Error(message)); -}; - -CombinedStream.prototype._updateDataSize = function() { - this.dataSize = 0; - - var self = this; - this._streams.forEach(function(stream) { - if (!stream.dataSize) { - return; - } - - self.dataSize += stream.dataSize; - }); - - if (this._currentStream && this._currentStream.dataSize) { - this.dataSize += this._currentStream.dataSize; - } -}; - -CombinedStream.prototype._emitError = function(err) { - this._reset(); - this.emit('error', err); -}; - - -/***/ }), -/* 548 */ -/***/ (function(module) { - -/** @license MIT License (c) copyright 2010-2014 original author or authors */ -/** @author Brian Cavalier */ -/** @author John Hann */ - -(function(define) { 'use strict'; -define(function() { - - return function progress(Promise) { - - /** - * @deprecated - * Register a progress handler for this promise - * @param {function} onProgress - * @returns {Promise} - */ - Promise.prototype.progress = function(onProgress) { - return this.then(void 0, void 0, onProgress); - }; - - return Promise; - }; - -}); -}(typeof define === 'function' && define.amd ? define : function(factory) { module.exports = factory(); })); - - -/***/ }), -/* 549 */, -/* 550 */, -/* 551 */, -/* 552 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var url = __webpack_require__(835) -var isUrl = /^https?:/ - -function Redirect (request) { - this.request = request - this.followRedirect = true - this.followRedirects = true - this.followAllRedirects = false - this.followOriginalHttpMethod = false - this.allowRedirect = function () { return true } - this.maxRedirects = 10 - this.redirects = [] - this.redirectsFollowed = 0 - this.removeRefererHeader = false -} - -Redirect.prototype.onRequest = function (options) { - var self = this - - if (options.maxRedirects !== undefined) { - self.maxRedirects = options.maxRedirects - } - if (typeof options.followRedirect === 'function') { - self.allowRedirect = options.followRedirect - } - if (options.followRedirect !== undefined) { - self.followRedirects = !!options.followRedirect - } - if (options.followAllRedirects !== undefined) { - self.followAllRedirects = options.followAllRedirects - } - if (self.followRedirects || self.followAllRedirects) { - self.redirects = self.redirects || [] - } - if (options.removeRefererHeader !== undefined) { - self.removeRefererHeader = options.removeRefererHeader - } - if (options.followOriginalHttpMethod !== undefined) { - self.followOriginalHttpMethod = options.followOriginalHttpMethod - } -} - -Redirect.prototype.redirectTo = function (response) { - var self = this - var request = self.request - - var redirectTo = null - if (response.statusCode >= 300 && response.statusCode < 400 && response.caseless.has('location')) { - var location = response.caseless.get('location') - request.debug('redirect', location) - - if (self.followAllRedirects) { - redirectTo = location - } else if (self.followRedirects) { - switch (request.method) { - case 'PATCH': - case 'PUT': - case 'POST': - case 'DELETE': - // Do not follow redirects - break - default: - redirectTo = location - break - } - } - } else if (response.statusCode === 401) { - var authHeader = request._auth.onResponse(response) - if (authHeader) { - request.setHeader('authorization', authHeader) - redirectTo = request.uri - } - } - return redirectTo -} - -Redirect.prototype.onResponse = function (response) { - var self = this - var request = self.request - - var redirectTo = self.redirectTo(response) - if (!redirectTo || !self.allowRedirect.call(request, response)) { - return false - } - - request.debug('redirect to', redirectTo) - - // ignore any potential response body. it cannot possibly be useful - // to us at this point. - // response.resume should be defined, but check anyway before calling. Workaround for browserify. - if (response.resume) { - response.resume() - } - - if (self.redirectsFollowed >= self.maxRedirects) { - request.emit('error', new Error('Exceeded maxRedirects. Probably stuck in a redirect loop ' + request.uri.href)) - return false - } - self.redirectsFollowed += 1 - - if (!isUrl.test(redirectTo)) { - redirectTo = url.resolve(request.uri.href, redirectTo) - } - - var uriPrev = request.uri - request.uri = url.parse(redirectTo) - - // handle the case where we change protocol from https to http or vice versa - if (request.uri.protocol !== uriPrev.protocol) { - delete request.agent - } - - self.redirects.push({ statusCode: response.statusCode, redirectUri: redirectTo }) - - if (self.followAllRedirects && request.method !== 'HEAD' && - response.statusCode !== 401 && response.statusCode !== 307) { - request.method = self.followOriginalHttpMethod ? request.method : 'GET' - } - // request.method = 'GET' // Force all redirects to use GET || commented out fixes #215 - delete request.src - delete request.req - delete request._started - if (response.statusCode !== 401 && response.statusCode !== 307) { - // Remove parameters from the previous response, unless this is the second request - // for a server that requires digest authentication. - delete request.body - delete request._form - if (request.headers) { - request.removeHeader('host') - request.removeHeader('content-type') - request.removeHeader('content-length') - if (request.uri.hostname !== request.originalHost.split(':')[0]) { - // Remove authorization if changing hostnames (but not if just - // changing ports or protocols). This matches the behavior of curl: - // https://github.com/bagder/curl/blob/6beb0eee/lib/http.c#L710 - request.removeHeader('authorization') - } - } - } - - if (!self.removeRefererHeader) { - request.setHeader('referer', uriPrev.href) - } - - request.emit('redirect') - - request.init() - - return true -} - -exports.Redirect = Redirect - - -/***/ }), -/* 553 */, -/* 554 */ -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var caseless = __webpack_require__(7) -var uuid = __webpack_require__(826) -var helpers = __webpack_require__(810) - -var md5 = helpers.md5 -var toBase64 = helpers.toBase64 - -function Auth (request) { - // define all public properties here - this.request = request - this.hasAuth = false - this.sentAuth = false - this.bearerToken = null - this.user = null - this.pass = null -} - -Auth.prototype.basic = function (user, pass, sendImmediately) { - var self = this - if (typeof user !== 'string' || (pass !== undefined && typeof pass !== 'string')) { - self.request.emit('error', new Error('auth() received invalid user or password')) - } - self.user = user - self.pass = pass - self.hasAuth = true - var header = user + ':' + (pass || '') - if (sendImmediately || typeof sendImmediately === 'undefined') { - var authHeader = 'Basic ' + toBase64(header) - self.sentAuth = true - return authHeader - } -} - -Auth.prototype.bearer = function (bearer, sendImmediately) { - var self = this - self.bearerToken = bearer - self.hasAuth = true - if (sendImmediately || typeof sendImmediately === 'undefined') { - if (typeof bearer === 'function') { - bearer = bearer() - } - var authHeader = 'Bearer ' + (bearer || '') - self.sentAuth = true - return authHeader - } -} - -Auth.prototype.digest = function (method, path, authHeader) { - // TODO: More complete implementation of RFC 2617. - // - handle challenge.domain - // - support qop="auth-int" only - // - handle Authentication-Info (not necessarily?) - // - check challenge.stale (not necessarily?) - // - increase nc (not necessarily?) - // For reference: - // http://tools.ietf.org/html/rfc2617#section-3 - // https://github.com/bagder/curl/blob/master/lib/http_digest.c - - var self = this - - var challenge = {} - var re = /([a-z0-9_-]+)=(?:"([^"]+)"|([a-z0-9_-]+))/gi - while (true) { - var match = re.exec(authHeader) - if (!match) { - break - } - challenge[match[1]] = match[2] || match[3] - } - - /** - * RFC 2617: handle both MD5 and MD5-sess algorithms. - * - * If the algorithm directive's value is "MD5" or unspecified, then HA1 is - * HA1=MD5(username:realm:password) - * If the algorithm directive's value is "MD5-sess", then HA1 is - * HA1=MD5(MD5(username:realm:password):nonce:cnonce) - */ - var ha1Compute = function (algorithm, user, realm, pass, nonce, cnonce) { - var ha1 = md5(user + ':' + realm + ':' + pass) - if (algorithm && algorithm.toLowerCase() === 'md5-sess') { - return md5(ha1 + ':' + nonce + ':' + cnonce) - } else { - return ha1 - } - } - - var qop = /(^|,)\s*auth\s*($|,)/.test(challenge.qop) && 'auth' - var nc = qop && '00000001' - var cnonce = qop && uuid().replace(/-/g, '') - var ha1 = ha1Compute(challenge.algorithm, self.user, challenge.realm, self.pass, challenge.nonce, cnonce) - var ha2 = md5(method + ':' + path) - var digestResponse = qop - ? md5(ha1 + ':' + challenge.nonce + ':' + nc + ':' + cnonce + ':' + qop + ':' + ha2) - : md5(ha1 + ':' + challenge.nonce + ':' + ha2) - var authValues = { - username: self.user, - realm: challenge.realm, - nonce: challenge.nonce, - uri: path, - qop: qop, - response: digestResponse, - nc: nc, - cnonce: cnonce, - algorithm: challenge.algorithm, - opaque: challenge.opaque - } - - authHeader = [] - for (var k in authValues) { - if (authValues[k]) { - if (k === 'qop' || k === 'nc' || k === 'algorithm') { - authHeader.push(k + '=' + authValues[k]) - } else { - authHeader.push(k + '="' + authValues[k] + '"') - } - } - } - authHeader = 'Digest ' + authHeader.join(', ') - self.sentAuth = true - return authHeader -} - -Auth.prototype.onRequest = function (user, pass, sendImmediately, bearer) { - var self = this - var request = self.request - - var authHeader - if (bearer === undefined && user === undefined) { - self.request.emit('error', new Error('no auth mechanism defined')) - } else if (bearer !== undefined) { - authHeader = self.bearer(bearer, sendImmediately) - } else { - authHeader = self.basic(user, pass, sendImmediately) - } - if (authHeader) { - request.setHeader('authorization', authHeader) - } -} - -Auth.prototype.onResponse = function (response) { - var self = this - var request = self.request - - if (!self.hasAuth || self.sentAuth) { return null } - - var c = caseless(response.headers) - - var authHeader = c.get('www-authenticate') - var authVerb = authHeader && authHeader.split(' ')[0].toLowerCase() - request.debug('reauth', authVerb) - - switch (authVerb) { - case 'basic': - return self.basic(self.user, self.pass, true) - - case 'bearer': - return self.bearer(self.bearerToken, true) - - case 'digest': - return self.digest(request.method, request.path, authHeader) - } -} - -exports.Auth = Auth - - -/***/ }), -/* 555 */, -/* 556 */, -/* 557 */ -/***/ (function(module, exports, __webpack_require__) { - -/* module decorator */ module = __webpack_require__.nmd(module); -/** - * @license - * Lodash - * Copyright OpenJS Foundation and other contributors - * Released under MIT license - * Based on Underscore.js 1.8.3 - * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors - */ -;(function() { - - /** Used as a safe reference for `undefined` in pre-ES5 environments. */ - var undefined; - - /** Used as the semantic version number. */ - var VERSION = '4.17.19'; - - /** Used as the size to enable large array optimizations. */ - var LARGE_ARRAY_SIZE = 200; - - /** Error message constants. */ - var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', - FUNC_ERROR_TEXT = 'Expected a function'; - - /** Used to stand-in for `undefined` hash values. */ - var HASH_UNDEFINED = '__lodash_hash_undefined__'; - - /** Used as the maximum memoize cache size. */ - var MAX_MEMOIZE_SIZE = 500; - - /** Used as the internal argument placeholder. */ - var PLACEHOLDER = '__lodash_placeholder__'; - - /** Used to compose bitmasks for cloning. */ - var CLONE_DEEP_FLAG = 1, - CLONE_FLAT_FLAG = 2, - CLONE_SYMBOLS_FLAG = 4; - - /** Used to compose bitmasks for value comparisons. */ - var COMPARE_PARTIAL_FLAG = 1, - COMPARE_UNORDERED_FLAG = 2; - - /** Used to compose bitmasks for function metadata. */ - var WRAP_BIND_FLAG = 1, - WRAP_BIND_KEY_FLAG = 2, - WRAP_CURRY_BOUND_FLAG = 4, - WRAP_CURRY_FLAG = 8, - WRAP_CURRY_RIGHT_FLAG = 16, - WRAP_PARTIAL_FLAG = 32, - WRAP_PARTIAL_RIGHT_FLAG = 64, - WRAP_ARY_FLAG = 128, - WRAP_REARG_FLAG = 256, - WRAP_FLIP_FLAG = 512; - - /** Used as default options for `_.truncate`. */ - var DEFAULT_TRUNC_LENGTH = 30, - DEFAULT_TRUNC_OMISSION = '...'; - - /** Used to detect hot functions by number of calls within a span of milliseconds. */ - var HOT_COUNT = 800, - HOT_SPAN = 16; - - /** Used to indicate the type of lazy iteratees. */ - var LAZY_FILTER_FLAG = 1, - LAZY_MAP_FLAG = 2, - LAZY_WHILE_FLAG = 3; - - /** Used as references for various `Number` constants. */ - var INFINITY = 1 / 0, - MAX_SAFE_INTEGER = 9007199254740991, - MAX_INTEGER = 1.7976931348623157e+308, - NAN = 0 / 0; - - /** Used as references for the maximum length and index of an array. */ - var MAX_ARRAY_LENGTH = 4294967295, - MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, - HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; - - /** Used to associate wrap methods with their bit flags. */ - var wrapFlags = [ - ['ary', WRAP_ARY_FLAG], - ['bind', WRAP_BIND_FLAG], - ['bindKey', WRAP_BIND_KEY_FLAG], - ['curry', WRAP_CURRY_FLAG], - ['curryRight', WRAP_CURRY_RIGHT_FLAG], - ['flip', WRAP_FLIP_FLAG], - ['partial', WRAP_PARTIAL_FLAG], - ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], - ['rearg', WRAP_REARG_FLAG] - ]; - - /** `Object#toString` result references. */ - var argsTag = '[object Arguments]', - arrayTag = '[object Array]', - asyncTag = '[object AsyncFunction]', - boolTag = '[object Boolean]', - dateTag = '[object Date]', - domExcTag = '[object DOMException]', - errorTag = '[object Error]', - funcTag = '[object Function]', - genTag = '[object GeneratorFunction]', - mapTag = '[object Map]', - numberTag = '[object Number]', - nullTag = '[object Null]', - objectTag = '[object Object]', - promiseTag = '[object Promise]', - proxyTag = '[object Proxy]', - regexpTag = '[object RegExp]', - setTag = '[object Set]', - stringTag = '[object String]', - symbolTag = '[object Symbol]', - undefinedTag = '[object Undefined]', - weakMapTag = '[object WeakMap]', - weakSetTag = '[object WeakSet]'; - - var arrayBufferTag = '[object ArrayBuffer]', - dataViewTag = '[object DataView]', - float32Tag = '[object Float32Array]', - float64Tag = '[object Float64Array]', - int8Tag = '[object Int8Array]', - int16Tag = '[object Int16Array]', - int32Tag = '[object Int32Array]', - uint8Tag = '[object Uint8Array]', - uint8ClampedTag = '[object Uint8ClampedArray]', - uint16Tag = '[object Uint16Array]', - uint32Tag = '[object Uint32Array]'; - - /** Used to match empty string literals in compiled template source. */ - var reEmptyStringLeading = /\b__p \+= '';/g, - reEmptyStringMiddle = /\b(__p \+=) '' \+/g, - reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; - - /** Used to match HTML entities and HTML characters. */ - var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, - reUnescapedHtml = /[&<>"']/g, - reHasEscapedHtml = RegExp(reEscapedHtml.source), - reHasUnescapedHtml = RegExp(reUnescapedHtml.source); - - /** Used to match template delimiters. */ - var reEscape = /<%-([\s\S]+?)%>/g, - reEvaluate = /<%([\s\S]+?)%>/g, - reInterpolate = /<%=([\s\S]+?)%>/g; - - /** Used to match property names within property paths. */ - var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, - reIsPlainProp = /^\w*$/, - rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; - - /** - * Used to match `RegExp` - * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). - */ - var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, - reHasRegExpChar = RegExp(reRegExpChar.source); - - /** Used to match leading and trailing whitespace. */ - var reTrim = /^\s+|\s+$/g, - reTrimStart = /^\s+/, - reTrimEnd = /\s+$/; - - /** Used to match wrap detail comments. */ - var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, - reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, - reSplitDetails = /,? & /; - - /** Used to match words composed of alphanumeric characters. */ - var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; - - /** Used to match backslashes in property paths. */ - var reEscapeChar = /\\(\\)?/g; - - /** - * Used to match - * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). - */ - var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; - - /** Used to match `RegExp` flags from their coerced string values. */ - var reFlags = /\w*$/; - - /** Used to detect bad signed hexadecimal string values. */ - var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; - - /** Used to detect binary string values. */ - var reIsBinary = /^0b[01]+$/i; - - /** Used to detect host constructors (Safari). */ - var reIsHostCtor = /^\[object .+?Constructor\]$/; - - /** Used to detect octal string values. */ - var reIsOctal = /^0o[0-7]+$/i; - - /** Used to detect unsigned integer values. */ - var reIsUint = /^(?:0|[1-9]\d*)$/; - - /** Used to match Latin Unicode letters (excluding mathematical operators). */ - var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; - - /** Used to ensure capturing order of template delimiters. */ - var reNoMatch = /($^)/; - - /** Used to match unescaped characters in compiled string literals. */ - var reUnescapedString = /['\n\r\u2028\u2029\\]/g; - - /** Used to compose unicode character classes. */ - var rsAstralRange = '\\ud800-\\udfff', - rsComboMarksRange = '\\u0300-\\u036f', - reComboHalfMarksRange = '\\ufe20-\\ufe2f', - rsComboSymbolsRange = '\\u20d0-\\u20ff', - rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, - rsDingbatRange = '\\u2700-\\u27bf', - rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', - rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', - rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', - rsPunctuationRange = '\\u2000-\\u206f', - rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', - rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', - rsVarRange = '\\ufe0e\\ufe0f', - rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; - - /** Used to compose unicode capture groups. */ - var rsApos = "['\u2019]", - rsAstral = '[' + rsAstralRange + ']', - rsBreak = '[' + rsBreakRange + ']', - rsCombo = '[' + rsComboRange + ']', - rsDigits = '\\d+', - rsDingbat = '[' + rsDingbatRange + ']', - rsLower = '[' + rsLowerRange + ']', - rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', - rsFitz = '\\ud83c[\\udffb-\\udfff]', - rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', - rsNonAstral = '[^' + rsAstralRange + ']', - rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', - rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', - rsUpper = '[' + rsUpperRange + ']', - rsZWJ = '\\u200d'; - - /** Used to compose unicode regexes. */ - var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', - rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', - rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', - rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', - reOptMod = rsModifier + '?', - rsOptVar = '[' + rsVarRange + ']?', - rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', - rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', - rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', - rsSeq = rsOptVar + reOptMod + rsOptJoin, - rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, - rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; - - /** Used to match apostrophes. */ - var reApos = RegExp(rsApos, 'g'); - - /** - * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and - * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). - */ - var reComboMark = RegExp(rsCombo, 'g'); - - /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ - var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); - - /** Used to match complex or compound words. */ - var reUnicodeWord = RegExp([ - rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', - rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', - rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, - rsUpper + '+' + rsOptContrUpper, - rsOrdUpper, - rsOrdLower, - rsDigits, - rsEmoji - ].join('|'), 'g'); - - /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ - var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); - - /** Used to detect strings that need a more robust regexp to match words. */ - var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; - - /** Used to assign default `context` object properties. */ - var contextProps = [ - 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', - 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', - 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', - 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', - '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' - ]; - - /** Used to make template sourceURLs easier to identify. */ - var templateCounter = -1; - - /** Used to identify `toStringTag` values of typed arrays. */ - var typedArrayTags = {}; - typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = - typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = - typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = - typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = - typedArrayTags[uint32Tag] = true; - typedArrayTags[argsTag] = typedArrayTags[arrayTag] = - typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = - typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = - typedArrayTags[errorTag] = typedArrayTags[funcTag] = - typedArrayTags[mapTag] = typedArrayTags[numberTag] = - typedArrayTags[objectTag] = typedArrayTags[regexpTag] = - typedArrayTags[setTag] = typedArrayTags[stringTag] = - typedArrayTags[weakMapTag] = false; - - /** Used to identify `toStringTag` values supported by `_.clone`. */ - var cloneableTags = {}; - cloneableTags[argsTag] = cloneableTags[arrayTag] = - cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = - cloneableTags[boolTag] = cloneableTags[dateTag] = - cloneableTags[float32Tag] = cloneableTags[float64Tag] = - cloneableTags[int8Tag] = cloneableTags[int16Tag] = - cloneableTags[int32Tag] = cloneableTags[mapTag] = - cloneableTags[numberTag] = cloneableTags[objectTag] = - cloneableTags[regexpTag] = cloneableTags[setTag] = - cloneableTags[stringTag] = cloneableTags[symbolTag] = - cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = - cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; - cloneableTags[errorTag] = cloneableTags[funcTag] = - cloneableTags[weakMapTag] = false; - - /** Used to map Latin Unicode letters to basic Latin letters. */ - var deburredLetters = { - // Latin-1 Supplement block. - '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', - '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', - '\xc7': 'C', '\xe7': 'c', - '\xd0': 'D', '\xf0': 'd', - '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', - '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', - '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', - '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', - '\xd1': 'N', '\xf1': 'n', - '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', - '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', - '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', - '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', - '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', - '\xc6': 'Ae', '\xe6': 'ae', - '\xde': 'Th', '\xfe': 'th', - '\xdf': 'ss', - // Latin Extended-A block. - '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', - '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', - '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', - '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', - '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', - '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', - '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', - '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', - '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', - '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', - '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', - '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', - '\u0134': 'J', '\u0135': 'j', - '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', - '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', - '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', - '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', - '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', - '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', - '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', - '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', - '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', - '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', - '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', - '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', - '\u0163': 't', '\u0165': 't', '\u0167': 't', - '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', - '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', - '\u0174': 'W', '\u0175': 'w', - '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', - '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', - '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', - '\u0132': 'IJ', '\u0133': 'ij', - '\u0152': 'Oe', '\u0153': 'oe', - '\u0149': "'n", '\u017f': 's' - }; - - /** Used to map characters to HTML entities. */ - var htmlEscapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - "'": ''' - }; - - /** Used to map HTML entities to characters. */ - var htmlUnescapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - ''': "'" - }; - - /** Used to escape characters for inclusion in compiled string literals. */ - var stringEscapes = { - '\\': '\\', - "'": "'", - '\n': 'n', - '\r': 'r', - '\u2028': 'u2028', - '\u2029': 'u2029' - }; - - /** Built-in method references without a dependency on `root`. */ - var freeParseFloat = parseFloat, - freeParseInt = parseInt; - - /** Detect free variable `global` from Node.js. */ - var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; - - /** Detect free variable `self`. */ - var freeSelf = typeof self == 'object' && self && self.Object === Object && self; - - /** Used as a reference to the global object. */ - var root = freeGlobal || freeSelf || Function('return this')(); - - /** Detect free variable `exports`. */ - var freeExports = true && exports && !exports.nodeType && exports; - - /** Detect free variable `module`. */ - var freeModule = freeExports && "object" == 'object' && module && !module.nodeType && module; - - /** Detect the popular CommonJS extension `module.exports`. */ - var moduleExports = freeModule && freeModule.exports === freeExports; - - /** Detect free variable `process` from Node.js. */ - var freeProcess = moduleExports && freeGlobal.process; - - /** Used to access faster Node.js helpers. */ - var nodeUtil = (function() { - try { - // Use `util.types` for Node.js 10+. - var types = freeModule && freeModule.require && freeModule.require('util').types; - - if (types) { - return types; - } - - // Legacy `process.binding('util')` for Node.js < 10. - return freeProcess && freeProcess.binding && freeProcess.binding('util'); - } catch (e) {} - }()); - - /* Node.js helper references. */ - var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, - nodeIsDate = nodeUtil && nodeUtil.isDate, - nodeIsMap = nodeUtil && nodeUtil.isMap, - nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, - nodeIsSet = nodeUtil && nodeUtil.isSet, - nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; - - /*--------------------------------------------------------------------------*/ - - /** - * A faster alternative to `Function#apply`, this function invokes `func` - * with the `this` binding of `thisArg` and the arguments of `args`. - * - * @private - * @param {Function} func The function to invoke. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} args The arguments to invoke `func` with. - * @returns {*} Returns the result of `func`. - */ - function apply(func, thisArg, args) { - switch (args.length) { - case 0: return func.call(thisArg); - case 1: return func.call(thisArg, args[0]); - case 2: return func.call(thisArg, args[0], args[1]); - case 3: return func.call(thisArg, args[0], args[1], args[2]); - } - return func.apply(thisArg, args); - } - - /** - * A specialized version of `baseAggregator` for arrays. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function arrayAggregator(array, setter, iteratee, accumulator) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - var value = array[index]; - setter(accumulator, value, iteratee(value), array); - } - return accumulator; - } - - /** - * A specialized version of `_.forEach` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEach(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (iteratee(array[index], index, array) === false) { - break; - } - } - return array; - } - - /** - * A specialized version of `_.forEachRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEachRight(array, iteratee) { - var length = array == null ? 0 : array.length; - - while (length--) { - if (iteratee(array[length], length, array) === false) { - break; - } - } - return array; - } - - /** - * A specialized version of `_.every` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - */ - function arrayEvery(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (!predicate(array[index], index, array)) { - return false; - } - } - return true; - } - - /** - * A specialized version of `_.filter` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function arrayFilter(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result[resIndex++] = value; - } - } - return result; - } - - /** - * A specialized version of `_.includes` for arrays without support for - * specifying an index to search from. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludes(array, value) { - var length = array == null ? 0 : array.length; - return !!length && baseIndexOf(array, value, 0) > -1; - } - - /** - * This function is like `arrayIncludes` except that it accepts a comparator. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @param {Function} comparator The comparator invoked per element. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludesWith(array, value, comparator) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (comparator(value, array[index])) { - return true; - } - } - return false; - } - - /** - * A specialized version of `_.map` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function arrayMap(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length, - result = Array(length); - - while (++index < length) { - result[index] = iteratee(array[index], index, array); - } - return result; - } - - /** - * Appends the elements of `values` to `array`. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to append. - * @returns {Array} Returns `array`. - */ - function arrayPush(array, values) { - var index = -1, - length = values.length, - offset = array.length; - - while (++index < length) { - array[offset + index] = values[index]; - } - return array; - } - - /** - * A specialized version of `_.reduce` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the first element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduce(array, iteratee, accumulator, initAccum) { - var index = -1, - length = array == null ? 0 : array.length; - - if (initAccum && length) { - accumulator = array[++index]; - } - while (++index < length) { - accumulator = iteratee(accumulator, array[index], index, array); - } - return accumulator; - } - - /** - * A specialized version of `_.reduceRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the last element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduceRight(array, iteratee, accumulator, initAccum) { - var length = array == null ? 0 : array.length; - if (initAccum && length) { - accumulator = array[--length]; - } - while (length--) { - accumulator = iteratee(accumulator, array[length], length, array); - } - return accumulator; - } - - /** - * A specialized version of `_.some` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function arraySome(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (predicate(array[index], index, array)) { - return true; - } - } - return false; - } - - /** - * Gets the size of an ASCII `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - var asciiSize = baseProperty('length'); - - /** - * Converts an ASCII `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function asciiToArray(string) { - return string.split(''); - } - - /** - * Splits an ASCII `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function asciiWords(string) { - return string.match(reAsciiWord) || []; - } - - /** - * The base implementation of methods like `_.findKey` and `_.findLastKey`, - * without support for iteratee shorthands, which iterates over `collection` - * using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the found element or its key, else `undefined`. - */ - function baseFindKey(collection, predicate, eachFunc) { - var result; - eachFunc(collection, function(value, key, collection) { - if (predicate(value, key, collection)) { - result = key; - return false; - } - }); - return result; - } - - /** - * The base implementation of `_.findIndex` and `_.findLastIndex` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {number} fromIndex The index to search from. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseFindIndex(array, predicate, fromIndex, fromRight) { - var length = array.length, - index = fromIndex + (fromRight ? 1 : -1); - - while ((fromRight ? index-- : ++index < length)) { - if (predicate(array[index], index, array)) { - return index; - } - } - return -1; - } - - /** - * The base implementation of `_.indexOf` without `fromIndex` bounds checks. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOf(array, value, fromIndex) { - return value === value - ? strictIndexOf(array, value, fromIndex) - : baseFindIndex(array, baseIsNaN, fromIndex); - } - - /** - * This function is like `baseIndexOf` except that it accepts a comparator. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @param {Function} comparator The comparator invoked per element. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOfWith(array, value, fromIndex, comparator) { - var index = fromIndex - 1, - length = array.length; - - while (++index < length) { - if (comparator(array[index], value)) { - return index; - } - } - return -1; - } - - /** - * The base implementation of `_.isNaN` without support for number objects. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. - */ - function baseIsNaN(value) { - return value !== value; - } - - /** - * The base implementation of `_.mean` and `_.meanBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the mean. - */ - function baseMean(array, iteratee) { - var length = array == null ? 0 : array.length; - return length ? (baseSum(array, iteratee) / length) : NAN; - } - - /** - * The base implementation of `_.property` without support for deep paths. - * - * @private - * @param {string} key The key of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function baseProperty(key) { - return function(object) { - return object == null ? undefined : object[key]; - }; - } - - /** - * The base implementation of `_.propertyOf` without support for deep paths. - * - * @private - * @param {Object} object The object to query. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyOf(object) { - return function(key) { - return object == null ? undefined : object[key]; - }; - } - - /** - * The base implementation of `_.reduce` and `_.reduceRight`, without support - * for iteratee shorthands, which iterates over `collection` using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} accumulator The initial value. - * @param {boolean} initAccum Specify using the first or last element of - * `collection` as the initial value. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the accumulated value. - */ - function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { - eachFunc(collection, function(value, index, collection) { - accumulator = initAccum - ? (initAccum = false, value) - : iteratee(accumulator, value, index, collection); - }); - return accumulator; - } - - /** - * The base implementation of `_.sortBy` which uses `comparer` to define the - * sort order of `array` and replaces criteria objects with their corresponding - * values. - * - * @private - * @param {Array} array The array to sort. - * @param {Function} comparer The function to define sort order. - * @returns {Array} Returns `array`. - */ - function baseSortBy(array, comparer) { - var length = array.length; - - array.sort(comparer); - while (length--) { - array[length] = array[length].value; - } - return array; - } - - /** - * The base implementation of `_.sum` and `_.sumBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the sum. - */ - function baseSum(array, iteratee) { - var result, - index = -1, - length = array.length; - - while (++index < length) { - var current = iteratee(array[index]); - if (current !== undefined) { - result = result === undefined ? current : (result + current); - } - } - return result; - } - - /** - * The base implementation of `_.times` without support for iteratee shorthands - * or max array length checks. - * - * @private - * @param {number} n The number of times to invoke `iteratee`. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the array of results. - */ - function baseTimes(n, iteratee) { - var index = -1, - result = Array(n); - - while (++index < n) { - result[index] = iteratee(index); - } - return result; - } - - /** - * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array - * of key-value pairs for `object` corresponding to the property names of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the key-value pairs. - */ - function baseToPairs(object, props) { - return arrayMap(props, function(key) { - return [key, object[key]]; - }); - } - - /** - * The base implementation of `_.unary` without support for storing metadata. - * - * @private - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. - */ - function baseUnary(func) { - return function(value) { - return func(value); - }; - } - - /** - * The base implementation of `_.values` and `_.valuesIn` which creates an - * array of `object` property values corresponding to the property names - * of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the array of property values. - */ - function baseValues(object, props) { - return arrayMap(props, function(key) { - return object[key]; - }); - } - - /** - * Checks if a `cache` value for `key` exists. - * - * @private - * @param {Object} cache The cache to query. - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function cacheHas(cache, key) { - return cache.has(key); - } - - /** - * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the first unmatched string symbol. - */ - function charsStartIndex(strSymbols, chrSymbols) { - var index = -1, - length = strSymbols.length; - - while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } - - /** - * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the last unmatched string symbol. - */ - function charsEndIndex(strSymbols, chrSymbols) { - var index = strSymbols.length; - - while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } - - /** - * Gets the number of `placeholder` occurrences in `array`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} placeholder The placeholder to search for. - * @returns {number} Returns the placeholder count. - */ - function countHolders(array, placeholder) { - var length = array.length, - result = 0; - - while (length--) { - if (array[length] === placeholder) { - ++result; - } - } - return result; - } - - /** - * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A - * letters to basic Latin letters. - * - * @private - * @param {string} letter The matched letter to deburr. - * @returns {string} Returns the deburred letter. - */ - var deburrLetter = basePropertyOf(deburredLetters); - - /** - * Used by `_.escape` to convert characters to HTML entities. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - var escapeHtmlChar = basePropertyOf(htmlEscapes); - - /** - * Used by `_.template` to escape characters for inclusion in compiled string literals. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - function escapeStringChar(chr) { - return '\\' + stringEscapes[chr]; - } - - /** - * Gets the value at `key` of `object`. - * - * @private - * @param {Object} [object] The object to query. - * @param {string} key The key of the property to get. - * @returns {*} Returns the property value. - */ - function getValue(object, key) { - return object == null ? undefined : object[key]; - } - - /** - * Checks if `string` contains Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a symbol is found, else `false`. - */ - function hasUnicode(string) { - return reHasUnicode.test(string); - } - - /** - * Checks if `string` contains a word composed of Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a word is found, else `false`. - */ - function hasUnicodeWord(string) { - return reHasUnicodeWord.test(string); - } - - /** - * Converts `iterator` to an array. - * - * @private - * @param {Object} iterator The iterator to convert. - * @returns {Array} Returns the converted array. - */ - function iteratorToArray(iterator) { - var data, - result = []; - - while (!(data = iterator.next()).done) { - result.push(data.value); - } - return result; - } - - /** - * Converts `map` to its key-value pairs. - * - * @private - * @param {Object} map The map to convert. - * @returns {Array} Returns the key-value pairs. - */ - function mapToArray(map) { - var index = -1, - result = Array(map.size); - - map.forEach(function(value, key) { - result[++index] = [key, value]; - }); - return result; - } - - /** - * Creates a unary function that invokes `func` with its argument transformed. - * - * @private - * @param {Function} func The function to wrap. - * @param {Function} transform The argument transform. - * @returns {Function} Returns the new function. - */ - function overArg(func, transform) { - return function(arg) { - return func(transform(arg)); - }; - } - - /** - * Replaces all `placeholder` elements in `array` with an internal placeholder - * and returns an array of their indexes. - * - * @private - * @param {Array} array The array to modify. - * @param {*} placeholder The placeholder to replace. - * @returns {Array} Returns the new array of placeholder indexes. - */ - function replaceHolders(array, placeholder) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index]; - if (value === placeholder || value === PLACEHOLDER) { - array[index] = PLACEHOLDER; - result[resIndex++] = index; - } - } - return result; - } - - /** - * Converts `set` to an array of its values. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the values. - */ - function setToArray(set) { - var index = -1, - result = Array(set.size); - - set.forEach(function(value) { - result[++index] = value; - }); - return result; - } - - /** - * Converts `set` to its value-value pairs. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the value-value pairs. - */ - function setToPairs(set) { - var index = -1, - result = Array(set.size); - - set.forEach(function(value) { - result[++index] = [value, value]; - }); - return result; - } - - /** - * A specialized version of `_.indexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictIndexOf(array, value, fromIndex) { - var index = fromIndex - 1, - length = array.length; - - while (++index < length) { - if (array[index] === value) { - return index; - } - } - return -1; - } - - /** - * A specialized version of `_.lastIndexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictLastIndexOf(array, value, fromIndex) { - var index = fromIndex + 1; - while (index--) { - if (array[index] === value) { - return index; - } - } - return index; - } - - /** - * Gets the number of symbols in `string`. - * - * @private - * @param {string} string The string to inspect. - * @returns {number} Returns the string size. - */ - function stringSize(string) { - return hasUnicode(string) - ? unicodeSize(string) - : asciiSize(string); - } - - /** - * Converts `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function stringToArray(string) { - return hasUnicode(string) - ? unicodeToArray(string) - : asciiToArray(string); - } - - /** - * Used by `_.unescape` to convert HTML entities to characters. - * - * @private - * @param {string} chr The matched character to unescape. - * @returns {string} Returns the unescaped character. - */ - var unescapeHtmlChar = basePropertyOf(htmlUnescapes); - - /** - * Gets the size of a Unicode `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - function unicodeSize(string) { - var result = reUnicode.lastIndex = 0; - while (reUnicode.test(string)) { - ++result; - } - return result; - } - - /** - * Converts a Unicode `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function unicodeToArray(string) { - return string.match(reUnicode) || []; - } - - /** - * Splits a Unicode `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function unicodeWords(string) { - return string.match(reUnicodeWord) || []; - } - - /*--------------------------------------------------------------------------*/ - - /** - * Create a new pristine `lodash` function using the `context` object. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Util - * @param {Object} [context=root] The context object. - * @returns {Function} Returns a new `lodash` function. - * @example - * - * _.mixin({ 'foo': _.constant('foo') }); - * - * var lodash = _.runInContext(); - * lodash.mixin({ 'bar': lodash.constant('bar') }); - * - * _.isFunction(_.foo); - * // => true - * _.isFunction(_.bar); - * // => false - * - * lodash.isFunction(lodash.foo); - * // => false - * lodash.isFunction(lodash.bar); - * // => true - * - * // Create a suped-up `defer` in Node.js. - * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; - */ - var runInContext = (function runInContext(context) { - context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); - - /** Built-in constructor references. */ - var Array = context.Array, - Date = context.Date, - Error = context.Error, - Function = context.Function, - Math = context.Math, - Object = context.Object, - RegExp = context.RegExp, - String = context.String, - TypeError = context.TypeError; - - /** Used for built-in method references. */ - var arrayProto = Array.prototype, - funcProto = Function.prototype, - objectProto = Object.prototype; - - /** Used to detect overreaching core-js shims. */ - var coreJsData = context['__core-js_shared__']; - - /** Used to resolve the decompiled source of functions. */ - var funcToString = funcProto.toString; - - /** Used to check objects for own properties. */ - var hasOwnProperty = objectProto.hasOwnProperty; - - /** Used to generate unique IDs. */ - var idCounter = 0; - - /** Used to detect methods masquerading as native. */ - var maskSrcKey = (function() { - var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); - return uid ? ('Symbol(src)_1.' + uid) : ''; - }()); - - /** - * Used to resolve the - * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) - * of values. - */ - var nativeObjectToString = objectProto.toString; - - /** Used to infer the `Object` constructor. */ - var objectCtorString = funcToString.call(Object); - - /** Used to restore the original `_` reference in `_.noConflict`. */ - var oldDash = root._; - - /** Used to detect if a method is native. */ - var reIsNative = RegExp('^' + - funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') - .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' - ); - - /** Built-in value references. */ - var Buffer = moduleExports ? context.Buffer : undefined, - Symbol = context.Symbol, - Uint8Array = context.Uint8Array, - allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, - getPrototype = overArg(Object.getPrototypeOf, Object), - objectCreate = Object.create, - propertyIsEnumerable = objectProto.propertyIsEnumerable, - splice = arrayProto.splice, - spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, - symIterator = Symbol ? Symbol.iterator : undefined, - symToStringTag = Symbol ? Symbol.toStringTag : undefined; - - var defineProperty = (function() { - try { - var func = getNative(Object, 'defineProperty'); - func({}, '', {}); - return func; - } catch (e) {} - }()); - - /** Mocked built-ins. */ - var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, - ctxNow = Date && Date.now !== root.Date.now && Date.now, - ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; - - /* Built-in method references for those with the same name as other `lodash` methods. */ - var nativeCeil = Math.ceil, - nativeFloor = Math.floor, - nativeGetSymbols = Object.getOwnPropertySymbols, - nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, - nativeIsFinite = context.isFinite, - nativeJoin = arrayProto.join, - nativeKeys = overArg(Object.keys, Object), - nativeMax = Math.max, - nativeMin = Math.min, - nativeNow = Date.now, - nativeParseInt = context.parseInt, - nativeRandom = Math.random, - nativeReverse = arrayProto.reverse; - - /* Built-in method references that are verified to be native. */ - var DataView = getNative(context, 'DataView'), - Map = getNative(context, 'Map'), - Promise = getNative(context, 'Promise'), - Set = getNative(context, 'Set'), - WeakMap = getNative(context, 'WeakMap'), - nativeCreate = getNative(Object, 'create'); - - /** Used to store function metadata. */ - var metaMap = WeakMap && new WeakMap; - - /** Used to lookup unminified function names. */ - var realNames = {}; - - /** Used to detect maps, sets, and weakmaps. */ - var dataViewCtorString = toSource(DataView), - mapCtorString = toSource(Map), - promiseCtorString = toSource(Promise), - setCtorString = toSource(Set), - weakMapCtorString = toSource(WeakMap); - - /** Used to convert symbols to primitives and strings. */ - var symbolProto = Symbol ? Symbol.prototype : undefined, - symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, - symbolToString = symbolProto ? symbolProto.toString : undefined; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a `lodash` object which wraps `value` to enable implicit method - * chain sequences. Methods that operate on and return arrays, collections, - * and functions can be chained together. Methods that retrieve a single value - * or may return a primitive value will automatically end the chain sequence - * and return the unwrapped value. Otherwise, the value must be unwrapped - * with `_#value`. - * - * Explicit chain sequences, which must be unwrapped with `_#value`, may be - * enabled using `_.chain`. - * - * The execution of chained methods is lazy, that is, it's deferred until - * `_#value` is implicitly or explicitly called. - * - * Lazy evaluation allows several methods to support shortcut fusion. - * Shortcut fusion is an optimization to merge iteratee calls; this avoids - * the creation of intermediate arrays and can greatly reduce the number of - * iteratee executions. Sections of a chain sequence qualify for shortcut - * fusion if the section is applied to an array and iteratees accept only - * one argument. The heuristic for whether a section qualifies for shortcut - * fusion is subject to change. - * - * Chaining is supported in custom builds as long as the `_#value` method is - * directly or indirectly included in the build. - * - * In addition to lodash methods, wrappers have `Array` and `String` methods. - * - * The wrapper `Array` methods are: - * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` - * - * The wrapper `String` methods are: - * `replace` and `split` - * - * The wrapper methods that support shortcut fusion are: - * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, - * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, - * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` - * - * The chainable wrapper methods are: - * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, - * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, - * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, - * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, - * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, - * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, - * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, - * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, - * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, - * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, - * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, - * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, - * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, - * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, - * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, - * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, - * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, - * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, - * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, - * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, - * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, - * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, - * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, - * `zipObject`, `zipObjectDeep`, and `zipWith` - * - * The wrapper methods that are **not** chainable by default are: - * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, - * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, - * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, - * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, - * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, - * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, - * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, - * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, - * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, - * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, - * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, - * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, - * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, - * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, - * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, - * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, - * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, - * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, - * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, - * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, - * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, - * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, - * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, - * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, - * `upperFirst`, `value`, and `words` - * - * @name _ - * @constructor - * @category Seq - * @param {*} value The value to wrap in a `lodash` instance. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * function square(n) { - * return n * n; - * } - * - * var wrapped = _([1, 2, 3]); - * - * // Returns an unwrapped value. - * wrapped.reduce(_.add); - * // => 6 - * - * // Returns a wrapped value. - * var squares = wrapped.map(square); - * - * _.isArray(squares); - * // => false - * - * _.isArray(squares.value()); - * // => true - */ - function lodash(value) { - if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { - if (value instanceof LodashWrapper) { - return value; - } - if (hasOwnProperty.call(value, '__wrapped__')) { - return wrapperClone(value); - } - } - return new LodashWrapper(value); - } - - /** - * The base implementation of `_.create` without support for assigning - * properties to the created object. - * - * @private - * @param {Object} proto The object to inherit from. - * @returns {Object} Returns the new object. - */ - var baseCreate = (function() { - function object() {} - return function(proto) { - if (!isObject(proto)) { - return {}; - } - if (objectCreate) { - return objectCreate(proto); - } - object.prototype = proto; - var result = new object; - object.prototype = undefined; - return result; - }; - }()); - - /** - * The function whose prototype chain sequence wrappers inherit from. - * - * @private - */ - function baseLodash() { - // No operation performed. - } - - /** - * The base constructor for creating `lodash` wrapper objects. - * - * @private - * @param {*} value The value to wrap. - * @param {boolean} [chainAll] Enable explicit method chain sequences. - */ - function LodashWrapper(value, chainAll) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__chain__ = !!chainAll; - this.__index__ = 0; - this.__values__ = undefined; - } - - /** - * By default, the template delimiters used by lodash are like those in - * embedded Ruby (ERB) as well as ES2015 template strings. Change the - * following template settings to use alternative delimiters. - * - * @static - * @memberOf _ - * @type {Object} - */ - lodash.templateSettings = { - - /** - * Used to detect `data` property values to be HTML-escaped. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'escape': reEscape, - - /** - * Used to detect code to be evaluated. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'evaluate': reEvaluate, - - /** - * Used to detect `data` property values to inject. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'interpolate': reInterpolate, - - /** - * Used to reference the data object in the template text. - * - * @memberOf _.templateSettings - * @type {string} - */ - 'variable': '', - - /** - * Used to import variables into the compiled template. - * - * @memberOf _.templateSettings - * @type {Object} - */ - 'imports': { - - /** - * A reference to the `lodash` function. - * - * @memberOf _.templateSettings.imports - * @type {Function} - */ - '_': lodash - } - }; - - // Ensure wrappers are instances of `baseLodash`. - lodash.prototype = baseLodash.prototype; - lodash.prototype.constructor = lodash; - - LodashWrapper.prototype = baseCreate(baseLodash.prototype); - LodashWrapper.prototype.constructor = LodashWrapper; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. - * - * @private - * @constructor - * @param {*} value The value to wrap. - */ - function LazyWrapper(value) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__dir__ = 1; - this.__filtered__ = false; - this.__iteratees__ = []; - this.__takeCount__ = MAX_ARRAY_LENGTH; - this.__views__ = []; - } - - /** - * Creates a clone of the lazy wrapper object. - * - * @private - * @name clone - * @memberOf LazyWrapper - * @returns {Object} Returns the cloned `LazyWrapper` object. - */ - function lazyClone() { - var result = new LazyWrapper(this.__wrapped__); - result.__actions__ = copyArray(this.__actions__); - result.__dir__ = this.__dir__; - result.__filtered__ = this.__filtered__; - result.__iteratees__ = copyArray(this.__iteratees__); - result.__takeCount__ = this.__takeCount__; - result.__views__ = copyArray(this.__views__); - return result; - } - - /** - * Reverses the direction of lazy iteration. - * - * @private - * @name reverse - * @memberOf LazyWrapper - * @returns {Object} Returns the new reversed `LazyWrapper` object. - */ - function lazyReverse() { - if (this.__filtered__) { - var result = new LazyWrapper(this); - result.__dir__ = -1; - result.__filtered__ = true; - } else { - result = this.clone(); - result.__dir__ *= -1; - } - return result; - } - - /** - * Extracts the unwrapped value from its lazy wrapper. - * - * @private - * @name value - * @memberOf LazyWrapper - * @returns {*} Returns the unwrapped value. - */ - function lazyValue() { - var array = this.__wrapped__.value(), - dir = this.__dir__, - isArr = isArray(array), - isRight = dir < 0, - arrLength = isArr ? array.length : 0, - view = getView(0, arrLength, this.__views__), - start = view.start, - end = view.end, - length = end - start, - index = isRight ? end : (start - 1), - iteratees = this.__iteratees__, - iterLength = iteratees.length, - resIndex = 0, - takeCount = nativeMin(length, this.__takeCount__); - - if (!isArr || (!isRight && arrLength == length && takeCount == length)) { - return baseWrapperValue(array, this.__actions__); - } - var result = []; - - outer: - while (length-- && resIndex < takeCount) { - index += dir; - - var iterIndex = -1, - value = array[index]; - - while (++iterIndex < iterLength) { - var data = iteratees[iterIndex], - iteratee = data.iteratee, - type = data.type, - computed = iteratee(value); - - if (type == LAZY_MAP_FLAG) { - value = computed; - } else if (!computed) { - if (type == LAZY_FILTER_FLAG) { - continue outer; - } else { - break outer; - } - } - } - result[resIndex++] = value; - } - return result; - } - - // Ensure `LazyWrapper` is an instance of `baseLodash`. - LazyWrapper.prototype = baseCreate(baseLodash.prototype); - LazyWrapper.prototype.constructor = LazyWrapper; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a hash object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Hash(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; - - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } - - /** - * Removes all key-value entries from the hash. - * - * @private - * @name clear - * @memberOf Hash - */ - function hashClear() { - this.__data__ = nativeCreate ? nativeCreate(null) : {}; - this.size = 0; - } - - /** - * Removes `key` and its value from the hash. - * - * @private - * @name delete - * @memberOf Hash - * @param {Object} hash The hash to modify. - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function hashDelete(key) { - var result = this.has(key) && delete this.__data__[key]; - this.size -= result ? 1 : 0; - return result; - } - - /** - * Gets the hash value for `key`. - * - * @private - * @name get - * @memberOf Hash - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function hashGet(key) { - var data = this.__data__; - if (nativeCreate) { - var result = data[key]; - return result === HASH_UNDEFINED ? undefined : result; - } - return hasOwnProperty.call(data, key) ? data[key] : undefined; - } - - /** - * Checks if a hash value for `key` exists. - * - * @private - * @name has - * @memberOf Hash - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function hashHas(key) { - var data = this.__data__; - return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); - } - - /** - * Sets the hash `key` to `value`. - * - * @private - * @name set - * @memberOf Hash - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the hash instance. - */ - function hashSet(key, value) { - var data = this.__data__; - this.size += this.has(key) ? 0 : 1; - data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; - return this; - } - - // Add methods to `Hash`. - Hash.prototype.clear = hashClear; - Hash.prototype['delete'] = hashDelete; - Hash.prototype.get = hashGet; - Hash.prototype.has = hashHas; - Hash.prototype.set = hashSet; - - /*------------------------------------------------------------------------*/ - - /** - * Creates an list cache object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function ListCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; - - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } - - /** - * Removes all key-value entries from the list cache. - * - * @private - * @name clear - * @memberOf ListCache - */ - function listCacheClear() { - this.__data__ = []; - this.size = 0; - } - - /** - * Removes `key` and its value from the list cache. - * - * @private - * @name delete - * @memberOf ListCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function listCacheDelete(key) { - var data = this.__data__, - index = assocIndexOf(data, key); - - if (index < 0) { - return false; - } - var lastIndex = data.length - 1; - if (index == lastIndex) { - data.pop(); - } else { - splice.call(data, index, 1); - } - --this.size; - return true; - } - - /** - * Gets the list cache value for `key`. - * - * @private - * @name get - * @memberOf ListCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function listCacheGet(key) { - var data = this.__data__, - index = assocIndexOf(data, key); - - return index < 0 ? undefined : data[index][1]; - } - - /** - * Checks if a list cache value for `key` exists. - * - * @private - * @name has - * @memberOf ListCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function listCacheHas(key) { - return assocIndexOf(this.__data__, key) > -1; - } - - /** - * Sets the list cache `key` to `value`. - * - * @private - * @name set - * @memberOf ListCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the list cache instance. - */ - function listCacheSet(key, value) { - var data = this.__data__, - index = assocIndexOf(data, key); - - if (index < 0) { - ++this.size; - data.push([key, value]); - } else { - data[index][1] = value; - } - return this; - } - - // Add methods to `ListCache`. - ListCache.prototype.clear = listCacheClear; - ListCache.prototype['delete'] = listCacheDelete; - ListCache.prototype.get = listCacheGet; - ListCache.prototype.has = listCacheHas; - ListCache.prototype.set = listCacheSet; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a map cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function MapCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; - - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } - - /** - * Removes all key-value entries from the map. - * - * @private - * @name clear - * @memberOf MapCache - */ - function mapCacheClear() { - this.size = 0; - this.__data__ = { - 'hash': new Hash, - 'map': new (Map || ListCache), - 'string': new Hash - }; - } - - /** - * Removes `key` and its value from the map. - * - * @private - * @name delete - * @memberOf MapCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function mapCacheDelete(key) { - var result = getMapData(this, key)['delete'](key); - this.size -= result ? 1 : 0; - return result; - } - - /** - * Gets the map value for `key`. - * - * @private - * @name get - * @memberOf MapCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function mapCacheGet(key) { - return getMapData(this, key).get(key); - } - - /** - * Checks if a map value for `key` exists. - * - * @private - * @name has - * @memberOf MapCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function mapCacheHas(key) { - return getMapData(this, key).has(key); - } - - /** - * Sets the map `key` to `value`. - * - * @private - * @name set - * @memberOf MapCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the map cache instance. - */ - function mapCacheSet(key, value) { - var data = getMapData(this, key), - size = data.size; - - data.set(key, value); - this.size += data.size == size ? 0 : 1; - return this; - } - - // Add methods to `MapCache`. - MapCache.prototype.clear = mapCacheClear; - MapCache.prototype['delete'] = mapCacheDelete; - MapCache.prototype.get = mapCacheGet; - MapCache.prototype.has = mapCacheHas; - MapCache.prototype.set = mapCacheSet; - - /*------------------------------------------------------------------------*/ - - /** - * - * Creates an array cache object to store unique values. - * - * @private - * @constructor - * @param {Array} [values] The values to cache. - */ - function SetCache(values) { - var index = -1, - length = values == null ? 0 : values.length; - - this.__data__ = new MapCache; - while (++index < length) { - this.add(values[index]); - } - } - - /** - * Adds `value` to the array cache. - * - * @private - * @name add - * @memberOf SetCache - * @alias push - * @param {*} value The value to cache. - * @returns {Object} Returns the cache instance. - */ - function setCacheAdd(value) { - this.__data__.set(value, HASH_UNDEFINED); - return this; - } - - /** - * Checks if `value` is in the array cache. - * - * @private - * @name has - * @memberOf SetCache - * @param {*} value The value to search for. - * @returns {number} Returns `true` if `value` is found, else `false`. - */ - function setCacheHas(value) { - return this.__data__.has(value); - } - - // Add methods to `SetCache`. - SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; - SetCache.prototype.has = setCacheHas; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a stack cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Stack(entries) { - var data = this.__data__ = new ListCache(entries); - this.size = data.size; - } - - /** - * Removes all key-value entries from the stack. - * - * @private - * @name clear - * @memberOf Stack - */ - function stackClear() { - this.__data__ = new ListCache; - this.size = 0; - } - - /** - * Removes `key` and its value from the stack. - * - * @private - * @name delete - * @memberOf Stack - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function stackDelete(key) { - var data = this.__data__, - result = data['delete'](key); - - this.size = data.size; - return result; - } - - /** - * Gets the stack value for `key`. - * - * @private - * @name get - * @memberOf Stack - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function stackGet(key) { - return this.__data__.get(key); - } - - /** - * Checks if a stack value for `key` exists. - * - * @private - * @name has - * @memberOf Stack - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function stackHas(key) { - return this.__data__.has(key); - } - - /** - * Sets the stack `key` to `value`. - * - * @private - * @name set - * @memberOf Stack - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the stack cache instance. - */ - function stackSet(key, value) { - var data = this.__data__; - if (data instanceof ListCache) { - var pairs = data.__data__; - if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { - pairs.push([key, value]); - this.size = ++data.size; - return this; - } - data = this.__data__ = new MapCache(pairs); - } - data.set(key, value); - this.size = data.size; - return this; - } - - // Add methods to `Stack`. - Stack.prototype.clear = stackClear; - Stack.prototype['delete'] = stackDelete; - Stack.prototype.get = stackGet; - Stack.prototype.has = stackHas; - Stack.prototype.set = stackSet; - - /*------------------------------------------------------------------------*/ - - /** - * Creates an array of the enumerable property names of the array-like `value`. - * - * @private - * @param {*} value The value to query. - * @param {boolean} inherited Specify returning inherited property names. - * @returns {Array} Returns the array of property names. - */ - function arrayLikeKeys(value, inherited) { - var isArr = isArray(value), - isArg = !isArr && isArguments(value), - isBuff = !isArr && !isArg && isBuffer(value), - isType = !isArr && !isArg && !isBuff && isTypedArray(value), - skipIndexes = isArr || isArg || isBuff || isType, - result = skipIndexes ? baseTimes(value.length, String) : [], - length = result.length; - - for (var key in value) { - if ((inherited || hasOwnProperty.call(value, key)) && - !(skipIndexes && ( - // Safari 9 has enumerable `arguments.length` in strict mode. - key == 'length' || - // Node.js 0.10 has enumerable non-index properties on buffers. - (isBuff && (key == 'offset' || key == 'parent')) || - // PhantomJS 2 has enumerable non-index properties on typed arrays. - (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || - // Skip index properties. - isIndex(key, length) - ))) { - result.push(key); - } - } - return result; - } - - /** - * A specialized version of `_.sample` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @returns {*} Returns the random element. - */ - function arraySample(array) { - var length = array.length; - return length ? array[baseRandom(0, length - 1)] : undefined; - } - - /** - * A specialized version of `_.sampleSize` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function arraySampleSize(array, n) { - return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); - } - - /** - * A specialized version of `_.shuffle` for arrays. - * - * @private - * @param {Array} array The array to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function arrayShuffle(array) { - return shuffleSelf(copyArray(array)); - } - - /** - * This function is like `assignValue` except that it doesn't assign - * `undefined` values. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignMergeValue(object, key, value) { - if ((value !== undefined && !eq(object[key], value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } - - /** - * Assigns `value` to `key` of `object` if the existing value is not equivalent - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignValue(object, key, value) { - var objValue = object[key]; - if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } - - /** - * Gets the index at which the `key` is found in `array` of key-value pairs. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} key The key to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function assocIndexOf(array, key) { - var length = array.length; - while (length--) { - if (eq(array[length][0], key)) { - return length; - } - } - return -1; - } - - /** - * Aggregates elements of `collection` on `accumulator` with keys transformed - * by `iteratee` and values set by `setter`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function baseAggregator(collection, setter, iteratee, accumulator) { - baseEach(collection, function(value, key, collection) { - setter(accumulator, value, iteratee(value), collection); - }); - return accumulator; - } - - /** - * The base implementation of `_.assign` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssign(object, source) { - return object && copyObject(source, keys(source), object); - } - - /** - * The base implementation of `_.assignIn` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssignIn(object, source) { - return object && copyObject(source, keysIn(source), object); - } - - /** - * The base implementation of `assignValue` and `assignMergeValue` without - * value checks. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function baseAssignValue(object, key, value) { - if (key == '__proto__' && defineProperty) { - defineProperty(object, key, { - 'configurable': true, - 'enumerable': true, - 'value': value, - 'writable': true - }); - } else { - object[key] = value; - } - } - - /** - * The base implementation of `_.at` without support for individual paths. - * - * @private - * @param {Object} object The object to iterate over. - * @param {string[]} paths The property paths to pick. - * @returns {Array} Returns the picked elements. - */ - function baseAt(object, paths) { - var index = -1, - length = paths.length, - result = Array(length), - skip = object == null; - - while (++index < length) { - result[index] = skip ? undefined : get(object, paths[index]); - } - return result; - } - - /** - * The base implementation of `_.clamp` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. - */ - function baseClamp(number, lower, upper) { - if (number === number) { - if (upper !== undefined) { - number = number <= upper ? number : upper; - } - if (lower !== undefined) { - number = number >= lower ? number : lower; - } - } - return number; - } - - /** - * The base implementation of `_.clone` and `_.cloneDeep` which tracks - * traversed objects. - * - * @private - * @param {*} value The value to clone. - * @param {boolean} bitmask The bitmask flags. - * 1 - Deep clone - * 2 - Flatten inherited properties - * 4 - Clone symbols - * @param {Function} [customizer] The function to customize cloning. - * @param {string} [key] The key of `value`. - * @param {Object} [object] The parent object of `value`. - * @param {Object} [stack] Tracks traversed objects and their clone counterparts. - * @returns {*} Returns the cloned value. - */ - function baseClone(value, bitmask, customizer, key, object, stack) { - var result, - isDeep = bitmask & CLONE_DEEP_FLAG, - isFlat = bitmask & CLONE_FLAT_FLAG, - isFull = bitmask & CLONE_SYMBOLS_FLAG; - - if (customizer) { - result = object ? customizer(value, key, object, stack) : customizer(value); - } - if (result !== undefined) { - return result; - } - if (!isObject(value)) { - return value; - } - var isArr = isArray(value); - if (isArr) { - result = initCloneArray(value); - if (!isDeep) { - return copyArray(value, result); - } - } else { - var tag = getTag(value), - isFunc = tag == funcTag || tag == genTag; - - if (isBuffer(value)) { - return cloneBuffer(value, isDeep); - } - if (tag == objectTag || tag == argsTag || (isFunc && !object)) { - result = (isFlat || isFunc) ? {} : initCloneObject(value); - if (!isDeep) { - return isFlat - ? copySymbolsIn(value, baseAssignIn(result, value)) - : copySymbols(value, baseAssign(result, value)); - } - } else { - if (!cloneableTags[tag]) { - return object ? value : {}; - } - result = initCloneByTag(value, tag, isDeep); - } - } - // Check for circular references and return its corresponding clone. - stack || (stack = new Stack); - var stacked = stack.get(value); - if (stacked) { - return stacked; - } - stack.set(value, result); - - if (isSet(value)) { - value.forEach(function(subValue) { - result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack)); - }); - } else if (isMap(value)) { - value.forEach(function(subValue, key) { - result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack)); - }); - } - - var keysFunc = isFull - ? (isFlat ? getAllKeysIn : getAllKeys) - : (isFlat ? keysIn : keys); - - var props = isArr ? undefined : keysFunc(value); - arrayEach(props || value, function(subValue, key) { - if (props) { - key = subValue; - subValue = value[key]; - } - // Recursively populate clone (susceptible to call stack limits). - assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); - }); - return result; - } - - /** - * The base implementation of `_.conforms` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property predicates to conform to. - * @returns {Function} Returns the new spec function. - */ - function baseConforms(source) { - var props = keys(source); - return function(object) { - return baseConformsTo(object, source, props); - }; - } - - /** - * The base implementation of `_.conformsTo` which accepts `props` to check. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. - */ - function baseConformsTo(object, source, props) { - var length = props.length; - if (object == null) { - return !length; - } - object = Object(object); - while (length--) { - var key = props[length], - predicate = source[key], - value = object[key]; - - if ((value === undefined && !(key in object)) || !predicate(value)) { - return false; - } - } - return true; - } - - /** - * The base implementation of `_.delay` and `_.defer` which accepts `args` - * to provide to `func`. - * - * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {Array} args The arguments to provide to `func`. - * @returns {number|Object} Returns the timer id or timeout object. - */ - function baseDelay(func, wait, args) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - return setTimeout(function() { func.apply(undefined, args); }, wait); - } - - /** - * The base implementation of methods like `_.difference` without support - * for excluding multiple arrays or iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Array} values The values to exclude. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - */ - function baseDifference(array, values, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - isCommon = true, - length = array.length, - result = [], - valuesLength = values.length; - - if (!length) { - return result; - } - if (iteratee) { - values = arrayMap(values, baseUnary(iteratee)); - } - if (comparator) { - includes = arrayIncludesWith; - isCommon = false; - } - else if (values.length >= LARGE_ARRAY_SIZE) { - includes = cacheHas; - isCommon = false; - values = new SetCache(values); - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee == null ? value : iteratee(value); - - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var valuesIndex = valuesLength; - while (valuesIndex--) { - if (values[valuesIndex] === computed) { - continue outer; - } - } - result.push(value); - } - else if (!includes(values, computed, comparator)) { - result.push(value); - } - } - return result; - } - - /** - * The base implementation of `_.forEach` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEach = createBaseEach(baseForOwn); - - /** - * The base implementation of `_.forEachRight` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEachRight = createBaseEach(baseForOwnRight, true); - - /** - * The base implementation of `_.every` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false` - */ - function baseEvery(collection, predicate) { - var result = true; - baseEach(collection, function(value, index, collection) { - result = !!predicate(value, index, collection); - return result; - }); - return result; - } - - /** - * The base implementation of methods like `_.max` and `_.min` which accepts a - * `comparator` to determine the extremum value. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The iteratee invoked per iteration. - * @param {Function} comparator The comparator used to compare values. - * @returns {*} Returns the extremum value. - */ - function baseExtremum(array, iteratee, comparator) { - var index = -1, - length = array.length; - - while (++index < length) { - var value = array[index], - current = iteratee(value); - - if (current != null && (computed === undefined - ? (current === current && !isSymbol(current)) - : comparator(current, computed) - )) { - var computed = current, - result = value; - } - } - return result; - } - - /** - * The base implementation of `_.fill` without an iteratee call guard. - * - * @private - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - */ - function baseFill(array, value, start, end) { - var length = array.length; - - start = toInteger(start); - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = (end === undefined || end > length) ? length : toInteger(end); - if (end < 0) { - end += length; - } - end = start > end ? 0 : toLength(end); - while (start < end) { - array[start++] = value; - } - return array; - } - - /** - * The base implementation of `_.filter` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function baseFilter(collection, predicate) { - var result = []; - baseEach(collection, function(value, index, collection) { - if (predicate(value, index, collection)) { - result.push(value); - } - }); - return result; - } - - /** - * The base implementation of `_.flatten` with support for restricting flattening. - * - * @private - * @param {Array} array The array to flatten. - * @param {number} depth The maximum recursion depth. - * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. - * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. - * @param {Array} [result=[]] The initial result value. - * @returns {Array} Returns the new flattened array. - */ - function baseFlatten(array, depth, predicate, isStrict, result) { - var index = -1, - length = array.length; - - predicate || (predicate = isFlattenable); - result || (result = []); - - while (++index < length) { - var value = array[index]; - if (depth > 0 && predicate(value)) { - if (depth > 1) { - // Recursively flatten arrays (susceptible to call stack limits). - baseFlatten(value, depth - 1, predicate, isStrict, result); - } else { - arrayPush(result, value); - } - } else if (!isStrict) { - result[result.length] = value; - } - } - return result; - } - - /** - * The base implementation of `baseForOwn` which iterates over `object` - * properties returned by `keysFunc` and invokes `iteratee` for each property. - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseFor = createBaseFor(); - - /** - * This function is like `baseFor` except that it iterates over properties - * in the opposite order. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseForRight = createBaseFor(true); - - /** - * The base implementation of `_.forOwn` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwn(object, iteratee) { - return object && baseFor(object, iteratee, keys); - } - - /** - * The base implementation of `_.forOwnRight` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwnRight(object, iteratee) { - return object && baseForRight(object, iteratee, keys); - } - - /** - * The base implementation of `_.functions` which creates an array of - * `object` function property names filtered from `props`. - * - * @private - * @param {Object} object The object to inspect. - * @param {Array} props The property names to filter. - * @returns {Array} Returns the function names. - */ - function baseFunctions(object, props) { - return arrayFilter(props, function(key) { - return isFunction(object[key]); - }); - } - - /** - * The base implementation of `_.get` without support for default values. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @returns {*} Returns the resolved value. - */ - function baseGet(object, path) { - path = castPath(path, object); - - var index = 0, - length = path.length; - - while (object != null && index < length) { - object = object[toKey(path[index++])]; - } - return (index && index == length) ? object : undefined; - } - - /** - * The base implementation of `getAllKeys` and `getAllKeysIn` which uses - * `keysFunc` and `symbolsFunc` to get the enumerable property names and - * symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Function} keysFunc The function to get the keys of `object`. - * @param {Function} symbolsFunc The function to get the symbols of `object`. - * @returns {Array} Returns the array of property names and symbols. - */ - function baseGetAllKeys(object, keysFunc, symbolsFunc) { - var result = keysFunc(object); - return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); - } - - /** - * The base implementation of `getTag` without fallbacks for buggy environments. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. - */ - function baseGetTag(value) { - if (value == null) { - return value === undefined ? undefinedTag : nullTag; - } - return (symToStringTag && symToStringTag in Object(value)) - ? getRawTag(value) - : objectToString(value); - } - - /** - * The base implementation of `_.gt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - */ - function baseGt(value, other) { - return value > other; - } - - /** - * The base implementation of `_.has` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHas(object, key) { - return object != null && hasOwnProperty.call(object, key); - } - - /** - * The base implementation of `_.hasIn` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHasIn(object, key) { - return object != null && key in Object(object); - } - - /** - * The base implementation of `_.inRange` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to check. - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - */ - function baseInRange(number, start, end) { - return number >= nativeMin(start, end) && number < nativeMax(start, end); - } - - /** - * The base implementation of methods like `_.intersection`, without support - * for iteratee shorthands, that accepts an array of arrays to inspect. - * - * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of shared values. - */ - function baseIntersection(arrays, iteratee, comparator) { - var includes = comparator ? arrayIncludesWith : arrayIncludes, - length = arrays[0].length, - othLength = arrays.length, - othIndex = othLength, - caches = Array(othLength), - maxLength = Infinity, - result = []; - - while (othIndex--) { - var array = arrays[othIndex]; - if (othIndex && iteratee) { - array = arrayMap(array, baseUnary(iteratee)); - } - maxLength = nativeMin(array.length, maxLength); - caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) - ? new SetCache(othIndex && array) - : undefined; - } - array = arrays[0]; - - var index = -1, - seen = caches[0]; - - outer: - while (++index < length && result.length < maxLength) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - value = (comparator || value !== 0) ? value : 0; - if (!(seen - ? cacheHas(seen, computed) - : includes(result, computed, comparator) - )) { - othIndex = othLength; - while (--othIndex) { - var cache = caches[othIndex]; - if (!(cache - ? cacheHas(cache, computed) - : includes(arrays[othIndex], computed, comparator)) - ) { - continue outer; - } - } - if (seen) { - seen.push(computed); - } - result.push(value); - } - } - return result; - } - - /** - * The base implementation of `_.invert` and `_.invertBy` which inverts - * `object` with values transformed by `iteratee` and set by `setter`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform values. - * @param {Object} accumulator The initial inverted object. - * @returns {Function} Returns `accumulator`. - */ - function baseInverter(object, setter, iteratee, accumulator) { - baseForOwn(object, function(value, key, object) { - setter(accumulator, iteratee(value), key, object); - }); - return accumulator; - } - - /** - * The base implementation of `_.invoke` without support for individual - * method arguments. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {Array} args The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. - */ - function baseInvoke(object, path, args) { - path = castPath(path, object); - object = parent(object, path); - var func = object == null ? object : object[toKey(last(path))]; - return func == null ? undefined : apply(func, object, args); - } - - /** - * The base implementation of `_.isArguments`. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - */ - function baseIsArguments(value) { - return isObjectLike(value) && baseGetTag(value) == argsTag; - } - - /** - * The base implementation of `_.isArrayBuffer` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - */ - function baseIsArrayBuffer(value) { - return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; - } - - /** - * The base implementation of `_.isDate` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - */ - function baseIsDate(value) { - return isObjectLike(value) && baseGetTag(value) == dateTag; - } - - /** - * The base implementation of `_.isEqual` which supports partial comparisons - * and tracks traversed objects. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {boolean} bitmask The bitmask flags. - * 1 - Unordered comparison - * 2 - Partial comparison - * @param {Function} [customizer] The function to customize comparisons. - * @param {Object} [stack] Tracks traversed `value` and `other` objects. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - */ - function baseIsEqual(value, other, bitmask, customizer, stack) { - if (value === other) { - return true; - } - if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { - return value !== value && other !== other; - } - return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); - } - - /** - * A specialized version of `baseIsEqual` for arrays and objects which performs - * deep comparisons and tracks traversed objects enabling objects with circular - * references to be compared. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} [stack] Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { - var objIsArr = isArray(object), - othIsArr = isArray(other), - objTag = objIsArr ? arrayTag : getTag(object), - othTag = othIsArr ? arrayTag : getTag(other); - - objTag = objTag == argsTag ? objectTag : objTag; - othTag = othTag == argsTag ? objectTag : othTag; - - var objIsObj = objTag == objectTag, - othIsObj = othTag == objectTag, - isSameTag = objTag == othTag; - - if (isSameTag && isBuffer(object)) { - if (!isBuffer(other)) { - return false; - } - objIsArr = true; - objIsObj = false; - } - if (isSameTag && !objIsObj) { - stack || (stack = new Stack); - return (objIsArr || isTypedArray(object)) - ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) - : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); - } - if (!(bitmask & COMPARE_PARTIAL_FLAG)) { - var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), - othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); - - if (objIsWrapped || othIsWrapped) { - var objUnwrapped = objIsWrapped ? object.value() : object, - othUnwrapped = othIsWrapped ? other.value() : other; - - stack || (stack = new Stack); - return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); - } - } - if (!isSameTag) { - return false; - } - stack || (stack = new Stack); - return equalObjects(object, other, bitmask, customizer, equalFunc, stack); - } - - /** - * The base implementation of `_.isMap` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. - */ - function baseIsMap(value) { - return isObjectLike(value) && getTag(value) == mapTag; - } - - /** - * The base implementation of `_.isMatch` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Array} matchData The property names, values, and compare flags to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - */ - function baseIsMatch(object, source, matchData, customizer) { - var index = matchData.length, - length = index, - noCustomizer = !customizer; - - if (object == null) { - return !length; - } - object = Object(object); - while (index--) { - var data = matchData[index]; - if ((noCustomizer && data[2]) - ? data[1] !== object[data[0]] - : !(data[0] in object) - ) { - return false; - } - } - while (++index < length) { - data = matchData[index]; - var key = data[0], - objValue = object[key], - srcValue = data[1]; - - if (noCustomizer && data[2]) { - if (objValue === undefined && !(key in object)) { - return false; - } - } else { - var stack = new Stack; - if (customizer) { - var result = customizer(objValue, srcValue, key, object, source, stack); - } - if (!(result === undefined - ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) - : result - )) { - return false; - } - } - } - return true; - } - - /** - * The base implementation of `_.isNative` without bad shim checks. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. - */ - function baseIsNative(value) { - if (!isObject(value) || isMasked(value)) { - return false; - } - var pattern = isFunction(value) ? reIsNative : reIsHostCtor; - return pattern.test(toSource(value)); - } - - /** - * The base implementation of `_.isRegExp` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. - */ - function baseIsRegExp(value) { - return isObjectLike(value) && baseGetTag(value) == regexpTag; - } - - /** - * The base implementation of `_.isSet` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. - */ - function baseIsSet(value) { - return isObjectLike(value) && getTag(value) == setTag; - } - - /** - * The base implementation of `_.isTypedArray` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. - */ - function baseIsTypedArray(value) { - return isObjectLike(value) && - isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; - } - - /** - * The base implementation of `_.iteratee`. - * - * @private - * @param {*} [value=_.identity] The value to convert to an iteratee. - * @returns {Function} Returns the iteratee. - */ - function baseIteratee(value) { - // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. - // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. - if (typeof value == 'function') { - return value; - } - if (value == null) { - return identity; - } - if (typeof value == 'object') { - return isArray(value) - ? baseMatchesProperty(value[0], value[1]) - : baseMatches(value); - } - return property(value); - } - - /** - * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeys(object) { - if (!isPrototype(object)) { - return nativeKeys(object); - } - var result = []; - for (var key in Object(object)) { - if (hasOwnProperty.call(object, key) && key != 'constructor') { - result.push(key); - } - } - return result; - } - - /** - * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeysIn(object) { - if (!isObject(object)) { - return nativeKeysIn(object); - } - var isProto = isPrototype(object), - result = []; - - for (var key in object) { - if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { - result.push(key); - } - } - return result; - } - - /** - * The base implementation of `_.lt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - */ - function baseLt(value, other) { - return value < other; - } - - /** - * The base implementation of `_.map` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function baseMap(collection, iteratee) { - var index = -1, - result = isArrayLike(collection) ? Array(collection.length) : []; - - baseEach(collection, function(value, key, collection) { - result[++index] = iteratee(value, key, collection); - }); - return result; - } - - /** - * The base implementation of `_.matches` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property values to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatches(source) { - var matchData = getMatchData(source); - if (matchData.length == 1 && matchData[0][2]) { - return matchesStrictComparable(matchData[0][0], matchData[0][1]); - } - return function(object) { - return object === source || baseIsMatch(object, source, matchData); - }; - } - - /** - * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. - * - * @private - * @param {string} path The path of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatchesProperty(path, srcValue) { - if (isKey(path) && isStrictComparable(srcValue)) { - return matchesStrictComparable(toKey(path), srcValue); - } - return function(object) { - var objValue = get(object, path); - return (objValue === undefined && objValue === srcValue) - ? hasIn(object, path) - : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); - }; - } - - /** - * The base implementation of `_.merge` without support for multiple sources. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {number} srcIndex The index of `source`. - * @param {Function} [customizer] The function to customize merged values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMerge(object, source, srcIndex, customizer, stack) { - if (object === source) { - return; - } - baseFor(source, function(srcValue, key) { - stack || (stack = new Stack); - if (isObject(srcValue)) { - baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); - } - else { - var newValue = customizer - ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack) - : undefined; - - if (newValue === undefined) { - newValue = srcValue; - } - assignMergeValue(object, key, newValue); - } - }, keysIn); - } - - /** - * A specialized version of `baseMerge` for arrays and objects which performs - * deep merges and tracks traversed objects enabling objects with circular - * references to be merged. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {string} key The key of the value to merge. - * @param {number} srcIndex The index of `source`. - * @param {Function} mergeFunc The function to merge values. - * @param {Function} [customizer] The function to customize assigned values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { - var objValue = safeGet(object, key), - srcValue = safeGet(source, key), - stacked = stack.get(srcValue); - - if (stacked) { - assignMergeValue(object, key, stacked); - return; - } - var newValue = customizer - ? customizer(objValue, srcValue, (key + ''), object, source, stack) - : undefined; - - var isCommon = newValue === undefined; - - if (isCommon) { - var isArr = isArray(srcValue), - isBuff = !isArr && isBuffer(srcValue), - isTyped = !isArr && !isBuff && isTypedArray(srcValue); - - newValue = srcValue; - if (isArr || isBuff || isTyped) { - if (isArray(objValue)) { - newValue = objValue; - } - else if (isArrayLikeObject(objValue)) { - newValue = copyArray(objValue); - } - else if (isBuff) { - isCommon = false; - newValue = cloneBuffer(srcValue, true); - } - else if (isTyped) { - isCommon = false; - newValue = cloneTypedArray(srcValue, true); - } - else { - newValue = []; - } - } - else if (isPlainObject(srcValue) || isArguments(srcValue)) { - newValue = objValue; - if (isArguments(objValue)) { - newValue = toPlainObject(objValue); - } - else if (!isObject(objValue) || isFunction(objValue)) { - newValue = initCloneObject(srcValue); - } - } - else { - isCommon = false; - } - } - if (isCommon) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, newValue); - mergeFunc(newValue, srcValue, srcIndex, customizer, stack); - stack['delete'](srcValue); - } - assignMergeValue(object, key, newValue); - } - - /** - * The base implementation of `_.nth` which doesn't coerce arguments. - * - * @private - * @param {Array} array The array to query. - * @param {number} n The index of the element to return. - * @returns {*} Returns the nth element of `array`. - */ - function baseNth(array, n) { - var length = array.length; - if (!length) { - return; - } - n += n < 0 ? length : 0; - return isIndex(n, length) ? array[n] : undefined; - } - - /** - * The base implementation of `_.orderBy` without param guards. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. - * @param {string[]} orders The sort orders of `iteratees`. - * @returns {Array} Returns the new sorted array. - */ - function baseOrderBy(collection, iteratees, orders) { - if (iteratees.length) { - iteratees = arrayMap(iteratees, function(iteratee) { - if (isArray(iteratee)) { - return function(value) { - return baseGet(value, iteratee.length === 1 ? iteratee[0] : iteratee); - } - } - return iteratee; - }); - } else { - iteratees = [identity]; - } - - var index = -1; - iteratees = arrayMap(iteratees, baseUnary(getIteratee())); - - var result = baseMap(collection, function(value, key, collection) { - var criteria = arrayMap(iteratees, function(iteratee) { - return iteratee(value); - }); - return { 'criteria': criteria, 'index': ++index, 'value': value }; - }); - - return baseSortBy(result, function(object, other) { - return compareMultiple(object, other, orders); - }); - } - - /** - * The base implementation of `_.pick` without support for individual - * property identifiers. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @returns {Object} Returns the new object. - */ - function basePick(object, paths) { - return basePickBy(object, paths, function(value, path) { - return hasIn(object, path); - }); - } - - /** - * The base implementation of `_.pickBy` without support for iteratee shorthands. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @param {Function} predicate The function invoked per property. - * @returns {Object} Returns the new object. - */ - function basePickBy(object, paths, predicate) { - var index = -1, - length = paths.length, - result = {}; - - while (++index < length) { - var path = paths[index], - value = baseGet(object, path); - - if (predicate(value, path)) { - baseSet(result, castPath(path, object), value); - } - } - return result; - } - - /** - * A specialized version of `baseProperty` which supports deep paths. - * - * @private - * @param {Array|string} path The path of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyDeep(path) { - return function(object) { - return baseGet(object, path); - }; - } - - /** - * The base implementation of `_.pullAllBy` without support for iteratee - * shorthands. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - */ - function basePullAll(array, values, iteratee, comparator) { - var indexOf = comparator ? baseIndexOfWith : baseIndexOf, - index = -1, - length = values.length, - seen = array; - - if (array === values) { - values = copyArray(values); - } - if (iteratee) { - seen = arrayMap(array, baseUnary(iteratee)); - } - while (++index < length) { - var fromIndex = 0, - value = values[index], - computed = iteratee ? iteratee(value) : value; - - while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { - if (seen !== array) { - splice.call(seen, fromIndex, 1); - } - splice.call(array, fromIndex, 1); - } - } - return array; - } - - /** - * The base implementation of `_.pullAt` without support for individual - * indexes or capturing the removed elements. - * - * @private - * @param {Array} array The array to modify. - * @param {number[]} indexes The indexes of elements to remove. - * @returns {Array} Returns `array`. - */ - function basePullAt(array, indexes) { - var length = array ? indexes.length : 0, - lastIndex = length - 1; - - while (length--) { - var index = indexes[length]; - if (length == lastIndex || index !== previous) { - var previous = index; - if (isIndex(index)) { - splice.call(array, index, 1); - } else { - baseUnset(array, index); - } - } - } - return array; - } - - /** - * The base implementation of `_.random` without support for returning - * floating-point numbers. - * - * @private - * @param {number} lower The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the random number. - */ - function baseRandom(lower, upper) { - return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); - } - - /** - * The base implementation of `_.range` and `_.rangeRight` which doesn't - * coerce arguments. - * - * @private - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @param {number} step The value to increment or decrement by. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the range of numbers. - */ - function baseRange(start, end, step, fromRight) { - var index = -1, - length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), - result = Array(length); - - while (length--) { - result[fromRight ? length : ++index] = start; - start += step; - } - return result; - } - - /** - * The base implementation of `_.repeat` which doesn't coerce arguments. - * - * @private - * @param {string} string The string to repeat. - * @param {number} n The number of times to repeat the string. - * @returns {string} Returns the repeated string. - */ - function baseRepeat(string, n) { - var result = ''; - if (!string || n < 1 || n > MAX_SAFE_INTEGER) { - return result; - } - // Leverage the exponentiation by squaring algorithm for a faster repeat. - // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. - do { - if (n % 2) { - result += string; - } - n = nativeFloor(n / 2); - if (n) { - string += string; - } - } while (n); - - return result; - } - - /** - * The base implementation of `_.rest` which doesn't validate or coerce arguments. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. - */ - function baseRest(func, start) { - return setToString(overRest(func, start, identity), func + ''); - } - - /** - * The base implementation of `_.sample`. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - */ - function baseSample(collection) { - return arraySample(values(collection)); - } - - /** - * The base implementation of `_.sampleSize` without param guards. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function baseSampleSize(collection, n) { - var array = values(collection); - return shuffleSelf(array, baseClamp(n, 0, array.length)); - } - - /** - * The base implementation of `_.set`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. - */ - function baseSet(object, path, value, customizer) { - if (!isObject(object)) { - return object; - } - path = castPath(path, object); - - var index = -1, - length = path.length, - lastIndex = length - 1, - nested = object; - - while (nested != null && ++index < length) { - var key = toKey(path[index]), - newValue = value; - - if (key === '__proto__' || key === 'constructor' || key === 'prototype') { - return object; - } - - if (index != lastIndex) { - var objValue = nested[key]; - newValue = customizer ? customizer(objValue, key, nested) : undefined; - if (newValue === undefined) { - newValue = isObject(objValue) - ? objValue - : (isIndex(path[index + 1]) ? [] : {}); - } - } - assignValue(nested, key, newValue); - nested = nested[key]; - } - return object; - } - - /** - * The base implementation of `setData` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. - */ - var baseSetData = !metaMap ? identity : function(func, data) { - metaMap.set(func, data); - return func; - }; - - /** - * The base implementation of `setToString` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. - */ - var baseSetToString = !defineProperty ? identity : function(func, string) { - return defineProperty(func, 'toString', { - 'configurable': true, - 'enumerable': false, - 'value': constant(string), - 'writable': true - }); - }; - - /** - * The base implementation of `_.shuffle`. - * - * @private - * @param {Array|Object} collection The collection to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function baseShuffle(collection) { - return shuffleSelf(values(collection)); - } - - /** - * The base implementation of `_.slice` without an iteratee call guard. - * - * @private - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. - */ - function baseSlice(array, start, end) { - var index = -1, - length = array.length; - - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = end > length ? length : end; - if (end < 0) { - end += length; - } - length = start > end ? 0 : ((end - start) >>> 0); - start >>>= 0; - - var result = Array(length); - while (++index < length) { - result[index] = array[index + start]; - } - return result; - } - - /** - * The base implementation of `_.some` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function baseSome(collection, predicate) { - var result; - - baseEach(collection, function(value, index, collection) { - result = predicate(value, index, collection); - return !result; - }); - return !!result; - } - - /** - * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which - * performs a binary search of `array` to determine the index at which `value` - * should be inserted into `array` in order to maintain its sort order. - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndex(array, value, retHighest) { - var low = 0, - high = array == null ? low : array.length; - - if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { - while (low < high) { - var mid = (low + high) >>> 1, - computed = array[mid]; - - if (computed !== null && !isSymbol(computed) && - (retHighest ? (computed <= value) : (computed < value))) { - low = mid + 1; - } else { - high = mid; - } - } - return high; - } - return baseSortedIndexBy(array, value, identity, retHighest); - } - - /** - * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` - * which invokes `iteratee` for `value` and each element of `array` to compute - * their sort ranking. The iteratee is invoked with one argument; (value). - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} iteratee The iteratee invoked per element. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndexBy(array, value, iteratee, retHighest) { - var low = 0, - high = array == null ? 0 : array.length; - if (high === 0) { - return 0; - } - - value = iteratee(value); - var valIsNaN = value !== value, - valIsNull = value === null, - valIsSymbol = isSymbol(value), - valIsUndefined = value === undefined; - - while (low < high) { - var mid = nativeFloor((low + high) / 2), - computed = iteratee(array[mid]), - othIsDefined = computed !== undefined, - othIsNull = computed === null, - othIsReflexive = computed === computed, - othIsSymbol = isSymbol(computed); - - if (valIsNaN) { - var setLow = retHighest || othIsReflexive; - } else if (valIsUndefined) { - setLow = othIsReflexive && (retHighest || othIsDefined); - } else if (valIsNull) { - setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); - } else if (valIsSymbol) { - setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); - } else if (othIsNull || othIsSymbol) { - setLow = false; - } else { - setLow = retHighest ? (computed <= value) : (computed < value); - } - if (setLow) { - low = mid + 1; - } else { - high = mid; - } - } - return nativeMin(high, MAX_ARRAY_INDEX); - } - - /** - * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - */ - function baseSortedUniq(array, iteratee) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - if (!index || !eq(computed, seen)) { - var seen = computed; - result[resIndex++] = value === 0 ? 0 : value; - } - } - return result; - } - - /** - * The base implementation of `_.toNumber` which doesn't ensure correct - * conversions of binary, hexadecimal, or octal string values. - * - * @private - * @param {*} value The value to process. - * @returns {number} Returns the number. - */ - function baseToNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - return +value; - } - - /** - * The base implementation of `_.toString` which doesn't convert nullish - * values to empty strings. - * - * @private - * @param {*} value The value to process. - * @returns {string} Returns the string. - */ - function baseToString(value) { - // Exit early for strings to avoid a performance hit in some environments. - if (typeof value == 'string') { - return value; - } - if (isArray(value)) { - // Recursively convert values (susceptible to call stack limits). - return arrayMap(value, baseToString) + ''; - } - if (isSymbol(value)) { - return symbolToString ? symbolToString.call(value) : ''; - } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; - } - - /** - * The base implementation of `_.uniqBy` without support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. - */ - function baseUniq(array, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - length = array.length, - isCommon = true, - result = [], - seen = result; - - if (comparator) { - isCommon = false; - includes = arrayIncludesWith; - } - else if (length >= LARGE_ARRAY_SIZE) { - var set = iteratee ? null : createSet(array); - if (set) { - return setToArray(set); - } - isCommon = false; - includes = cacheHas; - seen = new SetCache; - } - else { - seen = iteratee ? [] : result; - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var seenIndex = seen.length; - while (seenIndex--) { - if (seen[seenIndex] === computed) { - continue outer; - } - } - if (iteratee) { - seen.push(computed); - } - result.push(value); - } - else if (!includes(seen, computed, comparator)) { - if (seen !== result) { - seen.push(computed); - } - result.push(value); - } - } - return result; - } - - /** - * The base implementation of `_.unset`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The property path to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. - */ - function baseUnset(object, path) { - path = castPath(path, object); - object = parent(object, path); - return object == null || delete object[toKey(last(path))]; - } - - /** - * The base implementation of `_.update`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to update. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. - */ - function baseUpdate(object, path, updater, customizer) { - return baseSet(object, path, updater(baseGet(object, path)), customizer); - } - - /** - * The base implementation of methods like `_.dropWhile` and `_.takeWhile` - * without support for iteratee shorthands. - * - * @private - * @param {Array} array The array to query. - * @param {Function} predicate The function invoked per iteration. - * @param {boolean} [isDrop] Specify dropping elements instead of taking them. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the slice of `array`. - */ - function baseWhile(array, predicate, isDrop, fromRight) { - var length = array.length, - index = fromRight ? length : -1; - - while ((fromRight ? index-- : ++index < length) && - predicate(array[index], index, array)) {} - - return isDrop - ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) - : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); - } - - /** - * The base implementation of `wrapperValue` which returns the result of - * performing a sequence of actions on the unwrapped `value`, where each - * successive action is supplied the return value of the previous. - * - * @private - * @param {*} value The unwrapped value. - * @param {Array} actions Actions to perform to resolve the unwrapped value. - * @returns {*} Returns the resolved value. - */ - function baseWrapperValue(value, actions) { - var result = value; - if (result instanceof LazyWrapper) { - result = result.value(); - } - return arrayReduce(actions, function(result, action) { - return action.func.apply(action.thisArg, arrayPush([result], action.args)); - }, result); - } - - /** - * The base implementation of methods like `_.xor`, without support for - * iteratee shorthands, that accepts an array of arrays to inspect. - * - * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of values. - */ - function baseXor(arrays, iteratee, comparator) { - var length = arrays.length; - if (length < 2) { - return length ? baseUniq(arrays[0]) : []; - } - var index = -1, - result = Array(length); - - while (++index < length) { - var array = arrays[index], - othIndex = -1; - - while (++othIndex < length) { - if (othIndex != index) { - result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); - } - } - } - return baseUniq(baseFlatten(result, 1), iteratee, comparator); - } - - /** - * This base implementation of `_.zipObject` which assigns values using `assignFunc`. - * - * @private - * @param {Array} props The property identifiers. - * @param {Array} values The property values. - * @param {Function} assignFunc The function to assign values. - * @returns {Object} Returns the new object. - */ - function baseZipObject(props, values, assignFunc) { - var index = -1, - length = props.length, - valsLength = values.length, - result = {}; - - while (++index < length) { - var value = index < valsLength ? values[index] : undefined; - assignFunc(result, props[index], value); - } - return result; - } - - /** - * Casts `value` to an empty array if it's not an array like object. - * - * @private - * @param {*} value The value to inspect. - * @returns {Array|Object} Returns the cast array-like object. - */ - function castArrayLikeObject(value) { - return isArrayLikeObject(value) ? value : []; - } - - /** - * Casts `value` to `identity` if it's not a function. - * - * @private - * @param {*} value The value to inspect. - * @returns {Function} Returns cast function. - */ - function castFunction(value) { - return typeof value == 'function' ? value : identity; - } - - /** - * Casts `value` to a path array if it's not one. - * - * @private - * @param {*} value The value to inspect. - * @param {Object} [object] The object to query keys on. - * @returns {Array} Returns the cast property path array. - */ - function castPath(value, object) { - if (isArray(value)) { - return value; - } - return isKey(value, object) ? [value] : stringToPath(toString(value)); - } - - /** - * A `baseRest` alias which can be replaced with `identity` by module - * replacement plugins. - * - * @private - * @type {Function} - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. - */ - var castRest = baseRest; - - /** - * Casts `array` to a slice if it's needed. - * - * @private - * @param {Array} array The array to inspect. - * @param {number} start The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the cast slice. - */ - function castSlice(array, start, end) { - var length = array.length; - end = end === undefined ? length : end; - return (!start && end >= length) ? array : baseSlice(array, start, end); - } - - /** - * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). - * - * @private - * @param {number|Object} id The timer id or timeout object of the timer to clear. - */ - var clearTimeout = ctxClearTimeout || function(id) { - return root.clearTimeout(id); - }; - - /** - * Creates a clone of `buffer`. - * - * @private - * @param {Buffer} buffer The buffer to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Buffer} Returns the cloned buffer. - */ - function cloneBuffer(buffer, isDeep) { - if (isDeep) { - return buffer.slice(); - } - var length = buffer.length, - result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); - - buffer.copy(result); - return result; - } - - /** - * Creates a clone of `arrayBuffer`. - * - * @private - * @param {ArrayBuffer} arrayBuffer The array buffer to clone. - * @returns {ArrayBuffer} Returns the cloned array buffer. - */ - function cloneArrayBuffer(arrayBuffer) { - var result = new arrayBuffer.constructor(arrayBuffer.byteLength); - new Uint8Array(result).set(new Uint8Array(arrayBuffer)); - return result; - } - - /** - * Creates a clone of `dataView`. - * - * @private - * @param {Object} dataView The data view to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned data view. - */ - function cloneDataView(dataView, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; - return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); - } - - /** - * Creates a clone of `regexp`. - * - * @private - * @param {Object} regexp The regexp to clone. - * @returns {Object} Returns the cloned regexp. - */ - function cloneRegExp(regexp) { - var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); - result.lastIndex = regexp.lastIndex; - return result; - } - - /** - * Creates a clone of the `symbol` object. - * - * @private - * @param {Object} symbol The symbol object to clone. - * @returns {Object} Returns the cloned symbol object. - */ - function cloneSymbol(symbol) { - return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; - } - - /** - * Creates a clone of `typedArray`. - * - * @private - * @param {Object} typedArray The typed array to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned typed array. - */ - function cloneTypedArray(typedArray, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; - return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); - } - - /** - * Compares values to sort them in ascending order. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {number} Returns the sort order indicator for `value`. - */ - function compareAscending(value, other) { - if (value !== other) { - var valIsDefined = value !== undefined, - valIsNull = value === null, - valIsReflexive = value === value, - valIsSymbol = isSymbol(value); - - var othIsDefined = other !== undefined, - othIsNull = other === null, - othIsReflexive = other === other, - othIsSymbol = isSymbol(other); - - if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || - (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || - (valIsNull && othIsDefined && othIsReflexive) || - (!valIsDefined && othIsReflexive) || - !valIsReflexive) { - return 1; - } - if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || - (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || - (othIsNull && valIsDefined && valIsReflexive) || - (!othIsDefined && valIsReflexive) || - !othIsReflexive) { - return -1; - } - } - return 0; - } - - /** - * Used by `_.orderBy` to compare multiple properties of a value to another - * and stable sort them. - * - * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, - * specify an order of "desc" for descending or "asc" for ascending sort order - * of corresponding values. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {boolean[]|string[]} orders The order to sort by for each property. - * @returns {number} Returns the sort order indicator for `object`. - */ - function compareMultiple(object, other, orders) { - var index = -1, - objCriteria = object.criteria, - othCriteria = other.criteria, - length = objCriteria.length, - ordersLength = orders.length; - - while (++index < length) { - var result = compareAscending(objCriteria[index], othCriteria[index]); - if (result) { - if (index >= ordersLength) { - return result; - } - var order = orders[index]; - return result * (order == 'desc' ? -1 : 1); - } - } - // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications - // that causes it, under certain circumstances, to provide the same value for - // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 - // for more details. - // - // This also ensures a stable sort in V8 and other engines. - // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. - return object.index - other.index; - } - - /** - * Creates an array that is the composition of partially applied arguments, - * placeholders, and provided arguments into a single array of arguments. - * - * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to prepend to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. - */ - function composeArgs(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersLength = holders.length, - leftIndex = -1, - leftLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(leftLength + rangeLength), - isUncurried = !isCurried; - - while (++leftIndex < leftLength) { - result[leftIndex] = partials[leftIndex]; - } - while (++argsIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[holders[argsIndex]] = args[argsIndex]; - } - } - while (rangeLength--) { - result[leftIndex++] = args[argsIndex++]; - } - return result; - } - - /** - * This function is like `composeArgs` except that the arguments composition - * is tailored for `_.partialRight`. - * - * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to append to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. - */ - function composeArgsRight(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersIndex = -1, - holdersLength = holders.length, - rightIndex = -1, - rightLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(rangeLength + rightLength), - isUncurried = !isCurried; - - while (++argsIndex < rangeLength) { - result[argsIndex] = args[argsIndex]; - } - var offset = argsIndex; - while (++rightIndex < rightLength) { - result[offset + rightIndex] = partials[rightIndex]; - } - while (++holdersIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[offset + holders[holdersIndex]] = args[argsIndex++]; - } - } - return result; - } - - /** - * Copies the values of `source` to `array`. - * - * @private - * @param {Array} source The array to copy values from. - * @param {Array} [array=[]] The array to copy values to. - * @returns {Array} Returns `array`. - */ - function copyArray(source, array) { - var index = -1, - length = source.length; - - array || (array = Array(length)); - while (++index < length) { - array[index] = source[index]; - } - return array; - } - - /** - * Copies properties of `source` to `object`. - * - * @private - * @param {Object} source The object to copy properties from. - * @param {Array} props The property identifiers to copy. - * @param {Object} [object={}] The object to copy properties to. - * @param {Function} [customizer] The function to customize copied values. - * @returns {Object} Returns `object`. - */ - function copyObject(source, props, object, customizer) { - var isNew = !object; - object || (object = {}); - - var index = -1, - length = props.length; - - while (++index < length) { - var key = props[index]; - - var newValue = customizer - ? customizer(object[key], source[key], key, object, source) - : undefined; - - if (newValue === undefined) { - newValue = source[key]; - } - if (isNew) { - baseAssignValue(object, key, newValue); - } else { - assignValue(object, key, newValue); - } - } - return object; - } - - /** - * Copies own symbols of `source` to `object`. - * - * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. - */ - function copySymbols(source, object) { - return copyObject(source, getSymbols(source), object); - } - - /** - * Copies own and inherited symbols of `source` to `object`. - * - * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. - */ - function copySymbolsIn(source, object) { - return copyObject(source, getSymbolsIn(source), object); - } - - /** - * Creates a function like `_.groupBy`. - * - * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} [initializer] The accumulator object initializer. - * @returns {Function} Returns the new aggregator function. - */ - function createAggregator(setter, initializer) { - return function(collection, iteratee) { - var func = isArray(collection) ? arrayAggregator : baseAggregator, - accumulator = initializer ? initializer() : {}; - - return func(collection, setter, getIteratee(iteratee, 2), accumulator); - }; - } - - /** - * Creates a function like `_.assign`. - * - * @private - * @param {Function} assigner The function to assign values. - * @returns {Function} Returns the new assigner function. - */ - function createAssigner(assigner) { - return baseRest(function(object, sources) { - var index = -1, - length = sources.length, - customizer = length > 1 ? sources[length - 1] : undefined, - guard = length > 2 ? sources[2] : undefined; - - customizer = (assigner.length > 3 && typeof customizer == 'function') - ? (length--, customizer) - : undefined; - - if (guard && isIterateeCall(sources[0], sources[1], guard)) { - customizer = length < 3 ? undefined : customizer; - length = 1; - } - object = Object(object); - while (++index < length) { - var source = sources[index]; - if (source) { - assigner(object, source, index, customizer); - } - } - return object; - }); - } - - /** - * Creates a `baseEach` or `baseEachRight` function. - * - * @private - * @param {Function} eachFunc The function to iterate over a collection. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. - */ - function createBaseEach(eachFunc, fromRight) { - return function(collection, iteratee) { - if (collection == null) { - return collection; - } - if (!isArrayLike(collection)) { - return eachFunc(collection, iteratee); - } - var length = collection.length, - index = fromRight ? length : -1, - iterable = Object(collection); - - while ((fromRight ? index-- : ++index < length)) { - if (iteratee(iterable[index], index, iterable) === false) { - break; - } - } - return collection; - }; - } - - /** - * Creates a base function for methods like `_.forIn` and `_.forOwn`. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. - */ - function createBaseFor(fromRight) { - return function(object, iteratee, keysFunc) { - var index = -1, - iterable = Object(object), - props = keysFunc(object), - length = props.length; - - while (length--) { - var key = props[fromRight ? length : ++index]; - if (iteratee(iterable[key], key, iterable) === false) { - break; - } - } - return object; - }; - } - - /** - * Creates a function that wraps `func` to invoke it with the optional `this` - * binding of `thisArg`. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createBind(func, bitmask, thisArg) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); - - function wrapper() { - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return fn.apply(isBind ? thisArg : this, arguments); - } - return wrapper; - } - - /** - * Creates a function like `_.lowerFirst`. - * - * @private - * @param {string} methodName The name of the `String` case method to use. - * @returns {Function} Returns the new case function. - */ - function createCaseFirst(methodName) { - return function(string) { - string = toString(string); - - var strSymbols = hasUnicode(string) - ? stringToArray(string) - : undefined; - - var chr = strSymbols - ? strSymbols[0] - : string.charAt(0); - - var trailing = strSymbols - ? castSlice(strSymbols, 1).join('') - : string.slice(1); - - return chr[methodName]() + trailing; - }; - } - - /** - * Creates a function like `_.camelCase`. - * - * @private - * @param {Function} callback The function to combine each word. - * @returns {Function} Returns the new compounder function. - */ - function createCompounder(callback) { - return function(string) { - return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); - }; - } - - /** - * Creates a function that produces an instance of `Ctor` regardless of - * whether it was invoked as part of a `new` expression or by `call` or `apply`. - * - * @private - * @param {Function} Ctor The constructor to wrap. - * @returns {Function} Returns the new wrapped function. - */ - function createCtor(Ctor) { - return function() { - // Use a `switch` statement to work with class constructors. See - // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist - // for more details. - var args = arguments; - switch (args.length) { - case 0: return new Ctor; - case 1: return new Ctor(args[0]); - case 2: return new Ctor(args[0], args[1]); - case 3: return new Ctor(args[0], args[1], args[2]); - case 4: return new Ctor(args[0], args[1], args[2], args[3]); - case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); - case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); - case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); - } - var thisBinding = baseCreate(Ctor.prototype), - result = Ctor.apply(thisBinding, args); - - // Mimic the constructor's `return` behavior. - // See https://es5.github.io/#x13.2.2 for more details. - return isObject(result) ? result : thisBinding; - }; - } - - /** - * Creates a function that wraps `func` to enable currying. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {number} arity The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createCurry(func, bitmask, arity) { - var Ctor = createCtor(func); - - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length, - placeholder = getHolder(wrapper); - - while (index--) { - args[index] = arguments[index]; - } - var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) - ? [] - : replaceHolders(args, placeholder); - - length -= holders.length; - if (length < arity) { - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, undefined, - args, holders, undefined, undefined, arity - length); - } - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return apply(fn, this, args); - } - return wrapper; - } - - /** - * Creates a `_.find` or `_.findLast` function. - * - * @private - * @param {Function} findIndexFunc The function to find the collection index. - * @returns {Function} Returns the new find function. - */ - function createFind(findIndexFunc) { - return function(collection, predicate, fromIndex) { - var iterable = Object(collection); - if (!isArrayLike(collection)) { - var iteratee = getIteratee(predicate, 3); - collection = keys(collection); - predicate = function(key) { return iteratee(iterable[key], key, iterable); }; - } - var index = findIndexFunc(collection, predicate, fromIndex); - return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; - }; - } - - /** - * Creates a `_.flow` or `_.flowRight` function. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new flow function. - */ - function createFlow(fromRight) { - return flatRest(function(funcs) { - var length = funcs.length, - index = length, - prereq = LodashWrapper.prototype.thru; - - if (fromRight) { - funcs.reverse(); - } - while (index--) { - var func = funcs[index]; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - if (prereq && !wrapper && getFuncName(func) == 'wrapper') { - var wrapper = new LodashWrapper([], true); - } - } - index = wrapper ? index : length; - while (++index < length) { - func = funcs[index]; - - var funcName = getFuncName(func), - data = funcName == 'wrapper' ? getData(func) : undefined; - - if (data && isLaziable(data[0]) && - data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && - !data[4].length && data[9] == 1 - ) { - wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); - } else { - wrapper = (func.length == 1 && isLaziable(func)) - ? wrapper[funcName]() - : wrapper.thru(func); - } - } - return function() { - var args = arguments, - value = args[0]; - - if (wrapper && args.length == 1 && isArray(value)) { - return wrapper.plant(value).value(); - } - var index = 0, - result = length ? funcs[index].apply(this, args) : value; - - while (++index < length) { - result = funcs[index].call(this, result); - } - return result; - }; - }); - } - - /** - * Creates a function that wraps `func` to invoke it with optional `this` - * binding of `thisArg`, partial application, and currying. - * - * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [partialsRight] The arguments to append to those provided - * to the new function. - * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { - var isAry = bitmask & WRAP_ARY_FLAG, - isBind = bitmask & WRAP_BIND_FLAG, - isBindKey = bitmask & WRAP_BIND_KEY_FLAG, - isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), - isFlip = bitmask & WRAP_FLIP_FLAG, - Ctor = isBindKey ? undefined : createCtor(func); - - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length; - - while (index--) { - args[index] = arguments[index]; - } - if (isCurried) { - var placeholder = getHolder(wrapper), - holdersCount = countHolders(args, placeholder); - } - if (partials) { - args = composeArgs(args, partials, holders, isCurried); - } - if (partialsRight) { - args = composeArgsRight(args, partialsRight, holdersRight, isCurried); - } - length -= holdersCount; - if (isCurried && length < arity) { - var newHolders = replaceHolders(args, placeholder); - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, thisArg, - args, newHolders, argPos, ary, arity - length - ); - } - var thisBinding = isBind ? thisArg : this, - fn = isBindKey ? thisBinding[func] : func; - - length = args.length; - if (argPos) { - args = reorder(args, argPos); - } else if (isFlip && length > 1) { - args.reverse(); - } - if (isAry && ary < length) { - args.length = ary; - } - if (this && this !== root && this instanceof wrapper) { - fn = Ctor || createCtor(fn); - } - return fn.apply(thisBinding, args); - } - return wrapper; - } - - /** - * Creates a function like `_.invertBy`. - * - * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} toIteratee The function to resolve iteratees. - * @returns {Function} Returns the new inverter function. - */ - function createInverter(setter, toIteratee) { - return function(object, iteratee) { - return baseInverter(object, setter, toIteratee(iteratee), {}); - }; - } - - /** - * Creates a function that performs a mathematical operation on two values. - * - * @private - * @param {Function} operator The function to perform the operation. - * @param {number} [defaultValue] The value used for `undefined` arguments. - * @returns {Function} Returns the new mathematical operation function. - */ - function createMathOperation(operator, defaultValue) { - return function(value, other) { - var result; - if (value === undefined && other === undefined) { - return defaultValue; - } - if (value !== undefined) { - result = value; - } - if (other !== undefined) { - if (result === undefined) { - return other; - } - if (typeof value == 'string' || typeof other == 'string') { - value = baseToString(value); - other = baseToString(other); - } else { - value = baseToNumber(value); - other = baseToNumber(other); - } - result = operator(value, other); - } - return result; - }; - } - - /** - * Creates a function like `_.over`. - * - * @private - * @param {Function} arrayFunc The function to iterate over iteratees. - * @returns {Function} Returns the new over function. - */ - function createOver(arrayFunc) { - return flatRest(function(iteratees) { - iteratees = arrayMap(iteratees, baseUnary(getIteratee())); - return baseRest(function(args) { - var thisArg = this; - return arrayFunc(iteratees, function(iteratee) { - return apply(iteratee, thisArg, args); - }); - }); - }); - } - - /** - * Creates the padding for `string` based on `length`. The `chars` string - * is truncated if the number of characters exceeds `length`. - * - * @private - * @param {number} length The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padding for `string`. - */ - function createPadding(length, chars) { - chars = chars === undefined ? ' ' : baseToString(chars); - - var charsLength = chars.length; - if (charsLength < 2) { - return charsLength ? baseRepeat(chars, length) : chars; - } - var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); - return hasUnicode(chars) - ? castSlice(stringToArray(result), 0, length).join('') - : result.slice(0, length); - } - - /** - * Creates a function that wraps `func` to invoke it with the `this` binding - * of `thisArg` and `partials` prepended to the arguments it receives. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} partials The arguments to prepend to those provided to - * the new function. - * @returns {Function} Returns the new wrapped function. - */ - function createPartial(func, bitmask, thisArg, partials) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); - - function wrapper() { - var argsIndex = -1, - argsLength = arguments.length, - leftIndex = -1, - leftLength = partials.length, - args = Array(leftLength + argsLength), - fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - - while (++leftIndex < leftLength) { - args[leftIndex] = partials[leftIndex]; - } - while (argsLength--) { - args[leftIndex++] = arguments[++argsIndex]; - } - return apply(fn, isBind ? thisArg : this, args); - } - return wrapper; - } - - /** - * Creates a `_.range` or `_.rangeRight` function. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new range function. - */ - function createRange(fromRight) { - return function(start, end, step) { - if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { - end = step = undefined; - } - // Ensure the sign of `-0` is preserved. - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); - } - step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); - return baseRange(start, end, step, fromRight); - }; - } - - /** - * Creates a function that performs a relational operation on two values. - * - * @private - * @param {Function} operator The function to perform the operation. - * @returns {Function} Returns the new relational operation function. - */ - function createRelationalOperation(operator) { - return function(value, other) { - if (!(typeof value == 'string' && typeof other == 'string')) { - value = toNumber(value); - other = toNumber(other); - } - return operator(value, other); - }; - } - - /** - * Creates a function that wraps `func` to continue currying. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {Function} wrapFunc The function to create the `func` wrapper. - * @param {*} placeholder The placeholder value. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { - var isCurry = bitmask & WRAP_CURRY_FLAG, - newHolders = isCurry ? holders : undefined, - newHoldersRight = isCurry ? undefined : holders, - newPartials = isCurry ? partials : undefined, - newPartialsRight = isCurry ? undefined : partials; - - bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); - bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); - - if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { - bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); - } - var newData = [ - func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, - newHoldersRight, argPos, ary, arity - ]; - - var result = wrapFunc.apply(undefined, newData); - if (isLaziable(func)) { - setData(result, newData); - } - result.placeholder = placeholder; - return setWrapToString(result, func, bitmask); - } - - /** - * Creates a function like `_.round`. - * - * @private - * @param {string} methodName The name of the `Math` method to use when rounding. - * @returns {Function} Returns the new round function. - */ - function createRound(methodName) { - var func = Math[methodName]; - return function(number, precision) { - number = toNumber(number); - precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); - if (precision && nativeIsFinite(number)) { - // Shift with exponential notation to avoid floating-point issues. - // See [MDN](https://mdn.io/round#Examples) for more details. - var pair = (toString(number) + 'e').split('e'), - value = func(pair[0] + 'e' + (+pair[1] + precision)); - - pair = (toString(value) + 'e').split('e'); - return +(pair[0] + 'e' + (+pair[1] - precision)); - } - return func(number); - }; - } - - /** - * Creates a set object of `values`. - * - * @private - * @param {Array} values The values to add to the set. - * @returns {Object} Returns the new set. - */ - var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { - return new Set(values); - }; - - /** - * Creates a `_.toPairs` or `_.toPairsIn` function. - * - * @private - * @param {Function} keysFunc The function to get the keys of a given object. - * @returns {Function} Returns the new pairs function. - */ - function createToPairs(keysFunc) { - return function(object) { - var tag = getTag(object); - if (tag == mapTag) { - return mapToArray(object); - } - if (tag == setTag) { - return setToPairs(object); - } - return baseToPairs(object, keysFunc(object)); - }; - } - - /** - * Creates a function that either curries or invokes `func` with optional - * `this` binding and partially applied arguments. - * - * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. - * 1 - `_.bind` - * 2 - `_.bindKey` - * 4 - `_.curry` or `_.curryRight` of a bound function - * 8 - `_.curry` - * 16 - `_.curryRight` - * 32 - `_.partial` - * 64 - `_.partialRight` - * 128 - `_.rearg` - * 256 - `_.ary` - * 512 - `_.flip` - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to be partially applied. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { - var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; - if (!isBindKey && typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - var length = partials ? partials.length : 0; - if (!length) { - bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); - partials = holders = undefined; - } - ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); - arity = arity === undefined ? arity : toInteger(arity); - length -= holders ? holders.length : 0; - - if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { - var partialsRight = partials, - holdersRight = holders; - - partials = holders = undefined; - } - var data = isBindKey ? undefined : getData(func); - - var newData = [ - func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, - argPos, ary, arity - ]; - - if (data) { - mergeData(newData, data); - } - func = newData[0]; - bitmask = newData[1]; - thisArg = newData[2]; - partials = newData[3]; - holders = newData[4]; - arity = newData[9] = newData[9] === undefined - ? (isBindKey ? 0 : func.length) - : nativeMax(newData[9] - length, 0); - - if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { - bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); - } - if (!bitmask || bitmask == WRAP_BIND_FLAG) { - var result = createBind(func, bitmask, thisArg); - } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { - result = createCurry(func, bitmask, arity); - } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { - result = createPartial(func, bitmask, thisArg, partials); - } else { - result = createHybrid.apply(undefined, newData); - } - var setter = data ? baseSetData : setData; - return setWrapToString(setter(result, newData), func, bitmask); - } - - /** - * Used by `_.defaults` to customize its `_.assignIn` use to assign properties - * of source objects to the destination object for all destination properties - * that resolve to `undefined`. - * - * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to assign. - * @param {Object} object The parent object of `objValue`. - * @returns {*} Returns the value to assign. - */ - function customDefaultsAssignIn(objValue, srcValue, key, object) { - if (objValue === undefined || - (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { - return srcValue; - } - return objValue; - } - - /** - * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source - * objects into destination objects that are passed thru. - * - * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to merge. - * @param {Object} object The parent object of `objValue`. - * @param {Object} source The parent object of `srcValue`. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - * @returns {*} Returns the value to assign. - */ - function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { - if (isObject(objValue) && isObject(srcValue)) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, objValue); - baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); - stack['delete'](srcValue); - } - return objValue; - } - - /** - * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain - * objects. - * - * @private - * @param {*} value The value to inspect. - * @param {string} key The key of the property to inspect. - * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. - */ - function customOmitClone(value) { - return isPlainObject(value) ? undefined : value; - } - - /** - * A specialized version of `baseIsEqualDeep` for arrays with support for - * partial deep comparisons. - * - * @private - * @param {Array} array The array to compare. - * @param {Array} other The other array to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `array` and `other` objects. - * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. - */ - function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - arrLength = array.length, - othLength = other.length; - - if (arrLength != othLength && !(isPartial && othLength > arrLength)) { - return false; - } - // Check that cyclic values are equal. - var arrStacked = stack.get(array); - var othStacked = stack.get(other); - if (arrStacked && othStacked) { - return arrStacked == other && othStacked == array; - } - var index = -1, - result = true, - seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; - - stack.set(array, other); - stack.set(other, array); - - // Ignore non-index properties. - while (++index < arrLength) { - var arrValue = array[index], - othValue = other[index]; - - if (customizer) { - var compared = isPartial - ? customizer(othValue, arrValue, index, other, array, stack) - : customizer(arrValue, othValue, index, array, other, stack); - } - if (compared !== undefined) { - if (compared) { - continue; - } - result = false; - break; - } - // Recursively compare arrays (susceptible to call stack limits). - if (seen) { - if (!arraySome(other, function(othValue, othIndex) { - if (!cacheHas(seen, othIndex) && - (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { - return seen.push(othIndex); - } - })) { - result = false; - break; - } - } else if (!( - arrValue === othValue || - equalFunc(arrValue, othValue, bitmask, customizer, stack) - )) { - result = false; - break; - } - } - stack['delete'](array); - stack['delete'](other); - return result; - } - - /** - * A specialized version of `baseIsEqualDeep` for comparing objects of - * the same `toStringTag`. - * - * **Note:** This function only supports comparing values with tags of - * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {string} tag The `toStringTag` of the objects to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { - switch (tag) { - case dataViewTag: - if ((object.byteLength != other.byteLength) || - (object.byteOffset != other.byteOffset)) { - return false; - } - object = object.buffer; - other = other.buffer; - - case arrayBufferTag: - if ((object.byteLength != other.byteLength) || - !equalFunc(new Uint8Array(object), new Uint8Array(other))) { - return false; - } - return true; - - case boolTag: - case dateTag: - case numberTag: - // Coerce booleans to `1` or `0` and dates to milliseconds. - // Invalid dates are coerced to `NaN`. - return eq(+object, +other); - - case errorTag: - return object.name == other.name && object.message == other.message; - - case regexpTag: - case stringTag: - // Coerce regexes to strings and treat strings, primitives and objects, - // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring - // for more details. - return object == (other + ''); - - case mapTag: - var convert = mapToArray; - - case setTag: - var isPartial = bitmask & COMPARE_PARTIAL_FLAG; - convert || (convert = setToArray); - - if (object.size != other.size && !isPartial) { - return false; - } - // Assume cyclic values are equal. - var stacked = stack.get(object); - if (stacked) { - return stacked == other; - } - bitmask |= COMPARE_UNORDERED_FLAG; - - // Recursively compare objects (susceptible to call stack limits). - stack.set(object, other); - var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); - stack['delete'](object); - return result; - - case symbolTag: - if (symbolValueOf) { - return symbolValueOf.call(object) == symbolValueOf.call(other); - } - } - return false; - } - - /** - * A specialized version of `baseIsEqualDeep` for objects with support for - * partial deep comparisons. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - objProps = getAllKeys(object), - objLength = objProps.length, - othProps = getAllKeys(other), - othLength = othProps.length; - - if (objLength != othLength && !isPartial) { - return false; - } - var index = objLength; - while (index--) { - var key = objProps[index]; - if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { - return false; - } - } - // Check that cyclic values are equal. - var objStacked = stack.get(object); - var othStacked = stack.get(other); - if (objStacked && othStacked) { - return objStacked == other && othStacked == object; - } - var result = true; - stack.set(object, other); - stack.set(other, object); - - var skipCtor = isPartial; - while (++index < objLength) { - key = objProps[index]; - var objValue = object[key], - othValue = other[key]; - - if (customizer) { - var compared = isPartial - ? customizer(othValue, objValue, key, other, object, stack) - : customizer(objValue, othValue, key, object, other, stack); - } - // Recursively compare objects (susceptible to call stack limits). - if (!(compared === undefined - ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) - : compared - )) { - result = false; - break; - } - skipCtor || (skipCtor = key == 'constructor'); - } - if (result && !skipCtor) { - var objCtor = object.constructor, - othCtor = other.constructor; - - // Non `Object` object instances with different constructors are not equal. - if (objCtor != othCtor && - ('constructor' in object && 'constructor' in other) && - !(typeof objCtor == 'function' && objCtor instanceof objCtor && - typeof othCtor == 'function' && othCtor instanceof othCtor)) { - result = false; - } - } - stack['delete'](object); - stack['delete'](other); - return result; - } - - /** - * A specialized version of `baseRest` which flattens the rest array. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. - */ - function flatRest(func) { - return setToString(overRest(func, undefined, flatten), func + ''); - } - - /** - * Creates an array of own enumerable property names and symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. - */ - function getAllKeys(object) { - return baseGetAllKeys(object, keys, getSymbols); - } - - /** - * Creates an array of own and inherited enumerable property names and - * symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. - */ - function getAllKeysIn(object) { - return baseGetAllKeys(object, keysIn, getSymbolsIn); - } - - /** - * Gets metadata for `func`. - * - * @private - * @param {Function} func The function to query. - * @returns {*} Returns the metadata for `func`. - */ - var getData = !metaMap ? noop : function(func) { - return metaMap.get(func); - }; - - /** - * Gets the name of `func`. - * - * @private - * @param {Function} func The function to query. - * @returns {string} Returns the function name. - */ - function getFuncName(func) { - var result = (func.name + ''), - array = realNames[result], - length = hasOwnProperty.call(realNames, result) ? array.length : 0; - - while (length--) { - var data = array[length], - otherFunc = data.func; - if (otherFunc == null || otherFunc == func) { - return data.name; - } - } - return result; - } - - /** - * Gets the argument placeholder value for `func`. - * - * @private - * @param {Function} func The function to inspect. - * @returns {*} Returns the placeholder value. - */ - function getHolder(func) { - var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; - return object.placeholder; - } - - /** - * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, - * this function returns the custom method, otherwise it returns `baseIteratee`. - * If arguments are provided, the chosen function is invoked with them and - * its result is returned. - * - * @private - * @param {*} [value] The value to convert to an iteratee. - * @param {number} [arity] The arity of the created iteratee. - * @returns {Function} Returns the chosen function or its result. - */ - function getIteratee() { - var result = lodash.iteratee || iteratee; - result = result === iteratee ? baseIteratee : result; - return arguments.length ? result(arguments[0], arguments[1]) : result; - } - - /** - * Gets the data for `map`. - * - * @private - * @param {Object} map The map to query. - * @param {string} key The reference key. - * @returns {*} Returns the map data. - */ - function getMapData(map, key) { - var data = map.__data__; - return isKeyable(key) - ? data[typeof key == 'string' ? 'string' : 'hash'] - : data.map; - } - - /** - * Gets the property names, values, and compare flags of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the match data of `object`. - */ - function getMatchData(object) { - var result = keys(object), - length = result.length; - - while (length--) { - var key = result[length], - value = object[key]; - - result[length] = [key, value, isStrictComparable(value)]; - } - return result; - } - - /** - * Gets the native function at `key` of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {string} key The key of the method to get. - * @returns {*} Returns the function if it's native, else `undefined`. - */ - function getNative(object, key) { - var value = getValue(object, key); - return baseIsNative(value) ? value : undefined; - } - - /** - * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the raw `toStringTag`. - */ - function getRawTag(value) { - var isOwn = hasOwnProperty.call(value, symToStringTag), - tag = value[symToStringTag]; - - try { - value[symToStringTag] = undefined; - var unmasked = true; - } catch (e) {} - - var result = nativeObjectToString.call(value); - if (unmasked) { - if (isOwn) { - value[symToStringTag] = tag; - } else { - delete value[symToStringTag]; - } - } - return result; - } - - /** - * Creates an array of the own enumerable symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. - */ - var getSymbols = !nativeGetSymbols ? stubArray : function(object) { - if (object == null) { - return []; - } - object = Object(object); - return arrayFilter(nativeGetSymbols(object), function(symbol) { - return propertyIsEnumerable.call(object, symbol); - }); - }; - - /** - * Creates an array of the own and inherited enumerable symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. - */ - var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { - var result = []; - while (object) { - arrayPush(result, getSymbols(object)); - object = getPrototype(object); - } - return result; - }; - - /** - * Gets the `toStringTag` of `value`. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. - */ - var getTag = baseGetTag; - - // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. - if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || - (Map && getTag(new Map) != mapTag) || - (Promise && getTag(Promise.resolve()) != promiseTag) || - (Set && getTag(new Set) != setTag) || - (WeakMap && getTag(new WeakMap) != weakMapTag)) { - getTag = function(value) { - var result = baseGetTag(value), - Ctor = result == objectTag ? value.constructor : undefined, - ctorString = Ctor ? toSource(Ctor) : ''; - - if (ctorString) { - switch (ctorString) { - case dataViewCtorString: return dataViewTag; - case mapCtorString: return mapTag; - case promiseCtorString: return promiseTag; - case setCtorString: return setTag; - case weakMapCtorString: return weakMapTag; - } - } - return result; - }; - } - - /** - * Gets the view, applying any `transforms` to the `start` and `end` positions. - * - * @private - * @param {number} start The start of the view. - * @param {number} end The end of the view. - * @param {Array} transforms The transformations to apply to the view. - * @returns {Object} Returns an object containing the `start` and `end` - * positions of the view. - */ - function getView(start, end, transforms) { - var index = -1, - length = transforms.length; - - while (++index < length) { - var data = transforms[index], - size = data.size; - - switch (data.type) { - case 'drop': start += size; break; - case 'dropRight': end -= size; break; - case 'take': end = nativeMin(end, start + size); break; - case 'takeRight': start = nativeMax(start, end - size); break; - } - } - return { 'start': start, 'end': end }; - } - - /** - * Extracts wrapper details from the `source` body comment. - * - * @private - * @param {string} source The source to inspect. - * @returns {Array} Returns the wrapper details. - */ - function getWrapDetails(source) { - var match = source.match(reWrapDetails); - return match ? match[1].split(reSplitDetails) : []; - } - - /** - * Checks if `path` exists on `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @param {Function} hasFunc The function to check properties. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - */ - function hasPath(object, path, hasFunc) { - path = castPath(path, object); - - var index = -1, - length = path.length, - result = false; - - while (++index < length) { - var key = toKey(path[index]); - if (!(result = object != null && hasFunc(object, key))) { - break; - } - object = object[key]; - } - if (result || ++index != length) { - return result; - } - length = object == null ? 0 : object.length; - return !!length && isLength(length) && isIndex(key, length) && - (isArray(object) || isArguments(object)); - } - - /** - * Initializes an array clone. - * - * @private - * @param {Array} array The array to clone. - * @returns {Array} Returns the initialized clone. - */ - function initCloneArray(array) { - var length = array.length, - result = new array.constructor(length); - - // Add properties assigned by `RegExp#exec`. - if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { - result.index = array.index; - result.input = array.input; - } - return result; - } - - /** - * Initializes an object clone. - * - * @private - * @param {Object} object The object to clone. - * @returns {Object} Returns the initialized clone. - */ - function initCloneObject(object) { - return (typeof object.constructor == 'function' && !isPrototype(object)) - ? baseCreate(getPrototype(object)) - : {}; - } - - /** - * Initializes an object clone based on its `toStringTag`. - * - * **Note:** This function only supports cloning values with tags of - * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`. - * - * @private - * @param {Object} object The object to clone. - * @param {string} tag The `toStringTag` of the object to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the initialized clone. - */ - function initCloneByTag(object, tag, isDeep) { - var Ctor = object.constructor; - switch (tag) { - case arrayBufferTag: - return cloneArrayBuffer(object); - - case boolTag: - case dateTag: - return new Ctor(+object); - - case dataViewTag: - return cloneDataView(object, isDeep); - - case float32Tag: case float64Tag: - case int8Tag: case int16Tag: case int32Tag: - case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: - return cloneTypedArray(object, isDeep); - - case mapTag: - return new Ctor; - - case numberTag: - case stringTag: - return new Ctor(object); - - case regexpTag: - return cloneRegExp(object); - - case setTag: - return new Ctor; - - case symbolTag: - return cloneSymbol(object); - } - } - - /** - * Inserts wrapper `details` in a comment at the top of the `source` body. - * - * @private - * @param {string} source The source to modify. - * @returns {Array} details The details to insert. - * @returns {string} Returns the modified source. - */ - function insertWrapDetails(source, details) { - var length = details.length; - if (!length) { - return source; - } - var lastIndex = length - 1; - details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; - details = details.join(length > 2 ? ', ' : ' '); - return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); - } - - /** - * Checks if `value` is a flattenable `arguments` object or array. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. - */ - function isFlattenable(value) { - return isArray(value) || isArguments(value) || - !!(spreadableSymbol && value && value[spreadableSymbol]); - } - - /** - * Checks if `value` is a valid array-like index. - * - * @private - * @param {*} value The value to check. - * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. - * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. - */ - function isIndex(value, length) { - var type = typeof value; - length = length == null ? MAX_SAFE_INTEGER : length; - - return !!length && - (type == 'number' || - (type != 'symbol' && reIsUint.test(value))) && - (value > -1 && value % 1 == 0 && value < length); - } - - /** - * Checks if the given arguments are from an iteratee call. - * - * @private - * @param {*} value The potential iteratee value argument. - * @param {*} index The potential iteratee index or key argument. - * @param {*} object The potential iteratee object argument. - * @returns {boolean} Returns `true` if the arguments are from an iteratee call, - * else `false`. - */ - function isIterateeCall(value, index, object) { - if (!isObject(object)) { - return false; - } - var type = typeof index; - if (type == 'number' - ? (isArrayLike(object) && isIndex(index, object.length)) - : (type == 'string' && index in object) - ) { - return eq(object[index], value); - } - return false; - } - - /** - * Checks if `value` is a property name and not a property path. - * - * @private - * @param {*} value The value to check. - * @param {Object} [object] The object to query keys on. - * @returns {boolean} Returns `true` if `value` is a property name, else `false`. - */ - function isKey(value, object) { - if (isArray(value)) { - return false; - } - var type = typeof value; - if (type == 'number' || type == 'symbol' || type == 'boolean' || - value == null || isSymbol(value)) { - return true; - } - return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || - (object != null && value in Object(object)); - } - - /** - * Checks if `value` is suitable for use as unique object key. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is suitable, else `false`. - */ - function isKeyable(value) { - var type = typeof value; - return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') - ? (value !== '__proto__') - : (value === null); - } - - /** - * Checks if `func` has a lazy counterpart. - * - * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` has a lazy counterpart, - * else `false`. - */ - function isLaziable(func) { - var funcName = getFuncName(func), - other = lodash[funcName]; - - if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { - return false; - } - if (func === other) { - return true; - } - var data = getData(other); - return !!data && func === data[0]; - } - - /** - * Checks if `func` has its source masked. - * - * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` is masked, else `false`. - */ - function isMasked(func) { - return !!maskSrcKey && (maskSrcKey in func); - } - - /** - * Checks if `func` is capable of being masked. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `func` is maskable, else `false`. - */ - var isMaskable = coreJsData ? isFunction : stubFalse; - - /** - * Checks if `value` is likely a prototype object. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. - */ - function isPrototype(value) { - var Ctor = value && value.constructor, - proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; - - return value === proto; - } - - /** - * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` if suitable for strict - * equality comparisons, else `false`. - */ - function isStrictComparable(value) { - return value === value && !isObject(value); - } - - /** - * A specialized version of `matchesProperty` for source values suitable - * for strict equality comparisons, i.e. `===`. - * - * @private - * @param {string} key The key of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. - */ - function matchesStrictComparable(key, srcValue) { - return function(object) { - if (object == null) { - return false; - } - return object[key] === srcValue && - (srcValue !== undefined || (key in Object(object))); - }; - } - - /** - * A specialized version of `_.memoize` which clears the memoized function's - * cache when it exceeds `MAX_MEMOIZE_SIZE`. - * - * @private - * @param {Function} func The function to have its output memoized. - * @returns {Function} Returns the new memoized function. - */ - function memoizeCapped(func) { - var result = memoize(func, function(key) { - if (cache.size === MAX_MEMOIZE_SIZE) { - cache.clear(); - } - return key; - }); - - var cache = result.cache; - return result; - } - - /** - * Merges the function metadata of `source` into `data`. - * - * Merging metadata reduces the number of wrappers used to invoke a function. - * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` - * may be applied regardless of execution order. Methods like `_.ary` and - * `_.rearg` modify function arguments, making the order in which they are - * executed important, preventing the merging of metadata. However, we make - * an exception for a safe combined case where curried functions have `_.ary` - * and or `_.rearg` applied. - * - * @private - * @param {Array} data The destination metadata. - * @param {Array} source The source metadata. - * @returns {Array} Returns `data`. - */ - function mergeData(data, source) { - var bitmask = data[1], - srcBitmask = source[1], - newBitmask = bitmask | srcBitmask, - isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); - - var isCombo = - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || - ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); - - // Exit early if metadata can't be merged. - if (!(isCommon || isCombo)) { - return data; - } - // Use source `thisArg` if available. - if (srcBitmask & WRAP_BIND_FLAG) { - data[2] = source[2]; - // Set when currying a bound function. - newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; - } - // Compose partial arguments. - var value = source[3]; - if (value) { - var partials = data[3]; - data[3] = partials ? composeArgs(partials, value, source[4]) : value; - data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; - } - // Compose partial right arguments. - value = source[5]; - if (value) { - partials = data[5]; - data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; - data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; - } - // Use source `argPos` if available. - value = source[7]; - if (value) { - data[7] = value; - } - // Use source `ary` if it's smaller. - if (srcBitmask & WRAP_ARY_FLAG) { - data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); - } - // Use source `arity` if one is not provided. - if (data[9] == null) { - data[9] = source[9]; - } - // Use source `func` and merge bitmasks. - data[0] = source[0]; - data[1] = newBitmask; - - return data; - } - - /** - * This function is like - * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * except that it includes inherited enumerable properties. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function nativeKeysIn(object) { - var result = []; - if (object != null) { - for (var key in Object(object)) { - result.push(key); - } - } - return result; - } - - /** - * Converts `value` to a string using `Object.prototype.toString`. - * - * @private - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. - */ - function objectToString(value) { - return nativeObjectToString.call(value); - } - - /** - * A specialized version of `baseRest` which transforms the rest array. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @param {Function} transform The rest array transform. - * @returns {Function} Returns the new function. - */ - function overRest(func, start, transform) { - start = nativeMax(start === undefined ? (func.length - 1) : start, 0); - return function() { - var args = arguments, - index = -1, - length = nativeMax(args.length - start, 0), - array = Array(length); - - while (++index < length) { - array[index] = args[start + index]; - } - index = -1; - var otherArgs = Array(start + 1); - while (++index < start) { - otherArgs[index] = args[index]; - } - otherArgs[start] = transform(array); - return apply(func, this, otherArgs); - }; - } - - /** - * Gets the parent value at `path` of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} path The path to get the parent value of. - * @returns {*} Returns the parent value. - */ - function parent(object, path) { - return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); - } - - /** - * Reorder `array` according to the specified indexes where the element at - * the first index is assigned as the first element, the element at - * the second index is assigned as the second element, and so on. - * - * @private - * @param {Array} array The array to reorder. - * @param {Array} indexes The arranged array indexes. - * @returns {Array} Returns `array`. - */ - function reorder(array, indexes) { - var arrLength = array.length, - length = nativeMin(indexes.length, arrLength), - oldArray = copyArray(array); - - while (length--) { - var index = indexes[length]; - array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; - } - return array; - } - - /** - * Gets the value at `key`, unless `key` is "__proto__" or "constructor". - * - * @private - * @param {Object} object The object to query. - * @param {string} key The key of the property to get. - * @returns {*} Returns the property value. - */ - function safeGet(object, key) { - if (key === 'constructor' && typeof object[key] === 'function') { - return; - } - - if (key == '__proto__') { - return; - } - - return object[key]; - } - - /** - * Sets metadata for `func`. - * - * **Note:** If this function becomes hot, i.e. is invoked a lot in a short - * period of time, it will trip its breaker and transition to an identity - * function to avoid garbage collection pauses in V8. See - * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) - * for more details. - * - * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. - */ - var setData = shortOut(baseSetData); - - /** - * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). - * - * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @returns {number|Object} Returns the timer id or timeout object. - */ - var setTimeout = ctxSetTimeout || function(func, wait) { - return root.setTimeout(func, wait); - }; - - /** - * Sets the `toString` method of `func` to return `string`. - * - * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. - */ - var setToString = shortOut(baseSetToString); - - /** - * Sets the `toString` method of `wrapper` to mimic the source of `reference` - * with wrapper details in a comment at the top of the source body. - * - * @private - * @param {Function} wrapper The function to modify. - * @param {Function} reference The reference function. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Function} Returns `wrapper`. - */ - function setWrapToString(wrapper, reference, bitmask) { - var source = (reference + ''); - return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); - } - - /** - * Creates a function that'll short out and invoke `identity` instead - * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` - * milliseconds. - * - * @private - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new shortable function. - */ - function shortOut(func) { - var count = 0, - lastCalled = 0; - - return function() { - var stamp = nativeNow(), - remaining = HOT_SPAN - (stamp - lastCalled); - - lastCalled = stamp; - if (remaining > 0) { - if (++count >= HOT_COUNT) { - return arguments[0]; - } - } else { - count = 0; - } - return func.apply(undefined, arguments); - }; - } - - /** - * A specialized version of `_.shuffle` which mutates and sets the size of `array`. - * - * @private - * @param {Array} array The array to shuffle. - * @param {number} [size=array.length] The size of `array`. - * @returns {Array} Returns `array`. - */ - function shuffleSelf(array, size) { - var index = -1, - length = array.length, - lastIndex = length - 1; - - size = size === undefined ? length : size; - while (++index < size) { - var rand = baseRandom(index, lastIndex), - value = array[rand]; - - array[rand] = array[index]; - array[index] = value; - } - array.length = size; - return array; - } - - /** - * Converts `string` to a property path array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the property path array. - */ - var stringToPath = memoizeCapped(function(string) { - var result = []; - if (string.charCodeAt(0) === 46 /* . */) { - result.push(''); - } - string.replace(rePropName, function(match, number, quote, subString) { - result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match)); - }); - return result; - }); - - /** - * Converts `value` to a string key if it's not a string or symbol. - * - * @private - * @param {*} value The value to inspect. - * @returns {string|symbol} Returns the key. - */ - function toKey(value) { - if (typeof value == 'string' || isSymbol(value)) { - return value; - } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; - } - - /** - * Converts `func` to its source code. - * - * @private - * @param {Function} func The function to convert. - * @returns {string} Returns the source code. - */ - function toSource(func) { - if (func != null) { - try { - return funcToString.call(func); - } catch (e) {} - try { - return (func + ''); - } catch (e) {} - } - return ''; - } - - /** - * Updates wrapper `details` based on `bitmask` flags. - * - * @private - * @returns {Array} details The details to modify. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Array} Returns `details`. - */ - function updateWrapDetails(details, bitmask) { - arrayEach(wrapFlags, function(pair) { - var value = '_.' + pair[0]; - if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { - details.push(value); - } - }); - return details.sort(); - } - - /** - * Creates a clone of `wrapper`. - * - * @private - * @param {Object} wrapper The wrapper to clone. - * @returns {Object} Returns the cloned wrapper. - */ - function wrapperClone(wrapper) { - if (wrapper instanceof LazyWrapper) { - return wrapper.clone(); - } - var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); - result.__actions__ = copyArray(wrapper.__actions__); - result.__index__ = wrapper.__index__; - result.__values__ = wrapper.__values__; - return result; - } - - /*------------------------------------------------------------------------*/ - - /** - * Creates an array of elements split into groups the length of `size`. - * If `array` can't be split evenly, the final chunk will be the remaining - * elements. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to process. - * @param {number} [size=1] The length of each chunk - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the new array of chunks. - * @example - * - * _.chunk(['a', 'b', 'c', 'd'], 2); - * // => [['a', 'b'], ['c', 'd']] - * - * _.chunk(['a', 'b', 'c', 'd'], 3); - * // => [['a', 'b', 'c'], ['d']] - */ - function chunk(array, size, guard) { - if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { - size = 1; - } else { - size = nativeMax(toInteger(size), 0); - } - var length = array == null ? 0 : array.length; - if (!length || size < 1) { - return []; - } - var index = 0, - resIndex = 0, - result = Array(nativeCeil(length / size)); - - while (index < length) { - result[resIndex++] = baseSlice(array, index, (index += size)); - } - return result; - } - - /** - * Creates an array with all falsey values removed. The values `false`, `null`, - * `0`, `""`, `undefined`, and `NaN` are falsey. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to compact. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.compact([0, 1, false, 2, '', 3]); - * // => [1, 2, 3] - */ - function compact(array) { - var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index]; - if (value) { - result[resIndex++] = value; - } - } - return result; - } - - /** - * Creates a new array concatenating `array` with any additional arrays - * and/or values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to concatenate. - * @param {...*} [values] The values to concatenate. - * @returns {Array} Returns the new concatenated array. - * @example - * - * var array = [1]; - * var other = _.concat(array, 2, [3], [[4]]); - * - * console.log(other); - * // => [1, 2, 3, [4]] - * - * console.log(array); - * // => [1] - */ - function concat() { - var length = arguments.length; - if (!length) { - return []; - } - var args = Array(length - 1), - array = arguments[0], - index = length; - - while (index--) { - args[index - 1] = arguments[index]; - } - return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); - } - - /** - * Creates an array of `array` values not included in the other given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * **Note:** Unlike `_.pullAll`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.without, _.xor - * @example - * - * _.difference([2, 1], [2, 3]); - * // => [1] - */ - var difference = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) - : []; - }); - - /** - * This method is like `_.difference` except that it accepts `iteratee` which - * is invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * **Note:** Unlike `_.pullAllBy`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2] - * - * // The `_.property` iteratee shorthand. - * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] - */ - var differenceBy = baseRest(function(array, values) { - var iteratee = last(values); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) - : []; - }); - - /** - * This method is like `_.difference` except that it accepts `comparator` - * which is invoked to compare elements of `array` to `values`. The order and - * references of result values are determined by the first array. The comparator - * is invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.pullAllWith`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * - * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); - * // => [{ 'x': 2, 'y': 1 }] - */ - var differenceWith = baseRest(function(array, values) { - var comparator = last(values); - if (isArrayLikeObject(comparator)) { - comparator = undefined; - } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) - : []; - }); - - /** - * Creates a slice of `array` with `n` elements dropped from the beginning. - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.drop([1, 2, 3]); - * // => [2, 3] - * - * _.drop([1, 2, 3], 2); - * // => [3] - * - * _.drop([1, 2, 3], 5); - * // => [] - * - * _.drop([1, 2, 3], 0); - * // => [1, 2, 3] - */ - function drop(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, n < 0 ? 0 : n, length); - } - - /** - * Creates a slice of `array` with `n` elements dropped from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.dropRight([1, 2, 3]); - * // => [1, 2] - * - * _.dropRight([1, 2, 3], 2); - * // => [1] - * - * _.dropRight([1, 2, 3], 5); - * // => [] - * - * _.dropRight([1, 2, 3], 0); - * // => [1, 2, 3] - */ - function dropRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, 0, n < 0 ? 0 : n); - } - - /** - * Creates a slice of `array` excluding elements dropped from the end. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.dropRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney'] - * - * // The `_.matches` iteratee shorthand. - * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['barney', 'fred'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropRightWhile(users, ['active', false]); - * // => objects for ['barney'] - * - * // The `_.property` iteratee shorthand. - * _.dropRightWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] - */ - function dropRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true, true) - : []; - } - - /** - * Creates a slice of `array` excluding elements dropped from the beginning. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.dropWhile(users, function(o) { return !o.active; }); - * // => objects for ['pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.dropWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropWhile(users, ['active', false]); - * // => objects for ['pebbles'] - * - * // The `_.property` iteratee shorthand. - * _.dropWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] - */ - function dropWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true) - : []; - } - - /** - * Fills elements of `array` with `value` from `start` up to, but not - * including, `end`. - * - * **Note:** This method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.2.0 - * @category Array - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.fill(array, 'a'); - * console.log(array); - * // => ['a', 'a', 'a'] - * - * _.fill(Array(3), 2); - * // => [2, 2, 2] - * - * _.fill([4, 6, 8, 10], '*', 1, 3); - * // => [4, '*', '*', 10] - */ - function fill(array, value, start, end) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { - start = 0; - end = length; - } - return baseFill(array, value, start, end); - } - - /** - * This method is like `_.find` except that it returns the index of the first - * element `predicate` returns truthy for instead of the element itself. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.findIndex(users, function(o) { return o.user == 'barney'; }); - * // => 0 - * - * // The `_.matches` iteratee shorthand. - * _.findIndex(users, { 'user': 'fred', 'active': false }); - * // => 1 - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findIndex(users, ['active', false]); - * // => 0 - * - * // The `_.property` iteratee shorthand. - * _.findIndex(users, 'active'); - * // => 2 - */ - function findIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); - } - return baseFindIndex(array, getIteratee(predicate, 3), index); - } - - /** - * This method is like `_.findIndex` except that it iterates over elements - * of `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=array.length-1] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); - * // => 2 - * - * // The `_.matches` iteratee shorthand. - * _.findLastIndex(users, { 'user': 'barney', 'active': true }); - * // => 0 - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastIndex(users, ['active', false]); - * // => 2 - * - * // The `_.property` iteratee shorthand. - * _.findLastIndex(users, 'active'); - * // => 0 - */ - function findLastIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length - 1; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = fromIndex < 0 - ? nativeMax(length + index, 0) - : nativeMin(index, length - 1); - } - return baseFindIndex(array, getIteratee(predicate, 3), index, true); - } - - /** - * Flattens `array` a single level deep. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example - * - * _.flatten([1, [2, [3, [4]], 5]]); - * // => [1, 2, [3, [4]], 5] - */ - function flatten(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, 1) : []; - } - - /** - * Recursively flattens `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example - * - * _.flattenDeep([1, [2, [3, [4]], 5]]); - * // => [1, 2, 3, 4, 5] - */ - function flattenDeep(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, INFINITY) : []; - } - - /** - * Recursively flatten `array` up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.4.0 - * @category Array - * @param {Array} array The array to flatten. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * var array = [1, [2, [3, [4]], 5]]; - * - * _.flattenDepth(array, 1); - * // => [1, 2, [3, [4]], 5] - * - * _.flattenDepth(array, 2); - * // => [1, 2, 3, [4], 5] - */ - function flattenDepth(array, depth) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(array, depth); - } - - /** - * The inverse of `_.toPairs`; this method returns an object composed - * from key-value `pairs`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} pairs The key-value pairs. - * @returns {Object} Returns the new object. - * @example - * - * _.fromPairs([['a', 1], ['b', 2]]); - * // => { 'a': 1, 'b': 2 } - */ - function fromPairs(pairs) { - var index = -1, - length = pairs == null ? 0 : pairs.length, - result = {}; - - while (++index < length) { - var pair = pairs[index]; - result[pair[0]] = pair[1]; - } - return result; - } - - /** - * Gets the first element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias first - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the first element of `array`. - * @example - * - * _.head([1, 2, 3]); - * // => 1 - * - * _.head([]); - * // => undefined - */ - function head(array) { - return (array && array.length) ? array[0] : undefined; - } - - /** - * Gets the index at which the first occurrence of `value` is found in `array` - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. If `fromIndex` is negative, it's used as the - * offset from the end of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.indexOf([1, 2, 1, 2], 2); - * // => 1 - * - * // Search from the `fromIndex`. - * _.indexOf([1, 2, 1, 2], 2, 2); - * // => 3 - */ - function indexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); - } - return baseIndexOf(array, value, index); - } - - /** - * Gets all but the last element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.initial([1, 2, 3]); - * // => [1, 2] - */ - function initial(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 0, -1) : []; - } - - /** - * Creates an array of unique values that are included in all given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * _.intersection([2, 1], [2, 3]); - * // => [2] - */ - var intersection = baseRest(function(arrays) { - var mapped = arrayMap(arrays, castArrayLikeObject); - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped) - : []; - }); - - /** - * This method is like `_.intersection` except that it accepts `iteratee` - * which is invoked for each element of each `arrays` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [2.1] - * - * // The `_.property` iteratee shorthand. - * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }] - */ - var intersectionBy = baseRest(function(arrays) { - var iteratee = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); - - if (iteratee === last(mapped)) { - iteratee = undefined; - } else { - mapped.pop(); - } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, getIteratee(iteratee, 2)) - : []; - }); - - /** - * This method is like `_.intersection` except that it accepts `comparator` - * which is invoked to compare elements of `arrays`. The order and references - * of result values are determined by the first array. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.intersectionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }] - */ - var intersectionWith = baseRest(function(arrays) { - var comparator = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); - - comparator = typeof comparator == 'function' ? comparator : undefined; - if (comparator) { - mapped.pop(); - } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, undefined, comparator) - : []; - }); - - /** - * Converts all elements in `array` into a string separated by `separator`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to convert. - * @param {string} [separator=','] The element separator. - * @returns {string} Returns the joined string. - * @example - * - * _.join(['a', 'b', 'c'], '~'); - * // => 'a~b~c' - */ - function join(array, separator) { - return array == null ? '' : nativeJoin.call(array, separator); - } - - /** - * Gets the last element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the last element of `array`. - * @example - * - * _.last([1, 2, 3]); - * // => 3 - */ - function last(array) { - var length = array == null ? 0 : array.length; - return length ? array[length - 1] : undefined; - } - - /** - * This method is like `_.indexOf` except that it iterates over elements of - * `array` from right to left. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=array.length-1] The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.lastIndexOf([1, 2, 1, 2], 2); - * // => 3 - * - * // Search from the `fromIndex`. - * _.lastIndexOf([1, 2, 1, 2], 2, 2); - * // => 1 - */ - function lastIndexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); - } - return value === value - ? strictLastIndexOf(array, value, index) - : baseFindIndex(array, baseIsNaN, index, true); - } - - /** - * Gets the element at index `n` of `array`. If `n` is negative, the nth - * element from the end is returned. - * - * @static - * @memberOf _ - * @since 4.11.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=0] The index of the element to return. - * @returns {*} Returns the nth element of `array`. - * @example - * - * var array = ['a', 'b', 'c', 'd']; - * - * _.nth(array, 1); - * // => 'b' - * - * _.nth(array, -2); - * // => 'c'; - */ - function nth(array, n) { - return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; - } - - /** - * Removes all given values from `array` using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` - * to remove elements from an array by predicate. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...*} [values] The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; - * - * _.pull(array, 'a', 'c'); - * console.log(array); - * // => ['b', 'b'] - */ - var pull = baseRest(pullAll); - - /** - * This method is like `_.pull` except that it accepts an array of values to remove. - * - * **Note:** Unlike `_.difference`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; - * - * _.pullAll(array, ['a', 'c']); - * console.log(array); - * // => ['b', 'b'] - */ - function pullAll(array, values) { - return (array && array.length && values && values.length) - ? basePullAll(array, values) - : array; - } - - /** - * This method is like `_.pullAll` except that it accepts `iteratee` which is - * invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The iteratee is invoked with one argument: (value). - * - * **Note:** Unlike `_.differenceBy`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; - * - * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); - * console.log(array); - * // => [{ 'x': 2 }] - */ - function pullAllBy(array, values, iteratee) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, getIteratee(iteratee, 2)) - : array; - } - - /** - * This method is like `_.pullAll` except that it accepts `comparator` which - * is invoked to compare elements of `array` to `values`. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.differenceWith`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; - * - * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); - * console.log(array); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] - */ - function pullAllWith(array, values, comparator) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, undefined, comparator) - : array; - } - - /** - * Removes elements from `array` corresponding to `indexes` and returns an - * array of removed elements. - * - * **Note:** Unlike `_.at`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...(number|number[])} [indexes] The indexes of elements to remove. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = ['a', 'b', 'c', 'd']; - * var pulled = _.pullAt(array, [1, 3]); - * - * console.log(array); - * // => ['a', 'c'] - * - * console.log(pulled); - * // => ['b', 'd'] - */ - var pullAt = flatRest(function(array, indexes) { - var length = array == null ? 0 : array.length, - result = baseAt(array, indexes); - - basePullAt(array, arrayMap(indexes, function(index) { - return isIndex(index, length) ? +index : index; - }).sort(compareAscending)); - - return result; - }); - - /** - * Removes all elements from `array` that `predicate` returns truthy for - * and returns an array of the removed elements. The predicate is invoked - * with three arguments: (value, index, array). - * - * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` - * to pull elements from an array by value. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = [1, 2, 3, 4]; - * var evens = _.remove(array, function(n) { - * return n % 2 == 0; - * }); - * - * console.log(array); - * // => [1, 3] - * - * console.log(evens); - * // => [2, 4] - */ - function remove(array, predicate) { - var result = []; - if (!(array && array.length)) { - return result; - } - var index = -1, - indexes = [], - length = array.length; - - predicate = getIteratee(predicate, 3); - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result.push(value); - indexes.push(index); - } - } - basePullAt(array, indexes); - return result; - } - - /** - * Reverses `array` so that the first element becomes the last, the second - * element becomes the second to last, and so on. - * - * **Note:** This method mutates `array` and is based on - * [`Array#reverse`](https://mdn.io/Array/reverse). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.reverse(array); - * // => [3, 2, 1] - * - * console.log(array); - * // => [3, 2, 1] - */ - function reverse(array) { - return array == null ? array : nativeReverse.call(array); - } - - /** - * Creates a slice of `array` from `start` up to, but not including, `end`. - * - * **Note:** This method is used instead of - * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are - * returned. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. - */ - function slice(array, start, end) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { - start = 0; - end = length; - } - else { - start = start == null ? 0 : toInteger(start); - end = end === undefined ? length : toInteger(end); - } - return baseSlice(array, start, end); - } - - /** - * Uses a binary search to determine the lowest index at which `value` - * should be inserted into `array` in order to maintain its sort order. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * _.sortedIndex([30, 50], 40); - * // => 1 - */ - function sortedIndex(array, value) { - return baseSortedIndex(array, value); - } - - /** - * This method is like `_.sortedIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; - * - * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 0 - * - * // The `_.property` iteratee shorthand. - * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); - * // => 0 - */ - function sortedIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); - } - - /** - * This method is like `_.indexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.sortedIndexOf([4, 5, 5, 5, 6], 5); - * // => 1 - */ - function sortedIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value); - if (index < length && eq(array[index], value)) { - return index; - } - } - return -1; - } - - /** - * This method is like `_.sortedIndex` except that it returns the highest - * index at which `value` should be inserted into `array` in order to - * maintain its sort order. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * _.sortedLastIndex([4, 5, 5, 5, 6], 5); - * // => 4 - */ - function sortedLastIndex(array, value) { - return baseSortedIndex(array, value, true); - } - - /** - * This method is like `_.sortedLastIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; - * - * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 1 - * - * // The `_.property` iteratee shorthand. - * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); - * // => 1 - */ - function sortedLastIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); - } - - /** - * This method is like `_.lastIndexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); - * // => 3 - */ - function sortedLastIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value, true) - 1; - if (eq(array[index], value)) { - return index; - } - } - return -1; - } - - /** - * This method is like `_.uniq` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.sortedUniq([1, 1, 2]); - * // => [1, 2] - */ - function sortedUniq(array) { - return (array && array.length) - ? baseSortedUniq(array) - : []; - } - - /** - * This method is like `_.uniqBy` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); - * // => [1.1, 2.3] - */ - function sortedUniqBy(array, iteratee) { - return (array && array.length) - ? baseSortedUniq(array, getIteratee(iteratee, 2)) - : []; - } - - /** - * Gets all but the first element of `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to query. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.tail([1, 2, 3]); - * // => [2, 3] - */ - function tail(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 1, length) : []; - } - - /** - * Creates a slice of `array` with `n` elements taken from the beginning. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.take([1, 2, 3]); - * // => [1] - * - * _.take([1, 2, 3], 2); - * // => [1, 2] - * - * _.take([1, 2, 3], 5); - * // => [1, 2, 3] - * - * _.take([1, 2, 3], 0); - * // => [] - */ - function take(array, n, guard) { - if (!(array && array.length)) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, 0, n < 0 ? 0 : n); - } - - /** - * Creates a slice of `array` with `n` elements taken from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.takeRight([1, 2, 3]); - * // => [3] - * - * _.takeRight([1, 2, 3], 2); - * // => [2, 3] - * - * _.takeRight([1, 2, 3], 5); - * // => [1, 2, 3] - * - * _.takeRight([1, 2, 3], 0); - * // => [] - */ - function takeRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, n < 0 ? 0 : n, length); - } - - /** - * Creates a slice of `array` with elements taken from the end. Elements are - * taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.takeRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeRightWhile(users, ['active', false]); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.property` iteratee shorthand. - * _.takeRightWhile(users, 'active'); - * // => [] - */ - function takeRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), false, true) - : []; - } - - /** - * Creates a slice of `array` with elements taken from the beginning. Elements - * are taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.takeWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney', 'fred'] - * - * // The `_.matches` iteratee shorthand. - * _.takeWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeWhile(users, ['active', false]); - * // => objects for ['barney', 'fred'] - * - * // The `_.property` iteratee shorthand. - * _.takeWhile(users, 'active'); - * // => [] - */ - function takeWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3)) - : []; - } - - /** - * Creates an array of unique values, in order, from all given arrays using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of combined values. - * @example - * - * _.union([2], [1, 2]); - * // => [2, 1] - */ - var union = baseRest(function(arrays) { - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); - }); - - /** - * This method is like `_.union` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which uniqueness is computed. Result values are chosen from the first - * array in which the value occurs. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * _.unionBy([2.1], [1.2, 2.3], Math.floor); - * // => [2.1, 1.2] - * - * // The `_.property` iteratee shorthand. - * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] - */ - var unionBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); - }); - - /** - * This method is like `_.union` except that it accepts `comparator` which - * is invoked to compare elements of `arrays`. Result values are chosen from - * the first array in which the value occurs. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.unionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] - */ - var unionWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); - }); - - /** - * Creates a duplicate-free version of an array, using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons, in which only the first occurrence of each element - * is kept. The order of result values is determined by the order they occur - * in the array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.uniq([2, 1, 2]); - * // => [2, 1] - */ - function uniq(array) { - return (array && array.length) ? baseUniq(array) : []; - } - - /** - * This method is like `_.uniq` except that it accepts `iteratee` which is - * invoked for each element in `array` to generate the criterion by which - * uniqueness is computed. The order of result values is determined by the - * order they occur in the array. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.uniqBy([2.1, 1.2, 2.3], Math.floor); - * // => [2.1, 1.2] - * - * // The `_.property` iteratee shorthand. - * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] - */ - function uniqBy(array, iteratee) { - return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; - } - - /** - * This method is like `_.uniq` except that it accepts `comparator` which - * is invoked to compare elements of `array`. The order of result values is - * determined by the order they occur in the array.The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.uniqWith(objects, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] - */ - function uniqWith(array, comparator) { - comparator = typeof comparator == 'function' ? comparator : undefined; - return (array && array.length) ? baseUniq(array, undefined, comparator) : []; - } - - /** - * This method is like `_.zip` except that it accepts an array of grouped - * elements and creates an array regrouping the elements to their pre-zip - * configuration. - * - * @static - * @memberOf _ - * @since 1.2.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] - * - * _.unzip(zipped); - * // => [['a', 'b'], [1, 2], [true, false]] - */ - function unzip(array) { - if (!(array && array.length)) { - return []; - } - var length = 0; - array = arrayFilter(array, function(group) { - if (isArrayLikeObject(group)) { - length = nativeMax(group.length, length); - return true; - } - }); - return baseTimes(length, function(index) { - return arrayMap(array, baseProperty(index)); - }); - } - - /** - * This method is like `_.unzip` except that it accepts `iteratee` to specify - * how regrouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @param {Function} [iteratee=_.identity] The function to combine - * regrouped values. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip([1, 2], [10, 20], [100, 200]); - * // => [[1, 10, 100], [2, 20, 200]] - * - * _.unzipWith(zipped, _.add); - * // => [3, 30, 300] - */ - function unzipWith(array, iteratee) { - if (!(array && array.length)) { - return []; - } - var result = unzip(array); - if (iteratee == null) { - return result; - } - return arrayMap(result, function(group) { - return apply(iteratee, undefined, group); - }); - } - - /** - * Creates an array excluding all given values using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.pull`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...*} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.xor - * @example - * - * _.without([2, 1, 2, 3], 1, 2); - * // => [3] - */ - var without = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, values) - : []; - }); - - /** - * Creates an array of unique values that is the - * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) - * of the given arrays. The order of result values is determined by the order - * they occur in the arrays. - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.without - * @example - * - * _.xor([2, 1], [2, 3]); - * // => [1, 3] - */ - var xor = baseRest(function(arrays) { - return baseXor(arrayFilter(arrays, isArrayLikeObject)); - }); - - /** - * This method is like `_.xor` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which by which they're compared. The order of result values is determined - * by the order they occur in the arrays. The iteratee is invoked with one - * argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2, 3.4] - * - * // The `_.property` iteratee shorthand. - * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] - */ - var xorBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); - }); - - /** - * This method is like `_.xor` except that it accepts `comparator` which is - * invoked to compare elements of `arrays`. The order of result values is - * determined by the order they occur in the arrays. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.xorWith(objects, others, _.isEqual); - * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] - */ - var xorWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); - }); - - /** - * Creates an array of grouped elements, the first of which contains the - * first elements of the given arrays, the second of which contains the - * second elements of the given arrays, and so on. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @returns {Array} Returns the new array of grouped elements. - * @example - * - * _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] - */ - var zip = baseRest(unzip); - - /** - * This method is like `_.fromPairs` except that it accepts two arrays, - * one of property identifiers and one of corresponding values. - * - * @static - * @memberOf _ - * @since 0.4.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example - * - * _.zipObject(['a', 'b'], [1, 2]); - * // => { 'a': 1, 'b': 2 } - */ - function zipObject(props, values) { - return baseZipObject(props || [], values || [], assignValue); - } - - /** - * This method is like `_.zipObject` except that it supports property paths. - * - * @static - * @memberOf _ - * @since 4.1.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example - * - * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); - * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } - */ - function zipObjectDeep(props, values) { - return baseZipObject(props || [], values || [], baseSet); - } - - /** - * This method is like `_.zip` except that it accepts `iteratee` to specify - * how grouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @param {Function} [iteratee=_.identity] The function to combine - * grouped values. - * @returns {Array} Returns the new array of grouped elements. - * @example - * - * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { - * return a + b + c; - * }); - * // => [111, 222] - */ - var zipWith = baseRest(function(arrays) { - var length = arrays.length, - iteratee = length > 1 ? arrays[length - 1] : undefined; - - iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; - return unzipWith(arrays, iteratee); - }); - - /*------------------------------------------------------------------------*/ - - /** - * Creates a `lodash` wrapper instance that wraps `value` with explicit method - * chain sequences enabled. The result of such sequences must be unwrapped - * with `_#value`. - * - * @static - * @memberOf _ - * @since 1.3.0 - * @category Seq - * @param {*} value The value to wrap. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'pebbles', 'age': 1 } - * ]; - * - * var youngest = _ - * .chain(users) - * .sortBy('age') - * .map(function(o) { - * return o.user + ' is ' + o.age; - * }) - * .head() - * .value(); - * // => 'pebbles is 1' - */ - function chain(value) { - var result = lodash(value); - result.__chain__ = true; - return result; - } - - /** - * This method invokes `interceptor` and returns `value`. The interceptor - * is invoked with one argument; (value). The purpose of this method is to - * "tap into" a method chain sequence in order to modify intermediate results. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns `value`. - * @example - * - * _([1, 2, 3]) - * .tap(function(array) { - * // Mutate input array. - * array.pop(); - * }) - * .reverse() - * .value(); - * // => [2, 1] - */ - function tap(value, interceptor) { - interceptor(value); - return value; - } - - /** - * This method is like `_.tap` except that it returns the result of `interceptor`. - * The purpose of this method is to "pass thru" values replacing intermediate - * results in a method chain sequence. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns the result of `interceptor`. - * @example - * - * _(' abc ') - * .chain() - * .trim() - * .thru(function(value) { - * return [value]; - * }) - * .value(); - * // => ['abc'] - */ - function thru(value, interceptor) { - return interceptor(value); - } - - /** - * This method is the wrapper version of `_.at`. - * - * @name at - * @memberOf _ - * @since 1.0.0 - * @category Seq - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; - * - * _(object).at(['a[0].b.c', 'a[1]']).value(); - * // => [3, 4] - */ - var wrapperAt = flatRest(function(paths) { - var length = paths.length, - start = length ? paths[0] : 0, - value = this.__wrapped__, - interceptor = function(object) { return baseAt(object, paths); }; - - if (length > 1 || this.__actions__.length || - !(value instanceof LazyWrapper) || !isIndex(start)) { - return this.thru(interceptor); - } - value = value.slice(start, +start + (length ? 1 : 0)); - value.__actions__.push({ - 'func': thru, - 'args': [interceptor], - 'thisArg': undefined - }); - return new LodashWrapper(value, this.__chain__).thru(function(array) { - if (length && !array.length) { - array.push(undefined); - } - return array; - }); - }); - - /** - * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. - * - * @name chain - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 } - * ]; - * - * // A sequence without explicit chaining. - * _(users).head(); - * // => { 'user': 'barney', 'age': 36 } - * - * // A sequence with explicit chaining. - * _(users) - * .chain() - * .head() - * .pick('user') - * .value(); - * // => { 'user': 'barney' } - */ - function wrapperChain() { - return chain(this); - } - - /** - * Executes the chain sequence and returns the wrapped result. - * - * @name commit - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2]; - * var wrapped = _(array).push(3); - * - * console.log(array); - * // => [1, 2] - * - * wrapped = wrapped.commit(); - * console.log(array); - * // => [1, 2, 3] - * - * wrapped.last(); - * // => 3 - * - * console.log(array); - * // => [1, 2, 3] - */ - function wrapperCommit() { - return new LodashWrapper(this.value(), this.__chain__); - } - - /** - * Gets the next value on a wrapped object following the - * [iterator protocol](https://mdn.io/iteration_protocols#iterator). - * - * @name next - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the next iterator value. - * @example - * - * var wrapped = _([1, 2]); - * - * wrapped.next(); - * // => { 'done': false, 'value': 1 } - * - * wrapped.next(); - * // => { 'done': false, 'value': 2 } - * - * wrapped.next(); - * // => { 'done': true, 'value': undefined } - */ - function wrapperNext() { - if (this.__values__ === undefined) { - this.__values__ = toArray(this.value()); - } - var done = this.__index__ >= this.__values__.length, - value = done ? undefined : this.__values__[this.__index__++]; - - return { 'done': done, 'value': value }; - } - - /** - * Enables the wrapper to be iterable. - * - * @name Symbol.iterator - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the wrapper object. - * @example - * - * var wrapped = _([1, 2]); - * - * wrapped[Symbol.iterator]() === wrapped; - * // => true - * - * Array.from(wrapped); - * // => [1, 2] - */ - function wrapperToIterator() { - return this; - } - - /** - * Creates a clone of the chain sequence planting `value` as the wrapped value. - * - * @name plant - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @param {*} value The value to plant. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * function square(n) { - * return n * n; - * } - * - * var wrapped = _([1, 2]).map(square); - * var other = wrapped.plant([3, 4]); - * - * other.value(); - * // => [9, 16] - * - * wrapped.value(); - * // => [1, 4] - */ - function wrapperPlant(value) { - var result, - parent = this; - - while (parent instanceof baseLodash) { - var clone = wrapperClone(parent); - clone.__index__ = 0; - clone.__values__ = undefined; - if (result) { - previous.__wrapped__ = clone; - } else { - result = clone; - } - var previous = clone; - parent = parent.__wrapped__; - } - previous.__wrapped__ = value; - return result; - } - - /** - * This method is the wrapper version of `_.reverse`. - * - * **Note:** This method mutates the wrapped array. - * - * @name reverse - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2, 3]; - * - * _(array).reverse().value() - * // => [3, 2, 1] - * - * console.log(array); - * // => [3, 2, 1] - */ - function wrapperReverse() { - var value = this.__wrapped__; - if (value instanceof LazyWrapper) { - var wrapped = value; - if (this.__actions__.length) { - wrapped = new LazyWrapper(this); - } - wrapped = wrapped.reverse(); - wrapped.__actions__.push({ - 'func': thru, - 'args': [reverse], - 'thisArg': undefined - }); - return new LodashWrapper(wrapped, this.__chain__); - } - return this.thru(reverse); - } - - /** - * Executes the chain sequence to resolve the unwrapped value. - * - * @name value - * @memberOf _ - * @since 0.1.0 - * @alias toJSON, valueOf - * @category Seq - * @returns {*} Returns the resolved unwrapped value. - * @example - * - * _([1, 2, 3]).value(); - * // => [1, 2, 3] - */ - function wrapperValue() { - return baseWrapperValue(this.__wrapped__, this.__actions__); - } - - /*------------------------------------------------------------------------*/ - - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the number of times the key was returned by `iteratee`. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.countBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': 1, '6': 2 } - * - * // The `_.property` iteratee shorthand. - * _.countBy(['one', 'two', 'three'], 'length'); - * // => { '3': 2, '5': 1 } - */ - var countBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - ++result[key]; - } else { - baseAssignValue(result, key, 1); - } - }); - - /** - * Checks if `predicate` returns truthy for **all** elements of `collection`. - * Iteration is stopped once `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index|key, collection). - * - * **Note:** This method returns `true` for - * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because - * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of - * elements of empty collections. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - * @example - * - * _.every([true, 1, null, 'yes'], Boolean); - * // => false - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.every(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.every(users, ['active', false]); - * // => true - * - * // The `_.property` iteratee shorthand. - * _.every(users, 'active'); - * // => false - */ - function every(collection, predicate, guard) { - var func = isArray(collection) ? arrayEvery : baseEvery; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; - } - return func(collection, getIteratee(predicate, 3)); - } - - /** - * Iterates over elements of `collection`, returning an array of all elements - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * **Note:** Unlike `_.remove`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.reject - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * _.filter(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.filter(users, { 'age': 36, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.filter(users, ['active', false]); - * // => objects for ['fred'] - * - * // The `_.property` iteratee shorthand. - * _.filter(users, 'active'); - * // => objects for ['barney'] - * - * // Combining several predicates using `_.overEvery` or `_.overSome`. - * _.filter(users, _.overSome([{ 'age': 36 }, ['age', 40]])); - * // => objects for ['fred', 'barney'] - */ - function filter(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, getIteratee(predicate, 3)); - } - - /** - * Iterates over elements of `collection`, returning the first element - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false }, - * { 'user': 'pebbles', 'age': 1, 'active': true } - * ]; - * - * _.find(users, function(o) { return o.age < 40; }); - * // => object for 'barney' - * - * // The `_.matches` iteratee shorthand. - * _.find(users, { 'age': 1, 'active': true }); - * // => object for 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.find(users, ['active', false]); - * // => object for 'fred' - * - * // The `_.property` iteratee shorthand. - * _.find(users, 'active'); - * // => object for 'barney' - */ - var find = createFind(findIndex); - - /** - * This method is like `_.find` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=collection.length-1] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * _.findLast([1, 2, 3, 4], function(n) { - * return n % 2 == 1; - * }); - * // => 3 - */ - var findLast = createFind(findLastIndex); - - /** - * Creates a flattened array of values by running each element in `collection` - * thru `iteratee` and flattening the mapped results. The iteratee is invoked - * with three arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [n, n]; - * } - * - * _.flatMap([1, 2], duplicate); - * // => [1, 1, 2, 2] - */ - function flatMap(collection, iteratee) { - return baseFlatten(map(collection, iteratee), 1); - } - - /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results. - * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } - * - * _.flatMapDeep([1, 2], duplicate); - * // => [1, 1, 2, 2] - */ - function flatMapDeep(collection, iteratee) { - return baseFlatten(map(collection, iteratee), INFINITY); - } - - /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } - * - * _.flatMapDepth([1, 2], duplicate, 2); - * // => [[1, 1], [2, 2]] - */ - function flatMapDepth(collection, iteratee, depth) { - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(map(collection, iteratee), depth); - } - - /** - * Iterates over elements of `collection` and invokes `iteratee` for each element. - * The iteratee is invoked with three arguments: (value, index|key, collection). - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * **Note:** As with other "Collections" methods, objects with a "length" - * property are iterated like arrays. To avoid this behavior use `_.forIn` - * or `_.forOwn` for object iteration. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias each - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEachRight - * @example - * - * _.forEach([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `1` then `2`. - * - * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). - */ - function forEach(collection, iteratee) { - var func = isArray(collection) ? arrayEach : baseEach; - return func(collection, getIteratee(iteratee, 3)); - } - - /** - * This method is like `_.forEach` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @alias eachRight - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEach - * @example - * - * _.forEachRight([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `2` then `1`. - */ - function forEachRight(collection, iteratee) { - var func = isArray(collection) ? arrayEachRight : baseEachRight; - return func(collection, getIteratee(iteratee, 3)); - } - - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The order of grouped values - * is determined by the order they occur in `collection`. The corresponding - * value of each key is an array of elements responsible for generating the - * key. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.groupBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': [4.2], '6': [6.1, 6.3] } - * - * // The `_.property` iteratee shorthand. - * _.groupBy(['one', 'two', 'three'], 'length'); - * // => { '3': ['one', 'two'], '5': ['three'] } - */ - var groupBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - result[key].push(value); - } else { - baseAssignValue(result, key, [value]); - } - }); - - /** - * Checks if `value` is in `collection`. If `collection` is a string, it's - * checked for a substring of `value`, otherwise - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * is used for equality comparisons. If `fromIndex` is negative, it's used as - * the offset from the end of `collection`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {boolean} Returns `true` if `value` is found, else `false`. - * @example - * - * _.includes([1, 2, 3], 1); - * // => true - * - * _.includes([1, 2, 3], 1, 2); - * // => false - * - * _.includes({ 'a': 1, 'b': 2 }, 1); - * // => true - * - * _.includes('abcd', 'bc'); - * // => true - */ - function includes(collection, value, fromIndex, guard) { - collection = isArrayLike(collection) ? collection : values(collection); - fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; - - var length = collection.length; - if (fromIndex < 0) { - fromIndex = nativeMax(length + fromIndex, 0); - } - return isString(collection) - ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) - : (!!length && baseIndexOf(collection, value, fromIndex) > -1); - } - - /** - * Invokes the method at `path` of each element in `collection`, returning - * an array of the results of each invoked method. Any additional arguments - * are provided to each invoked method. If `path` is a function, it's invoked - * for, and `this` bound to, each element in `collection`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array|Function|string} path The path of the method to invoke or - * the function invoked per iteration. - * @param {...*} [args] The arguments to invoke each method with. - * @returns {Array} Returns the array of results. - * @example - * - * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); - * // => [[1, 5, 7], [1, 2, 3]] - * - * _.invokeMap([123, 456], String.prototype.split, ''); - * // => [['1', '2', '3'], ['4', '5', '6']] - */ - var invokeMap = baseRest(function(collection, path, args) { - var index = -1, - isFunc = typeof path == 'function', - result = isArrayLike(collection) ? Array(collection.length) : []; - - baseEach(collection, function(value) { - result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); - }); - return result; - }); - - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the last element responsible for generating the key. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * var array = [ - * { 'dir': 'left', 'code': 97 }, - * { 'dir': 'right', 'code': 100 } - * ]; - * - * _.keyBy(array, function(o) { - * return String.fromCharCode(o.code); - * }); - * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } - * - * _.keyBy(array, 'dir'); - * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } - */ - var keyBy = createAggregator(function(result, value, key) { - baseAssignValue(result, key, value); - }); - - /** - * Creates an array of values by running each element in `collection` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. - * - * The guarded methods are: - * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, - * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, - * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, - * `template`, `trim`, `trimEnd`, `trimStart`, and `words` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - * @example - * - * function square(n) { - * return n * n; - * } - * - * _.map([4, 8], square); - * // => [16, 64] - * - * _.map({ 'a': 4, 'b': 8 }, square); - * // => [16, 64] (iteration order is not guaranteed) - * - * var users = [ - * { 'user': 'barney' }, - * { 'user': 'fred' } - * ]; - * - * // The `_.property` iteratee shorthand. - * _.map(users, 'user'); - * // => ['barney', 'fred'] - */ - function map(collection, iteratee) { - var func = isArray(collection) ? arrayMap : baseMap; - return func(collection, getIteratee(iteratee, 3)); - } - - /** - * This method is like `_.sortBy` except that it allows specifying the sort - * orders of the iteratees to sort by. If `orders` is unspecified, all values - * are sorted in ascending order. Otherwise, specify an order of "desc" for - * descending or "asc" for ascending sort order of corresponding values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] - * The iteratees to sort by. - * @param {string[]} [orders] The sort orders of `iteratees`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {Array} Returns the new sorted array. - * @example - * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 34 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'barney', 'age': 36 } - * ]; - * - * // Sort by `user` in ascending order and by `age` in descending order. - * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] - */ - function orderBy(collection, iteratees, orders, guard) { - if (collection == null) { - return []; - } - if (!isArray(iteratees)) { - iteratees = iteratees == null ? [] : [iteratees]; - } - orders = guard ? undefined : orders; - if (!isArray(orders)) { - orders = orders == null ? [] : [orders]; - } - return baseOrderBy(collection, iteratees, orders); - } - - /** - * Creates an array of elements split into two groups, the first of which - * contains elements `predicate` returns truthy for, the second of which - * contains elements `predicate` returns falsey for. The predicate is - * invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the array of grouped elements. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true }, - * { 'user': 'pebbles', 'age': 1, 'active': false } - * ]; - * - * _.partition(users, function(o) { return o.active; }); - * // => objects for [['fred'], ['barney', 'pebbles']] - * - * // The `_.matches` iteratee shorthand. - * _.partition(users, { 'age': 1, 'active': false }); - * // => objects for [['pebbles'], ['barney', 'fred']] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.partition(users, ['active', false]); - * // => objects for [['barney', 'pebbles'], ['fred']] - * - * // The `_.property` iteratee shorthand. - * _.partition(users, 'active'); - * // => objects for [['fred'], ['barney', 'pebbles']] - */ - var partition = createAggregator(function(result, value, key) { - result[key ? 0 : 1].push(value); - }, function() { return [[], []]; }); - - /** - * Reduces `collection` to a value which is the accumulated result of running - * each element in `collection` thru `iteratee`, where each successive - * invocation is supplied the return value of the previous. If `accumulator` - * is not given, the first element of `collection` is used as the initial - * value. The iteratee is invoked with four arguments: - * (accumulator, value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.reduce`, `_.reduceRight`, and `_.transform`. - * - * The guarded methods are: - * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, - * and `sortBy` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduceRight - * @example - * - * _.reduce([1, 2], function(sum, n) { - * return sum + n; - * }, 0); - * // => 3 - * - * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * return result; - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) - */ - function reduce(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduce : baseReduce, - initAccum = arguments.length < 3; - - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); - } - - /** - * This method is like `_.reduce` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduce - * @example - * - * var array = [[0, 1], [2, 3], [4, 5]]; - * - * _.reduceRight(array, function(flattened, other) { - * return flattened.concat(other); - * }, []); - * // => [4, 5, 2, 3, 0, 1] - */ - function reduceRight(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduceRight : baseReduce, - initAccum = arguments.length < 3; - - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); - } - - /** - * The opposite of `_.filter`; this method returns the elements of `collection` - * that `predicate` does **not** return truthy for. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.filter - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true } - * ]; - * - * _.reject(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.reject(users, { 'age': 40, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.reject(users, ['active', false]); - * // => objects for ['fred'] - * - * // The `_.property` iteratee shorthand. - * _.reject(users, 'active'); - * // => objects for ['barney'] - */ - function reject(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, negate(getIteratee(predicate, 3))); - } - - /** - * Gets a random element from `collection`. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - * @example - * - * _.sample([1, 2, 3, 4]); - * // => 2 - */ - function sample(collection) { - var func = isArray(collection) ? arraySample : baseSample; - return func(collection); - } - - /** - * Gets `n` random elements at unique keys from `collection` up to the - * size of `collection`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @param {number} [n=1] The number of elements to sample. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the random elements. - * @example - * - * _.sampleSize([1, 2, 3], 2); - * // => [3, 1] - * - * _.sampleSize([1, 2, 3], 4); - * // => [2, 3, 1] - */ - function sampleSize(collection, n, guard) { - if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); - } - var func = isArray(collection) ? arraySampleSize : baseSampleSize; - return func(collection, n); - } - - /** - * Creates an array of shuffled values, using a version of the - * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to shuffle. - * @returns {Array} Returns the new shuffled array. - * @example - * - * _.shuffle([1, 2, 3, 4]); - * // => [4, 1, 3, 2] - */ - function shuffle(collection) { - var func = isArray(collection) ? arrayShuffle : baseShuffle; - return func(collection); - } - - /** - * Gets the size of `collection` by returning its length for array-like - * values or the number of own enumerable string keyed properties for objects. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @returns {number} Returns the collection size. - * @example - * - * _.size([1, 2, 3]); - * // => 3 - * - * _.size({ 'a': 1, 'b': 2 }); - * // => 2 - * - * _.size('pebbles'); - * // => 7 - */ - function size(collection) { - if (collection == null) { - return 0; - } - if (isArrayLike(collection)) { - return isString(collection) ? stringSize(collection) : collection.length; - } - var tag = getTag(collection); - if (tag == mapTag || tag == setTag) { - return collection.size; - } - return baseKeys(collection).length; - } - - /** - * Checks if `predicate` returns truthy for **any** element of `collection`. - * Iteration is stopped once `predicate` returns truthy. The predicate is - * invoked with three arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - * @example - * - * _.some([null, 0, 'yes', false], Boolean); - * // => true - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.some(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.some(users, ['active', false]); - * // => true - * - * // The `_.property` iteratee shorthand. - * _.some(users, 'active'); - * // => true - */ - function some(collection, predicate, guard) { - var func = isArray(collection) ? arraySome : baseSome; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; - } - return func(collection, getIteratee(predicate, 3)); - } - - /** - * Creates an array of elements, sorted in ascending order by the results of - * running each element in a collection thru each iteratee. This method - * performs a stable sort, that is, it preserves the original sort order of - * equal elements. The iteratees are invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {...(Function|Function[])} [iteratees=[_.identity]] - * The iteratees to sort by. - * @returns {Array} Returns the new sorted array. - * @example - * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 30 }, - * { 'user': 'barney', 'age': 34 } - * ]; - * - * _.sortBy(users, [function(o) { return o.user; }]); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 30]] - * - * _.sortBy(users, ['user', 'age']); - * // => objects for [['barney', 34], ['barney', 36], ['fred', 30], ['fred', 48]] - */ - var sortBy = baseRest(function(collection, iteratees) { - if (collection == null) { - return []; - } - var length = iteratees.length; - if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { - iteratees = []; - } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { - iteratees = [iteratees[0]]; - } - return baseOrderBy(collection, baseFlatten(iteratees, 1), []); - }); - - /*------------------------------------------------------------------------*/ - - /** - * Gets the timestamp of the number of milliseconds that have elapsed since - * the Unix epoch (1 January 1970 00:00:00 UTC). - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Date - * @returns {number} Returns the timestamp. - * @example - * - * _.defer(function(stamp) { - * console.log(_.now() - stamp); - * }, _.now()); - * // => Logs the number of milliseconds it took for the deferred invocation. - */ - var now = ctxNow || function() { - return root.Date.now(); - }; - - /*------------------------------------------------------------------------*/ - - /** - * The opposite of `_.before`; this method creates a function that invokes - * `func` once it's called `n` or more times. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {number} n The number of calls before `func` is invoked. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * var saves = ['profile', 'settings']; - * - * var done = _.after(saves.length, function() { - * console.log('done saving!'); - * }); - * - * _.forEach(saves, function(type) { - * asyncSave({ 'type': type, 'complete': done }); - * }); - * // => Logs 'done saving!' after the two async saves have completed. - */ - function after(n, func) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - n = toInteger(n); - return function() { - if (--n < 1) { - return func.apply(this, arguments); - } - }; - } - - /** - * Creates a function that invokes `func`, with up to `n` arguments, - * ignoring any additional arguments. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @param {number} [n=func.length] The arity cap. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new capped function. - * @example - * - * _.map(['6', '8', '10'], _.ary(parseInt, 1)); - * // => [6, 8, 10] - */ - function ary(func, n, guard) { - n = guard ? undefined : n; - n = (func && n == null) ? func.length : n; - return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); - } - - /** - * Creates a function that invokes `func`, with the `this` binding and arguments - * of the created function, while it's called less than `n` times. Subsequent - * calls to the created function return the result of the last `func` invocation. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {number} n The number of calls at which `func` is no longer invoked. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * jQuery(element).on('click', _.before(5, addContactToList)); - * // => Allows adding up to 4 contacts to the list. - */ - function before(n, func) { - var result; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - n = toInteger(n); - return function() { - if (--n > 0) { - result = func.apply(this, arguments); - } - if (n <= 1) { - func = undefined; - } - return result; - }; - } - - /** - * Creates a function that invokes `func` with the `this` binding of `thisArg` - * and `partials` prepended to the arguments it receives. - * - * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for partially applied arguments. - * - * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" - * property of bound functions. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to bind. - * @param {*} thisArg The `this` binding of `func`. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * function greet(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * - * var object = { 'user': 'fred' }; - * - * var bound = _.bind(greet, object, 'hi'); - * bound('!'); - * // => 'hi fred!' - * - * // Bound with placeholders. - * var bound = _.bind(greet, object, _, '!'); - * bound('hi'); - * // => 'hi fred!' - */ - var bind = baseRest(function(func, thisArg, partials) { - var bitmask = WRAP_BIND_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bind)); - bitmask |= WRAP_PARTIAL_FLAG; - } - return createWrap(func, bitmask, thisArg, partials, holders); - }); - - /** - * Creates a function that invokes the method at `object[key]` with `partials` - * prepended to the arguments it receives. - * - * This method differs from `_.bind` by allowing bound functions to reference - * methods that may be redefined or don't yet exist. See - * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) - * for more details. - * - * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * @static - * @memberOf _ - * @since 0.10.0 - * @category Function - * @param {Object} object The object to invoke the method on. - * @param {string} key The key of the method. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * var object = { - * 'user': 'fred', - * 'greet': function(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * }; - * - * var bound = _.bindKey(object, 'greet', 'hi'); - * bound('!'); - * // => 'hi fred!' - * - * object.greet = function(greeting, punctuation) { - * return greeting + 'ya ' + this.user + punctuation; - * }; - * - * bound('!'); - * // => 'hiya fred!' - * - * // Bound with placeholders. - * var bound = _.bindKey(object, 'greet', _, '!'); - * bound('hi'); - * // => 'hiya fred!' - */ - var bindKey = baseRest(function(object, key, partials) { - var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bindKey)); - bitmask |= WRAP_PARTIAL_FLAG; - } - return createWrap(key, bitmask, object, partials, holders); - }); - - /** - * Creates a function that accepts arguments of `func` and either invokes - * `func` returning its result, if at least `arity` number of arguments have - * been provided, or returns a function that accepts the remaining `func` - * arguments, and so on. The arity of `func` may be specified if `func.length` - * is not sufficient. - * - * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for provided arguments. - * - * **Note:** This method doesn't set the "length" property of curried functions. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. - * @example - * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curry(abc); - * - * curried(1)(2)(3); - * // => [1, 2, 3] - * - * curried(1, 2)(3); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] - * - * // Curried with placeholders. - * curried(1)(_, 3)(2); - * // => [1, 2, 3] - */ - function curry(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curry.placeholder; - return result; - } - - /** - * This method is like `_.curry` except that arguments are applied to `func` - * in the manner of `_.partialRight` instead of `_.partial`. - * - * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for provided arguments. - * - * **Note:** This method doesn't set the "length" property of curried functions. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. - * @example - * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curryRight(abc); - * - * curried(3)(2)(1); - * // => [1, 2, 3] - * - * curried(2, 3)(1); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] - * - * // Curried with placeholders. - * curried(3)(1, _)(2); - * // => [1, 2, 3] - */ - function curryRight(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curryRight.placeholder; - return result; - } - - /** - * Creates a debounced function that delays invoking `func` until after `wait` - * milliseconds have elapsed since the last time the debounced function was - * invoked. The debounced function comes with a `cancel` method to cancel - * delayed `func` invocations and a `flush` method to immediately invoke them. - * Provide `options` to indicate whether `func` should be invoked on the - * leading and/or trailing edge of the `wait` timeout. The `func` is invoked - * with the last arguments provided to the debounced function. Subsequent - * calls to the debounced function return the result of the last `func` - * invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the debounced function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.debounce` and `_.throttle`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to debounce. - * @param {number} [wait=0] The number of milliseconds to delay. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=false] - * Specify invoking on the leading edge of the timeout. - * @param {number} [options.maxWait] - * The maximum time `func` is allowed to be delayed before it's invoked. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new debounced function. - * @example - * - * // Avoid costly calculations while the window size is in flux. - * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); - * - * // Invoke `sendMail` when clicked, debouncing subsequent calls. - * jQuery(element).on('click', _.debounce(sendMail, 300, { - * 'leading': true, - * 'trailing': false - * })); - * - * // Ensure `batchLog` is invoked once after 1 second of debounced calls. - * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); - * var source = new EventSource('/stream'); - * jQuery(source).on('message', debounced); - * - * // Cancel the trailing debounced invocation. - * jQuery(window).on('popstate', debounced.cancel); - */ - function debounce(func, wait, options) { - var lastArgs, - lastThis, - maxWait, - result, - timerId, - lastCallTime, - lastInvokeTime = 0, - leading = false, - maxing = false, - trailing = true; - - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - wait = toNumber(wait) || 0; - if (isObject(options)) { - leading = !!options.leading; - maxing = 'maxWait' in options; - maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; - trailing = 'trailing' in options ? !!options.trailing : trailing; - } - - function invokeFunc(time) { - var args = lastArgs, - thisArg = lastThis; - - lastArgs = lastThis = undefined; - lastInvokeTime = time; - result = func.apply(thisArg, args); - return result; - } - - function leadingEdge(time) { - // Reset any `maxWait` timer. - lastInvokeTime = time; - // Start the timer for the trailing edge. - timerId = setTimeout(timerExpired, wait); - // Invoke the leading edge. - return leading ? invokeFunc(time) : result; - } - - function remainingWait(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime, - timeWaiting = wait - timeSinceLastCall; - - return maxing - ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) - : timeWaiting; - } - - function shouldInvoke(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime; - - // Either this is the first call, activity has stopped and we're at the - // trailing edge, the system time has gone backwards and we're treating - // it as the trailing edge, or we've hit the `maxWait` limit. - return (lastCallTime === undefined || (timeSinceLastCall >= wait) || - (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); - } - - function timerExpired() { - var time = now(); - if (shouldInvoke(time)) { - return trailingEdge(time); - } - // Restart the timer. - timerId = setTimeout(timerExpired, remainingWait(time)); - } - - function trailingEdge(time) { - timerId = undefined; - - // Only invoke if we have `lastArgs` which means `func` has been - // debounced at least once. - if (trailing && lastArgs) { - return invokeFunc(time); - } - lastArgs = lastThis = undefined; - return result; - } - - function cancel() { - if (timerId !== undefined) { - clearTimeout(timerId); - } - lastInvokeTime = 0; - lastArgs = lastCallTime = lastThis = timerId = undefined; - } - - function flush() { - return timerId === undefined ? result : trailingEdge(now()); - } - - function debounced() { - var time = now(), - isInvoking = shouldInvoke(time); - - lastArgs = arguments; - lastThis = this; - lastCallTime = time; - - if (isInvoking) { - if (timerId === undefined) { - return leadingEdge(lastCallTime); - } - if (maxing) { - // Handle invocations in a tight loop. - clearTimeout(timerId); - timerId = setTimeout(timerExpired, wait); - return invokeFunc(lastCallTime); - } - } - if (timerId === undefined) { - timerId = setTimeout(timerExpired, wait); - } - return result; - } - debounced.cancel = cancel; - debounced.flush = flush; - return debounced; - } - - /** - * Defers invoking the `func` until the current call stack has cleared. Any - * additional arguments are provided to `func` when it's invoked. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to defer. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. - * @example - * - * _.defer(function(text) { - * console.log(text); - * }, 'deferred'); - * // => Logs 'deferred' after one millisecond. - */ - var defer = baseRest(function(func, args) { - return baseDelay(func, 1, args); - }); - - /** - * Invokes `func` after `wait` milliseconds. Any additional arguments are - * provided to `func` when it's invoked. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. - * @example - * - * _.delay(function(text) { - * console.log(text); - * }, 1000, 'later'); - * // => Logs 'later' after one second. - */ - var delay = baseRest(function(func, wait, args) { - return baseDelay(func, toNumber(wait) || 0, args); - }); - - /** - * Creates a function that invokes `func` with arguments reversed. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to flip arguments for. - * @returns {Function} Returns the new flipped function. - * @example - * - * var flipped = _.flip(function() { - * return _.toArray(arguments); - * }); - * - * flipped('a', 'b', 'c', 'd'); - * // => ['d', 'c', 'b', 'a'] - */ - function flip(func) { - return createWrap(func, WRAP_FLIP_FLAG); - } - - /** - * Creates a function that memoizes the result of `func`. If `resolver` is - * provided, it determines the cache key for storing the result based on the - * arguments provided to the memoized function. By default, the first argument - * provided to the memoized function is used as the map cache key. The `func` - * is invoked with the `this` binding of the memoized function. - * - * **Note:** The cache is exposed as the `cache` property on the memoized - * function. Its creation may be customized by replacing the `_.memoize.Cache` - * constructor with one whose instances implement the - * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) - * method interface of `clear`, `delete`, `get`, `has`, and `set`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to have its output memoized. - * @param {Function} [resolver] The function to resolve the cache key. - * @returns {Function} Returns the new memoized function. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * var other = { 'c': 3, 'd': 4 }; - * - * var values = _.memoize(_.values); - * values(object); - * // => [1, 2] - * - * values(other); - * // => [3, 4] - * - * object.a = 2; - * values(object); - * // => [1, 2] - * - * // Modify the result cache. - * values.cache.set(object, ['a', 'b']); - * values(object); - * // => ['a', 'b'] - * - * // Replace `_.memoize.Cache`. - * _.memoize.Cache = WeakMap; - */ - function memoize(func, resolver) { - if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { - throw new TypeError(FUNC_ERROR_TEXT); - } - var memoized = function() { - var args = arguments, - key = resolver ? resolver.apply(this, args) : args[0], - cache = memoized.cache; - - if (cache.has(key)) { - return cache.get(key); - } - var result = func.apply(this, args); - memoized.cache = cache.set(key, result) || cache; - return result; - }; - memoized.cache = new (memoize.Cache || MapCache); - return memoized; - } - - // Expose `MapCache`. - memoize.Cache = MapCache; - - /** - * Creates a function that negates the result of the predicate `func`. The - * `func` predicate is invoked with the `this` binding and arguments of the - * created function. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} predicate The predicate to negate. - * @returns {Function} Returns the new negated function. - * @example - * - * function isEven(n) { - * return n % 2 == 0; - * } - * - * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); - * // => [1, 3, 5] - */ - function negate(predicate) { - if (typeof predicate != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - return function() { - var args = arguments; - switch (args.length) { - case 0: return !predicate.call(this); - case 1: return !predicate.call(this, args[0]); - case 2: return !predicate.call(this, args[0], args[1]); - case 3: return !predicate.call(this, args[0], args[1], args[2]); - } - return !predicate.apply(this, args); - }; - } - - /** - * Creates a function that is restricted to invoking `func` once. Repeat calls - * to the function return the value of the first invocation. The `func` is - * invoked with the `this` binding and arguments of the created function. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * var initialize = _.once(createApplication); - * initialize(); - * initialize(); - * // => `createApplication` is invoked once - */ - function once(func) { - return before(2, func); - } - - /** - * Creates a function that invokes `func` with its arguments transformed. - * - * @static - * @since 4.0.0 - * @memberOf _ - * @category Function - * @param {Function} func The function to wrap. - * @param {...(Function|Function[])} [transforms=[_.identity]] - * The argument transforms. - * @returns {Function} Returns the new function. - * @example - * - * function doubled(n) { - * return n * 2; - * } - * - * function square(n) { - * return n * n; - * } - * - * var func = _.overArgs(function(x, y) { - * return [x, y]; - * }, [square, doubled]); - * - * func(9, 3); - * // => [81, 6] - * - * func(10, 5); - * // => [100, 10] - */ - var overArgs = castRest(function(func, transforms) { - transforms = (transforms.length == 1 && isArray(transforms[0])) - ? arrayMap(transforms[0], baseUnary(getIteratee())) - : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); - - var funcsLength = transforms.length; - return baseRest(function(args) { - var index = -1, - length = nativeMin(args.length, funcsLength); - - while (++index < length) { - args[index] = transforms[index].call(this, args[index]); - } - return apply(func, this, args); - }); - }); - - /** - * Creates a function that invokes `func` with `partials` prepended to the - * arguments it receives. This method is like `_.bind` except it does **not** - * alter the `this` binding. - * - * The `_.partial.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. - * - * @static - * @memberOf _ - * @since 0.2.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. - * @example - * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } - * - * var sayHelloTo = _.partial(greet, 'hello'); - * sayHelloTo('fred'); - * // => 'hello fred' - * - * // Partially applied with placeholders. - * var greetFred = _.partial(greet, _, 'fred'); - * greetFred('hi'); - * // => 'hi fred' - */ - var partial = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partial)); - return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); - }); - - /** - * This method is like `_.partial` except that partially applied arguments - * are appended to the arguments it receives. - * - * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. - * @example - * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } - * - * var greetFred = _.partialRight(greet, 'fred'); - * greetFred('hi'); - * // => 'hi fred' - * - * // Partially applied with placeholders. - * var sayHelloTo = _.partialRight(greet, 'hello', _); - * sayHelloTo('fred'); - * // => 'hello fred' - */ - var partialRight = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partialRight)); - return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); - }); - - /** - * Creates a function that invokes `func` with arguments arranged according - * to the specified `indexes` where the argument value at the first index is - * provided as the first argument, the argument value at the second index is - * provided as the second argument, and so on. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to rearrange arguments for. - * @param {...(number|number[])} indexes The arranged argument indexes. - * @returns {Function} Returns the new function. - * @example - * - * var rearged = _.rearg(function(a, b, c) { - * return [a, b, c]; - * }, [2, 0, 1]); - * - * rearged('b', 'c', 'a') - * // => ['a', 'b', 'c'] - */ - var rearg = flatRest(function(func, indexes) { - return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); - }); - - /** - * Creates a function that invokes `func` with the `this` binding of the - * created function and arguments from `start` and beyond provided as - * an array. - * - * **Note:** This method is based on the - * [rest parameter](https://mdn.io/rest_parameters). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. - * @example - * - * var say = _.rest(function(what, names) { - * return what + ' ' + _.initial(names).join(', ') + - * (_.size(names) > 1 ? ', & ' : '') + _.last(names); - * }); - * - * say('hello', 'fred', 'barney', 'pebbles'); - * // => 'hello fred, barney, & pebbles' - */ - function rest(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - start = start === undefined ? start : toInteger(start); - return baseRest(func, start); - } - - /** - * Creates a function that invokes `func` with the `this` binding of the - * create function and an array of arguments much like - * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). - * - * **Note:** This method is based on the - * [spread operator](https://mdn.io/spread_operator). - * - * @static - * @memberOf _ - * @since 3.2.0 - * @category Function - * @param {Function} func The function to spread arguments over. - * @param {number} [start=0] The start position of the spread. - * @returns {Function} Returns the new function. - * @example - * - * var say = _.spread(function(who, what) { - * return who + ' says ' + what; - * }); - * - * say(['fred', 'hello']); - * // => 'fred says hello' - * - * var numbers = Promise.all([ - * Promise.resolve(40), - * Promise.resolve(36) - * ]); - * - * numbers.then(_.spread(function(x, y) { - * return x + y; - * })); - * // => a Promise of 76 - */ - function spread(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - start = start == null ? 0 : nativeMax(toInteger(start), 0); - return baseRest(function(args) { - var array = args[start], - otherArgs = castSlice(args, 0, start); - - if (array) { - arrayPush(otherArgs, array); - } - return apply(func, this, otherArgs); - }); - } - - /** - * Creates a throttled function that only invokes `func` at most once per - * every `wait` milliseconds. The throttled function comes with a `cancel` - * method to cancel delayed `func` invocations and a `flush` method to - * immediately invoke them. Provide `options` to indicate whether `func` - * should be invoked on the leading and/or trailing edge of the `wait` - * timeout. The `func` is invoked with the last arguments provided to the - * throttled function. Subsequent calls to the throttled function return the - * result of the last `func` invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the throttled function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.throttle` and `_.debounce`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to throttle. - * @param {number} [wait=0] The number of milliseconds to throttle invocations to. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=true] - * Specify invoking on the leading edge of the timeout. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new throttled function. - * @example - * - * // Avoid excessively updating the position while scrolling. - * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); - * - * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. - * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); - * jQuery(element).on('click', throttled); - * - * // Cancel the trailing throttled invocation. - * jQuery(window).on('popstate', throttled.cancel); - */ - function throttle(func, wait, options) { - var leading = true, - trailing = true; - - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - if (isObject(options)) { - leading = 'leading' in options ? !!options.leading : leading; - trailing = 'trailing' in options ? !!options.trailing : trailing; - } - return debounce(func, wait, { - 'leading': leading, - 'maxWait': wait, - 'trailing': trailing - }); - } - - /** - * Creates a function that accepts up to one argument, ignoring any - * additional arguments. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. - * @example - * - * _.map(['6', '8', '10'], _.unary(parseInt)); - * // => [6, 8, 10] - */ - function unary(func) { - return ary(func, 1); - } - - /** - * Creates a function that provides `value` to `wrapper` as its first - * argument. Any additional arguments provided to the function are appended - * to those provided to the `wrapper`. The wrapper is invoked with the `this` - * binding of the created function. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {*} value The value to wrap. - * @param {Function} [wrapper=identity] The wrapper function. - * @returns {Function} Returns the new function. - * @example - * - * var p = _.wrap(_.escape, function(func, text) { - * return '

' + func(text) + '

'; - * }); - * - * p('fred, barney, & pebbles'); - * // => '

fred, barney, & pebbles

' - */ - function wrap(value, wrapper) { - return partial(castFunction(wrapper), value); - } - - /*------------------------------------------------------------------------*/ - - /** - * Casts `value` as an array if it's not one. - * - * @static - * @memberOf _ - * @since 4.4.0 - * @category Lang - * @param {*} value The value to inspect. - * @returns {Array} Returns the cast array. - * @example - * - * _.castArray(1); - * // => [1] - * - * _.castArray({ 'a': 1 }); - * // => [{ 'a': 1 }] - * - * _.castArray('abc'); - * // => ['abc'] - * - * _.castArray(null); - * // => [null] - * - * _.castArray(undefined); - * // => [undefined] - * - * _.castArray(); - * // => [] - * - * var array = [1, 2, 3]; - * console.log(_.castArray(array) === array); - * // => true - */ - function castArray() { - if (!arguments.length) { - return []; - } - var value = arguments[0]; - return isArray(value) ? value : [value]; - } - - /** - * Creates a shallow clone of `value`. - * - * **Note:** This method is loosely based on the - * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) - * and supports cloning arrays, array buffers, booleans, date objects, maps, - * numbers, `Object` objects, regexes, sets, strings, symbols, and typed - * arrays. The own enumerable properties of `arguments` objects are cloned - * as plain objects. An empty object is returned for uncloneable values such - * as error objects, functions, DOM nodes, and WeakMaps. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to clone. - * @returns {*} Returns the cloned value. - * @see _.cloneDeep - * @example - * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; - * - * var shallow = _.clone(objects); - * console.log(shallow[0] === objects[0]); - * // => true - */ - function clone(value) { - return baseClone(value, CLONE_SYMBOLS_FLAG); - } - - /** - * This method is like `_.clone` except that it accepts `customizer` which - * is invoked to produce the cloned value. If `customizer` returns `undefined`, - * cloning is handled by the method instead. The `customizer` is invoked with - * up to four arguments; (value [, index|key, object, stack]). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the cloned value. - * @see _.cloneDeepWith - * @example - * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(false); - * } - * } - * - * var el = _.cloneWith(document.body, customizer); - * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 0 - */ - function cloneWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); - } - - /** - * This method is like `_.clone` except that it recursively clones `value`. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @returns {*} Returns the deep cloned value. - * @see _.clone - * @example - * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; - * - * var deep = _.cloneDeep(objects); - * console.log(deep[0] === objects[0]); - * // => false - */ - function cloneDeep(value) { - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); - } - - /** - * This method is like `_.cloneWith` except that it recursively clones `value`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the deep cloned value. - * @see _.cloneWith - * @example - * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(true); - * } - * } - * - * var el = _.cloneDeepWith(document.body, customizer); - * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 20 - */ - function cloneDeepWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); - } - - /** - * Checks if `object` conforms to `source` by invoking the predicate - * properties of `source` with the corresponding property values of `object`. - * - * **Note:** This method is equivalent to `_.conforms` when `source` is - * partially applied. - * - * @static - * @memberOf _ - * @since 4.14.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * - * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); - * // => true - * - * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); - * // => false - */ - function conformsTo(object, source) { - return source == null || baseConformsTo(object, source, keys(source)); - } - - /** - * Performs a - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * comparison between two values to determine if they are equivalent. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.eq(object, object); - * // => true - * - * _.eq(object, other); - * // => false - * - * _.eq('a', 'a'); - * // => true - * - * _.eq('a', Object('a')); - * // => false - * - * _.eq(NaN, NaN); - * // => true - */ - function eq(value, other) { - return value === other || (value !== value && other !== other); - } - - /** - * Checks if `value` is greater than `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - * @see _.lt - * @example - * - * _.gt(3, 1); - * // => true - * - * _.gt(3, 3); - * // => false - * - * _.gt(1, 3); - * // => false - */ - var gt = createRelationalOperation(baseGt); - - /** - * Checks if `value` is greater than or equal to `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than or equal to - * `other`, else `false`. - * @see _.lte - * @example - * - * _.gte(3, 1); - * // => true - * - * _.gte(3, 3); - * // => true - * - * _.gte(1, 3); - * // => false - */ - var gte = createRelationalOperation(function(value, other) { - return value >= other; - }); - - /** - * Checks if `value` is likely an `arguments` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - * else `false`. - * @example - * - * _.isArguments(function() { return arguments; }()); - * // => true - * - * _.isArguments([1, 2, 3]); - * // => false - */ - var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { - return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && - !propertyIsEnumerable.call(value, 'callee'); - }; - - /** - * Checks if `value` is classified as an `Array` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array, else `false`. - * @example - * - * _.isArray([1, 2, 3]); - * // => true - * - * _.isArray(document.body.children); - * // => false - * - * _.isArray('abc'); - * // => false - * - * _.isArray(_.noop); - * // => false - */ - var isArray = Array.isArray; - - /** - * Checks if `value` is classified as an `ArrayBuffer` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - * @example - * - * _.isArrayBuffer(new ArrayBuffer(2)); - * // => true - * - * _.isArrayBuffer(new Array(2)); - * // => false - */ - var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; - - /** - * Checks if `value` is array-like. A value is considered array-like if it's - * not a function and has a `value.length` that's an integer greater than or - * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is array-like, else `false`. - * @example - * - * _.isArrayLike([1, 2, 3]); - * // => true - * - * _.isArrayLike(document.body.children); - * // => true - * - * _.isArrayLike('abc'); - * // => true - * - * _.isArrayLike(_.noop); - * // => false - */ - function isArrayLike(value) { - return value != null && isLength(value.length) && !isFunction(value); - } - - /** - * This method is like `_.isArrayLike` except that it also checks if `value` - * is an object. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array-like object, - * else `false`. - * @example - * - * _.isArrayLikeObject([1, 2, 3]); - * // => true - * - * _.isArrayLikeObject(document.body.children); - * // => true - * - * _.isArrayLikeObject('abc'); - * // => false - * - * _.isArrayLikeObject(_.noop); - * // => false - */ - function isArrayLikeObject(value) { - return isObjectLike(value) && isArrayLike(value); - } - - /** - * Checks if `value` is classified as a boolean primitive or object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. - * @example - * - * _.isBoolean(false); - * // => true - * - * _.isBoolean(null); - * // => false - */ - function isBoolean(value) { - return value === true || value === false || - (isObjectLike(value) && baseGetTag(value) == boolTag); - } - - /** - * Checks if `value` is a buffer. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. - * @example - * - * _.isBuffer(new Buffer(2)); - * // => true - * - * _.isBuffer(new Uint8Array(2)); - * // => false - */ - var isBuffer = nativeIsBuffer || stubFalse; - - /** - * Checks if `value` is classified as a `Date` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - * @example - * - * _.isDate(new Date); - * // => true - * - * _.isDate('Mon April 23 2012'); - * // => false - */ - var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; - - /** - * Checks if `value` is likely a DOM element. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. - * @example - * - * _.isElement(document.body); - * // => true - * - * _.isElement(''); - * // => false - */ - function isElement(value) { - return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); - } - - /** - * Checks if `value` is an empty object, collection, map, or set. - * - * Objects are considered empty if they have no own enumerable string keyed - * properties. - * - * Array-like values such as `arguments` objects, arrays, buffers, strings, or - * jQuery-like collections are considered empty if they have a `length` of `0`. - * Similarly, maps and sets are considered empty if they have a `size` of `0`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is empty, else `false`. - * @example - * - * _.isEmpty(null); - * // => true - * - * _.isEmpty(true); - * // => true - * - * _.isEmpty(1); - * // => true - * - * _.isEmpty([1, 2, 3]); - * // => false - * - * _.isEmpty({ 'a': 1 }); - * // => false - */ - function isEmpty(value) { - if (value == null) { - return true; - } - if (isArrayLike(value) && - (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || - isBuffer(value) || isTypedArray(value) || isArguments(value))) { - return !value.length; - } - var tag = getTag(value); - if (tag == mapTag || tag == setTag) { - return !value.size; - } - if (isPrototype(value)) { - return !baseKeys(value).length; - } - for (var key in value) { - if (hasOwnProperty.call(value, key)) { - return false; - } - } - return true; - } - - /** - * Performs a deep comparison between two values to determine if they are - * equivalent. - * - * **Note:** This method supports comparing arrays, array buffers, booleans, - * date objects, error objects, maps, numbers, `Object` objects, regexes, - * sets, strings, symbols, and typed arrays. `Object` objects are compared - * by their own, not inherited, enumerable properties. Functions and DOM - * nodes are compared by strict equality, i.e. `===`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.isEqual(object, other); - * // => true - * - * object === other; - * // => false - */ - function isEqual(value, other) { - return baseIsEqual(value, other); - } - - /** - * This method is like `_.isEqual` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with up to - * six arguments: (objValue, othValue [, index|key, object, other, stack]). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, othValue) { - * if (isGreeting(objValue) && isGreeting(othValue)) { - * return true; - * } - * } - * - * var array = ['hello', 'goodbye']; - * var other = ['hi', 'goodbye']; - * - * _.isEqualWith(array, other, customizer); - * // => true - */ - function isEqualWith(value, other, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - var result = customizer ? customizer(value, other) : undefined; - return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; - } - - /** - * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, - * `SyntaxError`, `TypeError`, or `URIError` object. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an error object, else `false`. - * @example - * - * _.isError(new Error); - * // => true - * - * _.isError(Error); - * // => false - */ - function isError(value) { - if (!isObjectLike(value)) { - return false; - } - var tag = baseGetTag(value); - return tag == errorTag || tag == domExcTag || - (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); - } - - /** - * Checks if `value` is a finite primitive number. - * - * **Note:** This method is based on - * [`Number.isFinite`](https://mdn.io/Number/isFinite). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. - * @example - * - * _.isFinite(3); - * // => true - * - * _.isFinite(Number.MIN_VALUE); - * // => true - * - * _.isFinite(Infinity); - * // => false - * - * _.isFinite('3'); - * // => false - */ - function isFinite(value) { - return typeof value == 'number' && nativeIsFinite(value); - } - - /** - * Checks if `value` is classified as a `Function` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a function, else `false`. - * @example - * - * _.isFunction(_); - * // => true - * - * _.isFunction(/abc/); - * // => false - */ - function isFunction(value) { - if (!isObject(value)) { - return false; - } - // The use of `Object#toString` avoids issues with the `typeof` operator - // in Safari 9 which returns 'object' for typed arrays and other constructors. - var tag = baseGetTag(value); - return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; - } - - /** - * Checks if `value` is an integer. - * - * **Note:** This method is based on - * [`Number.isInteger`](https://mdn.io/Number/isInteger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an integer, else `false`. - * @example - * - * _.isInteger(3); - * // => true - * - * _.isInteger(Number.MIN_VALUE); - * // => false - * - * _.isInteger(Infinity); - * // => false - * - * _.isInteger('3'); - * // => false - */ - function isInteger(value) { - return typeof value == 'number' && value == toInteger(value); - } - - /** - * Checks if `value` is a valid array-like length. - * - * **Note:** This method is loosely based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. - * @example - * - * _.isLength(3); - * // => true - * - * _.isLength(Number.MIN_VALUE); - * // => false - * - * _.isLength(Infinity); - * // => false - * - * _.isLength('3'); - * // => false - */ - function isLength(value) { - return typeof value == 'number' && - value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; - } - - /** - * Checks if `value` is the - * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) - * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an object, else `false`. - * @example - * - * _.isObject({}); - * // => true - * - * _.isObject([1, 2, 3]); - * // => true - * - * _.isObject(_.noop); - * // => true - * - * _.isObject(null); - * // => false - */ - function isObject(value) { - var type = typeof value; - return value != null && (type == 'object' || type == 'function'); - } - - /** - * Checks if `value` is object-like. A value is object-like if it's not `null` - * and has a `typeof` result of "object". - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is object-like, else `false`. - * @example - * - * _.isObjectLike({}); - * // => true - * - * _.isObjectLike([1, 2, 3]); - * // => true - * - * _.isObjectLike(_.noop); - * // => false - * - * _.isObjectLike(null); - * // => false - */ - function isObjectLike(value) { - return value != null && typeof value == 'object'; - } - - /** - * Checks if `value` is classified as a `Map` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. - * @example - * - * _.isMap(new Map); - * // => true - * - * _.isMap(new WeakMap); - * // => false - */ - var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; - - /** - * Performs a partial deep comparison between `object` and `source` to - * determine if `object` contains equivalent property values. - * - * **Note:** This method is equivalent to `_.matches` when `source` is - * partially applied. - * - * Partial comparisons will match empty array and empty object `source` - * values against any array or object value, respectively. See `_.isEqual` - * for a list of supported value comparisons. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * - * _.isMatch(object, { 'b': 2 }); - * // => true - * - * _.isMatch(object, { 'b': 1 }); - * // => false - */ - function isMatch(object, source) { - return object === source || baseIsMatch(object, source, getMatchData(source)); - } - - /** - * This method is like `_.isMatch` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with five - * arguments: (objValue, srcValue, index|key, object, source). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - * @example - * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, srcValue) { - * if (isGreeting(objValue) && isGreeting(srcValue)) { - * return true; - * } - * } - * - * var object = { 'greeting': 'hello' }; - * var source = { 'greeting': 'hi' }; - * - * _.isMatchWith(object, source, customizer); - * // => true - */ - function isMatchWith(object, source, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseIsMatch(object, source, getMatchData(source), customizer); - } - - /** - * Checks if `value` is `NaN`. - * - * **Note:** This method is based on - * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as - * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for - * `undefined` and other non-number values. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. - * @example - * - * _.isNaN(NaN); - * // => true - * - * _.isNaN(new Number(NaN)); - * // => true - * - * isNaN(undefined); - * // => true - * - * _.isNaN(undefined); - * // => false - */ - function isNaN(value) { - // An `NaN` primitive is the only value that is not equal to itself. - // Perform the `toStringTag` check first to avoid errors with some - // ActiveX objects in IE. - return isNumber(value) && value != +value; - } - - /** - * Checks if `value` is a pristine native function. - * - * **Note:** This method can't reliably detect native functions in the presence - * of the core-js package because core-js circumvents this kind of detection. - * Despite multiple requests, the core-js maintainer has made it clear: any - * attempt to fix the detection will be obstructed. As a result, we're left - * with little choice but to throw an error. Unfortunately, this also affects - * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), - * which rely on core-js. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. - * @example - * - * _.isNative(Array.prototype.push); - * // => true - * - * _.isNative(_); - * // => false - */ - function isNative(value) { - if (isMaskable(value)) { - throw new Error(CORE_ERROR_TEXT); - } - return baseIsNative(value); - } - - /** - * Checks if `value` is `null`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `null`, else `false`. - * @example - * - * _.isNull(null); - * // => true - * - * _.isNull(void 0); - * // => false - */ - function isNull(value) { - return value === null; - } - - /** - * Checks if `value` is `null` or `undefined`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is nullish, else `false`. - * @example - * - * _.isNil(null); - * // => true - * - * _.isNil(void 0); - * // => true - * - * _.isNil(NaN); - * // => false - */ - function isNil(value) { - return value == null; - } - - /** - * Checks if `value` is classified as a `Number` primitive or object. - * - * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are - * classified as numbers, use the `_.isFinite` method. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a number, else `false`. - * @example - * - * _.isNumber(3); - * // => true - * - * _.isNumber(Number.MIN_VALUE); - * // => true - * - * _.isNumber(Infinity); - * // => true - * - * _.isNumber('3'); - * // => false - */ - function isNumber(value) { - return typeof value == 'number' || - (isObjectLike(value) && baseGetTag(value) == numberTag); - } - - /** - * Checks if `value` is a plain object, that is, an object created by the - * `Object` constructor or one with a `[[Prototype]]` of `null`. - * - * @static - * @memberOf _ - * @since 0.8.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * _.isPlainObject(new Foo); - * // => false - * - * _.isPlainObject([1, 2, 3]); - * // => false - * - * _.isPlainObject({ 'x': 0, 'y': 0 }); - * // => true - * - * _.isPlainObject(Object.create(null)); - * // => true - */ - function isPlainObject(value) { - if (!isObjectLike(value) || baseGetTag(value) != objectTag) { - return false; - } - var proto = getPrototype(value); - if (proto === null) { - return true; - } - var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; - return typeof Ctor == 'function' && Ctor instanceof Ctor && - funcToString.call(Ctor) == objectCtorString; - } - - /** - * Checks if `value` is classified as a `RegExp` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. - * @example - * - * _.isRegExp(/abc/); - * // => true - * - * _.isRegExp('/abc/'); - * // => false - */ - var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; - - /** - * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 - * double precision number which isn't the result of a rounded unsafe integer. - * - * **Note:** This method is based on - * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. - * @example - * - * _.isSafeInteger(3); - * // => true - * - * _.isSafeInteger(Number.MIN_VALUE); - * // => false - * - * _.isSafeInteger(Infinity); - * // => false - * - * _.isSafeInteger('3'); - * // => false - */ - function isSafeInteger(value) { - return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; - } - - /** - * Checks if `value` is classified as a `Set` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. - * @example - * - * _.isSet(new Set); - * // => true - * - * _.isSet(new WeakSet); - * // => false - */ - var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; - - /** - * Checks if `value` is classified as a `String` primitive or object. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a string, else `false`. - * @example - * - * _.isString('abc'); - * // => true - * - * _.isString(1); - * // => false - */ - function isString(value) { - return typeof value == 'string' || - (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); - } - - /** - * Checks if `value` is classified as a `Symbol` primitive or object. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. - * @example - * - * _.isSymbol(Symbol.iterator); - * // => true - * - * _.isSymbol('abc'); - * // => false - */ - function isSymbol(value) { - return typeof value == 'symbol' || - (isObjectLike(value) && baseGetTag(value) == symbolTag); - } - - /** - * Checks if `value` is classified as a typed array. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. - * @example - * - * _.isTypedArray(new Uint8Array); - * // => true - * - * _.isTypedArray([]); - * // => false - */ - var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; - - /** - * Checks if `value` is `undefined`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. - * @example - * - * _.isUndefined(void 0); - * // => true - * - * _.isUndefined(null); - * // => false - */ - function isUndefined(value) { - return value === undefined; - } - - /** - * Checks if `value` is classified as a `WeakMap` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. - * @example - * - * _.isWeakMap(new WeakMap); - * // => true - * - * _.isWeakMap(new Map); - * // => false - */ - function isWeakMap(value) { - return isObjectLike(value) && getTag(value) == weakMapTag; - } - - /** - * Checks if `value` is classified as a `WeakSet` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. - * @example - * - * _.isWeakSet(new WeakSet); - * // => true - * - * _.isWeakSet(new Set); - * // => false - */ - function isWeakSet(value) { - return isObjectLike(value) && baseGetTag(value) == weakSetTag; - } - - /** - * Checks if `value` is less than `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - * @see _.gt - * @example - * - * _.lt(1, 3); - * // => true - * - * _.lt(3, 3); - * // => false - * - * _.lt(3, 1); - * // => false - */ - var lt = createRelationalOperation(baseLt); - - /** - * Checks if `value` is less than or equal to `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than or equal to - * `other`, else `false`. - * @see _.gte - * @example - * - * _.lte(1, 3); - * // => true - * - * _.lte(3, 3); - * // => true - * - * _.lte(3, 1); - * // => false - */ - var lte = createRelationalOperation(function(value, other) { - return value <= other; - }); - - /** - * Converts `value` to an array. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to convert. - * @returns {Array} Returns the converted array. - * @example - * - * _.toArray({ 'a': 1, 'b': 2 }); - * // => [1, 2] - * - * _.toArray('abc'); - * // => ['a', 'b', 'c'] - * - * _.toArray(1); - * // => [] - * - * _.toArray(null); - * // => [] - */ - function toArray(value) { - if (!value) { - return []; - } - if (isArrayLike(value)) { - return isString(value) ? stringToArray(value) : copyArray(value); - } - if (symIterator && value[symIterator]) { - return iteratorToArray(value[symIterator]()); - } - var tag = getTag(value), - func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); - - return func(value); - } - - /** - * Converts `value` to a finite number. - * - * @static - * @memberOf _ - * @since 4.12.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted number. - * @example - * - * _.toFinite(3.2); - * // => 3.2 - * - * _.toFinite(Number.MIN_VALUE); - * // => 5e-324 - * - * _.toFinite(Infinity); - * // => 1.7976931348623157e+308 - * - * _.toFinite('3.2'); - * // => 3.2 - */ - function toFinite(value) { - if (!value) { - return value === 0 ? value : 0; - } - value = toNumber(value); - if (value === INFINITY || value === -INFINITY) { - var sign = (value < 0 ? -1 : 1); - return sign * MAX_INTEGER; - } - return value === value ? value : 0; - } - - /** - * Converts `value` to an integer. - * - * **Note:** This method is loosely based on - * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toInteger(3.2); - * // => 3 - * - * _.toInteger(Number.MIN_VALUE); - * // => 0 - * - * _.toInteger(Infinity); - * // => 1.7976931348623157e+308 - * - * _.toInteger('3.2'); - * // => 3 - */ - function toInteger(value) { - var result = toFinite(value), - remainder = result % 1; - - return result === result ? (remainder ? result - remainder : result) : 0; - } - - /** - * Converts `value` to an integer suitable for use as the length of an - * array-like object. - * - * **Note:** This method is based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toLength(3.2); - * // => 3 - * - * _.toLength(Number.MIN_VALUE); - * // => 0 - * - * _.toLength(Infinity); - * // => 4294967295 - * - * _.toLength('3.2'); - * // => 3 - */ - function toLength(value) { - return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; - } - - /** - * Converts `value` to a number. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to process. - * @returns {number} Returns the number. - * @example - * - * _.toNumber(3.2); - * // => 3.2 - * - * _.toNumber(Number.MIN_VALUE); - * // => 5e-324 - * - * _.toNumber(Infinity); - * // => Infinity - * - * _.toNumber('3.2'); - * // => 3.2 - */ - function toNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - if (isObject(value)) { - var other = typeof value.valueOf == 'function' ? value.valueOf() : value; - value = isObject(other) ? (other + '') : other; - } - if (typeof value != 'string') { - return value === 0 ? value : +value; - } - value = value.replace(reTrim, ''); - var isBinary = reIsBinary.test(value); - return (isBinary || reIsOctal.test(value)) - ? freeParseInt(value.slice(2), isBinary ? 2 : 8) - : (reIsBadHex.test(value) ? NAN : +value); - } - - /** - * Converts `value` to a plain object flattening inherited enumerable string - * keyed properties of `value` to own properties of the plain object. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {Object} Returns the converted plain object. - * @example - * - * function Foo() { - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.assign({ 'a': 1 }, new Foo); - * // => { 'a': 1, 'b': 2 } - * - * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); - * // => { 'a': 1, 'b': 2, 'c': 3 } - */ - function toPlainObject(value) { - return copyObject(value, keysIn(value)); - } - - /** - * Converts `value` to a safe integer. A safe integer can be compared and - * represented correctly. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toSafeInteger(3.2); - * // => 3 - * - * _.toSafeInteger(Number.MIN_VALUE); - * // => 0 - * - * _.toSafeInteger(Infinity); - * // => 9007199254740991 - * - * _.toSafeInteger('3.2'); - * // => 3 - */ - function toSafeInteger(value) { - return value - ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) - : (value === 0 ? value : 0); - } - - /** - * Converts `value` to a string. An empty string is returned for `null` - * and `undefined` values. The sign of `-0` is preserved. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. - * @example - * - * _.toString(null); - * // => '' - * - * _.toString(-0); - * // => '-0' - * - * _.toString([1, 2, 3]); - * // => '1,2,3' - */ - function toString(value) { - return value == null ? '' : baseToString(value); - } - - /*------------------------------------------------------------------------*/ - - /** - * Assigns own enumerable string keyed properties of source objects to the - * destination object. Source objects are applied from left to right. - * Subsequent sources overwrite property assignments of previous sources. - * - * **Note:** This method mutates `object` and is loosely based on - * [`Object.assign`](https://mdn.io/Object/assign). - * - * @static - * @memberOf _ - * @since 0.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assignIn - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * function Bar() { - * this.c = 3; - * } - * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; - * - * _.assign({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'c': 3 } - */ - var assign = createAssigner(function(object, source) { - if (isPrototype(source) || isArrayLike(source)) { - copyObject(source, keys(source), object); - return; - } - for (var key in source) { - if (hasOwnProperty.call(source, key)) { - assignValue(object, key, source[key]); - } - } - }); - - /** - * This method is like `_.assign` except that it iterates over own and - * inherited source properties. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias extend - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assign - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * function Bar() { - * this.c = 3; - * } - * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; - * - * _.assignIn({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } - */ - var assignIn = createAssigner(function(object, source) { - copyObject(source, keysIn(source), object); - }); - - /** - * This method is like `_.assignIn` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias extendWith - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignWith - * @example - * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; - * } - * - * var defaults = _.partialRight(_.assignInWith, customizer); - * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } - */ - var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keysIn(source), object, customizer); - }); - - /** - * This method is like `_.assign` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignInWith - * @example - * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; - * } - * - * var defaults = _.partialRight(_.assignWith, customizer); - * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } - */ - var assignWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keys(source), object, customizer); - }); - - /** - * Creates an array of values corresponding to `paths` of `object`. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Array} Returns the picked values. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; - * - * _.at(object, ['a[0].b.c', 'a[1]']); - * // => [3, 4] - */ - var at = flatRest(baseAt); - - /** - * Creates an object that inherits from the `prototype` object. If a - * `properties` object is given, its own enumerable string keyed properties - * are assigned to the created object. - * - * @static - * @memberOf _ - * @since 2.3.0 - * @category Object - * @param {Object} prototype The object to inherit from. - * @param {Object} [properties] The properties to assign to the object. - * @returns {Object} Returns the new object. - * @example - * - * function Shape() { - * this.x = 0; - * this.y = 0; - * } - * - * function Circle() { - * Shape.call(this); - * } - * - * Circle.prototype = _.create(Shape.prototype, { - * 'constructor': Circle - * }); - * - * var circle = new Circle; - * circle instanceof Circle; - * // => true - * - * circle instanceof Shape; - * // => true - */ - function create(prototype, properties) { - var result = baseCreate(prototype); - return properties == null ? result : baseAssign(result, properties); - } - - /** - * Assigns own and inherited enumerable string keyed properties of source - * objects to the destination object for all destination properties that - * resolve to `undefined`. Source objects are applied from left to right. - * Once a property is set, additional values of the same property are ignored. - * - * **Note:** This method mutates `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaultsDeep - * @example - * - * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } - */ - var defaults = baseRest(function(object, sources) { - object = Object(object); - - var index = -1; - var length = sources.length; - var guard = length > 2 ? sources[2] : undefined; - - if (guard && isIterateeCall(sources[0], sources[1], guard)) { - length = 1; - } - - while (++index < length) { - var source = sources[index]; - var props = keysIn(source); - var propsIndex = -1; - var propsLength = props.length; - - while (++propsIndex < propsLength) { - var key = props[propsIndex]; - var value = object[key]; - - if (value === undefined || - (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) { - object[key] = source[key]; - } - } - } - - return object; - }); - - /** - * This method is like `_.defaults` except that it recursively assigns - * default properties. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 3.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaults - * @example - * - * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); - * // => { 'a': { 'b': 2, 'c': 3 } } - */ - var defaultsDeep = baseRest(function(args) { - args.push(undefined, customDefaultsMerge); - return apply(mergeWith, undefined, args); - }); - - /** - * This method is like `_.find` except that it returns the key of the first - * element `predicate` returns truthy for instead of the element itself. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. - * @example - * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findKey(users, function(o) { return o.age < 40; }); - * // => 'barney' (iteration order is not guaranteed) - * - * // The `_.matches` iteratee shorthand. - * _.findKey(users, { 'age': 1, 'active': true }); - * // => 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findKey(users, ['active', false]); - * // => 'fred' - * - * // The `_.property` iteratee shorthand. - * _.findKey(users, 'active'); - * // => 'barney' - */ - function findKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); - } - - /** - * This method is like `_.findKey` except that it iterates over elements of - * a collection in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. - * @example - * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findLastKey(users, function(o) { return o.age < 40; }); - * // => returns 'pebbles' assuming `_.findKey` returns 'barney' - * - * // The `_.matches` iteratee shorthand. - * _.findLastKey(users, { 'age': 36, 'active': true }); - * // => 'barney' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastKey(users, ['active', false]); - * // => 'fred' - * - * // The `_.property` iteratee shorthand. - * _.findLastKey(users, 'active'); - * // => 'pebbles' - */ - function findLastKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); - } - - /** - * Iterates over own and inherited enumerable string keyed properties of an - * object and invokes `iteratee` for each property. The iteratee is invoked - * with three arguments: (value, key, object). Iteratee functions may exit - * iteration early by explicitly returning `false`. - * - * @static - * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forInRight - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forIn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). - */ - function forIn(object, iteratee) { - return object == null - ? object - : baseFor(object, getIteratee(iteratee, 3), keysIn); - } - - /** - * This method is like `_.forIn` except that it iterates over properties of - * `object` in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forIn - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forInRight(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. - */ - function forInRight(object, iteratee) { - return object == null - ? object - : baseForRight(object, getIteratee(iteratee, 3), keysIn); - } - - /** - * Iterates over own enumerable string keyed properties of an object and - * invokes `iteratee` for each property. The iteratee is invoked with three - * arguments: (value, key, object). Iteratee functions may exit iteration - * early by explicitly returning `false`. - * - * @static - * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwnRight - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forOwn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). - */ - function forOwn(object, iteratee) { - return object && baseForOwn(object, getIteratee(iteratee, 3)); - } - - /** - * This method is like `_.forOwn` except that it iterates over properties of - * `object` in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwn - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forOwnRight(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. - */ - function forOwnRight(object, iteratee) { - return object && baseForOwnRight(object, getIteratee(iteratee, 3)); - } - - /** - * Creates an array of function property names from own enumerable properties - * of `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functionsIn - * @example - * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } - * - * Foo.prototype.c = _.constant('c'); - * - * _.functions(new Foo); - * // => ['a', 'b'] - */ - function functions(object) { - return object == null ? [] : baseFunctions(object, keys(object)); - } - - /** - * Creates an array of function property names from own and inherited - * enumerable properties of `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functions - * @example - * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } - * - * Foo.prototype.c = _.constant('c'); - * - * _.functionsIn(new Foo); - * // => ['a', 'b', 'c'] - */ - function functionsIn(object) { - return object == null ? [] : baseFunctions(object, keysIn(object)); - } - - /** - * Gets the value at `path` of `object`. If the resolved value is - * `undefined`, the `defaultValue` is returned in its place. - * - * @static - * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.get(object, 'a[0].b.c'); - * // => 3 - * - * _.get(object, ['a', '0', 'b', 'c']); - * // => 3 - * - * _.get(object, 'a.b.c', 'default'); - * // => 'default' - */ - function get(object, path, defaultValue) { - var result = object == null ? undefined : baseGet(object, path); - return result === undefined ? defaultValue : result; - } - - /** - * Checks if `path` is a direct property of `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - * @example - * - * var object = { 'a': { 'b': 2 } }; - * var other = _.create({ 'a': _.create({ 'b': 2 }) }); - * - * _.has(object, 'a'); - * // => true - * - * _.has(object, 'a.b'); - * // => true - * - * _.has(object, ['a', 'b']); - * // => true - * - * _.has(other, 'a'); - * // => false - */ - function has(object, path) { - return object != null && hasPath(object, path, baseHas); - } - - /** - * Checks if `path` is a direct or inherited property of `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - * @example - * - * var object = _.create({ 'a': _.create({ 'b': 2 }) }); - * - * _.hasIn(object, 'a'); - * // => true - * - * _.hasIn(object, 'a.b'); - * // => true - * - * _.hasIn(object, ['a', 'b']); - * // => true - * - * _.hasIn(object, 'b'); - * // => false - */ - function hasIn(object, path) { - return object != null && hasPath(object, path, baseHasIn); - } - - /** - * Creates an object composed of the inverted keys and values of `object`. - * If `object` contains duplicate values, subsequent values overwrite - * property assignments of previous values. - * - * @static - * @memberOf _ - * @since 0.7.0 - * @category Object - * @param {Object} object The object to invert. - * @returns {Object} Returns the new inverted object. - * @example - * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; - * - * _.invert(object); - * // => { '1': 'c', '2': 'b' } - */ - var invert = createInverter(function(result, value, key) { - if (value != null && - typeof value.toString != 'function') { - value = nativeObjectToString.call(value); - } - - result[value] = key; - }, constant(identity)); - - /** - * This method is like `_.invert` except that the inverted object is generated - * from the results of running each element of `object` thru `iteratee`. The - * corresponding inverted value of each inverted key is an array of keys - * responsible for generating the inverted value. The iteratee is invoked - * with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.1.0 - * @category Object - * @param {Object} object The object to invert. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Object} Returns the new inverted object. - * @example - * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; - * - * _.invertBy(object); - * // => { '1': ['a', 'c'], '2': ['b'] } - * - * _.invertBy(object, function(value) { - * return 'group' + value; - * }); - * // => { 'group1': ['a', 'c'], 'group2': ['b'] } - */ - var invertBy = createInverter(function(result, value, key) { - if (value != null && - typeof value.toString != 'function') { - value = nativeObjectToString.call(value); - } - - if (hasOwnProperty.call(result, value)) { - result[value].push(key); - } else { - result[value] = [key]; - } - }, getIteratee); - - /** - * Invokes the method at `path` of `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {...*} [args] The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. - * @example - * - * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; - * - * _.invoke(object, 'a[0].b.c.slice', 1, 3); - * // => [2, 3] - */ - var invoke = baseRest(baseInvoke); - - /** - * Creates an array of the own enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. See the - * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * for more details. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.keys(new Foo); - * // => ['a', 'b'] (iteration order is not guaranteed) - * - * _.keys('hi'); - * // => ['0', '1'] - */ - function keys(object) { - return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); - } - - /** - * Creates an array of the own and inherited enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.keysIn(new Foo); - * // => ['a', 'b', 'c'] (iteration order is not guaranteed) - */ - function keysIn(object) { - return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); - } - - /** - * The opposite of `_.mapValues`; this method creates an object with the - * same values as `object` and keys generated by running each own enumerable - * string keyed property of `object` thru `iteratee`. The iteratee is invoked - * with three arguments: (value, key, object). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapValues - * @example - * - * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { - * return key + value; - * }); - * // => { 'a1': 1, 'b2': 2 } - */ - function mapKeys(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); - - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, iteratee(value, key, object), value); - }); - return result; - } - - /** - * Creates an object with the same keys as `object` and values generated - * by running each own enumerable string keyed property of `object` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, key, object). - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapKeys - * @example - * - * var users = { - * 'fred': { 'user': 'fred', 'age': 40 }, - * 'pebbles': { 'user': 'pebbles', 'age': 1 } - * }; - * - * _.mapValues(users, function(o) { return o.age; }); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) - * - * // The `_.property` iteratee shorthand. - * _.mapValues(users, 'age'); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) - */ - function mapValues(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); - - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, key, iteratee(value, key, object)); - }); - return result; - } - - /** - * This method is like `_.assign` except that it recursively merges own and - * inherited enumerable string keyed properties of source objects into the - * destination object. Source properties that resolve to `undefined` are - * skipped if a destination value exists. Array and plain object properties - * are merged recursively. Other objects and value types are overridden by - * assignment. Source objects are applied from left to right. Subsequent - * sources overwrite property assignments of previous sources. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @example - * - * var object = { - * 'a': [{ 'b': 2 }, { 'd': 4 }] - * }; - * - * var other = { - * 'a': [{ 'c': 3 }, { 'e': 5 }] - * }; - * - * _.merge(object, other); - * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } - */ - var merge = createAssigner(function(object, source, srcIndex) { - baseMerge(object, source, srcIndex); - }); - - /** - * This method is like `_.merge` except that it accepts `customizer` which - * is invoked to produce the merged values of the destination and source - * properties. If `customizer` returns `undefined`, merging is handled by the - * method instead. The `customizer` is invoked with six arguments: - * (objValue, srcValue, key, object, source, stack). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} customizer The function to customize assigned values. - * @returns {Object} Returns `object`. - * @example - * - * function customizer(objValue, srcValue) { - * if (_.isArray(objValue)) { - * return objValue.concat(srcValue); - * } - * } - * - * var object = { 'a': [1], 'b': [2] }; - * var other = { 'a': [3], 'b': [4] }; - * - * _.mergeWith(object, other, customizer); - * // => { 'a': [1, 3], 'b': [2, 4] } - */ - var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { - baseMerge(object, source, srcIndex, customizer); - }); - - /** - * The opposite of `_.pick`; this method creates an object composed of the - * own and inherited enumerable property paths of `object` that are not omitted. - * - * **Note:** This method is considerably slower than `_.pick`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to omit. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.omit(object, ['a', 'c']); - * // => { 'b': '2' } - */ - var omit = flatRest(function(object, paths) { - var result = {}; - if (object == null) { - return result; - } - var isDeep = false; - paths = arrayMap(paths, function(path) { - path = castPath(path, object); - isDeep || (isDeep = path.length > 1); - return path; - }); - copyObject(object, getAllKeysIn(object), result); - if (isDeep) { - result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); - } - var length = paths.length; - while (length--) { - baseUnset(result, paths[length]); - } - return result; - }); - - /** - * The opposite of `_.pickBy`; this method creates an object composed of - * the own and inherited enumerable string keyed properties of `object` that - * `predicate` doesn't return truthy for. The predicate is invoked with two - * arguments: (value, key). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.omitBy(object, _.isNumber); - * // => { 'b': '2' } - */ - function omitBy(object, predicate) { - return pickBy(object, negate(getIteratee(predicate))); - } - - /** - * Creates an object composed of the picked `object` properties. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.pick(object, ['a', 'c']); - * // => { 'a': 1, 'c': 3 } - */ - var pick = flatRest(function(object, paths) { - return object == null ? {} : basePick(object, paths); - }); - - /** - * Creates an object composed of the `object` properties `predicate` returns - * truthy for. The predicate is invoked with two arguments: (value, key). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.pickBy(object, _.isNumber); - * // => { 'a': 1, 'c': 3 } - */ - function pickBy(object, predicate) { - if (object == null) { - return {}; - } - var props = arrayMap(getAllKeysIn(object), function(prop) { - return [prop]; - }); - predicate = getIteratee(predicate); - return basePickBy(object, props, function(value, path) { - return predicate(value, path[0]); - }); - } - - /** - * This method is like `_.get` except that if the resolved value is a - * function it's invoked with the `this` binding of its parent object and - * its result is returned. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to resolve. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. - * @example - * - * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; - * - * _.result(object, 'a[0].b.c1'); - * // => 3 - * - * _.result(object, 'a[0].b.c2'); - * // => 4 - * - * _.result(object, 'a[0].b.c3', 'default'); - * // => 'default' - * - * _.result(object, 'a[0].b.c3', _.constant('default')); - * // => 'default' - */ - function result(object, path, defaultValue) { - path = castPath(path, object); - - var index = -1, - length = path.length; - - // Ensure the loop is entered when path is empty. - if (!length) { - length = 1; - object = undefined; - } - while (++index < length) { - var value = object == null ? undefined : object[toKey(path[index])]; - if (value === undefined) { - index = length; - value = defaultValue; - } - object = isFunction(value) ? value.call(object) : value; - } - return object; - } - - /** - * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, - * it's created. Arrays are created for missing index properties while objects - * are created for all other missing properties. Use `_.setWith` to customize - * `path` creation. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @returns {Object} Returns `object`. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.set(object, 'a[0].b.c', 4); - * console.log(object.a[0].b.c); - * // => 4 - * - * _.set(object, ['x', '0', 'y', 'z'], 5); - * console.log(object.x[0].y.z); - * // => 5 - */ - function set(object, path, value) { - return object == null ? object : baseSet(object, path, value); - } - - /** - * This method is like `_.set` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @example - * - * var object = {}; - * - * _.setWith(object, '[0][1]', 'a', Object); - * // => { '0': { '1': 'a' } } - */ - function setWith(object, path, value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseSet(object, path, value, customizer); - } - - /** - * Creates an array of own enumerable string keyed-value pairs for `object` - * which can be consumed by `_.fromPairs`. If `object` is a map or set, its - * entries are returned. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias entries - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.toPairs(new Foo); - * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) - */ - var toPairs = createToPairs(keys); - - /** - * Creates an array of own and inherited enumerable string keyed-value pairs - * for `object` which can be consumed by `_.fromPairs`. If `object` is a map - * or set, its entries are returned. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias entriesIn - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.toPairsIn(new Foo); - * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) - */ - var toPairsIn = createToPairs(keysIn); - - /** - * An alternative to `_.reduce`; this method transforms `object` to a new - * `accumulator` object which is the result of running each of its own - * enumerable string keyed properties thru `iteratee`, with each invocation - * potentially mutating the `accumulator` object. If `accumulator` is not - * provided, a new object with the same `[[Prototype]]` will be used. The - * iteratee is invoked with four arguments: (accumulator, value, key, object). - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * @static - * @memberOf _ - * @since 1.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The custom accumulator value. - * @returns {*} Returns the accumulated value. - * @example - * - * _.transform([2, 3, 4], function(result, n) { - * result.push(n *= n); - * return n % 2 == 0; - * }, []); - * // => [4, 9] - * - * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } - */ - function transform(object, iteratee, accumulator) { - var isArr = isArray(object), - isArrLike = isArr || isBuffer(object) || isTypedArray(object); - - iteratee = getIteratee(iteratee, 4); - if (accumulator == null) { - var Ctor = object && object.constructor; - if (isArrLike) { - accumulator = isArr ? new Ctor : []; - } - else if (isObject(object)) { - accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; - } - else { - accumulator = {}; - } - } - (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { - return iteratee(accumulator, value, index, object); - }); - return accumulator; - } - - /** - * Removes the property at `path` of `object`. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 7 } }] }; - * _.unset(object, 'a[0].b.c'); - * // => true - * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; - * - * _.unset(object, ['a', '0', 'b', 'c']); - * // => true - * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; - */ - function unset(object, path) { - return object == null ? true : baseUnset(object, path); - } - - /** - * This method is like `_.set` except that accepts `updater` to produce the - * value to set. Use `_.updateWith` to customize `path` creation. The `updater` - * is invoked with one argument: (value). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @returns {Object} Returns `object`. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.update(object, 'a[0].b.c', function(n) { return n * n; }); - * console.log(object.a[0].b.c); - * // => 9 - * - * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); - * console.log(object.x[0].y.z); - * // => 0 - */ - function update(object, path, updater) { - return object == null ? object : baseUpdate(object, path, castFunction(updater)); - } - - /** - * This method is like `_.update` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @example - * - * var object = {}; - * - * _.updateWith(object, '[0][1]', _.constant('a'), Object); - * // => { '0': { '1': 'a' } } - */ - function updateWith(object, path, updater, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); - } - - /** - * Creates an array of the own enumerable string keyed property values of `object`. - * - * **Note:** Non-object values are coerced to objects. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.values(new Foo); - * // => [1, 2] (iteration order is not guaranteed) - * - * _.values('hi'); - * // => ['h', 'i'] - */ - function values(object) { - return object == null ? [] : baseValues(object, keys(object)); - } - - /** - * Creates an array of the own and inherited enumerable string keyed property - * values of `object`. - * - * **Note:** Non-object values are coerced to objects. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.valuesIn(new Foo); - * // => [1, 2, 3] (iteration order is not guaranteed) - */ - function valuesIn(object) { - return object == null ? [] : baseValues(object, keysIn(object)); - } - - /*------------------------------------------------------------------------*/ - - /** - * Clamps `number` within the inclusive `lower` and `upper` bounds. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Number - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. - * @example - * - * _.clamp(-10, -5, 5); - * // => -5 - * - * _.clamp(10, -5, 5); - * // => 5 - */ - function clamp(number, lower, upper) { - if (upper === undefined) { - upper = lower; - lower = undefined; - } - if (upper !== undefined) { - upper = toNumber(upper); - upper = upper === upper ? upper : 0; - } - if (lower !== undefined) { - lower = toNumber(lower); - lower = lower === lower ? lower : 0; - } - return baseClamp(toNumber(number), lower, upper); - } - - /** - * Checks if `n` is between `start` and up to, but not including, `end`. If - * `end` is not specified, it's set to `start` with `start` then set to `0`. - * If `start` is greater than `end` the params are swapped to support - * negative ranges. - * - * @static - * @memberOf _ - * @since 3.3.0 - * @category Number - * @param {number} number The number to check. - * @param {number} [start=0] The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - * @see _.range, _.rangeRight - * @example - * - * _.inRange(3, 2, 4); - * // => true - * - * _.inRange(4, 8); - * // => true - * - * _.inRange(4, 2); - * // => false - * - * _.inRange(2, 2); - * // => false - * - * _.inRange(1.2, 2); - * // => true - * - * _.inRange(5.2, 4); - * // => false - * - * _.inRange(-3, -2, -6); - * // => true - */ - function inRange(number, start, end) { - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); - } - number = toNumber(number); - return baseInRange(number, start, end); - } - - /** - * Produces a random number between the inclusive `lower` and `upper` bounds. - * If only one argument is provided a number between `0` and the given number - * is returned. If `floating` is `true`, or either `lower` or `upper` are - * floats, a floating-point number is returned instead of an integer. - * - * **Note:** JavaScript follows the IEEE-754 standard for resolving - * floating-point values which can produce unexpected results. - * - * @static - * @memberOf _ - * @since 0.7.0 - * @category Number - * @param {number} [lower=0] The lower bound. - * @param {number} [upper=1] The upper bound. - * @param {boolean} [floating] Specify returning a floating-point number. - * @returns {number} Returns the random number. - * @example - * - * _.random(0, 5); - * // => an integer between 0 and 5 - * - * _.random(5); - * // => also an integer between 0 and 5 - * - * _.random(5, true); - * // => a floating-point number between 0 and 5 - * - * _.random(1.2, 5.2); - * // => a floating-point number between 1.2 and 5.2 - */ - function random(lower, upper, floating) { - if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { - upper = floating = undefined; - } - if (floating === undefined) { - if (typeof upper == 'boolean') { - floating = upper; - upper = undefined; - } - else if (typeof lower == 'boolean') { - floating = lower; - lower = undefined; - } - } - if (lower === undefined && upper === undefined) { - lower = 0; - upper = 1; - } - else { - lower = toFinite(lower); - if (upper === undefined) { - upper = lower; - lower = 0; - } else { - upper = toFinite(upper); - } - } - if (lower > upper) { - var temp = lower; - lower = upper; - upper = temp; - } - if (floating || lower % 1 || upper % 1) { - var rand = nativeRandom(); - return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); - } - return baseRandom(lower, upper); - } - - /*------------------------------------------------------------------------*/ - - /** - * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the camel cased string. - * @example - * - * _.camelCase('Foo Bar'); - * // => 'fooBar' - * - * _.camelCase('--foo-bar--'); - * // => 'fooBar' - * - * _.camelCase('__FOO_BAR__'); - * // => 'fooBar' - */ - var camelCase = createCompounder(function(result, word, index) { - word = word.toLowerCase(); - return result + (index ? capitalize(word) : word); - }); - - /** - * Converts the first character of `string` to upper case and the remaining - * to lower case. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to capitalize. - * @returns {string} Returns the capitalized string. - * @example - * - * _.capitalize('FRED'); - * // => 'Fred' - */ - function capitalize(string) { - return upperFirst(toString(string).toLowerCase()); - } - - /** - * Deburrs `string` by converting - * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) - * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) - * letters to basic Latin letters and removing - * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to deburr. - * @returns {string} Returns the deburred string. - * @example - * - * _.deburr('déjà vu'); - * // => 'deja vu' - */ - function deburr(string) { - string = toString(string); - return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); - } - - /** - * Checks if `string` ends with the given target string. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=string.length] The position to search up to. - * @returns {boolean} Returns `true` if `string` ends with `target`, - * else `false`. - * @example - * - * _.endsWith('abc', 'c'); - * // => true - * - * _.endsWith('abc', 'b'); - * // => false - * - * _.endsWith('abc', 'b', 2); - * // => true - */ - function endsWith(string, target, position) { - string = toString(string); - target = baseToString(target); - - var length = string.length; - position = position === undefined - ? length - : baseClamp(toInteger(position), 0, length); - - var end = position; - position -= target.length; - return position >= 0 && string.slice(position, end) == target; - } - - /** - * Converts the characters "&", "<", ">", '"', and "'" in `string` to their - * corresponding HTML entities. - * - * **Note:** No other characters are escaped. To escape additional - * characters use a third-party library like [_he_](https://mths.be/he). - * - * Though the ">" character is escaped for symmetry, characters like - * ">" and "/" don't need escaping in HTML and have no special meaning - * unless they're part of a tag or unquoted attribute value. See - * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) - * (under "semi-related fun fact") for more details. - * - * When working with HTML you should always - * [quote attribute values](http://wonko.com/post/html-escaping) to reduce - * XSS vectors. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. - * @example - * - * _.escape('fred, barney, & pebbles'); - * // => 'fred, barney, & pebbles' - */ - function escape(string) { - string = toString(string); - return (string && reHasUnescapedHtml.test(string)) - ? string.replace(reUnescapedHtml, escapeHtmlChar) - : string; - } - - /** - * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", - * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. - * @example - * - * _.escapeRegExp('[lodash](https://lodash.com/)'); - * // => '\[lodash\]\(https://lodash\.com/\)' - */ - function escapeRegExp(string) { - string = toString(string); - return (string && reHasRegExpChar.test(string)) - ? string.replace(reRegExpChar, '\\$&') - : string; - } - - /** - * Converts `string` to - * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the kebab cased string. - * @example - * - * _.kebabCase('Foo Bar'); - * // => 'foo-bar' - * - * _.kebabCase('fooBar'); - * // => 'foo-bar' - * - * _.kebabCase('__FOO_BAR__'); - * // => 'foo-bar' - */ - var kebabCase = createCompounder(function(result, word, index) { - return result + (index ? '-' : '') + word.toLowerCase(); - }); - - /** - * Converts `string`, as space separated words, to lower case. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the lower cased string. - * @example - * - * _.lowerCase('--Foo-Bar--'); - * // => 'foo bar' - * - * _.lowerCase('fooBar'); - * // => 'foo bar' - * - * _.lowerCase('__FOO_BAR__'); - * // => 'foo bar' - */ - var lowerCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + word.toLowerCase(); - }); - - /** - * Converts the first character of `string` to lower case. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the converted string. - * @example - * - * _.lowerFirst('Fred'); - * // => 'fred' - * - * _.lowerFirst('FRED'); - * // => 'fRED' - */ - var lowerFirst = createCaseFirst('toLowerCase'); - - /** - * Pads `string` on the left and right sides if it's shorter than `length`. - * Padding characters are truncated if they can't be evenly divided by `length`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. - * @example - * - * _.pad('abc', 8); - * // => ' abc ' - * - * _.pad('abc', 8, '_-'); - * // => '_-abc_-_' - * - * _.pad('abc', 3); - * // => 'abc' - */ - function pad(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - if (!length || strLength >= length) { - return string; - } - var mid = (length - strLength) / 2; - return ( - createPadding(nativeFloor(mid), chars) + - string + - createPadding(nativeCeil(mid), chars) - ); - } - - /** - * Pads `string` on the right side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. - * @example - * - * _.padEnd('abc', 6); - * // => 'abc ' - * - * _.padEnd('abc', 6, '_-'); - * // => 'abc_-_' - * - * _.padEnd('abc', 3); - * // => 'abc' - */ - function padEnd(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (string + createPadding(length - strLength, chars)) - : string; - } - - /** - * Pads `string` on the left side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. - * @example - * - * _.padStart('abc', 6); - * // => ' abc' - * - * _.padStart('abc', 6, '_-'); - * // => '_-_abc' - * - * _.padStart('abc', 3); - * // => 'abc' - */ - function padStart(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (createPadding(length - strLength, chars) + string) - : string; - } - - /** - * Converts `string` to an integer of the specified radix. If `radix` is - * `undefined` or `0`, a `radix` of `10` is used unless `value` is a - * hexadecimal, in which case a `radix` of `16` is used. - * - * **Note:** This method aligns with the - * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category String - * @param {string} string The string to convert. - * @param {number} [radix=10] The radix to interpret `value` by. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {number} Returns the converted integer. - * @example - * - * _.parseInt('08'); - * // => 8 - * - * _.map(['6', '08', '10'], _.parseInt); - * // => [6, 8, 10] - */ - function parseInt(string, radix, guard) { - if (guard || radix == null) { - radix = 0; - } else if (radix) { - radix = +radix; - } - return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); - } - - /** - * Repeats the given string `n` times. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to repeat. - * @param {number} [n=1] The number of times to repeat the string. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {string} Returns the repeated string. - * @example - * - * _.repeat('*', 3); - * // => '***' - * - * _.repeat('abc', 2); - * // => 'abcabc' - * - * _.repeat('abc', 0); - * // => '' - */ - function repeat(string, n, guard) { - if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); - } - return baseRepeat(toString(string), n); - } - - /** - * Replaces matches for `pattern` in `string` with `replacement`. - * - * **Note:** This method is based on - * [`String#replace`](https://mdn.io/String/replace). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to modify. - * @param {RegExp|string} pattern The pattern to replace. - * @param {Function|string} replacement The match replacement. - * @returns {string} Returns the modified string. - * @example - * - * _.replace('Hi Fred', 'Fred', 'Barney'); - * // => 'Hi Barney' - */ - function replace() { - var args = arguments, - string = toString(args[0]); - - return args.length < 3 ? string : string.replace(args[1], args[2]); - } - - /** - * Converts `string` to - * [snake case](https://en.wikipedia.org/wiki/Snake_case). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the snake cased string. - * @example - * - * _.snakeCase('Foo Bar'); - * // => 'foo_bar' - * - * _.snakeCase('fooBar'); - * // => 'foo_bar' - * - * _.snakeCase('--FOO-BAR--'); - * // => 'foo_bar' - */ - var snakeCase = createCompounder(function(result, word, index) { - return result + (index ? '_' : '') + word.toLowerCase(); - }); - - /** - * Splits `string` by `separator`. - * - * **Note:** This method is based on - * [`String#split`](https://mdn.io/String/split). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to split. - * @param {RegExp|string} separator The separator pattern to split by. - * @param {number} [limit] The length to truncate results to. - * @returns {Array} Returns the string segments. - * @example - * - * _.split('a-b-c', '-', 2); - * // => ['a', 'b'] - */ - function split(string, separator, limit) { - if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { - separator = limit = undefined; - } - limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; - if (!limit) { - return []; - } - string = toString(string); - if (string && ( - typeof separator == 'string' || - (separator != null && !isRegExp(separator)) - )) { - separator = baseToString(separator); - if (!separator && hasUnicode(string)) { - return castSlice(stringToArray(string), 0, limit); - } - } - return string.split(separator, limit); - } - - /** - * Converts `string` to - * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). - * - * @static - * @memberOf _ - * @since 3.1.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the start cased string. - * @example - * - * _.startCase('--foo-bar--'); - * // => 'Foo Bar' - * - * _.startCase('fooBar'); - * // => 'Foo Bar' - * - * _.startCase('__FOO_BAR__'); - * // => 'FOO BAR' - */ - var startCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + upperFirst(word); - }); - - /** - * Checks if `string` starts with the given target string. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=0] The position to search from. - * @returns {boolean} Returns `true` if `string` starts with `target`, - * else `false`. - * @example - * - * _.startsWith('abc', 'a'); - * // => true - * - * _.startsWith('abc', 'b'); - * // => false - * - * _.startsWith('abc', 'b', 1); - * // => true - */ - function startsWith(string, target, position) { - string = toString(string); - position = position == null - ? 0 - : baseClamp(toInteger(position), 0, string.length); - - target = baseToString(target); - return string.slice(position, position + target.length) == target; - } - - /** - * Creates a compiled template function that can interpolate data properties - * in "interpolate" delimiters, HTML-escape interpolated data properties in - * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data - * properties may be accessed as free variables in the template. If a setting - * object is given, it takes precedence over `_.templateSettings` values. - * - * **Note:** In the development build `_.template` utilizes - * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) - * for easier debugging. - * - * For more information on precompiling templates see - * [lodash's custom builds documentation](https://lodash.com/custom-builds). - * - * For more information on Chrome extension sandboxes see - * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category String - * @param {string} [string=''] The template string. - * @param {Object} [options={}] The options object. - * @param {RegExp} [options.escape=_.templateSettings.escape] - * The HTML "escape" delimiter. - * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] - * The "evaluate" delimiter. - * @param {Object} [options.imports=_.templateSettings.imports] - * An object to import into the template as free variables. - * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] - * The "interpolate" delimiter. - * @param {string} [options.sourceURL='lodash.templateSources[n]'] - * The sourceURL of the compiled template. - * @param {string} [options.variable='obj'] - * The data object variable name. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the compiled template function. - * @example - * - * // Use the "interpolate" delimiter to create a compiled template. - * var compiled = _.template('hello <%= user %>!'); - * compiled({ 'user': 'fred' }); - * // => 'hello fred!' - * - * // Use the HTML "escape" delimiter to escape data property values. - * var compiled = _.template('<%- value %>'); - * compiled({ 'value': '